[Midnightbsd-cvs] src [7201] vendor/jansson: add jansson 2.7

laffer1 at midnightbsd.org laffer1 at midnightbsd.org
Sun Aug 2 10:24:45 EDT 2015


Revision: 7201
          http://svnweb.midnightbsd.org/src/?rev=7201
Author:   laffer1
Date:     2015-08-02 10:24:45 -0400 (Sun, 02 Aug 2015)
Log Message:
-----------
add jansson 2.7

Added Paths:
-----------
    vendor/jansson/
    vendor/jansson/dist/
    vendor/jansson/dist/CHANGES
    vendor/jansson/dist/CMakeLists.txt
    vendor/jansson/dist/LICENSE
    vendor/jansson/dist/Makefile.am
    vendor/jansson/dist/Makefile.in
    vendor/jansson/dist/README.rst
    vendor/jansson/dist/aclocal.m4
    vendor/jansson/dist/android/
    vendor/jansson/dist/android/jansson_config.h
    vendor/jansson/dist/cmake/
    vendor/jansson/dist/cmake/CheckFunctionKeywords.cmake
    vendor/jansson/dist/cmake/FindSphinx.cmake
    vendor/jansson/dist/cmake/JanssonConfig.cmake.in
    vendor/jansson/dist/cmake/JanssonConfigVersion.cmake.in
    vendor/jansson/dist/cmake/jansson_config.h.cmake
    vendor/jansson/dist/cmake/jansson_private_config.h.cmake
    vendor/jansson/dist/compile
    vendor/jansson/dist/config.guess
    vendor/jansson/dist/config.sub
    vendor/jansson/dist/configure
    vendor/jansson/dist/configure.ac
    vendor/jansson/dist/depcomp
    vendor/jansson/dist/doc/
    vendor/jansson/dist/doc/Makefile.am
    vendor/jansson/dist/doc/Makefile.in
    vendor/jansson/dist/doc/README
    vendor/jansson/dist/doc/apiref.rst
    vendor/jansson/dist/doc/changes.rst
    vendor/jansson/dist/doc/conf.py
    vendor/jansson/dist/doc/conformance.rst
    vendor/jansson/dist/doc/ext/
    vendor/jansson/dist/doc/ext/refcounting.py
    vendor/jansson/dist/doc/gettingstarted.rst
    vendor/jansson/dist/doc/github_commits.c
    vendor/jansson/dist/doc/index.rst
    vendor/jansson/dist/doc/portability.rst
    vendor/jansson/dist/doc/tutorial.rst
    vendor/jansson/dist/doc/upgrading.rst
    vendor/jansson/dist/install-sh
    vendor/jansson/dist/jansson.pc.in
    vendor/jansson/dist/jansson_private_config.h.in
    vendor/jansson/dist/ltmain.sh
    vendor/jansson/dist/missing
    vendor/jansson/dist/src/
    vendor/jansson/dist/src/Makefile.am
    vendor/jansson/dist/src/Makefile.in
    vendor/jansson/dist/src/dump.c
    vendor/jansson/dist/src/error.c
    vendor/jansson/dist/src/hashtable.c
    vendor/jansson/dist/src/hashtable.h
    vendor/jansson/dist/src/hashtable_seed.c
    vendor/jansson/dist/src/jansson.def
    vendor/jansson/dist/src/jansson.h
    vendor/jansson/dist/src/jansson_config.h
    vendor/jansson/dist/src/jansson_config.h.in
    vendor/jansson/dist/src/jansson_private.h
    vendor/jansson/dist/src/load.c
    vendor/jansson/dist/src/lookup3.h
    vendor/jansson/dist/src/memory.c
    vendor/jansson/dist/src/pack_unpack.c
    vendor/jansson/dist/src/strbuffer.c
    vendor/jansson/dist/src/strbuffer.h
    vendor/jansson/dist/src/strconv.c
    vendor/jansson/dist/src/utf.c
    vendor/jansson/dist/src/utf.h
    vendor/jansson/dist/src/value.c
    vendor/jansson/dist/test/
    vendor/jansson/dist/test/Makefile.am
    vendor/jansson/dist/test/Makefile.in
    vendor/jansson/dist/test/bin/
    vendor/jansson/dist/test/bin/Makefile.am
    vendor/jansson/dist/test/bin/Makefile.in
    vendor/jansson/dist/test/bin/json_process.c
    vendor/jansson/dist/test/run-suites
    vendor/jansson/dist/test/scripts/
    vendor/jansson/dist/test/scripts/run-tests.sh
    vendor/jansson/dist/test/scripts/valgrind.sh
    vendor/jansson/dist/test/suites/
    vendor/jansson/dist/test/suites/Makefile.am
    vendor/jansson/dist/test/suites/Makefile.in
    vendor/jansson/dist/test/suites/api/
    vendor/jansson/dist/test/suites/api/Makefile.am
    vendor/jansson/dist/test/suites/api/Makefile.in
    vendor/jansson/dist/test/suites/api/check-exports
    vendor/jansson/dist/test/suites/api/run
    vendor/jansson/dist/test/suites/api/test_array.c
    vendor/jansson/dist/test/suites/api/test_copy.c
    vendor/jansson/dist/test/suites/api/test_dump.c
    vendor/jansson/dist/test/suites/api/test_dump_callback.c
    vendor/jansson/dist/test/suites/api/test_equal.c
    vendor/jansson/dist/test/suites/api/test_load.c
    vendor/jansson/dist/test/suites/api/test_load_callback.c
    vendor/jansson/dist/test/suites/api/test_loadb.c
    vendor/jansson/dist/test/suites/api/test_memory_funcs.c
    vendor/jansson/dist/test/suites/api/test_number.c
    vendor/jansson/dist/test/suites/api/test_object.c
    vendor/jansson/dist/test/suites/api/test_pack.c
    vendor/jansson/dist/test/suites/api/test_simple.c
    vendor/jansson/dist/test/suites/api/test_unpack.c
    vendor/jansson/dist/test/suites/api/util.h
    vendor/jansson/dist/test/suites/invalid/
    vendor/jansson/dist/test/suites/invalid/apostrophe/
    vendor/jansson/dist/test/suites/invalid/apostrophe/error
    vendor/jansson/dist/test/suites/invalid/apostrophe/input
    vendor/jansson/dist/test/suites/invalid/ascii-unicode-identifier/
    vendor/jansson/dist/test/suites/invalid/ascii-unicode-identifier/error
    vendor/jansson/dist/test/suites/invalid/ascii-unicode-identifier/input
    vendor/jansson/dist/test/suites/invalid/brace-comma/
    vendor/jansson/dist/test/suites/invalid/brace-comma/error
    vendor/jansson/dist/test/suites/invalid/brace-comma/input
    vendor/jansson/dist/test/suites/invalid/bracket-comma/
    vendor/jansson/dist/test/suites/invalid/bracket-comma/error
    vendor/jansson/dist/test/suites/invalid/bracket-comma/input
    vendor/jansson/dist/test/suites/invalid/bracket-one-comma/
    vendor/jansson/dist/test/suites/invalid/bracket-one-comma/error.normal
    vendor/jansson/dist/test/suites/invalid/bracket-one-comma/error.strip
    vendor/jansson/dist/test/suites/invalid/bracket-one-comma/input
    vendor/jansson/dist/test/suites/invalid/empty/
    vendor/jansson/dist/test/suites/invalid/empty/error
    vendor/jansson/dist/test/suites/invalid/empty/input
    vendor/jansson/dist/test/suites/invalid/extra-comma-in-array/
    vendor/jansson/dist/test/suites/invalid/extra-comma-in-array/error
    vendor/jansson/dist/test/suites/invalid/extra-comma-in-array/input
    vendor/jansson/dist/test/suites/invalid/extra-comma-in-multiline-array/
    vendor/jansson/dist/test/suites/invalid/extra-comma-in-multiline-array/error
    vendor/jansson/dist/test/suites/invalid/extra-comma-in-multiline-array/input
    vendor/jansson/dist/test/suites/invalid/garbage-after-newline/
    vendor/jansson/dist/test/suites/invalid/garbage-after-newline/error
    vendor/jansson/dist/test/suites/invalid/garbage-after-newline/input
    vendor/jansson/dist/test/suites/invalid/garbage-at-the-end/
    vendor/jansson/dist/test/suites/invalid/garbage-at-the-end/error
    vendor/jansson/dist/test/suites/invalid/garbage-at-the-end/input
    vendor/jansson/dist/test/suites/invalid/integer-starting-with-zero/
    vendor/jansson/dist/test/suites/invalid/integer-starting-with-zero/error
    vendor/jansson/dist/test/suites/invalid/integer-starting-with-zero/input
    vendor/jansson/dist/test/suites/invalid/invalid-escape/
    vendor/jansson/dist/test/suites/invalid/invalid-escape/error
    vendor/jansson/dist/test/suites/invalid/invalid-escape/input
    vendor/jansson/dist/test/suites/invalid/invalid-identifier/
    vendor/jansson/dist/test/suites/invalid/invalid-identifier/error
    vendor/jansson/dist/test/suites/invalid/invalid-identifier/input
    vendor/jansson/dist/test/suites/invalid/invalid-negative-integer/
    vendor/jansson/dist/test/suites/invalid/invalid-negative-integer/error
    vendor/jansson/dist/test/suites/invalid/invalid-negative-integer/input
    vendor/jansson/dist/test/suites/invalid/invalid-negative-real/
    vendor/jansson/dist/test/suites/invalid/invalid-negative-real/error
    vendor/jansson/dist/test/suites/invalid/invalid-negative-real/input
    vendor/jansson/dist/test/suites/invalid/invalid-second-surrogate/
    vendor/jansson/dist/test/suites/invalid/invalid-second-surrogate/error
    vendor/jansson/dist/test/suites/invalid/invalid-second-surrogate/input
    vendor/jansson/dist/test/suites/invalid/lone-open-brace/
    vendor/jansson/dist/test/suites/invalid/lone-open-brace/error.normal
    vendor/jansson/dist/test/suites/invalid/lone-open-brace/error.strip
    vendor/jansson/dist/test/suites/invalid/lone-open-brace/input
    vendor/jansson/dist/test/suites/invalid/lone-open-bracket/
    vendor/jansson/dist/test/suites/invalid/lone-open-bracket/error.normal
    vendor/jansson/dist/test/suites/invalid/lone-open-bracket/error.strip
    vendor/jansson/dist/test/suites/invalid/lone-open-bracket/input
    vendor/jansson/dist/test/suites/invalid/lone-second-surrogate/
    vendor/jansson/dist/test/suites/invalid/lone-second-surrogate/error
    vendor/jansson/dist/test/suites/invalid/lone-second-surrogate/input
    vendor/jansson/dist/test/suites/invalid/minus-sign-without-number/
    vendor/jansson/dist/test/suites/invalid/minus-sign-without-number/error
    vendor/jansson/dist/test/suites/invalid/minus-sign-without-number/input
    vendor/jansson/dist/test/suites/invalid/negative-integer-starting-with-zero/
    vendor/jansson/dist/test/suites/invalid/negative-integer-starting-with-zero/error
    vendor/jansson/dist/test/suites/invalid/negative-integer-starting-with-zero/input
    vendor/jansson/dist/test/suites/invalid/null/
    vendor/jansson/dist/test/suites/invalid/null/error
    vendor/jansson/dist/test/suites/invalid/null/input
    vendor/jansson/dist/test/suites/invalid/null-byte-in-object-key/
    vendor/jansson/dist/test/suites/invalid/null-byte-in-object-key/error
    vendor/jansson/dist/test/suites/invalid/null-byte-in-object-key/input
    vendor/jansson/dist/test/suites/invalid/null-byte-in-string/
    vendor/jansson/dist/test/suites/invalid/null-byte-in-string/error
    vendor/jansson/dist/test/suites/invalid/null-byte-in-string/input
    vendor/jansson/dist/test/suites/invalid/null-byte-in-string/nostrip
    vendor/jansson/dist/test/suites/invalid/null-byte-outside-string/
    vendor/jansson/dist/test/suites/invalid/null-byte-outside-string/error
    vendor/jansson/dist/test/suites/invalid/null-byte-outside-string/input
    vendor/jansson/dist/test/suites/invalid/null-byte-outside-string/nostrip
    vendor/jansson/dist/test/suites/invalid/object-apostrophes/
    vendor/jansson/dist/test/suites/invalid/object-apostrophes/error
    vendor/jansson/dist/test/suites/invalid/object-apostrophes/input
    vendor/jansson/dist/test/suites/invalid/object-garbage-at-end/
    vendor/jansson/dist/test/suites/invalid/object-garbage-at-end/error
    vendor/jansson/dist/test/suites/invalid/object-garbage-at-end/input
    vendor/jansson/dist/test/suites/invalid/object-in-unterminated-array/
    vendor/jansson/dist/test/suites/invalid/object-in-unterminated-array/error.normal
    vendor/jansson/dist/test/suites/invalid/object-in-unterminated-array/error.strip
    vendor/jansson/dist/test/suites/invalid/object-in-unterminated-array/input
    vendor/jansson/dist/test/suites/invalid/object-no-colon/
    vendor/jansson/dist/test/suites/invalid/object-no-colon/error.normal
    vendor/jansson/dist/test/suites/invalid/object-no-colon/error.strip
    vendor/jansson/dist/test/suites/invalid/object-no-colon/input
    vendor/jansson/dist/test/suites/invalid/object-no-value/
    vendor/jansson/dist/test/suites/invalid/object-no-value/error.normal
    vendor/jansson/dist/test/suites/invalid/object-no-value/error.strip
    vendor/jansson/dist/test/suites/invalid/object-no-value/input
    vendor/jansson/dist/test/suites/invalid/object-unterminated-value/
    vendor/jansson/dist/test/suites/invalid/object-unterminated-value/error.normal
    vendor/jansson/dist/test/suites/invalid/object-unterminated-value/error.strip
    vendor/jansson/dist/test/suites/invalid/object-unterminated-value/input
    vendor/jansson/dist/test/suites/invalid/real-garbage-after-e/
    vendor/jansson/dist/test/suites/invalid/real-garbage-after-e/error
    vendor/jansson/dist/test/suites/invalid/real-garbage-after-e/input
    vendor/jansson/dist/test/suites/invalid/real-negative-overflow/
    vendor/jansson/dist/test/suites/invalid/real-negative-overflow/error
    vendor/jansson/dist/test/suites/invalid/real-negative-overflow/input
    vendor/jansson/dist/test/suites/invalid/real-positive-overflow/
    vendor/jansson/dist/test/suites/invalid/real-positive-overflow/error
    vendor/jansson/dist/test/suites/invalid/real-positive-overflow/input
    vendor/jansson/dist/test/suites/invalid/real-truncated-at-e/
    vendor/jansson/dist/test/suites/invalid/real-truncated-at-e/error
    vendor/jansson/dist/test/suites/invalid/real-truncated-at-e/input
    vendor/jansson/dist/test/suites/invalid/real-truncated-at-point/
    vendor/jansson/dist/test/suites/invalid/real-truncated-at-point/error
    vendor/jansson/dist/test/suites/invalid/real-truncated-at-point/input
    vendor/jansson/dist/test/suites/invalid/run
    vendor/jansson/dist/test/suites/invalid/tab-character-in-string/
    vendor/jansson/dist/test/suites/invalid/tab-character-in-string/error
    vendor/jansson/dist/test/suites/invalid/tab-character-in-string/input
    vendor/jansson/dist/test/suites/invalid/too-big-negative-integer/
    vendor/jansson/dist/test/suites/invalid/too-big-negative-integer/error
    vendor/jansson/dist/test/suites/invalid/too-big-negative-integer/input
    vendor/jansson/dist/test/suites/invalid/too-big-positive-integer/
    vendor/jansson/dist/test/suites/invalid/too-big-positive-integer/error
    vendor/jansson/dist/test/suites/invalid/too-big-positive-integer/input
    vendor/jansson/dist/test/suites/invalid/truncated-unicode-surrogate/
    vendor/jansson/dist/test/suites/invalid/truncated-unicode-surrogate/error
    vendor/jansson/dist/test/suites/invalid/truncated-unicode-surrogate/input
    vendor/jansson/dist/test/suites/invalid/unicode-identifier/
    vendor/jansson/dist/test/suites/invalid/unicode-identifier/error
    vendor/jansson/dist/test/suites/invalid/unicode-identifier/input
    vendor/jansson/dist/test/suites/invalid/unterminated-array/
    vendor/jansson/dist/test/suites/invalid/unterminated-array/error.normal
    vendor/jansson/dist/test/suites/invalid/unterminated-array/error.strip
    vendor/jansson/dist/test/suites/invalid/unterminated-array/input
    vendor/jansson/dist/test/suites/invalid/unterminated-array-and-object/
    vendor/jansson/dist/test/suites/invalid/unterminated-array-and-object/error.normal
    vendor/jansson/dist/test/suites/invalid/unterminated-array-and-object/error.strip
    vendor/jansson/dist/test/suites/invalid/unterminated-array-and-object/input
    vendor/jansson/dist/test/suites/invalid/unterminated-empty-key/
    vendor/jansson/dist/test/suites/invalid/unterminated-empty-key/error.normal
    vendor/jansson/dist/test/suites/invalid/unterminated-empty-key/error.strip
    vendor/jansson/dist/test/suites/invalid/unterminated-empty-key/input
    vendor/jansson/dist/test/suites/invalid/unterminated-key/
    vendor/jansson/dist/test/suites/invalid/unterminated-key/error.normal
    vendor/jansson/dist/test/suites/invalid/unterminated-key/error.strip
    vendor/jansson/dist/test/suites/invalid/unterminated-key/input
    vendor/jansson/dist/test/suites/invalid/unterminated-object-and-array/
    vendor/jansson/dist/test/suites/invalid/unterminated-object-and-array/error
    vendor/jansson/dist/test/suites/invalid/unterminated-object-and-array/input
    vendor/jansson/dist/test/suites/invalid/unterminated-string/
    vendor/jansson/dist/test/suites/invalid/unterminated-string/error.normal
    vendor/jansson/dist/test/suites/invalid/unterminated-string/error.strip
    vendor/jansson/dist/test/suites/invalid/unterminated-string/input
    vendor/jansson/dist/test/suites/invalid-unicode/
    vendor/jansson/dist/test/suites/invalid-unicode/encoded-surrogate-half/
    vendor/jansson/dist/test/suites/invalid-unicode/encoded-surrogate-half/error
    vendor/jansson/dist/test/suites/invalid-unicode/encoded-surrogate-half/input
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-after-backslash/
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-after-backslash/error
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-after-backslash/input
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-array/
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-array/error
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-array/input
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-bigger-int/
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-bigger-int/error
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-bigger-int/input
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-escape/
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-escape/error
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-escape/input
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-exponent/
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-exponent/error
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-exponent/input
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-identifier/
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-identifier/error
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-identifier/input
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-int/
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-int/error
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-int/input
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-real-after-e/
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-real-after-e/error
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-real-after-e/input
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-string/
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-string/error
    vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-string/input
    vendor/jansson/dist/test/suites/invalid-unicode/lone-invalid-utf-8/
    vendor/jansson/dist/test/suites/invalid-unicode/lone-invalid-utf-8/error
    vendor/jansson/dist/test/suites/invalid-unicode/lone-invalid-utf-8/input
    vendor/jansson/dist/test/suites/invalid-unicode/lone-utf-8-continuation-byte/
    vendor/jansson/dist/test/suites/invalid-unicode/lone-utf-8-continuation-byte/error
    vendor/jansson/dist/test/suites/invalid-unicode/lone-utf-8-continuation-byte/input
    vendor/jansson/dist/test/suites/invalid-unicode/not-in-unicode-range/
    vendor/jansson/dist/test/suites/invalid-unicode/not-in-unicode-range/error
    vendor/jansson/dist/test/suites/invalid-unicode/not-in-unicode-range/input
    vendor/jansson/dist/test/suites/invalid-unicode/overlong-3-byte-encoding/
    vendor/jansson/dist/test/suites/invalid-unicode/overlong-3-byte-encoding/error
    vendor/jansson/dist/test/suites/invalid-unicode/overlong-3-byte-encoding/input
    vendor/jansson/dist/test/suites/invalid-unicode/overlong-4-byte-encoding/
    vendor/jansson/dist/test/suites/invalid-unicode/overlong-4-byte-encoding/error
    vendor/jansson/dist/test/suites/invalid-unicode/overlong-4-byte-encoding/input
    vendor/jansson/dist/test/suites/invalid-unicode/overlong-ascii-encoding/
    vendor/jansson/dist/test/suites/invalid-unicode/overlong-ascii-encoding/error
    vendor/jansson/dist/test/suites/invalid-unicode/overlong-ascii-encoding/input
    vendor/jansson/dist/test/suites/invalid-unicode/restricted-utf-8/
    vendor/jansson/dist/test/suites/invalid-unicode/restricted-utf-8/error
    vendor/jansson/dist/test/suites/invalid-unicode/restricted-utf-8/input
    vendor/jansson/dist/test/suites/invalid-unicode/run
    vendor/jansson/dist/test/suites/invalid-unicode/truncated-utf-8/
    vendor/jansson/dist/test/suites/invalid-unicode/truncated-utf-8/error
    vendor/jansson/dist/test/suites/invalid-unicode/truncated-utf-8/input
    vendor/jansson/dist/test/suites/valid/
    vendor/jansson/dist/test/suites/valid/complex-array/
    vendor/jansson/dist/test/suites/valid/complex-array/env
    vendor/jansson/dist/test/suites/valid/complex-array/input
    vendor/jansson/dist/test/suites/valid/complex-array/output
    vendor/jansson/dist/test/suites/valid/empty-array/
    vendor/jansson/dist/test/suites/valid/empty-array/input
    vendor/jansson/dist/test/suites/valid/empty-array/output
    vendor/jansson/dist/test/suites/valid/empty-object/
    vendor/jansson/dist/test/suites/valid/empty-object/input
    vendor/jansson/dist/test/suites/valid/empty-object/output
    vendor/jansson/dist/test/suites/valid/empty-object-in-array/
    vendor/jansson/dist/test/suites/valid/empty-object-in-array/input
    vendor/jansson/dist/test/suites/valid/empty-object-in-array/output
    vendor/jansson/dist/test/suites/valid/empty-string/
    vendor/jansson/dist/test/suites/valid/empty-string/input
    vendor/jansson/dist/test/suites/valid/empty-string/output
    vendor/jansson/dist/test/suites/valid/escaped-utf-control-char/
    vendor/jansson/dist/test/suites/valid/escaped-utf-control-char/input
    vendor/jansson/dist/test/suites/valid/escaped-utf-control-char/output
    vendor/jansson/dist/test/suites/valid/false/
    vendor/jansson/dist/test/suites/valid/false/input
    vendor/jansson/dist/test/suites/valid/false/output
    vendor/jansson/dist/test/suites/valid/negative-int/
    vendor/jansson/dist/test/suites/valid/negative-int/input
    vendor/jansson/dist/test/suites/valid/negative-int/output
    vendor/jansson/dist/test/suites/valid/negative-one/
    vendor/jansson/dist/test/suites/valid/negative-one/input
    vendor/jansson/dist/test/suites/valid/negative-one/output
    vendor/jansson/dist/test/suites/valid/negative-zero/
    vendor/jansson/dist/test/suites/valid/negative-zero/input
    vendor/jansson/dist/test/suites/valid/negative-zero/output
    vendor/jansson/dist/test/suites/valid/null/
    vendor/jansson/dist/test/suites/valid/null/input
    vendor/jansson/dist/test/suites/valid/null/output
    vendor/jansson/dist/test/suites/valid/one-byte-utf-8/
    vendor/jansson/dist/test/suites/valid/one-byte-utf-8/input
    vendor/jansson/dist/test/suites/valid/one-byte-utf-8/output
    vendor/jansson/dist/test/suites/valid/real-capital-e/
    vendor/jansson/dist/test/suites/valid/real-capital-e/input
    vendor/jansson/dist/test/suites/valid/real-capital-e/output
    vendor/jansson/dist/test/suites/valid/real-capital-e-negative-exponent/
    vendor/jansson/dist/test/suites/valid/real-capital-e-negative-exponent/input
    vendor/jansson/dist/test/suites/valid/real-capital-e-negative-exponent/output
    vendor/jansson/dist/test/suites/valid/real-capital-e-positive-exponent/
    vendor/jansson/dist/test/suites/valid/real-capital-e-positive-exponent/input
    vendor/jansson/dist/test/suites/valid/real-capital-e-positive-exponent/output
    vendor/jansson/dist/test/suites/valid/real-exponent/
    vendor/jansson/dist/test/suites/valid/real-exponent/input
    vendor/jansson/dist/test/suites/valid/real-exponent/output
    vendor/jansson/dist/test/suites/valid/real-fraction-exponent/
    vendor/jansson/dist/test/suites/valid/real-fraction-exponent/input
    vendor/jansson/dist/test/suites/valid/real-fraction-exponent/output
    vendor/jansson/dist/test/suites/valid/real-negative-exponent/
    vendor/jansson/dist/test/suites/valid/real-negative-exponent/input
    vendor/jansson/dist/test/suites/valid/real-negative-exponent/output
    vendor/jansson/dist/test/suites/valid/real-positive-exponent/
    vendor/jansson/dist/test/suites/valid/real-positive-exponent/input
    vendor/jansson/dist/test/suites/valid/real-positive-exponent/output
    vendor/jansson/dist/test/suites/valid/real-subnormal-number/
    vendor/jansson/dist/test/suites/valid/real-subnormal-number/input
    vendor/jansson/dist/test/suites/valid/real-subnormal-number/output
    vendor/jansson/dist/test/suites/valid/real-underflow/
    vendor/jansson/dist/test/suites/valid/real-underflow/input
    vendor/jansson/dist/test/suites/valid/real-underflow/output
    vendor/jansson/dist/test/suites/valid/run
    vendor/jansson/dist/test/suites/valid/short-string/
    vendor/jansson/dist/test/suites/valid/short-string/input
    vendor/jansson/dist/test/suites/valid/short-string/output
    vendor/jansson/dist/test/suites/valid/simple-ascii-string/
    vendor/jansson/dist/test/suites/valid/simple-ascii-string/input
    vendor/jansson/dist/test/suites/valid/simple-ascii-string/output
    vendor/jansson/dist/test/suites/valid/simple-int-0/
    vendor/jansson/dist/test/suites/valid/simple-int-0/input
    vendor/jansson/dist/test/suites/valid/simple-int-0/output
    vendor/jansson/dist/test/suites/valid/simple-int-1/
    vendor/jansson/dist/test/suites/valid/simple-int-1/input
    vendor/jansson/dist/test/suites/valid/simple-int-1/output
    vendor/jansson/dist/test/suites/valid/simple-int-123/
    vendor/jansson/dist/test/suites/valid/simple-int-123/input
    vendor/jansson/dist/test/suites/valid/simple-int-123/output
    vendor/jansson/dist/test/suites/valid/simple-object/
    vendor/jansson/dist/test/suites/valid/simple-object/input
    vendor/jansson/dist/test/suites/valid/simple-object/output
    vendor/jansson/dist/test/suites/valid/simple-real/
    vendor/jansson/dist/test/suites/valid/simple-real/input
    vendor/jansson/dist/test/suites/valid/simple-real/output
    vendor/jansson/dist/test/suites/valid/string-escapes/
    vendor/jansson/dist/test/suites/valid/string-escapes/input
    vendor/jansson/dist/test/suites/valid/string-escapes/output
    vendor/jansson/dist/test/suites/valid/three-byte-utf-8/
    vendor/jansson/dist/test/suites/valid/three-byte-utf-8/input
    vendor/jansson/dist/test/suites/valid/three-byte-utf-8/output
    vendor/jansson/dist/test/suites/valid/true/
    vendor/jansson/dist/test/suites/valid/true/input
    vendor/jansson/dist/test/suites/valid/true/output
    vendor/jansson/dist/test/suites/valid/two-byte-utf-8/
    vendor/jansson/dist/test/suites/valid/two-byte-utf-8/input
    vendor/jansson/dist/test/suites/valid/two-byte-utf-8/output
    vendor/jansson/dist/test/suites/valid/utf-8-string/
    vendor/jansson/dist/test/suites/valid/utf-8-string/input
    vendor/jansson/dist/test/suites/valid/utf-8-string/output
    vendor/jansson/dist/test/suites/valid/utf-surrogate-four-byte-encoding/
    vendor/jansson/dist/test/suites/valid/utf-surrogate-four-byte-encoding/input
    vendor/jansson/dist/test/suites/valid/utf-surrogate-four-byte-encoding/output
    vendor/jansson/dist/test-driver

Added: vendor/jansson/dist/CHANGES
===================================================================
--- vendor/jansson/dist/CHANGES	                        (rev 0)
+++ vendor/jansson/dist/CHANGES	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,679 @@
+Version 2.7
+===========
+
+Released 2014-10-02
+
+* New features:
+
+  - `json_pack()` and friends: Add format specifiers ``s%`` and ``+%``
+    for a size_t string length (#141).
+
+  - `json_unpack()` and friends: Add format specifier ``s%`` for
+    unpacking the string length along with the string itself (#141).
+
+  - Add length-aware string constructors `json_stringn()` and
+    `json_stringn_nocheck()`, length-aware string mutators
+    `json_string_setn()` and `json_string_setn_nocheck()`, and a
+    function for getting string's length `json_string_length()` (#141,
+    #143).
+
+  - Support ``\u0000`` escapes in the decoder. The support can be
+    enabled by using the ``JSON_ALLOW_NUL`` decoding flag (#141).
+
+  - Add `json_boolean_value()` as an alias for `json_is_true()`
+    (#146).
+
+  - Add JSON_REAL_PRECISION encoding flag/macro for controlling real
+    number precision (#178).
+
+  - Define the maximum indentation as JSON_MAX_INDENT (#191).
+
+* Bug fixes:
+
+  - Some malformed ``\uNNNN`` escapes could crash the decoder with an
+    assertion failure.
+
+  - Avoid integer overflows with very long strings in UTF-8 decoder and
+    hashtable.
+
+  - Check for *NULL* key in `json_object_get()` and
+    `json_object_del()` (#151).
+
+  - Enhance hashtable seeding on Windows (#162).
+
+  - `json_unpack()`: Allow mixing JSON_STRICT with optional keys
+    (#162, #163).
+
+  - Fix int/int32 mismatch (#142).
+
+  - Parse subnormal numbers correctly (#202).
+
+* Build:
+
+  - Remove VS2010 build files. CMake should be used on Windows instead
+    (#165).
+
+  - Fix CMake build flags for MinGW (#193).
+
+  - Add CMake config files for find_package. Rename config.h to
+    jansson_private_config.h (#157, #159).
+
+  - Make Valgrind checks work with CMake (#160).
+
+  - Fix feature checks to use correct __ATOMIC flags.
+
+  - Fix CMake checks for uint16_t and uint8_t support (#177).
+
+  - Make Jansson build on SmartOS/Solaris (#171).
+
+  - Work around a GCC bug on Solaris (#175).
+
+  - Fix autoreconf on Debian (#182).
+
+  - Don't use GNU make specific export for global AM_CFLAGS (#203,
+    #204).
+
+  - Fix building on Android using the supplied Android.mk (#166,
+    #174).
+
+  - Android.mk: Add -DHAVE_STDINT_H to LOCAL_CFLAGS (#200).
+
+* Documentation:
+
+  - Document JANSSON_BUILD_SHARED_LIBS CMake option (#187).
+
+* Tests:
+
+  - Close file handles correctly (#198).
+
+* Other changes:
+
+  - ``\uNNNN`` escapes are now encoded in upper case for better
+    readability.
+
+  - Enable usage of AddressSanitizer (#180).
+
+
+Version 2.6
+===========
+
+Released 2014-02-11
+
+* Security:
+
+  - CVE-2013-6401: The hash function used by the hashtable
+    implementation has been changed, and is automatically seeded with
+    random data when the first JSON object is created. This prevents
+    an attacker from causing large JSON objects with specially crafted
+    keys perform poorly.
+
+* New features:
+
+  - `json_object_seed()`: Set the seed value of the hash function.
+
+* Bug fixes:
+
+  - Include CMake specific files in the release tarball.
+
+* Documentation:
+
+  - Fix tutorial source to send a User-Agent header, which is now
+    required by the GitHub API.
+
+  - Set all memory to zero in secure_free() example.
+
+
+Version 2.5
+===========
+
+Released 2013-09-19
+
+* New features:
+
+  - `json_pack()` and friends: Add format specifiers ``s#``, ``+`` and
+    ``+#``.
+
+  - Add ``JSON_DECODE_INT_AS_REAL`` decoding flag to treat all numbers
+    as real in the decoder (#123).
+
+  - Add `json_array_foreach()`, paralleling `json_object_foreach()`
+    (#118).
+
+* Bug fixes:
+
+  - `json_dumps()` and friends: Don't crash if json is *NULL* and
+    ``JSON_ENCODE_ANY`` is set.
+
+  - Fix a theoretical integer overflow in `jsonp_strdup()`.
+
+  - Fix `l_isxdigit()` macro (#97).
+
+  - Fix an off-by-one error in `json_array_remove()`.
+
+* Build:
+
+  - Support CMake in addition to GNU Autotools (#106, #107, #112,
+    #115, #120, #127).
+
+  - Support building for Android (#109).
+
+  - Don't use ``-Werror`` by default.
+
+  - Support building and testing with VPATH (#93).
+
+  - Fix compilation when ``NDEBUG`` is defined (#128)
+
+* Tests:
+
+  - Fix a refleak in ``test/bin/json_process.c``.
+
+* Documentation:
+
+  - Clarify the return value of `json_load_callback_t`.
+
+  - Document how to circumvent problems with separate heaps on Windows.
+
+  - Fix memory leaks and warnings in ``github_commits.c``.
+
+  - Use `json_decref()` properly in tutorial.
+
+* Other:
+
+  - Make it possible to forward declare ``struct json_t``.
+
+
+Version 2.4
+===========
+
+Released 2012-09-23
+
+* New features:
+
+  - Add `json_boolean()` macro that returns the JSON true or false
+    value based on its argument (#86).
+
+  - Add `json_load_callback()` that calls a callback function
+    repeatedly to read the JSON input (#57).
+
+  - Add JSON_ESCAPE_SLASH encoding flag to escape all occurences of
+    ``/`` with ``\/``.
+
+* Bug fixes:
+
+  - Check for and reject NaN and Inf values for reals. Encoding these
+    values resulted in invalid JSON.
+
+  - Fix `json_real_set()` to return -1 on error.
+
+* Build:
+
+  - Jansson now builds on Windows with Visual Studio 2010, and
+    includes solution and project files in ``win32/vs2010/``
+    directory.
+
+  - Fix build warnings (#77, #78).
+
+  - Add ``-no-undefined`` to LDFLAGS (#90).
+
+* Tests:
+
+  - Fix the symbol exports test on Linux/PPC64 (#88).
+
+* Documentation:
+
+  - Fix typos (#73, #84).
+
+
+Version 2.3.1
+=============
+
+Released 2012-04-20
+
+* Build issues:
+
+  - Only use ``long long`` if ``strtoll()`` is also available.
+
+* Documentation:
+
+  - Fix the names of library version constants in documentation. (#52)
+
+  - Change the tutorial to use GitHub API v3. (#65)
+
+* Tests:
+
+  - Make some tests locale independent. (#51)
+
+  - Distribute the library exports test in the tarball.
+
+  - Make test run on shells that don't support the ``export FOO=bar``
+    syntax.
+
+
+Version 2.3
+===========
+
+Released 2012-01-27
+
+* New features:
+
+  - `json_unpack()` and friends: Add support for optional object keys
+    with the ``{s?o}`` syntax.
+
+  - Add `json_object_update_existing()` and
+    `json_object_update_missing()`, for updating only existing keys or
+    only adding missing keys to an object. (#37)
+
+  - Add `json_object_foreach()` for more convenient iteration over
+    objects. (#45, #46)
+
+  - When decoding JSON, write the number of bytes that were read from
+    input to ``error.position`` also on success. This is handy with
+    ``JSON_DISABLE_EOF_CHECK``.
+
+  - Add support for decoding any JSON value, not just arrays or
+    objects. The support is enabled with the new ``JSON_DECODE_ANY``
+    flag. Patch by Andrea Marchesini. (#4)
+
+* Bug fixes
+
+  - Avoid problems with object's serial number growing too big. (#40,
+    #41)
+
+  - Decoding functions now return NULL if the first argument is NULL.
+    Patch by Andrea Marchesini.
+
+  - Include ``jansson_config.h.win32`` in the distribution tarball.
+
+  - Remove ``+`` and leading zeros from exponents in the encoder.
+    (#39)
+
+  - Make Jansson build and work on MinGW. (#39, #38)
+
+* Documentation
+
+  - Note that the same JSON values must not be encoded in parallel by
+    separate threads. (#42)
+
+  - Document MinGW support.
+
+
+Version 2.2.1
+=============
+
+Released 2011-10-06
+
+* Bug fixes:
+
+  - Fix real number encoding and decoding under non-C locales. (#32)
+
+  - Fix identifier decoding under non-UTF-8 locales. (#35)
+
+  - `json_load_file()`: Open the input file in binary mode for maximum
+    compatiblity.
+
+* Documentation:
+
+  - Clarify the lifecycle of the result of the ``s`` fromat of
+    `json_unpack()`. (#31)
+
+  - Add some portability info. (#36)
+
+  - Little clarifications here and there.
+
+* Other:
+
+  - Some style fixes, issues detected by static analyzers.
+
+
+Version 2.2
+===========
+
+Released 2011-09-03
+
+* New features:
+
+  - `json_dump_callback()`: Pass the encoder output to a callback
+    function in chunks.
+
+* Bug fixes:
+
+  - `json_string_set()`: Check that target is a string and value is
+    not NULL.
+
+* Other:
+
+  - Documentation typo fixes and clarifications.
+
+
+Version 2.1
+===========
+
+Released 2011-06-10
+
+* New features:
+
+  - `json_loadb()`: Decode a string with a given size, useful if the
+    string is not null terminated.
+
+  - Add ``JSON_ENCODE_ANY`` encoding flag to allow encoding any JSON
+    value. By default, only arrays and objects can be encoded. (#19)
+
+  - Add ``JSON_REJECT_DUPLICATES`` decoding flag to issue a decoding
+    error if any JSON object in the input contins duplicate keys. (#3)
+
+  - Add ``JSON_DISABLE_EOF_CHECK`` decoding flag to stop decoding after a
+    valid JSON input. This allows other data after the JSON data.
+
+* Bug fixes:
+
+  - Fix an additional memory leak when memory allocation fails in
+    `json_object_set()` and friends.
+
+  - Clear errno before calling `strtod()` for better portability. (#27)
+
+* Building:
+
+  - Avoid set-but-not-used warning/error in a test. (#20)
+
+* Other:
+
+  - Minor clarifications to documentation.
+
+
+Version 2.0.1
+=============
+
+Released 2011-03-31
+
+* Bug fixes:
+
+  - Replace a few `malloc()` and `free()` calls with their
+    counterparts that support custom memory management.
+
+  - Fix object key hashing in json_unpack() strict checking mode.
+
+  - Fix the parentheses in ``JANSSON_VERSION_HEX`` macro.
+
+  - Fix `json_object_size()` return value.
+
+  - Fix a few compilation issues.
+
+* Portability:
+
+  - Enhance portability of `va_copy()`.
+
+  - Test framework portability enhancements.
+
+* Documentation:
+
+  - Distribute ``doc/upgrading.rst`` with the source tarball.
+
+  - Build documentation in strict mode in ``make distcheck``.
+
+
+Version 2.0
+===========
+
+Released 2011-02-28
+
+This release is backwards incompatible with the 1.x release series.
+See the chapter "Upgrading from older versions" in documentation for
+details.
+
+* Backwards incompatible changes:
+
+  - Unify unsigned integer usage in the API: All occurences of
+    unsigned int and unsigned long have been replaced with size_t.
+
+  - Change JSON integer's underlying type to the widest signed integer
+    type available, i.e. long long if it's supported, otherwise long.
+    Add a typedef json_int_t that defines the type.
+
+  - Change the maximum indentation depth to 31 spaces in encoder. This
+    frees up bits from the flags parameter of encoding functions
+    `json_dumpf()`, `json_dumps()` and `json_dump_file()`.
+
+  - For future needs, add a flags parameter to all decoding functions
+    `json_loadf()`, `json_loads()` and `json_load_file()`.
+
+* New features
+
+  - `json_pack()`, `json_pack_ex()`, `json_vpack_ex()`: Create JSON
+    values based on a format string.
+
+  - `json_unpack()`, `json_unpack_ex()`, `json_vunpack_ex()`: Simple
+    value extraction and validation functionality based on a format
+    string.
+
+  - Add column, position and source fields to the ``json_error_t``
+    struct.
+
+  - Enhance error reporting in the decoder.
+
+  - ``JANSSON_VERSION`` et al.: Preprocessor constants that define the
+    library version.
+
+  - `json_set_alloc_funcs()`: Set custom memory allocation functions.
+
+* Fix many portability issues, especially on Windows.
+
+* Configuration
+
+  - Add file ``jansson_config.h`` that contains site specific
+    configuration. It's created automatically by the configure script,
+    or can be created by hand if the configure script cannot be used.
+    The file ``jansson_config.h.win32`` can be used without
+    modifications on Windows systems.
+
+  - Add a section to documentation describing how to build Jansson on
+    Windows.
+
+  - Documentation now requires Sphinx 1.0 or newer.
+
+
+Version 1.3
+===========
+
+Released 2010-06-13
+
+* New functions:
+
+  - `json_object_iter_set()`, `json_object_iter_set_new()`: Change
+    object contents while iterating over it.
+
+  - `json_object_iter_at()`: Return an iterator that points to a
+    specific object item.
+
+* New encoding flags:
+
+  - ``JSON_PRESERVE_ORDER``: Preserve the insertion order of object
+    keys.
+
+* Bug fixes:
+
+  - Fix an error that occured when an array or object was first
+    encoded as empty, then populated with some data, and then
+    re-encoded
+
+  - Fix the situation like above, but when the first encoding resulted
+    in an error
+
+* Documentation:
+
+  - Clarify the documentation on reference stealing, providing an
+    example usage pattern
+
+
+Version 1.2.1
+=============
+
+Released 2010-04-03
+
+* Bug fixes:
+
+  - Fix reference counting on ``true``, ``false`` and ``null``
+  - Estimate real number underflows in decoder with 0.0 instead of
+    issuing an error
+
+* Portability:
+
+  - Make ``int32_t`` available on all systems
+  - Support compilers that don't have the ``inline`` keyword
+  - Require Autoconf 2.60 (for ``int32_t``)
+
+* Tests:
+
+  - Print test names correctly when ``VERBOSE=1``
+  - ``test/suites/api``: Fail when a test fails
+  - Enhance tests for iterators
+  - Enhance tests for decoding texts that contain null bytes
+
+* Documentation:
+
+  - Don't remove ``changes.rst`` in ``make clean``
+  - Add a chapter on RFC conformance
+
+
+Version 1.2
+===========
+
+Released 2010-01-21
+
+* New functions:
+
+  - `json_equal()`: Test whether two JSON values are equal
+  - `json_copy()` and `json_deep_copy()`: Make shallow and deep copies
+    of JSON values
+  - Add a version of all functions taking a string argument that
+    doesn't check for valid UTF-8: `json_string_nocheck()`,
+    `json_string_set_nocheck()`, `json_object_set_nocheck()`,
+    `json_object_set_new_nocheck()`
+
+* New encoding flags:
+
+  - ``JSON_SORT_KEYS``: Sort objects by key
+  - ``JSON_ENSURE_ASCII``: Escape all non-ASCII Unicode characters
+  - ``JSON_COMPACT``: Use a compact representation with all unneeded
+    whitespace stripped
+
+* Bug fixes:
+
+  - Revise and unify whitespace usage in encoder: Add spaces between
+    array and object items, never append newline to output.
+  - Remove const qualifier from the ``json_t`` parameter in
+    `json_string_set()`, `json_integer_set()` and `json_real_set`.
+  - Use ``int32_t`` internally for representing Unicode code points
+    (int is not enough on all platforms)
+
+* Other changes:
+
+  - Convert ``CHANGES`` (this file) to reStructured text and add it to
+    HTML documentation
+  - The test system has been refactored. Python is no longer required
+    to run the tests.
+  - Documentation can now be built by invoking ``make html``
+  - Support for pkg-config
+
+
+Version 1.1.3
+=============
+
+Released 2009-12-18
+
+* Encode reals correctly, so that first encoding and then decoding a
+  real always produces the same value
+* Don't export private symbols in ``libjansson.so``
+
+
+Version 1.1.2
+=============
+
+Released 2009-11-08
+
+* Fix a bug where an error message was not produced if the input file
+  could not be opened in `json_load_file()`
+* Fix an assertion failure in decoder caused by a minus sign without a
+  digit after it
+* Remove an unneeded include of ``stdint.h`` in ``jansson.h``
+
+
+Version 1.1.1
+=============
+
+Released 2009-10-26
+
+* All documentation files were not distributed with v1.1; build
+  documentation in make distcheck to prevent this in the future
+* Fix v1.1 release date in ``CHANGES``
+
+
+Version 1.1
+===========
+
+Released 2009-10-20
+
+* API additions and improvements:
+
+  - Extend array and object APIs
+  - Add functions to modify integer, real and string values
+  - Improve argument validation
+  - Use unsigned int instead of ``uint32_t`` for encoding flags
+
+* Enhance documentation
+
+  - Add getting started guide and tutorial
+  - Fix some typos
+  - General clarifications and cleanup
+
+* Check for integer and real overflows and underflows in decoder
+* Make singleton values thread-safe (``true``, ``false`` and ``null``)
+* Enhance circular reference handling
+* Don't define ``-std=c99`` in ``AM_CFLAGS``
+* Add C++ guards to ``jansson.h``
+* Minor performance and portability improvements
+* Expand test coverage
+
+
+Version 1.0.4
+=============
+
+Released 2009-10-11
+
+* Relax Autoconf version requirement to 2.59
+* Make Jansson compile on platforms where plain ``char`` is unsigned
+* Fix API tests for object
+
+
+Version 1.0.3
+=============
+
+Released 2009-09-14
+
+* Check for integer and real overflows and underflows in decoder
+* Use the Python json module for tests, or simplejson if the json
+  module is not found
+* Distribute changelog (this file)
+
+
+Version 1.0.2
+=============
+
+Released 2009-09-08
+
+* Handle EOF correctly in decoder
+
+
+Version 1.0.1
+=============
+
+Released 2009-09-04
+
+* Fixed broken `json_is_boolean()`
+
+
+Version 1.0
+===========
+
+Released 2009-08-25
+
+* Initial release

Added: vendor/jansson/dist/CMakeLists.txt
===================================================================
--- vendor/jansson/dist/CMakeLists.txt	                        (rev 0)
+++ vendor/jansson/dist/CMakeLists.txt	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,658 @@
+# Notes:
+#
+# Author: Paul Harris, June 2012
+# Additions: Joakim Soderberg, Febuary 2013
+#
+# Supports: building static/shared, release/debug/etc, can also build html docs
+# and some of the tests.
+# Note that its designed for out-of-tree builds, so it will not pollute your
+# source tree.
+#
+# TODO 1: Finish implementing tests. api tests are working, but the valgrind
+# variants are not flagging problems.
+#
+# TODO 2: There is a check_exports script that would try and incorporate.
+#
+# TODO 3: Consolidate version numbers, currently the version number is written
+# into: * cmake (here) * autotools (the configure) * source code header files.
+# Should not be written directly into header files, autotools/cmake can do
+# that job.
+#
+# Brief intro on how to use cmake:
+# > mkdir build (somewhere - we do out-of-tree builds)
+# > use cmake, ccmake, or cmake-gui to configure the project. for linux, you
+# can only choose one variant: release,debug,etc... and static or shared.
+# >> example:
+# >> cd build
+# >> ccmake -i ../path_to_jansson_dir
+# >>  inside, configure your options. press C until there are no lines
+#     with * next to them.
+# >>  note, I like to configure the 'install' path to ../install, so I get
+#     self-contained clean installs I can point other projects to.
+# >>  press G to 'generate' the project files.
+# >> make (to build the project)
+# >> make install
+# >> make test (to run the tests, if you enabled them)
+#
+# Brief description on how it works:
+# There is a small heirachy of CMakeLists.txt files which define how the
+# project is built.
+# Header file detection etc is done, and the results are written into config.h
+# and jansson_config.h, which are generated from the corresponding
+# config.h.cmake and jansson_config.h.cmake template files.
+# The generated header files end up in the build directory - not in
+# the source directory.
+# The rest is down to the usual make process.
+
+
+
+cmake_minimum_required (VERSION 2.8)
+# required for exports? cmake_minimum_required (VERSION 2.8.6)
+project (jansson C)
+
+# Options
+option(JANSSON_BUILD_SHARED_LIBS "Build shared libraries." OFF)
+option(USE_URANDOM "Use /dev/urandom to seed the hash function." ON)
+option(USE_WINDOWS_CRYPTOAPI "Use CryptGenRandom to seed the hash function." ON)
+
+if (MSVC)
+   # This option must match the settings used in your program, in particular if you
+	# are linking statically
+	option(JANSSON_STATIC_CRT "Link the static CRT libraries" OFF )
+endif ()
+
+# Set some nicer output dirs.
+set(CMAKE_RUNTIME_OUTPUT_DIRECTORY ${PROJECT_BINARY_DIR}/bin)
+set(CMAKE_LIBRARY_OUTPUT_DIRECTORY ${PROJECT_BINARY_DIR}/lib)
+set(CMAKE_ARCHIVE_OUTPUT_DIRECTORY ${PROJECT_BINARY_DIR}/lib)
+
+# Give the debug version a different postfix for windows,
+# so both the debug and release version can be built in the
+# same build-tree on Windows (MSVC).
+if (WIN32)
+   set(CMAKE_DEBUG_POSTFIX "_d")
+else (WIN32)
+endif (WIN32)
+
+# This is how I thought it should go
+# set (JANSSON_VERSION "2.3.1")
+# set (JANSSON_SOVERSION 2)
+
+set(JANSSON_DISPLAY_VERSION "2.7")
+
+# This is what is required to match the same numbers as automake's
+set(JANSSON_VERSION "4.7.0")
+set(JANSSON_SOVERSION 4)
+
+# for CheckFunctionKeywords
+set(CMAKE_MODULE_PATH "${CMAKE_CURRENT_SOURCE_DIR}/cmake")
+
+include (CheckCSourceCompiles)
+include (CheckFunctionExists)
+include (CheckFunctionKeywords)
+include (CheckIncludeFiles)
+include (CheckTypeSize)
+
+if (MSVC)
+   # Turn off Microsofts "security" warnings.
+   add_definitions( "/W3 /D_CRT_SECURE_NO_WARNINGS /wd4005 /wd4996 /nologo" )
+   
+   if (STATIC_CRT)
+      set(CMAKE_C_FLAGS_RELEASE "/MT")
+      set(CMAKE_C_FLAGS_DEBUG "/MTd")
+   endif()
+   
+endif()
+
+if (NOT WIN32 AND (CMAKE_COMPILER_IS_GNUCC OR CMAKE_COMPILER_IS_GNUCXX))
+   add_definitions("-fPIC")
+endif()
+
+check_include_files (endian.h HAVE_ENDIAN_H)
+check_include_files (fcntl.h HAVE_FCNTL_H)
+check_include_files (sched.h HAVE_SCHED_H)
+check_include_files (unistd.h HAVE_UNISTD_H)
+check_include_files (sys/param.h HAVE_SYS_PARAM_H)
+check_include_files (sys/stat.h HAVE_SYS_STAT_H)
+check_include_files (sys/time.h HAVE_SYS_TIME_H)
+check_include_files (sys/time.h HAVE_SYS_TYPES_H)
+
+check_function_exists (close HAVE_CLOSE)
+check_function_exists (getpid HAVE_GETPID)
+check_function_exists (gettimeofday HAVE_GETTIMEOFDAY)
+check_function_exists (open HAVE_OPEN)
+check_function_exists (read HAVE_READ)
+check_function_exists (sched_yield HAVE_SCHED_YIELD)
+
+# Check for the int-type includes
+check_include_files (stdint.h HAVE_STDINT_H)
+
+# Check our 64 bit integer sizes
+check_type_size (__int64 __INT64)
+check_type_size (int64_t INT64_T)
+check_type_size ("long long" LONG_LONG_INT)
+
+# Check our 32 bit integer sizes
+check_type_size (int32_t INT32_T)
+check_type_size (__int32 __INT32)
+check_type_size ("long" LONG_INT)
+check_type_size ("int" INT)
+if (HAVE_INT32_T)
+   set (JSON_INT32 int32_t)
+elseif (HAVE___INT32)
+   set (JSON_INT32 __int32)
+elseif (HAVE_LONG_INT AND (${LONG_INT} EQUAL 4))
+   set (JSON_INT32 long)
+elseif (HAVE_INT AND (${INT} EQUAL 4))
+   set (JSON_INT32 int)
+else ()
+   message (FATAL_ERROR "Could not detect a valid 32-bit integer type")
+endif ()
+
+check_type_size ("unsigned long" UNSIGNED_LONG_INT)
+check_type_size ("unsigned int" UNSIGNED_INT)
+check_type_size ("unsigned short" UNSIGNED_SHORT)
+
+check_type_size (uint32_t UINT32_T)
+check_type_size (__uint32 __UINT32)
+if (HAVE_UINT32_T)
+   set (JSON_UINT32 uint32_t)
+elseif (HAVE___UINT32)
+   set (JSON_UINT32 __uint32)
+elseif (HAVE_UNSIGNED_LONG_INT AND (${UNSIGNED_LONG_INT} EQUAL 4))
+   set (JSON_UINT32 "unsigned long")
+elseif (HAVE_UNSIGNED_INT AND (${UNSIGNED_INT} EQUAL 4))
+   set (JSON_UINT32 "unsigned int")
+else ()
+   message (FATAL_ERROR "Could not detect a valid unsigned 32-bit integer type")
+endif ()
+
+check_type_size (uint16_t UINT16_T)
+check_type_size (__uint16 __UINT16)
+if (HAVE_UINT16_T)
+   set (JSON_UINT16 uint16_t)
+elseif (HAVE___UINT16)
+   set (JSON_UINT16 __uint16)
+elseif (HAVE_UNSIGNED_INT AND (${UNSIGNED_INT} EQUAL 2))
+   set (JSON_UINT16 "unsigned int")
+elseif (HAVE_UNSIGNED_SHORT AND (${UNSIGNED_SHORT} EQUAL 2))
+   set (JSON_UINT16 "unsigned short")
+else ()
+   message (FATAL_ERROR "Could not detect a valid unsigned 16-bit integer type")
+endif ()
+
+check_type_size (uint8_t UINT8_T)
+check_type_size (__uint8 __UINT8)
+if (HAVE_UINT8_T)
+   set (JSON_UINT8 uint8_t)
+elseif (HAVE___UINT8)
+   set (JSON_UINT8 __uint8)
+else ()
+   set (JSON_UINT8 "unsigned char")
+endif ()
+
+# Check for ssize_t and SSIZE_T existance.
+check_type_size(ssize_t SSIZE_T)
+check_type_size(SSIZE_T UPPERCASE_SSIZE_T)
+if(NOT HAVE_SSIZE_T)
+   if(HAVE_UPPERCASE_SSIZE_T)
+      set(JSON_SSIZE SSIZE_T)
+   else()
+      set(JSON_SSIZE int)
+   endif()
+endif()
+set(CMAKE_EXTRA_INCLUDE_FILES "")
+
+# Check for all the variants of strtoll
+check_function_exists (strtoll HAVE_STRTOLL)
+check_function_exists (strtoq HAVE_STRTOQ)
+check_function_exists (_strtoi64 HAVE__STRTOI64)
+
+# Figure out what variant we should use
+if (HAVE_STRTOLL)
+   set (JSON_STRTOINT strtoll)
+elseif (HAVE_STRTOQ)
+   set (JSON_STRTOINT strtoq)
+elseif (HAVE__STRTOI64)
+   set (JSON_STRTOINT _strtoi64)
+else ()
+   # fallback to strtol (32 bit)
+   # this will set all the required variables
+   set (JSON_STRTOINT strtol)
+   set (JSON_INT_T long)
+   set (JSON_INTEGER_FORMAT "\"ld\"")
+endif ()
+
+# if we haven't defined JSON_INT_T, then we have a 64 bit conversion function.
+# detect what to use for the 64 bit type.
+# Note: I will prefer long long if I can get it, as that is what the automake system aimed for.
+if (NOT DEFINED JSON_INT_T)
+   if (HAVE_LONG_LONG_INT AND (${LONG_LONG_INT} EQUAL 8))
+      set (JSON_INT_T "long long")
+   elseif (HAVE_INT64_T)
+      set (JSON_INT_T int64_t)
+   elseif (HAVE___INT64)
+      set (JSON_INT_T __int64)
+   else ()
+      message (FATAL_ERROR "Could not detect 64 bit type, although I detected the strtoll equivalent")
+   endif ()
+
+   # Apparently, Borland BCC and MSVC wants I64d,
+   # Borland BCC could also accept LD
+   # and gcc wants ldd,
+   # I am not sure what cygwin will want, so I will assume I64d
+
+   if (WIN32) # matches both msvc and cygwin
+      set (JSON_INTEGER_FORMAT "\"I64d\"")
+   else ()
+      set (JSON_INTEGER_FORMAT "\"lld\"")
+   endif ()
+endif ()
+
+
+# If locale.h and localeconv() are available, define to 1, otherwise to 0.
+check_include_files (locale.h HAVE_LOCALE_H)
+check_function_exists (localeconv HAVE_LOCALECONV)
+
+if (HAVE_LOCALECONV AND HAVE_LOCALE_H)
+   set (JSON_HAVE_LOCALECONV 1)
+else ()
+   set (JSON_HAVE_LOCALECONV 0)
+endif()
+
+# check if we have setlocale
+check_function_exists(setlocale HAVE_SETLOCALE)
+
+# Check what the inline keyword is.
+# Note that the original JSON_INLINE was always set to just 'inline', so this goes further.
+check_function_keywords("inline")
+check_function_keywords("__inline")
+check_function_keywords("__inline__")
+
+if (HAVE_INLINE)
+   set(JSON_INLINE inline)
+elseif (HAVE___INLINE)
+   set(JSON_INLINE __inline)
+elseif (HAVE___INLINE__)
+   set(JSON_INLINE __inline__)
+else()
+   # no inline on this platform
+   set (JSON_INLINE)
+endif()
+
+# Find our snprintf
+check_function_exists (snprintf HAVE_SNPRINTF)
+check_function_exists (_snprintf HAVE__SNPRINTF)
+
+if (HAVE_SNPRINTF)
+   set(JSON_SNPRINTF snprintf)
+elseif (HAVE__SNPRINTF)
+   set(JSON_SNPRINTF _snprintf)
+endif () 
+
+check_c_source_compiles ("int main() { unsigned long val; __sync_bool_compare_and_swap(&val, 0, 1); return 0; } " HAVE_SYNC_BUILTINS)
+check_c_source_compiles ("int main() { char l; unsigned long v; __atomic_test_and_set(&l, __ATOMIC_RELAXED); __atomic_store_n(&v, 1, __ATOMIC_RELEASE); __atomic_load_n(&v, __ATOMIC_ACQUIRE); return 0; }" HAVE_ATOMIC_BUILTINS)
+
+# Create pkg-conf file.
+# (We use the same files as ./configure does, so we
+#  have to defined the same variables used there).
+if(NOT DEFINED CMAKE_INSTALL_LIBDIR)
+  set(CMAKE_INSTALL_LIBDIR lib)
+endif(NOT DEFINED CMAKE_INSTALL_LIBDIR)
+set(prefix      ${CMAKE_INSTALL_PREFIX})
+set(exec_prefix ${CMAKE_INSTALL_PREFIX})
+set(libdir      ${CMAKE_INSTALL_PREFIX}/${CMAKE_INSTALL_LIBDIR})
+set(VERSION     ${JANSSON_DISPLAY_VERSION})
+configure_file(${CMAKE_CURRENT_SOURCE_DIR}/jansson.pc.in
+               ${CMAKE_CURRENT_BINARY_DIR}/jansson.pc @ONLY)
+
+# configure the public config file
+configure_file (${CMAKE_CURRENT_SOURCE_DIR}/cmake/jansson_config.h.cmake
+                ${CMAKE_CURRENT_BINARY_DIR}/include/jansson_config.h)
+
+# Copy the jansson.h file to the public include folder
+file (COPY ${CMAKE_CURRENT_SOURCE_DIR}/src/jansson.h
+           DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/include/)
+
+add_definitions(-DJANSSON_USING_CMAKE)
+
+# configure the private config file
+configure_file (${CMAKE_CURRENT_SOURCE_DIR}/cmake/jansson_private_config.h.cmake
+                ${CMAKE_CURRENT_BINARY_DIR}/private_include/jansson_private_config.h)
+
+# and tell the source code to include it
+add_definitions(-DHAVE_CONFIG_H)
+
+include_directories (${CMAKE_CURRENT_BINARY_DIR}/include)
+include_directories (${CMAKE_CURRENT_BINARY_DIR}/private_include)
+
+# Add the lib sources.
+file(GLOB JANSSON_SRC src/*.c)
+
+set(JANSSON_HDR_PRIVATE
+   ${CMAKE_CURRENT_SOURCE_DIR}/src/hashtable.h
+   ${CMAKE_CURRENT_SOURCE_DIR}/src/jansson_private.h
+   ${CMAKE_CURRENT_SOURCE_DIR}/src/strbuffer.h
+   ${CMAKE_CURRENT_SOURCE_DIR}/src/utf.h
+   ${CMAKE_CURRENT_BINARY_DIR}/private_include/jansson_private_config.h)
+
+set(JANSSON_HDR_PUBLIC 
+   ${CMAKE_CURRENT_BINARY_DIR}/include/jansson_config.h
+   ${CMAKE_CURRENT_SOURCE_DIR}/src/jansson.h)
+
+source_group("Library Sources" FILES ${JANSSON_SRC})
+source_group("Library Private Headers" FILES ${JANSSON_HDR_PRIVATE})
+source_group("Library Public Headers" FILES ${JANSSON_HDR_PUBLIC})
+
+if(JANSSON_BUILD_SHARED_LIBS)
+   add_library(jansson SHARED 
+      ${JANSSON_SRC} 
+      ${JANSSON_HDR_PRIVATE} 
+      ${JANSSON_HDR_PUBLIC} 
+      src/jansson.def)
+
+   set_target_properties(jansson PROPERTIES
+      VERSION ${JANSSON_VERSION}
+      SOVERSION ${JANSSON_SOVERSION})
+else()
+   add_library(jansson 
+      ${JANSSON_SRC}
+      ${JANSSON_HDR_PRIVATE} 
+      ${JANSSON_HDR_PUBLIC})
+endif()
+
+
+# For building Documentation (uses Sphinx)
+option(JANSSON_BUILD_DOCS "Build documentation (uses python-sphinx)." ON)
+if (JANSSON_BUILD_DOCS)
+   find_package(Sphinx)
+
+   if (NOT SPHINX_FOUND)
+      message(WARNING "Sphinx not found. Cannot generate documentation! 
+      Set -DJANSSON_BUILD_DOCS=OFF to get rid of this message.")
+   else()
+      if (Sphinx_VERSION_STRING VERSION_LESS 1.0)
+         message(WARNING "Your Sphinx version is too old! 
+               This project requires Sphinx v1.0 or above to produce 
+               proper documentation (you have v${Sphinx_VERSION_STRING}).
+               You will get output but it will have errors.")
+      endif()
+
+      # configured documentation tools and intermediate build results
+      set(BINARY_BUILD_DIR "${CMAKE_CURRENT_BINARY_DIR}/_build")
+
+      # Sphinx cache with pickled ReST documents
+      set(SPHINX_CACHE_DIR "${CMAKE_CURRENT_BINARY_DIR}/_doctrees")
+
+      # CMake could be used to build the conf.py file too,
+      # eg it could automatically write the version of the program or change the theme.
+      # if(NOT DEFINED SPHINX_THEME)
+      #    set(SPHINX_THEME default)
+      # endif()
+      #
+      # if(NOT DEFINED SPHINX_THEME_DIR)
+      #    set(SPHINX_THEME_DIR)
+      # endif()
+      #
+      # configure_file(
+      #    "${CMAKE_CURRENT_SOURCE_DIR}/conf.py.in"
+      #    "${BINARY_BUILD_DIR}/conf.py"
+      #    @ONLY)
+
+      # TODO: Add support for all sphinx builders: http://sphinx-doc.org/builders.html
+
+      # Add documentation targets.
+      set(DOC_TARGETS html)
+
+      option(JANSSON_BUILD_MAN "Create a target for building man pages." ON)
+
+      if (JANSSON_BUILD_MAN)
+         if (Sphinx_VERSION_STRING VERSION_LESS 1.0)
+            message(WARNING "Sphinx version 1.0 > is required to build man pages. You have v${Sphinx_VERSION_STRING}.")
+         else()
+            list(APPEND DOC_TARGETS man)
+         endif()
+      endif()
+
+      option(JANSSON_BUILD_LATEX "Create a target for building latex docs (to create PDF)." OFF)
+
+      if (JANSSON_BUILD_LATEX)
+         find_package(LATEX)
+
+         if (NOT LATEX_COMPILER)
+            message("Couldn't find Latex, can't build latex docs using Sphinx")
+         else()
+            message("Latex found! If you have problems building, see Sphinx documentation for required Latex packages.")
+            list(APPEND DOC_TARGETS latex)
+         endif()
+      endif()
+      
+      # The doc target will build all documentation targets.
+      add_custom_target(doc)
+
+      foreach (DOC_TARGET ${DOC_TARGETS})
+         add_custom_target(${DOC_TARGET}
+            ${SPHINX_EXECUTABLE}
+            # -q   # Enable for quiet mode
+            -b ${DOC_TARGET}
+            -d "${SPHINX_CACHE_DIR}"
+            # -c "${BINARY_BUILD_DIR}" # enable if using cmake-generated conf.py
+            "${CMAKE_CURRENT_SOURCE_DIR}/doc"
+            "${CMAKE_CURRENT_BINARY_DIR}/doc/${DOC_TARGET}"
+            COMMENT "Building ${DOC_TARGET} documentation with Sphinx")
+
+         add_dependencies(doc ${DOC_TARGET})
+      endforeach()
+
+      message("Building documentation enabled for: ${DOC_TARGETS}")
+   endif()
+endif ()
+
+
+option(JANSSON_WITHOUT_TESTS "Don't build tests ('make test' to execute tests)" OFF)
+
+if (NOT JANSSON_WITHOUT_TESTS)
+   option(JANSSON_TEST_WITH_VALGRIND "Enable valgrind tests." OFF)
+
+   ENABLE_TESTING()
+
+   if (JANSSON_TEST_WITH_VALGRIND)
+      # TODO: Add FindValgrind.cmake instead of having a hardcoded path.
+
+      add_definitions(-DVALGRIND)
+
+      # enable valgrind
+      set(CMAKE_MEMORYCHECK_COMMAND valgrind)
+      set(CMAKE_MEMORYCHECK_COMMAND_OPTIONS
+         "--error-exitcode=1 --leak-check=full --show-reachable=yes --track-origins=yes -q")
+
+      set(MEMCHECK_COMMAND
+         "${CMAKE_MEMORYCHECK_COMMAND} ${CMAKE_MEMORYCHECK_COMMAND_OPTIONS}")
+      separate_arguments(MEMCHECK_COMMAND)
+   endif ()
+
+   #
+   # Test suites.
+   #
+   if (CMAKE_COMPILER_IS_GNUCC)
+      add_definitions(-Wall -Wextra -Wdeclaration-after-statement)
+   endif ()
+
+   set(api_tests
+         test_array
+         test_copy
+         test_dump
+         test_dump_callback
+         test_equal
+         test_load
+         test_loadb
+         test_number
+         test_object
+         test_pack
+         test_simple
+         test_unpack)
+
+   # Doing arithmetic on void pointers is not allowed by Microsofts compiler
+   # such as secure_malloc and secure_free is doing, so exclude it for now.
+   if (NOT MSVC)
+      list(APPEND api_tests test_memory_funcs)
+   endif()
+
+   # Helper macro for building and linking a test program.
+   macro(build_testprog name dir)
+       add_executable(${name} ${dir}/${name}.c)
+       add_dependencies(${name} jansson)
+       target_link_libraries(${name} jansson)
+   endmacro(build_testprog)
+
+   # Create executables and tests/valgrind tests for API tests.
+   foreach (test ${api_tests})
+      build_testprog(${test} ${PROJECT_SOURCE_DIR}/test/suites/api)
+
+      if (JANSSON_TEST_WITH_VALGRIND)
+         add_test(memcheck__${test}
+                  ${MEMCHECK_COMMAND} ${CMAKE_RUNTIME_OUTPUT_DIRECTORY}/${test})
+      else()
+         add_test(${test} ${CMAKE_RUNTIME_OUTPUT_DIRECTORY}/${test})
+      endif ()
+   endforeach ()
+
+   # Test harness for the suites tests.
+   build_testprog(json_process ${PROJECT_SOURCE_DIR}/test/bin)
+
+   set(SUITES encoding-flags valid invalid invalid-unicode)
+   foreach (SUITE ${SUITES})
+       file(GLOB TESTDIRS ${jansson_SOURCE_DIR}/test/suites/${SUITE}/*)
+
+       foreach (TESTDIR ${TESTDIRS})
+         if (IS_DIRECTORY ${TESTDIR})
+            get_filename_component(TNAME ${TESTDIR} NAME)
+
+            set(SUITE_TEST_CMD ${CMAKE_RUNTIME_OUTPUT_DIRECTORY}/json_process)
+
+            if (JANSSON_TEST_WITH_VALGRIND)
+               add_test(memcheck__${SUITE}__${TNAME}
+                        ${MEMCHECK_COMMAND} ${SUITE_TEST_CMD} ${TESTDIR})
+            else()
+               add_test(${SUITE}__${TNAME}
+                        ${SUITE_TEST_CMD} ${TESTDIR})
+            endif()
+
+            if ((${SUITE} STREQUAL "valid" OR ${SUITE} STREQUAL "invalid") AND NOT EXISTS ${TESTDIR}/nostrip)
+               if (JANSSON_TEST_WITH_VALGRIND)
+                  add_test(memcheck__${SUITE}__${TNAME}__strip
+                           ${MEMCHECK_COMMAND} ${SUITE_TEST_CMD} --strip ${TESTDIR})
+               else()
+                  add_test(${SUITE}__${TNAME}__strip
+                           ${SUITE_TEST_CMD} --strip ${TESTDIR})
+               endif()
+            endif ()
+         endif ()
+       endforeach ()
+   endforeach ()
+
+   add_custom_target(check COMMAND ${CMAKE_CTEST_COMMAND} 
+                     DEPENDS json_process ${api_tests})
+endif ()
+
+#
+# Installation preparation.
+#
+
+# Allow the user to override installation directories.
+set(JANSSON_INSTALL_LIB_DIR       lib CACHE PATH "Installation directory for libraries")
+set(JANSSON_INSTALL_BIN_DIR       bin CACHE PATH "Installation directory for executables")
+set(JANSSON_INSTALL_INCLUDE_DIR   include CACHE PATH "Installation directory for header files")
+
+if(WIN32 AND NOT CYGWIN)
+  set(DEF_INSTALL_CMAKE_DIR cmake)
+else()
+  set(DEF_INSTALL_CMAKE_DIR lib/cmake/jansson)
+endif()
+
+set(JANSSON_INSTALL_CMAKE_DIR ${DEF_INSTALL_CMAKE_DIR} CACHE PATH "Installation directory for CMake files")
+
+# Make sure the paths are absolute.
+foreach(p LIB BIN INCLUDE CMAKE)
+    set(var JANSSON_INSTALL_${p}_DIR)
+    if(NOT IS_ABSOLUTE "${${var}}")
+        set(${var} "${CMAKE_INSTALL_PREFIX}/${${var}}")
+    endif()
+endforeach()
+
+# Export targets (This is used for other CMake projects to easily find the libraries and include files).
+export(TARGETS jansson
+        FILE "${PROJECT_BINARY_DIR}/JanssonTargets.cmake")
+export(PACKAGE jansson)
+
+# Generate the config file for the build-tree.
+set(JANSSON__INCLUDE_DIRS 
+    "${PROJECT_SOURCE_DIR}/include"
+    "${PROJECT_BINARY_DIR}/include")
+set(JANSSON_INCLUDE_DIRS ${JANSSON__INCLUDE_DIRS} CACHE PATH "Jansson include directories")
+configure_file(${PROJECT_SOURCE_DIR}/cmake/JanssonConfig.cmake.in
+                ${PROJECT_BINARY_DIR}/JanssonConfig.cmake 
+                @ONLY)
+
+# Generate the config file for the installation tree.
+file(RELATIVE_PATH 
+    REL_INCLUDE_DIR 
+    "${JANSSON_INSTALL_CMAKE_DIR}"
+    "${JANSSON_INSTALL_INCLUDE_DIR}") # Calculate the relative directory from the Cmake dir.
+
+# Note the EVENT_CMAKE_DIR is defined in JanssonConfig.cmake.in, 
+# we escape it here so it's evaluated when it is included instead
+# so that the include dirs are given relative to where the 
+# config file is located.
+set(JANSSON__INCLUDE_DIRS 
+    "\${JANSSON_CMAKE_DIR}/${REL_INCLUDE_DIR}") 
+configure_file(${PROJECT_SOURCE_DIR}/cmake/JanssonConfig.cmake.in
+                ${PROJECT_BINARY_DIR}${CMAKE_FILES_DIRECTORY}/JanssonConfig.cmake 
+                @ONLY)
+
+# Generate version info for both build-tree and install-tree.
+configure_file(${PROJECT_SOURCE_DIR}/cmake/JanssonConfigVersion.cmake.in
+                ${PROJECT_BINARY_DIR}/JanssonConfigVersion.cmake 
+                @ONLY)
+
+# Define the public headers.
+set_target_properties(jansson PROPERTIES PUBLIC_HEADER "${JANSSON_HDR_PUBLIC}")
+#TODO: fix this.
+
+# Create pkg-conf file.
+# (We use the same files as ./configure does, so we
+#  have to defined the same variables used there).
+set(prefix      ${CMAKE_INSTALL_PREFIX})
+set(exec_prefix ${CMAKE_INSTALL_PREFIX})
+set(libdir      ${CMAKE_INSTALL_PREFIX}/${JANSSON_INSTALL_LIB_DIR})
+set(VERSION     ${JANSSON_DISPLAY_VERSION})
+configure_file(${CMAKE_CURRENT_SOURCE_DIR}/jansson.pc.in
+               ${CMAKE_CURRENT_BINARY_DIR}/jansson.pc @ONLY)
+
+#
+# Install targets.
+#
+install(TARGETS jansson
+        EXPORT JanssonTargets
+        LIBRARY DESTINATION "${JANSSON_INSTALL_LIB_DIR}" COMPONENT lib
+        ARCHIVE DESTINATION "${JANSSON_INSTALL_LIB_DIR}" COMPONENT lib
+        RUNTIME DESTINATION "${JANSSON_INSTALL_BIN_DIR}" COMPONENT lib # Windows DLLs
+        PUBLIC_HEADER DESTINATION "${JANSSON_INSTALL_INCLUDE_DIR}" COMPONENT dev)
+
+# Install the pkg-config.
+install (FILES 
+         ${CMAKE_CURRENT_BINARY_DIR}/jansson.pc
+         DESTINATION ${JANSSON_INSTALL_LIB_DIR}/pkgconfig COMPONENT dev)
+
+# Install the configs.
+install(FILES
+    ${PROJECT_BINARY_DIR}/${CMAKE_FILES_DIRECTORY}/JanssonConfig.cmake
+    ${PROJECT_BINARY_DIR}/JanssonConfigVersion.cmake
+    DESTINATION "${JANSSON_INSTALL_CMAKE_DIR}" COMPONENT dev)
+
+# Install exports for the install-tree.
+install(EXPORT JanssonTargets 
+        DESTINATION "${JANSSON_INSTALL_CMAKE_DIR}" COMPONENT dev)
+
+# For use when simply using add_library from a parent project to build jansson.
+set(JANSSON_LIBRARIES jansson CACHE STRING "Jansson libraries")

Added: vendor/jansson/dist/LICENSE
===================================================================
--- vendor/jansson/dist/LICENSE	                        (rev 0)
+++ vendor/jansson/dist/LICENSE	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,19 @@
+Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.

Added: vendor/jansson/dist/Makefile.am
===================================================================
--- vendor/jansson/dist/Makefile.am	                        (rev 0)
+++ vendor/jansson/dist/Makefile.am	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,10 @@
+EXTRA_DIST = CHANGES LICENSE README.rst CMakeLists.txt cmake android
+SUBDIRS = doc src test
+
+# "make distcheck" builds the dvi target, so use it to check that the
+# documentation is built correctly.
+dvi:
+	$(MAKE) SPHINXOPTS_EXTRA=-W html
+
+pkgconfigdir = $(libdir)/pkgconfig
+pkgconfig_DATA = jansson.pc

Added: vendor/jansson/dist/Makefile.in
===================================================================
--- vendor/jansson/dist/Makefile.in	                        (rev 0)
+++ vendor/jansson/dist/Makefile.in	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,859 @@
+# Makefile.in generated by automake 1.14.1 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994-2013 Free Software Foundation, Inc.
+
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+ at SET_MAKE@
+
+VPATH = @srcdir@
+am__is_gnu_make = test -n '$(MAKEFILE_LIST)' && test -n '$(MAKELEVEL)'
+am__make_running_with_option = \
+  case $${target_option-} in \
+      ?) ;; \
+      *) echo "am__make_running_with_option: internal error: invalid" \
+              "target option '$${target_option-}' specified" >&2; \
+         exit 1;; \
+  esac; \
+  has_opt=no; \
+  sane_makeflags=$$MAKEFLAGS; \
+  if $(am__is_gnu_make); then \
+    sane_makeflags=$$MFLAGS; \
+  else \
+    case $$MAKEFLAGS in \
+      *\\[\ \	]*) \
+        bs=\\; \
+        sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \
+          | sed "s/$$bs$$bs[$$bs $$bs	]*//g"`;; \
+    esac; \
+  fi; \
+  skip_next=no; \
+  strip_trailopt () \
+  { \
+    flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \
+  }; \
+  for flg in $$sane_makeflags; do \
+    test $$skip_next = yes && { skip_next=no; continue; }; \
+    case $$flg in \
+      *=*|--*) continue;; \
+        -*I) strip_trailopt 'I'; skip_next=yes;; \
+      -*I?*) strip_trailopt 'I';; \
+        -*O) strip_trailopt 'O'; skip_next=yes;; \
+      -*O?*) strip_trailopt 'O';; \
+        -*l) strip_trailopt 'l'; skip_next=yes;; \
+      -*l?*) strip_trailopt 'l';; \
+      -[dEDm]) skip_next=yes;; \
+      -[JT]) skip_next=yes;; \
+    esac; \
+    case $$flg in \
+      *$$target_option*) has_opt=yes; break;; \
+    esac; \
+  done; \
+  test $$has_opt = yes
+am__make_dryrun = (target_option=n; $(am__make_running_with_option))
+am__make_keepgoing = (target_option=k; $(am__make_running_with_option))
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+subdir = .
+DIST_COMMON = $(srcdir)/Makefile.in $(srcdir)/Makefile.am \
+	$(top_srcdir)/configure $(am__configure_deps) \
+	$(srcdir)/jansson_private_config.h.in $(srcdir)/jansson.pc.in \
+	compile config.guess config.sub install-sh missing ltmain.sh
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+	$(ACLOCAL_M4)
+am__CONFIG_DISTCLEAN_FILES = config.status config.cache config.log \
+ configure.lineno config.status.lineno
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = jansson_private_config.h
+CONFIG_CLEAN_FILES = jansson.pc
+CONFIG_CLEAN_VPATH_FILES =
+AM_V_P = $(am__v_P_ at AM_V@)
+am__v_P_ = $(am__v_P_ at AM_DEFAULT_V@)
+am__v_P_0 = false
+am__v_P_1 = :
+AM_V_GEN = $(am__v_GEN_ at AM_V@)
+am__v_GEN_ = $(am__v_GEN_ at AM_DEFAULT_V@)
+am__v_GEN_0 = @echo "  GEN     " $@;
+am__v_GEN_1 = 
+AM_V_at = $(am__v_at_ at AM_V@)
+am__v_at_ = $(am__v_at_ at AM_DEFAULT_V@)
+am__v_at_0 = @
+am__v_at_1 = 
+SOURCES =
+DIST_SOURCES =
+RECURSIVE_TARGETS = all-recursive check-recursive cscopelist-recursive \
+	ctags-recursive dvi-recursive html-recursive info-recursive \
+	install-data-recursive install-dvi-recursive \
+	install-exec-recursive install-html-recursive \
+	install-info-recursive install-pdf-recursive \
+	install-ps-recursive install-recursive installcheck-recursive \
+	installdirs-recursive pdf-recursive ps-recursive \
+	tags-recursive uninstall-recursive
+am__can_run_installinfo = \
+  case $$AM_UPDATE_INFO_DIR in \
+    n|no|NO) false;; \
+    *) (install-info --version) >/dev/null 2>&1;; \
+  esac
+am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`;
+am__vpath_adj = case $$p in \
+    $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \
+    *) f=$$p;; \
+  esac;
+am__strip_dir = f=`echo $$p | sed -e 's|^.*/||'`;
+am__install_max = 40
+am__nobase_strip_setup = \
+  srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*|]/\\\\&/g'`
+am__nobase_strip = \
+  for p in $$list; do echo "$$p"; done | sed -e "s|$$srcdirstrip/||"
+am__nobase_list = $(am__nobase_strip_setup); \
+  for p in $$list; do echo "$$p $$p"; done | \
+  sed "s| $$srcdirstrip/| |;"' / .*\//!s/ .*/ ./; s,\( .*\)/[^/]*$$,\1,' | \
+  $(AWK) 'BEGIN { files["."] = "" } { files[$$2] = files[$$2] " " $$1; \
+    if (++n[$$2] == $(am__install_max)) \
+      { print $$2, files[$$2]; n[$$2] = 0; files[$$2] = "" } } \
+    END { for (dir in files) print dir, files[dir] }'
+am__base_list = \
+  sed '$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;s/\n/ /g' | \
+  sed '$$!N;$$!N;$$!N;$$!N;s/\n/ /g'
+am__uninstall_files_from_dir = { \
+  test -z "$$files" \
+    || { test ! -d "$$dir" && test ! -f "$$dir" && test ! -r "$$dir"; } \
+    || { echo " ( cd '$$dir' && rm -f" $$files ")"; \
+         $(am__cd) "$$dir" && rm -f $$files; }; \
+  }
+am__installdirs = "$(DESTDIR)$(pkgconfigdir)"
+DATA = $(pkgconfig_DATA)
+RECURSIVE_CLEAN_TARGETS = mostlyclean-recursive clean-recursive	\
+  distclean-recursive maintainer-clean-recursive
+am__recursive_targets = \
+  $(RECURSIVE_TARGETS) \
+  $(RECURSIVE_CLEAN_TARGETS) \
+  $(am__extra_recursive_targets)
+AM_RECURSIVE_TARGETS = $(am__recursive_targets:-recursive=) TAGS CTAGS \
+	cscope distdir dist dist-all distcheck
+am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) \
+	$(LISP)jansson_private_config.h.in
+# Read a list of newline-separated strings from the standard input,
+# and print each of them once, without duplicates.  Input order is
+# *not* preserved.
+am__uniquify_input = $(AWK) '\
+  BEGIN { nonempty = 0; } \
+  { items[$$0] = 1; nonempty = 1; } \
+  END { if (nonempty) { for (i in items) print i; }; } \
+'
+# Make sure the list of sources is unique.  This is necessary because,
+# e.g., the same source file might be shared among _SOURCES variables
+# for different programs/libraries.
+am__define_uniq_tagged_files = \
+  list='$(am__tagged_files)'; \
+  unique=`for i in $$list; do \
+    if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+  done | $(am__uniquify_input)`
+ETAGS = etags
+CTAGS = ctags
+CSCOPE = cscope
+DIST_SUBDIRS = $(SUBDIRS)
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+distdir = $(PACKAGE)-$(VERSION)
+top_distdir = $(distdir)
+am__remove_distdir = \
+  if test -d "$(distdir)"; then \
+    find "$(distdir)" -type d ! -perm -200 -exec chmod u+w {} ';' \
+      && rm -rf "$(distdir)" \
+      || { sleep 5 && rm -rf "$(distdir)"; }; \
+  else :; fi
+am__post_remove_distdir = $(am__remove_distdir)
+am__relativize = \
+  dir0=`pwd`; \
+  sed_first='s,^\([^/]*\)/.*$$,\1,'; \
+  sed_rest='s,^[^/]*/*,,'; \
+  sed_last='s,^.*/\([^/]*\)$$,\1,'; \
+  sed_butlast='s,/*[^/]*$$,,'; \
+  while test -n "$$dir1"; do \
+    first=`echo "$$dir1" | sed -e "$$sed_first"`; \
+    if test "$$first" != "."; then \
+      if test "$$first" = ".."; then \
+        dir2=`echo "$$dir0" | sed -e "$$sed_last"`/"$$dir2"; \
+        dir0=`echo "$$dir0" | sed -e "$$sed_butlast"`; \
+      else \
+        first2=`echo "$$dir2" | sed -e "$$sed_first"`; \
+        if test "$$first2" = "$$first"; then \
+          dir2=`echo "$$dir2" | sed -e "$$sed_rest"`; \
+        else \
+          dir2="../$$dir2"; \
+        fi; \
+        dir0="$$dir0"/"$$first"; \
+      fi; \
+    fi; \
+    dir1=`echo "$$dir1" | sed -e "$$sed_rest"`; \
+  done; \
+  reldir="$$dir2"
+DIST_ARCHIVES = $(distdir).tar.gz
+GZIP_ENV = --best
+DIST_TARGETS = dist-gzip
+distuninstallcheck_listfiles = find . -type f -print
+am__distuninstallcheck_listfiles = $(distuninstallcheck_listfiles) \
+  | sed 's|^\./|$(prefix)/|' | grep -v '$(infodir)/dir$$'
+distcleancheck_listfiles = find . -type f -print
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AM_CFLAGS = @AM_CFLAGS@
+AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DLLTOOL = @DLLTOOL@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+GREP = @GREP@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+LD = @LD@
+LDFLAGS = @LDFLAGS@
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+MAKEINFO = @MAKEINFO@
+MANIFEST_TOOL = @MANIFEST_TOOL@
+MKDIR_P = @MKDIR_P@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_URL = @PACKAGE_URL@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+VERSION = @VERSION@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+json_have_localeconv = @json_have_localeconv@
+json_have_long_long = @json_have_long_long@
+json_inline = @json_inline@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+EXTRA_DIST = CHANGES LICENSE README.rst CMakeLists.txt cmake android
+SUBDIRS = doc src test
+pkgconfigdir = $(libdir)/pkgconfig
+pkgconfig_DATA = jansson.pc
+all: jansson_private_config.h
+	$(MAKE) $(AM_MAKEFLAGS) all-recursive
+
+.SUFFIXES:
+am--refresh: Makefile
+	@:
+$(srcdir)/Makefile.in:  $(srcdir)/Makefile.am  $(am__configure_deps)
+	@for dep in $?; do \
+	  case '$(am__configure_deps)' in \
+	    *$$dep*) \
+	      echo ' cd $(srcdir) && $(AUTOMAKE) --foreign'; \
+	      $(am__cd) $(srcdir) && $(AUTOMAKE) --foreign \
+		&& exit 0; \
+	      exit 1;; \
+	  esac; \
+	done; \
+	echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign Makefile'; \
+	$(am__cd) $(top_srcdir) && \
+	  $(AUTOMAKE) --foreign Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+	@case '$?' in \
+	  *config.status*) \
+	    echo ' $(SHELL) ./config.status'; \
+	    $(SHELL) ./config.status;; \
+	  *) \
+	    echo ' cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe)'; \
+	    cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe);; \
+	esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+	$(SHELL) ./config.status --recheck
+
+$(top_srcdir)/configure:  $(am__configure_deps)
+	$(am__cd) $(srcdir) && $(AUTOCONF)
+$(ACLOCAL_M4):  $(am__aclocal_m4_deps)
+	$(am__cd) $(srcdir) && $(ACLOCAL) $(ACLOCAL_AMFLAGS)
+$(am__aclocal_m4_deps):
+
+jansson_private_config.h: stamp-h1
+	@test -f $@ || rm -f stamp-h1
+	@test -f $@ || $(MAKE) $(AM_MAKEFLAGS) stamp-h1
+
+stamp-h1: $(srcdir)/jansson_private_config.h.in $(top_builddir)/config.status
+	@rm -f stamp-h1
+	cd $(top_builddir) && $(SHELL) ./config.status jansson_private_config.h
+$(srcdir)/jansson_private_config.h.in:  $(am__configure_deps) 
+	($(am__cd) $(top_srcdir) && $(AUTOHEADER))
+	rm -f stamp-h1
+	touch $@
+
+distclean-hdr:
+	-rm -f jansson_private_config.h stamp-h1
+jansson.pc: $(top_builddir)/config.status $(srcdir)/jansson.pc.in
+	cd $(top_builddir) && $(SHELL) ./config.status $@
+
+mostlyclean-libtool:
+	-rm -f *.lo
+
+clean-libtool:
+	-rm -rf .libs _libs
+
+distclean-libtool:
+	-rm -f libtool config.lt
+install-pkgconfigDATA: $(pkgconfig_DATA)
+	@$(NORMAL_INSTALL)
+	@list='$(pkgconfig_DATA)'; test -n "$(pkgconfigdir)" || list=; \
+	if test -n "$$list"; then \
+	  echo " $(MKDIR_P) '$(DESTDIR)$(pkgconfigdir)'"; \
+	  $(MKDIR_P) "$(DESTDIR)$(pkgconfigdir)" || exit 1; \
+	fi; \
+	for p in $$list; do \
+	  if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \
+	  echo "$$d$$p"; \
+	done | $(am__base_list) | \
+	while read files; do \
+	  echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(pkgconfigdir)'"; \
+	  $(INSTALL_DATA) $$files "$(DESTDIR)$(pkgconfigdir)" || exit $$?; \
+	done
+
+uninstall-pkgconfigDATA:
+	@$(NORMAL_UNINSTALL)
+	@list='$(pkgconfig_DATA)'; test -n "$(pkgconfigdir)" || list=; \
+	files=`for p in $$list; do echo $$p; done | sed -e 's|^.*/||'`; \
+	dir='$(DESTDIR)$(pkgconfigdir)'; $(am__uninstall_files_from_dir)
+
+# This directory's subdirectories are mostly independent; you can cd
+# into them and run 'make' without going through this Makefile.
+# To change the values of 'make' variables: instead of editing Makefiles,
+# (1) if the variable is set in 'config.status', edit 'config.status'
+#     (which will cause the Makefiles to be regenerated when you run 'make');
+# (2) otherwise, pass the desired values on the 'make' command line.
+$(am__recursive_targets):
+	@fail=; \
+	if $(am__make_keepgoing); then \
+	  failcom='fail=yes'; \
+	else \
+	  failcom='exit 1'; \
+	fi; \
+	dot_seen=no; \
+	target=`echo $@ | sed s/-recursive//`; \
+	case "$@" in \
+	  distclean-* | maintainer-clean-*) list='$(DIST_SUBDIRS)' ;; \
+	  *) list='$(SUBDIRS)' ;; \
+	esac; \
+	for subdir in $$list; do \
+	  echo "Making $$target in $$subdir"; \
+	  if test "$$subdir" = "."; then \
+	    dot_seen=yes; \
+	    local_target="$$target-am"; \
+	  else \
+	    local_target="$$target"; \
+	  fi; \
+	  ($(am__cd) $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$local_target) \
+	  || eval $$failcom; \
+	done; \
+	if test "$$dot_seen" = "no"; then \
+	  $(MAKE) $(AM_MAKEFLAGS) "$$target-am" || exit 1; \
+	fi; test -z "$$fail"
+
+ID: $(am__tagged_files)
+	$(am__define_uniq_tagged_files); mkid -fID $$unique
+tags: tags-recursive
+TAGS: tags
+
+tags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+	set x; \
+	here=`pwd`; \
+	if ($(ETAGS) --etags-include --version) >/dev/null 2>&1; then \
+	  include_option=--etags-include; \
+	  empty_fix=.; \
+	else \
+	  include_option=--include; \
+	  empty_fix=; \
+	fi; \
+	list='$(SUBDIRS)'; for subdir in $$list; do \
+	  if test "$$subdir" = .; then :; else \
+	    test ! -f $$subdir/TAGS || \
+	      set "$$@" "$$include_option=$$here/$$subdir/TAGS"; \
+	  fi; \
+	done; \
+	$(am__define_uniq_tagged_files); \
+	shift; \
+	if test -z "$(ETAGS_ARGS)$$*$$unique"; then :; else \
+	  test -n "$$unique" || unique=$$empty_fix; \
+	  if test $$# -gt 0; then \
+	    $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+	      "$$@" $$unique; \
+	  else \
+	    $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+	      $$unique; \
+	  fi; \
+	fi
+ctags: ctags-recursive
+
+CTAGS: ctags
+ctags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+	$(am__define_uniq_tagged_files); \
+	test -z "$(CTAGS_ARGS)$$unique" \
+	  || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \
+	     $$unique
+
+GTAGS:
+	here=`$(am__cd) $(top_builddir) && pwd` \
+	  && $(am__cd) $(top_srcdir) \
+	  && gtags -i $(GTAGS_ARGS) "$$here"
+cscope: cscope.files
+	test ! -s cscope.files \
+	  || $(CSCOPE) -b -q $(AM_CSCOPEFLAGS) $(CSCOPEFLAGS) -i cscope.files $(CSCOPE_ARGS)
+clean-cscope:
+	-rm -f cscope.files
+cscope.files: clean-cscope cscopelist
+cscopelist: cscopelist-recursive
+
+cscopelist-am: $(am__tagged_files)
+	list='$(am__tagged_files)'; \
+	case "$(srcdir)" in \
+	  [\\/]* | ?:[\\/]*) sdir="$(srcdir)" ;; \
+	  *) sdir=$(subdir)/$(srcdir) ;; \
+	esac; \
+	for i in $$list; do \
+	  if test -f "$$i"; then \
+	    echo "$(subdir)/$$i"; \
+	  else \
+	    echo "$$sdir/$$i"; \
+	  fi; \
+	done >> $(top_builddir)/cscope.files
+
+distclean-tags:
+	-rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
+	-rm -f cscope.out cscope.in.out cscope.po.out cscope.files
+
+distdir: $(DISTFILES)
+	$(am__remove_distdir)
+	test -d "$(distdir)" || mkdir "$(distdir)"
+	@srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	list='$(DISTFILES)'; \
+	  dist_files=`for file in $$list; do echo $$file; done | \
+	  sed -e "s|^$$srcdirstrip/||;t" \
+	      -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+	case $$dist_files in \
+	  */*) $(MKDIR_P) `echo "$$dist_files" | \
+			   sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+			   sort -u` ;; \
+	esac; \
+	for file in $$dist_files; do \
+	  if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+	  if test -d $$d/$$file; then \
+	    dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+	    if test -d "$(distdir)/$$file"; then \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+	      cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+	  else \
+	    test -f "$(distdir)/$$file" \
+	    || cp -p $$d/$$file "$(distdir)/$$file" \
+	    || exit 1; \
+	  fi; \
+	done
+	@list='$(DIST_SUBDIRS)'; for subdir in $$list; do \
+	  if test "$$subdir" = .; then :; else \
+	    $(am__make_dryrun) \
+	      || test -d "$(distdir)/$$subdir" \
+	      || $(MKDIR_P) "$(distdir)/$$subdir" \
+	      || exit 1; \
+	    dir1=$$subdir; dir2="$(distdir)/$$subdir"; \
+	    $(am__relativize); \
+	    new_distdir=$$reldir; \
+	    dir1=$$subdir; dir2="$(top_distdir)"; \
+	    $(am__relativize); \
+	    new_top_distdir=$$reldir; \
+	    echo " (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) top_distdir="$$new_top_distdir" distdir="$$new_distdir" \\"; \
+	    echo "     am__remove_distdir=: am__skip_length_check=: am__skip_mode_fix=: distdir)"; \
+	    ($(am__cd) $$subdir && \
+	      $(MAKE) $(AM_MAKEFLAGS) \
+	        top_distdir="$$new_top_distdir" \
+	        distdir="$$new_distdir" \
+		am__remove_distdir=: \
+		am__skip_length_check=: \
+		am__skip_mode_fix=: \
+	        distdir) \
+	      || exit 1; \
+	  fi; \
+	done
+	-test -n "$(am__skip_mode_fix)" \
+	|| find "$(distdir)" -type d ! -perm -755 \
+		-exec chmod u+rwx,go+rx {} \; -o \
+	  ! -type d ! -perm -444 -links 1 -exec chmod a+r {} \; -o \
+	  ! -type d ! -perm -400 -exec chmod a+r {} \; -o \
+	  ! -type d ! -perm -444 -exec $(install_sh) -c -m a+r {} {} \; \
+	|| chmod -R a+r "$(distdir)"
+dist-gzip: distdir
+	tardir=$(distdir) && $(am__tar) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).tar.gz
+	$(am__post_remove_distdir)
+
+dist-bzip2: distdir
+	tardir=$(distdir) && $(am__tar) | BZIP2=$${BZIP2--9} bzip2 -c >$(distdir).tar.bz2
+	$(am__post_remove_distdir)
+
+dist-lzip: distdir
+	tardir=$(distdir) && $(am__tar) | lzip -c $${LZIP_OPT--9} >$(distdir).tar.lz
+	$(am__post_remove_distdir)
+
+dist-xz: distdir
+	tardir=$(distdir) && $(am__tar) | XZ_OPT=$${XZ_OPT--e} xz -c >$(distdir).tar.xz
+	$(am__post_remove_distdir)
+
+dist-tarZ: distdir
+	@echo WARNING: "Support for shar distribution archives is" \
+	               "deprecated." >&2
+	@echo WARNING: "It will be removed altogether in Automake 2.0" >&2
+	tardir=$(distdir) && $(am__tar) | compress -c >$(distdir).tar.Z
+	$(am__post_remove_distdir)
+
+dist-shar: distdir
+	@echo WARNING: "Support for distribution archives compressed with" \
+		       "legacy program 'compress' is deprecated." >&2
+	@echo WARNING: "It will be removed altogether in Automake 2.0" >&2
+	shar $(distdir) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).shar.gz
+	$(am__post_remove_distdir)
+
+dist-zip: distdir
+	-rm -f $(distdir).zip
+	zip -rq $(distdir).zip $(distdir)
+	$(am__post_remove_distdir)
+
+dist dist-all:
+	$(MAKE) $(AM_MAKEFLAGS) $(DIST_TARGETS) am__post_remove_distdir='@:'
+	$(am__post_remove_distdir)
+
+# This target untars the dist file and tries a VPATH configuration.  Then
+# it guarantees that the distribution is self-contained by making another
+# tarfile.
+distcheck: dist
+	case '$(DIST_ARCHIVES)' in \
+	*.tar.gz*) \
+	  GZIP=$(GZIP_ENV) gzip -dc $(distdir).tar.gz | $(am__untar) ;;\
+	*.tar.bz2*) \
+	  bzip2 -dc $(distdir).tar.bz2 | $(am__untar) ;;\
+	*.tar.lz*) \
+	  lzip -dc $(distdir).tar.lz | $(am__untar) ;;\
+	*.tar.xz*) \
+	  xz -dc $(distdir).tar.xz | $(am__untar) ;;\
+	*.tar.Z*) \
+	  uncompress -c $(distdir).tar.Z | $(am__untar) ;;\
+	*.shar.gz*) \
+	  GZIP=$(GZIP_ENV) gzip -dc $(distdir).shar.gz | unshar ;;\
+	*.zip*) \
+	  unzip $(distdir).zip ;;\
+	esac
+	chmod -R a-w $(distdir)
+	chmod u+w $(distdir)
+	mkdir $(distdir)/_build $(distdir)/_inst
+	chmod a-w $(distdir)
+	test -d $(distdir)/_build || exit 0; \
+	dc_install_base=`$(am__cd) $(distdir)/_inst && pwd | sed -e 's,^[^:\\/]:[\\/],/,'` \
+	  && dc_destdir="$${TMPDIR-/tmp}/am-dc-$$$$/" \
+	  && am__cwd=`pwd` \
+	  && $(am__cd) $(distdir)/_build \
+	  && ../configure \
+	    $(AM_DISTCHECK_CONFIGURE_FLAGS) \
+	    $(DISTCHECK_CONFIGURE_FLAGS) \
+	    --srcdir=.. --prefix="$$dc_install_base" \
+	  && $(MAKE) $(AM_MAKEFLAGS) \
+	  && $(MAKE) $(AM_MAKEFLAGS) dvi \
+	  && $(MAKE) $(AM_MAKEFLAGS) check \
+	  && $(MAKE) $(AM_MAKEFLAGS) install \
+	  && $(MAKE) $(AM_MAKEFLAGS) installcheck \
+	  && $(MAKE) $(AM_MAKEFLAGS) uninstall \
+	  && $(MAKE) $(AM_MAKEFLAGS) distuninstallcheck_dir="$$dc_install_base" \
+	        distuninstallcheck \
+	  && chmod -R a-w "$$dc_install_base" \
+	  && ({ \
+	       (cd ../.. && umask 077 && mkdir "$$dc_destdir") \
+	       && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" install \
+	       && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" uninstall \
+	       && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" \
+	            distuninstallcheck_dir="$$dc_destdir" distuninstallcheck; \
+	      } || { rm -rf "$$dc_destdir"; exit 1; }) \
+	  && rm -rf "$$dc_destdir" \
+	  && $(MAKE) $(AM_MAKEFLAGS) dist \
+	  && rm -rf $(DIST_ARCHIVES) \
+	  && $(MAKE) $(AM_MAKEFLAGS) distcleancheck \
+	  && cd "$$am__cwd" \
+	  || exit 1
+	$(am__post_remove_distdir)
+	@(echo "$(distdir) archives ready for distribution: "; \
+	  list='$(DIST_ARCHIVES)'; for i in $$list; do echo $$i; done) | \
+	  sed -e 1h -e 1s/./=/g -e 1p -e 1x -e '$$p' -e '$$x'
+distuninstallcheck:
+	@test -n '$(distuninstallcheck_dir)' || { \
+	  echo 'ERROR: trying to run $@ with an empty' \
+	       '$$(distuninstallcheck_dir)' >&2; \
+	  exit 1; \
+	}; \
+	$(am__cd) '$(distuninstallcheck_dir)' || { \
+	  echo 'ERROR: cannot chdir into $(distuninstallcheck_dir)' >&2; \
+	  exit 1; \
+	}; \
+	test `$(am__distuninstallcheck_listfiles) | wc -l` -eq 0 \
+	   || { echo "ERROR: files left after uninstall:" ; \
+	        if test -n "$(DESTDIR)"; then \
+	          echo "  (check DESTDIR support)"; \
+	        fi ; \
+	        $(distuninstallcheck_listfiles) ; \
+	        exit 1; } >&2
+distcleancheck: distclean
+	@if test '$(srcdir)' = . ; then \
+	  echo "ERROR: distcleancheck can only run from a VPATH build" ; \
+	  exit 1 ; \
+	fi
+	@test `$(distcleancheck_listfiles) | wc -l` -eq 0 \
+	  || { echo "ERROR: files left in build directory after distclean:" ; \
+	       $(distcleancheck_listfiles) ; \
+	       exit 1; } >&2
+check-am: all-am
+check: check-recursive
+all-am: Makefile $(DATA) jansson_private_config.h
+installdirs: installdirs-recursive
+installdirs-am:
+	for dir in "$(DESTDIR)$(pkgconfigdir)"; do \
+	  test -z "$$dir" || $(MKDIR_P) "$$dir"; \
+	done
+install: install-recursive
+install-exec: install-exec-recursive
+install-data: install-data-recursive
+uninstall: uninstall-recursive
+
+install-am: all-am
+	@$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-recursive
+install-strip:
+	if test -z '$(STRIP)'; then \
+	  $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+	    install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+	      install; \
+	else \
+	  $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+	    install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+	    "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \
+	fi
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+	-test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+	-test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+
+maintainer-clean-generic:
+	@echo "This command is intended for maintainers to use"
+	@echo "it deletes files that may require special tools to rebuild."
+clean: clean-recursive
+
+clean-am: clean-generic clean-libtool mostlyclean-am
+
+distclean: distclean-recursive
+	-rm -f $(am__CONFIG_DISTCLEAN_FILES)
+	-rm -f Makefile
+distclean-am: clean-am distclean-generic distclean-hdr \
+	distclean-libtool distclean-tags
+
+dvi-am:
+
+html: html-recursive
+
+html-am:
+
+info: info-recursive
+
+info-am:
+
+install-data-am: install-pkgconfigDATA
+
+install-dvi: install-dvi-recursive
+
+install-dvi-am:
+
+install-exec-am:
+
+install-html: install-html-recursive
+
+install-html-am:
+
+install-info: install-info-recursive
+
+install-info-am:
+
+install-man:
+
+install-pdf: install-pdf-recursive
+
+install-pdf-am:
+
+install-ps: install-ps-recursive
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-recursive
+	-rm -f $(am__CONFIG_DISTCLEAN_FILES)
+	-rm -rf $(top_srcdir)/autom4te.cache
+	-rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-recursive
+
+mostlyclean-am: mostlyclean-generic mostlyclean-libtool
+
+pdf: pdf-recursive
+
+pdf-am:
+
+ps: ps-recursive
+
+ps-am:
+
+uninstall-am: uninstall-pkgconfigDATA
+
+.MAKE: $(am__recursive_targets) all install-am install-strip
+
+.PHONY: $(am__recursive_targets) CTAGS GTAGS TAGS all all-am \
+	am--refresh check check-am clean clean-cscope clean-generic \
+	clean-libtool cscope cscopelist-am ctags ctags-am dist \
+	dist-all dist-bzip2 dist-gzip dist-lzip dist-shar dist-tarZ \
+	dist-xz dist-zip distcheck distclean distclean-generic \
+	distclean-hdr distclean-libtool distclean-tags distcleancheck \
+	distdir distuninstallcheck dvi dvi-am html html-am info \
+	info-am install install-am install-data install-data-am \
+	install-dvi install-dvi-am install-exec install-exec-am \
+	install-html install-html-am install-info install-info-am \
+	install-man install-pdf install-pdf-am install-pkgconfigDATA \
+	install-ps install-ps-am install-strip installcheck \
+	installcheck-am installdirs installdirs-am maintainer-clean \
+	maintainer-clean-generic mostlyclean mostlyclean-generic \
+	mostlyclean-libtool pdf pdf-am ps ps-am tags tags-am uninstall \
+	uninstall-am uninstall-pkgconfigDATA
+
+
+# "make distcheck" builds the dvi target, so use it to check that the
+# documentation is built correctly.
+dvi:
+	$(MAKE) SPHINXOPTS_EXTRA=-W html
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:

Added: vendor/jansson/dist/README.rst
===================================================================
--- vendor/jansson/dist/README.rst	                        (rev 0)
+++ vendor/jansson/dist/README.rst	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,65 @@
+Jansson README
+==============
+
+.. image:: https://travis-ci.org/akheron/jansson.png
+  :target: https://travis-ci.org/akheron/jansson
+  
+.. image:: https://ci.appveyor.com/api/projects/status/lmhkkc4q8cwc65ko
+  :target: https://ci.appveyor.com/project/akheron/jansson
+
+Jansson_ is a C library for encoding, decoding and manipulating JSON
+data. Its main features and design principles are:
+
+- Simple and intuitive API and data model
+
+- Comprehensive documentation
+
+- No dependencies on other libraries
+
+- Full Unicode support (UTF-8)
+
+- Extensive test suite
+
+Jansson is licensed under the `MIT license`_; see LICENSE in the
+source distribution for details.
+
+
+Compilation and Installation
+----------------------------
+
+If you obtained a source tarball, just use the standard autotools
+commands::
+
+   $ ./configure
+   $ make
+   $ make install
+
+To run the test suite, invoke::
+
+   $ make check
+
+If the source has been checked out from a Git repository, the
+./configure script has to be generated first. The easiest way is to
+use autoreconf::
+
+   $ autoreconf -i
+
+
+Documentation
+-------------
+
+Prebuilt HTML documentation is available at
+http://www.digip.org/jansson/doc/.
+
+The documentation source is in the ``doc/`` subdirectory. To generate
+HTML documentation, invoke::
+
+   $ make html
+
+Then, point your browser to ``doc/_build/html/index.html``. Sphinx_
+1.0 or newer is required to generate the documentation.
+
+
+.. _Jansson: http://www.digip.org/jansson/
+.. _`MIT license`: http://www.opensource.org/licenses/mit-license.php
+.. _Sphinx: http://sphinx.pocoo.org/

Added: vendor/jansson/dist/aclocal.m4
===================================================================
--- vendor/jansson/dist/aclocal.m4	                        (rev 0)
+++ vendor/jansson/dist/aclocal.m4	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,9751 @@
+# generated automatically by aclocal 1.14.1 -*- Autoconf -*-
+
+# Copyright (C) 1996-2013 Free Software Foundation, Inc.
+
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+m4_ifndef([AC_CONFIG_MACRO_DIRS], [m4_defun([_AM_CONFIG_MACRO_DIRS], [])m4_defun([AC_CONFIG_MACRO_DIRS], [_AM_CONFIG_MACRO_DIRS($@)])])
+m4_ifndef([AC_AUTOCONF_VERSION],
+  [m4_copy([m4_PACKAGE_VERSION], [AC_AUTOCONF_VERSION])])dnl
+m4_if(m4_defn([AC_AUTOCONF_VERSION]), [2.69],,
+[m4_warning([this file was generated for autoconf 2.69.
+You have another version of autoconf.  It may work, but is not guaranteed to.
+If you have problems, you may need to regenerate the build system entirely.
+To do so, use the procedure documented by the package, typically 'autoreconf'.])])
+
+# libtool.m4 - Configure libtool for the host system. -*-Autoconf-*-
+#
+#   Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005,
+#                 2006, 2007, 2008, 2009, 2010, 2011 Free Software
+#                 Foundation, Inc.
+#   Written by Gordon Matzigkeit, 1996
+#
+# This file is free software; the Free Software Foundation gives
+# unlimited permission to copy and/or distribute it, with or without
+# modifications, as long as this notice is preserved.
+
+m4_define([_LT_COPYING], [dnl
+#   Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005,
+#                 2006, 2007, 2008, 2009, 2010, 2011 Free Software
+#                 Foundation, Inc.
+#   Written by Gordon Matzigkeit, 1996
+#
+#   This file is part of GNU Libtool.
+#
+# GNU Libtool is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# As a special exception to the GNU General Public License,
+# if you distribute this file as part of a program or library that
+# is built using GNU Libtool, you may include this file under the
+# same distribution terms that you use for the rest of that program.
+#
+# GNU Libtool is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with GNU Libtool; see the file COPYING.  If not, a copy
+# can be downloaded from http://www.gnu.org/licenses/gpl.html, or
+# obtained by writing to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+])
+
+# serial 57 LT_INIT
+
+
+# LT_PREREQ(VERSION)
+# ------------------
+# Complain and exit if this libtool version is less that VERSION.
+m4_defun([LT_PREREQ],
+[m4_if(m4_version_compare(m4_defn([LT_PACKAGE_VERSION]), [$1]), -1,
+       [m4_default([$3],
+		   [m4_fatal([Libtool version $1 or higher is required],
+		             63)])],
+       [$2])])
+
+
+# _LT_CHECK_BUILDDIR
+# ------------------
+# Complain if the absolute build directory name contains unusual characters
+m4_defun([_LT_CHECK_BUILDDIR],
+[case `pwd` in
+  *\ * | *\	*)
+    AC_MSG_WARN([Libtool does not cope well with whitespace in `pwd`]) ;;
+esac
+])
+
+
+# LT_INIT([OPTIONS])
+# ------------------
+AC_DEFUN([LT_INIT],
+[AC_PREREQ([2.58])dnl We use AC_INCLUDES_DEFAULT
+AC_REQUIRE([AC_CONFIG_AUX_DIR_DEFAULT])dnl
+AC_BEFORE([$0], [LT_LANG])dnl
+AC_BEFORE([$0], [LT_OUTPUT])dnl
+AC_BEFORE([$0], [LTDL_INIT])dnl
+m4_require([_LT_CHECK_BUILDDIR])dnl
+
+dnl Autoconf doesn't catch unexpanded LT_ macros by default:
+m4_pattern_forbid([^_?LT_[A-Z_]+$])dnl
+m4_pattern_allow([^(_LT_EOF|LT_DLGLOBAL|LT_DLLAZY_OR_NOW|LT_MULTI_MODULE)$])dnl
+dnl aclocal doesn't pull ltoptions.m4, ltsugar.m4, or ltversion.m4
+dnl unless we require an AC_DEFUNed macro:
+AC_REQUIRE([LTOPTIONS_VERSION])dnl
+AC_REQUIRE([LTSUGAR_VERSION])dnl
+AC_REQUIRE([LTVERSION_VERSION])dnl
+AC_REQUIRE([LTOBSOLETE_VERSION])dnl
+m4_require([_LT_PROG_LTMAIN])dnl
+
+_LT_SHELL_INIT([SHELL=${CONFIG_SHELL-/bin/sh}])
+
+dnl Parse OPTIONS
+_LT_SET_OPTIONS([$0], [$1])
+
+# This can be used to rebuild libtool when needed
+LIBTOOL_DEPS="$ltmain"
+
+# Always use our own libtool.
+LIBTOOL='$(SHELL) $(top_builddir)/libtool'
+AC_SUBST(LIBTOOL)dnl
+
+_LT_SETUP
+
+# Only expand once:
+m4_define([LT_INIT])
+])# LT_INIT
+
+# Old names:
+AU_ALIAS([AC_PROG_LIBTOOL], [LT_INIT])
+AU_ALIAS([AM_PROG_LIBTOOL], [LT_INIT])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_PROG_LIBTOOL], [])
+dnl AC_DEFUN([AM_PROG_LIBTOOL], [])
+
+
+# _LT_CC_BASENAME(CC)
+# -------------------
+# Calculate cc_basename.  Skip known compiler wrappers and cross-prefix.
+m4_defun([_LT_CC_BASENAME],
+[for cc_temp in $1""; do
+  case $cc_temp in
+    compile | *[[\\/]]compile | ccache | *[[\\/]]ccache ) ;;
+    distcc | *[[\\/]]distcc | purify | *[[\\/]]purify ) ;;
+    \-*) ;;
+    *) break;;
+  esac
+done
+cc_basename=`$ECHO "$cc_temp" | $SED "s%.*/%%; s%^$host_alias-%%"`
+])
+
+
+# _LT_FILEUTILS_DEFAULTS
+# ----------------------
+# It is okay to use these file commands and assume they have been set
+# sensibly after `m4_require([_LT_FILEUTILS_DEFAULTS])'.
+m4_defun([_LT_FILEUTILS_DEFAULTS],
+[: ${CP="cp -f"}
+: ${MV="mv -f"}
+: ${RM="rm -f"}
+])# _LT_FILEUTILS_DEFAULTS
+
+
+# _LT_SETUP
+# ---------
+m4_defun([_LT_SETUP],
+[AC_REQUIRE([AC_CANONICAL_HOST])dnl
+AC_REQUIRE([AC_CANONICAL_BUILD])dnl
+AC_REQUIRE([_LT_PREPARE_SED_QUOTE_VARS])dnl
+AC_REQUIRE([_LT_PROG_ECHO_BACKSLASH])dnl
+
+_LT_DECL([], [PATH_SEPARATOR], [1], [The PATH separator for the build system])dnl
+dnl
+_LT_DECL([], [host_alias], [0], [The host system])dnl
+_LT_DECL([], [host], [0])dnl
+_LT_DECL([], [host_os], [0])dnl
+dnl
+_LT_DECL([], [build_alias], [0], [The build system])dnl
+_LT_DECL([], [build], [0])dnl
+_LT_DECL([], [build_os], [0])dnl
+dnl
+AC_REQUIRE([AC_PROG_CC])dnl
+AC_REQUIRE([LT_PATH_LD])dnl
+AC_REQUIRE([LT_PATH_NM])dnl
+dnl
+AC_REQUIRE([AC_PROG_LN_S])dnl
+test -z "$LN_S" && LN_S="ln -s"
+_LT_DECL([], [LN_S], [1], [Whether we need soft or hard links])dnl
+dnl
+AC_REQUIRE([LT_CMD_MAX_LEN])dnl
+_LT_DECL([objext], [ac_objext], [0], [Object file suffix (normally "o")])dnl
+_LT_DECL([], [exeext], [0], [Executable file suffix (normally "")])dnl
+dnl
+m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+m4_require([_LT_CHECK_SHELL_FEATURES])dnl
+m4_require([_LT_PATH_CONVERSION_FUNCTIONS])dnl
+m4_require([_LT_CMD_RELOAD])dnl
+m4_require([_LT_CHECK_MAGIC_METHOD])dnl
+m4_require([_LT_CHECK_SHAREDLIB_FROM_LINKLIB])dnl
+m4_require([_LT_CMD_OLD_ARCHIVE])dnl
+m4_require([_LT_CMD_GLOBAL_SYMBOLS])dnl
+m4_require([_LT_WITH_SYSROOT])dnl
+
+_LT_CONFIG_LIBTOOL_INIT([
+# See if we are running on zsh, and set the options which allow our
+# commands through without removal of \ escapes INIT.
+if test -n "\${ZSH_VERSION+set}" ; then
+   setopt NO_GLOB_SUBST
+fi
+])
+if test -n "${ZSH_VERSION+set}" ; then
+   setopt NO_GLOB_SUBST
+fi
+
+_LT_CHECK_OBJDIR
+
+m4_require([_LT_TAG_COMPILER])dnl
+
+case $host_os in
+aix3*)
+  # AIX sometimes has problems with the GCC collect2 program.  For some
+  # reason, if we set the COLLECT_NAMES environment variable, the problems
+  # vanish in a puff of smoke.
+  if test "X${COLLECT_NAMES+set}" != Xset; then
+    COLLECT_NAMES=
+    export COLLECT_NAMES
+  fi
+  ;;
+esac
+
+# Global variables:
+ofile=libtool
+can_build_shared=yes
+
+# All known linkers require a `.a' archive for static linking (except MSVC,
+# which needs '.lib').
+libext=a
+
+with_gnu_ld="$lt_cv_prog_gnu_ld"
+
+old_CC="$CC"
+old_CFLAGS="$CFLAGS"
+
+# Set sane defaults for various variables
+test -z "$CC" && CC=cc
+test -z "$LTCC" && LTCC=$CC
+test -z "$LTCFLAGS" && LTCFLAGS=$CFLAGS
+test -z "$LD" && LD=ld
+test -z "$ac_objext" && ac_objext=o
+
+_LT_CC_BASENAME([$compiler])
+
+# Only perform the check for file, if the check method requires it
+test -z "$MAGIC_CMD" && MAGIC_CMD=file
+case $deplibs_check_method in
+file_magic*)
+  if test "$file_magic_cmd" = '$MAGIC_CMD'; then
+    _LT_PATH_MAGIC
+  fi
+  ;;
+esac
+
+# Use C for the default configuration in the libtool script
+LT_SUPPORTED_TAG([CC])
+_LT_LANG_C_CONFIG
+_LT_LANG_DEFAULT_CONFIG
+_LT_CONFIG_COMMANDS
+])# _LT_SETUP
+
+
+# _LT_PREPARE_SED_QUOTE_VARS
+# --------------------------
+# Define a few sed substitution that help us do robust quoting.
+m4_defun([_LT_PREPARE_SED_QUOTE_VARS],
+[# Backslashify metacharacters that are still active within
+# double-quoted strings.
+sed_quote_subst='s/\([["`$\\]]\)/\\\1/g'
+
+# Same as above, but do not quote variable references.
+double_quote_subst='s/\([["`\\]]\)/\\\1/g'
+
+# Sed substitution to delay expansion of an escaped shell variable in a
+# double_quote_subst'ed string.
+delay_variable_subst='s/\\\\\\\\\\\$/\\\\\\$/g'
+
+# Sed substitution to delay expansion of an escaped single quote.
+delay_single_quote_subst='s/'\''/'\'\\\\\\\'\''/g'
+
+# Sed substitution to avoid accidental globbing in evaled expressions
+no_glob_subst='s/\*/\\\*/g'
+])
+
+# _LT_PROG_LTMAIN
+# ---------------
+# Note that this code is called both from `configure', and `config.status'
+# now that we use AC_CONFIG_COMMANDS to generate libtool.  Notably,
+# `config.status' has no value for ac_aux_dir unless we are using Automake,
+# so we pass a copy along to make sure it has a sensible value anyway.
+m4_defun([_LT_PROG_LTMAIN],
+[m4_ifdef([AC_REQUIRE_AUX_FILE], [AC_REQUIRE_AUX_FILE([ltmain.sh])])dnl
+_LT_CONFIG_LIBTOOL_INIT([ac_aux_dir='$ac_aux_dir'])
+ltmain="$ac_aux_dir/ltmain.sh"
+])# _LT_PROG_LTMAIN
+
+
+
+# So that we can recreate a full libtool script including additional
+# tags, we accumulate the chunks of code to send to AC_CONFIG_COMMANDS
+# in macros and then make a single call at the end using the `libtool'
+# label.
+
+
+# _LT_CONFIG_LIBTOOL_INIT([INIT-COMMANDS])
+# ----------------------------------------
+# Register INIT-COMMANDS to be passed to AC_CONFIG_COMMANDS later.
+m4_define([_LT_CONFIG_LIBTOOL_INIT],
+[m4_ifval([$1],
+          [m4_append([_LT_OUTPUT_LIBTOOL_INIT],
+                     [$1
+])])])
+
+# Initialize.
+m4_define([_LT_OUTPUT_LIBTOOL_INIT])
+
+
+# _LT_CONFIG_LIBTOOL([COMMANDS])
+# ------------------------------
+# Register COMMANDS to be passed to AC_CONFIG_COMMANDS later.
+m4_define([_LT_CONFIG_LIBTOOL],
+[m4_ifval([$1],
+          [m4_append([_LT_OUTPUT_LIBTOOL_COMMANDS],
+                     [$1
+])])])
+
+# Initialize.
+m4_define([_LT_OUTPUT_LIBTOOL_COMMANDS])
+
+
+# _LT_CONFIG_SAVE_COMMANDS([COMMANDS], [INIT_COMMANDS])
+# -----------------------------------------------------
+m4_defun([_LT_CONFIG_SAVE_COMMANDS],
+[_LT_CONFIG_LIBTOOL([$1])
+_LT_CONFIG_LIBTOOL_INIT([$2])
+])
+
+
+# _LT_FORMAT_COMMENT([COMMENT])
+# -----------------------------
+# Add leading comment marks to the start of each line, and a trailing
+# full-stop to the whole comment if one is not present already.
+m4_define([_LT_FORMAT_COMMENT],
+[m4_ifval([$1], [
+m4_bpatsubst([m4_bpatsubst([$1], [^ *], [# ])],
+              [['`$\]], [\\\&])]m4_bmatch([$1], [[!?.]$], [], [.])
+)])
+
+
+
+
+
+# _LT_DECL([CONFIGNAME], VARNAME, VALUE, [DESCRIPTION], [IS-TAGGED?])
+# -------------------------------------------------------------------
+# CONFIGNAME is the name given to the value in the libtool script.
+# VARNAME is the (base) name used in the configure script.
+# VALUE may be 0, 1 or 2 for a computed quote escaped value based on
+# VARNAME.  Any other value will be used directly.
+m4_define([_LT_DECL],
+[lt_if_append_uniq([lt_decl_varnames], [$2], [, ],
+    [lt_dict_add_subkey([lt_decl_dict], [$2], [libtool_name],
+	[m4_ifval([$1], [$1], [$2])])
+    lt_dict_add_subkey([lt_decl_dict], [$2], [value], [$3])
+    m4_ifval([$4],
+	[lt_dict_add_subkey([lt_decl_dict], [$2], [description], [$4])])
+    lt_dict_add_subkey([lt_decl_dict], [$2],
+	[tagged?], [m4_ifval([$5], [yes], [no])])])
+])
+
+
+# _LT_TAGDECL([CONFIGNAME], VARNAME, VALUE, [DESCRIPTION])
+# --------------------------------------------------------
+m4_define([_LT_TAGDECL], [_LT_DECL([$1], [$2], [$3], [$4], [yes])])
+
+
+# lt_decl_tag_varnames([SEPARATOR], [VARNAME1...])
+# ------------------------------------------------
+m4_define([lt_decl_tag_varnames],
+[_lt_decl_filter([tagged?], [yes], $@)])
+
+
+# _lt_decl_filter(SUBKEY, VALUE, [SEPARATOR], [VARNAME1..])
+# ---------------------------------------------------------
+m4_define([_lt_decl_filter],
+[m4_case([$#],
+  [0], [m4_fatal([$0: too few arguments: $#])],
+  [1], [m4_fatal([$0: too few arguments: $#: $1])],
+  [2], [lt_dict_filter([lt_decl_dict], [$1], [$2], [], lt_decl_varnames)],
+  [3], [lt_dict_filter([lt_decl_dict], [$1], [$2], [$3], lt_decl_varnames)],
+  [lt_dict_filter([lt_decl_dict], $@)])[]dnl
+])
+
+
+# lt_decl_quote_varnames([SEPARATOR], [VARNAME1...])
+# --------------------------------------------------
+m4_define([lt_decl_quote_varnames],
+[_lt_decl_filter([value], [1], $@)])
+
+
+# lt_decl_dquote_varnames([SEPARATOR], [VARNAME1...])
+# ---------------------------------------------------
+m4_define([lt_decl_dquote_varnames],
+[_lt_decl_filter([value], [2], $@)])
+
+
+# lt_decl_varnames_tagged([SEPARATOR], [VARNAME1...])
+# ---------------------------------------------------
+m4_define([lt_decl_varnames_tagged],
+[m4_assert([$# <= 2])dnl
+_$0(m4_quote(m4_default([$1], [[, ]])),
+    m4_ifval([$2], [[$2]], [m4_dquote(lt_decl_tag_varnames)]),
+    m4_split(m4_normalize(m4_quote(_LT_TAGS)), [ ]))])
+m4_define([_lt_decl_varnames_tagged],
+[m4_ifval([$3], [lt_combine([$1], [$2], [_], $3)])])
+
+
+# lt_decl_all_varnames([SEPARATOR], [VARNAME1...])
+# ------------------------------------------------
+m4_define([lt_decl_all_varnames],
+[_$0(m4_quote(m4_default([$1], [[, ]])),
+     m4_if([$2], [],
+	   m4_quote(lt_decl_varnames),
+	m4_quote(m4_shift($@))))[]dnl
+])
+m4_define([_lt_decl_all_varnames],
+[lt_join($@, lt_decl_varnames_tagged([$1],
+			lt_decl_tag_varnames([[, ]], m4_shift($@))))dnl
+])
+
+
+# _LT_CONFIG_STATUS_DECLARE([VARNAME])
+# ------------------------------------
+# Quote a variable value, and forward it to `config.status' so that its
+# declaration there will have the same value as in `configure'.  VARNAME
+# must have a single quote delimited value for this to work.
+m4_define([_LT_CONFIG_STATUS_DECLARE],
+[$1='`$ECHO "$][$1" | $SED "$delay_single_quote_subst"`'])
+
+
+# _LT_CONFIG_STATUS_DECLARATIONS
+# ------------------------------
+# We delimit libtool config variables with single quotes, so when
+# we write them to config.status, we have to be sure to quote all
+# embedded single quotes properly.  In configure, this macro expands
+# each variable declared with _LT_DECL (and _LT_TAGDECL) into:
+#
+#    <var>='`$ECHO "$<var>" | $SED "$delay_single_quote_subst"`'
+m4_defun([_LT_CONFIG_STATUS_DECLARATIONS],
+[m4_foreach([_lt_var], m4_quote(lt_decl_all_varnames),
+    [m4_n([_LT_CONFIG_STATUS_DECLARE(_lt_var)])])])
+
+
+# _LT_LIBTOOL_TAGS
+# ----------------
+# Output comment and list of tags supported by the script
+m4_defun([_LT_LIBTOOL_TAGS],
+[_LT_FORMAT_COMMENT([The names of the tagged configurations supported by this script])dnl
+available_tags="_LT_TAGS"dnl
+])
+
+
+# _LT_LIBTOOL_DECLARE(VARNAME, [TAG])
+# -----------------------------------
+# Extract the dictionary values for VARNAME (optionally with TAG) and
+# expand to a commented shell variable setting:
+#
+#    # Some comment about what VAR is for.
+#    visible_name=$lt_internal_name
+m4_define([_LT_LIBTOOL_DECLARE],
+[_LT_FORMAT_COMMENT(m4_quote(lt_dict_fetch([lt_decl_dict], [$1],
+					   [description])))[]dnl
+m4_pushdef([_libtool_name],
+    m4_quote(lt_dict_fetch([lt_decl_dict], [$1], [libtool_name])))[]dnl
+m4_case(m4_quote(lt_dict_fetch([lt_decl_dict], [$1], [value])),
+    [0], [_libtool_name=[$]$1],
+    [1], [_libtool_name=$lt_[]$1],
+    [2], [_libtool_name=$lt_[]$1],
+    [_libtool_name=lt_dict_fetch([lt_decl_dict], [$1], [value])])[]dnl
+m4_ifval([$2], [_$2])[]m4_popdef([_libtool_name])[]dnl
+])
+
+
+# _LT_LIBTOOL_CONFIG_VARS
+# -----------------------
+# Produce commented declarations of non-tagged libtool config variables
+# suitable for insertion in the LIBTOOL CONFIG section of the `libtool'
+# script.  Tagged libtool config variables (even for the LIBTOOL CONFIG
+# section) are produced by _LT_LIBTOOL_TAG_VARS.
+m4_defun([_LT_LIBTOOL_CONFIG_VARS],
+[m4_foreach([_lt_var],
+    m4_quote(_lt_decl_filter([tagged?], [no], [], lt_decl_varnames)),
+    [m4_n([_LT_LIBTOOL_DECLARE(_lt_var)])])])
+
+
+# _LT_LIBTOOL_TAG_VARS(TAG)
+# -------------------------
+m4_define([_LT_LIBTOOL_TAG_VARS],
+[m4_foreach([_lt_var], m4_quote(lt_decl_tag_varnames),
+    [m4_n([_LT_LIBTOOL_DECLARE(_lt_var, [$1])])])])
+
+
+# _LT_TAGVAR(VARNAME, [TAGNAME])
+# ------------------------------
+m4_define([_LT_TAGVAR], [m4_ifval([$2], [$1_$2], [$1])])
+
+
+# _LT_CONFIG_COMMANDS
+# -------------------
+# Send accumulated output to $CONFIG_STATUS.  Thanks to the lists of
+# variables for single and double quote escaping we saved from calls
+# to _LT_DECL, we can put quote escaped variables declarations
+# into `config.status', and then the shell code to quote escape them in
+# for loops in `config.status'.  Finally, any additional code accumulated
+# from calls to _LT_CONFIG_LIBTOOL_INIT is expanded.
+m4_defun([_LT_CONFIG_COMMANDS],
+[AC_PROVIDE_IFELSE([LT_OUTPUT],
+	dnl If the libtool generation code has been placed in $CONFIG_LT,
+	dnl instead of duplicating it all over again into config.status,
+	dnl then we will have config.status run $CONFIG_LT later, so it
+	dnl needs to know what name is stored there:
+        [AC_CONFIG_COMMANDS([libtool],
+            [$SHELL $CONFIG_LT || AS_EXIT(1)], [CONFIG_LT='$CONFIG_LT'])],
+    dnl If the libtool generation code is destined for config.status,
+    dnl expand the accumulated commands and init code now:
+    [AC_CONFIG_COMMANDS([libtool],
+        [_LT_OUTPUT_LIBTOOL_COMMANDS], [_LT_OUTPUT_LIBTOOL_COMMANDS_INIT])])
+])#_LT_CONFIG_COMMANDS
+
+
+# Initialize.
+m4_define([_LT_OUTPUT_LIBTOOL_COMMANDS_INIT],
+[
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+sed_quote_subst='$sed_quote_subst'
+double_quote_subst='$double_quote_subst'
+delay_variable_subst='$delay_variable_subst'
+_LT_CONFIG_STATUS_DECLARATIONS
+LTCC='$LTCC'
+LTCFLAGS='$LTCFLAGS'
+compiler='$compiler_DEFAULT'
+
+# A function that is used when there is no print builtin or printf.
+func_fallback_echo ()
+{
+  eval 'cat <<_LTECHO_EOF
+\$[]1
+_LTECHO_EOF'
+}
+
+# Quote evaled strings.
+for var in lt_decl_all_varnames([[ \
+]], lt_decl_quote_varnames); do
+    case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in
+    *[[\\\\\\\`\\"\\\$]]*)
+      eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED \\"\\\$sed_quote_subst\\"\\\`\\\\\\""
+      ;;
+    *)
+      eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\""
+      ;;
+    esac
+done
+
+# Double-quote double-evaled strings.
+for var in lt_decl_all_varnames([[ \
+]], lt_decl_dquote_varnames); do
+    case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in
+    *[[\\\\\\\`\\"\\\$]]*)
+      eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED -e \\"\\\$double_quote_subst\\" -e \\"\\\$sed_quote_subst\\" -e \\"\\\$delay_variable_subst\\"\\\`\\\\\\""
+      ;;
+    *)
+      eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\""
+      ;;
+    esac
+done
+
+_LT_OUTPUT_LIBTOOL_INIT
+])
+
+# _LT_GENERATED_FILE_INIT(FILE, [COMMENT])
+# ------------------------------------
+# Generate a child script FILE with all initialization necessary to
+# reuse the environment learned by the parent script, and make the
+# file executable.  If COMMENT is supplied, it is inserted after the
+# `#!' sequence but before initialization text begins.  After this
+# macro, additional text can be appended to FILE to form the body of
+# the child script.  The macro ends with non-zero status if the
+# file could not be fully written (such as if the disk is full).
+m4_ifdef([AS_INIT_GENERATED],
+[m4_defun([_LT_GENERATED_FILE_INIT],[AS_INIT_GENERATED($@)])],
+[m4_defun([_LT_GENERATED_FILE_INIT],
+[m4_require([AS_PREPARE])]dnl
+[m4_pushdef([AS_MESSAGE_LOG_FD])]dnl
+[lt_write_fail=0
+cat >$1 <<_ASEOF || lt_write_fail=1
+#! $SHELL
+# Generated by $as_me.
+$2
+SHELL=\${CONFIG_SHELL-$SHELL}
+export SHELL
+_ASEOF
+cat >>$1 <<\_ASEOF || lt_write_fail=1
+AS_SHELL_SANITIZE
+_AS_PREPARE
+exec AS_MESSAGE_FD>&1
+_ASEOF
+test $lt_write_fail = 0 && chmod +x $1[]dnl
+m4_popdef([AS_MESSAGE_LOG_FD])])])# _LT_GENERATED_FILE_INIT
+
+# LT_OUTPUT
+# ---------
+# This macro allows early generation of the libtool script (before
+# AC_OUTPUT is called), incase it is used in configure for compilation
+# tests.
+AC_DEFUN([LT_OUTPUT],
+[: ${CONFIG_LT=./config.lt}
+AC_MSG_NOTICE([creating $CONFIG_LT])
+_LT_GENERATED_FILE_INIT(["$CONFIG_LT"],
+[# Run this file to recreate a libtool stub with the current configuration.])
+
+cat >>"$CONFIG_LT" <<\_LTEOF
+lt_cl_silent=false
+exec AS_MESSAGE_LOG_FD>>config.log
+{
+  echo
+  AS_BOX([Running $as_me.])
+} >&AS_MESSAGE_LOG_FD
+
+lt_cl_help="\
+\`$as_me' creates a local libtool stub from the current configuration,
+for use in further configure time tests before the real libtool is
+generated.
+
+Usage: $[0] [[OPTIONS]]
+
+  -h, --help      print this help, then exit
+  -V, --version   print version number, then exit
+  -q, --quiet     do not print progress messages
+  -d, --debug     don't remove temporary files
+
+Report bugs to <bug-libtool at gnu.org>."
+
+lt_cl_version="\
+m4_ifset([AC_PACKAGE_NAME], [AC_PACKAGE_NAME ])config.lt[]dnl
+m4_ifset([AC_PACKAGE_VERSION], [ AC_PACKAGE_VERSION])
+configured by $[0], generated by m4_PACKAGE_STRING.
+
+Copyright (C) 2011 Free Software Foundation, Inc.
+This config.lt script is free software; the Free Software Foundation
+gives unlimited permision to copy, distribute and modify it."
+
+while test $[#] != 0
+do
+  case $[1] in
+    --version | --v* | -V )
+      echo "$lt_cl_version"; exit 0 ;;
+    --help | --h* | -h )
+      echo "$lt_cl_help"; exit 0 ;;
+    --debug | --d* | -d )
+      debug=: ;;
+    --quiet | --q* | --silent | --s* | -q )
+      lt_cl_silent=: ;;
+
+    -*) AC_MSG_ERROR([unrecognized option: $[1]
+Try \`$[0] --help' for more information.]) ;;
+
+    *) AC_MSG_ERROR([unrecognized argument: $[1]
+Try \`$[0] --help' for more information.]) ;;
+  esac
+  shift
+done
+
+if $lt_cl_silent; then
+  exec AS_MESSAGE_FD>/dev/null
+fi
+_LTEOF
+
+cat >>"$CONFIG_LT" <<_LTEOF
+_LT_OUTPUT_LIBTOOL_COMMANDS_INIT
+_LTEOF
+
+cat >>"$CONFIG_LT" <<\_LTEOF
+AC_MSG_NOTICE([creating $ofile])
+_LT_OUTPUT_LIBTOOL_COMMANDS
+AS_EXIT(0)
+_LTEOF
+chmod +x "$CONFIG_LT"
+
+# configure is writing to config.log, but config.lt does its own redirection,
+# appending to config.log, which fails on DOS, as config.log is still kept
+# open by configure.  Here we exec the FD to /dev/null, effectively closing
+# config.log, so it can be properly (re)opened and appended to by config.lt.
+lt_cl_success=:
+test "$silent" = yes &&
+  lt_config_lt_args="$lt_config_lt_args --quiet"
+exec AS_MESSAGE_LOG_FD>/dev/null
+$SHELL "$CONFIG_LT" $lt_config_lt_args || lt_cl_success=false
+exec AS_MESSAGE_LOG_FD>>config.log
+$lt_cl_success || AS_EXIT(1)
+])# LT_OUTPUT
+
+
+# _LT_CONFIG(TAG)
+# ---------------
+# If TAG is the built-in tag, create an initial libtool script with a
+# default configuration from the untagged config vars.  Otherwise add code
+# to config.status for appending the configuration named by TAG from the
+# matching tagged config vars.
+m4_defun([_LT_CONFIG],
+[m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+_LT_CONFIG_SAVE_COMMANDS([
+  m4_define([_LT_TAG], m4_if([$1], [], [C], [$1]))dnl
+  m4_if(_LT_TAG, [C], [
+    # See if we are running on zsh, and set the options which allow our
+    # commands through without removal of \ escapes.
+    if test -n "${ZSH_VERSION+set}" ; then
+      setopt NO_GLOB_SUBST
+    fi
+
+    cfgfile="${ofile}T"
+    trap "$RM \"$cfgfile\"; exit 1" 1 2 15
+    $RM "$cfgfile"
+
+    cat <<_LT_EOF >> "$cfgfile"
+#! $SHELL
+
+# `$ECHO "$ofile" | sed 's%^.*/%%'` - Provide generalized library-building support services.
+# Generated automatically by $as_me ($PACKAGE$TIMESTAMP) $VERSION
+# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+# NOTE: Changes made to this file will be lost: look at ltmain.sh.
+#
+_LT_COPYING
+_LT_LIBTOOL_TAGS
+
+# ### BEGIN LIBTOOL CONFIG
+_LT_LIBTOOL_CONFIG_VARS
+_LT_LIBTOOL_TAG_VARS
+# ### END LIBTOOL CONFIG
+
+_LT_EOF
+
+  case $host_os in
+  aix3*)
+    cat <<\_LT_EOF >> "$cfgfile"
+# AIX sometimes has problems with the GCC collect2 program.  For some
+# reason, if we set the COLLECT_NAMES environment variable, the problems
+# vanish in a puff of smoke.
+if test "X${COLLECT_NAMES+set}" != Xset; then
+  COLLECT_NAMES=
+  export COLLECT_NAMES
+fi
+_LT_EOF
+    ;;
+  esac
+
+  _LT_PROG_LTMAIN
+
+  # We use sed instead of cat because bash on DJGPP gets confused if
+  # if finds mixed CR/LF and LF-only lines.  Since sed operates in
+  # text mode, it properly converts lines to CR/LF.  This bash problem
+  # is reportedly fixed, but why not run on old versions too?
+  sed '$q' "$ltmain" >> "$cfgfile" \
+     || (rm -f "$cfgfile"; exit 1)
+
+  _LT_PROG_REPLACE_SHELLFNS
+
+   mv -f "$cfgfile" "$ofile" ||
+    (rm -f "$ofile" && cp "$cfgfile" "$ofile" && rm -f "$cfgfile")
+  chmod +x "$ofile"
+],
+[cat <<_LT_EOF >> "$ofile"
+
+dnl Unfortunately we have to use $1 here, since _LT_TAG is not expanded
+dnl in a comment (ie after a #).
+# ### BEGIN LIBTOOL TAG CONFIG: $1
+_LT_LIBTOOL_TAG_VARS(_LT_TAG)
+# ### END LIBTOOL TAG CONFIG: $1
+_LT_EOF
+])dnl /m4_if
+],
+[m4_if([$1], [], [
+    PACKAGE='$PACKAGE'
+    VERSION='$VERSION'
+    TIMESTAMP='$TIMESTAMP'
+    RM='$RM'
+    ofile='$ofile'], [])
+])dnl /_LT_CONFIG_SAVE_COMMANDS
+])# _LT_CONFIG
+
+
+# LT_SUPPORTED_TAG(TAG)
+# ---------------------
+# Trace this macro to discover what tags are supported by the libtool
+# --tag option, using:
+#    autoconf --trace 'LT_SUPPORTED_TAG:$1'
+AC_DEFUN([LT_SUPPORTED_TAG], [])
+
+
+# C support is built-in for now
+m4_define([_LT_LANG_C_enabled], [])
+m4_define([_LT_TAGS], [])
+
+
+# LT_LANG(LANG)
+# -------------
+# Enable libtool support for the given language if not already enabled.
+AC_DEFUN([LT_LANG],
+[AC_BEFORE([$0], [LT_OUTPUT])dnl
+m4_case([$1],
+  [C],			[_LT_LANG(C)],
+  [C++],		[_LT_LANG(CXX)],
+  [Go],			[_LT_LANG(GO)],
+  [Java],		[_LT_LANG(GCJ)],
+  [Fortran 77],		[_LT_LANG(F77)],
+  [Fortran],		[_LT_LANG(FC)],
+  [Windows Resource],	[_LT_LANG(RC)],
+  [m4_ifdef([_LT_LANG_]$1[_CONFIG],
+    [_LT_LANG($1)],
+    [m4_fatal([$0: unsupported language: "$1"])])])dnl
+])# LT_LANG
+
+
+# _LT_LANG(LANGNAME)
+# ------------------
+m4_defun([_LT_LANG],
+[m4_ifdef([_LT_LANG_]$1[_enabled], [],
+  [LT_SUPPORTED_TAG([$1])dnl
+  m4_append([_LT_TAGS], [$1 ])dnl
+  m4_define([_LT_LANG_]$1[_enabled], [])dnl
+  _LT_LANG_$1_CONFIG($1)])dnl
+])# _LT_LANG
+
+
+m4_ifndef([AC_PROG_GO], [
+# NOTE: This macro has been submitted for inclusion into   #
+#  GNU Autoconf as AC_PROG_GO.  When it is available in    #
+#  a released version of Autoconf we should remove this    #
+#  macro and use it instead.                               #
+m4_defun([AC_PROG_GO],
+[AC_LANG_PUSH(Go)dnl
+AC_ARG_VAR([GOC],     [Go compiler command])dnl
+AC_ARG_VAR([GOFLAGS], [Go compiler flags])dnl
+_AC_ARG_VAR_LDFLAGS()dnl
+AC_CHECK_TOOL(GOC, gccgo)
+if test -z "$GOC"; then
+  if test -n "$ac_tool_prefix"; then
+    AC_CHECK_PROG(GOC, [${ac_tool_prefix}gccgo], [${ac_tool_prefix}gccgo])
+  fi
+fi
+if test -z "$GOC"; then
+  AC_CHECK_PROG(GOC, gccgo, gccgo, false)
+fi
+])#m4_defun
+])#m4_ifndef
+
+
+# _LT_LANG_DEFAULT_CONFIG
+# -----------------------
+m4_defun([_LT_LANG_DEFAULT_CONFIG],
+[AC_PROVIDE_IFELSE([AC_PROG_CXX],
+  [LT_LANG(CXX)],
+  [m4_define([AC_PROG_CXX], defn([AC_PROG_CXX])[LT_LANG(CXX)])])
+
+AC_PROVIDE_IFELSE([AC_PROG_F77],
+  [LT_LANG(F77)],
+  [m4_define([AC_PROG_F77], defn([AC_PROG_F77])[LT_LANG(F77)])])
+
+AC_PROVIDE_IFELSE([AC_PROG_FC],
+  [LT_LANG(FC)],
+  [m4_define([AC_PROG_FC], defn([AC_PROG_FC])[LT_LANG(FC)])])
+
+dnl The call to [A][M_PROG_GCJ] is quoted like that to stop aclocal
+dnl pulling things in needlessly.
+AC_PROVIDE_IFELSE([AC_PROG_GCJ],
+  [LT_LANG(GCJ)],
+  [AC_PROVIDE_IFELSE([A][M_PROG_GCJ],
+    [LT_LANG(GCJ)],
+    [AC_PROVIDE_IFELSE([LT_PROG_GCJ],
+      [LT_LANG(GCJ)],
+      [m4_ifdef([AC_PROG_GCJ],
+	[m4_define([AC_PROG_GCJ], defn([AC_PROG_GCJ])[LT_LANG(GCJ)])])
+       m4_ifdef([A][M_PROG_GCJ],
+	[m4_define([A][M_PROG_GCJ], defn([A][M_PROG_GCJ])[LT_LANG(GCJ)])])
+       m4_ifdef([LT_PROG_GCJ],
+	[m4_define([LT_PROG_GCJ], defn([LT_PROG_GCJ])[LT_LANG(GCJ)])])])])])
+
+AC_PROVIDE_IFELSE([AC_PROG_GO],
+  [LT_LANG(GO)],
+  [m4_define([AC_PROG_GO], defn([AC_PROG_GO])[LT_LANG(GO)])])
+
+AC_PROVIDE_IFELSE([LT_PROG_RC],
+  [LT_LANG(RC)],
+  [m4_define([LT_PROG_RC], defn([LT_PROG_RC])[LT_LANG(RC)])])
+])# _LT_LANG_DEFAULT_CONFIG
+
+# Obsolete macros:
+AU_DEFUN([AC_LIBTOOL_CXX], [LT_LANG(C++)])
+AU_DEFUN([AC_LIBTOOL_F77], [LT_LANG(Fortran 77)])
+AU_DEFUN([AC_LIBTOOL_FC], [LT_LANG(Fortran)])
+AU_DEFUN([AC_LIBTOOL_GCJ], [LT_LANG(Java)])
+AU_DEFUN([AC_LIBTOOL_RC], [LT_LANG(Windows Resource)])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_LIBTOOL_CXX], [])
+dnl AC_DEFUN([AC_LIBTOOL_F77], [])
+dnl AC_DEFUN([AC_LIBTOOL_FC], [])
+dnl AC_DEFUN([AC_LIBTOOL_GCJ], [])
+dnl AC_DEFUN([AC_LIBTOOL_RC], [])
+
+
+# _LT_TAG_COMPILER
+# ----------------
+m4_defun([_LT_TAG_COMPILER],
+[AC_REQUIRE([AC_PROG_CC])dnl
+
+_LT_DECL([LTCC], [CC], [1], [A C compiler])dnl
+_LT_DECL([LTCFLAGS], [CFLAGS], [1], [LTCC compiler flags])dnl
+_LT_TAGDECL([CC], [compiler], [1], [A language specific compiler])dnl
+_LT_TAGDECL([with_gcc], [GCC], [0], [Is the compiler the GNU compiler?])dnl
+
+# If no C compiler was specified, use CC.
+LTCC=${LTCC-"$CC"}
+
+# If no C compiler flags were specified, use CFLAGS.
+LTCFLAGS=${LTCFLAGS-"$CFLAGS"}
+
+# Allow CC to be a program name with arguments.
+compiler=$CC
+])# _LT_TAG_COMPILER
+
+
+# _LT_COMPILER_BOILERPLATE
+# ------------------------
+# Check for compiler boilerplate output or warnings with
+# the simple compiler test code.
+m4_defun([_LT_COMPILER_BOILERPLATE],
+[m4_require([_LT_DECL_SED])dnl
+ac_outfile=conftest.$ac_objext
+echo "$lt_simple_compile_test_code" >conftest.$ac_ext
+eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_compiler_boilerplate=`cat conftest.err`
+$RM conftest*
+])# _LT_COMPILER_BOILERPLATE
+
+
+# _LT_LINKER_BOILERPLATE
+# ----------------------
+# Check for linker boilerplate output or warnings with
+# the simple link test code.
+m4_defun([_LT_LINKER_BOILERPLATE],
+[m4_require([_LT_DECL_SED])dnl
+ac_outfile=conftest.$ac_objext
+echo "$lt_simple_link_test_code" >conftest.$ac_ext
+eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_linker_boilerplate=`cat conftest.err`
+$RM -r conftest*
+])# _LT_LINKER_BOILERPLATE
+
+# _LT_REQUIRED_DARWIN_CHECKS
+# -------------------------
+m4_defun_once([_LT_REQUIRED_DARWIN_CHECKS],[
+  case $host_os in
+    rhapsody* | darwin*)
+    AC_CHECK_TOOL([DSYMUTIL], [dsymutil], [:])
+    AC_CHECK_TOOL([NMEDIT], [nmedit], [:])
+    AC_CHECK_TOOL([LIPO], [lipo], [:])
+    AC_CHECK_TOOL([OTOOL], [otool], [:])
+    AC_CHECK_TOOL([OTOOL64], [otool64], [:])
+    _LT_DECL([], [DSYMUTIL], [1],
+      [Tool to manipulate archived DWARF debug symbol files on Mac OS X])
+    _LT_DECL([], [NMEDIT], [1],
+      [Tool to change global to local symbols on Mac OS X])
+    _LT_DECL([], [LIPO], [1],
+      [Tool to manipulate fat objects and archives on Mac OS X])
+    _LT_DECL([], [OTOOL], [1],
+      [ldd/readelf like tool for Mach-O binaries on Mac OS X])
+    _LT_DECL([], [OTOOL64], [1],
+      [ldd/readelf like tool for 64 bit Mach-O binaries on Mac OS X 10.4])
+
+    AC_CACHE_CHECK([for -single_module linker flag],[lt_cv_apple_cc_single_mod],
+      [lt_cv_apple_cc_single_mod=no
+      if test -z "${LT_MULTI_MODULE}"; then
+	# By default we will add the -single_module flag. You can override
+	# by either setting the environment variable LT_MULTI_MODULE
+	# non-empty at configure time, or by adding -multi_module to the
+	# link flags.
+	rm -rf libconftest.dylib*
+	echo "int foo(void){return 1;}" > conftest.c
+	echo "$LTCC $LTCFLAGS $LDFLAGS -o libconftest.dylib \
+-dynamiclib -Wl,-single_module conftest.c" >&AS_MESSAGE_LOG_FD
+	$LTCC $LTCFLAGS $LDFLAGS -o libconftest.dylib \
+	  -dynamiclib -Wl,-single_module conftest.c 2>conftest.err
+        _lt_result=$?
+	# If there is a non-empty error log, and "single_module"
+	# appears in it, assume the flag caused a linker warning
+        if test -s conftest.err && $GREP single_module conftest.err; then
+	  cat conftest.err >&AS_MESSAGE_LOG_FD
+	# Otherwise, if the output was created with a 0 exit code from
+	# the compiler, it worked.
+	elif test -f libconftest.dylib && test $_lt_result -eq 0; then
+	  lt_cv_apple_cc_single_mod=yes
+	else
+	  cat conftest.err >&AS_MESSAGE_LOG_FD
+	fi
+	rm -rf libconftest.dylib*
+	rm -f conftest.*
+      fi])
+
+    AC_CACHE_CHECK([for -exported_symbols_list linker flag],
+      [lt_cv_ld_exported_symbols_list],
+      [lt_cv_ld_exported_symbols_list=no
+      save_LDFLAGS=$LDFLAGS
+      echo "_main" > conftest.sym
+      LDFLAGS="$LDFLAGS -Wl,-exported_symbols_list,conftest.sym"
+      AC_LINK_IFELSE([AC_LANG_PROGRAM([],[])],
+	[lt_cv_ld_exported_symbols_list=yes],
+	[lt_cv_ld_exported_symbols_list=no])
+	LDFLAGS="$save_LDFLAGS"
+    ])
+
+    AC_CACHE_CHECK([for -force_load linker flag],[lt_cv_ld_force_load],
+      [lt_cv_ld_force_load=no
+      cat > conftest.c << _LT_EOF
+int forced_loaded() { return 2;}
+_LT_EOF
+      echo "$LTCC $LTCFLAGS -c -o conftest.o conftest.c" >&AS_MESSAGE_LOG_FD
+      $LTCC $LTCFLAGS -c -o conftest.o conftest.c 2>&AS_MESSAGE_LOG_FD
+      echo "$AR cru libconftest.a conftest.o" >&AS_MESSAGE_LOG_FD
+      $AR cru libconftest.a conftest.o 2>&AS_MESSAGE_LOG_FD
+      echo "$RANLIB libconftest.a" >&AS_MESSAGE_LOG_FD
+      $RANLIB libconftest.a 2>&AS_MESSAGE_LOG_FD
+      cat > conftest.c << _LT_EOF
+int main() { return 0;}
+_LT_EOF
+      echo "$LTCC $LTCFLAGS $LDFLAGS -o conftest conftest.c -Wl,-force_load,./libconftest.a" >&AS_MESSAGE_LOG_FD
+      $LTCC $LTCFLAGS $LDFLAGS -o conftest conftest.c -Wl,-force_load,./libconftest.a 2>conftest.err
+      _lt_result=$?
+      if test -s conftest.err && $GREP force_load conftest.err; then
+	cat conftest.err >&AS_MESSAGE_LOG_FD
+      elif test -f conftest && test $_lt_result -eq 0 && $GREP forced_load conftest >/dev/null 2>&1 ; then
+	lt_cv_ld_force_load=yes
+      else
+	cat conftest.err >&AS_MESSAGE_LOG_FD
+      fi
+        rm -f conftest.err libconftest.a conftest conftest.c
+        rm -rf conftest.dSYM
+    ])
+    case $host_os in
+    rhapsody* | darwin1.[[012]])
+      _lt_dar_allow_undefined='${wl}-undefined ${wl}suppress' ;;
+    darwin1.*)
+      _lt_dar_allow_undefined='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' ;;
+    darwin*) # darwin 5.x on
+      # if running on 10.5 or later, the deployment target defaults
+      # to the OS version, if on x86, and 10.4, the deployment
+      # target defaults to 10.4. Don't you love it?
+      case ${MACOSX_DEPLOYMENT_TARGET-10.0},$host in
+	10.0,*86*-darwin8*|10.0,*-darwin[[91]]*)
+	  _lt_dar_allow_undefined='${wl}-undefined ${wl}dynamic_lookup' ;;
+	10.[[012]]*)
+	  _lt_dar_allow_undefined='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' ;;
+	10.*)
+	  _lt_dar_allow_undefined='${wl}-undefined ${wl}dynamic_lookup' ;;
+      esac
+    ;;
+  esac
+    if test "$lt_cv_apple_cc_single_mod" = "yes"; then
+      _lt_dar_single_mod='$single_module'
+    fi
+    if test "$lt_cv_ld_exported_symbols_list" = "yes"; then
+      _lt_dar_export_syms=' ${wl}-exported_symbols_list,$output_objdir/${libname}-symbols.expsym'
+    else
+      _lt_dar_export_syms='~$NMEDIT -s $output_objdir/${libname}-symbols.expsym ${lib}'
+    fi
+    if test "$DSYMUTIL" != ":" && test "$lt_cv_ld_force_load" = "no"; then
+      _lt_dsymutil='~$DSYMUTIL $lib || :'
+    else
+      _lt_dsymutil=
+    fi
+    ;;
+  esac
+])
+
+
+# _LT_DARWIN_LINKER_FEATURES([TAG])
+# ---------------------------------
+# Checks for linker and compiler features on darwin
+m4_defun([_LT_DARWIN_LINKER_FEATURES],
+[
+  m4_require([_LT_REQUIRED_DARWIN_CHECKS])
+  _LT_TAGVAR(archive_cmds_need_lc, $1)=no
+  _LT_TAGVAR(hardcode_direct, $1)=no
+  _LT_TAGVAR(hardcode_automatic, $1)=yes
+  _LT_TAGVAR(hardcode_shlibpath_var, $1)=unsupported
+  if test "$lt_cv_ld_force_load" = "yes"; then
+    _LT_TAGVAR(whole_archive_flag_spec, $1)='`for conv in $convenience\"\"; do test  -n \"$conv\" && new_convenience=\"$new_convenience ${wl}-force_load,$conv\"; done; func_echo_all \"$new_convenience\"`'
+    m4_case([$1], [F77], [_LT_TAGVAR(compiler_needs_object, $1)=yes],
+                  [FC],  [_LT_TAGVAR(compiler_needs_object, $1)=yes])
+  else
+    _LT_TAGVAR(whole_archive_flag_spec, $1)=''
+  fi
+  _LT_TAGVAR(link_all_deplibs, $1)=yes
+  _LT_TAGVAR(allow_undefined_flag, $1)="$_lt_dar_allow_undefined"
+  case $cc_basename in
+     ifort*) _lt_dar_can_shared=yes ;;
+     *) _lt_dar_can_shared=$GCC ;;
+  esac
+  if test "$_lt_dar_can_shared" = "yes"; then
+    output_verbose_link_cmd=func_echo_all
+    _LT_TAGVAR(archive_cmds, $1)="\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring $_lt_dar_single_mod${_lt_dsymutil}"
+    _LT_TAGVAR(module_cmds, $1)="\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags${_lt_dsymutil}"
+    _LT_TAGVAR(archive_expsym_cmds, $1)="sed 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring ${_lt_dar_single_mod}${_lt_dar_export_syms}${_lt_dsymutil}"
+    _LT_TAGVAR(module_expsym_cmds, $1)="sed -e 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags${_lt_dar_export_syms}${_lt_dsymutil}"
+    m4_if([$1], [CXX],
+[   if test "$lt_cv_apple_cc_single_mod" != "yes"; then
+      _LT_TAGVAR(archive_cmds, $1)="\$CC -r -keep_private_externs -nostdlib -o \${lib}-master.o \$libobjs~\$CC -dynamiclib \$allow_undefined_flag -o \$lib \${lib}-master.o \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring${_lt_dsymutil}"
+      _LT_TAGVAR(archive_expsym_cmds, $1)="sed 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC -r -keep_private_externs -nostdlib -o \${lib}-master.o \$libobjs~\$CC -dynamiclib \$allow_undefined_flag -o \$lib \${lib}-master.o \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring${_lt_dar_export_syms}${_lt_dsymutil}"
+    fi
+],[])
+  else
+  _LT_TAGVAR(ld_shlibs, $1)=no
+  fi
+])
+
+# _LT_SYS_MODULE_PATH_AIX([TAGNAME])
+# ----------------------------------
+# Links a minimal program and checks the executable
+# for the system default hardcoded library path. In most cases,
+# this is /usr/lib:/lib, but when the MPI compilers are used
+# the location of the communication and MPI libs are included too.
+# If we don't find anything, use the default library path according
+# to the aix ld manual.
+# Store the results from the different compilers for each TAGNAME.
+# Allow to override them for all tags through lt_cv_aix_libpath.
+m4_defun([_LT_SYS_MODULE_PATH_AIX],
+[m4_require([_LT_DECL_SED])dnl
+if test "${lt_cv_aix_libpath+set}" = set; then
+  aix_libpath=$lt_cv_aix_libpath
+else
+  AC_CACHE_VAL([_LT_TAGVAR([lt_cv_aix_libpath_], [$1])],
+  [AC_LINK_IFELSE([AC_LANG_PROGRAM],[
+  lt_aix_libpath_sed='[
+      /Import File Strings/,/^$/ {
+	  /^0/ {
+	      s/^0  *\([^ ]*\) *$/\1/
+	      p
+	  }
+      }]'
+  _LT_TAGVAR([lt_cv_aix_libpath_], [$1])=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+  # Check for a 64-bit object if we didn't find anything.
+  if test -z "$_LT_TAGVAR([lt_cv_aix_libpath_], [$1])"; then
+    _LT_TAGVAR([lt_cv_aix_libpath_], [$1])=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+  fi],[])
+  if test -z "$_LT_TAGVAR([lt_cv_aix_libpath_], [$1])"; then
+    _LT_TAGVAR([lt_cv_aix_libpath_], [$1])="/usr/lib:/lib"
+  fi
+  ])
+  aix_libpath=$_LT_TAGVAR([lt_cv_aix_libpath_], [$1])
+fi
+])# _LT_SYS_MODULE_PATH_AIX
+
+
+# _LT_SHELL_INIT(ARG)
+# -------------------
+m4_define([_LT_SHELL_INIT],
+[m4_divert_text([M4SH-INIT], [$1
+])])# _LT_SHELL_INIT
+
+
+
+# _LT_PROG_ECHO_BACKSLASH
+# -----------------------
+# Find how we can fake an echo command that does not interpret backslash.
+# In particular, with Autoconf 2.60 or later we add some code to the start
+# of the generated configure script which will find a shell with a builtin
+# printf (which we can use as an echo command).
+m4_defun([_LT_PROG_ECHO_BACKSLASH],
+[ECHO='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO
+ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO$ECHO
+
+AC_MSG_CHECKING([how to print strings])
+# Test print first, because it will be a builtin if present.
+if test "X`( print -r -- -n ) 2>/dev/null`" = X-n && \
+   test "X`print -r -- $ECHO 2>/dev/null`" = "X$ECHO"; then
+  ECHO='print -r --'
+elif test "X`printf %s $ECHO 2>/dev/null`" = "X$ECHO"; then
+  ECHO='printf %s\n'
+else
+  # Use this function as a fallback that always works.
+  func_fallback_echo ()
+  {
+    eval 'cat <<_LTECHO_EOF
+$[]1
+_LTECHO_EOF'
+  }
+  ECHO='func_fallback_echo'
+fi
+
+# func_echo_all arg...
+# Invoke $ECHO with all args, space-separated.
+func_echo_all ()
+{
+    $ECHO "$*" 
+}
+
+case "$ECHO" in
+  printf*) AC_MSG_RESULT([printf]) ;;
+  print*) AC_MSG_RESULT([print -r]) ;;
+  *) AC_MSG_RESULT([cat]) ;;
+esac
+
+m4_ifdef([_AS_DETECT_SUGGESTED],
+[_AS_DETECT_SUGGESTED([
+  test -n "${ZSH_VERSION+set}${BASH_VERSION+set}" || (
+    ECHO='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+    ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO
+    ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO$ECHO
+    PATH=/empty FPATH=/empty; export PATH FPATH
+    test "X`printf %s $ECHO`" = "X$ECHO" \
+      || test "X`print -r -- $ECHO`" = "X$ECHO" )])])
+
+_LT_DECL([], [SHELL], [1], [Shell to use when invoking shell scripts])
+_LT_DECL([], [ECHO], [1], [An echo program that protects backslashes])
+])# _LT_PROG_ECHO_BACKSLASH
+
+
+# _LT_WITH_SYSROOT
+# ----------------
+AC_DEFUN([_LT_WITH_SYSROOT],
+[AC_MSG_CHECKING([for sysroot])
+AC_ARG_WITH([sysroot],
+[  --with-sysroot[=DIR] Search for dependent libraries within DIR
+                        (or the compiler's sysroot if not specified).],
+[], [with_sysroot=no])
+
+dnl lt_sysroot will always be passed unquoted.  We quote it here
+dnl in case the user passed a directory name.
+lt_sysroot=
+case ${with_sysroot} in #(
+ yes)
+   if test "$GCC" = yes; then
+     lt_sysroot=`$CC --print-sysroot 2>/dev/null`
+   fi
+   ;; #(
+ /*)
+   lt_sysroot=`echo "$with_sysroot" | sed -e "$sed_quote_subst"`
+   ;; #(
+ no|'')
+   ;; #(
+ *)
+   AC_MSG_RESULT([${with_sysroot}])
+   AC_MSG_ERROR([The sysroot must be an absolute path.])
+   ;;
+esac
+
+ AC_MSG_RESULT([${lt_sysroot:-no}])
+_LT_DECL([], [lt_sysroot], [0], [The root where to search for ]dnl
+[dependent libraries, and in which our libraries should be installed.])])
+
+# _LT_ENABLE_LOCK
+# ---------------
+m4_defun([_LT_ENABLE_LOCK],
+[AC_ARG_ENABLE([libtool-lock],
+  [AS_HELP_STRING([--disable-libtool-lock],
+    [avoid locking (might break parallel builds)])])
+test "x$enable_libtool_lock" != xno && enable_libtool_lock=yes
+
+# Some flags need to be propagated to the compiler or linker for good
+# libtool support.
+case $host in
+ia64-*-hpux*)
+  # Find out which ABI we are using.
+  echo 'int i;' > conftest.$ac_ext
+  if AC_TRY_EVAL(ac_compile); then
+    case `/usr/bin/file conftest.$ac_objext` in
+      *ELF-32*)
+	HPUX_IA64_MODE="32"
+	;;
+      *ELF-64*)
+	HPUX_IA64_MODE="64"
+	;;
+    esac
+  fi
+  rm -rf conftest*
+  ;;
+*-*-irix6*)
+  # Find out which ABI we are using.
+  echo '[#]line '$LINENO' "configure"' > conftest.$ac_ext
+  if AC_TRY_EVAL(ac_compile); then
+    if test "$lt_cv_prog_gnu_ld" = yes; then
+      case `/usr/bin/file conftest.$ac_objext` in
+	*32-bit*)
+	  LD="${LD-ld} -melf32bsmip"
+	  ;;
+	*N32*)
+	  LD="${LD-ld} -melf32bmipn32"
+	  ;;
+	*64-bit*)
+	  LD="${LD-ld} -melf64bmip"
+	;;
+      esac
+    else
+      case `/usr/bin/file conftest.$ac_objext` in
+	*32-bit*)
+	  LD="${LD-ld} -32"
+	  ;;
+	*N32*)
+	  LD="${LD-ld} -n32"
+	  ;;
+	*64-bit*)
+	  LD="${LD-ld} -64"
+	  ;;
+      esac
+    fi
+  fi
+  rm -rf conftest*
+  ;;
+
+x86_64-*kfreebsd*-gnu|x86_64-*linux*|powerpc*-*linux*| \
+s390*-*linux*|s390*-*tpf*|sparc*-*linux*)
+  # Find out which ABI we are using.
+  echo 'int i;' > conftest.$ac_ext
+  if AC_TRY_EVAL(ac_compile); then
+    case `/usr/bin/file conftest.o` in
+      *32-bit*)
+	case $host in
+	  x86_64-*kfreebsd*-gnu)
+	    LD="${LD-ld} -m elf_i386_fbsd"
+	    ;;
+	  x86_64-*linux*)
+	    case `/usr/bin/file conftest.o` in
+	      *x86-64*)
+		LD="${LD-ld} -m elf32_x86_64"
+		;;
+	      *)
+		LD="${LD-ld} -m elf_i386"
+		;;
+	    esac
+	    ;;
+	  powerpc64le-*)
+	    LD="${LD-ld} -m elf32lppclinux"
+	    ;;
+	  powerpc64-*)
+	    LD="${LD-ld} -m elf32ppclinux"
+	    ;;
+	  s390x-*linux*)
+	    LD="${LD-ld} -m elf_s390"
+	    ;;
+	  sparc64-*linux*)
+	    LD="${LD-ld} -m elf32_sparc"
+	    ;;
+	esac
+	;;
+      *64-bit*)
+	case $host in
+	  x86_64-*kfreebsd*-gnu)
+	    LD="${LD-ld} -m elf_x86_64_fbsd"
+	    ;;
+	  x86_64-*linux*)
+	    LD="${LD-ld} -m elf_x86_64"
+	    ;;
+	  powerpcle-*)
+	    LD="${LD-ld} -m elf64lppc"
+	    ;;
+	  powerpc-*)
+	    LD="${LD-ld} -m elf64ppc"
+	    ;;
+	  s390*-*linux*|s390*-*tpf*)
+	    LD="${LD-ld} -m elf64_s390"
+	    ;;
+	  sparc*-*linux*)
+	    LD="${LD-ld} -m elf64_sparc"
+	    ;;
+	esac
+	;;
+    esac
+  fi
+  rm -rf conftest*
+  ;;
+
+*-*-sco3.2v5*)
+  # On SCO OpenServer 5, we need -belf to get full-featured binaries.
+  SAVE_CFLAGS="$CFLAGS"
+  CFLAGS="$CFLAGS -belf"
+  AC_CACHE_CHECK([whether the C compiler needs -belf], lt_cv_cc_needs_belf,
+    [AC_LANG_PUSH(C)
+     AC_LINK_IFELSE([AC_LANG_PROGRAM([[]],[[]])],[lt_cv_cc_needs_belf=yes],[lt_cv_cc_needs_belf=no])
+     AC_LANG_POP])
+  if test x"$lt_cv_cc_needs_belf" != x"yes"; then
+    # this is probably gcc 2.8.0, egcs 1.0 or newer; no need for -belf
+    CFLAGS="$SAVE_CFLAGS"
+  fi
+  ;;
+*-*solaris*)
+  # Find out which ABI we are using.
+  echo 'int i;' > conftest.$ac_ext
+  if AC_TRY_EVAL(ac_compile); then
+    case `/usr/bin/file conftest.o` in
+    *64-bit*)
+      case $lt_cv_prog_gnu_ld in
+      yes*)
+        case $host in
+        i?86-*-solaris*)
+          LD="${LD-ld} -m elf_x86_64"
+          ;;
+        sparc*-*-solaris*)
+          LD="${LD-ld} -m elf64_sparc"
+          ;;
+        esac
+        # GNU ld 2.21 introduced _sol2 emulations.  Use them if available.
+        if ${LD-ld} -V | grep _sol2 >/dev/null 2>&1; then
+          LD="${LD-ld}_sol2"
+        fi
+        ;;
+      *)
+	if ${LD-ld} -64 -r -o conftest2.o conftest.o >/dev/null 2>&1; then
+	  LD="${LD-ld} -64"
+	fi
+	;;
+      esac
+      ;;
+    esac
+  fi
+  rm -rf conftest*
+  ;;
+esac
+
+need_locks="$enable_libtool_lock"
+])# _LT_ENABLE_LOCK
+
+
+# _LT_PROG_AR
+# -----------
+m4_defun([_LT_PROG_AR],
+[AC_CHECK_TOOLS(AR, [ar], false)
+: ${AR=ar}
+: ${AR_FLAGS=cru}
+_LT_DECL([], [AR], [1], [The archiver])
+_LT_DECL([], [AR_FLAGS], [1], [Flags to create an archive])
+
+AC_CACHE_CHECK([for archiver @FILE support], [lt_cv_ar_at_file],
+  [lt_cv_ar_at_file=no
+   AC_COMPILE_IFELSE([AC_LANG_PROGRAM],
+     [echo conftest.$ac_objext > conftest.lst
+      lt_ar_try='$AR $AR_FLAGS libconftest.a @conftest.lst >&AS_MESSAGE_LOG_FD'
+      AC_TRY_EVAL([lt_ar_try])
+      if test "$ac_status" -eq 0; then
+	# Ensure the archiver fails upon bogus file names.
+	rm -f conftest.$ac_objext libconftest.a
+	AC_TRY_EVAL([lt_ar_try])
+	if test "$ac_status" -ne 0; then
+          lt_cv_ar_at_file=@
+        fi
+      fi
+      rm -f conftest.* libconftest.a
+     ])
+  ])
+
+if test "x$lt_cv_ar_at_file" = xno; then
+  archiver_list_spec=
+else
+  archiver_list_spec=$lt_cv_ar_at_file
+fi
+_LT_DECL([], [archiver_list_spec], [1],
+  [How to feed a file listing to the archiver])
+])# _LT_PROG_AR
+
+
+# _LT_CMD_OLD_ARCHIVE
+# -------------------
+m4_defun([_LT_CMD_OLD_ARCHIVE],
+[_LT_PROG_AR
+
+AC_CHECK_TOOL(STRIP, strip, :)
+test -z "$STRIP" && STRIP=:
+_LT_DECL([], [STRIP], [1], [A symbol stripping program])
+
+AC_CHECK_TOOL(RANLIB, ranlib, :)
+test -z "$RANLIB" && RANLIB=:
+_LT_DECL([], [RANLIB], [1],
+    [Commands used to install an old-style archive])
+
+# Determine commands to create old-style static archives.
+old_archive_cmds='$AR $AR_FLAGS $oldlib$oldobjs'
+old_postinstall_cmds='chmod 644 $oldlib'
+old_postuninstall_cmds=
+
+if test -n "$RANLIB"; then
+  case $host_os in
+  openbsd*)
+    old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB -t \$tool_oldlib"
+    ;;
+  *)
+    old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB \$tool_oldlib"
+    ;;
+  esac
+  old_archive_cmds="$old_archive_cmds~\$RANLIB \$tool_oldlib"
+fi
+
+case $host_os in
+  darwin*)
+    lock_old_archive_extraction=yes ;;
+  *)
+    lock_old_archive_extraction=no ;;
+esac
+_LT_DECL([], [old_postinstall_cmds], [2])
+_LT_DECL([], [old_postuninstall_cmds], [2])
+_LT_TAGDECL([], [old_archive_cmds], [2],
+    [Commands used to build an old-style archive])
+_LT_DECL([], [lock_old_archive_extraction], [0],
+    [Whether to use a lock for old archive extraction])
+])# _LT_CMD_OLD_ARCHIVE
+
+
+# _LT_COMPILER_OPTION(MESSAGE, VARIABLE-NAME, FLAGS,
+#		[OUTPUT-FILE], [ACTION-SUCCESS], [ACTION-FAILURE])
+# ----------------------------------------------------------------
+# Check whether the given compiler option works
+AC_DEFUN([_LT_COMPILER_OPTION],
+[m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+m4_require([_LT_DECL_SED])dnl
+AC_CACHE_CHECK([$1], [$2],
+  [$2=no
+   m4_if([$4], , [ac_outfile=conftest.$ac_objext], [ac_outfile=$4])
+   echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+   lt_compiler_flag="$3"
+   # Insert the option either (1) after the last *FLAGS variable, or
+   # (2) before a word containing "conftest.", or (3) at the end.
+   # Note that $ac_compile itself does not contain backslashes and begins
+   # with a dollar sign (not a hyphen), so the echo should work correctly.
+   # The option is referenced via a variable to avoid confusing sed.
+   lt_compile=`echo "$ac_compile" | $SED \
+   -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+   -e 's: [[^ ]]*conftest\.: $lt_compiler_flag&:; t' \
+   -e 's:$: $lt_compiler_flag:'`
+   (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&AS_MESSAGE_LOG_FD)
+   (eval "$lt_compile" 2>conftest.err)
+   ac_status=$?
+   cat conftest.err >&AS_MESSAGE_LOG_FD
+   echo "$as_me:$LINENO: \$? = $ac_status" >&AS_MESSAGE_LOG_FD
+   if (exit $ac_status) && test -s "$ac_outfile"; then
+     # The compiler can only warn and ignore the option if not recognized
+     # So say no if there are warnings other than the usual output.
+     $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' >conftest.exp
+     $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+     if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then
+       $2=yes
+     fi
+   fi
+   $RM conftest*
+])
+
+if test x"[$]$2" = xyes; then
+    m4_if([$5], , :, [$5])
+else
+    m4_if([$6], , :, [$6])
+fi
+])# _LT_COMPILER_OPTION
+
+# Old name:
+AU_ALIAS([AC_LIBTOOL_COMPILER_OPTION], [_LT_COMPILER_OPTION])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_LIBTOOL_COMPILER_OPTION], [])
+
+
+# _LT_LINKER_OPTION(MESSAGE, VARIABLE-NAME, FLAGS,
+#                  [ACTION-SUCCESS], [ACTION-FAILURE])
+# ----------------------------------------------------
+# Check whether the given linker option works
+AC_DEFUN([_LT_LINKER_OPTION],
+[m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+m4_require([_LT_DECL_SED])dnl
+AC_CACHE_CHECK([$1], [$2],
+  [$2=no
+   save_LDFLAGS="$LDFLAGS"
+   LDFLAGS="$LDFLAGS $3"
+   echo "$lt_simple_link_test_code" > conftest.$ac_ext
+   if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then
+     # The linker can only warn and ignore the option if not recognized
+     # So say no if there are warnings
+     if test -s conftest.err; then
+       # Append any errors to the config.log.
+       cat conftest.err 1>&AS_MESSAGE_LOG_FD
+       $ECHO "$_lt_linker_boilerplate" | $SED '/^$/d' > conftest.exp
+       $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+       if diff conftest.exp conftest.er2 >/dev/null; then
+         $2=yes
+       fi
+     else
+       $2=yes
+     fi
+   fi
+   $RM -r conftest*
+   LDFLAGS="$save_LDFLAGS"
+])
+
+if test x"[$]$2" = xyes; then
+    m4_if([$4], , :, [$4])
+else
+    m4_if([$5], , :, [$5])
+fi
+])# _LT_LINKER_OPTION
+
+# Old name:
+AU_ALIAS([AC_LIBTOOL_LINKER_OPTION], [_LT_LINKER_OPTION])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_LIBTOOL_LINKER_OPTION], [])
+
+
+# LT_CMD_MAX_LEN
+#---------------
+AC_DEFUN([LT_CMD_MAX_LEN],
+[AC_REQUIRE([AC_CANONICAL_HOST])dnl
+# find the maximum length of command line arguments
+AC_MSG_CHECKING([the maximum length of command line arguments])
+AC_CACHE_VAL([lt_cv_sys_max_cmd_len], [dnl
+  i=0
+  teststring="ABCD"
+
+  case $build_os in
+  msdosdjgpp*)
+    # On DJGPP, this test can blow up pretty badly due to problems in libc
+    # (any single argument exceeding 2000 bytes causes a buffer overrun
+    # during glob expansion).  Even if it were fixed, the result of this
+    # check would be larger than it should be.
+    lt_cv_sys_max_cmd_len=12288;    # 12K is about right
+    ;;
+
+  gnu*)
+    # Under GNU Hurd, this test is not required because there is
+    # no limit to the length of command line arguments.
+    # Libtool will interpret -1 as no limit whatsoever
+    lt_cv_sys_max_cmd_len=-1;
+    ;;
+
+  cygwin* | mingw* | cegcc*)
+    # On Win9x/ME, this test blows up -- it succeeds, but takes
+    # about 5 minutes as the teststring grows exponentially.
+    # Worse, since 9x/ME are not pre-emptively multitasking,
+    # you end up with a "frozen" computer, even though with patience
+    # the test eventually succeeds (with a max line length of 256k).
+    # Instead, let's just punt: use the minimum linelength reported by
+    # all of the supported platforms: 8192 (on NT/2K/XP).
+    lt_cv_sys_max_cmd_len=8192;
+    ;;
+
+  mint*)
+    # On MiNT this can take a long time and run out of memory.
+    lt_cv_sys_max_cmd_len=8192;
+    ;;
+
+  amigaos*)
+    # On AmigaOS with pdksh, this test takes hours, literally.
+    # So we just punt and use a minimum line length of 8192.
+    lt_cv_sys_max_cmd_len=8192;
+    ;;
+
+  netbsd* | freebsd* | openbsd* | darwin* | dragonfly*)
+    # This has been around since 386BSD, at least.  Likely further.
+    if test -x /sbin/sysctl; then
+      lt_cv_sys_max_cmd_len=`/sbin/sysctl -n kern.argmax`
+    elif test -x /usr/sbin/sysctl; then
+      lt_cv_sys_max_cmd_len=`/usr/sbin/sysctl -n kern.argmax`
+    else
+      lt_cv_sys_max_cmd_len=65536	# usable default for all BSDs
+    fi
+    # And add a safety zone
+    lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4`
+    lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3`
+    ;;
+
+  interix*)
+    # We know the value 262144 and hardcode it with a safety zone (like BSD)
+    lt_cv_sys_max_cmd_len=196608
+    ;;
+
+  os2*)
+    # The test takes a long time on OS/2.
+    lt_cv_sys_max_cmd_len=8192
+    ;;
+
+  osf*)
+    # Dr. Hans Ekkehard Plesser reports seeing a kernel panic running configure
+    # due to this test when exec_disable_arg_limit is 1 on Tru64. It is not
+    # nice to cause kernel panics so lets avoid the loop below.
+    # First set a reasonable default.
+    lt_cv_sys_max_cmd_len=16384
+    #
+    if test -x /sbin/sysconfig; then
+      case `/sbin/sysconfig -q proc exec_disable_arg_limit` in
+        *1*) lt_cv_sys_max_cmd_len=-1 ;;
+      esac
+    fi
+    ;;
+  sco3.2v5*)
+    lt_cv_sys_max_cmd_len=102400
+    ;;
+  sysv5* | sco5v6* | sysv4.2uw2*)
+    kargmax=`grep ARG_MAX /etc/conf/cf.d/stune 2>/dev/null`
+    if test -n "$kargmax"; then
+      lt_cv_sys_max_cmd_len=`echo $kargmax | sed 's/.*[[	 ]]//'`
+    else
+      lt_cv_sys_max_cmd_len=32768
+    fi
+    ;;
+  *)
+    lt_cv_sys_max_cmd_len=`(getconf ARG_MAX) 2> /dev/null`
+    if test -n "$lt_cv_sys_max_cmd_len" && \
+	test undefined != "$lt_cv_sys_max_cmd_len"; then
+      lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4`
+      lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3`
+    else
+      # Make teststring a little bigger before we do anything with it.
+      # a 1K string should be a reasonable start.
+      for i in 1 2 3 4 5 6 7 8 ; do
+        teststring=$teststring$teststring
+      done
+      SHELL=${SHELL-${CONFIG_SHELL-/bin/sh}}
+      # If test is not a shell built-in, we'll probably end up computing a
+      # maximum length that is only half of the actual maximum length, but
+      # we can't tell.
+      while { test "X"`env echo "$teststring$teststring" 2>/dev/null` \
+	         = "X$teststring$teststring"; } >/dev/null 2>&1 &&
+	      test $i != 17 # 1/2 MB should be enough
+      do
+        i=`expr $i + 1`
+        teststring=$teststring$teststring
+      done
+      # Only check the string length outside the loop.
+      lt_cv_sys_max_cmd_len=`expr "X$teststring" : ".*" 2>&1`
+      teststring=
+      # Add a significant safety factor because C++ compilers can tack on
+      # massive amounts of additional arguments before passing them to the
+      # linker.  It appears as though 1/2 is a usable value.
+      lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 2`
+    fi
+    ;;
+  esac
+])
+if test -n $lt_cv_sys_max_cmd_len ; then
+  AC_MSG_RESULT($lt_cv_sys_max_cmd_len)
+else
+  AC_MSG_RESULT(none)
+fi
+max_cmd_len=$lt_cv_sys_max_cmd_len
+_LT_DECL([], [max_cmd_len], [0],
+    [What is the maximum length of a command?])
+])# LT_CMD_MAX_LEN
+
+# Old name:
+AU_ALIAS([AC_LIBTOOL_SYS_MAX_CMD_LEN], [LT_CMD_MAX_LEN])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_LIBTOOL_SYS_MAX_CMD_LEN], [])
+
+
+# _LT_HEADER_DLFCN
+# ----------------
+m4_defun([_LT_HEADER_DLFCN],
+[AC_CHECK_HEADERS([dlfcn.h], [], [], [AC_INCLUDES_DEFAULT])dnl
+])# _LT_HEADER_DLFCN
+
+
+# _LT_TRY_DLOPEN_SELF (ACTION-IF-TRUE, ACTION-IF-TRUE-W-USCORE,
+#                      ACTION-IF-FALSE, ACTION-IF-CROSS-COMPILING)
+# ----------------------------------------------------------------
+m4_defun([_LT_TRY_DLOPEN_SELF],
+[m4_require([_LT_HEADER_DLFCN])dnl
+if test "$cross_compiling" = yes; then :
+  [$4]
+else
+  lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2
+  lt_status=$lt_dlunknown
+  cat > conftest.$ac_ext <<_LT_EOF
+[#line $LINENO "configure"
+#include "confdefs.h"
+
+#if HAVE_DLFCN_H
+#include <dlfcn.h>
+#endif
+
+#include <stdio.h>
+
+#ifdef RTLD_GLOBAL
+#  define LT_DLGLOBAL		RTLD_GLOBAL
+#else
+#  ifdef DL_GLOBAL
+#    define LT_DLGLOBAL		DL_GLOBAL
+#  else
+#    define LT_DLGLOBAL		0
+#  endif
+#endif
+
+/* We may have to define LT_DLLAZY_OR_NOW in the command line if we
+   find out it does not work in some platform. */
+#ifndef LT_DLLAZY_OR_NOW
+#  ifdef RTLD_LAZY
+#    define LT_DLLAZY_OR_NOW		RTLD_LAZY
+#  else
+#    ifdef DL_LAZY
+#      define LT_DLLAZY_OR_NOW		DL_LAZY
+#    else
+#      ifdef RTLD_NOW
+#        define LT_DLLAZY_OR_NOW	RTLD_NOW
+#      else
+#        ifdef DL_NOW
+#          define LT_DLLAZY_OR_NOW	DL_NOW
+#        else
+#          define LT_DLLAZY_OR_NOW	0
+#        endif
+#      endif
+#    endif
+#  endif
+#endif
+
+/* When -fvisbility=hidden is used, assume the code has been annotated
+   correspondingly for the symbols needed.  */
+#if defined(__GNUC__) && (((__GNUC__ == 3) && (__GNUC_MINOR__ >= 3)) || (__GNUC__ > 3))
+int fnord () __attribute__((visibility("default")));
+#endif
+
+int fnord () { return 42; }
+int main ()
+{
+  void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW);
+  int status = $lt_dlunknown;
+
+  if (self)
+    {
+      if (dlsym (self,"fnord"))       status = $lt_dlno_uscore;
+      else
+        {
+	  if (dlsym( self,"_fnord"))  status = $lt_dlneed_uscore;
+          else puts (dlerror ());
+	}
+      /* dlclose (self); */
+    }
+  else
+    puts (dlerror ());
+
+  return status;
+}]
+_LT_EOF
+  if AC_TRY_EVAL(ac_link) && test -s conftest${ac_exeext} 2>/dev/null; then
+    (./conftest; exit; ) >&AS_MESSAGE_LOG_FD 2>/dev/null
+    lt_status=$?
+    case x$lt_status in
+      x$lt_dlno_uscore) $1 ;;
+      x$lt_dlneed_uscore) $2 ;;
+      x$lt_dlunknown|x*) $3 ;;
+    esac
+  else :
+    # compilation failed
+    $3
+  fi
+fi
+rm -fr conftest*
+])# _LT_TRY_DLOPEN_SELF
+
+
+# LT_SYS_DLOPEN_SELF
+# ------------------
+AC_DEFUN([LT_SYS_DLOPEN_SELF],
+[m4_require([_LT_HEADER_DLFCN])dnl
+if test "x$enable_dlopen" != xyes; then
+  enable_dlopen=unknown
+  enable_dlopen_self=unknown
+  enable_dlopen_self_static=unknown
+else
+  lt_cv_dlopen=no
+  lt_cv_dlopen_libs=
+
+  case $host_os in
+  beos*)
+    lt_cv_dlopen="load_add_on"
+    lt_cv_dlopen_libs=
+    lt_cv_dlopen_self=yes
+    ;;
+
+  mingw* | pw32* | cegcc*)
+    lt_cv_dlopen="LoadLibrary"
+    lt_cv_dlopen_libs=
+    ;;
+
+  cygwin*)
+    lt_cv_dlopen="dlopen"
+    lt_cv_dlopen_libs=
+    ;;
+
+  darwin*)
+  # if libdl is installed we need to link against it
+    AC_CHECK_LIB([dl], [dlopen],
+		[lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl"],[
+    lt_cv_dlopen="dyld"
+    lt_cv_dlopen_libs=
+    lt_cv_dlopen_self=yes
+    ])
+    ;;
+
+  *)
+    AC_CHECK_FUNC([shl_load],
+	  [lt_cv_dlopen="shl_load"],
+      [AC_CHECK_LIB([dld], [shl_load],
+	    [lt_cv_dlopen="shl_load" lt_cv_dlopen_libs="-ldld"],
+	[AC_CHECK_FUNC([dlopen],
+	      [lt_cv_dlopen="dlopen"],
+	  [AC_CHECK_LIB([dl], [dlopen],
+		[lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl"],
+	    [AC_CHECK_LIB([svld], [dlopen],
+		  [lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-lsvld"],
+	      [AC_CHECK_LIB([dld], [dld_link],
+		    [lt_cv_dlopen="dld_link" lt_cv_dlopen_libs="-ldld"])
+	      ])
+	    ])
+	  ])
+	])
+      ])
+    ;;
+  esac
+
+  if test "x$lt_cv_dlopen" != xno; then
+    enable_dlopen=yes
+  else
+    enable_dlopen=no
+  fi
+
+  case $lt_cv_dlopen in
+  dlopen)
+    save_CPPFLAGS="$CPPFLAGS"
+    test "x$ac_cv_header_dlfcn_h" = xyes && CPPFLAGS="$CPPFLAGS -DHAVE_DLFCN_H"
+
+    save_LDFLAGS="$LDFLAGS"
+    wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $export_dynamic_flag_spec\"
+
+    save_LIBS="$LIBS"
+    LIBS="$lt_cv_dlopen_libs $LIBS"
+
+    AC_CACHE_CHECK([whether a program can dlopen itself],
+	  lt_cv_dlopen_self, [dnl
+	  _LT_TRY_DLOPEN_SELF(
+	    lt_cv_dlopen_self=yes, lt_cv_dlopen_self=yes,
+	    lt_cv_dlopen_self=no, lt_cv_dlopen_self=cross)
+    ])
+
+    if test "x$lt_cv_dlopen_self" = xyes; then
+      wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $lt_prog_compiler_static\"
+      AC_CACHE_CHECK([whether a statically linked program can dlopen itself],
+	  lt_cv_dlopen_self_static, [dnl
+	  _LT_TRY_DLOPEN_SELF(
+	    lt_cv_dlopen_self_static=yes, lt_cv_dlopen_self_static=yes,
+	    lt_cv_dlopen_self_static=no,  lt_cv_dlopen_self_static=cross)
+      ])
+    fi
+
+    CPPFLAGS="$save_CPPFLAGS"
+    LDFLAGS="$save_LDFLAGS"
+    LIBS="$save_LIBS"
+    ;;
+  esac
+
+  case $lt_cv_dlopen_self in
+  yes|no) enable_dlopen_self=$lt_cv_dlopen_self ;;
+  *) enable_dlopen_self=unknown ;;
+  esac
+
+  case $lt_cv_dlopen_self_static in
+  yes|no) enable_dlopen_self_static=$lt_cv_dlopen_self_static ;;
+  *) enable_dlopen_self_static=unknown ;;
+  esac
+fi
+_LT_DECL([dlopen_support], [enable_dlopen], [0],
+	 [Whether dlopen is supported])
+_LT_DECL([dlopen_self], [enable_dlopen_self], [0],
+	 [Whether dlopen of programs is supported])
+_LT_DECL([dlopen_self_static], [enable_dlopen_self_static], [0],
+	 [Whether dlopen of statically linked programs is supported])
+])# LT_SYS_DLOPEN_SELF
+
+# Old name:
+AU_ALIAS([AC_LIBTOOL_DLOPEN_SELF], [LT_SYS_DLOPEN_SELF])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_LIBTOOL_DLOPEN_SELF], [])
+
+
+# _LT_COMPILER_C_O([TAGNAME])
+# ---------------------------
+# Check to see if options -c and -o are simultaneously supported by compiler.
+# This macro does not hard code the compiler like AC_PROG_CC_C_O.
+m4_defun([_LT_COMPILER_C_O],
+[m4_require([_LT_DECL_SED])dnl
+m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+m4_require([_LT_TAG_COMPILER])dnl
+AC_CACHE_CHECK([if $compiler supports -c -o file.$ac_objext],
+  [_LT_TAGVAR(lt_cv_prog_compiler_c_o, $1)],
+  [_LT_TAGVAR(lt_cv_prog_compiler_c_o, $1)=no
+   $RM -r conftest 2>/dev/null
+   mkdir conftest
+   cd conftest
+   mkdir out
+   echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+   lt_compiler_flag="-o out/conftest2.$ac_objext"
+   # Insert the option either (1) after the last *FLAGS variable, or
+   # (2) before a word containing "conftest.", or (3) at the end.
+   # Note that $ac_compile itself does not contain backslashes and begins
+   # with a dollar sign (not a hyphen), so the echo should work correctly.
+   lt_compile=`echo "$ac_compile" | $SED \
+   -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+   -e 's: [[^ ]]*conftest\.: $lt_compiler_flag&:; t' \
+   -e 's:$: $lt_compiler_flag:'`
+   (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&AS_MESSAGE_LOG_FD)
+   (eval "$lt_compile" 2>out/conftest.err)
+   ac_status=$?
+   cat out/conftest.err >&AS_MESSAGE_LOG_FD
+   echo "$as_me:$LINENO: \$? = $ac_status" >&AS_MESSAGE_LOG_FD
+   if (exit $ac_status) && test -s out/conftest2.$ac_objext
+   then
+     # The compiler can only warn and ignore the option if not recognized
+     # So say no if there are warnings
+     $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' > out/conftest.exp
+     $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2
+     if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then
+       _LT_TAGVAR(lt_cv_prog_compiler_c_o, $1)=yes
+     fi
+   fi
+   chmod u+w . 2>&AS_MESSAGE_LOG_FD
+   $RM conftest*
+   # SGI C++ compiler will create directory out/ii_files/ for
+   # template instantiation
+   test -d out/ii_files && $RM out/ii_files/* && rmdir out/ii_files
+   $RM out/* && rmdir out
+   cd ..
+   $RM -r conftest
+   $RM conftest*
+])
+_LT_TAGDECL([compiler_c_o], [lt_cv_prog_compiler_c_o], [1],
+	[Does compiler simultaneously support -c and -o options?])
+])# _LT_COMPILER_C_O
+
+
+# _LT_COMPILER_FILE_LOCKS([TAGNAME])
+# ----------------------------------
+# Check to see if we can do hard links to lock some files if needed
+m4_defun([_LT_COMPILER_FILE_LOCKS],
+[m4_require([_LT_ENABLE_LOCK])dnl
+m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+_LT_COMPILER_C_O([$1])
+
+hard_links="nottested"
+if test "$_LT_TAGVAR(lt_cv_prog_compiler_c_o, $1)" = no && test "$need_locks" != no; then
+  # do not overwrite the value of need_locks provided by the user
+  AC_MSG_CHECKING([if we can lock with hard links])
+  hard_links=yes
+  $RM conftest*
+  ln conftest.a conftest.b 2>/dev/null && hard_links=no
+  touch conftest.a
+  ln conftest.a conftest.b 2>&5 || hard_links=no
+  ln conftest.a conftest.b 2>/dev/null && hard_links=no
+  AC_MSG_RESULT([$hard_links])
+  if test "$hard_links" = no; then
+    AC_MSG_WARN([`$CC' does not support `-c -o', so `make -j' may be unsafe])
+    need_locks=warn
+  fi
+else
+  need_locks=no
+fi
+_LT_DECL([], [need_locks], [1], [Must we lock files when doing compilation?])
+])# _LT_COMPILER_FILE_LOCKS
+
+
+# _LT_CHECK_OBJDIR
+# ----------------
+m4_defun([_LT_CHECK_OBJDIR],
+[AC_CACHE_CHECK([for objdir], [lt_cv_objdir],
+[rm -f .libs 2>/dev/null
+mkdir .libs 2>/dev/null
+if test -d .libs; then
+  lt_cv_objdir=.libs
+else
+  # MS-DOS does not allow filenames that begin with a dot.
+  lt_cv_objdir=_libs
+fi
+rmdir .libs 2>/dev/null])
+objdir=$lt_cv_objdir
+_LT_DECL([], [objdir], [0],
+         [The name of the directory that contains temporary libtool files])dnl
+m4_pattern_allow([LT_OBJDIR])dnl
+AC_DEFINE_UNQUOTED(LT_OBJDIR, "$lt_cv_objdir/",
+  [Define to the sub-directory in which libtool stores uninstalled libraries.])
+])# _LT_CHECK_OBJDIR
+
+
+# _LT_LINKER_HARDCODE_LIBPATH([TAGNAME])
+# --------------------------------------
+# Check hardcoding attributes.
+m4_defun([_LT_LINKER_HARDCODE_LIBPATH],
+[AC_MSG_CHECKING([how to hardcode library paths into programs])
+_LT_TAGVAR(hardcode_action, $1)=
+if test -n "$_LT_TAGVAR(hardcode_libdir_flag_spec, $1)" ||
+   test -n "$_LT_TAGVAR(runpath_var, $1)" ||
+   test "X$_LT_TAGVAR(hardcode_automatic, $1)" = "Xyes" ; then
+
+  # We can hardcode non-existent directories.
+  if test "$_LT_TAGVAR(hardcode_direct, $1)" != no &&
+     # If the only mechanism to avoid hardcoding is shlibpath_var, we
+     # have to relink, otherwise we might link with an installed library
+     # when we should be linking with a yet-to-be-installed one
+     ## test "$_LT_TAGVAR(hardcode_shlibpath_var, $1)" != no &&
+     test "$_LT_TAGVAR(hardcode_minus_L, $1)" != no; then
+    # Linking always hardcodes the temporary library directory.
+    _LT_TAGVAR(hardcode_action, $1)=relink
+  else
+    # We can link without hardcoding, and we can hardcode nonexisting dirs.
+    _LT_TAGVAR(hardcode_action, $1)=immediate
+  fi
+else
+  # We cannot hardcode anything, or else we can only hardcode existing
+  # directories.
+  _LT_TAGVAR(hardcode_action, $1)=unsupported
+fi
+AC_MSG_RESULT([$_LT_TAGVAR(hardcode_action, $1)])
+
+if test "$_LT_TAGVAR(hardcode_action, $1)" = relink ||
+   test "$_LT_TAGVAR(inherit_rpath, $1)" = yes; then
+  # Fast installation is not supported
+  enable_fast_install=no
+elif test "$shlibpath_overrides_runpath" = yes ||
+     test "$enable_shared" = no; then
+  # Fast installation is not necessary
+  enable_fast_install=needless
+fi
+_LT_TAGDECL([], [hardcode_action], [0],
+    [How to hardcode a shared library path into an executable])
+])# _LT_LINKER_HARDCODE_LIBPATH
+
+
+# _LT_CMD_STRIPLIB
+# ----------------
+m4_defun([_LT_CMD_STRIPLIB],
+[m4_require([_LT_DECL_EGREP])
+striplib=
+old_striplib=
+AC_MSG_CHECKING([whether stripping libraries is possible])
+if test -n "$STRIP" && $STRIP -V 2>&1 | $GREP "GNU strip" >/dev/null; then
+  test -z "$old_striplib" && old_striplib="$STRIP --strip-debug"
+  test -z "$striplib" && striplib="$STRIP --strip-unneeded"
+  AC_MSG_RESULT([yes])
+else
+# FIXME - insert some real tests, host_os isn't really good enough
+  case $host_os in
+  darwin*)
+    if test -n "$STRIP" ; then
+      striplib="$STRIP -x"
+      old_striplib="$STRIP -S"
+      AC_MSG_RESULT([yes])
+    else
+      AC_MSG_RESULT([no])
+    fi
+    ;;
+  *)
+    AC_MSG_RESULT([no])
+    ;;
+  esac
+fi
+_LT_DECL([], [old_striplib], [1], [Commands to strip libraries])
+_LT_DECL([], [striplib], [1])
+])# _LT_CMD_STRIPLIB
+
+
+# _LT_SYS_DYNAMIC_LINKER([TAG])
+# -----------------------------
+# PORTME Fill in your ld.so characteristics
+m4_defun([_LT_SYS_DYNAMIC_LINKER],
+[AC_REQUIRE([AC_CANONICAL_HOST])dnl
+m4_require([_LT_DECL_EGREP])dnl
+m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+m4_require([_LT_DECL_OBJDUMP])dnl
+m4_require([_LT_DECL_SED])dnl
+m4_require([_LT_CHECK_SHELL_FEATURES])dnl
+AC_MSG_CHECKING([dynamic linker characteristics])
+m4_if([$1],
+	[], [
+if test "$GCC" = yes; then
+  case $host_os in
+    darwin*) lt_awk_arg="/^libraries:/,/LR/" ;;
+    *) lt_awk_arg="/^libraries:/" ;;
+  esac
+  case $host_os in
+    mingw* | cegcc*) lt_sed_strip_eq="s,=\([[A-Za-z]]:\),\1,g" ;;
+    *) lt_sed_strip_eq="s,=/,/,g" ;;
+  esac
+  lt_search_path_spec=`$CC -print-search-dirs | awk $lt_awk_arg | $SED -e "s/^libraries://" -e $lt_sed_strip_eq`
+  case $lt_search_path_spec in
+  *\;*)
+    # if the path contains ";" then we assume it to be the separator
+    # otherwise default to the standard path separator (i.e. ":") - it is
+    # assumed that no part of a normal pathname contains ";" but that should
+    # okay in the real world where ";" in dirpaths is itself problematic.
+    lt_search_path_spec=`$ECHO "$lt_search_path_spec" | $SED 's/;/ /g'`
+    ;;
+  *)
+    lt_search_path_spec=`$ECHO "$lt_search_path_spec" | $SED "s/$PATH_SEPARATOR/ /g"`
+    ;;
+  esac
+  # Ok, now we have the path, separated by spaces, we can step through it
+  # and add multilib dir if necessary.
+  lt_tmp_lt_search_path_spec=
+  lt_multi_os_dir=`$CC $CPPFLAGS $CFLAGS $LDFLAGS -print-multi-os-directory 2>/dev/null`
+  for lt_sys_path in $lt_search_path_spec; do
+    if test -d "$lt_sys_path/$lt_multi_os_dir"; then
+      lt_tmp_lt_search_path_spec="$lt_tmp_lt_search_path_spec $lt_sys_path/$lt_multi_os_dir"
+    else
+      test -d "$lt_sys_path" && \
+	lt_tmp_lt_search_path_spec="$lt_tmp_lt_search_path_spec $lt_sys_path"
+    fi
+  done
+  lt_search_path_spec=`$ECHO "$lt_tmp_lt_search_path_spec" | awk '
+BEGIN {RS=" "; FS="/|\n";} {
+  lt_foo="";
+  lt_count=0;
+  for (lt_i = NF; lt_i > 0; lt_i--) {
+    if ($lt_i != "" && $lt_i != ".") {
+      if ($lt_i == "..") {
+        lt_count++;
+      } else {
+        if (lt_count == 0) {
+          lt_foo="/" $lt_i lt_foo;
+        } else {
+          lt_count--;
+        }
+      }
+    }
+  }
+  if (lt_foo != "") { lt_freq[[lt_foo]]++; }
+  if (lt_freq[[lt_foo]] == 1) { print lt_foo; }
+}'`
+  # AWK program above erroneously prepends '/' to C:/dos/paths
+  # for these hosts.
+  case $host_os in
+    mingw* | cegcc*) lt_search_path_spec=`$ECHO "$lt_search_path_spec" |\
+      $SED 's,/\([[A-Za-z]]:\),\1,g'` ;;
+  esac
+  sys_lib_search_path_spec=`$ECHO "$lt_search_path_spec" | $lt_NL2SP`
+else
+  sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib"
+fi])
+library_names_spec=
+libname_spec='lib$name'
+soname_spec=
+shrext_cmds=".so"
+postinstall_cmds=
+postuninstall_cmds=
+finish_cmds=
+finish_eval=
+shlibpath_var=
+shlibpath_overrides_runpath=unknown
+version_type=none
+dynamic_linker="$host_os ld.so"
+sys_lib_dlsearch_path_spec="/lib /usr/lib"
+need_lib_prefix=unknown
+hardcode_into_libs=no
+
+# when you set need_version to no, make sure it does not cause -set_version
+# flags to be left without arguments
+need_version=unknown
+
+case $host_os in
+aix3*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  library_names_spec='${libname}${release}${shared_ext}$versuffix $libname.a'
+  shlibpath_var=LIBPATH
+
+  # AIX 3 has no versioning support, so we append a major version to the name.
+  soname_spec='${libname}${release}${shared_ext}$major'
+  ;;
+
+aix[[4-9]]*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  need_lib_prefix=no
+  need_version=no
+  hardcode_into_libs=yes
+  if test "$host_cpu" = ia64; then
+    # AIX 5 supports IA64
+    library_names_spec='${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext}$versuffix $libname${shared_ext}'
+    shlibpath_var=LD_LIBRARY_PATH
+  else
+    # With GCC up to 2.95.x, collect2 would create an import file
+    # for dependence libraries.  The import file would start with
+    # the line `#! .'.  This would cause the generated library to
+    # depend on `.', always an invalid library.  This was fixed in
+    # development snapshots of GCC prior to 3.0.
+    case $host_os in
+      aix4 | aix4.[[01]] | aix4.[[01]].*)
+      if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)'
+	   echo ' yes '
+	   echo '#endif'; } | ${CC} -E - | $GREP yes > /dev/null; then
+	:
+      else
+	can_build_shared=no
+      fi
+      ;;
+    esac
+    # AIX (on Power*) has no versioning support, so currently we can not hardcode correct
+    # soname into executable. Probably we can add versioning support to
+    # collect2, so additional links can be useful in future.
+    if test "$aix_use_runtimelinking" = yes; then
+      # If using run time linking (on AIX 4.2 or later) use lib<name>.so
+      # instead of lib<name>.a to let people know that these are not
+      # typical AIX shared libraries.
+      library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+    else
+      # We preserve .a as extension for shared libraries through AIX4.2
+      # and later when we are not doing run time linking.
+      library_names_spec='${libname}${release}.a $libname.a'
+      soname_spec='${libname}${release}${shared_ext}$major'
+    fi
+    shlibpath_var=LIBPATH
+  fi
+  ;;
+
+amigaos*)
+  case $host_cpu in
+  powerpc)
+    # Since July 2007 AmigaOS4 officially supports .so libraries.
+    # When compiling the executable, add -use-dynld -Lsobjs: to the compileline.
+    library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+    ;;
+  m68k)
+    library_names_spec='$libname.ixlibrary $libname.a'
+    # Create ${libname}_ixlibrary.a entries in /sys/libs.
+    finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`func_echo_all "$lib" | $SED '\''s%^.*/\([[^/]]*\)\.ixlibrary$%\1%'\''`; test $RM /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done'
+    ;;
+  esac
+  ;;
+
+beos*)
+  library_names_spec='${libname}${shared_ext}'
+  dynamic_linker="$host_os ld.so"
+  shlibpath_var=LIBRARY_PATH
+  ;;
+
+bsdi[[45]]*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir'
+  shlibpath_var=LD_LIBRARY_PATH
+  sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib"
+  sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib"
+  # the default ld.so.conf also contains /usr/contrib/lib and
+  # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow
+  # libtool to hard-code these into programs
+  ;;
+
+cygwin* | mingw* | pw32* | cegcc*)
+  version_type=windows
+  shrext_cmds=".dll"
+  need_version=no
+  need_lib_prefix=no
+
+  case $GCC,$cc_basename in
+  yes,*)
+    # gcc
+    library_names_spec='$libname.dll.a'
+    # DLL is installed to $(libdir)/../bin by postinstall_cmds
+    postinstall_cmds='base_file=`basename \${file}`~
+      dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i; echo \$dlname'\''`~
+      dldir=$destdir/`dirname \$dlpath`~
+      test -d \$dldir || mkdir -p \$dldir~
+      $install_prog $dir/$dlname \$dldir/$dlname~
+      chmod a+x \$dldir/$dlname~
+      if test -n '\''$stripme'\'' && test -n '\''$striplib'\''; then
+        eval '\''$striplib \$dldir/$dlname'\'' || exit \$?;
+      fi'
+    postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~
+      dlpath=$dir/\$dldll~
+       $RM \$dlpath'
+    shlibpath_overrides_runpath=yes
+
+    case $host_os in
+    cygwin*)
+      # Cygwin DLLs use 'cyg' prefix rather than 'lib'
+      soname_spec='`echo ${libname} | sed -e 's/^lib/cyg/'``echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}'
+m4_if([$1], [],[
+      sys_lib_search_path_spec="$sys_lib_search_path_spec /usr/lib/w32api"])
+      ;;
+    mingw* | cegcc*)
+      # MinGW DLLs use traditional 'lib' prefix
+      soname_spec='${libname}`echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}'
+      ;;
+    pw32*)
+      # pw32 DLLs use 'pw' prefix rather than 'lib'
+      library_names_spec='`echo ${libname} | sed -e 's/^lib/pw/'``echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}'
+      ;;
+    esac
+    dynamic_linker='Win32 ld.exe'
+    ;;
+
+  *,cl*)
+    # Native MSVC
+    libname_spec='$name'
+    soname_spec='${libname}`echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}'
+    library_names_spec='${libname}.dll.lib'
+
+    case $build_os in
+    mingw*)
+      sys_lib_search_path_spec=
+      lt_save_ifs=$IFS
+      IFS=';'
+      for lt_path in $LIB
+      do
+        IFS=$lt_save_ifs
+        # Let DOS variable expansion print the short 8.3 style file name.
+        lt_path=`cd "$lt_path" 2>/dev/null && cmd //C "for %i in (".") do @echo %~si"`
+        sys_lib_search_path_spec="$sys_lib_search_path_spec $lt_path"
+      done
+      IFS=$lt_save_ifs
+      # Convert to MSYS style.
+      sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | sed -e 's|\\\\|/|g' -e 's| \\([[a-zA-Z]]\\):| /\\1|g' -e 's|^ ||'`
+      ;;
+    cygwin*)
+      # Convert to unix form, then to dos form, then back to unix form
+      # but this time dos style (no spaces!) so that the unix form looks
+      # like /cygdrive/c/PROGRA~1:/cygdr...
+      sys_lib_search_path_spec=`cygpath --path --unix "$LIB"`
+      sys_lib_search_path_spec=`cygpath --path --dos "$sys_lib_search_path_spec" 2>/dev/null`
+      sys_lib_search_path_spec=`cygpath --path --unix "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+      ;;
+    *)
+      sys_lib_search_path_spec="$LIB"
+      if $ECHO "$sys_lib_search_path_spec" | [$GREP ';[c-zC-Z]:/' >/dev/null]; then
+        # It is most probably a Windows format PATH.
+        sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'`
+      else
+        sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+      fi
+      # FIXME: find the short name or the path components, as spaces are
+      # common. (e.g. "Program Files" -> "PROGRA~1")
+      ;;
+    esac
+
+    # DLL is installed to $(libdir)/../bin by postinstall_cmds
+    postinstall_cmds='base_file=`basename \${file}`~
+      dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i; echo \$dlname'\''`~
+      dldir=$destdir/`dirname \$dlpath`~
+      test -d \$dldir || mkdir -p \$dldir~
+      $install_prog $dir/$dlname \$dldir/$dlname'
+    postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~
+      dlpath=$dir/\$dldll~
+       $RM \$dlpath'
+    shlibpath_overrides_runpath=yes
+    dynamic_linker='Win32 link.exe'
+    ;;
+
+  *)
+    # Assume MSVC wrapper
+    library_names_spec='${libname}`echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext} $libname.lib'
+    dynamic_linker='Win32 ld.exe'
+    ;;
+  esac
+  # FIXME: first we should search . and the directory the executable is in
+  shlibpath_var=PATH
+  ;;
+
+darwin* | rhapsody*)
+  dynamic_linker="$host_os dyld"
+  version_type=darwin
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${major}$shared_ext ${libname}$shared_ext'
+  soname_spec='${libname}${release}${major}$shared_ext'
+  shlibpath_overrides_runpath=yes
+  shlibpath_var=DYLD_LIBRARY_PATH
+  shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`'
+m4_if([$1], [],[
+  sys_lib_search_path_spec="$sys_lib_search_path_spec /usr/local/lib"])
+  sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib'
+  ;;
+
+dgux*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname$shared_ext'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  shlibpath_var=LD_LIBRARY_PATH
+  ;;
+
+freebsd* | dragonfly*)
+  # DragonFly does not have aout.  When/if they implement a new
+  # versioning mechanism, adjust this.
+  if test -x /usr/bin/objformat; then
+    objformat=`/usr/bin/objformat`
+  else
+    case $host_os in
+    freebsd[[23]].*) objformat=aout ;;
+    *) objformat=elf ;;
+    esac
+  fi
+  version_type=freebsd-$objformat
+  case $version_type in
+    freebsd-elf*)
+      library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+      need_version=no
+      need_lib_prefix=no
+      ;;
+    freebsd-*)
+      library_names_spec='${libname}${release}${shared_ext}$versuffix $libname${shared_ext}$versuffix'
+      need_version=yes
+      ;;
+  esac
+  shlibpath_var=LD_LIBRARY_PATH
+  case $host_os in
+  freebsd2.*)
+    shlibpath_overrides_runpath=yes
+    ;;
+  freebsd3.[[01]]* | freebsdelf3.[[01]]*)
+    shlibpath_overrides_runpath=yes
+    hardcode_into_libs=yes
+    ;;
+  freebsd3.[[2-9]]* | freebsdelf3.[[2-9]]* | \
+  freebsd4.[[0-5]] | freebsdelf4.[[0-5]] | freebsd4.1.1 | freebsdelf4.1.1)
+    shlibpath_overrides_runpath=no
+    hardcode_into_libs=yes
+    ;;
+  *) # from 4.6 on, and DragonFly
+    shlibpath_overrides_runpath=yes
+    hardcode_into_libs=yes
+    ;;
+  esac
+  ;;
+
+haiku*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  need_lib_prefix=no
+  need_version=no
+  dynamic_linker="$host_os runtime_loader"
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  shlibpath_var=LIBRARY_PATH
+  shlibpath_overrides_runpath=yes
+  sys_lib_dlsearch_path_spec='/boot/home/config/lib /boot/common/lib /boot/system/lib'
+  hardcode_into_libs=yes
+  ;;
+
+hpux9* | hpux10* | hpux11*)
+  # Give a soname corresponding to the major version so that dld.sl refuses to
+  # link against other versions.
+  version_type=sunos
+  need_lib_prefix=no
+  need_version=no
+  case $host_cpu in
+  ia64*)
+    shrext_cmds='.so'
+    hardcode_into_libs=yes
+    dynamic_linker="$host_os dld.so"
+    shlibpath_var=LD_LIBRARY_PATH
+    shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+    library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+    soname_spec='${libname}${release}${shared_ext}$major'
+    if test "X$HPUX_IA64_MODE" = X32; then
+      sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib"
+    else
+      sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64"
+    fi
+    sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+    ;;
+  hppa*64*)
+    shrext_cmds='.sl'
+    hardcode_into_libs=yes
+    dynamic_linker="$host_os dld.sl"
+    shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH
+    shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+    library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+    soname_spec='${libname}${release}${shared_ext}$major'
+    sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64"
+    sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+    ;;
+  *)
+    shrext_cmds='.sl'
+    dynamic_linker="$host_os dld.sl"
+    shlibpath_var=SHLIB_PATH
+    shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH
+    library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+    soname_spec='${libname}${release}${shared_ext}$major'
+    ;;
+  esac
+  # HP-UX runs *really* slowly unless shared libraries are mode 555, ...
+  postinstall_cmds='chmod 555 $lib'
+  # or fails outright, so override atomically:
+  install_override_mode=555
+  ;;
+
+interix[[3-9]]*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=no
+  hardcode_into_libs=yes
+  ;;
+
+irix5* | irix6* | nonstopux*)
+  case $host_os in
+    nonstopux*) version_type=nonstopux ;;
+    *)
+	if test "$lt_cv_prog_gnu_ld" = yes; then
+		version_type=linux # correct to gnu/linux during the next big refactor
+	else
+		version_type=irix
+	fi ;;
+  esac
+  need_lib_prefix=no
+  need_version=no
+  soname_spec='${libname}${release}${shared_ext}$major'
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext} $libname${shared_ext}'
+  case $host_os in
+  irix5* | nonstopux*)
+    libsuff= shlibsuff=
+    ;;
+  *)
+    case $LD in # libtool.m4 will add one of these switches to LD
+    *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ")
+      libsuff= shlibsuff= libmagic=32-bit;;
+    *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ")
+      libsuff=32 shlibsuff=N32 libmagic=N32;;
+    *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ")
+      libsuff=64 shlibsuff=64 libmagic=64-bit;;
+    *) libsuff= shlibsuff= libmagic=never-match;;
+    esac
+    ;;
+  esac
+  shlibpath_var=LD_LIBRARY${shlibsuff}_PATH
+  shlibpath_overrides_runpath=no
+  sys_lib_search_path_spec="/usr/lib${libsuff} /lib${libsuff} /usr/local/lib${libsuff}"
+  sys_lib_dlsearch_path_spec="/usr/lib${libsuff} /lib${libsuff}"
+  hardcode_into_libs=yes
+  ;;
+
+# No shared lib support for Linux oldld, aout, or coff.
+linux*oldld* | linux*aout* | linux*coff*)
+  dynamic_linker=no
+  ;;
+
+# This must be glibc/ELF.
+linux* | k*bsd*-gnu | kopensolaris*-gnu | gnu*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=no
+
+  # Some binutils ld are patched to set DT_RUNPATH
+  AC_CACHE_VAL([lt_cv_shlibpath_overrides_runpath],
+    [lt_cv_shlibpath_overrides_runpath=no
+    save_LDFLAGS=$LDFLAGS
+    save_libdir=$libdir
+    eval "libdir=/foo; wl=\"$_LT_TAGVAR(lt_prog_compiler_wl, $1)\"; \
+	 LDFLAGS=\"\$LDFLAGS $_LT_TAGVAR(hardcode_libdir_flag_spec, $1)\""
+    AC_LINK_IFELSE([AC_LANG_PROGRAM([],[])],
+      [AS_IF([ ($OBJDUMP -p conftest$ac_exeext) 2>/dev/null | grep "RUNPATH.*$libdir" >/dev/null],
+	 [lt_cv_shlibpath_overrides_runpath=yes])])
+    LDFLAGS=$save_LDFLAGS
+    libdir=$save_libdir
+    ])
+  shlibpath_overrides_runpath=$lt_cv_shlibpath_overrides_runpath
+
+  # This implies no fast_install, which is unacceptable.
+  # Some rework will be needed to allow for fast_install
+  # before this can be enabled.
+  hardcode_into_libs=yes
+
+  # Append ld.so.conf contents to the search path
+  if test -f /etc/ld.so.conf; then
+    lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \[$]2)); skip = 1; } { if (!skip) print \[$]0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;/^[	 ]*hwcap[	 ]/d;s/[:,	]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;s/"//g;/^$/d' | tr '\n' ' '`
+    sys_lib_dlsearch_path_spec="/lib /usr/lib $lt_ld_extra"
+  fi
+
+  # We used to test for /lib/ld.so.1 and disable shared libraries on
+  # powerpc, because MkLinux only supported shared libraries with the
+  # GNU dynamic linker.  Since this was broken with cross compilers,
+  # most powerpc-linux boxes support dynamic linking these days and
+  # people can always --disable-shared, the test was removed, and we
+  # assume the GNU/Linux dynamic linker is in use.
+  dynamic_linker='GNU/Linux ld.so'
+  ;;
+
+netbsdelf*-gnu)
+  version_type=linux
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=no
+  hardcode_into_libs=yes
+  dynamic_linker='NetBSD ld.elf_so'
+  ;;
+
+netbsd*)
+  version_type=sunos
+  need_lib_prefix=no
+  need_version=no
+  if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+    library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+    finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+    dynamic_linker='NetBSD (a.out) ld.so'
+  else
+    library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+    soname_spec='${libname}${release}${shared_ext}$major'
+    dynamic_linker='NetBSD ld.elf_so'
+  fi
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=yes
+  hardcode_into_libs=yes
+  ;;
+
+newsos6)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=yes
+  ;;
+
+*nto* | *qnx*)
+  version_type=qnx
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=no
+  hardcode_into_libs=yes
+  dynamic_linker='ldqnx.so'
+  ;;
+
+openbsd*)
+  version_type=sunos
+  sys_lib_dlsearch_path_spec="/usr/lib"
+  need_lib_prefix=no
+  # Some older versions of OpenBSD (3.3 at least) *do* need versioned libs.
+  case $host_os in
+    openbsd3.3 | openbsd3.3.*)	need_version=yes ;;
+    *)				need_version=no  ;;
+  esac
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+  finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+  shlibpath_var=LD_LIBRARY_PATH
+  if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+    case $host_os in
+      openbsd2.[[89]] | openbsd2.[[89]].*)
+	shlibpath_overrides_runpath=no
+	;;
+      *)
+	shlibpath_overrides_runpath=yes
+	;;
+      esac
+  else
+    shlibpath_overrides_runpath=yes
+  fi
+  ;;
+
+os2*)
+  libname_spec='$name'
+  shrext_cmds=".dll"
+  need_lib_prefix=no
+  library_names_spec='$libname${shared_ext} $libname.a'
+  dynamic_linker='OS/2 ld.exe'
+  shlibpath_var=LIBPATH
+  ;;
+
+osf3* | osf4* | osf5*)
+  version_type=osf
+  need_lib_prefix=no
+  need_version=no
+  soname_spec='${libname}${release}${shared_ext}$major'
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  shlibpath_var=LD_LIBRARY_PATH
+  sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib"
+  sys_lib_dlsearch_path_spec="$sys_lib_search_path_spec"
+  ;;
+
+rdos*)
+  dynamic_linker=no
+  ;;
+
+solaris*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=yes
+  hardcode_into_libs=yes
+  # ldd complains unless libraries are executable
+  postinstall_cmds='chmod +x $lib'
+  ;;
+
+sunos4*)
+  version_type=sunos
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+  finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=yes
+  if test "$with_gnu_ld" = yes; then
+    need_lib_prefix=no
+  fi
+  need_version=yes
+  ;;
+
+sysv4 | sysv4.3*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  shlibpath_var=LD_LIBRARY_PATH
+  case $host_vendor in
+    sni)
+      shlibpath_overrides_runpath=no
+      need_lib_prefix=no
+      runpath_var=LD_RUN_PATH
+      ;;
+    siemens)
+      need_lib_prefix=no
+      ;;
+    motorola)
+      need_lib_prefix=no
+      need_version=no
+      shlibpath_overrides_runpath=no
+      sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib'
+      ;;
+  esac
+  ;;
+
+sysv4*MP*)
+  if test -d /usr/nec ;then
+    version_type=linux # correct to gnu/linux during the next big refactor
+    library_names_spec='$libname${shared_ext}.$versuffix $libname${shared_ext}.$major $libname${shared_ext}'
+    soname_spec='$libname${shared_ext}.$major'
+    shlibpath_var=LD_LIBRARY_PATH
+  fi
+  ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+  version_type=freebsd-elf
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=yes
+  hardcode_into_libs=yes
+  if test "$with_gnu_ld" = yes; then
+    sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib'
+  else
+    sys_lib_search_path_spec='/usr/ccs/lib /usr/lib'
+    case $host_os in
+      sco3.2v5*)
+        sys_lib_search_path_spec="$sys_lib_search_path_spec /lib"
+	;;
+    esac
+  fi
+  sys_lib_dlsearch_path_spec='/usr/lib'
+  ;;
+
+tpf*)
+  # TPF is a cross-target only.  Preferred cross-host = GNU/Linux.
+  version_type=linux # correct to gnu/linux during the next big refactor
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=no
+  hardcode_into_libs=yes
+  ;;
+
+uts4*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  shlibpath_var=LD_LIBRARY_PATH
+  ;;
+
+*)
+  dynamic_linker=no
+  ;;
+esac
+AC_MSG_RESULT([$dynamic_linker])
+test "$dynamic_linker" = no && can_build_shared=no
+
+variables_saved_for_relink="PATH $shlibpath_var $runpath_var"
+if test "$GCC" = yes; then
+  variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH"
+fi
+
+if test "${lt_cv_sys_lib_search_path_spec+set}" = set; then
+  sys_lib_search_path_spec="$lt_cv_sys_lib_search_path_spec"
+fi
+if test "${lt_cv_sys_lib_dlsearch_path_spec+set}" = set; then
+  sys_lib_dlsearch_path_spec="$lt_cv_sys_lib_dlsearch_path_spec"
+fi
+
+_LT_DECL([], [variables_saved_for_relink], [1],
+    [Variables whose values should be saved in libtool wrapper scripts and
+    restored at link time])
+_LT_DECL([], [need_lib_prefix], [0],
+    [Do we need the "lib" prefix for modules?])
+_LT_DECL([], [need_version], [0], [Do we need a version for libraries?])
+_LT_DECL([], [version_type], [0], [Library versioning type])
+_LT_DECL([], [runpath_var], [0],  [Shared library runtime path variable])
+_LT_DECL([], [shlibpath_var], [0],[Shared library path variable])
+_LT_DECL([], [shlibpath_overrides_runpath], [0],
+    [Is shlibpath searched before the hard-coded library search path?])
+_LT_DECL([], [libname_spec], [1], [Format of library name prefix])
+_LT_DECL([], [library_names_spec], [1],
+    [[List of archive names.  First name is the real one, the rest are links.
+    The last name is the one that the linker finds with -lNAME]])
+_LT_DECL([], [soname_spec], [1],
+    [[The coded name of the library, if different from the real name]])
+_LT_DECL([], [install_override_mode], [1],
+    [Permission mode override for installation of shared libraries])
+_LT_DECL([], [postinstall_cmds], [2],
+    [Command to use after installation of a shared archive])
+_LT_DECL([], [postuninstall_cmds], [2],
+    [Command to use after uninstallation of a shared archive])
+_LT_DECL([], [finish_cmds], [2],
+    [Commands used to finish a libtool library installation in a directory])
+_LT_DECL([], [finish_eval], [1],
+    [[As "finish_cmds", except a single script fragment to be evaled but
+    not shown]])
+_LT_DECL([], [hardcode_into_libs], [0],
+    [Whether we should hardcode library paths into libraries])
+_LT_DECL([], [sys_lib_search_path_spec], [2],
+    [Compile-time system search path for libraries])
+_LT_DECL([], [sys_lib_dlsearch_path_spec], [2],
+    [Run-time system search path for libraries])
+])# _LT_SYS_DYNAMIC_LINKER
+
+
+# _LT_PATH_TOOL_PREFIX(TOOL)
+# --------------------------
+# find a file program which can recognize shared library
+AC_DEFUN([_LT_PATH_TOOL_PREFIX],
+[m4_require([_LT_DECL_EGREP])dnl
+AC_MSG_CHECKING([for $1])
+AC_CACHE_VAL(lt_cv_path_MAGIC_CMD,
+[case $MAGIC_CMD in
+[[\\/*] |  ?:[\\/]*])
+  lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a path.
+  ;;
+*)
+  lt_save_MAGIC_CMD="$MAGIC_CMD"
+  lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+dnl $ac_dummy forces splitting on constant user-supplied paths.
+dnl POSIX.2 word splitting is done only on the output of word expansions,
+dnl not every word.  This closes a longstanding sh security hole.
+  ac_dummy="m4_if([$2], , $PATH, [$2])"
+  for ac_dir in $ac_dummy; do
+    IFS="$lt_save_ifs"
+    test -z "$ac_dir" && ac_dir=.
+    if test -f $ac_dir/$1; then
+      lt_cv_path_MAGIC_CMD="$ac_dir/$1"
+      if test -n "$file_magic_test_file"; then
+	case $deplibs_check_method in
+	"file_magic "*)
+	  file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"`
+	  MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+	  if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null |
+	    $EGREP "$file_magic_regex" > /dev/null; then
+	    :
+	  else
+	    cat <<_LT_EOF 1>&2
+
+*** Warning: the command libtool uses to detect shared libraries,
+*** $file_magic_cmd, produces output that libtool cannot recognize.
+*** The result is that libtool may fail to recognize shared libraries
+*** as such.  This will affect the creation of libtool libraries that
+*** depend on shared libraries, but programs linked with such libtool
+*** libraries will work regardless of this problem.  Nevertheless, you
+*** may want to report the problem to your system manager and/or to
+*** bug-libtool at gnu.org
+
+_LT_EOF
+	  fi ;;
+	esac
+      fi
+      break
+    fi
+  done
+  IFS="$lt_save_ifs"
+  MAGIC_CMD="$lt_save_MAGIC_CMD"
+  ;;
+esac])
+MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+if test -n "$MAGIC_CMD"; then
+  AC_MSG_RESULT($MAGIC_CMD)
+else
+  AC_MSG_RESULT(no)
+fi
+_LT_DECL([], [MAGIC_CMD], [0],
+	 [Used to examine libraries when file_magic_cmd begins with "file"])dnl
+])# _LT_PATH_TOOL_PREFIX
+
+# Old name:
+AU_ALIAS([AC_PATH_TOOL_PREFIX], [_LT_PATH_TOOL_PREFIX])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_PATH_TOOL_PREFIX], [])
+
+
+# _LT_PATH_MAGIC
+# --------------
+# find a file program which can recognize a shared library
+m4_defun([_LT_PATH_MAGIC],
+[_LT_PATH_TOOL_PREFIX(${ac_tool_prefix}file, /usr/bin$PATH_SEPARATOR$PATH)
+if test -z "$lt_cv_path_MAGIC_CMD"; then
+  if test -n "$ac_tool_prefix"; then
+    _LT_PATH_TOOL_PREFIX(file, /usr/bin$PATH_SEPARATOR$PATH)
+  else
+    MAGIC_CMD=:
+  fi
+fi
+])# _LT_PATH_MAGIC
+
+
+# LT_PATH_LD
+# ----------
+# find the pathname to the GNU or non-GNU linker
+AC_DEFUN([LT_PATH_LD],
+[AC_REQUIRE([AC_PROG_CC])dnl
+AC_REQUIRE([AC_CANONICAL_HOST])dnl
+AC_REQUIRE([AC_CANONICAL_BUILD])dnl
+m4_require([_LT_DECL_SED])dnl
+m4_require([_LT_DECL_EGREP])dnl
+m4_require([_LT_PROG_ECHO_BACKSLASH])dnl
+
+AC_ARG_WITH([gnu-ld],
+    [AS_HELP_STRING([--with-gnu-ld],
+	[assume the C compiler uses GNU ld @<:@default=no@:>@])],
+    [test "$withval" = no || with_gnu_ld=yes],
+    [with_gnu_ld=no])dnl
+
+ac_prog=ld
+if test "$GCC" = yes; then
+  # Check if gcc -print-prog-name=ld gives a path.
+  AC_MSG_CHECKING([for ld used by $CC])
+  case $host in
+  *-*-mingw*)
+    # gcc leaves a trailing carriage return which upsets mingw
+    ac_prog=`($CC -print-prog-name=ld) 2>&5 | tr -d '\015'` ;;
+  *)
+    ac_prog=`($CC -print-prog-name=ld) 2>&5` ;;
+  esac
+  case $ac_prog in
+    # Accept absolute paths.
+    [[\\/]]* | ?:[[\\/]]*)
+      re_direlt='/[[^/]][[^/]]*/\.\./'
+      # Canonicalize the pathname of ld
+      ac_prog=`$ECHO "$ac_prog"| $SED 's%\\\\%/%g'`
+      while $ECHO "$ac_prog" | $GREP "$re_direlt" > /dev/null 2>&1; do
+	ac_prog=`$ECHO $ac_prog| $SED "s%$re_direlt%/%"`
+      done
+      test -z "$LD" && LD="$ac_prog"
+      ;;
+  "")
+    # If it fails, then pretend we aren't using GCC.
+    ac_prog=ld
+    ;;
+  *)
+    # If it is relative, then search for the first ld in PATH.
+    with_gnu_ld=unknown
+    ;;
+  esac
+elif test "$with_gnu_ld" = yes; then
+  AC_MSG_CHECKING([for GNU ld])
+else
+  AC_MSG_CHECKING([for non-GNU ld])
+fi
+AC_CACHE_VAL(lt_cv_path_LD,
+[if test -z "$LD"; then
+  lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+  for ac_dir in $PATH; do
+    IFS="$lt_save_ifs"
+    test -z "$ac_dir" && ac_dir=.
+    if test -f "$ac_dir/$ac_prog" || test -f "$ac_dir/$ac_prog$ac_exeext"; then
+      lt_cv_path_LD="$ac_dir/$ac_prog"
+      # Check to see if the program is GNU ld.  I'd rather use --version,
+      # but apparently some variants of GNU ld only accept -v.
+      # Break only if it was the GNU/non-GNU ld that we prefer.
+      case `"$lt_cv_path_LD" -v 2>&1 </dev/null` in
+      *GNU* | *'with BFD'*)
+	test "$with_gnu_ld" != no && break
+	;;
+      *)
+	test "$with_gnu_ld" != yes && break
+	;;
+      esac
+    fi
+  done
+  IFS="$lt_save_ifs"
+else
+  lt_cv_path_LD="$LD" # Let the user override the test with a path.
+fi])
+LD="$lt_cv_path_LD"
+if test -n "$LD"; then
+  AC_MSG_RESULT($LD)
+else
+  AC_MSG_RESULT(no)
+fi
+test -z "$LD" && AC_MSG_ERROR([no acceptable ld found in \$PATH])
+_LT_PATH_LD_GNU
+AC_SUBST([LD])
+
+_LT_TAGDECL([], [LD], [1], [The linker used to build libraries])
+])# LT_PATH_LD
+
+# Old names:
+AU_ALIAS([AM_PROG_LD], [LT_PATH_LD])
+AU_ALIAS([AC_PROG_LD], [LT_PATH_LD])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AM_PROG_LD], [])
+dnl AC_DEFUN([AC_PROG_LD], [])
+
+
+# _LT_PATH_LD_GNU
+#- --------------
+m4_defun([_LT_PATH_LD_GNU],
+[AC_CACHE_CHECK([if the linker ($LD) is GNU ld], lt_cv_prog_gnu_ld,
+[# I'd rather use --version here, but apparently some GNU lds only accept -v.
+case `$LD -v 2>&1 </dev/null` in
+*GNU* | *'with BFD'*)
+  lt_cv_prog_gnu_ld=yes
+  ;;
+*)
+  lt_cv_prog_gnu_ld=no
+  ;;
+esac])
+with_gnu_ld=$lt_cv_prog_gnu_ld
+])# _LT_PATH_LD_GNU
+
+
+# _LT_CMD_RELOAD
+# --------------
+# find reload flag for linker
+#   -- PORTME Some linkers may need a different reload flag.
+m4_defun([_LT_CMD_RELOAD],
+[AC_CACHE_CHECK([for $LD option to reload object files],
+  lt_cv_ld_reload_flag,
+  [lt_cv_ld_reload_flag='-r'])
+reload_flag=$lt_cv_ld_reload_flag
+case $reload_flag in
+"" | " "*) ;;
+*) reload_flag=" $reload_flag" ;;
+esac
+reload_cmds='$LD$reload_flag -o $output$reload_objs'
+case $host_os in
+  cygwin* | mingw* | pw32* | cegcc*)
+    if test "$GCC" != yes; then
+      reload_cmds=false
+    fi
+    ;;
+  darwin*)
+    if test "$GCC" = yes; then
+      reload_cmds='$LTCC $LTCFLAGS -nostdlib ${wl}-r -o $output$reload_objs'
+    else
+      reload_cmds='$LD$reload_flag -o $output$reload_objs'
+    fi
+    ;;
+esac
+_LT_TAGDECL([], [reload_flag], [1], [How to create reloadable object files])dnl
+_LT_TAGDECL([], [reload_cmds], [2])dnl
+])# _LT_CMD_RELOAD
+
+
+# _LT_CHECK_MAGIC_METHOD
+# ----------------------
+# how to check for library dependencies
+#  -- PORTME fill in with the dynamic library characteristics
+m4_defun([_LT_CHECK_MAGIC_METHOD],
+[m4_require([_LT_DECL_EGREP])
+m4_require([_LT_DECL_OBJDUMP])
+AC_CACHE_CHECK([how to recognize dependent libraries],
+lt_cv_deplibs_check_method,
+[lt_cv_file_magic_cmd='$MAGIC_CMD'
+lt_cv_file_magic_test_file=
+lt_cv_deplibs_check_method='unknown'
+# Need to set the preceding variable on all platforms that support
+# interlibrary dependencies.
+# 'none' -- dependencies not supported.
+# `unknown' -- same as none, but documents that we really don't know.
+# 'pass_all' -- all dependencies passed with no checks.
+# 'test_compile' -- check by making test program.
+# 'file_magic [[regex]]' -- check by looking for files in library path
+# which responds to the $file_magic_cmd with a given extended regex.
+# If you have `file' or equivalent on your system and you're not sure
+# whether `pass_all' will *always* work, you probably want this one.
+
+case $host_os in
+aix[[4-9]]*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+beos*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+bsdi[[45]]*)
+  lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[ML]]SB (shared object|dynamic lib)'
+  lt_cv_file_magic_cmd='/usr/bin/file -L'
+  lt_cv_file_magic_test_file=/shlib/libc.so
+  ;;
+
+cygwin*)
+  # func_win32_libid is a shell function defined in ltmain.sh
+  lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL'
+  lt_cv_file_magic_cmd='func_win32_libid'
+  ;;
+
+mingw* | pw32*)
+  # Base MSYS/MinGW do not provide the 'file' command needed by
+  # func_win32_libid shell function, so use a weaker test based on 'objdump',
+  # unless we find 'file', for example because we are cross-compiling.
+  # func_win32_libid assumes BSD nm, so disallow it if using MS dumpbin.
+  if ( test "$lt_cv_nm_interface" = "BSD nm" && file / ) >/dev/null 2>&1; then
+    lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL'
+    lt_cv_file_magic_cmd='func_win32_libid'
+  else
+    # Keep this pattern in sync with the one in func_win32_libid.
+    lt_cv_deplibs_check_method='file_magic file format (pei*-i386(.*architecture: i386)?|pe-arm-wince|pe-x86-64)'
+    lt_cv_file_magic_cmd='$OBJDUMP -f'
+  fi
+  ;;
+
+cegcc*)
+  # use the weaker test based on 'objdump'. See mingw*.
+  lt_cv_deplibs_check_method='file_magic file format pe-arm-.*little(.*architecture: arm)?'
+  lt_cv_file_magic_cmd='$OBJDUMP -f'
+  ;;
+
+darwin* | rhapsody*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+freebsd* | dragonfly*)
+  if echo __ELF__ | $CC -E - | $GREP __ELF__ > /dev/null; then
+    case $host_cpu in
+    i*86 )
+      # Not sure whether the presence of OpenBSD here was a mistake.
+      # Let's accept both of them until this is cleared up.
+      lt_cv_deplibs_check_method='file_magic (FreeBSD|OpenBSD|DragonFly)/i[[3-9]]86 (compact )?demand paged shared library'
+      lt_cv_file_magic_cmd=/usr/bin/file
+      lt_cv_file_magic_test_file=`echo /usr/lib/libc.so.*`
+      ;;
+    esac
+  else
+    lt_cv_deplibs_check_method=pass_all
+  fi
+  ;;
+
+haiku*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+hpux10.20* | hpux11*)
+  lt_cv_file_magic_cmd=/usr/bin/file
+  case $host_cpu in
+  ia64*)
+    lt_cv_deplibs_check_method='file_magic (s[[0-9]][[0-9]][[0-9]]|ELF-[[0-9]][[0-9]]) shared object file - IA64'
+    lt_cv_file_magic_test_file=/usr/lib/hpux32/libc.so
+    ;;
+  hppa*64*)
+    [lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF[ -][0-9][0-9])(-bit)?( [LM]SB)? shared object( file)?[, -]* PA-RISC [0-9]\.[0-9]']
+    lt_cv_file_magic_test_file=/usr/lib/pa20_64/libc.sl
+    ;;
+  *)
+    lt_cv_deplibs_check_method='file_magic (s[[0-9]][[0-9]][[0-9]]|PA-RISC[[0-9]]\.[[0-9]]) shared library'
+    lt_cv_file_magic_test_file=/usr/lib/libc.sl
+    ;;
+  esac
+  ;;
+
+interix[[3-9]]*)
+  # PIC code is broken on Interix 3.x, that's why |\.a not |_pic\.a here
+  lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so|\.a)$'
+  ;;
+
+irix5* | irix6* | nonstopux*)
+  case $LD in
+  *-32|*"-32 ") libmagic=32-bit;;
+  *-n32|*"-n32 ") libmagic=N32;;
+  *-64|*"-64 ") libmagic=64-bit;;
+  *) libmagic=never-match;;
+  esac
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+# This must be glibc/ELF.
+linux* | k*bsd*-gnu | kopensolaris*-gnu | gnu*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+netbsd* | netbsdelf*-gnu)
+  if echo __ELF__ | $CC -E - | $GREP __ELF__ > /dev/null; then
+    lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so\.[[0-9]]+\.[[0-9]]+|_pic\.a)$'
+  else
+    lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so|_pic\.a)$'
+  fi
+  ;;
+
+newos6*)
+  lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[ML]]SB (executable|dynamic lib)'
+  lt_cv_file_magic_cmd=/usr/bin/file
+  lt_cv_file_magic_test_file=/usr/lib/libnls.so
+  ;;
+
+*nto* | *qnx*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+openbsd*)
+  if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+    lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so\.[[0-9]]+\.[[0-9]]+|\.so|_pic\.a)$'
+  else
+    lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so\.[[0-9]]+\.[[0-9]]+|_pic\.a)$'
+  fi
+  ;;
+
+osf3* | osf4* | osf5*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+rdos*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+solaris*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+sysv4 | sysv4.3*)
+  case $host_vendor in
+  motorola)
+    lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[ML]]SB (shared object|dynamic lib) M[[0-9]][[0-9]]* Version [[0-9]]'
+    lt_cv_file_magic_test_file=`echo /usr/lib/libc.so*`
+    ;;
+  ncr)
+    lt_cv_deplibs_check_method=pass_all
+    ;;
+  sequent)
+    lt_cv_file_magic_cmd='/bin/file'
+    lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[LM]]SB (shared object|dynamic lib )'
+    ;;
+  sni)
+    lt_cv_file_magic_cmd='/bin/file'
+    lt_cv_deplibs_check_method="file_magic ELF [[0-9]][[0-9]]*-bit [[LM]]SB dynamic lib"
+    lt_cv_file_magic_test_file=/lib/libc.so
+    ;;
+  siemens)
+    lt_cv_deplibs_check_method=pass_all
+    ;;
+  pc)
+    lt_cv_deplibs_check_method=pass_all
+    ;;
+  esac
+  ;;
+
+tpf*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+esac
+])
+
+file_magic_glob=
+want_nocaseglob=no
+if test "$build" = "$host"; then
+  case $host_os in
+  mingw* | pw32*)
+    if ( shopt | grep nocaseglob ) >/dev/null 2>&1; then
+      want_nocaseglob=yes
+    else
+      file_magic_glob=`echo aAbBcCdDeEfFgGhHiIjJkKlLmMnNoOpPqQrRsStTuUvVwWxXyYzZ | $SED -e "s/\(..\)/s\/[[\1]]\/[[\1]]\/g;/g"`
+    fi
+    ;;
+  esac
+fi
+
+file_magic_cmd=$lt_cv_file_magic_cmd
+deplibs_check_method=$lt_cv_deplibs_check_method
+test -z "$deplibs_check_method" && deplibs_check_method=unknown
+
+_LT_DECL([], [deplibs_check_method], [1],
+    [Method to check whether dependent libraries are shared objects])
+_LT_DECL([], [file_magic_cmd], [1],
+    [Command to use when deplibs_check_method = "file_magic"])
+_LT_DECL([], [file_magic_glob], [1],
+    [How to find potential files when deplibs_check_method = "file_magic"])
+_LT_DECL([], [want_nocaseglob], [1],
+    [Find potential files using nocaseglob when deplibs_check_method = "file_magic"])
+])# _LT_CHECK_MAGIC_METHOD
+
+
+# LT_PATH_NM
+# ----------
+# find the pathname to a BSD- or MS-compatible name lister
+AC_DEFUN([LT_PATH_NM],
+[AC_REQUIRE([AC_PROG_CC])dnl
+AC_CACHE_CHECK([for BSD- or MS-compatible name lister (nm)], lt_cv_path_NM,
+[if test -n "$NM"; then
+  # Let the user override the test.
+  lt_cv_path_NM="$NM"
+else
+  lt_nm_to_check="${ac_tool_prefix}nm"
+  if test -n "$ac_tool_prefix" && test "$build" = "$host"; then
+    lt_nm_to_check="$lt_nm_to_check nm"
+  fi
+  for lt_tmp_nm in $lt_nm_to_check; do
+    lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+    for ac_dir in $PATH /usr/ccs/bin/elf /usr/ccs/bin /usr/ucb /bin; do
+      IFS="$lt_save_ifs"
+      test -z "$ac_dir" && ac_dir=.
+      tmp_nm="$ac_dir/$lt_tmp_nm"
+      if test -f "$tmp_nm" || test -f "$tmp_nm$ac_exeext" ; then
+	# Check to see if the nm accepts a BSD-compat flag.
+	# Adding the `sed 1q' prevents false positives on HP-UX, which says:
+	#   nm: unknown option "B" ignored
+	# Tru64's nm complains that /dev/null is an invalid object file
+	case `"$tmp_nm" -B /dev/null 2>&1 | sed '1q'` in
+	*/dev/null* | *'Invalid file or object type'*)
+	  lt_cv_path_NM="$tmp_nm -B"
+	  break
+	  ;;
+	*)
+	  case `"$tmp_nm" -p /dev/null 2>&1 | sed '1q'` in
+	  */dev/null*)
+	    lt_cv_path_NM="$tmp_nm -p"
+	    break
+	    ;;
+	  *)
+	    lt_cv_path_NM=${lt_cv_path_NM="$tmp_nm"} # keep the first match, but
+	    continue # so that we can try to find one that supports BSD flags
+	    ;;
+	  esac
+	  ;;
+	esac
+      fi
+    done
+    IFS="$lt_save_ifs"
+  done
+  : ${lt_cv_path_NM=no}
+fi])
+if test "$lt_cv_path_NM" != "no"; then
+  NM="$lt_cv_path_NM"
+else
+  # Didn't find any BSD compatible name lister, look for dumpbin.
+  if test -n "$DUMPBIN"; then :
+    # Let the user override the test.
+  else
+    AC_CHECK_TOOLS(DUMPBIN, [dumpbin "link -dump"], :)
+    case `$DUMPBIN -symbols /dev/null 2>&1 | sed '1q'` in
+    *COFF*)
+      DUMPBIN="$DUMPBIN -symbols"
+      ;;
+    *)
+      DUMPBIN=:
+      ;;
+    esac
+  fi
+  AC_SUBST([DUMPBIN])
+  if test "$DUMPBIN" != ":"; then
+    NM="$DUMPBIN"
+  fi
+fi
+test -z "$NM" && NM=nm
+AC_SUBST([NM])
+_LT_DECL([], [NM], [1], [A BSD- or MS-compatible name lister])dnl
+
+AC_CACHE_CHECK([the name lister ($NM) interface], [lt_cv_nm_interface],
+  [lt_cv_nm_interface="BSD nm"
+  echo "int some_variable = 0;" > conftest.$ac_ext
+  (eval echo "\"\$as_me:$LINENO: $ac_compile\"" >&AS_MESSAGE_LOG_FD)
+  (eval "$ac_compile" 2>conftest.err)
+  cat conftest.err >&AS_MESSAGE_LOG_FD
+  (eval echo "\"\$as_me:$LINENO: $NM \\\"conftest.$ac_objext\\\"\"" >&AS_MESSAGE_LOG_FD)
+  (eval "$NM \"conftest.$ac_objext\"" 2>conftest.err > conftest.out)
+  cat conftest.err >&AS_MESSAGE_LOG_FD
+  (eval echo "\"\$as_me:$LINENO: output\"" >&AS_MESSAGE_LOG_FD)
+  cat conftest.out >&AS_MESSAGE_LOG_FD
+  if $GREP 'External.*some_variable' conftest.out > /dev/null; then
+    lt_cv_nm_interface="MS dumpbin"
+  fi
+  rm -f conftest*])
+])# LT_PATH_NM
+
+# Old names:
+AU_ALIAS([AM_PROG_NM], [LT_PATH_NM])
+AU_ALIAS([AC_PROG_NM], [LT_PATH_NM])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AM_PROG_NM], [])
+dnl AC_DEFUN([AC_PROG_NM], [])
+
+# _LT_CHECK_SHAREDLIB_FROM_LINKLIB
+# --------------------------------
+# how to determine the name of the shared library
+# associated with a specific link library.
+#  -- PORTME fill in with the dynamic library characteristics
+m4_defun([_LT_CHECK_SHAREDLIB_FROM_LINKLIB],
+[m4_require([_LT_DECL_EGREP])
+m4_require([_LT_DECL_OBJDUMP])
+m4_require([_LT_DECL_DLLTOOL])
+AC_CACHE_CHECK([how to associate runtime and link libraries],
+lt_cv_sharedlib_from_linklib_cmd,
+[lt_cv_sharedlib_from_linklib_cmd='unknown'
+
+case $host_os in
+cygwin* | mingw* | pw32* | cegcc*)
+  # two different shell functions defined in ltmain.sh
+  # decide which to use based on capabilities of $DLLTOOL
+  case `$DLLTOOL --help 2>&1` in
+  *--identify-strict*)
+    lt_cv_sharedlib_from_linklib_cmd=func_cygming_dll_for_implib
+    ;;
+  *)
+    lt_cv_sharedlib_from_linklib_cmd=func_cygming_dll_for_implib_fallback
+    ;;
+  esac
+  ;;
+*)
+  # fallback: assume linklib IS sharedlib
+  lt_cv_sharedlib_from_linklib_cmd="$ECHO"
+  ;;
+esac
+])
+sharedlib_from_linklib_cmd=$lt_cv_sharedlib_from_linklib_cmd
+test -z "$sharedlib_from_linklib_cmd" && sharedlib_from_linklib_cmd=$ECHO
+
+_LT_DECL([], [sharedlib_from_linklib_cmd], [1],
+    [Command to associate shared and link libraries])
+])# _LT_CHECK_SHAREDLIB_FROM_LINKLIB
+
+
+# _LT_PATH_MANIFEST_TOOL
+# ----------------------
+# locate the manifest tool
+m4_defun([_LT_PATH_MANIFEST_TOOL],
+[AC_CHECK_TOOL(MANIFEST_TOOL, mt, :)
+test -z "$MANIFEST_TOOL" && MANIFEST_TOOL=mt
+AC_CACHE_CHECK([if $MANIFEST_TOOL is a manifest tool], [lt_cv_path_mainfest_tool],
+  [lt_cv_path_mainfest_tool=no
+  echo "$as_me:$LINENO: $MANIFEST_TOOL '-?'" >&AS_MESSAGE_LOG_FD
+  $MANIFEST_TOOL '-?' 2>conftest.err > conftest.out
+  cat conftest.err >&AS_MESSAGE_LOG_FD
+  if $GREP 'Manifest Tool' conftest.out > /dev/null; then
+    lt_cv_path_mainfest_tool=yes
+  fi
+  rm -f conftest*])
+if test "x$lt_cv_path_mainfest_tool" != xyes; then
+  MANIFEST_TOOL=:
+fi
+_LT_DECL([], [MANIFEST_TOOL], [1], [Manifest tool])dnl
+])# _LT_PATH_MANIFEST_TOOL
+
+
+# LT_LIB_M
+# --------
+# check for math library
+AC_DEFUN([LT_LIB_M],
+[AC_REQUIRE([AC_CANONICAL_HOST])dnl
+LIBM=
+case $host in
+*-*-beos* | *-*-cegcc* | *-*-cygwin* | *-*-haiku* | *-*-pw32* | *-*-darwin*)
+  # These system don't have libm, or don't need it
+  ;;
+*-ncr-sysv4.3*)
+  AC_CHECK_LIB(mw, _mwvalidcheckl, LIBM="-lmw")
+  AC_CHECK_LIB(m, cos, LIBM="$LIBM -lm")
+  ;;
+*)
+  AC_CHECK_LIB(m, cos, LIBM="-lm")
+  ;;
+esac
+AC_SUBST([LIBM])
+])# LT_LIB_M
+
+# Old name:
+AU_ALIAS([AC_CHECK_LIBM], [LT_LIB_M])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_CHECK_LIBM], [])
+
+
+# _LT_COMPILER_NO_RTTI([TAGNAME])
+# -------------------------------
+m4_defun([_LT_COMPILER_NO_RTTI],
+[m4_require([_LT_TAG_COMPILER])dnl
+
+_LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=
+
+if test "$GCC" = yes; then
+  case $cc_basename in
+  nvcc*)
+    _LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=' -Xcompiler -fno-builtin' ;;
+  *)
+    _LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=' -fno-builtin' ;;
+  esac
+
+  _LT_COMPILER_OPTION([if $compiler supports -fno-rtti -fno-exceptions],
+    lt_cv_prog_compiler_rtti_exceptions,
+    [-fno-rtti -fno-exceptions], [],
+    [_LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)="$_LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1) -fno-rtti -fno-exceptions"])
+fi
+_LT_TAGDECL([no_builtin_flag], [lt_prog_compiler_no_builtin_flag], [1],
+	[Compiler flag to turn off builtin functions])
+])# _LT_COMPILER_NO_RTTI
+
+
+# _LT_CMD_GLOBAL_SYMBOLS
+# ----------------------
+m4_defun([_LT_CMD_GLOBAL_SYMBOLS],
+[AC_REQUIRE([AC_CANONICAL_HOST])dnl
+AC_REQUIRE([AC_PROG_CC])dnl
+AC_REQUIRE([AC_PROG_AWK])dnl
+AC_REQUIRE([LT_PATH_NM])dnl
+AC_REQUIRE([LT_PATH_LD])dnl
+m4_require([_LT_DECL_SED])dnl
+m4_require([_LT_DECL_EGREP])dnl
+m4_require([_LT_TAG_COMPILER])dnl
+
+# Check for command to grab the raw symbol name followed by C symbol from nm.
+AC_MSG_CHECKING([command to parse $NM output from $compiler object])
+AC_CACHE_VAL([lt_cv_sys_global_symbol_pipe],
+[
+# These are sane defaults that work on at least a few old systems.
+# [They come from Ultrix.  What could be older than Ultrix?!! ;)]
+
+# Character class describing NM global symbol codes.
+symcode='[[BCDEGRST]]'
+
+# Regexp to match symbols that can be accessed directly from C.
+sympat='\([[_A-Za-z]][[_A-Za-z0-9]]*\)'
+
+# Define system-specific variables.
+case $host_os in
+aix*)
+  symcode='[[BCDT]]'
+  ;;
+cygwin* | mingw* | pw32* | cegcc*)
+  symcode='[[ABCDGISTW]]'
+  ;;
+hpux*)
+  if test "$host_cpu" = ia64; then
+    symcode='[[ABCDEGRST]]'
+  fi
+  ;;
+irix* | nonstopux*)
+  symcode='[[BCDEGRST]]'
+  ;;
+osf*)
+  symcode='[[BCDEGQRST]]'
+  ;;
+solaris*)
+  symcode='[[BDRT]]'
+  ;;
+sco3.2v5*)
+  symcode='[[DT]]'
+  ;;
+sysv4.2uw2*)
+  symcode='[[DT]]'
+  ;;
+sysv5* | sco5v6* | unixware* | OpenUNIX*)
+  symcode='[[ABDT]]'
+  ;;
+sysv4)
+  symcode='[[DFNSTU]]'
+  ;;
+esac
+
+# If we're using GNU nm, then use its standard symbol codes.
+case `$NM -V 2>&1` in
+*GNU* | *'with BFD'*)
+  symcode='[[ABCDGIRSTW]]' ;;
+esac
+
+# Transform an extracted symbol line into a proper C declaration.
+# Some systems (esp. on ia64) link data and code symbols differently,
+# so use this general approach.
+lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^T .* \(.*\)$/extern int \1();/p' -e 's/^$symcode* .* \(.*\)$/extern char \1;/p'"
+
+# Transform an extracted symbol line into symbol name and symbol address
+lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([[^ ]]*\)[[ ]]*$/  {\\\"\1\\\", (void *) 0},/p' -e 's/^$symcode* \([[^ ]]*\) \([[^ ]]*\)$/  {\"\2\", (void *) \&\2},/p'"
+lt_cv_sys_global_symbol_to_c_name_address_lib_prefix="sed -n -e 's/^: \([[^ ]]*\)[[ ]]*$/  {\\\"\1\\\", (void *) 0},/p' -e 's/^$symcode* \([[^ ]]*\) \(lib[[^ ]]*\)$/  {\"\2\", (void *) \&\2},/p' -e 's/^$symcode* \([[^ ]]*\) \([[^ ]]*\)$/  {\"lib\2\", (void *) \&\2},/p'"
+
+# Handle CRLF in mingw tool chain
+opt_cr=
+case $build_os in
+mingw*)
+  opt_cr=`$ECHO 'x\{0,1\}' | tr x '\015'` # option cr in regexp
+  ;;
+esac
+
+# Try without a prefix underscore, then with it.
+for ac_symprfx in "" "_"; do
+
+  # Transform symcode, sympat, and symprfx into a raw symbol and a C symbol.
+  symxfrm="\\1 $ac_symprfx\\2 \\2"
+
+  # Write the raw and C identifiers.
+  if test "$lt_cv_nm_interface" = "MS dumpbin"; then
+    # Fake it for dumpbin and say T for any non-static function
+    # and D for any global variable.
+    # Also find C++ and __fastcall symbols from MSVC++,
+    # which start with @ or ?.
+    lt_cv_sys_global_symbol_pipe="$AWK ['"\
+"     {last_section=section; section=\$ 3};"\
+"     /^COFF SYMBOL TABLE/{for(i in hide) delete hide[i]};"\
+"     /Section length .*#relocs.*(pick any)/{hide[last_section]=1};"\
+"     \$ 0!~/External *\|/{next};"\
+"     / 0+ UNDEF /{next}; / UNDEF \([^|]\)*()/{next};"\
+"     {if(hide[section]) next};"\
+"     {f=0}; \$ 0~/\(\).*\|/{f=1}; {printf f ? \"T \" : \"D \"};"\
+"     {split(\$ 0, a, /\||\r/); split(a[2], s)};"\
+"     s[1]~/^[@?]/{print s[1], s[1]; next};"\
+"     s[1]~prfx {split(s[1],t,\"@\"); print t[1], substr(t[1],length(prfx))}"\
+"     ' prfx=^$ac_symprfx]"
+  else
+    lt_cv_sys_global_symbol_pipe="sed -n -e 's/^.*[[	 ]]\($symcode$symcode*\)[[	 ]][[	 ]]*$ac_symprfx$sympat$opt_cr$/$symxfrm/p'"
+  fi
+  lt_cv_sys_global_symbol_pipe="$lt_cv_sys_global_symbol_pipe | sed '/ __gnu_lto/d'"
+
+  # Check to see that the pipe works correctly.
+  pipe_works=no
+
+  rm -f conftest*
+  cat > conftest.$ac_ext <<_LT_EOF
+#ifdef __cplusplus
+extern "C" {
+#endif
+char nm_test_var;
+void nm_test_func(void);
+void nm_test_func(void){}
+#ifdef __cplusplus
+}
+#endif
+int main(){nm_test_var='a';nm_test_func();return(0);}
+_LT_EOF
+
+  if AC_TRY_EVAL(ac_compile); then
+    # Now try to grab the symbols.
+    nlist=conftest.nm
+    if AC_TRY_EVAL(NM conftest.$ac_objext \| "$lt_cv_sys_global_symbol_pipe" \> $nlist) && test -s "$nlist"; then
+      # Try sorting and uniquifying the output.
+      if sort "$nlist" | uniq > "$nlist"T; then
+	mv -f "$nlist"T "$nlist"
+      else
+	rm -f "$nlist"T
+      fi
+
+      # Make sure that we snagged all the symbols we need.
+      if $GREP ' nm_test_var$' "$nlist" >/dev/null; then
+	if $GREP ' nm_test_func$' "$nlist" >/dev/null; then
+	  cat <<_LT_EOF > conftest.$ac_ext
+/* Keep this code in sync between libtool.m4, ltmain, lt_system.h, and tests.  */
+#if defined(_WIN32) || defined(__CYGWIN__) || defined(_WIN32_WCE)
+/* DATA imports from DLLs on WIN32 con't be const, because runtime
+   relocations are performed -- see ld's documentation on pseudo-relocs.  */
+# define LT@&t at _DLSYM_CONST
+#elif defined(__osf__)
+/* This system does not cope well with relocations in const data.  */
+# define LT@&t at _DLSYM_CONST
+#else
+# define LT@&t at _DLSYM_CONST const
+#endif
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+_LT_EOF
+	  # Now generate the symbol file.
+	  eval "$lt_cv_sys_global_symbol_to_cdecl"' < "$nlist" | $GREP -v main >> conftest.$ac_ext'
+
+	  cat <<_LT_EOF >> conftest.$ac_ext
+
+/* The mapping between symbol names and symbols.  */
+LT@&t at _DLSYM_CONST struct {
+  const char *name;
+  void       *address;
+}
+lt__PROGRAM__LTX_preloaded_symbols[[]] =
+{
+  { "@PROGRAM@", (void *) 0 },
+_LT_EOF
+	  $SED "s/^$symcode$symcode* \(.*\) \(.*\)$/  {\"\2\", (void *) \&\2},/" < "$nlist" | $GREP -v main >> conftest.$ac_ext
+	  cat <<\_LT_EOF >> conftest.$ac_ext
+  {0, (void *) 0}
+};
+
+/* This works around a problem in FreeBSD linker */
+#ifdef FREEBSD_WORKAROUND
+static const void *lt_preloaded_setup() {
+  return lt__PROGRAM__LTX_preloaded_symbols;
+}
+#endif
+
+#ifdef __cplusplus
+}
+#endif
+_LT_EOF
+	  # Now try linking the two files.
+	  mv conftest.$ac_objext conftstm.$ac_objext
+	  lt_globsym_save_LIBS=$LIBS
+	  lt_globsym_save_CFLAGS=$CFLAGS
+	  LIBS="conftstm.$ac_objext"
+	  CFLAGS="$CFLAGS$_LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)"
+	  if AC_TRY_EVAL(ac_link) && test -s conftest${ac_exeext}; then
+	    pipe_works=yes
+	  fi
+	  LIBS=$lt_globsym_save_LIBS
+	  CFLAGS=$lt_globsym_save_CFLAGS
+	else
+	  echo "cannot find nm_test_func in $nlist" >&AS_MESSAGE_LOG_FD
+	fi
+      else
+	echo "cannot find nm_test_var in $nlist" >&AS_MESSAGE_LOG_FD
+      fi
+    else
+      echo "cannot run $lt_cv_sys_global_symbol_pipe" >&AS_MESSAGE_LOG_FD
+    fi
+  else
+    echo "$progname: failed program was:" >&AS_MESSAGE_LOG_FD
+    cat conftest.$ac_ext >&5
+  fi
+  rm -rf conftest* conftst*
+
+  # Do not use the global_symbol_pipe unless it works.
+  if test "$pipe_works" = yes; then
+    break
+  else
+    lt_cv_sys_global_symbol_pipe=
+  fi
+done
+])
+if test -z "$lt_cv_sys_global_symbol_pipe"; then
+  lt_cv_sys_global_symbol_to_cdecl=
+fi
+if test -z "$lt_cv_sys_global_symbol_pipe$lt_cv_sys_global_symbol_to_cdecl"; then
+  AC_MSG_RESULT(failed)
+else
+  AC_MSG_RESULT(ok)
+fi
+
+# Response file support.
+if test "$lt_cv_nm_interface" = "MS dumpbin"; then
+  nm_file_list_spec='@'
+elif $NM --help 2>/dev/null | grep '[[@]]FILE' >/dev/null; then
+  nm_file_list_spec='@'
+fi
+
+_LT_DECL([global_symbol_pipe], [lt_cv_sys_global_symbol_pipe], [1],
+    [Take the output of nm and produce a listing of raw symbols and C names])
+_LT_DECL([global_symbol_to_cdecl], [lt_cv_sys_global_symbol_to_cdecl], [1],
+    [Transform the output of nm in a proper C declaration])
+_LT_DECL([global_symbol_to_c_name_address],
+    [lt_cv_sys_global_symbol_to_c_name_address], [1],
+    [Transform the output of nm in a C name address pair])
+_LT_DECL([global_symbol_to_c_name_address_lib_prefix],
+    [lt_cv_sys_global_symbol_to_c_name_address_lib_prefix], [1],
+    [Transform the output of nm in a C name address pair when lib prefix is needed])
+_LT_DECL([], [nm_file_list_spec], [1],
+    [Specify filename containing input files for $NM])
+]) # _LT_CMD_GLOBAL_SYMBOLS
+
+
+# _LT_COMPILER_PIC([TAGNAME])
+# ---------------------------
+m4_defun([_LT_COMPILER_PIC],
+[m4_require([_LT_TAG_COMPILER])dnl
+_LT_TAGVAR(lt_prog_compiler_wl, $1)=
+_LT_TAGVAR(lt_prog_compiler_pic, $1)=
+_LT_TAGVAR(lt_prog_compiler_static, $1)=
+
+m4_if([$1], [CXX], [
+  # C++ specific cases for pic, static, wl, etc.
+  if test "$GXX" = yes; then
+    _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+    _LT_TAGVAR(lt_prog_compiler_static, $1)='-static'
+
+    case $host_os in
+    aix*)
+      # All AIX code is PIC.
+      if test "$host_cpu" = ia64; then
+	# AIX 5 now supports IA64 processor
+	_LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+      fi
+      ;;
+
+    amigaos*)
+      case $host_cpu in
+      powerpc)
+            # see comment about AmigaOS4 .so support
+            _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+        ;;
+      m68k)
+            # FIXME: we need at least 68020 code to build shared libraries, but
+            # adding the `-m68020' flag to GCC prevents building anything better,
+            # like `-m68040'.
+            _LT_TAGVAR(lt_prog_compiler_pic, $1)='-m68020 -resident32 -malways-restore-a4'
+        ;;
+      esac
+      ;;
+
+    beos* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*)
+      # PIC is the default for these OSes.
+      ;;
+    mingw* | cygwin* | os2* | pw32* | cegcc*)
+      # This hack is so that the source file can tell whether it is being
+      # built for inclusion in a dll (and should export symbols for example).
+      # Although the cygwin gcc ignores -fPIC, still need this for old-style
+      # (--disable-auto-import) libraries
+      m4_if([$1], [GCJ], [],
+	[_LT_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT'])
+      ;;
+    darwin* | rhapsody*)
+      # PIC is the default on this platform
+      # Common symbols not allowed in MH_DYLIB files
+      _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fno-common'
+      ;;
+    *djgpp*)
+      # DJGPP does not support shared libraries at all
+      _LT_TAGVAR(lt_prog_compiler_pic, $1)=
+      ;;
+    haiku*)
+      # PIC is the default for Haiku.
+      # The "-static" flag exists, but is broken.
+      _LT_TAGVAR(lt_prog_compiler_static, $1)=
+      ;;
+    interix[[3-9]]*)
+      # Interix 3.x gcc -fpic/-fPIC options generate broken code.
+      # Instead, we relocate shared libraries at runtime.
+      ;;
+    sysv4*MP*)
+      if test -d /usr/nec; then
+	_LT_TAGVAR(lt_prog_compiler_pic, $1)=-Kconform_pic
+      fi
+      ;;
+    hpux*)
+      # PIC is the default for 64-bit PA HP-UX, but not for 32-bit
+      # PA HP-UX.  On IA64 HP-UX, PIC is the default but the pic flag
+      # sets the default TLS model and affects inlining.
+      case $host_cpu in
+      hppa*64*)
+	;;
+      *)
+	_LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+	;;
+      esac
+      ;;
+    *qnx* | *nto*)
+      # QNX uses GNU C++, but need to define -shared option too, otherwise
+      # it will coredump.
+      _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC -shared'
+      ;;
+    *)
+      _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+      ;;
+    esac
+  else
+    case $host_os in
+      aix[[4-9]]*)
+	# All AIX code is PIC.
+	if test "$host_cpu" = ia64; then
+	  # AIX 5 now supports IA64 processor
+	  _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+	else
+	  _LT_TAGVAR(lt_prog_compiler_static, $1)='-bnso -bI:/lib/syscalls.exp'
+	fi
+	;;
+      chorus*)
+	case $cc_basename in
+	cxch68*)
+	  # Green Hills C++ Compiler
+	  # _LT_TAGVAR(lt_prog_compiler_static, $1)="--no_auto_instantiation -u __main -u __premain -u _abort -r $COOL_DIR/lib/libOrb.a $MVME_DIR/lib/CC/libC.a $MVME_DIR/lib/classix/libcx.s.a"
+	  ;;
+	esac
+	;;
+      mingw* | cygwin* | os2* | pw32* | cegcc*)
+	# This hack is so that the source file can tell whether it is being
+	# built for inclusion in a dll (and should export symbols for example).
+	m4_if([$1], [GCJ], [],
+	  [_LT_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT'])
+	;;
+      dgux*)
+	case $cc_basename in
+	  ec++*)
+	    _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+	    ;;
+	  ghcx*)
+	    # Green Hills C++ Compiler
+	    _LT_TAGVAR(lt_prog_compiler_pic, $1)='-pic'
+	    ;;
+	  *)
+	    ;;
+	esac
+	;;
+      freebsd* | dragonfly*)
+	# FreeBSD uses GNU C++
+	;;
+      hpux9* | hpux10* | hpux11*)
+	case $cc_basename in
+	  CC*)
+	    _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+	    _LT_TAGVAR(lt_prog_compiler_static, $1)='${wl}-a ${wl}archive'
+	    if test "$host_cpu" != ia64; then
+	      _LT_TAGVAR(lt_prog_compiler_pic, $1)='+Z'
+	    fi
+	    ;;
+	  aCC*)
+	    _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+	    _LT_TAGVAR(lt_prog_compiler_static, $1)='${wl}-a ${wl}archive'
+	    case $host_cpu in
+	    hppa*64*|ia64*)
+	      # +Z the default
+	      ;;
+	    *)
+	      _LT_TAGVAR(lt_prog_compiler_pic, $1)='+Z'
+	      ;;
+	    esac
+	    ;;
+	  *)
+	    ;;
+	esac
+	;;
+      interix*)
+	# This is c89, which is MS Visual C++ (no shared libs)
+	# Anyone wants to do a port?
+	;;
+      irix5* | irix6* | nonstopux*)
+	case $cc_basename in
+	  CC*)
+	    _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+	    _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+	    # CC pic flag -KPIC is the default.
+	    ;;
+	  *)
+	    ;;
+	esac
+	;;
+      linux* | k*bsd*-gnu | kopensolaris*-gnu | gnu*)
+	case $cc_basename in
+	  KCC*)
+	    # KAI C++ Compiler
+	    _LT_TAGVAR(lt_prog_compiler_wl, $1)='--backend -Wl,'
+	    _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+	    ;;
+	  ecpc* )
+	    # old Intel C++ for x86_64 which still supported -KPIC.
+	    _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+	    _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+	    _LT_TAGVAR(lt_prog_compiler_static, $1)='-static'
+	    ;;
+	  icpc* )
+	    # Intel C++, used to be incompatible with GCC.
+	    # ICC 10 doesn't accept -KPIC any more.
+	    _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+	    _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+	    _LT_TAGVAR(lt_prog_compiler_static, $1)='-static'
+	    ;;
+	  pgCC* | pgcpp*)
+	    # Portland Group C++ compiler
+	    _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+	    _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fpic'
+	    _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+	    ;;
+	  cxx*)
+	    # Compaq C++
+	    # Make sure the PIC flag is empty.  It appears that all Alpha
+	    # Linux and Compaq Tru64 Unix objects are PIC.
+	    _LT_TAGVAR(lt_prog_compiler_pic, $1)=
+	    _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+	    ;;
+	  xlc* | xlC* | bgxl[[cC]]* | mpixl[[cC]]*)
+	    # IBM XL 8.0, 9.0 on PPC and BlueGene
+	    _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+	    _LT_TAGVAR(lt_prog_compiler_pic, $1)='-qpic'
+	    _LT_TAGVAR(lt_prog_compiler_static, $1)='-qstaticlink'
+	    ;;
+	  *)
+	    case `$CC -V 2>&1 | sed 5q` in
+	    *Sun\ C*)
+	      # Sun C++ 5.9
+	      _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+	      _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+	      _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld '
+	      ;;
+	    esac
+	    ;;
+	esac
+	;;
+      lynxos*)
+	;;
+      m88k*)
+	;;
+      mvs*)
+	case $cc_basename in
+	  cxx*)
+	    _LT_TAGVAR(lt_prog_compiler_pic, $1)='-W c,exportall'
+	    ;;
+	  *)
+	    ;;
+	esac
+	;;
+      netbsd* | netbsdelf*-gnu)
+	;;
+      *qnx* | *nto*)
+        # QNX uses GNU C++, but need to define -shared option too, otherwise
+        # it will coredump.
+        _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC -shared'
+        ;;
+      osf3* | osf4* | osf5*)
+	case $cc_basename in
+	  KCC*)
+	    _LT_TAGVAR(lt_prog_compiler_wl, $1)='--backend -Wl,'
+	    ;;
+	  RCC*)
+	    # Rational C++ 2.4.1
+	    _LT_TAGVAR(lt_prog_compiler_pic, $1)='-pic'
+	    ;;
+	  cxx*)
+	    # Digital/Compaq C++
+	    _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+	    # Make sure the PIC flag is empty.  It appears that all Alpha
+	    # Linux and Compaq Tru64 Unix objects are PIC.
+	    _LT_TAGVAR(lt_prog_compiler_pic, $1)=
+	    _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+	    ;;
+	  *)
+	    ;;
+	esac
+	;;
+      psos*)
+	;;
+      solaris*)
+	case $cc_basename in
+	  CC* | sunCC*)
+	    # Sun C++ 4.2, 5.x and Centerline C++
+	    _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+	    _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+	    _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld '
+	    ;;
+	  gcx*)
+	    # Green Hills C++ Compiler
+	    _LT_TAGVAR(lt_prog_compiler_pic, $1)='-PIC'
+	    ;;
+	  *)
+	    ;;
+	esac
+	;;
+      sunos4*)
+	case $cc_basename in
+	  CC*)
+	    # Sun C++ 4.x
+	    _LT_TAGVAR(lt_prog_compiler_pic, $1)='-pic'
+	    _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+	    ;;
+	  lcc*)
+	    # Lucid
+	    _LT_TAGVAR(lt_prog_compiler_pic, $1)='-pic'
+	    ;;
+	  *)
+	    ;;
+	esac
+	;;
+      sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*)
+	case $cc_basename in
+	  CC*)
+	    _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+	    _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+	    _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+	    ;;
+	esac
+	;;
+      tandem*)
+	case $cc_basename in
+	  NCC*)
+	    # NonStop-UX NCC 3.20
+	    _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+	    ;;
+	  *)
+	    ;;
+	esac
+	;;
+      vxworks*)
+	;;
+      *)
+	_LT_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no
+	;;
+    esac
+  fi
+],
+[
+  if test "$GCC" = yes; then
+    _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+    _LT_TAGVAR(lt_prog_compiler_static, $1)='-static'
+
+    case $host_os in
+      aix*)
+      # All AIX code is PIC.
+      if test "$host_cpu" = ia64; then
+	# AIX 5 now supports IA64 processor
+	_LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+      fi
+      ;;
+
+    amigaos*)
+      case $host_cpu in
+      powerpc)
+            # see comment about AmigaOS4 .so support
+            _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+        ;;
+      m68k)
+            # FIXME: we need at least 68020 code to build shared libraries, but
+            # adding the `-m68020' flag to GCC prevents building anything better,
+            # like `-m68040'.
+            _LT_TAGVAR(lt_prog_compiler_pic, $1)='-m68020 -resident32 -malways-restore-a4'
+        ;;
+      esac
+      ;;
+
+    beos* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*)
+      # PIC is the default for these OSes.
+      ;;
+
+    mingw* | cygwin* | pw32* | os2* | cegcc*)
+      # This hack is so that the source file can tell whether it is being
+      # built for inclusion in a dll (and should export symbols for example).
+      # Although the cygwin gcc ignores -fPIC, still need this for old-style
+      # (--disable-auto-import) libraries
+      m4_if([$1], [GCJ], [],
+	[_LT_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT'])
+      ;;
+
+    darwin* | rhapsody*)
+      # PIC is the default on this platform
+      # Common symbols not allowed in MH_DYLIB files
+      _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fno-common'
+      ;;
+
+    haiku*)
+      # PIC is the default for Haiku.
+      # The "-static" flag exists, but is broken.
+      _LT_TAGVAR(lt_prog_compiler_static, $1)=
+      ;;
+
+    hpux*)
+      # PIC is the default for 64-bit PA HP-UX, but not for 32-bit
+      # PA HP-UX.  On IA64 HP-UX, PIC is the default but the pic flag
+      # sets the default TLS model and affects inlining.
+      case $host_cpu in
+      hppa*64*)
+	# +Z the default
+	;;
+      *)
+	_LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+	;;
+      esac
+      ;;
+
+    interix[[3-9]]*)
+      # Interix 3.x gcc -fpic/-fPIC options generate broken code.
+      # Instead, we relocate shared libraries at runtime.
+      ;;
+
+    msdosdjgpp*)
+      # Just because we use GCC doesn't mean we suddenly get shared libraries
+      # on systems that don't support them.
+      _LT_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no
+      enable_shared=no
+      ;;
+
+    *nto* | *qnx*)
+      # QNX uses GNU C++, but need to define -shared option too, otherwise
+      # it will coredump.
+      _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC -shared'
+      ;;
+
+    sysv4*MP*)
+      if test -d /usr/nec; then
+	_LT_TAGVAR(lt_prog_compiler_pic, $1)=-Kconform_pic
+      fi
+      ;;
+
+    *)
+      _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+      ;;
+    esac
+
+    case $cc_basename in
+    nvcc*) # Cuda Compiler Driver 2.2
+      _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Xlinker '
+      if test -n "$_LT_TAGVAR(lt_prog_compiler_pic, $1)"; then
+        _LT_TAGVAR(lt_prog_compiler_pic, $1)="-Xcompiler $_LT_TAGVAR(lt_prog_compiler_pic, $1)"
+      fi
+      ;;
+    esac
+  else
+    # PORTME Check for flag to pass linker flags through the system compiler.
+    case $host_os in
+    aix*)
+      _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+      if test "$host_cpu" = ia64; then
+	# AIX 5 now supports IA64 processor
+	_LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+      else
+	_LT_TAGVAR(lt_prog_compiler_static, $1)='-bnso -bI:/lib/syscalls.exp'
+      fi
+      ;;
+
+    mingw* | cygwin* | pw32* | os2* | cegcc*)
+      # This hack is so that the source file can tell whether it is being
+      # built for inclusion in a dll (and should export symbols for example).
+      m4_if([$1], [GCJ], [],
+	[_LT_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT'])
+      ;;
+
+    hpux9* | hpux10* | hpux11*)
+      _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+      # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but
+      # not for PA HP-UX.
+      case $host_cpu in
+      hppa*64*|ia64*)
+	# +Z the default
+	;;
+      *)
+	_LT_TAGVAR(lt_prog_compiler_pic, $1)='+Z'
+	;;
+      esac
+      # Is there a better lt_prog_compiler_static that works with the bundled CC?
+      _LT_TAGVAR(lt_prog_compiler_static, $1)='${wl}-a ${wl}archive'
+      ;;
+
+    irix5* | irix6* | nonstopux*)
+      _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+      # PIC (with -KPIC) is the default.
+      _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+      ;;
+
+    linux* | k*bsd*-gnu | kopensolaris*-gnu | gnu*)
+      case $cc_basename in
+      # old Intel for x86_64 which still supported -KPIC.
+      ecc*)
+	_LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+	_LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+	_LT_TAGVAR(lt_prog_compiler_static, $1)='-static'
+        ;;
+      # icc used to be incompatible with GCC.
+      # ICC 10 doesn't accept -KPIC any more.
+      icc* | ifort*)
+	_LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+	_LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+	_LT_TAGVAR(lt_prog_compiler_static, $1)='-static'
+        ;;
+      # Lahey Fortran 8.1.
+      lf95*)
+	_LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+	_LT_TAGVAR(lt_prog_compiler_pic, $1)='--shared'
+	_LT_TAGVAR(lt_prog_compiler_static, $1)='--static'
+	;;
+      nagfor*)
+	# NAG Fortran compiler
+	_LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,-Wl,,'
+	_LT_TAGVAR(lt_prog_compiler_pic, $1)='-PIC'
+	_LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+	;;
+      pgcc* | pgf77* | pgf90* | pgf95* | pgfortran*)
+        # Portland Group compilers (*not* the Pentium gcc compiler,
+	# which looks to be a dead project)
+	_LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+	_LT_TAGVAR(lt_prog_compiler_pic, $1)='-fpic'
+	_LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+        ;;
+      ccc*)
+        _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+        # All Alpha code is PIC.
+        _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+        ;;
+      xl* | bgxl* | bgf* | mpixl*)
+	# IBM XL C 8.0/Fortran 10.1, 11.1 on PPC and BlueGene
+	_LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+	_LT_TAGVAR(lt_prog_compiler_pic, $1)='-qpic'
+	_LT_TAGVAR(lt_prog_compiler_static, $1)='-qstaticlink'
+	;;
+      *)
+	case `$CC -V 2>&1 | sed 5q` in
+	*Sun\ Ceres\ Fortran* | *Sun*Fortran*\ [[1-7]].* | *Sun*Fortran*\ 8.[[0-3]]*)
+	  # Sun Fortran 8.3 passes all unrecognized flags to the linker
+	  _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+	  _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+	  _LT_TAGVAR(lt_prog_compiler_wl, $1)=''
+	  ;;
+	*Sun\ F* | *Sun*Fortran*)
+	  _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+	  _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+	  _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld '
+	  ;;
+	*Sun\ C*)
+	  # Sun C 5.9
+	  _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+	  _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+	  _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+	  ;;
+        *Intel*\ [[CF]]*Compiler*)
+	  _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+	  _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+	  _LT_TAGVAR(lt_prog_compiler_static, $1)='-static'
+	  ;;
+	*Portland\ Group*)
+	  _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+	  _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fpic'
+	  _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+	  ;;
+	esac
+	;;
+      esac
+      ;;
+
+    newsos6)
+      _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+      _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+      ;;
+
+    *nto* | *qnx*)
+      # QNX uses GNU C++, but need to define -shared option too, otherwise
+      # it will coredump.
+      _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC -shared'
+      ;;
+
+    osf3* | osf4* | osf5*)
+      _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+      # All OSF/1 code is PIC.
+      _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+      ;;
+
+    rdos*)
+      _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+      ;;
+
+    solaris*)
+      _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+      _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+      case $cc_basename in
+      f77* | f90* | f95* | sunf77* | sunf90* | sunf95*)
+	_LT_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld ';;
+      *)
+	_LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,';;
+      esac
+      ;;
+
+    sunos4*)
+      _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld '
+      _LT_TAGVAR(lt_prog_compiler_pic, $1)='-PIC'
+      _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+      ;;
+
+    sysv4 | sysv4.2uw2* | sysv4.3*)
+      _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+      _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+      _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+      ;;
+
+    sysv4*MP*)
+      if test -d /usr/nec ;then
+	_LT_TAGVAR(lt_prog_compiler_pic, $1)='-Kconform_pic'
+	_LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+      fi
+      ;;
+
+    sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*)
+      _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+      _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+      _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+      ;;
+
+    unicos*)
+      _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+      _LT_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no
+      ;;
+
+    uts4*)
+      _LT_TAGVAR(lt_prog_compiler_pic, $1)='-pic'
+      _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+      ;;
+
+    *)
+      _LT_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no
+      ;;
+    esac
+  fi
+])
+case $host_os in
+  # For platforms which do not support PIC, -DPIC is meaningless:
+  *djgpp*)
+    _LT_TAGVAR(lt_prog_compiler_pic, $1)=
+    ;;
+  *)
+    _LT_TAGVAR(lt_prog_compiler_pic, $1)="$_LT_TAGVAR(lt_prog_compiler_pic, $1)@&t at m4_if([$1],[],[ -DPIC],[m4_if([$1],[CXX],[ -DPIC],[])])"
+    ;;
+esac
+
+AC_CACHE_CHECK([for $compiler option to produce PIC],
+  [_LT_TAGVAR(lt_cv_prog_compiler_pic, $1)],
+  [_LT_TAGVAR(lt_cv_prog_compiler_pic, $1)=$_LT_TAGVAR(lt_prog_compiler_pic, $1)])
+_LT_TAGVAR(lt_prog_compiler_pic, $1)=$_LT_TAGVAR(lt_cv_prog_compiler_pic, $1)
+
+#
+# Check to make sure the PIC flag actually works.
+#
+if test -n "$_LT_TAGVAR(lt_prog_compiler_pic, $1)"; then
+  _LT_COMPILER_OPTION([if $compiler PIC flag $_LT_TAGVAR(lt_prog_compiler_pic, $1) works],
+    [_LT_TAGVAR(lt_cv_prog_compiler_pic_works, $1)],
+    [$_LT_TAGVAR(lt_prog_compiler_pic, $1)@&t at m4_if([$1],[],[ -DPIC],[m4_if([$1],[CXX],[ -DPIC],[])])], [],
+    [case $_LT_TAGVAR(lt_prog_compiler_pic, $1) in
+     "" | " "*) ;;
+     *) _LT_TAGVAR(lt_prog_compiler_pic, $1)=" $_LT_TAGVAR(lt_prog_compiler_pic, $1)" ;;
+     esac],
+    [_LT_TAGVAR(lt_prog_compiler_pic, $1)=
+     _LT_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no])
+fi
+_LT_TAGDECL([pic_flag], [lt_prog_compiler_pic], [1],
+	[Additional compiler flags for building library objects])
+
+_LT_TAGDECL([wl], [lt_prog_compiler_wl], [1],
+	[How to pass a linker flag through the compiler])
+#
+# Check to make sure the static flag actually works.
+#
+wl=$_LT_TAGVAR(lt_prog_compiler_wl, $1) eval lt_tmp_static_flag=\"$_LT_TAGVAR(lt_prog_compiler_static, $1)\"
+_LT_LINKER_OPTION([if $compiler static flag $lt_tmp_static_flag works],
+  _LT_TAGVAR(lt_cv_prog_compiler_static_works, $1),
+  $lt_tmp_static_flag,
+  [],
+  [_LT_TAGVAR(lt_prog_compiler_static, $1)=])
+_LT_TAGDECL([link_static_flag], [lt_prog_compiler_static], [1],
+	[Compiler flag to prevent dynamic linking])
+])# _LT_COMPILER_PIC
+
+
+# _LT_LINKER_SHLIBS([TAGNAME])
+# ----------------------------
+# See if the linker supports building shared libraries.
+m4_defun([_LT_LINKER_SHLIBS],
+[AC_REQUIRE([LT_PATH_LD])dnl
+AC_REQUIRE([LT_PATH_NM])dnl
+m4_require([_LT_PATH_MANIFEST_TOOL])dnl
+m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+m4_require([_LT_DECL_EGREP])dnl
+m4_require([_LT_DECL_SED])dnl
+m4_require([_LT_CMD_GLOBAL_SYMBOLS])dnl
+m4_require([_LT_TAG_COMPILER])dnl
+AC_MSG_CHECKING([whether the $compiler linker ($LD) supports shared libraries])
+m4_if([$1], [CXX], [
+  _LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+  _LT_TAGVAR(exclude_expsyms, $1)=['_GLOBAL_OFFSET_TABLE_|_GLOBAL__F[ID]_.*']
+  case $host_os in
+  aix[[4-9]]*)
+    # If we're using GNU nm, then we don't want the "-C" option.
+    # -C means demangle to AIX nm, but means don't demangle with GNU nm
+    # Also, AIX nm treats weak defined symbols like other global defined
+    # symbols, whereas GNU nm marks them as "W".
+    if $NM -V 2>&1 | $GREP 'GNU' > /dev/null; then
+      _LT_TAGVAR(export_symbols_cmds, $1)='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B") || (\$ 2 == "W")) && ([substr](\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols'
+    else
+      _LT_TAGVAR(export_symbols_cmds, $1)='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B")) && ([substr](\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols'
+    fi
+    ;;
+  pw32*)
+    _LT_TAGVAR(export_symbols_cmds, $1)="$ltdll_cmds"
+    ;;
+  cygwin* | mingw* | cegcc*)
+    case $cc_basename in
+    cl*)
+      _LT_TAGVAR(exclude_expsyms, $1)='_NULL_IMPORT_DESCRIPTOR|_IMPORT_DESCRIPTOR_.*'
+      ;;
+    *)
+      _LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[[BCDGRS]][[ ]]/s/.*[[ ]]\([[^ ]]*\)/\1 DATA/;s/^.*[[ ]]__nm__\([[^ ]]*\)[[ ]][[^ ]]*/\1 DATA/;/^I[[ ]]/d;/^[[AITW]][[ ]]/s/.* //'\'' | sort | uniq > $export_symbols'
+      _LT_TAGVAR(exclude_expsyms, $1)=['[_]+GLOBAL_OFFSET_TABLE_|[_]+GLOBAL__[FID]_.*|[_]+head_[A-Za-z0-9_]+_dll|[A-Za-z0-9_]+_dll_iname']
+      ;;
+    esac
+    ;;
+  linux* | k*bsd*-gnu | gnu*)
+    _LT_TAGVAR(link_all_deplibs, $1)=no
+    ;;
+  *)
+    _LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+    ;;
+  esac
+], [
+  runpath_var=
+  _LT_TAGVAR(allow_undefined_flag, $1)=
+  _LT_TAGVAR(always_export_symbols, $1)=no
+  _LT_TAGVAR(archive_cmds, $1)=
+  _LT_TAGVAR(archive_expsym_cmds, $1)=
+  _LT_TAGVAR(compiler_needs_object, $1)=no
+  _LT_TAGVAR(enable_shared_with_static_runtimes, $1)=no
+  _LT_TAGVAR(export_dynamic_flag_spec, $1)=
+  _LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+  _LT_TAGVAR(hardcode_automatic, $1)=no
+  _LT_TAGVAR(hardcode_direct, $1)=no
+  _LT_TAGVAR(hardcode_direct_absolute, $1)=no
+  _LT_TAGVAR(hardcode_libdir_flag_spec, $1)=
+  _LT_TAGVAR(hardcode_libdir_separator, $1)=
+  _LT_TAGVAR(hardcode_minus_L, $1)=no
+  _LT_TAGVAR(hardcode_shlibpath_var, $1)=unsupported
+  _LT_TAGVAR(inherit_rpath, $1)=no
+  _LT_TAGVAR(link_all_deplibs, $1)=unknown
+  _LT_TAGVAR(module_cmds, $1)=
+  _LT_TAGVAR(module_expsym_cmds, $1)=
+  _LT_TAGVAR(old_archive_from_new_cmds, $1)=
+  _LT_TAGVAR(old_archive_from_expsyms_cmds, $1)=
+  _LT_TAGVAR(thread_safe_flag_spec, $1)=
+  _LT_TAGVAR(whole_archive_flag_spec, $1)=
+  # include_expsyms should be a list of space-separated symbols to be *always*
+  # included in the symbol list
+  _LT_TAGVAR(include_expsyms, $1)=
+  # exclude_expsyms can be an extended regexp of symbols to exclude
+  # it will be wrapped by ` (' and `)$', so one must not match beginning or
+  # end of line.  Example: `a|bc|.*d.*' will exclude the symbols `a' and `bc',
+  # as well as any symbol that contains `d'.
+  _LT_TAGVAR(exclude_expsyms, $1)=['_GLOBAL_OFFSET_TABLE_|_GLOBAL__F[ID]_.*']
+  # Although _GLOBAL_OFFSET_TABLE_ is a valid symbol C name, most a.out
+  # platforms (ab)use it in PIC code, but their linkers get confused if
+  # the symbol is explicitly referenced.  Since portable code cannot
+  # rely on this symbol name, it's probably fine to never include it in
+  # preloaded symbol tables.
+  # Exclude shared library initialization/finalization symbols.
+dnl Note also adjust exclude_expsyms for C++ above.
+  extract_expsyms_cmds=
+
+  case $host_os in
+  cygwin* | mingw* | pw32* | cegcc*)
+    # FIXME: the MSVC++ port hasn't been tested in a loooong time
+    # When not using gcc, we currently assume that we are using
+    # Microsoft Visual C++.
+    if test "$GCC" != yes; then
+      with_gnu_ld=no
+    fi
+    ;;
+  interix*)
+    # we just hope/assume this is gcc and not c89 (= MSVC++)
+    with_gnu_ld=yes
+    ;;
+  openbsd*)
+    with_gnu_ld=no
+    ;;
+  linux* | k*bsd*-gnu | gnu*)
+    _LT_TAGVAR(link_all_deplibs, $1)=no
+    ;;
+  esac
+
+  _LT_TAGVAR(ld_shlibs, $1)=yes
+
+  # On some targets, GNU ld is compatible enough with the native linker
+  # that we're better off using the native interface for both.
+  lt_use_gnu_ld_interface=no
+  if test "$with_gnu_ld" = yes; then
+    case $host_os in
+      aix*)
+	# The AIX port of GNU ld has always aspired to compatibility
+	# with the native linker.  However, as the warning in the GNU ld
+	# block says, versions before 2.19.5* couldn't really create working
+	# shared libraries, regardless of the interface used.
+	case `$LD -v 2>&1` in
+	  *\ \(GNU\ Binutils\)\ 2.19.5*) ;;
+	  *\ \(GNU\ Binutils\)\ 2.[[2-9]]*) ;;
+	  *\ \(GNU\ Binutils\)\ [[3-9]]*) ;;
+	  *)
+	    lt_use_gnu_ld_interface=yes
+	    ;;
+	esac
+	;;
+      *)
+	lt_use_gnu_ld_interface=yes
+	;;
+    esac
+  fi
+
+  if test "$lt_use_gnu_ld_interface" = yes; then
+    # If archive_cmds runs LD, not CC, wlarc should be empty
+    wlarc='${wl}'
+
+    # Set some defaults for GNU ld with shared library support. These
+    # are reset later if shared libraries are not supported. Putting them
+    # here allows them to be overridden if necessary.
+    runpath_var=LD_RUN_PATH
+    _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+    _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic'
+    # ancient GNU ld didn't support --whole-archive et. al.
+    if $LD --help 2>&1 | $GREP 'no-whole-archive' > /dev/null; then
+      _LT_TAGVAR(whole_archive_flag_spec, $1)="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+    else
+      _LT_TAGVAR(whole_archive_flag_spec, $1)=
+    fi
+    supports_anon_versioning=no
+    case `$LD -v 2>&1` in
+      *GNU\ gold*) supports_anon_versioning=yes ;;
+      *\ [[01]].* | *\ 2.[[0-9]].* | *\ 2.10.*) ;; # catch versions < 2.11
+      *\ 2.11.93.0.2\ *) supports_anon_versioning=yes ;; # RH7.3 ...
+      *\ 2.11.92.0.12\ *) supports_anon_versioning=yes ;; # Mandrake 8.2 ...
+      *\ 2.11.*) ;; # other 2.11 versions
+      *) supports_anon_versioning=yes ;;
+    esac
+
+    # See if GNU ld supports shared libraries.
+    case $host_os in
+    aix[[3-9]]*)
+      # On AIX/PPC, the GNU linker is very broken
+      if test "$host_cpu" != ia64; then
+	_LT_TAGVAR(ld_shlibs, $1)=no
+	cat <<_LT_EOF 1>&2
+
+*** Warning: the GNU linker, at least up to release 2.19, is reported
+*** to be unable to reliably create shared libraries on AIX.
+*** Therefore, libtool is disabling shared libraries support.  If you
+*** really care for shared libraries, you may want to install binutils
+*** 2.20 or above, or modify your PATH so that a non-GNU linker is found.
+*** You will then need to restart the configuration process.
+
+_LT_EOF
+      fi
+      ;;
+
+    amigaos*)
+      case $host_cpu in
+      powerpc)
+            # see comment about AmigaOS4 .so support
+            _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+            _LT_TAGVAR(archive_expsym_cmds, $1)=''
+        ;;
+      m68k)
+            _LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/a2ixlibrary.data~$ECHO "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$ECHO "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$ECHO "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$ECHO "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+            _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+            _LT_TAGVAR(hardcode_minus_L, $1)=yes
+        ;;
+      esac
+      ;;
+
+    beos*)
+      if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+	_LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+	# Joseph Beckenbach <jrb3 at best.com> says some releases of gcc
+	# support --undefined.  This deserves some investigation.  FIXME
+	_LT_TAGVAR(archive_cmds, $1)='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+      else
+	_LT_TAGVAR(ld_shlibs, $1)=no
+      fi
+      ;;
+
+    cygwin* | mingw* | pw32* | cegcc*)
+      # _LT_TAGVAR(hardcode_libdir_flag_spec, $1) is actually meaningless,
+      # as there is no search path for DLLs.
+      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+      _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-all-symbols'
+      _LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+      _LT_TAGVAR(always_export_symbols, $1)=no
+      _LT_TAGVAR(enable_shared_with_static_runtimes, $1)=yes
+      _LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[[BCDGRS]][[ ]]/s/.*[[ ]]\([[^ ]]*\)/\1 DATA/;s/^.*[[ ]]__nm__\([[^ ]]*\)[[ ]][[^ ]]*/\1 DATA/;/^I[[ ]]/d;/^[[AITW]][[ ]]/s/.* //'\'' | sort | uniq > $export_symbols'
+      _LT_TAGVAR(exclude_expsyms, $1)=['[_]+GLOBAL_OFFSET_TABLE_|[_]+GLOBAL__[FID]_.*|[_]+head_[A-Za-z0-9_]+_dll|[A-Za-z0-9_]+_dll_iname']
+
+      if $LD --help 2>&1 | $GREP 'auto-import' > /dev/null; then
+        _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+	# If the export-symbols file already is a .def file (1st line
+	# is EXPORTS), use it as is; otherwise, prepend...
+	_LT_TAGVAR(archive_expsym_cmds, $1)='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+	  cp $export_symbols $output_objdir/$soname.def;
+	else
+	  echo EXPORTS > $output_objdir/$soname.def;
+	  cat $export_symbols >> $output_objdir/$soname.def;
+	fi~
+	$CC -shared $output_objdir/$soname.def $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+      else
+	_LT_TAGVAR(ld_shlibs, $1)=no
+      fi
+      ;;
+
+    haiku*)
+      _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+      _LT_TAGVAR(link_all_deplibs, $1)=yes
+      ;;
+
+    interix[[3-9]]*)
+      _LT_TAGVAR(hardcode_direct, $1)=no
+      _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+      _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+      # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc.
+      # Instead, shared libraries are loaded at an image base (0x10000000 by
+      # default) and relocated if they conflict, which is a slow very memory
+      # consuming and fragmenting process.  To avoid this, we pick a random,
+      # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link
+      # time.  Moving up from 0x10000000 also allows more sbrk(2) space.
+      _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+      _LT_TAGVAR(archive_expsym_cmds, $1)='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+      ;;
+
+    gnu* | linux* | tpf* | k*bsd*-gnu | kopensolaris*-gnu)
+      tmp_diet=no
+      if test "$host_os" = linux-dietlibc; then
+	case $cc_basename in
+	  diet\ *) tmp_diet=yes;;	# linux-dietlibc with static linking (!diet-dyn)
+	esac
+      fi
+      if $LD --help 2>&1 | $EGREP ': supported targets:.* elf' > /dev/null \
+	 && test "$tmp_diet" = no
+      then
+	tmp_addflag=' $pic_flag'
+	tmp_sharedflag='-shared'
+	case $cc_basename,$host_cpu in
+        pgcc*)				# Portland Group C compiler
+	  _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test  -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+	  tmp_addflag=' $pic_flag'
+	  ;;
+	pgf77* | pgf90* | pgf95* | pgfortran*)
+					# Portland Group f77 and f90 compilers
+	  _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test  -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+	  tmp_addflag=' $pic_flag -Mnomain' ;;
+	ecc*,ia64* | icc*,ia64*)	# Intel C compiler on ia64
+	  tmp_addflag=' -i_dynamic' ;;
+	efc*,ia64* | ifort*,ia64*)	# Intel Fortran compiler on ia64
+	  tmp_addflag=' -i_dynamic -nofor_main' ;;
+	ifc* | ifort*)			# Intel Fortran compiler
+	  tmp_addflag=' -nofor_main' ;;
+	lf95*)				# Lahey Fortran 8.1
+	  _LT_TAGVAR(whole_archive_flag_spec, $1)=
+	  tmp_sharedflag='--shared' ;;
+	xl[[cC]]* | bgxl[[cC]]* | mpixl[[cC]]*) # IBM XL C 8.0 on PPC (deal with xlf below)
+	  tmp_sharedflag='-qmkshrobj'
+	  tmp_addflag= ;;
+	nvcc*)	# Cuda Compiler Driver 2.2
+	  _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test  -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+	  _LT_TAGVAR(compiler_needs_object, $1)=yes
+	  ;;
+	esac
+	case `$CC -V 2>&1 | sed 5q` in
+	*Sun\ C*)			# Sun C 5.9
+	  _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`new_convenience=; for conv in $convenience\"\"; do test -z \"$conv\" || new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+	  _LT_TAGVAR(compiler_needs_object, $1)=yes
+	  tmp_sharedflag='-G' ;;
+	*Sun\ F*)			# Sun Fortran 8.3
+	  tmp_sharedflag='-G' ;;
+	esac
+	_LT_TAGVAR(archive_cmds, $1)='$CC '"$tmp_sharedflag""$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+
+        if test "x$supports_anon_versioning" = xyes; then
+          _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $output_objdir/$libname.ver~
+	    cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~
+	    echo "local: *; };" >> $output_objdir/$libname.ver~
+	    $CC '"$tmp_sharedflag""$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib'
+        fi
+
+	case $cc_basename in
+	xlf* | bgf* | bgxlf* | mpixlf*)
+	  # IBM XL Fortran 10.1 on PPC cannot create shared libs itself
+	  _LT_TAGVAR(whole_archive_flag_spec, $1)='--whole-archive$convenience --no-whole-archive'
+	  _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+	  _LT_TAGVAR(archive_cmds, $1)='$LD -shared $libobjs $deplibs $linker_flags -soname $soname -o $lib'
+	  if test "x$supports_anon_versioning" = xyes; then
+	    _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $output_objdir/$libname.ver~
+	      cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~
+	      echo "local: *; };" >> $output_objdir/$libname.ver~
+	      $LD -shared $libobjs $deplibs $linker_flags -soname $soname -version-script $output_objdir/$libname.ver -o $lib'
+	  fi
+	  ;;
+	esac
+      else
+        _LT_TAGVAR(ld_shlibs, $1)=no
+      fi
+      ;;
+
+    netbsd* | netbsdelf*-gnu)
+      if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+	_LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable $libobjs $deplibs $linker_flags -o $lib'
+	wlarc=
+      else
+	_LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+	_LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+      fi
+      ;;
+
+    solaris*)
+      if $LD -v 2>&1 | $GREP 'BFD 2\.8' > /dev/null; then
+	_LT_TAGVAR(ld_shlibs, $1)=no
+	cat <<_LT_EOF 1>&2
+
+*** Warning: The releases 2.8.* of the GNU linker cannot reliably
+*** create shared libraries on Solaris systems.  Therefore, libtool
+*** is disabling shared libraries support.  We urge you to upgrade GNU
+*** binutils to release 2.9.1 or newer.  Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+_LT_EOF
+      elif $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+	_LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+	_LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+      else
+	_LT_TAGVAR(ld_shlibs, $1)=no
+      fi
+      ;;
+
+    sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*)
+      case `$LD -v 2>&1` in
+        *\ [[01]].* | *\ 2.[[0-9]].* | *\ 2.1[[0-5]].*)
+	_LT_TAGVAR(ld_shlibs, $1)=no
+	cat <<_LT_EOF 1>&2
+
+*** Warning: Releases of the GNU linker prior to 2.16.91.0.3 can not
+*** reliably create shared libraries on SCO systems.  Therefore, libtool
+*** is disabling shared libraries support.  We urge you to upgrade GNU
+*** binutils to release 2.16.91.0.3 or newer.  Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+_LT_EOF
+	;;
+	*)
+	  # For security reasons, it is highly recommended that you always
+	  # use absolute paths for naming shared libraries, and exclude the
+	  # DT_RUNPATH tag from executables and libraries.  But doing so
+	  # requires that you compile everything twice, which is a pain.
+	  if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+	    _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+	    _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+	    _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+	  else
+	    _LT_TAGVAR(ld_shlibs, $1)=no
+	  fi
+	;;
+      esac
+      ;;
+
+    sunos4*)
+      _LT_TAGVAR(archive_cmds, $1)='$LD -assert pure-text -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+      wlarc=
+      _LT_TAGVAR(hardcode_direct, $1)=yes
+      _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+      ;;
+
+    *)
+      if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+	_LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+	_LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+      else
+	_LT_TAGVAR(ld_shlibs, $1)=no
+      fi
+      ;;
+    esac
+
+    if test "$_LT_TAGVAR(ld_shlibs, $1)" = no; then
+      runpath_var=
+      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)=
+      _LT_TAGVAR(export_dynamic_flag_spec, $1)=
+      _LT_TAGVAR(whole_archive_flag_spec, $1)=
+    fi
+  else
+    # PORTME fill in a description of your system's linker (not GNU ld)
+    case $host_os in
+    aix3*)
+      _LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+      _LT_TAGVAR(always_export_symbols, $1)=yes
+      _LT_TAGVAR(archive_expsym_cmds, $1)='$LD -o $output_objdir/$soname $libobjs $deplibs $linker_flags -bE:$export_symbols -T512 -H512 -bM:SRE~$AR $AR_FLAGS $lib $output_objdir/$soname'
+      # Note: this linker hardcodes the directories in LIBPATH if there
+      # are no directories specified by -L.
+      _LT_TAGVAR(hardcode_minus_L, $1)=yes
+      if test "$GCC" = yes && test -z "$lt_prog_compiler_static"; then
+	# Neither direct hardcoding nor static linking is supported with a
+	# broken collect2.
+	_LT_TAGVAR(hardcode_direct, $1)=unsupported
+      fi
+      ;;
+
+    aix[[4-9]]*)
+      if test "$host_cpu" = ia64; then
+	# On IA64, the linker does run time linking by default, so we don't
+	# have to do anything special.
+	aix_use_runtimelinking=no
+	exp_sym_flag='-Bexport'
+	no_entry_flag=""
+      else
+	# If we're using GNU nm, then we don't want the "-C" option.
+	# -C means demangle to AIX nm, but means don't demangle with GNU nm
+	# Also, AIX nm treats weak defined symbols like other global
+	# defined symbols, whereas GNU nm marks them as "W".
+	if $NM -V 2>&1 | $GREP 'GNU' > /dev/null; then
+	  _LT_TAGVAR(export_symbols_cmds, $1)='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B") || (\$ 2 == "W")) && ([substr](\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols'
+	else
+	  _LT_TAGVAR(export_symbols_cmds, $1)='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B")) && ([substr](\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols'
+	fi
+	aix_use_runtimelinking=no
+
+	# Test if we are trying to use run time linking or normal
+	# AIX style linking. If -brtl is somewhere in LDFLAGS, we
+	# need to do runtime linking.
+	case $host_os in aix4.[[23]]|aix4.[[23]].*|aix[[5-9]]*)
+	  for ld_flag in $LDFLAGS; do
+	  if (test $ld_flag = "-brtl" || test $ld_flag = "-Wl,-brtl"); then
+	    aix_use_runtimelinking=yes
+	    break
+	  fi
+	  done
+	  ;;
+	esac
+
+	exp_sym_flag='-bexport'
+	no_entry_flag='-bnoentry'
+      fi
+
+      # When large executables or shared objects are built, AIX ld can
+      # have problems creating the table of contents.  If linking a library
+      # or program results in "error TOC overflow" add -mminimal-toc to
+      # CXXFLAGS/CFLAGS for g++/gcc.  In the cases where that is not
+      # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS.
+
+      _LT_TAGVAR(archive_cmds, $1)=''
+      _LT_TAGVAR(hardcode_direct, $1)=yes
+      _LT_TAGVAR(hardcode_direct_absolute, $1)=yes
+      _LT_TAGVAR(hardcode_libdir_separator, $1)=':'
+      _LT_TAGVAR(link_all_deplibs, $1)=yes
+      _LT_TAGVAR(file_list_spec, $1)='${wl}-f,'
+
+      if test "$GCC" = yes; then
+	case $host_os in aix4.[[012]]|aix4.[[012]].*)
+	# We only want to do this on AIX 4.2 and lower, the check
+	# below for broken collect2 doesn't work under 4.3+
+	  collect2name=`${CC} -print-prog-name=collect2`
+	  if test -f "$collect2name" &&
+	   strings "$collect2name" | $GREP resolve_lib_name >/dev/null
+	  then
+	  # We have reworked collect2
+	  :
+	  else
+	  # We have old collect2
+	  _LT_TAGVAR(hardcode_direct, $1)=unsupported
+	  # It fails to find uninstalled libraries when the uninstalled
+	  # path is not listed in the libpath.  Setting hardcode_minus_L
+	  # to unsupported forces relinking
+	  _LT_TAGVAR(hardcode_minus_L, $1)=yes
+	  _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+	  _LT_TAGVAR(hardcode_libdir_separator, $1)=
+	  fi
+	  ;;
+	esac
+	shared_flag='-shared'
+	if test "$aix_use_runtimelinking" = yes; then
+	  shared_flag="$shared_flag "'${wl}-G'
+	fi
+	_LT_TAGVAR(link_all_deplibs, $1)=no
+      else
+	# not using gcc
+	if test "$host_cpu" = ia64; then
+	# VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release
+	# chokes on -Wl,-G. The following line is correct:
+	  shared_flag='-G'
+	else
+	  if test "$aix_use_runtimelinking" = yes; then
+	    shared_flag='${wl}-G'
+	  else
+	    shared_flag='${wl}-bM:SRE'
+	  fi
+	fi
+      fi
+
+      _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-bexpall'
+      # It seems that -bexpall does not export symbols beginning with
+      # underscore (_), so it is better to generate a list of symbols to export.
+      _LT_TAGVAR(always_export_symbols, $1)=yes
+      if test "$aix_use_runtimelinking" = yes; then
+	# Warning - without using the other runtime loading flags (-brtl),
+	# -berok will link without error, but may produce a broken library.
+	_LT_TAGVAR(allow_undefined_flag, $1)='-berok'
+        # Determine the default libpath from the value encoded in an
+        # empty executable.
+        _LT_SYS_MODULE_PATH_AIX([$1])
+        _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath"
+        _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then func_echo_all "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag"
+      else
+	if test "$host_cpu" = ia64; then
+	  _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R $libdir:/usr/lib:/lib'
+	  _LT_TAGVAR(allow_undefined_flag, $1)="-z nodefs"
+	  _LT_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols"
+	else
+	 # Determine the default libpath from the value encoded in an
+	 # empty executable.
+	 _LT_SYS_MODULE_PATH_AIX([$1])
+	 _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath"
+	  # Warning - without using the other run time loading flags,
+	  # -berok will link without error, but may produce a broken library.
+	  _LT_TAGVAR(no_undefined_flag, $1)=' ${wl}-bernotok'
+	  _LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-berok'
+	  if test "$with_gnu_ld" = yes; then
+	    # We only use this code for GNU lds that support --whole-archive.
+	    _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive$convenience ${wl}--no-whole-archive'
+	  else
+	    # Exported symbols can be pulled into shared objects from archives
+	    _LT_TAGVAR(whole_archive_flag_spec, $1)='$convenience'
+	  fi
+	  _LT_TAGVAR(archive_cmds_need_lc, $1)=yes
+	  # This is similar to how AIX traditionally builds its shared libraries.
+	  _LT_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname'
+	fi
+      fi
+      ;;
+
+    amigaos*)
+      case $host_cpu in
+      powerpc)
+            # see comment about AmigaOS4 .so support
+            _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+            _LT_TAGVAR(archive_expsym_cmds, $1)=''
+        ;;
+      m68k)
+            _LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/a2ixlibrary.data~$ECHO "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$ECHO "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$ECHO "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$ECHO "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+            _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+            _LT_TAGVAR(hardcode_minus_L, $1)=yes
+        ;;
+      esac
+      ;;
+
+    bsdi[[45]]*)
+      _LT_TAGVAR(export_dynamic_flag_spec, $1)=-rdynamic
+      ;;
+
+    cygwin* | mingw* | pw32* | cegcc*)
+      # When not using gcc, we currently assume that we are using
+      # Microsoft Visual C++.
+      # hardcode_libdir_flag_spec is actually meaningless, as there is
+      # no search path for DLLs.
+      case $cc_basename in
+      cl*)
+	# Native MSVC
+	_LT_TAGVAR(hardcode_libdir_flag_spec, $1)=' '
+	_LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+	_LT_TAGVAR(always_export_symbols, $1)=yes
+	_LT_TAGVAR(file_list_spec, $1)='@'
+	# Tell ltmain to make .lib files, not .a files.
+	libext=lib
+	# Tell ltmain to make .dll files, not .so files.
+	shrext_cmds=".dll"
+	# FIXME: Setting linknames here is a bad hack.
+	_LT_TAGVAR(archive_cmds, $1)='$CC -o $output_objdir/$soname $libobjs $compiler_flags $deplibs -Wl,-dll~linknames='
+	_LT_TAGVAR(archive_expsym_cmds, $1)='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+	    sed -n -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' -e '1\\\!p' < $export_symbols > $output_objdir/$soname.exp;
+	  else
+	    sed -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' < $export_symbols > $output_objdir/$soname.exp;
+	  fi~
+	  $CC -o $tool_output_objdir$soname $libobjs $compiler_flags $deplibs "@$tool_output_objdir$soname.exp" -Wl,-DLL,-IMPLIB:"$tool_output_objdir$libname.dll.lib"~
+	  linknames='
+	# The linker will not automatically build a static lib if we build a DLL.
+	# _LT_TAGVAR(old_archive_from_new_cmds, $1)='true'
+	_LT_TAGVAR(enable_shared_with_static_runtimes, $1)=yes
+	_LT_TAGVAR(exclude_expsyms, $1)='_NULL_IMPORT_DESCRIPTOR|_IMPORT_DESCRIPTOR_.*'
+	_LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[[BCDGRS]][[ ]]/s/.*[[ ]]\([[^ ]]*\)/\1,DATA/'\'' | $SED -e '\''/^[[AITW]][[ ]]/s/.*[[ ]]//'\'' | sort | uniq > $export_symbols'
+	# Don't use ranlib
+	_LT_TAGVAR(old_postinstall_cmds, $1)='chmod 644 $oldlib'
+	_LT_TAGVAR(postlink_cmds, $1)='lt_outputfile="@OUTPUT@"~
+	  lt_tool_outputfile="@TOOL_OUTPUT@"~
+	  case $lt_outputfile in
+	    *.exe|*.EXE) ;;
+	    *)
+	      lt_outputfile="$lt_outputfile.exe"
+	      lt_tool_outputfile="$lt_tool_outputfile.exe"
+	      ;;
+	  esac~
+	  if test "$MANIFEST_TOOL" != ":" && test -f "$lt_outputfile.manifest"; then
+	    $MANIFEST_TOOL -manifest "$lt_tool_outputfile.manifest" -outputresource:"$lt_tool_outputfile" || exit 1;
+	    $RM "$lt_outputfile.manifest";
+	  fi'
+	;;
+      *)
+	# Assume MSVC wrapper
+	_LT_TAGVAR(hardcode_libdir_flag_spec, $1)=' '
+	_LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+	# Tell ltmain to make .lib files, not .a files.
+	libext=lib
+	# Tell ltmain to make .dll files, not .so files.
+	shrext_cmds=".dll"
+	# FIXME: Setting linknames here is a bad hack.
+	_LT_TAGVAR(archive_cmds, $1)='$CC -o $lib $libobjs $compiler_flags `func_echo_all "$deplibs" | $SED '\''s/ -lc$//'\''` -link -dll~linknames='
+	# The linker will automatically build a .lib file if we build a DLL.
+	_LT_TAGVAR(old_archive_from_new_cmds, $1)='true'
+	# FIXME: Should let the user specify the lib program.
+	_LT_TAGVAR(old_archive_cmds, $1)='lib -OUT:$oldlib$oldobjs$old_deplibs'
+	_LT_TAGVAR(enable_shared_with_static_runtimes, $1)=yes
+	;;
+      esac
+      ;;
+
+    darwin* | rhapsody*)
+      _LT_DARWIN_LINKER_FEATURES($1)
+      ;;
+
+    dgux*)
+      _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+      _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+      ;;
+
+    # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor
+    # support.  Future versions do this automatically, but an explicit c++rt0.o
+    # does not break anything, and helps significantly (at the cost of a little
+    # extra space).
+    freebsd2.2*)
+      _LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags /usr/lib/c++rt0.o'
+      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+      _LT_TAGVAR(hardcode_direct, $1)=yes
+      _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+      ;;
+
+    # Unfortunately, older versions of FreeBSD 2 do not have this feature.
+    freebsd2.*)
+      _LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+      _LT_TAGVAR(hardcode_direct, $1)=yes
+      _LT_TAGVAR(hardcode_minus_L, $1)=yes
+      _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+      ;;
+
+    # FreeBSD 3 and greater uses gcc -shared to do shared libraries.
+    freebsd* | dragonfly*)
+      _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+      _LT_TAGVAR(hardcode_direct, $1)=yes
+      _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+      ;;
+
+    hpux9*)
+      if test "$GCC" = yes; then
+	_LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/$soname~$CC -shared $pic_flag ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $libobjs $deplibs $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+      else
+	_LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/$soname~$LD -b +b $install_libdir -o $output_objdir/$soname $libobjs $deplibs $linker_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+      fi
+      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir'
+      _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+      _LT_TAGVAR(hardcode_direct, $1)=yes
+
+      # hardcode_minus_L: Not really in the search PATH,
+      # but as the default location of the library.
+      _LT_TAGVAR(hardcode_minus_L, $1)=yes
+      _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+      ;;
+
+    hpux10*)
+      if test "$GCC" = yes && test "$with_gnu_ld" = no; then
+	_LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+      else
+	_LT_TAGVAR(archive_cmds, $1)='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags'
+      fi
+      if test "$with_gnu_ld" = no; then
+	_LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir'
+	_LT_TAGVAR(hardcode_libdir_separator, $1)=:
+	_LT_TAGVAR(hardcode_direct, $1)=yes
+	_LT_TAGVAR(hardcode_direct_absolute, $1)=yes
+	_LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+	# hardcode_minus_L: Not really in the search PATH,
+	# but as the default location of the library.
+	_LT_TAGVAR(hardcode_minus_L, $1)=yes
+      fi
+      ;;
+
+    hpux11*)
+      if test "$GCC" = yes && test "$with_gnu_ld" = no; then
+	case $host_cpu in
+	hppa*64*)
+	  _LT_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+	  ;;
+	ia64*)
+	  _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+	  ;;
+	*)
+	  _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+	  ;;
+	esac
+      else
+	case $host_cpu in
+	hppa*64*)
+	  _LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+	  ;;
+	ia64*)
+	  _LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+	  ;;
+	*)
+	m4_if($1, [], [
+	  # Older versions of the 11.00 compiler do not understand -b yet
+	  # (HP92453-01 A.11.01.20 doesn't, HP92453-01 B.11.X.35175-35176.GP does)
+	  _LT_LINKER_OPTION([if $CC understands -b],
+	    _LT_TAGVAR(lt_cv_prog_compiler__b, $1), [-b],
+	    [_LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'],
+	    [_LT_TAGVAR(archive_cmds, $1)='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags'])],
+	  [_LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'])
+	  ;;
+	esac
+      fi
+      if test "$with_gnu_ld" = no; then
+	_LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir'
+	_LT_TAGVAR(hardcode_libdir_separator, $1)=:
+
+	case $host_cpu in
+	hppa*64*|ia64*)
+	  _LT_TAGVAR(hardcode_direct, $1)=no
+	  _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+	  ;;
+	*)
+	  _LT_TAGVAR(hardcode_direct, $1)=yes
+	  _LT_TAGVAR(hardcode_direct_absolute, $1)=yes
+	  _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+
+	  # hardcode_minus_L: Not really in the search PATH,
+	  # but as the default location of the library.
+	  _LT_TAGVAR(hardcode_minus_L, $1)=yes
+	  ;;
+	esac
+      fi
+      ;;
+
+    irix5* | irix6* | nonstopux*)
+      if test "$GCC" = yes; then
+	_LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+	# Try to use the -exported_symbol ld option, if it does not
+	# work, assume that -exports_file does not work either and
+	# implicitly export all symbols.
+	# This should be the same for all languages, so no per-tag cache variable.
+	AC_CACHE_CHECK([whether the $host_os linker accepts -exported_symbol],
+	  [lt_cv_irix_exported_symbol],
+	  [save_LDFLAGS="$LDFLAGS"
+	   LDFLAGS="$LDFLAGS -shared ${wl}-exported_symbol ${wl}foo ${wl}-update_registry ${wl}/dev/null"
+	   AC_LINK_IFELSE(
+	     [AC_LANG_SOURCE(
+	        [AC_LANG_CASE([C], [[int foo (void) { return 0; }]],
+			      [C++], [[int foo (void) { return 0; }]],
+			      [Fortran 77], [[
+      subroutine foo
+      end]],
+			      [Fortran], [[
+      subroutine foo
+      end]])])],
+	      [lt_cv_irix_exported_symbol=yes],
+	      [lt_cv_irix_exported_symbol=no])
+           LDFLAGS="$save_LDFLAGS"])
+	if test "$lt_cv_irix_exported_symbol" = yes; then
+          _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations ${wl}-exports_file ${wl}$export_symbols -o $lib'
+	fi
+      else
+	_LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+	_LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -exports_file $export_symbols -o $lib'
+      fi
+      _LT_TAGVAR(archive_cmds_need_lc, $1)='no'
+      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+      _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+      _LT_TAGVAR(inherit_rpath, $1)=yes
+      _LT_TAGVAR(link_all_deplibs, $1)=yes
+      ;;
+
+    netbsd* | netbsdelf*-gnu)
+      if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+	_LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'  # a.out
+      else
+	_LT_TAGVAR(archive_cmds, $1)='$LD -shared -o $lib $libobjs $deplibs $linker_flags'      # ELF
+      fi
+      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+      _LT_TAGVAR(hardcode_direct, $1)=yes
+      _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+      ;;
+
+    newsos6)
+      _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+      _LT_TAGVAR(hardcode_direct, $1)=yes
+      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+      _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+      _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+      ;;
+
+    *nto* | *qnx*)
+      ;;
+
+    openbsd*)
+      if test -f /usr/libexec/ld.so; then
+	_LT_TAGVAR(hardcode_direct, $1)=yes
+	_LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+	_LT_TAGVAR(hardcode_direct_absolute, $1)=yes
+	if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+	  _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+	  _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-retain-symbols-file,$export_symbols'
+	  _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+	  _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+	else
+	  case $host_os in
+	   openbsd[[01]].* | openbsd2.[[0-7]] | openbsd2.[[0-7]].*)
+	     _LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+	     _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+	     ;;
+	   *)
+	     _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+	     _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+	     ;;
+	  esac
+	fi
+      else
+	_LT_TAGVAR(ld_shlibs, $1)=no
+      fi
+      ;;
+
+    os2*)
+      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+      _LT_TAGVAR(hardcode_minus_L, $1)=yes
+      _LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+      _LT_TAGVAR(archive_cmds, $1)='$ECHO "LIBRARY $libname INITINSTANCE" > $output_objdir/$libname.def~$ECHO "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~echo DATA >> $output_objdir/$libname.def~echo " SINGLE NONSHARED" >> $output_objdir/$libname.def~echo EXPORTS >> $output_objdir/$libname.def~emxexp $libobjs >> $output_objdir/$libname.def~$CC -Zdll -Zcrtdll -o $lib $libobjs $deplibs $compiler_flags $output_objdir/$libname.def'
+      _LT_TAGVAR(old_archive_from_new_cmds, $1)='emximp -o $output_objdir/$libname.a $output_objdir/$libname.def'
+      ;;
+
+    osf3*)
+      if test "$GCC" = yes; then
+	_LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*'
+	_LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+      else
+	_LT_TAGVAR(allow_undefined_flag, $1)=' -expect_unresolved \*'
+	_LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+      fi
+      _LT_TAGVAR(archive_cmds_need_lc, $1)='no'
+      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+      _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+      ;;
+
+    osf4* | osf5*)	# as osf3* with the addition of -msym flag
+      if test "$GCC" = yes; then
+	_LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*'
+	_LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $pic_flag $libobjs $deplibs $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+	_LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+      else
+	_LT_TAGVAR(allow_undefined_flag, $1)=' -expect_unresolved \*'
+	_LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags -msym -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+	_LT_TAGVAR(archive_expsym_cmds, $1)='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done; printf "%s\\n" "-hidden">> $lib.exp~
+	$CC -shared${allow_undefined_flag} ${wl}-input ${wl}$lib.exp $compiler_flags $libobjs $deplibs -soname $soname `test -n "$verstring" && $ECHO "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib~$RM $lib.exp'
+
+	# Both c and cxx compiler support -rpath directly
+	_LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-rpath $libdir'
+      fi
+      _LT_TAGVAR(archive_cmds_need_lc, $1)='no'
+      _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+      ;;
+
+    solaris*)
+      _LT_TAGVAR(no_undefined_flag, $1)=' -z defs'
+      if test "$GCC" = yes; then
+	wlarc='${wl}'
+	_LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag ${wl}-z ${wl}text ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+	_LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+	  $CC -shared $pic_flag ${wl}-z ${wl}text ${wl}-M ${wl}$lib.exp ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags~$RM $lib.exp'
+      else
+	case `$CC -V 2>&1` in
+	*"Compilers 5.0"*)
+	  wlarc=''
+	  _LT_TAGVAR(archive_cmds, $1)='$LD -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $linker_flags'
+	  _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+	  $LD -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $linker_flags~$RM $lib.exp'
+	  ;;
+	*)
+	  wlarc='${wl}'
+	  _LT_TAGVAR(archive_cmds, $1)='$CC -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $compiler_flags'
+	  _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+	  $CC -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $compiler_flags~$RM $lib.exp'
+	  ;;
+	esac
+      fi
+      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+      _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+      case $host_os in
+      solaris2.[[0-5]] | solaris2.[[0-5]].*) ;;
+      *)
+	# The compiler driver will combine and reorder linker options,
+	# but understands `-z linker_flag'.  GCC discards it without `$wl',
+	# but is careful enough not to reorder.
+	# Supported since Solaris 2.6 (maybe 2.5.1?)
+	if test "$GCC" = yes; then
+	  _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}-z ${wl}allextract$convenience ${wl}-z ${wl}defaultextract'
+	else
+	  _LT_TAGVAR(whole_archive_flag_spec, $1)='-z allextract$convenience -z defaultextract'
+	fi
+	;;
+      esac
+      _LT_TAGVAR(link_all_deplibs, $1)=yes
+      ;;
+
+    sunos4*)
+      if test "x$host_vendor" = xsequent; then
+	# Use $CC to link under sequent, because it throws in some extra .o
+	# files that make .init and .fini sections work.
+	_LT_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h $soname -o $lib $libobjs $deplibs $compiler_flags'
+      else
+	_LT_TAGVAR(archive_cmds, $1)='$LD -assert pure-text -Bstatic -o $lib $libobjs $deplibs $linker_flags'
+      fi
+      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+      _LT_TAGVAR(hardcode_direct, $1)=yes
+      _LT_TAGVAR(hardcode_minus_L, $1)=yes
+      _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+      ;;
+
+    sysv4)
+      case $host_vendor in
+	sni)
+	  _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+	  _LT_TAGVAR(hardcode_direct, $1)=yes # is this really true???
+	;;
+	siemens)
+	  ## LD is ld it makes a PLAMLIB
+	  ## CC just makes a GrossModule.
+	  _LT_TAGVAR(archive_cmds, $1)='$LD -G -o $lib $libobjs $deplibs $linker_flags'
+	  _LT_TAGVAR(reload_cmds, $1)='$CC -r -o $output$reload_objs'
+	  _LT_TAGVAR(hardcode_direct, $1)=no
+        ;;
+	motorola)
+	  _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+	  _LT_TAGVAR(hardcode_direct, $1)=no #Motorola manual says yes, but my tests say they lie
+	;;
+      esac
+      runpath_var='LD_RUN_PATH'
+      _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+      ;;
+
+    sysv4.3*)
+      _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+      _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+      _LT_TAGVAR(export_dynamic_flag_spec, $1)='-Bexport'
+      ;;
+
+    sysv4*MP*)
+      if test -d /usr/nec; then
+	_LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+	_LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+	runpath_var=LD_RUN_PATH
+	hardcode_runpath_var=yes
+	_LT_TAGVAR(ld_shlibs, $1)=yes
+      fi
+      ;;
+
+    sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[[01]].[[10]]* | unixware7* | sco3.2v5.0.[[024]]*)
+      _LT_TAGVAR(no_undefined_flag, $1)='${wl}-z,text'
+      _LT_TAGVAR(archive_cmds_need_lc, $1)=no
+      _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+      runpath_var='LD_RUN_PATH'
+
+      if test "$GCC" = yes; then
+	_LT_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+	_LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+      else
+	_LT_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+	_LT_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+      fi
+      ;;
+
+    sysv5* | sco3.2v5* | sco5v6*)
+      # Note: We can NOT use -z defs as we might desire, because we do not
+      # link with -lc, and that would cause any symbols used from libc to
+      # always be unresolved, which means just about no library would
+      # ever link correctly.  If we're not using GNU ld we use -z text
+      # though, which does catch some bad symbols but isn't as heavy-handed
+      # as -z defs.
+      _LT_TAGVAR(no_undefined_flag, $1)='${wl}-z,text'
+      _LT_TAGVAR(allow_undefined_flag, $1)='${wl}-z,nodefs'
+      _LT_TAGVAR(archive_cmds_need_lc, $1)=no
+      _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R,$libdir'
+      _LT_TAGVAR(hardcode_libdir_separator, $1)=':'
+      _LT_TAGVAR(link_all_deplibs, $1)=yes
+      _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-Bexport'
+      runpath_var='LD_RUN_PATH'
+
+      if test "$GCC" = yes; then
+	_LT_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+	_LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+      else
+	_LT_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+	_LT_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+      fi
+      ;;
+
+    uts4*)
+      _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+      _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+      ;;
+
+    *)
+      _LT_TAGVAR(ld_shlibs, $1)=no
+      ;;
+    esac
+
+    if test x$host_vendor = xsni; then
+      case $host in
+      sysv4 | sysv4.2uw2* | sysv4.3* | sysv5*)
+	_LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-Blargedynsym'
+	;;
+      esac
+    fi
+  fi
+])
+AC_MSG_RESULT([$_LT_TAGVAR(ld_shlibs, $1)])
+test "$_LT_TAGVAR(ld_shlibs, $1)" = no && can_build_shared=no
+
+_LT_TAGVAR(with_gnu_ld, $1)=$with_gnu_ld
+
+_LT_DECL([], [libext], [0], [Old archive suffix (normally "a")])dnl
+_LT_DECL([], [shrext_cmds], [1], [Shared library suffix (normally ".so")])dnl
+_LT_DECL([], [extract_expsyms_cmds], [2],
+    [The commands to extract the exported symbol list from a shared archive])
+
+#
+# Do we need to explicitly link libc?
+#
+case "x$_LT_TAGVAR(archive_cmds_need_lc, $1)" in
+x|xyes)
+  # Assume -lc should be added
+  _LT_TAGVAR(archive_cmds_need_lc, $1)=yes
+
+  if test "$enable_shared" = yes && test "$GCC" = yes; then
+    case $_LT_TAGVAR(archive_cmds, $1) in
+    *'~'*)
+      # FIXME: we may have to deal with multi-command sequences.
+      ;;
+    '$CC '*)
+      # Test whether the compiler implicitly links with -lc since on some
+      # systems, -lgcc has to come before -lc. If gcc already passes -lc
+      # to ld, don't add -lc before -lgcc.
+      AC_CACHE_CHECK([whether -lc should be explicitly linked in],
+	[lt_cv_]_LT_TAGVAR(archive_cmds_need_lc, $1),
+	[$RM conftest*
+	echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+	if AC_TRY_EVAL(ac_compile) 2>conftest.err; then
+	  soname=conftest
+	  lib=conftest
+	  libobjs=conftest.$ac_objext
+	  deplibs=
+	  wl=$_LT_TAGVAR(lt_prog_compiler_wl, $1)
+	  pic_flag=$_LT_TAGVAR(lt_prog_compiler_pic, $1)
+	  compiler_flags=-v
+	  linker_flags=-v
+	  verstring=
+	  output_objdir=.
+	  libname=conftest
+	  lt_save_allow_undefined_flag=$_LT_TAGVAR(allow_undefined_flag, $1)
+	  _LT_TAGVAR(allow_undefined_flag, $1)=
+	  if AC_TRY_EVAL(_LT_TAGVAR(archive_cmds, $1) 2\>\&1 \| $GREP \" -lc \" \>/dev/null 2\>\&1)
+	  then
+	    lt_cv_[]_LT_TAGVAR(archive_cmds_need_lc, $1)=no
+	  else
+	    lt_cv_[]_LT_TAGVAR(archive_cmds_need_lc, $1)=yes
+	  fi
+	  _LT_TAGVAR(allow_undefined_flag, $1)=$lt_save_allow_undefined_flag
+	else
+	  cat conftest.err 1>&5
+	fi
+	$RM conftest*
+	])
+      _LT_TAGVAR(archive_cmds_need_lc, $1)=$lt_cv_[]_LT_TAGVAR(archive_cmds_need_lc, $1)
+      ;;
+    esac
+  fi
+  ;;
+esac
+
+_LT_TAGDECL([build_libtool_need_lc], [archive_cmds_need_lc], [0],
+    [Whether or not to add -lc for building shared libraries])
+_LT_TAGDECL([allow_libtool_libs_with_static_runtimes],
+    [enable_shared_with_static_runtimes], [0],
+    [Whether or not to disallow shared libs when runtime libs are static])
+_LT_TAGDECL([], [export_dynamic_flag_spec], [1],
+    [Compiler flag to allow reflexive dlopens])
+_LT_TAGDECL([], [whole_archive_flag_spec], [1],
+    [Compiler flag to generate shared objects directly from archives])
+_LT_TAGDECL([], [compiler_needs_object], [1],
+    [Whether the compiler copes with passing no objects directly])
+_LT_TAGDECL([], [old_archive_from_new_cmds], [2],
+    [Create an old-style archive from a shared archive])
+_LT_TAGDECL([], [old_archive_from_expsyms_cmds], [2],
+    [Create a temporary old-style archive to link instead of a shared archive])
+_LT_TAGDECL([], [archive_cmds], [2], [Commands used to build a shared archive])
+_LT_TAGDECL([], [archive_expsym_cmds], [2])
+_LT_TAGDECL([], [module_cmds], [2],
+    [Commands used to build a loadable module if different from building
+    a shared archive.])
+_LT_TAGDECL([], [module_expsym_cmds], [2])
+_LT_TAGDECL([], [with_gnu_ld], [1],
+    [Whether we are building with GNU ld or not])
+_LT_TAGDECL([], [allow_undefined_flag], [1],
+    [Flag that allows shared libraries with undefined symbols to be built])
+_LT_TAGDECL([], [no_undefined_flag], [1],
+    [Flag that enforces no undefined symbols])
+_LT_TAGDECL([], [hardcode_libdir_flag_spec], [1],
+    [Flag to hardcode $libdir into a binary during linking.
+    This must work even if $libdir does not exist])
+_LT_TAGDECL([], [hardcode_libdir_separator], [1],
+    [Whether we need a single "-rpath" flag with a separated argument])
+_LT_TAGDECL([], [hardcode_direct], [0],
+    [Set to "yes" if using DIR/libNAME${shared_ext} during linking hardcodes
+    DIR into the resulting binary])
+_LT_TAGDECL([], [hardcode_direct_absolute], [0],
+    [Set to "yes" if using DIR/libNAME${shared_ext} during linking hardcodes
+    DIR into the resulting binary and the resulting library dependency is
+    "absolute", i.e impossible to change by setting ${shlibpath_var} if the
+    library is relocated])
+_LT_TAGDECL([], [hardcode_minus_L], [0],
+    [Set to "yes" if using the -LDIR flag during linking hardcodes DIR
+    into the resulting binary])
+_LT_TAGDECL([], [hardcode_shlibpath_var], [0],
+    [Set to "yes" if using SHLIBPATH_VAR=DIR during linking hardcodes DIR
+    into the resulting binary])
+_LT_TAGDECL([], [hardcode_automatic], [0],
+    [Set to "yes" if building a shared library automatically hardcodes DIR
+    into the library and all subsequent libraries and executables linked
+    against it])
+_LT_TAGDECL([], [inherit_rpath], [0],
+    [Set to yes if linker adds runtime paths of dependent libraries
+    to runtime path list])
+_LT_TAGDECL([], [link_all_deplibs], [0],
+    [Whether libtool must link a program against all its dependency libraries])
+_LT_TAGDECL([], [always_export_symbols], [0],
+    [Set to "yes" if exported symbols are required])
+_LT_TAGDECL([], [export_symbols_cmds], [2],
+    [The commands to list exported symbols])
+_LT_TAGDECL([], [exclude_expsyms], [1],
+    [Symbols that should not be listed in the preloaded symbols])
+_LT_TAGDECL([], [include_expsyms], [1],
+    [Symbols that must always be exported])
+_LT_TAGDECL([], [prelink_cmds], [2],
+    [Commands necessary for linking programs (against libraries) with templates])
+_LT_TAGDECL([], [postlink_cmds], [2],
+    [Commands necessary for finishing linking programs])
+_LT_TAGDECL([], [file_list_spec], [1],
+    [Specify filename containing input files])
+dnl FIXME: Not yet implemented
+dnl _LT_TAGDECL([], [thread_safe_flag_spec], [1],
+dnl    [Compiler flag to generate thread safe objects])
+])# _LT_LINKER_SHLIBS
+
+
+# _LT_LANG_C_CONFIG([TAG])
+# ------------------------
+# Ensure that the configuration variables for a C compiler are suitably
+# defined.  These variables are subsequently used by _LT_CONFIG to write
+# the compiler configuration to `libtool'.
+m4_defun([_LT_LANG_C_CONFIG],
+[m4_require([_LT_DECL_EGREP])dnl
+lt_save_CC="$CC"
+AC_LANG_PUSH(C)
+
+# Source file extension for C test sources.
+ac_ext=c
+
+# Object file extension for compiled C test sources.
+objext=o
+_LT_TAGVAR(objext, $1)=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code="int some_variable = 0;"
+
+# Code to be used in simple link tests
+lt_simple_link_test_code='int main(){return(0);}'
+
+_LT_TAG_COMPILER
+# Save the default compiler, since it gets overwritten when the other
+# tags are being tested, and _LT_TAGVAR(compiler, []) is a NOP.
+compiler_DEFAULT=$CC
+
+# save warnings/boilerplate of simple test code
+_LT_COMPILER_BOILERPLATE
+_LT_LINKER_BOILERPLATE
+
+if test -n "$compiler"; then
+  _LT_COMPILER_NO_RTTI($1)
+  _LT_COMPILER_PIC($1)
+  _LT_COMPILER_C_O($1)
+  _LT_COMPILER_FILE_LOCKS($1)
+  _LT_LINKER_SHLIBS($1)
+  _LT_SYS_DYNAMIC_LINKER($1)
+  _LT_LINKER_HARDCODE_LIBPATH($1)
+  LT_SYS_DLOPEN_SELF
+  _LT_CMD_STRIPLIB
+
+  # Report which library types will actually be built
+  AC_MSG_CHECKING([if libtool supports shared libraries])
+  AC_MSG_RESULT([$can_build_shared])
+
+  AC_MSG_CHECKING([whether to build shared libraries])
+  test "$can_build_shared" = "no" && enable_shared=no
+
+  # On AIX, shared libraries and static libraries use the same namespace, and
+  # are all built from PIC.
+  case $host_os in
+  aix3*)
+    test "$enable_shared" = yes && enable_static=no
+    if test -n "$RANLIB"; then
+      archive_cmds="$archive_cmds~\$RANLIB \$lib"
+      postinstall_cmds='$RANLIB $lib'
+    fi
+    ;;
+
+  aix[[4-9]]*)
+    if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then
+      test "$enable_shared" = yes && enable_static=no
+    fi
+    ;;
+  esac
+  AC_MSG_RESULT([$enable_shared])
+
+  AC_MSG_CHECKING([whether to build static libraries])
+  # Make sure either enable_shared or enable_static is yes.
+  test "$enable_shared" = yes || enable_static=yes
+  AC_MSG_RESULT([$enable_static])
+
+  _LT_CONFIG($1)
+fi
+AC_LANG_POP
+CC="$lt_save_CC"
+])# _LT_LANG_C_CONFIG
+
+
+# _LT_LANG_CXX_CONFIG([TAG])
+# --------------------------
+# Ensure that the configuration variables for a C++ compiler are suitably
+# defined.  These variables are subsequently used by _LT_CONFIG to write
+# the compiler configuration to `libtool'.
+m4_defun([_LT_LANG_CXX_CONFIG],
+[m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+m4_require([_LT_DECL_EGREP])dnl
+m4_require([_LT_PATH_MANIFEST_TOOL])dnl
+if test -n "$CXX" && ( test "X$CXX" != "Xno" &&
+    ( (test "X$CXX" = "Xg++" && `g++ -v >/dev/null 2>&1` ) ||
+    (test "X$CXX" != "Xg++"))) ; then
+  AC_PROG_CXXCPP
+else
+  _lt_caught_CXX_error=yes
+fi
+
+AC_LANG_PUSH(C++)
+_LT_TAGVAR(archive_cmds_need_lc, $1)=no
+_LT_TAGVAR(allow_undefined_flag, $1)=
+_LT_TAGVAR(always_export_symbols, $1)=no
+_LT_TAGVAR(archive_expsym_cmds, $1)=
+_LT_TAGVAR(compiler_needs_object, $1)=no
+_LT_TAGVAR(export_dynamic_flag_spec, $1)=
+_LT_TAGVAR(hardcode_direct, $1)=no
+_LT_TAGVAR(hardcode_direct_absolute, $1)=no
+_LT_TAGVAR(hardcode_libdir_flag_spec, $1)=
+_LT_TAGVAR(hardcode_libdir_separator, $1)=
+_LT_TAGVAR(hardcode_minus_L, $1)=no
+_LT_TAGVAR(hardcode_shlibpath_var, $1)=unsupported
+_LT_TAGVAR(hardcode_automatic, $1)=no
+_LT_TAGVAR(inherit_rpath, $1)=no
+_LT_TAGVAR(module_cmds, $1)=
+_LT_TAGVAR(module_expsym_cmds, $1)=
+_LT_TAGVAR(link_all_deplibs, $1)=unknown
+_LT_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds
+_LT_TAGVAR(reload_flag, $1)=$reload_flag
+_LT_TAGVAR(reload_cmds, $1)=$reload_cmds
+_LT_TAGVAR(no_undefined_flag, $1)=
+_LT_TAGVAR(whole_archive_flag_spec, $1)=
+_LT_TAGVAR(enable_shared_with_static_runtimes, $1)=no
+
+# Source file extension for C++ test sources.
+ac_ext=cpp
+
+# Object file extension for compiled C++ test sources.
+objext=o
+_LT_TAGVAR(objext, $1)=$objext
+
+# No sense in running all these tests if we already determined that
+# the CXX compiler isn't working.  Some variables (like enable_shared)
+# are currently assumed to apply to all compilers on this platform,
+# and will be corrupted by setting them based on a non-working compiler.
+if test "$_lt_caught_CXX_error" != yes; then
+  # Code to be used in simple compile tests
+  lt_simple_compile_test_code="int some_variable = 0;"
+
+  # Code to be used in simple link tests
+  lt_simple_link_test_code='int main(int, char *[[]]) { return(0); }'
+
+  # ltmain only uses $CC for tagged configurations so make sure $CC is set.
+  _LT_TAG_COMPILER
+
+  # save warnings/boilerplate of simple test code
+  _LT_COMPILER_BOILERPLATE
+  _LT_LINKER_BOILERPLATE
+
+  # Allow CC to be a program name with arguments.
+  lt_save_CC=$CC
+  lt_save_CFLAGS=$CFLAGS
+  lt_save_LD=$LD
+  lt_save_GCC=$GCC
+  GCC=$GXX
+  lt_save_with_gnu_ld=$with_gnu_ld
+  lt_save_path_LD=$lt_cv_path_LD
+  if test -n "${lt_cv_prog_gnu_ldcxx+set}"; then
+    lt_cv_prog_gnu_ld=$lt_cv_prog_gnu_ldcxx
+  else
+    $as_unset lt_cv_prog_gnu_ld
+  fi
+  if test -n "${lt_cv_path_LDCXX+set}"; then
+    lt_cv_path_LD=$lt_cv_path_LDCXX
+  else
+    $as_unset lt_cv_path_LD
+  fi
+  test -z "${LDCXX+set}" || LD=$LDCXX
+  CC=${CXX-"c++"}
+  CFLAGS=$CXXFLAGS
+  compiler=$CC
+  _LT_TAGVAR(compiler, $1)=$CC
+  _LT_CC_BASENAME([$compiler])
+
+  if test -n "$compiler"; then
+    # We don't want -fno-exception when compiling C++ code, so set the
+    # no_builtin_flag separately
+    if test "$GXX" = yes; then
+      _LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=' -fno-builtin'
+    else
+      _LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=
+    fi
+
+    if test "$GXX" = yes; then
+      # Set up default GNU C++ configuration
+
+      LT_PATH_LD
+
+      # Check if GNU C++ uses GNU ld as the underlying linker, since the
+      # archiving commands below assume that GNU ld is being used.
+      if test "$with_gnu_ld" = yes; then
+        _LT_TAGVAR(archive_cmds, $1)='$CC $pic_flag -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib'
+        _LT_TAGVAR(archive_expsym_cmds, $1)='$CC $pic_flag -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+
+        _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+        _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic'
+
+        # If archive_cmds runs LD, not CC, wlarc should be empty
+        # XXX I think wlarc can be eliminated in ltcf-cxx, but I need to
+        #     investigate it a little bit more. (MM)
+        wlarc='${wl}'
+
+        # ancient GNU ld didn't support --whole-archive et. al.
+        if eval "`$CC -print-prog-name=ld` --help 2>&1" |
+	  $GREP 'no-whole-archive' > /dev/null; then
+          _LT_TAGVAR(whole_archive_flag_spec, $1)="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+        else
+          _LT_TAGVAR(whole_archive_flag_spec, $1)=
+        fi
+      else
+        with_gnu_ld=no
+        wlarc=
+
+        # A generic and very simple default shared library creation
+        # command for GNU C++ for the case where it uses the native
+        # linker, instead of GNU ld.  If possible, this setting should
+        # overridden to take advantage of the native linker features on
+        # the platform it is being used on.
+        _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $lib'
+      fi
+
+      # Commands to make compiler produce verbose output that lists
+      # what "hidden" libraries, object files and flags are used when
+      # linking a shared library.
+      output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP -v "^Configured with:" | $GREP "\-L"'
+
+    else
+      GXX=no
+      with_gnu_ld=no
+      wlarc=
+    fi
+
+    # PORTME: fill in a description of your system's C++ link characteristics
+    AC_MSG_CHECKING([whether the $compiler linker ($LD) supports shared libraries])
+    _LT_TAGVAR(ld_shlibs, $1)=yes
+    case $host_os in
+      aix3*)
+        # FIXME: insert proper C++ library support
+        _LT_TAGVAR(ld_shlibs, $1)=no
+        ;;
+      aix[[4-9]]*)
+        if test "$host_cpu" = ia64; then
+          # On IA64, the linker does run time linking by default, so we don't
+          # have to do anything special.
+          aix_use_runtimelinking=no
+          exp_sym_flag='-Bexport'
+          no_entry_flag=""
+        else
+          aix_use_runtimelinking=no
+
+          # Test if we are trying to use run time linking or normal
+          # AIX style linking. If -brtl is somewhere in LDFLAGS, we
+          # need to do runtime linking.
+          case $host_os in aix4.[[23]]|aix4.[[23]].*|aix[[5-9]]*)
+	    for ld_flag in $LDFLAGS; do
+	      case $ld_flag in
+	      *-brtl*)
+	        aix_use_runtimelinking=yes
+	        break
+	        ;;
+	      esac
+	    done
+	    ;;
+          esac
+
+          exp_sym_flag='-bexport'
+          no_entry_flag='-bnoentry'
+        fi
+
+        # When large executables or shared objects are built, AIX ld can
+        # have problems creating the table of contents.  If linking a library
+        # or program results in "error TOC overflow" add -mminimal-toc to
+        # CXXFLAGS/CFLAGS for g++/gcc.  In the cases where that is not
+        # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS.
+
+        _LT_TAGVAR(archive_cmds, $1)=''
+        _LT_TAGVAR(hardcode_direct, $1)=yes
+        _LT_TAGVAR(hardcode_direct_absolute, $1)=yes
+        _LT_TAGVAR(hardcode_libdir_separator, $1)=':'
+        _LT_TAGVAR(link_all_deplibs, $1)=yes
+        _LT_TAGVAR(file_list_spec, $1)='${wl}-f,'
+
+        if test "$GXX" = yes; then
+          case $host_os in aix4.[[012]]|aix4.[[012]].*)
+          # We only want to do this on AIX 4.2 and lower, the check
+          # below for broken collect2 doesn't work under 4.3+
+	  collect2name=`${CC} -print-prog-name=collect2`
+	  if test -f "$collect2name" &&
+	     strings "$collect2name" | $GREP resolve_lib_name >/dev/null
+	  then
+	    # We have reworked collect2
+	    :
+	  else
+	    # We have old collect2
+	    _LT_TAGVAR(hardcode_direct, $1)=unsupported
+	    # It fails to find uninstalled libraries when the uninstalled
+	    # path is not listed in the libpath.  Setting hardcode_minus_L
+	    # to unsupported forces relinking
+	    _LT_TAGVAR(hardcode_minus_L, $1)=yes
+	    _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+	    _LT_TAGVAR(hardcode_libdir_separator, $1)=
+	  fi
+          esac
+          shared_flag='-shared'
+	  if test "$aix_use_runtimelinking" = yes; then
+	    shared_flag="$shared_flag "'${wl}-G'
+	  fi
+        else
+          # not using gcc
+          if test "$host_cpu" = ia64; then
+	  # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release
+	  # chokes on -Wl,-G. The following line is correct:
+	  shared_flag='-G'
+          else
+	    if test "$aix_use_runtimelinking" = yes; then
+	      shared_flag='${wl}-G'
+	    else
+	      shared_flag='${wl}-bM:SRE'
+	    fi
+          fi
+        fi
+
+        _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-bexpall'
+        # It seems that -bexpall does not export symbols beginning with
+        # underscore (_), so it is better to generate a list of symbols to
+	# export.
+        _LT_TAGVAR(always_export_symbols, $1)=yes
+        if test "$aix_use_runtimelinking" = yes; then
+          # Warning - without using the other runtime loading flags (-brtl),
+          # -berok will link without error, but may produce a broken library.
+          _LT_TAGVAR(allow_undefined_flag, $1)='-berok'
+          # Determine the default libpath from the value encoded in an empty
+          # executable.
+          _LT_SYS_MODULE_PATH_AIX([$1])
+          _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath"
+
+          _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then func_echo_all "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag"
+        else
+          if test "$host_cpu" = ia64; then
+	    _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R $libdir:/usr/lib:/lib'
+	    _LT_TAGVAR(allow_undefined_flag, $1)="-z nodefs"
+	    _LT_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols"
+          else
+	    # Determine the default libpath from the value encoded in an
+	    # empty executable.
+	    _LT_SYS_MODULE_PATH_AIX([$1])
+	    _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath"
+	    # Warning - without using the other run time loading flags,
+	    # -berok will link without error, but may produce a broken library.
+	    _LT_TAGVAR(no_undefined_flag, $1)=' ${wl}-bernotok'
+	    _LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-berok'
+	    if test "$with_gnu_ld" = yes; then
+	      # We only use this code for GNU lds that support --whole-archive.
+	      _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive$convenience ${wl}--no-whole-archive'
+	    else
+	      # Exported symbols can be pulled into shared objects from archives
+	      _LT_TAGVAR(whole_archive_flag_spec, $1)='$convenience'
+	    fi
+	    _LT_TAGVAR(archive_cmds_need_lc, $1)=yes
+	    # This is similar to how AIX traditionally builds its shared
+	    # libraries.
+	    _LT_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname'
+          fi
+        fi
+        ;;
+
+      beos*)
+	if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+	  _LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+	  # Joseph Beckenbach <jrb3 at best.com> says some releases of gcc
+	  # support --undefined.  This deserves some investigation.  FIXME
+	  _LT_TAGVAR(archive_cmds, $1)='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+	else
+	  _LT_TAGVAR(ld_shlibs, $1)=no
+	fi
+	;;
+
+      chorus*)
+        case $cc_basename in
+          *)
+	  # FIXME: insert proper C++ library support
+	  _LT_TAGVAR(ld_shlibs, $1)=no
+	  ;;
+        esac
+        ;;
+
+      cygwin* | mingw* | pw32* | cegcc*)
+	case $GXX,$cc_basename in
+	,cl* | no,cl*)
+	  # Native MSVC
+	  # hardcode_libdir_flag_spec is actually meaningless, as there is
+	  # no search path for DLLs.
+	  _LT_TAGVAR(hardcode_libdir_flag_spec, $1)=' '
+	  _LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+	  _LT_TAGVAR(always_export_symbols, $1)=yes
+	  _LT_TAGVAR(file_list_spec, $1)='@'
+	  # Tell ltmain to make .lib files, not .a files.
+	  libext=lib
+	  # Tell ltmain to make .dll files, not .so files.
+	  shrext_cmds=".dll"
+	  # FIXME: Setting linknames here is a bad hack.
+	  _LT_TAGVAR(archive_cmds, $1)='$CC -o $output_objdir/$soname $libobjs $compiler_flags $deplibs -Wl,-dll~linknames='
+	  _LT_TAGVAR(archive_expsym_cmds, $1)='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+	      $SED -n -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' -e '1\\\!p' < $export_symbols > $output_objdir/$soname.exp;
+	    else
+	      $SED -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' < $export_symbols > $output_objdir/$soname.exp;
+	    fi~
+	    $CC -o $tool_output_objdir$soname $libobjs $compiler_flags $deplibs "@$tool_output_objdir$soname.exp" -Wl,-DLL,-IMPLIB:"$tool_output_objdir$libname.dll.lib"~
+	    linknames='
+	  # The linker will not automatically build a static lib if we build a DLL.
+	  # _LT_TAGVAR(old_archive_from_new_cmds, $1)='true'
+	  _LT_TAGVAR(enable_shared_with_static_runtimes, $1)=yes
+	  # Don't use ranlib
+	  _LT_TAGVAR(old_postinstall_cmds, $1)='chmod 644 $oldlib'
+	  _LT_TAGVAR(postlink_cmds, $1)='lt_outputfile="@OUTPUT@"~
+	    lt_tool_outputfile="@TOOL_OUTPUT@"~
+	    case $lt_outputfile in
+	      *.exe|*.EXE) ;;
+	      *)
+		lt_outputfile="$lt_outputfile.exe"
+		lt_tool_outputfile="$lt_tool_outputfile.exe"
+		;;
+	    esac~
+	    func_to_tool_file "$lt_outputfile"~
+	    if test "$MANIFEST_TOOL" != ":" && test -f "$lt_outputfile.manifest"; then
+	      $MANIFEST_TOOL -manifest "$lt_tool_outputfile.manifest" -outputresource:"$lt_tool_outputfile" || exit 1;
+	      $RM "$lt_outputfile.manifest";
+	    fi'
+	  ;;
+	*)
+	  # g++
+	  # _LT_TAGVAR(hardcode_libdir_flag_spec, $1) is actually meaningless,
+	  # as there is no search path for DLLs.
+	  _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+	  _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-all-symbols'
+	  _LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+	  _LT_TAGVAR(always_export_symbols, $1)=no
+	  _LT_TAGVAR(enable_shared_with_static_runtimes, $1)=yes
+
+	  if $LD --help 2>&1 | $GREP 'auto-import' > /dev/null; then
+	    _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+	    # If the export-symbols file already is a .def file (1st line
+	    # is EXPORTS), use it as is; otherwise, prepend...
+	    _LT_TAGVAR(archive_expsym_cmds, $1)='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+	      cp $export_symbols $output_objdir/$soname.def;
+	    else
+	      echo EXPORTS > $output_objdir/$soname.def;
+	      cat $export_symbols >> $output_objdir/$soname.def;
+	    fi~
+	    $CC -shared -nostdlib $output_objdir/$soname.def $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+	  else
+	    _LT_TAGVAR(ld_shlibs, $1)=no
+	  fi
+	  ;;
+	esac
+	;;
+      darwin* | rhapsody*)
+        _LT_DARWIN_LINKER_FEATURES($1)
+	;;
+
+      dgux*)
+        case $cc_basename in
+          ec++*)
+	    # FIXME: insert proper C++ library support
+	    _LT_TAGVAR(ld_shlibs, $1)=no
+	    ;;
+          ghcx*)
+	    # Green Hills C++ Compiler
+	    # FIXME: insert proper C++ library support
+	    _LT_TAGVAR(ld_shlibs, $1)=no
+	    ;;
+          *)
+	    # FIXME: insert proper C++ library support
+	    _LT_TAGVAR(ld_shlibs, $1)=no
+	    ;;
+        esac
+        ;;
+
+      freebsd2.*)
+        # C++ shared libraries reported to be fairly broken before
+	# switch to ELF
+        _LT_TAGVAR(ld_shlibs, $1)=no
+        ;;
+
+      freebsd-elf*)
+        _LT_TAGVAR(archive_cmds_need_lc, $1)=no
+        ;;
+
+      freebsd* | dragonfly*)
+        # FreeBSD 3 and later use GNU C++ and GNU ld with standard ELF
+        # conventions
+        _LT_TAGVAR(ld_shlibs, $1)=yes
+        ;;
+
+      haiku*)
+        _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+        _LT_TAGVAR(link_all_deplibs, $1)=yes
+        ;;
+
+      hpux9*)
+        _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir'
+        _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+        _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+        _LT_TAGVAR(hardcode_direct, $1)=yes
+        _LT_TAGVAR(hardcode_minus_L, $1)=yes # Not in the search PATH,
+				             # but as the default
+				             # location of the library.
+
+        case $cc_basename in
+          CC*)
+            # FIXME: insert proper C++ library support
+            _LT_TAGVAR(ld_shlibs, $1)=no
+            ;;
+          aCC*)
+            _LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/$soname~$CC -b ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+            # Commands to make compiler produce verbose output that lists
+            # what "hidden" libraries, object files and flags are used when
+            # linking a shared library.
+            #
+            # There doesn't appear to be a way to prevent this compiler from
+            # explicitly linking system object files so we need to strip them
+            # from the output so that they don't get included in the library
+            # dependencies.
+            output_verbose_link_cmd='templist=`($CC -b $CFLAGS -v conftest.$objext 2>&1) | $EGREP "\-L"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "$list"'
+            ;;
+          *)
+            if test "$GXX" = yes; then
+              _LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/$soname~$CC -shared -nostdlib $pic_flag ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+            else
+              # FIXME: insert proper C++ library support
+              _LT_TAGVAR(ld_shlibs, $1)=no
+            fi
+            ;;
+        esac
+        ;;
+
+      hpux10*|hpux11*)
+        if test $with_gnu_ld = no; then
+	  _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir'
+	  _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+
+          case $host_cpu in
+            hppa*64*|ia64*)
+              ;;
+            *)
+	      _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+              ;;
+          esac
+        fi
+        case $host_cpu in
+          hppa*64*|ia64*)
+            _LT_TAGVAR(hardcode_direct, $1)=no
+            _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+            ;;
+          *)
+            _LT_TAGVAR(hardcode_direct, $1)=yes
+            _LT_TAGVAR(hardcode_direct_absolute, $1)=yes
+            _LT_TAGVAR(hardcode_minus_L, $1)=yes # Not in the search PATH,
+					         # but as the default
+					         # location of the library.
+            ;;
+        esac
+
+        case $cc_basename in
+          CC*)
+	    # FIXME: insert proper C++ library support
+	    _LT_TAGVAR(ld_shlibs, $1)=no
+	    ;;
+          aCC*)
+	    case $host_cpu in
+	      hppa*64*)
+	        _LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+	        ;;
+	      ia64*)
+	        _LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+	        ;;
+	      *)
+	        _LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+	        ;;
+	    esac
+	    # Commands to make compiler produce verbose output that lists
+	    # what "hidden" libraries, object files and flags are used when
+	    # linking a shared library.
+	    #
+	    # There doesn't appear to be a way to prevent this compiler from
+	    # explicitly linking system object files so we need to strip them
+	    # from the output so that they don't get included in the library
+	    # dependencies.
+	    output_verbose_link_cmd='templist=`($CC -b $CFLAGS -v conftest.$objext 2>&1) | $GREP "\-L"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "$list"'
+	    ;;
+          *)
+	    if test "$GXX" = yes; then
+	      if test $with_gnu_ld = no; then
+	        case $host_cpu in
+	          hppa*64*)
+	            _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib -fPIC ${wl}+h ${wl}$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+	            ;;
+	          ia64*)
+	            _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $pic_flag ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+	            ;;
+	          *)
+	            _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $pic_flag ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+	            ;;
+	        esac
+	      fi
+	    else
+	      # FIXME: insert proper C++ library support
+	      _LT_TAGVAR(ld_shlibs, $1)=no
+	    fi
+	    ;;
+        esac
+        ;;
+
+      interix[[3-9]]*)
+	_LT_TAGVAR(hardcode_direct, $1)=no
+	_LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+	_LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+	_LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+	# Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc.
+	# Instead, shared libraries are loaded at an image base (0x10000000 by
+	# default) and relocated if they conflict, which is a slow very memory
+	# consuming and fragmenting process.  To avoid this, we pick a random,
+	# 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link
+	# time.  Moving up from 0x10000000 also allows more sbrk(2) space.
+	_LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+	_LT_TAGVAR(archive_expsym_cmds, $1)='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+	;;
+      irix5* | irix6*)
+        case $cc_basename in
+          CC*)
+	    # SGI C++
+	    _LT_TAGVAR(archive_cmds, $1)='$CC -shared -all -multigot $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+
+	    # Archives containing C++ object files must be created using
+	    # "CC -ar", where "CC" is the IRIX C++ compiler.  This is
+	    # necessary to make sure instantiated templates are included
+	    # in the archive.
+	    _LT_TAGVAR(old_archive_cmds, $1)='$CC -ar -WR,-u -o $oldlib $oldobjs'
+	    ;;
+          *)
+	    if test "$GXX" = yes; then
+	      if test "$with_gnu_ld" = no; then
+	        _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+	      else
+	        _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` -o $lib'
+	      fi
+	    fi
+	    _LT_TAGVAR(link_all_deplibs, $1)=yes
+	    ;;
+        esac
+        _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+        _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+        _LT_TAGVAR(inherit_rpath, $1)=yes
+        ;;
+
+      linux* | k*bsd*-gnu | kopensolaris*-gnu | gnu*)
+        case $cc_basename in
+          KCC*)
+	    # Kuck and Associates, Inc. (KAI) C++ Compiler
+
+	    # KCC will only create a shared library if the output file
+	    # ends with ".so" (or ".sl" for HP-UX), so rename the library
+	    # to its proper name (with version) after linking.
+	    _LT_TAGVAR(archive_cmds, $1)='tempext=`echo $shared_ext | $SED -e '\''s/\([[^()0-9A-Za-z{}]]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib'
+	    _LT_TAGVAR(archive_expsym_cmds, $1)='tempext=`echo $shared_ext | $SED -e '\''s/\([[^()0-9A-Za-z{}]]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib ${wl}-retain-symbols-file,$export_symbols; mv \$templib $lib'
+	    # Commands to make compiler produce verbose output that lists
+	    # what "hidden" libraries, object files and flags are used when
+	    # linking a shared library.
+	    #
+	    # There doesn't appear to be a way to prevent this compiler from
+	    # explicitly linking system object files so we need to strip them
+	    # from the output so that they don't get included in the library
+	    # dependencies.
+	    output_verbose_link_cmd='templist=`$CC $CFLAGS -v conftest.$objext -o libconftest$shared_ext 2>&1 | $GREP "ld"`; rm -f libconftest$shared_ext; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "$list"'
+
+	    _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+	    _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic'
+
+	    # Archives containing C++ object files must be created using
+	    # "CC -Bstatic", where "CC" is the KAI C++ compiler.
+	    _LT_TAGVAR(old_archive_cmds, $1)='$CC -Bstatic -o $oldlib $oldobjs'
+	    ;;
+	  icpc* | ecpc* )
+	    # Intel C++
+	    with_gnu_ld=yes
+	    # version 8.0 and above of icpc choke on multiply defined symbols
+	    # if we add $predep_objects and $postdep_objects, however 7.1 and
+	    # earlier do not add the objects themselves.
+	    case `$CC -V 2>&1` in
+	      *"Version 7."*)
+	        _LT_TAGVAR(archive_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib'
+		_LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+		;;
+	      *)  # Version 8.0 or newer
+	        tmp_idyn=
+	        case $host_cpu in
+		  ia64*) tmp_idyn=' -i_dynamic';;
+		esac
+	        _LT_TAGVAR(archive_cmds, $1)='$CC -shared'"$tmp_idyn"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+		_LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared'"$tmp_idyn"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+		;;
+	    esac
+	    _LT_TAGVAR(archive_cmds_need_lc, $1)=no
+	    _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+	    _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic'
+	    _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive$convenience ${wl}--no-whole-archive'
+	    ;;
+          pgCC* | pgcpp*)
+            # Portland Group C++ compiler
+	    case `$CC -V` in
+	    *pgCC\ [[1-5]].* | *pgcpp\ [[1-5]].*)
+	      _LT_TAGVAR(prelink_cmds, $1)='tpldir=Template.dir~
+		rm -rf $tpldir~
+		$CC --prelink_objects --instantiation_dir $tpldir $objs $libobjs $compile_deplibs~
+		compile_command="$compile_command `find $tpldir -name \*.o | sort | $NL2SP`"'
+	      _LT_TAGVAR(old_archive_cmds, $1)='tpldir=Template.dir~
+		rm -rf $tpldir~
+		$CC --prelink_objects --instantiation_dir $tpldir $oldobjs$old_deplibs~
+		$AR $AR_FLAGS $oldlib$oldobjs$old_deplibs `find $tpldir -name \*.o | sort | $NL2SP`~
+		$RANLIB $oldlib'
+	      _LT_TAGVAR(archive_cmds, $1)='tpldir=Template.dir~
+		rm -rf $tpldir~
+		$CC --prelink_objects --instantiation_dir $tpldir $predep_objects $libobjs $deplibs $convenience $postdep_objects~
+		$CC -shared $pic_flag $predep_objects $libobjs $deplibs `find $tpldir -name \*.o | sort | $NL2SP` $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname -o $lib'
+	      _LT_TAGVAR(archive_expsym_cmds, $1)='tpldir=Template.dir~
+		rm -rf $tpldir~
+		$CC --prelink_objects --instantiation_dir $tpldir $predep_objects $libobjs $deplibs $convenience $postdep_objects~
+		$CC -shared $pic_flag $predep_objects $libobjs $deplibs `find $tpldir -name \*.o | sort | $NL2SP` $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname ${wl}-retain-symbols-file ${wl}$export_symbols -o $lib'
+	      ;;
+	    *) # Version 6 and above use weak symbols
+	      _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname -o $lib'
+	      _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname ${wl}-retain-symbols-file ${wl}$export_symbols -o $lib'
+	      ;;
+	    esac
+
+	    _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}--rpath ${wl}$libdir'
+	    _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic'
+	    _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test  -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+            ;;
+	  cxx*)
+	    # Compaq C++
+	    _LT_TAGVAR(archive_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib'
+	    _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname  -o $lib ${wl}-retain-symbols-file $wl$export_symbols'
+
+	    runpath_var=LD_RUN_PATH
+	    _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-rpath $libdir'
+	    _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+
+	    # Commands to make compiler produce verbose output that lists
+	    # what "hidden" libraries, object files and flags are used when
+	    # linking a shared library.
+	    #
+	    # There doesn't appear to be a way to prevent this compiler from
+	    # explicitly linking system object files so we need to strip them
+	    # from the output so that they don't get included in the library
+	    # dependencies.
+	    output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP "ld"`; templist=`func_echo_all "$templist" | $SED "s/\(^.*ld.*\)\( .*ld .*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "X$list" | $Xsed'
+	    ;;
+	  xl* | mpixl* | bgxl*)
+	    # IBM XL 8.0 on PPC, with GNU ld
+	    _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+	    _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic'
+	    _LT_TAGVAR(archive_cmds, $1)='$CC -qmkshrobj $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+	    if test "x$supports_anon_versioning" = xyes; then
+	      _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $output_objdir/$libname.ver~
+		cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~
+		echo "local: *; };" >> $output_objdir/$libname.ver~
+		$CC -qmkshrobj $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib'
+	    fi
+	    ;;
+	  *)
+	    case `$CC -V 2>&1 | sed 5q` in
+	    *Sun\ C*)
+	      # Sun C++ 5.9
+	      _LT_TAGVAR(no_undefined_flag, $1)=' -zdefs'
+	      _LT_TAGVAR(archive_cmds, $1)='$CC -G${allow_undefined_flag} -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+	      _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -G${allow_undefined_flag} -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-retain-symbols-file ${wl}$export_symbols'
+	      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+	      _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`new_convenience=; for conv in $convenience\"\"; do test -z \"$conv\" || new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+	      _LT_TAGVAR(compiler_needs_object, $1)=yes
+
+	      # Not sure whether something based on
+	      # $CC $CFLAGS -v conftest.$objext -o libconftest$shared_ext 2>&1
+	      # would be better.
+	      output_verbose_link_cmd='func_echo_all'
+
+	      # Archives containing C++ object files must be created using
+	      # "CC -xar", where "CC" is the Sun C++ compiler.  This is
+	      # necessary to make sure instantiated templates are included
+	      # in the archive.
+	      _LT_TAGVAR(old_archive_cmds, $1)='$CC -xar -o $oldlib $oldobjs'
+	      ;;
+	    esac
+	    ;;
+	esac
+	;;
+
+      lynxos*)
+        # FIXME: insert proper C++ library support
+	_LT_TAGVAR(ld_shlibs, $1)=no
+	;;
+
+      m88k*)
+        # FIXME: insert proper C++ library support
+        _LT_TAGVAR(ld_shlibs, $1)=no
+	;;
+
+      mvs*)
+        case $cc_basename in
+          cxx*)
+	    # FIXME: insert proper C++ library support
+	    _LT_TAGVAR(ld_shlibs, $1)=no
+	    ;;
+	  *)
+	    # FIXME: insert proper C++ library support
+	    _LT_TAGVAR(ld_shlibs, $1)=no
+	    ;;
+	esac
+	;;
+
+      netbsd*)
+        if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+	  _LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable  -o $lib $predep_objects $libobjs $deplibs $postdep_objects $linker_flags'
+	  wlarc=
+	  _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+	  _LT_TAGVAR(hardcode_direct, $1)=yes
+	  _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+	fi
+	# Workaround some broken pre-1.5 toolchains
+	output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP conftest.$objext | $SED -e "s:-lgcc -lc -lgcc::"'
+	;;
+
+      *nto* | *qnx*)
+        _LT_TAGVAR(ld_shlibs, $1)=yes
+	;;
+
+      openbsd2*)
+        # C++ shared libraries are fairly broken
+	_LT_TAGVAR(ld_shlibs, $1)=no
+	;;
+
+      openbsd*)
+	if test -f /usr/libexec/ld.so; then
+	  _LT_TAGVAR(hardcode_direct, $1)=yes
+	  _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+	  _LT_TAGVAR(hardcode_direct_absolute, $1)=yes
+	  _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $lib'
+	  _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+	  if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+	    _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-retain-symbols-file,$export_symbols -o $lib'
+	    _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+	    _LT_TAGVAR(whole_archive_flag_spec, $1)="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+	  fi
+	  output_verbose_link_cmd=func_echo_all
+	else
+	  _LT_TAGVAR(ld_shlibs, $1)=no
+	fi
+	;;
+
+      osf3* | osf4* | osf5*)
+        case $cc_basename in
+          KCC*)
+	    # Kuck and Associates, Inc. (KAI) C++ Compiler
+
+	    # KCC will only create a shared library if the output file
+	    # ends with ".so" (or ".sl" for HP-UX), so rename the library
+	    # to its proper name (with version) after linking.
+	    _LT_TAGVAR(archive_cmds, $1)='tempext=`echo $shared_ext | $SED -e '\''s/\([[^()0-9A-Za-z{}]]\)/\\\\\1/g'\''`; templib=`echo "$lib" | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib'
+
+	    _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+	    _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+
+	    # Archives containing C++ object files must be created using
+	    # the KAI C++ compiler.
+	    case $host in
+	      osf3*) _LT_TAGVAR(old_archive_cmds, $1)='$CC -Bstatic -o $oldlib $oldobjs' ;;
+	      *) _LT_TAGVAR(old_archive_cmds, $1)='$CC -o $oldlib $oldobjs' ;;
+	    esac
+	    ;;
+          RCC*)
+	    # Rational C++ 2.4.1
+	    # FIXME: insert proper C++ library support
+	    _LT_TAGVAR(ld_shlibs, $1)=no
+	    ;;
+          cxx*)
+	    case $host in
+	      osf3*)
+	        _LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*'
+	        _LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $soname `test -n "$verstring" && func_echo_all "${wl}-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+	        _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+		;;
+	      *)
+	        _LT_TAGVAR(allow_undefined_flag, $1)=' -expect_unresolved \*'
+	        _LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -msym -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+	        _LT_TAGVAR(archive_expsym_cmds, $1)='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done~
+	          echo "-hidden">> $lib.exp~
+	          $CC -shared$allow_undefined_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -msym -soname $soname ${wl}-input ${wl}$lib.exp  `test -n "$verstring" && $ECHO "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib~
+	          $RM $lib.exp'
+	        _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-rpath $libdir'
+		;;
+	    esac
+
+	    _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+
+	    # Commands to make compiler produce verbose output that lists
+	    # what "hidden" libraries, object files and flags are used when
+	    # linking a shared library.
+	    #
+	    # There doesn't appear to be a way to prevent this compiler from
+	    # explicitly linking system object files so we need to strip them
+	    # from the output so that they don't get included in the library
+	    # dependencies.
+	    output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP "ld" | $GREP -v "ld:"`; templist=`func_echo_all "$templist" | $SED "s/\(^.*ld.*\)\( .*ld.*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "$list"'
+	    ;;
+	  *)
+	    if test "$GXX" = yes && test "$with_gnu_ld" = no; then
+	      _LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*'
+	      case $host in
+	        osf3*)
+	          _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib ${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+		  ;;
+	        *)
+	          _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -nostdlib ${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+		  ;;
+	      esac
+
+	      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+	      _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+
+	      # Commands to make compiler produce verbose output that lists
+	      # what "hidden" libraries, object files and flags are used when
+	      # linking a shared library.
+	      output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP -v "^Configured with:" | $GREP "\-L"'
+
+	    else
+	      # FIXME: insert proper C++ library support
+	      _LT_TAGVAR(ld_shlibs, $1)=no
+	    fi
+	    ;;
+        esac
+        ;;
+
+      psos*)
+        # FIXME: insert proper C++ library support
+        _LT_TAGVAR(ld_shlibs, $1)=no
+        ;;
+
+      sunos4*)
+        case $cc_basename in
+          CC*)
+	    # Sun C++ 4.x
+	    # FIXME: insert proper C++ library support
+	    _LT_TAGVAR(ld_shlibs, $1)=no
+	    ;;
+          lcc*)
+	    # Lucid
+	    # FIXME: insert proper C++ library support
+	    _LT_TAGVAR(ld_shlibs, $1)=no
+	    ;;
+          *)
+	    # FIXME: insert proper C++ library support
+	    _LT_TAGVAR(ld_shlibs, $1)=no
+	    ;;
+        esac
+        ;;
+
+      solaris*)
+        case $cc_basename in
+          CC* | sunCC*)
+	    # Sun C++ 4.2, 5.x and Centerline C++
+            _LT_TAGVAR(archive_cmds_need_lc,$1)=yes
+	    _LT_TAGVAR(no_undefined_flag, $1)=' -zdefs'
+	    _LT_TAGVAR(archive_cmds, $1)='$CC -G${allow_undefined_flag}  -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+	    _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+	      $CC -G${allow_undefined_flag} ${wl}-M ${wl}$lib.exp -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$RM $lib.exp'
+
+	    _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+	    _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+	    case $host_os in
+	      solaris2.[[0-5]] | solaris2.[[0-5]].*) ;;
+	      *)
+		# The compiler driver will combine and reorder linker options,
+		# but understands `-z linker_flag'.
+	        # Supported since Solaris 2.6 (maybe 2.5.1?)
+		_LT_TAGVAR(whole_archive_flag_spec, $1)='-z allextract$convenience -z defaultextract'
+	        ;;
+	    esac
+	    _LT_TAGVAR(link_all_deplibs, $1)=yes
+
+	    output_verbose_link_cmd='func_echo_all'
+
+	    # Archives containing C++ object files must be created using
+	    # "CC -xar", where "CC" is the Sun C++ compiler.  This is
+	    # necessary to make sure instantiated templates are included
+	    # in the archive.
+	    _LT_TAGVAR(old_archive_cmds, $1)='$CC -xar -o $oldlib $oldobjs'
+	    ;;
+          gcx*)
+	    # Green Hills C++ Compiler
+	    _LT_TAGVAR(archive_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib'
+
+	    # The C++ compiler must be used to create the archive.
+	    _LT_TAGVAR(old_archive_cmds, $1)='$CC $LDFLAGS -archive -o $oldlib $oldobjs'
+	    ;;
+          *)
+	    # GNU C++ compiler with Solaris linker
+	    if test "$GXX" = yes && test "$with_gnu_ld" = no; then
+	      _LT_TAGVAR(no_undefined_flag, $1)=' ${wl}-z ${wl}defs'
+	      if $CC --version | $GREP -v '^2\.7' > /dev/null; then
+	        _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -nostdlib $LDFLAGS $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib'
+	        _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+		  $CC -shared $pic_flag -nostdlib ${wl}-M $wl$lib.exp -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$RM $lib.exp'
+
+	        # Commands to make compiler produce verbose output that lists
+	        # what "hidden" libraries, object files and flags are used when
+	        # linking a shared library.
+	        output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP -v "^Configured with:" | $GREP "\-L"'
+	      else
+	        # g++ 2.7 appears to require `-G' NOT `-shared' on this
+	        # platform.
+	        _LT_TAGVAR(archive_cmds, $1)='$CC -G -nostdlib $LDFLAGS $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib'
+	        _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+		  $CC -G -nostdlib ${wl}-M $wl$lib.exp -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$RM $lib.exp'
+
+	        # Commands to make compiler produce verbose output that lists
+	        # what "hidden" libraries, object files and flags are used when
+	        # linking a shared library.
+	        output_verbose_link_cmd='$CC -G $CFLAGS -v conftest.$objext 2>&1 | $GREP -v "^Configured with:" | $GREP "\-L"'
+	      fi
+
+	      _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R $wl$libdir'
+	      case $host_os in
+		solaris2.[[0-5]] | solaris2.[[0-5]].*) ;;
+		*)
+		  _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}-z ${wl}allextract$convenience ${wl}-z ${wl}defaultextract'
+		  ;;
+	      esac
+	    fi
+	    ;;
+        esac
+        ;;
+
+    sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[[01]].[[10]]* | unixware7* | sco3.2v5.0.[[024]]*)
+      _LT_TAGVAR(no_undefined_flag, $1)='${wl}-z,text'
+      _LT_TAGVAR(archive_cmds_need_lc, $1)=no
+      _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+      runpath_var='LD_RUN_PATH'
+
+      case $cc_basename in
+        CC*)
+	  _LT_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+	  _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+	  ;;
+	*)
+	  _LT_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+	  _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+	  ;;
+      esac
+      ;;
+
+      sysv5* | sco3.2v5* | sco5v6*)
+	# Note: We can NOT use -z defs as we might desire, because we do not
+	# link with -lc, and that would cause any symbols used from libc to
+	# always be unresolved, which means just about no library would
+	# ever link correctly.  If we're not using GNU ld we use -z text
+	# though, which does catch some bad symbols but isn't as heavy-handed
+	# as -z defs.
+	_LT_TAGVAR(no_undefined_flag, $1)='${wl}-z,text'
+	_LT_TAGVAR(allow_undefined_flag, $1)='${wl}-z,nodefs'
+	_LT_TAGVAR(archive_cmds_need_lc, $1)=no
+	_LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+	_LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R,$libdir'
+	_LT_TAGVAR(hardcode_libdir_separator, $1)=':'
+	_LT_TAGVAR(link_all_deplibs, $1)=yes
+	_LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-Bexport'
+	runpath_var='LD_RUN_PATH'
+
+	case $cc_basename in
+          CC*)
+	    _LT_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+	    _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+	    _LT_TAGVAR(old_archive_cmds, $1)='$CC -Tprelink_objects $oldobjs~
+	      '"$_LT_TAGVAR(old_archive_cmds, $1)"
+	    _LT_TAGVAR(reload_cmds, $1)='$CC -Tprelink_objects $reload_objs~
+	      '"$_LT_TAGVAR(reload_cmds, $1)"
+	    ;;
+	  *)
+	    _LT_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+	    _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+	    ;;
+	esac
+      ;;
+
+      tandem*)
+        case $cc_basename in
+          NCC*)
+	    # NonStop-UX NCC 3.20
+	    # FIXME: insert proper C++ library support
+	    _LT_TAGVAR(ld_shlibs, $1)=no
+	    ;;
+          *)
+	    # FIXME: insert proper C++ library support
+	    _LT_TAGVAR(ld_shlibs, $1)=no
+	    ;;
+        esac
+        ;;
+
+      vxworks*)
+        # FIXME: insert proper C++ library support
+        _LT_TAGVAR(ld_shlibs, $1)=no
+        ;;
+
+      *)
+        # FIXME: insert proper C++ library support
+        _LT_TAGVAR(ld_shlibs, $1)=no
+        ;;
+    esac
+
+    AC_MSG_RESULT([$_LT_TAGVAR(ld_shlibs, $1)])
+    test "$_LT_TAGVAR(ld_shlibs, $1)" = no && can_build_shared=no
+
+    _LT_TAGVAR(GCC, $1)="$GXX"
+    _LT_TAGVAR(LD, $1)="$LD"
+
+    ## CAVEAT EMPTOR:
+    ## There is no encapsulation within the following macros, do not change
+    ## the running order or otherwise move them around unless you know exactly
+    ## what you are doing...
+    _LT_SYS_HIDDEN_LIBDEPS($1)
+    _LT_COMPILER_PIC($1)
+    _LT_COMPILER_C_O($1)
+    _LT_COMPILER_FILE_LOCKS($1)
+    _LT_LINKER_SHLIBS($1)
+    _LT_SYS_DYNAMIC_LINKER($1)
+    _LT_LINKER_HARDCODE_LIBPATH($1)
+
+    _LT_CONFIG($1)
+  fi # test -n "$compiler"
+
+  CC=$lt_save_CC
+  CFLAGS=$lt_save_CFLAGS
+  LDCXX=$LD
+  LD=$lt_save_LD
+  GCC=$lt_save_GCC
+  with_gnu_ld=$lt_save_with_gnu_ld
+  lt_cv_path_LDCXX=$lt_cv_path_LD
+  lt_cv_path_LD=$lt_save_path_LD
+  lt_cv_prog_gnu_ldcxx=$lt_cv_prog_gnu_ld
+  lt_cv_prog_gnu_ld=$lt_save_with_gnu_ld
+fi # test "$_lt_caught_CXX_error" != yes
+
+AC_LANG_POP
+])# _LT_LANG_CXX_CONFIG
+
+
+# _LT_FUNC_STRIPNAME_CNF
+# ----------------------
+# func_stripname_cnf prefix suffix name
+# strip PREFIX and SUFFIX off of NAME.
+# PREFIX and SUFFIX must not contain globbing or regex special
+# characters, hashes, percent signs, but SUFFIX may contain a leading
+# dot (in which case that matches only a dot).
+#
+# This function is identical to the (non-XSI) version of func_stripname,
+# except this one can be used by m4 code that may be executed by configure,
+# rather than the libtool script.
+m4_defun([_LT_FUNC_STRIPNAME_CNF],[dnl
+AC_REQUIRE([_LT_DECL_SED])
+AC_REQUIRE([_LT_PROG_ECHO_BACKSLASH])
+func_stripname_cnf ()
+{
+  case ${2} in
+  .*) func_stripname_result=`$ECHO "${3}" | $SED "s%^${1}%%; s%\\\\${2}\$%%"`;;
+  *)  func_stripname_result=`$ECHO "${3}" | $SED "s%^${1}%%; s%${2}\$%%"`;;
+  esac
+} # func_stripname_cnf
+])# _LT_FUNC_STRIPNAME_CNF
+
+# _LT_SYS_HIDDEN_LIBDEPS([TAGNAME])
+# ---------------------------------
+# Figure out "hidden" library dependencies from verbose
+# compiler output when linking a shared library.
+# Parse the compiler output and extract the necessary
+# objects, libraries and library flags.
+m4_defun([_LT_SYS_HIDDEN_LIBDEPS],
+[m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+AC_REQUIRE([_LT_FUNC_STRIPNAME_CNF])dnl
+# Dependencies to place before and after the object being linked:
+_LT_TAGVAR(predep_objects, $1)=
+_LT_TAGVAR(postdep_objects, $1)=
+_LT_TAGVAR(predeps, $1)=
+_LT_TAGVAR(postdeps, $1)=
+_LT_TAGVAR(compiler_lib_search_path, $1)=
+
+dnl we can't use the lt_simple_compile_test_code here,
+dnl because it contains code intended for an executable,
+dnl not a library.  It's possible we should let each
+dnl tag define a new lt_????_link_test_code variable,
+dnl but it's only used here...
+m4_if([$1], [], [cat > conftest.$ac_ext <<_LT_EOF
+int a;
+void foo (void) { a = 0; }
+_LT_EOF
+], [$1], [CXX], [cat > conftest.$ac_ext <<_LT_EOF
+class Foo
+{
+public:
+  Foo (void) { a = 0; }
+private:
+  int a;
+};
+_LT_EOF
+], [$1], [F77], [cat > conftest.$ac_ext <<_LT_EOF
+      subroutine foo
+      implicit none
+      integer*4 a
+      a=0
+      return
+      end
+_LT_EOF
+], [$1], [FC], [cat > conftest.$ac_ext <<_LT_EOF
+      subroutine foo
+      implicit none
+      integer a
+      a=0
+      return
+      end
+_LT_EOF
+], [$1], [GCJ], [cat > conftest.$ac_ext <<_LT_EOF
+public class foo {
+  private int a;
+  public void bar (void) {
+    a = 0;
+  }
+};
+_LT_EOF
+], [$1], [GO], [cat > conftest.$ac_ext <<_LT_EOF
+package foo
+func foo() {
+}
+_LT_EOF
+])
+
+_lt_libdeps_save_CFLAGS=$CFLAGS
+case "$CC $CFLAGS " in #(
+*\ -flto*\ *) CFLAGS="$CFLAGS -fno-lto" ;;
+*\ -fwhopr*\ *) CFLAGS="$CFLAGS -fno-whopr" ;;
+*\ -fuse-linker-plugin*\ *) CFLAGS="$CFLAGS -fno-use-linker-plugin" ;;
+esac
+
+dnl Parse the compiler output and extract the necessary
+dnl objects, libraries and library flags.
+if AC_TRY_EVAL(ac_compile); then
+  # Parse the compiler output and extract the necessary
+  # objects, libraries and library flags.
+
+  # Sentinel used to keep track of whether or not we are before
+  # the conftest object file.
+  pre_test_object_deps_done=no
+
+  for p in `eval "$output_verbose_link_cmd"`; do
+    case ${prev}${p} in
+
+    -L* | -R* | -l*)
+       # Some compilers place space between "-{L,R}" and the path.
+       # Remove the space.
+       if test $p = "-L" ||
+          test $p = "-R"; then
+	 prev=$p
+	 continue
+       fi
+
+       # Expand the sysroot to ease extracting the directories later.
+       if test -z "$prev"; then
+         case $p in
+         -L*) func_stripname_cnf '-L' '' "$p"; prev=-L; p=$func_stripname_result ;;
+         -R*) func_stripname_cnf '-R' '' "$p"; prev=-R; p=$func_stripname_result ;;
+         -l*) func_stripname_cnf '-l' '' "$p"; prev=-l; p=$func_stripname_result ;;
+         esac
+       fi
+       case $p in
+       =*) func_stripname_cnf '=' '' "$p"; p=$lt_sysroot$func_stripname_result ;;
+       esac
+       if test "$pre_test_object_deps_done" = no; then
+	 case ${prev} in
+	 -L | -R)
+	   # Internal compiler library paths should come after those
+	   # provided the user.  The postdeps already come after the
+	   # user supplied libs so there is no need to process them.
+	   if test -z "$_LT_TAGVAR(compiler_lib_search_path, $1)"; then
+	     _LT_TAGVAR(compiler_lib_search_path, $1)="${prev}${p}"
+	   else
+	     _LT_TAGVAR(compiler_lib_search_path, $1)="${_LT_TAGVAR(compiler_lib_search_path, $1)} ${prev}${p}"
+	   fi
+	   ;;
+	 # The "-l" case would never come before the object being
+	 # linked, so don't bother handling this case.
+	 esac
+       else
+	 if test -z "$_LT_TAGVAR(postdeps, $1)"; then
+	   _LT_TAGVAR(postdeps, $1)="${prev}${p}"
+	 else
+	   _LT_TAGVAR(postdeps, $1)="${_LT_TAGVAR(postdeps, $1)} ${prev}${p}"
+	 fi
+       fi
+       prev=
+       ;;
+
+    *.lto.$objext) ;; # Ignore GCC LTO objects
+    *.$objext)
+       # This assumes that the test object file only shows up
+       # once in the compiler output.
+       if test "$p" = "conftest.$objext"; then
+	 pre_test_object_deps_done=yes
+	 continue
+       fi
+
+       if test "$pre_test_object_deps_done" = no; then
+	 if test -z "$_LT_TAGVAR(predep_objects, $1)"; then
+	   _LT_TAGVAR(predep_objects, $1)="$p"
+	 else
+	   _LT_TAGVAR(predep_objects, $1)="$_LT_TAGVAR(predep_objects, $1) $p"
+	 fi
+       else
+	 if test -z "$_LT_TAGVAR(postdep_objects, $1)"; then
+	   _LT_TAGVAR(postdep_objects, $1)="$p"
+	 else
+	   _LT_TAGVAR(postdep_objects, $1)="$_LT_TAGVAR(postdep_objects, $1) $p"
+	 fi
+       fi
+       ;;
+
+    *) ;; # Ignore the rest.
+
+    esac
+  done
+
+  # Clean up.
+  rm -f a.out a.exe
+else
+  echo "libtool.m4: error: problem compiling $1 test program"
+fi
+
+$RM -f confest.$objext
+CFLAGS=$_lt_libdeps_save_CFLAGS
+
+# PORTME: override above test on systems where it is broken
+m4_if([$1], [CXX],
+[case $host_os in
+interix[[3-9]]*)
+  # Interix 3.5 installs completely hosed .la files for C++, so rather than
+  # hack all around it, let's just trust "g++" to DTRT.
+  _LT_TAGVAR(predep_objects,$1)=
+  _LT_TAGVAR(postdep_objects,$1)=
+  _LT_TAGVAR(postdeps,$1)=
+  ;;
+
+linux*)
+  case `$CC -V 2>&1 | sed 5q` in
+  *Sun\ C*)
+    # Sun C++ 5.9
+
+    # The more standards-conforming stlport4 library is
+    # incompatible with the Cstd library. Avoid specifying
+    # it if it's in CXXFLAGS. Ignore libCrun as
+    # -library=stlport4 depends on it.
+    case " $CXX $CXXFLAGS " in
+    *" -library=stlport4 "*)
+      solaris_use_stlport4=yes
+      ;;
+    esac
+
+    if test "$solaris_use_stlport4" != yes; then
+      _LT_TAGVAR(postdeps,$1)='-library=Cstd -library=Crun'
+    fi
+    ;;
+  esac
+  ;;
+
+solaris*)
+  case $cc_basename in
+  CC* | sunCC*)
+    # The more standards-conforming stlport4 library is
+    # incompatible with the Cstd library. Avoid specifying
+    # it if it's in CXXFLAGS. Ignore libCrun as
+    # -library=stlport4 depends on it.
+    case " $CXX $CXXFLAGS " in
+    *" -library=stlport4 "*)
+      solaris_use_stlport4=yes
+      ;;
+    esac
+
+    # Adding this requires a known-good setup of shared libraries for
+    # Sun compiler versions before 5.6, else PIC objects from an old
+    # archive will be linked into the output, leading to subtle bugs.
+    if test "$solaris_use_stlport4" != yes; then
+      _LT_TAGVAR(postdeps,$1)='-library=Cstd -library=Crun'
+    fi
+    ;;
+  esac
+  ;;
+esac
+])
+
+case " $_LT_TAGVAR(postdeps, $1) " in
+*" -lc "*) _LT_TAGVAR(archive_cmds_need_lc, $1)=no ;;
+esac
+ _LT_TAGVAR(compiler_lib_search_dirs, $1)=
+if test -n "${_LT_TAGVAR(compiler_lib_search_path, $1)}"; then
+ _LT_TAGVAR(compiler_lib_search_dirs, $1)=`echo " ${_LT_TAGVAR(compiler_lib_search_path, $1)}" | ${SED} -e 's! -L! !g' -e 's!^ !!'`
+fi
+_LT_TAGDECL([], [compiler_lib_search_dirs], [1],
+    [The directories searched by this compiler when creating a shared library])
+_LT_TAGDECL([], [predep_objects], [1],
+    [Dependencies to place before and after the objects being linked to
+    create a shared library])
+_LT_TAGDECL([], [postdep_objects], [1])
+_LT_TAGDECL([], [predeps], [1])
+_LT_TAGDECL([], [postdeps], [1])
+_LT_TAGDECL([], [compiler_lib_search_path], [1],
+    [The library search path used internally by the compiler when linking
+    a shared library])
+])# _LT_SYS_HIDDEN_LIBDEPS
+
+
+# _LT_LANG_F77_CONFIG([TAG])
+# --------------------------
+# Ensure that the configuration variables for a Fortran 77 compiler are
+# suitably defined.  These variables are subsequently used by _LT_CONFIG
+# to write the compiler configuration to `libtool'.
+m4_defun([_LT_LANG_F77_CONFIG],
+[AC_LANG_PUSH(Fortran 77)
+if test -z "$F77" || test "X$F77" = "Xno"; then
+  _lt_disable_F77=yes
+fi
+
+_LT_TAGVAR(archive_cmds_need_lc, $1)=no
+_LT_TAGVAR(allow_undefined_flag, $1)=
+_LT_TAGVAR(always_export_symbols, $1)=no
+_LT_TAGVAR(archive_expsym_cmds, $1)=
+_LT_TAGVAR(export_dynamic_flag_spec, $1)=
+_LT_TAGVAR(hardcode_direct, $1)=no
+_LT_TAGVAR(hardcode_direct_absolute, $1)=no
+_LT_TAGVAR(hardcode_libdir_flag_spec, $1)=
+_LT_TAGVAR(hardcode_libdir_separator, $1)=
+_LT_TAGVAR(hardcode_minus_L, $1)=no
+_LT_TAGVAR(hardcode_automatic, $1)=no
+_LT_TAGVAR(inherit_rpath, $1)=no
+_LT_TAGVAR(module_cmds, $1)=
+_LT_TAGVAR(module_expsym_cmds, $1)=
+_LT_TAGVAR(link_all_deplibs, $1)=unknown
+_LT_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds
+_LT_TAGVAR(reload_flag, $1)=$reload_flag
+_LT_TAGVAR(reload_cmds, $1)=$reload_cmds
+_LT_TAGVAR(no_undefined_flag, $1)=
+_LT_TAGVAR(whole_archive_flag_spec, $1)=
+_LT_TAGVAR(enable_shared_with_static_runtimes, $1)=no
+
+# Source file extension for f77 test sources.
+ac_ext=f
+
+# Object file extension for compiled f77 test sources.
+objext=o
+_LT_TAGVAR(objext, $1)=$objext
+
+# No sense in running all these tests if we already determined that
+# the F77 compiler isn't working.  Some variables (like enable_shared)
+# are currently assumed to apply to all compilers on this platform,
+# and will be corrupted by setting them based on a non-working compiler.
+if test "$_lt_disable_F77" != yes; then
+  # Code to be used in simple compile tests
+  lt_simple_compile_test_code="\
+      subroutine t
+      return
+      end
+"
+
+  # Code to be used in simple link tests
+  lt_simple_link_test_code="\
+      program t
+      end
+"
+
+  # ltmain only uses $CC for tagged configurations so make sure $CC is set.
+  _LT_TAG_COMPILER
+
+  # save warnings/boilerplate of simple test code
+  _LT_COMPILER_BOILERPLATE
+  _LT_LINKER_BOILERPLATE
+
+  # Allow CC to be a program name with arguments.
+  lt_save_CC="$CC"
+  lt_save_GCC=$GCC
+  lt_save_CFLAGS=$CFLAGS
+  CC=${F77-"f77"}
+  CFLAGS=$FFLAGS
+  compiler=$CC
+  _LT_TAGVAR(compiler, $1)=$CC
+  _LT_CC_BASENAME([$compiler])
+  GCC=$G77
+  if test -n "$compiler"; then
+    AC_MSG_CHECKING([if libtool supports shared libraries])
+    AC_MSG_RESULT([$can_build_shared])
+
+    AC_MSG_CHECKING([whether to build shared libraries])
+    test "$can_build_shared" = "no" && enable_shared=no
+
+    # On AIX, shared libraries and static libraries use the same namespace, and
+    # are all built from PIC.
+    case $host_os in
+      aix3*)
+        test "$enable_shared" = yes && enable_static=no
+        if test -n "$RANLIB"; then
+          archive_cmds="$archive_cmds~\$RANLIB \$lib"
+          postinstall_cmds='$RANLIB $lib'
+        fi
+        ;;
+      aix[[4-9]]*)
+	if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then
+	  test "$enable_shared" = yes && enable_static=no
+	fi
+        ;;
+    esac
+    AC_MSG_RESULT([$enable_shared])
+
+    AC_MSG_CHECKING([whether to build static libraries])
+    # Make sure either enable_shared or enable_static is yes.
+    test "$enable_shared" = yes || enable_static=yes
+    AC_MSG_RESULT([$enable_static])
+
+    _LT_TAGVAR(GCC, $1)="$G77"
+    _LT_TAGVAR(LD, $1)="$LD"
+
+    ## CAVEAT EMPTOR:
+    ## There is no encapsulation within the following macros, do not change
+    ## the running order or otherwise move them around unless you know exactly
+    ## what you are doing...
+    _LT_COMPILER_PIC($1)
+    _LT_COMPILER_C_O($1)
+    _LT_COMPILER_FILE_LOCKS($1)
+    _LT_LINKER_SHLIBS($1)
+    _LT_SYS_DYNAMIC_LINKER($1)
+    _LT_LINKER_HARDCODE_LIBPATH($1)
+
+    _LT_CONFIG($1)
+  fi # test -n "$compiler"
+
+  GCC=$lt_save_GCC
+  CC="$lt_save_CC"
+  CFLAGS="$lt_save_CFLAGS"
+fi # test "$_lt_disable_F77" != yes
+
+AC_LANG_POP
+])# _LT_LANG_F77_CONFIG
+
+
+# _LT_LANG_FC_CONFIG([TAG])
+# -------------------------
+# Ensure that the configuration variables for a Fortran compiler are
+# suitably defined.  These variables are subsequently used by _LT_CONFIG
+# to write the compiler configuration to `libtool'.
+m4_defun([_LT_LANG_FC_CONFIG],
+[AC_LANG_PUSH(Fortran)
+
+if test -z "$FC" || test "X$FC" = "Xno"; then
+  _lt_disable_FC=yes
+fi
+
+_LT_TAGVAR(archive_cmds_need_lc, $1)=no
+_LT_TAGVAR(allow_undefined_flag, $1)=
+_LT_TAGVAR(always_export_symbols, $1)=no
+_LT_TAGVAR(archive_expsym_cmds, $1)=
+_LT_TAGVAR(export_dynamic_flag_spec, $1)=
+_LT_TAGVAR(hardcode_direct, $1)=no
+_LT_TAGVAR(hardcode_direct_absolute, $1)=no
+_LT_TAGVAR(hardcode_libdir_flag_spec, $1)=
+_LT_TAGVAR(hardcode_libdir_separator, $1)=
+_LT_TAGVAR(hardcode_minus_L, $1)=no
+_LT_TAGVAR(hardcode_automatic, $1)=no
+_LT_TAGVAR(inherit_rpath, $1)=no
+_LT_TAGVAR(module_cmds, $1)=
+_LT_TAGVAR(module_expsym_cmds, $1)=
+_LT_TAGVAR(link_all_deplibs, $1)=unknown
+_LT_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds
+_LT_TAGVAR(reload_flag, $1)=$reload_flag
+_LT_TAGVAR(reload_cmds, $1)=$reload_cmds
+_LT_TAGVAR(no_undefined_flag, $1)=
+_LT_TAGVAR(whole_archive_flag_spec, $1)=
+_LT_TAGVAR(enable_shared_with_static_runtimes, $1)=no
+
+# Source file extension for fc test sources.
+ac_ext=${ac_fc_srcext-f}
+
+# Object file extension for compiled fc test sources.
+objext=o
+_LT_TAGVAR(objext, $1)=$objext
+
+# No sense in running all these tests if we already determined that
+# the FC compiler isn't working.  Some variables (like enable_shared)
+# are currently assumed to apply to all compilers on this platform,
+# and will be corrupted by setting them based on a non-working compiler.
+if test "$_lt_disable_FC" != yes; then
+  # Code to be used in simple compile tests
+  lt_simple_compile_test_code="\
+      subroutine t
+      return
+      end
+"
+
+  # Code to be used in simple link tests
+  lt_simple_link_test_code="\
+      program t
+      end
+"
+
+  # ltmain only uses $CC for tagged configurations so make sure $CC is set.
+  _LT_TAG_COMPILER
+
+  # save warnings/boilerplate of simple test code
+  _LT_COMPILER_BOILERPLATE
+  _LT_LINKER_BOILERPLATE
+
+  # Allow CC to be a program name with arguments.
+  lt_save_CC="$CC"
+  lt_save_GCC=$GCC
+  lt_save_CFLAGS=$CFLAGS
+  CC=${FC-"f95"}
+  CFLAGS=$FCFLAGS
+  compiler=$CC
+  GCC=$ac_cv_fc_compiler_gnu
+
+  _LT_TAGVAR(compiler, $1)=$CC
+  _LT_CC_BASENAME([$compiler])
+
+  if test -n "$compiler"; then
+    AC_MSG_CHECKING([if libtool supports shared libraries])
+    AC_MSG_RESULT([$can_build_shared])
+
+    AC_MSG_CHECKING([whether to build shared libraries])
+    test "$can_build_shared" = "no" && enable_shared=no
+
+    # On AIX, shared libraries and static libraries use the same namespace, and
+    # are all built from PIC.
+    case $host_os in
+      aix3*)
+        test "$enable_shared" = yes && enable_static=no
+        if test -n "$RANLIB"; then
+          archive_cmds="$archive_cmds~\$RANLIB \$lib"
+          postinstall_cmds='$RANLIB $lib'
+        fi
+        ;;
+      aix[[4-9]]*)
+	if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then
+	  test "$enable_shared" = yes && enable_static=no
+	fi
+        ;;
+    esac
+    AC_MSG_RESULT([$enable_shared])
+
+    AC_MSG_CHECKING([whether to build static libraries])
+    # Make sure either enable_shared or enable_static is yes.
+    test "$enable_shared" = yes || enable_static=yes
+    AC_MSG_RESULT([$enable_static])
+
+    _LT_TAGVAR(GCC, $1)="$ac_cv_fc_compiler_gnu"
+    _LT_TAGVAR(LD, $1)="$LD"
+
+    ## CAVEAT EMPTOR:
+    ## There is no encapsulation within the following macros, do not change
+    ## the running order or otherwise move them around unless you know exactly
+    ## what you are doing...
+    _LT_SYS_HIDDEN_LIBDEPS($1)
+    _LT_COMPILER_PIC($1)
+    _LT_COMPILER_C_O($1)
+    _LT_COMPILER_FILE_LOCKS($1)
+    _LT_LINKER_SHLIBS($1)
+    _LT_SYS_DYNAMIC_LINKER($1)
+    _LT_LINKER_HARDCODE_LIBPATH($1)
+
+    _LT_CONFIG($1)
+  fi # test -n "$compiler"
+
+  GCC=$lt_save_GCC
+  CC=$lt_save_CC
+  CFLAGS=$lt_save_CFLAGS
+fi # test "$_lt_disable_FC" != yes
+
+AC_LANG_POP
+])# _LT_LANG_FC_CONFIG
+
+
+# _LT_LANG_GCJ_CONFIG([TAG])
+# --------------------------
+# Ensure that the configuration variables for the GNU Java Compiler compiler
+# are suitably defined.  These variables are subsequently used by _LT_CONFIG
+# to write the compiler configuration to `libtool'.
+m4_defun([_LT_LANG_GCJ_CONFIG],
+[AC_REQUIRE([LT_PROG_GCJ])dnl
+AC_LANG_SAVE
+
+# Source file extension for Java test sources.
+ac_ext=java
+
+# Object file extension for compiled Java test sources.
+objext=o
+_LT_TAGVAR(objext, $1)=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code="class foo {}"
+
+# Code to be used in simple link tests
+lt_simple_link_test_code='public class conftest { public static void main(String[[]] argv) {}; }'
+
+# ltmain only uses $CC for tagged configurations so make sure $CC is set.
+_LT_TAG_COMPILER
+
+# save warnings/boilerplate of simple test code
+_LT_COMPILER_BOILERPLATE
+_LT_LINKER_BOILERPLATE
+
+# Allow CC to be a program name with arguments.
+lt_save_CC=$CC
+lt_save_CFLAGS=$CFLAGS
+lt_save_GCC=$GCC
+GCC=yes
+CC=${GCJ-"gcj"}
+CFLAGS=$GCJFLAGS
+compiler=$CC
+_LT_TAGVAR(compiler, $1)=$CC
+_LT_TAGVAR(LD, $1)="$LD"
+_LT_CC_BASENAME([$compiler])
+
+# GCJ did not exist at the time GCC didn't implicitly link libc in.
+_LT_TAGVAR(archive_cmds_need_lc, $1)=no
+
+_LT_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds
+_LT_TAGVAR(reload_flag, $1)=$reload_flag
+_LT_TAGVAR(reload_cmds, $1)=$reload_cmds
+
+if test -n "$compiler"; then
+  _LT_COMPILER_NO_RTTI($1)
+  _LT_COMPILER_PIC($1)
+  _LT_COMPILER_C_O($1)
+  _LT_COMPILER_FILE_LOCKS($1)
+  _LT_LINKER_SHLIBS($1)
+  _LT_LINKER_HARDCODE_LIBPATH($1)
+
+  _LT_CONFIG($1)
+fi
+
+AC_LANG_RESTORE
+
+GCC=$lt_save_GCC
+CC=$lt_save_CC
+CFLAGS=$lt_save_CFLAGS
+])# _LT_LANG_GCJ_CONFIG
+
+
+# _LT_LANG_GO_CONFIG([TAG])
+# --------------------------
+# Ensure that the configuration variables for the GNU Go compiler
+# are suitably defined.  These variables are subsequently used by _LT_CONFIG
+# to write the compiler configuration to `libtool'.
+m4_defun([_LT_LANG_GO_CONFIG],
+[AC_REQUIRE([LT_PROG_GO])dnl
+AC_LANG_SAVE
+
+# Source file extension for Go test sources.
+ac_ext=go
+
+# Object file extension for compiled Go test sources.
+objext=o
+_LT_TAGVAR(objext, $1)=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code="package main; func main() { }"
+
+# Code to be used in simple link tests
+lt_simple_link_test_code='package main; func main() { }'
+
+# ltmain only uses $CC for tagged configurations so make sure $CC is set.
+_LT_TAG_COMPILER
+
+# save warnings/boilerplate of simple test code
+_LT_COMPILER_BOILERPLATE
+_LT_LINKER_BOILERPLATE
+
+# Allow CC to be a program name with arguments.
+lt_save_CC=$CC
+lt_save_CFLAGS=$CFLAGS
+lt_save_GCC=$GCC
+GCC=yes
+CC=${GOC-"gccgo"}
+CFLAGS=$GOFLAGS
+compiler=$CC
+_LT_TAGVAR(compiler, $1)=$CC
+_LT_TAGVAR(LD, $1)="$LD"
+_LT_CC_BASENAME([$compiler])
+
+# Go did not exist at the time GCC didn't implicitly link libc in.
+_LT_TAGVAR(archive_cmds_need_lc, $1)=no
+
+_LT_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds
+_LT_TAGVAR(reload_flag, $1)=$reload_flag
+_LT_TAGVAR(reload_cmds, $1)=$reload_cmds
+
+if test -n "$compiler"; then
+  _LT_COMPILER_NO_RTTI($1)
+  _LT_COMPILER_PIC($1)
+  _LT_COMPILER_C_O($1)
+  _LT_COMPILER_FILE_LOCKS($1)
+  _LT_LINKER_SHLIBS($1)
+  _LT_LINKER_HARDCODE_LIBPATH($1)
+
+  _LT_CONFIG($1)
+fi
+
+AC_LANG_RESTORE
+
+GCC=$lt_save_GCC
+CC=$lt_save_CC
+CFLAGS=$lt_save_CFLAGS
+])# _LT_LANG_GO_CONFIG
+
+
+# _LT_LANG_RC_CONFIG([TAG])
+# -------------------------
+# Ensure that the configuration variables for the Windows resource compiler
+# are suitably defined.  These variables are subsequently used by _LT_CONFIG
+# to write the compiler configuration to `libtool'.
+m4_defun([_LT_LANG_RC_CONFIG],
+[AC_REQUIRE([LT_PROG_RC])dnl
+AC_LANG_SAVE
+
+# Source file extension for RC test sources.
+ac_ext=rc
+
+# Object file extension for compiled RC test sources.
+objext=o
+_LT_TAGVAR(objext, $1)=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code='sample MENU { MENUITEM "&Soup", 100, CHECKED }'
+
+# Code to be used in simple link tests
+lt_simple_link_test_code="$lt_simple_compile_test_code"
+
+# ltmain only uses $CC for tagged configurations so make sure $CC is set.
+_LT_TAG_COMPILER
+
+# save warnings/boilerplate of simple test code
+_LT_COMPILER_BOILERPLATE
+_LT_LINKER_BOILERPLATE
+
+# Allow CC to be a program name with arguments.
+lt_save_CC="$CC"
+lt_save_CFLAGS=$CFLAGS
+lt_save_GCC=$GCC
+GCC=
+CC=${RC-"windres"}
+CFLAGS=
+compiler=$CC
+_LT_TAGVAR(compiler, $1)=$CC
+_LT_CC_BASENAME([$compiler])
+_LT_TAGVAR(lt_cv_prog_compiler_c_o, $1)=yes
+
+if test -n "$compiler"; then
+  :
+  _LT_CONFIG($1)
+fi
+
+GCC=$lt_save_GCC
+AC_LANG_RESTORE
+CC=$lt_save_CC
+CFLAGS=$lt_save_CFLAGS
+])# _LT_LANG_RC_CONFIG
+
+
+# LT_PROG_GCJ
+# -----------
+AC_DEFUN([LT_PROG_GCJ],
+[m4_ifdef([AC_PROG_GCJ], [AC_PROG_GCJ],
+  [m4_ifdef([A][M_PROG_GCJ], [A][M_PROG_GCJ],
+    [AC_CHECK_TOOL(GCJ, gcj,)
+      test "x${GCJFLAGS+set}" = xset || GCJFLAGS="-g -O2"
+      AC_SUBST(GCJFLAGS)])])[]dnl
+])
+
+# Old name:
+AU_ALIAS([LT_AC_PROG_GCJ], [LT_PROG_GCJ])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([LT_AC_PROG_GCJ], [])
+
+
+# LT_PROG_GO
+# ----------
+AC_DEFUN([LT_PROG_GO],
+[AC_CHECK_TOOL(GOC, gccgo,)
+])
+
+
+# LT_PROG_RC
+# ----------
+AC_DEFUN([LT_PROG_RC],
+[AC_CHECK_TOOL(RC, windres,)
+])
+
+# Old name:
+AU_ALIAS([LT_AC_PROG_RC], [LT_PROG_RC])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([LT_AC_PROG_RC], [])
+
+
+# _LT_DECL_EGREP
+# --------------
+# If we don't have a new enough Autoconf to choose the best grep
+# available, choose the one first in the user's PATH.
+m4_defun([_LT_DECL_EGREP],
+[AC_REQUIRE([AC_PROG_EGREP])dnl
+AC_REQUIRE([AC_PROG_FGREP])dnl
+test -z "$GREP" && GREP=grep
+_LT_DECL([], [GREP], [1], [A grep program that handles long lines])
+_LT_DECL([], [EGREP], [1], [An ERE matcher])
+_LT_DECL([], [FGREP], [1], [A literal string matcher])
+dnl Non-bleeding-edge autoconf doesn't subst GREP, so do it here too
+AC_SUBST([GREP])
+])
+
+
+# _LT_DECL_OBJDUMP
+# --------------
+# If we don't have a new enough Autoconf to choose the best objdump
+# available, choose the one first in the user's PATH.
+m4_defun([_LT_DECL_OBJDUMP],
+[AC_CHECK_TOOL(OBJDUMP, objdump, false)
+test -z "$OBJDUMP" && OBJDUMP=objdump
+_LT_DECL([], [OBJDUMP], [1], [An object symbol dumper])
+AC_SUBST([OBJDUMP])
+])
+
+# _LT_DECL_DLLTOOL
+# ----------------
+# Ensure DLLTOOL variable is set.
+m4_defun([_LT_DECL_DLLTOOL],
+[AC_CHECK_TOOL(DLLTOOL, dlltool, false)
+test -z "$DLLTOOL" && DLLTOOL=dlltool
+_LT_DECL([], [DLLTOOL], [1], [DLL creation program])
+AC_SUBST([DLLTOOL])
+])
+
+# _LT_DECL_SED
+# ------------
+# Check for a fully-functional sed program, that truncates
+# as few characters as possible.  Prefer GNU sed if found.
+m4_defun([_LT_DECL_SED],
+[AC_PROG_SED
+test -z "$SED" && SED=sed
+Xsed="$SED -e 1s/^X//"
+_LT_DECL([], [SED], [1], [A sed program that does not truncate output])
+_LT_DECL([], [Xsed], ["\$SED -e 1s/^X//"],
+    [Sed that helps us avoid accidentally triggering echo(1) options like -n])
+])# _LT_DECL_SED
+
+m4_ifndef([AC_PROG_SED], [
+# NOTE: This macro has been submitted for inclusion into   #
+#  GNU Autoconf as AC_PROG_SED.  When it is available in   #
+#  a released version of Autoconf we should remove this    #
+#  macro and use it instead.                               #
+
+m4_defun([AC_PROG_SED],
+[AC_MSG_CHECKING([for a sed that does not truncate output])
+AC_CACHE_VAL(lt_cv_path_SED,
+[# Loop through the user's path and test for sed and gsed.
+# Then use that list of sed's as ones to test for truncation.
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+  for lt_ac_prog in sed gsed; do
+    for ac_exec_ext in '' $ac_executable_extensions; do
+      if $as_executable_p "$as_dir/$lt_ac_prog$ac_exec_ext"; then
+        lt_ac_sed_list="$lt_ac_sed_list $as_dir/$lt_ac_prog$ac_exec_ext"
+      fi
+    done
+  done
+done
+IFS=$as_save_IFS
+lt_ac_max=0
+lt_ac_count=0
+# Add /usr/xpg4/bin/sed as it is typically found on Solaris
+# along with /bin/sed that truncates output.
+for lt_ac_sed in $lt_ac_sed_list /usr/xpg4/bin/sed; do
+  test ! -f $lt_ac_sed && continue
+  cat /dev/null > conftest.in
+  lt_ac_count=0
+  echo $ECHO_N "0123456789$ECHO_C" >conftest.in
+  # Check for GNU sed and select it if it is found.
+  if "$lt_ac_sed" --version 2>&1 < /dev/null | grep 'GNU' > /dev/null; then
+    lt_cv_path_SED=$lt_ac_sed
+    break
+  fi
+  while true; do
+    cat conftest.in conftest.in >conftest.tmp
+    mv conftest.tmp conftest.in
+    cp conftest.in conftest.nl
+    echo >>conftest.nl
+    $lt_ac_sed -e 's/a$//' < conftest.nl >conftest.out || break
+    cmp -s conftest.out conftest.nl || break
+    # 10000 chars as input seems more than enough
+    test $lt_ac_count -gt 10 && break
+    lt_ac_count=`expr $lt_ac_count + 1`
+    if test $lt_ac_count -gt $lt_ac_max; then
+      lt_ac_max=$lt_ac_count
+      lt_cv_path_SED=$lt_ac_sed
+    fi
+  done
+done
+])
+SED=$lt_cv_path_SED
+AC_SUBST([SED])
+AC_MSG_RESULT([$SED])
+])#AC_PROG_SED
+])#m4_ifndef
+
+# Old name:
+AU_ALIAS([LT_AC_PROG_SED], [AC_PROG_SED])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([LT_AC_PROG_SED], [])
+
+
+# _LT_CHECK_SHELL_FEATURES
+# ------------------------
+# Find out whether the shell is Bourne or XSI compatible,
+# or has some other useful features.
+m4_defun([_LT_CHECK_SHELL_FEATURES],
+[AC_MSG_CHECKING([whether the shell understands some XSI constructs])
+# Try some XSI features
+xsi_shell=no
+( _lt_dummy="a/b/c"
+  test "${_lt_dummy##*/},${_lt_dummy%/*},${_lt_dummy#??}"${_lt_dummy%"$_lt_dummy"}, \
+      = c,a/b,b/c, \
+    && eval 'test $(( 1 + 1 )) -eq 2 \
+    && test "${#_lt_dummy}" -eq 5' ) >/dev/null 2>&1 \
+  && xsi_shell=yes
+AC_MSG_RESULT([$xsi_shell])
+_LT_CONFIG_LIBTOOL_INIT([xsi_shell='$xsi_shell'])
+
+AC_MSG_CHECKING([whether the shell understands "+="])
+lt_shell_append=no
+( foo=bar; set foo baz; eval "$[1]+=\$[2]" && test "$foo" = barbaz ) \
+    >/dev/null 2>&1 \
+  && lt_shell_append=yes
+AC_MSG_RESULT([$lt_shell_append])
+_LT_CONFIG_LIBTOOL_INIT([lt_shell_append='$lt_shell_append'])
+
+if ( (MAIL=60; unset MAIL) || exit) >/dev/null 2>&1; then
+  lt_unset=unset
+else
+  lt_unset=false
+fi
+_LT_DECL([], [lt_unset], [0], [whether the shell understands "unset"])dnl
+
+# test EBCDIC or ASCII
+case `echo X|tr X '\101'` in
+ A) # ASCII based system
+    # \n is not interpreted correctly by Solaris 8 /usr/ucb/tr
+  lt_SP2NL='tr \040 \012'
+  lt_NL2SP='tr \015\012 \040\040'
+  ;;
+ *) # EBCDIC based system
+  lt_SP2NL='tr \100 \n'
+  lt_NL2SP='tr \r\n \100\100'
+  ;;
+esac
+_LT_DECL([SP2NL], [lt_SP2NL], [1], [turn spaces into newlines])dnl
+_LT_DECL([NL2SP], [lt_NL2SP], [1], [turn newlines into spaces])dnl
+])# _LT_CHECK_SHELL_FEATURES
+
+
+# _LT_PROG_FUNCTION_REPLACE (FUNCNAME, REPLACEMENT-BODY)
+# ------------------------------------------------------
+# In `$cfgfile', look for function FUNCNAME delimited by `^FUNCNAME ()$' and
+# '^} FUNCNAME ', and replace its body with REPLACEMENT-BODY.
+m4_defun([_LT_PROG_FUNCTION_REPLACE],
+[dnl {
+sed -e '/^$1 ()$/,/^} # $1 /c\
+$1 ()\
+{\
+m4_bpatsubsts([$2], [$], [\\], [^\([	 ]\)], [\\\1])
+} # Extended-shell $1 implementation' "$cfgfile" > $cfgfile.tmp \
+  && mv -f "$cfgfile.tmp" "$cfgfile" \
+    || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+])
+
+
+# _LT_PROG_REPLACE_SHELLFNS
+# -------------------------
+# Replace existing portable implementations of several shell functions with
+# equivalent extended shell implementations where those features are available..
+m4_defun([_LT_PROG_REPLACE_SHELLFNS],
+[if test x"$xsi_shell" = xyes; then
+  _LT_PROG_FUNCTION_REPLACE([func_dirname], [dnl
+    case ${1} in
+      */*) func_dirname_result="${1%/*}${2}" ;;
+      *  ) func_dirname_result="${3}" ;;
+    esac])
+
+  _LT_PROG_FUNCTION_REPLACE([func_basename], [dnl
+    func_basename_result="${1##*/}"])
+
+  _LT_PROG_FUNCTION_REPLACE([func_dirname_and_basename], [dnl
+    case ${1} in
+      */*) func_dirname_result="${1%/*}${2}" ;;
+      *  ) func_dirname_result="${3}" ;;
+    esac
+    func_basename_result="${1##*/}"])
+
+  _LT_PROG_FUNCTION_REPLACE([func_stripname], [dnl
+    # pdksh 5.2.14 does not do ${X%$Y} correctly if both X and Y are
+    # positional parameters, so assign one to ordinary parameter first.
+    func_stripname_result=${3}
+    func_stripname_result=${func_stripname_result#"${1}"}
+    func_stripname_result=${func_stripname_result%"${2}"}])
+
+  _LT_PROG_FUNCTION_REPLACE([func_split_long_opt], [dnl
+    func_split_long_opt_name=${1%%=*}
+    func_split_long_opt_arg=${1#*=}])
+
+  _LT_PROG_FUNCTION_REPLACE([func_split_short_opt], [dnl
+    func_split_short_opt_arg=${1#??}
+    func_split_short_opt_name=${1%"$func_split_short_opt_arg"}])
+
+  _LT_PROG_FUNCTION_REPLACE([func_lo2o], [dnl
+    case ${1} in
+      *.lo) func_lo2o_result=${1%.lo}.${objext} ;;
+      *)    func_lo2o_result=${1} ;;
+    esac])
+
+  _LT_PROG_FUNCTION_REPLACE([func_xform], [    func_xform_result=${1%.*}.lo])
+
+  _LT_PROG_FUNCTION_REPLACE([func_arith], [    func_arith_result=$(( $[*] ))])
+
+  _LT_PROG_FUNCTION_REPLACE([func_len], [    func_len_result=${#1}])
+fi
+
+if test x"$lt_shell_append" = xyes; then
+  _LT_PROG_FUNCTION_REPLACE([func_append], [    eval "${1}+=\\${2}"])
+
+  _LT_PROG_FUNCTION_REPLACE([func_append_quoted], [dnl
+    func_quote_for_eval "${2}"
+dnl m4 expansion turns \\\\ into \\, and then the shell eval turns that into \
+    eval "${1}+=\\\\ \\$func_quote_for_eval_result"])
+
+  # Save a `func_append' function call where possible by direct use of '+='
+  sed -e 's%func_append \([[a-zA-Z_]]\{1,\}\) "%\1+="%g' $cfgfile > $cfgfile.tmp \
+    && mv -f "$cfgfile.tmp" "$cfgfile" \
+      || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+  test 0 -eq $? || _lt_function_replace_fail=:
+else
+  # Save a `func_append' function call even when '+=' is not available
+  sed -e 's%func_append \([[a-zA-Z_]]\{1,\}\) "%\1="$\1%g' $cfgfile > $cfgfile.tmp \
+    && mv -f "$cfgfile.tmp" "$cfgfile" \
+      || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+  test 0 -eq $? || _lt_function_replace_fail=:
+fi
+
+if test x"$_lt_function_replace_fail" = x":"; then
+  AC_MSG_WARN([Unable to substitute extended shell functions in $ofile])
+fi
+])
+
+# _LT_PATH_CONVERSION_FUNCTIONS
+# -----------------------------
+# Determine which file name conversion functions should be used by
+# func_to_host_file (and, implicitly, by func_to_host_path).  These are needed
+# for certain cross-compile configurations and native mingw.
+m4_defun([_LT_PATH_CONVERSION_FUNCTIONS],
+[AC_REQUIRE([AC_CANONICAL_HOST])dnl
+AC_REQUIRE([AC_CANONICAL_BUILD])dnl
+AC_MSG_CHECKING([how to convert $build file names to $host format])
+AC_CACHE_VAL(lt_cv_to_host_file_cmd,
+[case $host in
+  *-*-mingw* )
+    case $build in
+      *-*-mingw* ) # actually msys
+        lt_cv_to_host_file_cmd=func_convert_file_msys_to_w32
+        ;;
+      *-*-cygwin* )
+        lt_cv_to_host_file_cmd=func_convert_file_cygwin_to_w32
+        ;;
+      * ) # otherwise, assume *nix
+        lt_cv_to_host_file_cmd=func_convert_file_nix_to_w32
+        ;;
+    esac
+    ;;
+  *-*-cygwin* )
+    case $build in
+      *-*-mingw* ) # actually msys
+        lt_cv_to_host_file_cmd=func_convert_file_msys_to_cygwin
+        ;;
+      *-*-cygwin* )
+        lt_cv_to_host_file_cmd=func_convert_file_noop
+        ;;
+      * ) # otherwise, assume *nix
+        lt_cv_to_host_file_cmd=func_convert_file_nix_to_cygwin
+        ;;
+    esac
+    ;;
+  * ) # unhandled hosts (and "normal" native builds)
+    lt_cv_to_host_file_cmd=func_convert_file_noop
+    ;;
+esac
+])
+to_host_file_cmd=$lt_cv_to_host_file_cmd
+AC_MSG_RESULT([$lt_cv_to_host_file_cmd])
+_LT_DECL([to_host_file_cmd], [lt_cv_to_host_file_cmd],
+         [0], [convert $build file names to $host format])dnl
+
+AC_MSG_CHECKING([how to convert $build file names to toolchain format])
+AC_CACHE_VAL(lt_cv_to_tool_file_cmd,
+[#assume ordinary cross tools, or native build.
+lt_cv_to_tool_file_cmd=func_convert_file_noop
+case $host in
+  *-*-mingw* )
+    case $build in
+      *-*-mingw* ) # actually msys
+        lt_cv_to_tool_file_cmd=func_convert_file_msys_to_w32
+        ;;
+    esac
+    ;;
+esac
+])
+to_tool_file_cmd=$lt_cv_to_tool_file_cmd
+AC_MSG_RESULT([$lt_cv_to_tool_file_cmd])
+_LT_DECL([to_tool_file_cmd], [lt_cv_to_tool_file_cmd],
+         [0], [convert $build files to toolchain format])dnl
+])# _LT_PATH_CONVERSION_FUNCTIONS
+
+# Helper functions for option handling.                    -*- Autoconf -*-
+#
+#   Copyright (C) 2004, 2005, 2007, 2008, 2009 Free Software Foundation,
+#   Inc.
+#   Written by Gary V. Vaughan, 2004
+#
+# This file is free software; the Free Software Foundation gives
+# unlimited permission to copy and/or distribute it, with or without
+# modifications, as long as this notice is preserved.
+
+# serial 7 ltoptions.m4
+
+# This is to help aclocal find these macros, as it can't see m4_define.
+AC_DEFUN([LTOPTIONS_VERSION], [m4_if([1])])
+
+
+# _LT_MANGLE_OPTION(MACRO-NAME, OPTION-NAME)
+# ------------------------------------------
+m4_define([_LT_MANGLE_OPTION],
+[[_LT_OPTION_]m4_bpatsubst($1__$2, [[^a-zA-Z0-9_]], [_])])
+
+
+# _LT_SET_OPTION(MACRO-NAME, OPTION-NAME)
+# ---------------------------------------
+# Set option OPTION-NAME for macro MACRO-NAME, and if there is a
+# matching handler defined, dispatch to it.  Other OPTION-NAMEs are
+# saved as a flag.
+m4_define([_LT_SET_OPTION],
+[m4_define(_LT_MANGLE_OPTION([$1], [$2]))dnl
+m4_ifdef(_LT_MANGLE_DEFUN([$1], [$2]),
+        _LT_MANGLE_DEFUN([$1], [$2]),
+    [m4_warning([Unknown $1 option `$2'])])[]dnl
+])
+
+
+# _LT_IF_OPTION(MACRO-NAME, OPTION-NAME, IF-SET, [IF-NOT-SET])
+# ------------------------------------------------------------
+# Execute IF-SET if OPTION is set, IF-NOT-SET otherwise.
+m4_define([_LT_IF_OPTION],
+[m4_ifdef(_LT_MANGLE_OPTION([$1], [$2]), [$3], [$4])])
+
+
+# _LT_UNLESS_OPTIONS(MACRO-NAME, OPTION-LIST, IF-NOT-SET)
+# -------------------------------------------------------
+# Execute IF-NOT-SET unless all options in OPTION-LIST for MACRO-NAME
+# are set.
+m4_define([_LT_UNLESS_OPTIONS],
+[m4_foreach([_LT_Option], m4_split(m4_normalize([$2])),
+	    [m4_ifdef(_LT_MANGLE_OPTION([$1], _LT_Option),
+		      [m4_define([$0_found])])])[]dnl
+m4_ifdef([$0_found], [m4_undefine([$0_found])], [$3
+])[]dnl
+])
+
+
+# _LT_SET_OPTIONS(MACRO-NAME, OPTION-LIST)
+# ----------------------------------------
+# OPTION-LIST is a space-separated list of Libtool options associated
+# with MACRO-NAME.  If any OPTION has a matching handler declared with
+# LT_OPTION_DEFINE, dispatch to that macro; otherwise complain about
+# the unknown option and exit.
+m4_defun([_LT_SET_OPTIONS],
+[# Set options
+m4_foreach([_LT_Option], m4_split(m4_normalize([$2])),
+    [_LT_SET_OPTION([$1], _LT_Option)])
+
+m4_if([$1],[LT_INIT],[
+  dnl
+  dnl Simply set some default values (i.e off) if boolean options were not
+  dnl specified:
+  _LT_UNLESS_OPTIONS([LT_INIT], [dlopen], [enable_dlopen=no
+  ])
+  _LT_UNLESS_OPTIONS([LT_INIT], [win32-dll], [enable_win32_dll=no
+  ])
+  dnl
+  dnl If no reference was made to various pairs of opposing options, then
+  dnl we run the default mode handler for the pair.  For example, if neither
+  dnl `shared' nor `disable-shared' was passed, we enable building of shared
+  dnl archives by default:
+  _LT_UNLESS_OPTIONS([LT_INIT], [shared disable-shared], [_LT_ENABLE_SHARED])
+  _LT_UNLESS_OPTIONS([LT_INIT], [static disable-static], [_LT_ENABLE_STATIC])
+  _LT_UNLESS_OPTIONS([LT_INIT], [pic-only no-pic], [_LT_WITH_PIC])
+  _LT_UNLESS_OPTIONS([LT_INIT], [fast-install disable-fast-install],
+  		   [_LT_ENABLE_FAST_INSTALL])
+  ])
+])# _LT_SET_OPTIONS
+
+
+
+# _LT_MANGLE_DEFUN(MACRO-NAME, OPTION-NAME)
+# -----------------------------------------
+m4_define([_LT_MANGLE_DEFUN],
+[[_LT_OPTION_DEFUN_]m4_bpatsubst(m4_toupper([$1__$2]), [[^A-Z0-9_]], [_])])
+
+
+# LT_OPTION_DEFINE(MACRO-NAME, OPTION-NAME, CODE)
+# -----------------------------------------------
+m4_define([LT_OPTION_DEFINE],
+[m4_define(_LT_MANGLE_DEFUN([$1], [$2]), [$3])[]dnl
+])# LT_OPTION_DEFINE
+
+
+# dlopen
+# ------
+LT_OPTION_DEFINE([LT_INIT], [dlopen], [enable_dlopen=yes
+])
+
+AU_DEFUN([AC_LIBTOOL_DLOPEN],
+[_LT_SET_OPTION([LT_INIT], [dlopen])
+AC_DIAGNOSE([obsolete],
+[$0: Remove this warning and the call to _LT_SET_OPTION when you
+put the `dlopen' option into LT_INIT's first parameter.])
+])
+
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_LIBTOOL_DLOPEN], [])
+
+
+# win32-dll
+# ---------
+# Declare package support for building win32 dll's.
+LT_OPTION_DEFINE([LT_INIT], [win32-dll],
+[enable_win32_dll=yes
+
+case $host in
+*-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-cegcc*)
+  AC_CHECK_TOOL(AS, as, false)
+  AC_CHECK_TOOL(DLLTOOL, dlltool, false)
+  AC_CHECK_TOOL(OBJDUMP, objdump, false)
+  ;;
+esac
+
+test -z "$AS" && AS=as
+_LT_DECL([], [AS],      [1], [Assembler program])dnl
+
+test -z "$DLLTOOL" && DLLTOOL=dlltool
+_LT_DECL([], [DLLTOOL], [1], [DLL creation program])dnl
+
+test -z "$OBJDUMP" && OBJDUMP=objdump
+_LT_DECL([], [OBJDUMP], [1], [Object dumper program])dnl
+])# win32-dll
+
+AU_DEFUN([AC_LIBTOOL_WIN32_DLL],
+[AC_REQUIRE([AC_CANONICAL_HOST])dnl
+_LT_SET_OPTION([LT_INIT], [win32-dll])
+AC_DIAGNOSE([obsolete],
+[$0: Remove this warning and the call to _LT_SET_OPTION when you
+put the `win32-dll' option into LT_INIT's first parameter.])
+])
+
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_LIBTOOL_WIN32_DLL], [])
+
+
+# _LT_ENABLE_SHARED([DEFAULT])
+# ----------------------------
+# implement the --enable-shared flag, and supports the `shared' and
+# `disable-shared' LT_INIT options.
+# DEFAULT is either `yes' or `no'.  If omitted, it defaults to `yes'.
+m4_define([_LT_ENABLE_SHARED],
+[m4_define([_LT_ENABLE_SHARED_DEFAULT], [m4_if($1, no, no, yes)])dnl
+AC_ARG_ENABLE([shared],
+    [AS_HELP_STRING([--enable-shared@<:@=PKGS@:>@],
+	[build shared libraries @<:@default=]_LT_ENABLE_SHARED_DEFAULT[@:>@])],
+    [p=${PACKAGE-default}
+    case $enableval in
+    yes) enable_shared=yes ;;
+    no) enable_shared=no ;;
+    *)
+      enable_shared=no
+      # Look at the argument we got.  We use all the common list separators.
+      lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+      for pkg in $enableval; do
+	IFS="$lt_save_ifs"
+	if test "X$pkg" = "X$p"; then
+	  enable_shared=yes
+	fi
+      done
+      IFS="$lt_save_ifs"
+      ;;
+    esac],
+    [enable_shared=]_LT_ENABLE_SHARED_DEFAULT)
+
+    _LT_DECL([build_libtool_libs], [enable_shared], [0],
+	[Whether or not to build shared libraries])
+])# _LT_ENABLE_SHARED
+
+LT_OPTION_DEFINE([LT_INIT], [shared], [_LT_ENABLE_SHARED([yes])])
+LT_OPTION_DEFINE([LT_INIT], [disable-shared], [_LT_ENABLE_SHARED([no])])
+
+# Old names:
+AC_DEFUN([AC_ENABLE_SHARED],
+[_LT_SET_OPTION([LT_INIT], m4_if([$1], [no], [disable-])[shared])
+])
+
+AC_DEFUN([AC_DISABLE_SHARED],
+[_LT_SET_OPTION([LT_INIT], [disable-shared])
+])
+
+AU_DEFUN([AM_ENABLE_SHARED], [AC_ENABLE_SHARED($@)])
+AU_DEFUN([AM_DISABLE_SHARED], [AC_DISABLE_SHARED($@)])
+
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AM_ENABLE_SHARED], [])
+dnl AC_DEFUN([AM_DISABLE_SHARED], [])
+
+
+
+# _LT_ENABLE_STATIC([DEFAULT])
+# ----------------------------
+# implement the --enable-static flag, and support the `static' and
+# `disable-static' LT_INIT options.
+# DEFAULT is either `yes' or `no'.  If omitted, it defaults to `yes'.
+m4_define([_LT_ENABLE_STATIC],
+[m4_define([_LT_ENABLE_STATIC_DEFAULT], [m4_if($1, no, no, yes)])dnl
+AC_ARG_ENABLE([static],
+    [AS_HELP_STRING([--enable-static@<:@=PKGS@:>@],
+	[build static libraries @<:@default=]_LT_ENABLE_STATIC_DEFAULT[@:>@])],
+    [p=${PACKAGE-default}
+    case $enableval in
+    yes) enable_static=yes ;;
+    no) enable_static=no ;;
+    *)
+     enable_static=no
+      # Look at the argument we got.  We use all the common list separators.
+      lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+      for pkg in $enableval; do
+	IFS="$lt_save_ifs"
+	if test "X$pkg" = "X$p"; then
+	  enable_static=yes
+	fi
+      done
+      IFS="$lt_save_ifs"
+      ;;
+    esac],
+    [enable_static=]_LT_ENABLE_STATIC_DEFAULT)
+
+    _LT_DECL([build_old_libs], [enable_static], [0],
+	[Whether or not to build static libraries])
+])# _LT_ENABLE_STATIC
+
+LT_OPTION_DEFINE([LT_INIT], [static], [_LT_ENABLE_STATIC([yes])])
+LT_OPTION_DEFINE([LT_INIT], [disable-static], [_LT_ENABLE_STATIC([no])])
+
+# Old names:
+AC_DEFUN([AC_ENABLE_STATIC],
+[_LT_SET_OPTION([LT_INIT], m4_if([$1], [no], [disable-])[static])
+])
+
+AC_DEFUN([AC_DISABLE_STATIC],
+[_LT_SET_OPTION([LT_INIT], [disable-static])
+])
+
+AU_DEFUN([AM_ENABLE_STATIC], [AC_ENABLE_STATIC($@)])
+AU_DEFUN([AM_DISABLE_STATIC], [AC_DISABLE_STATIC($@)])
+
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AM_ENABLE_STATIC], [])
+dnl AC_DEFUN([AM_DISABLE_STATIC], [])
+
+
+
+# _LT_ENABLE_FAST_INSTALL([DEFAULT])
+# ----------------------------------
+# implement the --enable-fast-install flag, and support the `fast-install'
+# and `disable-fast-install' LT_INIT options.
+# DEFAULT is either `yes' or `no'.  If omitted, it defaults to `yes'.
+m4_define([_LT_ENABLE_FAST_INSTALL],
+[m4_define([_LT_ENABLE_FAST_INSTALL_DEFAULT], [m4_if($1, no, no, yes)])dnl
+AC_ARG_ENABLE([fast-install],
+    [AS_HELP_STRING([--enable-fast-install@<:@=PKGS@:>@],
+    [optimize for fast installation @<:@default=]_LT_ENABLE_FAST_INSTALL_DEFAULT[@:>@])],
+    [p=${PACKAGE-default}
+    case $enableval in
+    yes) enable_fast_install=yes ;;
+    no) enable_fast_install=no ;;
+    *)
+      enable_fast_install=no
+      # Look at the argument we got.  We use all the common list separators.
+      lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+      for pkg in $enableval; do
+	IFS="$lt_save_ifs"
+	if test "X$pkg" = "X$p"; then
+	  enable_fast_install=yes
+	fi
+      done
+      IFS="$lt_save_ifs"
+      ;;
+    esac],
+    [enable_fast_install=]_LT_ENABLE_FAST_INSTALL_DEFAULT)
+
+_LT_DECL([fast_install], [enable_fast_install], [0],
+	 [Whether or not to optimize for fast installation])dnl
+])# _LT_ENABLE_FAST_INSTALL
+
+LT_OPTION_DEFINE([LT_INIT], [fast-install], [_LT_ENABLE_FAST_INSTALL([yes])])
+LT_OPTION_DEFINE([LT_INIT], [disable-fast-install], [_LT_ENABLE_FAST_INSTALL([no])])
+
+# Old names:
+AU_DEFUN([AC_ENABLE_FAST_INSTALL],
+[_LT_SET_OPTION([LT_INIT], m4_if([$1], [no], [disable-])[fast-install])
+AC_DIAGNOSE([obsolete],
+[$0: Remove this warning and the call to _LT_SET_OPTION when you put
+the `fast-install' option into LT_INIT's first parameter.])
+])
+
+AU_DEFUN([AC_DISABLE_FAST_INSTALL],
+[_LT_SET_OPTION([LT_INIT], [disable-fast-install])
+AC_DIAGNOSE([obsolete],
+[$0: Remove this warning and the call to _LT_SET_OPTION when you put
+the `disable-fast-install' option into LT_INIT's first parameter.])
+])
+
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_ENABLE_FAST_INSTALL], [])
+dnl AC_DEFUN([AM_DISABLE_FAST_INSTALL], [])
+
+
+# _LT_WITH_PIC([MODE])
+# --------------------
+# implement the --with-pic flag, and support the `pic-only' and `no-pic'
+# LT_INIT options.
+# MODE is either `yes' or `no'.  If omitted, it defaults to `both'.
+m4_define([_LT_WITH_PIC],
+[AC_ARG_WITH([pic],
+    [AS_HELP_STRING([--with-pic@<:@=PKGS@:>@],
+	[try to use only PIC/non-PIC objects @<:@default=use both@:>@])],
+    [lt_p=${PACKAGE-default}
+    case $withval in
+    yes|no) pic_mode=$withval ;;
+    *)
+      pic_mode=default
+      # Look at the argument we got.  We use all the common list separators.
+      lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+      for lt_pkg in $withval; do
+	IFS="$lt_save_ifs"
+	if test "X$lt_pkg" = "X$lt_p"; then
+	  pic_mode=yes
+	fi
+      done
+      IFS="$lt_save_ifs"
+      ;;
+    esac],
+    [pic_mode=default])
+
+test -z "$pic_mode" && pic_mode=m4_default([$1], [default])
+
+_LT_DECL([], [pic_mode], [0], [What type of objects to build])dnl
+])# _LT_WITH_PIC
+
+LT_OPTION_DEFINE([LT_INIT], [pic-only], [_LT_WITH_PIC([yes])])
+LT_OPTION_DEFINE([LT_INIT], [no-pic], [_LT_WITH_PIC([no])])
+
+# Old name:
+AU_DEFUN([AC_LIBTOOL_PICMODE],
+[_LT_SET_OPTION([LT_INIT], [pic-only])
+AC_DIAGNOSE([obsolete],
+[$0: Remove this warning and the call to _LT_SET_OPTION when you
+put the `pic-only' option into LT_INIT's first parameter.])
+])
+
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_LIBTOOL_PICMODE], [])
+
+
+m4_define([_LTDL_MODE], [])
+LT_OPTION_DEFINE([LTDL_INIT], [nonrecursive],
+		 [m4_define([_LTDL_MODE], [nonrecursive])])
+LT_OPTION_DEFINE([LTDL_INIT], [recursive],
+		 [m4_define([_LTDL_MODE], [recursive])])
+LT_OPTION_DEFINE([LTDL_INIT], [subproject],
+		 [m4_define([_LTDL_MODE], [subproject])])
+
+m4_define([_LTDL_TYPE], [])
+LT_OPTION_DEFINE([LTDL_INIT], [installable],
+		 [m4_define([_LTDL_TYPE], [installable])])
+LT_OPTION_DEFINE([LTDL_INIT], [convenience],
+		 [m4_define([_LTDL_TYPE], [convenience])])
+
+# ltsugar.m4 -- libtool m4 base layer.                         -*-Autoconf-*-
+#
+# Copyright (C) 2004, 2005, 2007, 2008 Free Software Foundation, Inc.
+# Written by Gary V. Vaughan, 2004
+#
+# This file is free software; the Free Software Foundation gives
+# unlimited permission to copy and/or distribute it, with or without
+# modifications, as long as this notice is preserved.
+
+# serial 6 ltsugar.m4
+
+# This is to help aclocal find these macros, as it can't see m4_define.
+AC_DEFUN([LTSUGAR_VERSION], [m4_if([0.1])])
+
+
+# lt_join(SEP, ARG1, [ARG2...])
+# -----------------------------
+# Produce ARG1SEPARG2...SEPARGn, omitting [] arguments and their
+# associated separator.
+# Needed until we can rely on m4_join from Autoconf 2.62, since all earlier
+# versions in m4sugar had bugs.
+m4_define([lt_join],
+[m4_if([$#], [1], [],
+       [$#], [2], [[$2]],
+       [m4_if([$2], [], [], [[$2]_])$0([$1], m4_shift(m4_shift($@)))])])
+m4_define([_lt_join],
+[m4_if([$#$2], [2], [],
+       [m4_if([$2], [], [], [[$1$2]])$0([$1], m4_shift(m4_shift($@)))])])
+
+
+# lt_car(LIST)
+# lt_cdr(LIST)
+# ------------
+# Manipulate m4 lists.
+# These macros are necessary as long as will still need to support
+# Autoconf-2.59 which quotes differently.
+m4_define([lt_car], [[$1]])
+m4_define([lt_cdr],
+[m4_if([$#], 0, [m4_fatal([$0: cannot be called without arguments])],
+       [$#], 1, [],
+       [m4_dquote(m4_shift($@))])])
+m4_define([lt_unquote], $1)
+
+
+# lt_append(MACRO-NAME, STRING, [SEPARATOR])
+# ------------------------------------------
+# Redefine MACRO-NAME to hold its former content plus `SEPARATOR'`STRING'.
+# Note that neither SEPARATOR nor STRING are expanded; they are appended
+# to MACRO-NAME as is (leaving the expansion for when MACRO-NAME is invoked).
+# No SEPARATOR is output if MACRO-NAME was previously undefined (different
+# than defined and empty).
+#
+# This macro is needed until we can rely on Autoconf 2.62, since earlier
+# versions of m4sugar mistakenly expanded SEPARATOR but not STRING.
+m4_define([lt_append],
+[m4_define([$1],
+	   m4_ifdef([$1], [m4_defn([$1])[$3]])[$2])])
+
+
+
+# lt_combine(SEP, PREFIX-LIST, INFIX, SUFFIX1, [SUFFIX2...])
+# ----------------------------------------------------------
+# Produce a SEP delimited list of all paired combinations of elements of
+# PREFIX-LIST with SUFFIX1 through SUFFIXn.  Each element of the list
+# has the form PREFIXmINFIXSUFFIXn.
+# Needed until we can rely on m4_combine added in Autoconf 2.62.
+m4_define([lt_combine],
+[m4_if(m4_eval([$# > 3]), [1],
+       [m4_pushdef([_Lt_sep], [m4_define([_Lt_sep], m4_defn([lt_car]))])]]dnl
+[[m4_foreach([_Lt_prefix], [$2],
+	     [m4_foreach([_Lt_suffix],
+		]m4_dquote(m4_dquote(m4_shift(m4_shift(m4_shift($@)))))[,
+	[_Lt_sep([$1])[]m4_defn([_Lt_prefix])[$3]m4_defn([_Lt_suffix])])])])])
+
+
+# lt_if_append_uniq(MACRO-NAME, VARNAME, [SEPARATOR], [UNIQ], [NOT-UNIQ])
+# -----------------------------------------------------------------------
+# Iff MACRO-NAME does not yet contain VARNAME, then append it (delimited
+# by SEPARATOR if supplied) and expand UNIQ, else NOT-UNIQ.
+m4_define([lt_if_append_uniq],
+[m4_ifdef([$1],
+	  [m4_if(m4_index([$3]m4_defn([$1])[$3], [$3$2$3]), [-1],
+		 [lt_append([$1], [$2], [$3])$4],
+		 [$5])],
+	  [lt_append([$1], [$2], [$3])$4])])
+
+
+# lt_dict_add(DICT, KEY, VALUE)
+# -----------------------------
+m4_define([lt_dict_add],
+[m4_define([$1($2)], [$3])])
+
+
+# lt_dict_add_subkey(DICT, KEY, SUBKEY, VALUE)
+# --------------------------------------------
+m4_define([lt_dict_add_subkey],
+[m4_define([$1($2:$3)], [$4])])
+
+
+# lt_dict_fetch(DICT, KEY, [SUBKEY])
+# ----------------------------------
+m4_define([lt_dict_fetch],
+[m4_ifval([$3],
+	m4_ifdef([$1($2:$3)], [m4_defn([$1($2:$3)])]),
+    m4_ifdef([$1($2)], [m4_defn([$1($2)])]))])
+
+
+# lt_if_dict_fetch(DICT, KEY, [SUBKEY], VALUE, IF-TRUE, [IF-FALSE])
+# -----------------------------------------------------------------
+m4_define([lt_if_dict_fetch],
+[m4_if(lt_dict_fetch([$1], [$2], [$3]), [$4],
+	[$5],
+    [$6])])
+
+
+# lt_dict_filter(DICT, [SUBKEY], VALUE, [SEPARATOR], KEY, [...])
+# --------------------------------------------------------------
+m4_define([lt_dict_filter],
+[m4_if([$5], [], [],
+  [lt_join(m4_quote(m4_default([$4], [[, ]])),
+           lt_unquote(m4_split(m4_normalize(m4_foreach(_Lt_key, lt_car([m4_shiftn(4, $@)]),
+		      [lt_if_dict_fetch([$1], _Lt_key, [$2], [$3], [_Lt_key ])])))))])[]dnl
+])
+
+# ltversion.m4 -- version numbers			-*- Autoconf -*-
+#
+#   Copyright (C) 2004 Free Software Foundation, Inc.
+#   Written by Scott James Remnant, 2004
+#
+# This file is free software; the Free Software Foundation gives
+# unlimited permission to copy and/or distribute it, with or without
+# modifications, as long as this notice is preserved.
+
+# @configure_input@
+
+# serial 3337 ltversion.m4
+# This file is part of GNU Libtool
+
+m4_define([LT_PACKAGE_VERSION], [2.4.2])
+m4_define([LT_PACKAGE_REVISION], [1.3337])
+
+AC_DEFUN([LTVERSION_VERSION],
+[macro_version='2.4.2'
+macro_revision='1.3337'
+_LT_DECL(, macro_version, 0, [Which release of libtool.m4 was used?])
+_LT_DECL(, macro_revision, 0)
+])
+
+# lt~obsolete.m4 -- aclocal satisfying obsolete definitions.    -*-Autoconf-*-
+#
+#   Copyright (C) 2004, 2005, 2007, 2009 Free Software Foundation, Inc.
+#   Written by Scott James Remnant, 2004.
+#
+# This file is free software; the Free Software Foundation gives
+# unlimited permission to copy and/or distribute it, with or without
+# modifications, as long as this notice is preserved.
+
+# serial 5 lt~obsolete.m4
+
+# These exist entirely to fool aclocal when bootstrapping libtool.
+#
+# In the past libtool.m4 has provided macros via AC_DEFUN (or AU_DEFUN)
+# which have later been changed to m4_define as they aren't part of the
+# exported API, or moved to Autoconf or Automake where they belong.
+#
+# The trouble is, aclocal is a bit thick.  It'll see the old AC_DEFUN
+# in /usr/share/aclocal/libtool.m4 and remember it, then when it sees us
+# using a macro with the same name in our local m4/libtool.m4 it'll
+# pull the old libtool.m4 in (it doesn't see our shiny new m4_define
+# and doesn't know about Autoconf macros at all.)
+#
+# So we provide this file, which has a silly filename so it's always
+# included after everything else.  This provides aclocal with the
+# AC_DEFUNs it wants, but when m4 processes it, it doesn't do anything
+# because those macros already exist, or will be overwritten later.
+# We use AC_DEFUN over AU_DEFUN for compatibility with aclocal-1.6. 
+#
+# Anytime we withdraw an AC_DEFUN or AU_DEFUN, remember to add it here.
+# Yes, that means every name once taken will need to remain here until
+# we give up compatibility with versions before 1.7, at which point
+# we need to keep only those names which we still refer to.
+
+# This is to help aclocal find these macros, as it can't see m4_define.
+AC_DEFUN([LTOBSOLETE_VERSION], [m4_if([1])])
+
+m4_ifndef([AC_LIBTOOL_LINKER_OPTION],	[AC_DEFUN([AC_LIBTOOL_LINKER_OPTION])])
+m4_ifndef([AC_PROG_EGREP],		[AC_DEFUN([AC_PROG_EGREP])])
+m4_ifndef([_LT_AC_PROG_ECHO_BACKSLASH],	[AC_DEFUN([_LT_AC_PROG_ECHO_BACKSLASH])])
+m4_ifndef([_LT_AC_SHELL_INIT],		[AC_DEFUN([_LT_AC_SHELL_INIT])])
+m4_ifndef([_LT_AC_SYS_LIBPATH_AIX],	[AC_DEFUN([_LT_AC_SYS_LIBPATH_AIX])])
+m4_ifndef([_LT_PROG_LTMAIN],		[AC_DEFUN([_LT_PROG_LTMAIN])])
+m4_ifndef([_LT_AC_TAGVAR],		[AC_DEFUN([_LT_AC_TAGVAR])])
+m4_ifndef([AC_LTDL_ENABLE_INSTALL],	[AC_DEFUN([AC_LTDL_ENABLE_INSTALL])])
+m4_ifndef([AC_LTDL_PREOPEN],		[AC_DEFUN([AC_LTDL_PREOPEN])])
+m4_ifndef([_LT_AC_SYS_COMPILER],	[AC_DEFUN([_LT_AC_SYS_COMPILER])])
+m4_ifndef([_LT_AC_LOCK],		[AC_DEFUN([_LT_AC_LOCK])])
+m4_ifndef([AC_LIBTOOL_SYS_OLD_ARCHIVE],	[AC_DEFUN([AC_LIBTOOL_SYS_OLD_ARCHIVE])])
+m4_ifndef([_LT_AC_TRY_DLOPEN_SELF],	[AC_DEFUN([_LT_AC_TRY_DLOPEN_SELF])])
+m4_ifndef([AC_LIBTOOL_PROG_CC_C_O],	[AC_DEFUN([AC_LIBTOOL_PROG_CC_C_O])])
+m4_ifndef([AC_LIBTOOL_SYS_HARD_LINK_LOCKS], [AC_DEFUN([AC_LIBTOOL_SYS_HARD_LINK_LOCKS])])
+m4_ifndef([AC_LIBTOOL_OBJDIR],		[AC_DEFUN([AC_LIBTOOL_OBJDIR])])
+m4_ifndef([AC_LTDL_OBJDIR],		[AC_DEFUN([AC_LTDL_OBJDIR])])
+m4_ifndef([AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH], [AC_DEFUN([AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH])])
+m4_ifndef([AC_LIBTOOL_SYS_LIB_STRIP],	[AC_DEFUN([AC_LIBTOOL_SYS_LIB_STRIP])])
+m4_ifndef([AC_PATH_MAGIC],		[AC_DEFUN([AC_PATH_MAGIC])])
+m4_ifndef([AC_PROG_LD_GNU],		[AC_DEFUN([AC_PROG_LD_GNU])])
+m4_ifndef([AC_PROG_LD_RELOAD_FLAG],	[AC_DEFUN([AC_PROG_LD_RELOAD_FLAG])])
+m4_ifndef([AC_DEPLIBS_CHECK_METHOD],	[AC_DEFUN([AC_DEPLIBS_CHECK_METHOD])])
+m4_ifndef([AC_LIBTOOL_PROG_COMPILER_NO_RTTI], [AC_DEFUN([AC_LIBTOOL_PROG_COMPILER_NO_RTTI])])
+m4_ifndef([AC_LIBTOOL_SYS_GLOBAL_SYMBOL_PIPE], [AC_DEFUN([AC_LIBTOOL_SYS_GLOBAL_SYMBOL_PIPE])])
+m4_ifndef([AC_LIBTOOL_PROG_COMPILER_PIC], [AC_DEFUN([AC_LIBTOOL_PROG_COMPILER_PIC])])
+m4_ifndef([AC_LIBTOOL_PROG_LD_SHLIBS],	[AC_DEFUN([AC_LIBTOOL_PROG_LD_SHLIBS])])
+m4_ifndef([AC_LIBTOOL_POSTDEP_PREDEP],	[AC_DEFUN([AC_LIBTOOL_POSTDEP_PREDEP])])
+m4_ifndef([LT_AC_PROG_EGREP],		[AC_DEFUN([LT_AC_PROG_EGREP])])
+m4_ifndef([LT_AC_PROG_SED],		[AC_DEFUN([LT_AC_PROG_SED])])
+m4_ifndef([_LT_CC_BASENAME],		[AC_DEFUN([_LT_CC_BASENAME])])
+m4_ifndef([_LT_COMPILER_BOILERPLATE],	[AC_DEFUN([_LT_COMPILER_BOILERPLATE])])
+m4_ifndef([_LT_LINKER_BOILERPLATE],	[AC_DEFUN([_LT_LINKER_BOILERPLATE])])
+m4_ifndef([_AC_PROG_LIBTOOL],		[AC_DEFUN([_AC_PROG_LIBTOOL])])
+m4_ifndef([AC_LIBTOOL_SETUP],		[AC_DEFUN([AC_LIBTOOL_SETUP])])
+m4_ifndef([_LT_AC_CHECK_DLFCN],		[AC_DEFUN([_LT_AC_CHECK_DLFCN])])
+m4_ifndef([AC_LIBTOOL_SYS_DYNAMIC_LINKER],	[AC_DEFUN([AC_LIBTOOL_SYS_DYNAMIC_LINKER])])
+m4_ifndef([_LT_AC_TAGCONFIG],		[AC_DEFUN([_LT_AC_TAGCONFIG])])
+m4_ifndef([AC_DISABLE_FAST_INSTALL],	[AC_DEFUN([AC_DISABLE_FAST_INSTALL])])
+m4_ifndef([_LT_AC_LANG_CXX],		[AC_DEFUN([_LT_AC_LANG_CXX])])
+m4_ifndef([_LT_AC_LANG_F77],		[AC_DEFUN([_LT_AC_LANG_F77])])
+m4_ifndef([_LT_AC_LANG_GCJ],		[AC_DEFUN([_LT_AC_LANG_GCJ])])
+m4_ifndef([AC_LIBTOOL_LANG_C_CONFIG],	[AC_DEFUN([AC_LIBTOOL_LANG_C_CONFIG])])
+m4_ifndef([_LT_AC_LANG_C_CONFIG],	[AC_DEFUN([_LT_AC_LANG_C_CONFIG])])
+m4_ifndef([AC_LIBTOOL_LANG_CXX_CONFIG],	[AC_DEFUN([AC_LIBTOOL_LANG_CXX_CONFIG])])
+m4_ifndef([_LT_AC_LANG_CXX_CONFIG],	[AC_DEFUN([_LT_AC_LANG_CXX_CONFIG])])
+m4_ifndef([AC_LIBTOOL_LANG_F77_CONFIG],	[AC_DEFUN([AC_LIBTOOL_LANG_F77_CONFIG])])
+m4_ifndef([_LT_AC_LANG_F77_CONFIG],	[AC_DEFUN([_LT_AC_LANG_F77_CONFIG])])
+m4_ifndef([AC_LIBTOOL_LANG_GCJ_CONFIG],	[AC_DEFUN([AC_LIBTOOL_LANG_GCJ_CONFIG])])
+m4_ifndef([_LT_AC_LANG_GCJ_CONFIG],	[AC_DEFUN([_LT_AC_LANG_GCJ_CONFIG])])
+m4_ifndef([AC_LIBTOOL_LANG_RC_CONFIG],	[AC_DEFUN([AC_LIBTOOL_LANG_RC_CONFIG])])
+m4_ifndef([_LT_AC_LANG_RC_CONFIG],	[AC_DEFUN([_LT_AC_LANG_RC_CONFIG])])
+m4_ifndef([AC_LIBTOOL_CONFIG],		[AC_DEFUN([AC_LIBTOOL_CONFIG])])
+m4_ifndef([_LT_AC_FILE_LTDLL_C],	[AC_DEFUN([_LT_AC_FILE_LTDLL_C])])
+m4_ifndef([_LT_REQUIRED_DARWIN_CHECKS],	[AC_DEFUN([_LT_REQUIRED_DARWIN_CHECKS])])
+m4_ifndef([_LT_AC_PROG_CXXCPP],		[AC_DEFUN([_LT_AC_PROG_CXXCPP])])
+m4_ifndef([_LT_PREPARE_SED_QUOTE_VARS],	[AC_DEFUN([_LT_PREPARE_SED_QUOTE_VARS])])
+m4_ifndef([_LT_PROG_ECHO_BACKSLASH],	[AC_DEFUN([_LT_PROG_ECHO_BACKSLASH])])
+m4_ifndef([_LT_PROG_F77],		[AC_DEFUN([_LT_PROG_F77])])
+m4_ifndef([_LT_PROG_FC],		[AC_DEFUN([_LT_PROG_FC])])
+m4_ifndef([_LT_PROG_CXX],		[AC_DEFUN([_LT_PROG_CXX])])
+
+# Copyright (C) 2002-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_AUTOMAKE_VERSION(VERSION)
+# ----------------------------
+# Automake X.Y traces this macro to ensure aclocal.m4 has been
+# generated from the m4 files accompanying Automake X.Y.
+# (This private macro should not be called outside this file.)
+AC_DEFUN([AM_AUTOMAKE_VERSION],
+[am__api_version='1.14'
+dnl Some users find AM_AUTOMAKE_VERSION and mistake it for a way to
+dnl require some minimum version.  Point them to the right macro.
+m4_if([$1], [1.14.1], [],
+      [AC_FATAL([Do not call $0, use AM_INIT_AUTOMAKE([$1]).])])dnl
+])
+
+# _AM_AUTOCONF_VERSION(VERSION)
+# -----------------------------
+# aclocal traces this macro to find the Autoconf version.
+# This is a private macro too.  Using m4_define simplifies
+# the logic in aclocal, which can simply ignore this definition.
+m4_define([_AM_AUTOCONF_VERSION], [])
+
+# AM_SET_CURRENT_AUTOMAKE_VERSION
+# -------------------------------
+# Call AM_AUTOMAKE_VERSION and AM_AUTOMAKE_VERSION so they can be traced.
+# This function is AC_REQUIREd by AM_INIT_AUTOMAKE.
+AC_DEFUN([AM_SET_CURRENT_AUTOMAKE_VERSION],
+[AM_AUTOMAKE_VERSION([1.14.1])dnl
+m4_ifndef([AC_AUTOCONF_VERSION],
+  [m4_copy([m4_PACKAGE_VERSION], [AC_AUTOCONF_VERSION])])dnl
+_AM_AUTOCONF_VERSION(m4_defn([AC_AUTOCONF_VERSION]))])
+
+# AM_AUX_DIR_EXPAND                                         -*- Autoconf -*-
+
+# Copyright (C) 2001-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# For projects using AC_CONFIG_AUX_DIR([foo]), Autoconf sets
+# $ac_aux_dir to '$srcdir/foo'.  In other projects, it is set to
+# '$srcdir', '$srcdir/..', or '$srcdir/../..'.
+#
+# Of course, Automake must honor this variable whenever it calls a
+# tool from the auxiliary directory.  The problem is that $srcdir (and
+# therefore $ac_aux_dir as well) can be either absolute or relative,
+# depending on how configure is run.  This is pretty annoying, since
+# it makes $ac_aux_dir quite unusable in subdirectories: in the top
+# source directory, any form will work fine, but in subdirectories a
+# relative path needs to be adjusted first.
+#
+# $ac_aux_dir/missing
+#    fails when called from a subdirectory if $ac_aux_dir is relative
+# $top_srcdir/$ac_aux_dir/missing
+#    fails if $ac_aux_dir is absolute,
+#    fails when called from a subdirectory in a VPATH build with
+#          a relative $ac_aux_dir
+#
+# The reason of the latter failure is that $top_srcdir and $ac_aux_dir
+# are both prefixed by $srcdir.  In an in-source build this is usually
+# harmless because $srcdir is '.', but things will broke when you
+# start a VPATH build or use an absolute $srcdir.
+#
+# So we could use something similar to $top_srcdir/$ac_aux_dir/missing,
+# iff we strip the leading $srcdir from $ac_aux_dir.  That would be:
+#   am_aux_dir='\$(top_srcdir)/'`expr "$ac_aux_dir" : "$srcdir//*\(.*\)"`
+# and then we would define $MISSING as
+#   MISSING="\${SHELL} $am_aux_dir/missing"
+# This will work as long as MISSING is not called from configure, because
+# unfortunately $(top_srcdir) has no meaning in configure.
+# However there are other variables, like CC, which are often used in
+# configure, and could therefore not use this "fixed" $ac_aux_dir.
+#
+# Another solution, used here, is to always expand $ac_aux_dir to an
+# absolute PATH.  The drawback is that using absolute paths prevent a
+# configured tree to be moved without reconfiguration.
+
+AC_DEFUN([AM_AUX_DIR_EXPAND],
+[dnl Rely on autoconf to set up CDPATH properly.
+AC_PREREQ([2.50])dnl
+# expand $ac_aux_dir to an absolute path
+am_aux_dir=`cd $ac_aux_dir && pwd`
+])
+
+# AM_CONDITIONAL                                            -*- Autoconf -*-
+
+# Copyright (C) 1997-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_CONDITIONAL(NAME, SHELL-CONDITION)
+# -------------------------------------
+# Define a conditional.
+AC_DEFUN([AM_CONDITIONAL],
+[AC_PREREQ([2.52])dnl
+ m4_if([$1], [TRUE],  [AC_FATAL([$0: invalid condition: $1])],
+       [$1], [FALSE], [AC_FATAL([$0: invalid condition: $1])])dnl
+AC_SUBST([$1_TRUE])dnl
+AC_SUBST([$1_FALSE])dnl
+_AM_SUBST_NOTMAKE([$1_TRUE])dnl
+_AM_SUBST_NOTMAKE([$1_FALSE])dnl
+m4_define([_AM_COND_VALUE_$1], [$2])dnl
+if $2; then
+  $1_TRUE=
+  $1_FALSE='#'
+else
+  $1_TRUE='#'
+  $1_FALSE=
+fi
+AC_CONFIG_COMMANDS_PRE(
+[if test -z "${$1_TRUE}" && test -z "${$1_FALSE}"; then
+  AC_MSG_ERROR([[conditional "$1" was never defined.
+Usually this means the macro was only invoked conditionally.]])
+fi])])
+
+# Copyright (C) 1999-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+
+# There are a few dirty hacks below to avoid letting 'AC_PROG_CC' be
+# written in clear, in which case automake, when reading aclocal.m4,
+# will think it sees a *use*, and therefore will trigger all it's
+# C support machinery.  Also note that it means that autoscan, seeing
+# CC etc. in the Makefile, will ask for an AC_PROG_CC use...
+
+
+# _AM_DEPENDENCIES(NAME)
+# ----------------------
+# See how the compiler implements dependency checking.
+# NAME is "CC", "CXX", "OBJC", "OBJCXX", "UPC", or "GJC".
+# We try a few techniques and use that to set a single cache variable.
+#
+# We don't AC_REQUIRE the corresponding AC_PROG_CC since the latter was
+# modified to invoke _AM_DEPENDENCIES(CC); we would have a circular
+# dependency, and given that the user is not expected to run this macro,
+# just rely on AC_PROG_CC.
+AC_DEFUN([_AM_DEPENDENCIES],
+[AC_REQUIRE([AM_SET_DEPDIR])dnl
+AC_REQUIRE([AM_OUTPUT_DEPENDENCY_COMMANDS])dnl
+AC_REQUIRE([AM_MAKE_INCLUDE])dnl
+AC_REQUIRE([AM_DEP_TRACK])dnl
+
+m4_if([$1], [CC],   [depcc="$CC"   am_compiler_list=],
+      [$1], [CXX],  [depcc="$CXX"  am_compiler_list=],
+      [$1], [OBJC], [depcc="$OBJC" am_compiler_list='gcc3 gcc'],
+      [$1], [OBJCXX], [depcc="$OBJCXX" am_compiler_list='gcc3 gcc'],
+      [$1], [UPC],  [depcc="$UPC"  am_compiler_list=],
+      [$1], [GCJ],  [depcc="$GCJ"  am_compiler_list='gcc3 gcc'],
+                    [depcc="$$1"   am_compiler_list=])
+
+AC_CACHE_CHECK([dependency style of $depcc],
+               [am_cv_$1_dependencies_compiler_type],
+[if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then
+  # We make a subdir and do the tests there.  Otherwise we can end up
+  # making bogus files that we don't know about and never remove.  For
+  # instance it was reported that on HP-UX the gcc test will end up
+  # making a dummy file named 'D' -- because '-MD' means "put the output
+  # in D".
+  rm -rf conftest.dir
+  mkdir conftest.dir
+  # Copy depcomp to subdir because otherwise we won't find it if we're
+  # using a relative directory.
+  cp "$am_depcomp" conftest.dir
+  cd conftest.dir
+  # We will build objects and dependencies in a subdirectory because
+  # it helps to detect inapplicable dependency modes.  For instance
+  # both Tru64's cc and ICC support -MD to output dependencies as a
+  # side effect of compilation, but ICC will put the dependencies in
+  # the current directory while Tru64 will put them in the object
+  # directory.
+  mkdir sub
+
+  am_cv_$1_dependencies_compiler_type=none
+  if test "$am_compiler_list" = ""; then
+     am_compiler_list=`sed -n ['s/^#*\([a-zA-Z0-9]*\))$/\1/p'] < ./depcomp`
+  fi
+  am__universal=false
+  m4_case([$1], [CC],
+    [case " $depcc " in #(
+     *\ -arch\ *\ -arch\ *) am__universal=true ;;
+     esac],
+    [CXX],
+    [case " $depcc " in #(
+     *\ -arch\ *\ -arch\ *) am__universal=true ;;
+     esac])
+
+  for depmode in $am_compiler_list; do
+    # Setup a source with many dependencies, because some compilers
+    # like to wrap large dependency lists on column 80 (with \), and
+    # we should not choose a depcomp mode which is confused by this.
+    #
+    # We need to recreate these files for each test, as the compiler may
+    # overwrite some of them when testing with obscure command lines.
+    # This happens at least with the AIX C compiler.
+    : > sub/conftest.c
+    for i in 1 2 3 4 5 6; do
+      echo '#include "conftst'$i'.h"' >> sub/conftest.c
+      # Using ": > sub/conftst$i.h" creates only sub/conftst1.h with
+      # Solaris 10 /bin/sh.
+      echo '/* dummy */' > sub/conftst$i.h
+    done
+    echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf
+
+    # We check with '-c' and '-o' for the sake of the "dashmstdout"
+    # mode.  It turns out that the SunPro C++ compiler does not properly
+    # handle '-M -o', and we need to detect this.  Also, some Intel
+    # versions had trouble with output in subdirs.
+    am__obj=sub/conftest.${OBJEXT-o}
+    am__minus_obj="-o $am__obj"
+    case $depmode in
+    gcc)
+      # This depmode causes a compiler race in universal mode.
+      test "$am__universal" = false || continue
+      ;;
+    nosideeffect)
+      # After this tag, mechanisms are not by side-effect, so they'll
+      # only be used when explicitly requested.
+      if test "x$enable_dependency_tracking" = xyes; then
+	continue
+      else
+	break
+      fi
+      ;;
+    msvc7 | msvc7msys | msvisualcpp | msvcmsys)
+      # This compiler won't grok '-c -o', but also, the minuso test has
+      # not run yet.  These depmodes are late enough in the game, and
+      # so weak that their functioning should not be impacted.
+      am__obj=conftest.${OBJEXT-o}
+      am__minus_obj=
+      ;;
+    none) break ;;
+    esac
+    if depmode=$depmode \
+       source=sub/conftest.c object=$am__obj \
+       depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \
+       $SHELL ./depcomp $depcc -c $am__minus_obj sub/conftest.c \
+         >/dev/null 2>conftest.err &&
+       grep sub/conftst1.h sub/conftest.Po > /dev/null 2>&1 &&
+       grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 &&
+       grep $am__obj sub/conftest.Po > /dev/null 2>&1 &&
+       ${MAKE-make} -s -f confmf > /dev/null 2>&1; then
+      # icc doesn't choke on unknown options, it will just issue warnings
+      # or remarks (even with -Werror).  So we grep stderr for any message
+      # that says an option was ignored or not supported.
+      # When given -MP, icc 7.0 and 7.1 complain thusly:
+      #   icc: Command line warning: ignoring option '-M'; no argument required
+      # The diagnosis changed in icc 8.0:
+      #   icc: Command line remark: option '-MP' not supported
+      if (grep 'ignoring option' conftest.err ||
+          grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else
+        am_cv_$1_dependencies_compiler_type=$depmode
+        break
+      fi
+    fi
+  done
+
+  cd ..
+  rm -rf conftest.dir
+else
+  am_cv_$1_dependencies_compiler_type=none
+fi
+])
+AC_SUBST([$1DEPMODE], [depmode=$am_cv_$1_dependencies_compiler_type])
+AM_CONDITIONAL([am__fastdep$1], [
+  test "x$enable_dependency_tracking" != xno \
+  && test "$am_cv_$1_dependencies_compiler_type" = gcc3])
+])
+
+
+# AM_SET_DEPDIR
+# -------------
+# Choose a directory name for dependency files.
+# This macro is AC_REQUIREd in _AM_DEPENDENCIES.
+AC_DEFUN([AM_SET_DEPDIR],
+[AC_REQUIRE([AM_SET_LEADING_DOT])dnl
+AC_SUBST([DEPDIR], ["${am__leading_dot}deps"])dnl
+])
+
+
+# AM_DEP_TRACK
+# ------------
+AC_DEFUN([AM_DEP_TRACK],
+[AC_ARG_ENABLE([dependency-tracking], [dnl
+AS_HELP_STRING(
+  [--enable-dependency-tracking],
+  [do not reject slow dependency extractors])
+AS_HELP_STRING(
+  [--disable-dependency-tracking],
+  [speeds up one-time build])])
+if test "x$enable_dependency_tracking" != xno; then
+  am_depcomp="$ac_aux_dir/depcomp"
+  AMDEPBACKSLASH='\'
+  am__nodep='_no'
+fi
+AM_CONDITIONAL([AMDEP], [test "x$enable_dependency_tracking" != xno])
+AC_SUBST([AMDEPBACKSLASH])dnl
+_AM_SUBST_NOTMAKE([AMDEPBACKSLASH])dnl
+AC_SUBST([am__nodep])dnl
+_AM_SUBST_NOTMAKE([am__nodep])dnl
+])
+
+# Generate code to set up dependency tracking.              -*- Autoconf -*-
+
+# Copyright (C) 1999-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+
+# _AM_OUTPUT_DEPENDENCY_COMMANDS
+# ------------------------------
+AC_DEFUN([_AM_OUTPUT_DEPENDENCY_COMMANDS],
+[{
+  # Older Autoconf quotes --file arguments for eval, but not when files
+  # are listed without --file.  Let's play safe and only enable the eval
+  # if we detect the quoting.
+  case $CONFIG_FILES in
+  *\'*) eval set x "$CONFIG_FILES" ;;
+  *)   set x $CONFIG_FILES ;;
+  esac
+  shift
+  for mf
+  do
+    # Strip MF so we end up with the name of the file.
+    mf=`echo "$mf" | sed -e 's/:.*$//'`
+    # Check whether this is an Automake generated Makefile or not.
+    # We used to match only the files named 'Makefile.in', but
+    # some people rename them; so instead we look at the file content.
+    # Grep'ing the first line is not enough: some people post-process
+    # each Makefile.in and add a new line on top of each file to say so.
+    # Grep'ing the whole file is not good either: AIX grep has a line
+    # limit of 2048, but all sed's we know have understand at least 4000.
+    if sed -n 's,^#.*generated by automake.*,X,p' "$mf" | grep X >/dev/null 2>&1; then
+      dirpart=`AS_DIRNAME("$mf")`
+    else
+      continue
+    fi
+    # Extract the definition of DEPDIR, am__include, and am__quote
+    # from the Makefile without running 'make'.
+    DEPDIR=`sed -n 's/^DEPDIR = //p' < "$mf"`
+    test -z "$DEPDIR" && continue
+    am__include=`sed -n 's/^am__include = //p' < "$mf"`
+    test -z "$am__include" && continue
+    am__quote=`sed -n 's/^am__quote = //p' < "$mf"`
+    # Find all dependency output files, they are included files with
+    # $(DEPDIR) in their names.  We invoke sed twice because it is the
+    # simplest approach to changing $(DEPDIR) to its actual value in the
+    # expansion.
+    for file in `sed -n "
+      s/^$am__include $am__quote\(.*(DEPDIR).*\)$am__quote"'$/\1/p' <"$mf" | \
+	 sed -e 's/\$(DEPDIR)/'"$DEPDIR"'/g'`; do
+      # Make sure the directory exists.
+      test -f "$dirpart/$file" && continue
+      fdir=`AS_DIRNAME(["$file"])`
+      AS_MKDIR_P([$dirpart/$fdir])
+      # echo "creating $dirpart/$file"
+      echo '# dummy' > "$dirpart/$file"
+    done
+  done
+}
+])# _AM_OUTPUT_DEPENDENCY_COMMANDS
+
+
+# AM_OUTPUT_DEPENDENCY_COMMANDS
+# -----------------------------
+# This macro should only be invoked once -- use via AC_REQUIRE.
+#
+# This code is only required when automatic dependency tracking
+# is enabled.  FIXME.  This creates each '.P' file that we will
+# need in order to bootstrap the dependency handling code.
+AC_DEFUN([AM_OUTPUT_DEPENDENCY_COMMANDS],
+[AC_CONFIG_COMMANDS([depfiles],
+     [test x"$AMDEP_TRUE" != x"" || _AM_OUTPUT_DEPENDENCY_COMMANDS],
+     [AMDEP_TRUE="$AMDEP_TRUE" ac_aux_dir="$ac_aux_dir"])
+])
+
+# Do all the work for Automake.                             -*- Autoconf -*-
+
+# Copyright (C) 1996-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This macro actually does too much.  Some checks are only needed if
+# your package does certain things.  But this isn't really a big deal.
+
+dnl Redefine AC_PROG_CC to automatically invoke _AM_PROG_CC_C_O.
+m4_define([AC_PROG_CC],
+m4_defn([AC_PROG_CC])
+[_AM_PROG_CC_C_O
+])
+
+# AM_INIT_AUTOMAKE(PACKAGE, VERSION, [NO-DEFINE])
+# AM_INIT_AUTOMAKE([OPTIONS])
+# -----------------------------------------------
+# The call with PACKAGE and VERSION arguments is the old style
+# call (pre autoconf-2.50), which is being phased out.  PACKAGE
+# and VERSION should now be passed to AC_INIT and removed from
+# the call to AM_INIT_AUTOMAKE.
+# We support both call styles for the transition.  After
+# the next Automake release, Autoconf can make the AC_INIT
+# arguments mandatory, and then we can depend on a new Autoconf
+# release and drop the old call support.
+AC_DEFUN([AM_INIT_AUTOMAKE],
+[AC_PREREQ([2.65])dnl
+dnl Autoconf wants to disallow AM_ names.  We explicitly allow
+dnl the ones we care about.
+m4_pattern_allow([^AM_[A-Z]+FLAGS$])dnl
+AC_REQUIRE([AM_SET_CURRENT_AUTOMAKE_VERSION])dnl
+AC_REQUIRE([AC_PROG_INSTALL])dnl
+if test "`cd $srcdir && pwd`" != "`pwd`"; then
+  # Use -I$(srcdir) only when $(srcdir) != ., so that make's output
+  # is not polluted with repeated "-I."
+  AC_SUBST([am__isrc], [' -I$(srcdir)'])_AM_SUBST_NOTMAKE([am__isrc])dnl
+  # test to see if srcdir already configured
+  if test -f $srcdir/config.status; then
+    AC_MSG_ERROR([source directory already configured; run "make distclean" there first])
+  fi
+fi
+
+# test whether we have cygpath
+if test -z "$CYGPATH_W"; then
+  if (cygpath --version) >/dev/null 2>/dev/null; then
+    CYGPATH_W='cygpath -w'
+  else
+    CYGPATH_W=echo
+  fi
+fi
+AC_SUBST([CYGPATH_W])
+
+# Define the identity of the package.
+dnl Distinguish between old-style and new-style calls.
+m4_ifval([$2],
+[AC_DIAGNOSE([obsolete],
+             [$0: two- and three-arguments forms are deprecated.])
+m4_ifval([$3], [_AM_SET_OPTION([no-define])])dnl
+ AC_SUBST([PACKAGE], [$1])dnl
+ AC_SUBST([VERSION], [$2])],
+[_AM_SET_OPTIONS([$1])dnl
+dnl Diagnose old-style AC_INIT with new-style AM_AUTOMAKE_INIT.
+m4_if(
+  m4_ifdef([AC_PACKAGE_NAME], [ok]):m4_ifdef([AC_PACKAGE_VERSION], [ok]),
+  [ok:ok],,
+  [m4_fatal([AC_INIT should be called with package and version arguments])])dnl
+ AC_SUBST([PACKAGE], ['AC_PACKAGE_TARNAME'])dnl
+ AC_SUBST([VERSION], ['AC_PACKAGE_VERSION'])])dnl
+
+_AM_IF_OPTION([no-define],,
+[AC_DEFINE_UNQUOTED([PACKAGE], ["$PACKAGE"], [Name of package])
+ AC_DEFINE_UNQUOTED([VERSION], ["$VERSION"], [Version number of package])])dnl
+
+# Some tools Automake needs.
+AC_REQUIRE([AM_SANITY_CHECK])dnl
+AC_REQUIRE([AC_ARG_PROGRAM])dnl
+AM_MISSING_PROG([ACLOCAL], [aclocal-${am__api_version}])
+AM_MISSING_PROG([AUTOCONF], [autoconf])
+AM_MISSING_PROG([AUTOMAKE], [automake-${am__api_version}])
+AM_MISSING_PROG([AUTOHEADER], [autoheader])
+AM_MISSING_PROG([MAKEINFO], [makeinfo])
+AC_REQUIRE([AM_PROG_INSTALL_SH])dnl
+AC_REQUIRE([AM_PROG_INSTALL_STRIP])dnl
+AC_REQUIRE([AC_PROG_MKDIR_P])dnl
+# For better backward compatibility.  To be removed once Automake 1.9.x
+# dies out for good.  For more background, see:
+# <http://lists.gnu.org/archive/html/automake/2012-07/msg00001.html>
+# <http://lists.gnu.org/archive/html/automake/2012-07/msg00014.html>
+AC_SUBST([mkdir_p], ['$(MKDIR_P)'])
+# We need awk for the "check" target.  The system "awk" is bad on
+# some platforms.
+AC_REQUIRE([AC_PROG_AWK])dnl
+AC_REQUIRE([AC_PROG_MAKE_SET])dnl
+AC_REQUIRE([AM_SET_LEADING_DOT])dnl
+_AM_IF_OPTION([tar-ustar], [_AM_PROG_TAR([ustar])],
+	      [_AM_IF_OPTION([tar-pax], [_AM_PROG_TAR([pax])],
+			     [_AM_PROG_TAR([v7])])])
+_AM_IF_OPTION([no-dependencies],,
+[AC_PROVIDE_IFELSE([AC_PROG_CC],
+		  [_AM_DEPENDENCIES([CC])],
+		  [m4_define([AC_PROG_CC],
+			     m4_defn([AC_PROG_CC])[_AM_DEPENDENCIES([CC])])])dnl
+AC_PROVIDE_IFELSE([AC_PROG_CXX],
+		  [_AM_DEPENDENCIES([CXX])],
+		  [m4_define([AC_PROG_CXX],
+			     m4_defn([AC_PROG_CXX])[_AM_DEPENDENCIES([CXX])])])dnl
+AC_PROVIDE_IFELSE([AC_PROG_OBJC],
+		  [_AM_DEPENDENCIES([OBJC])],
+		  [m4_define([AC_PROG_OBJC],
+			     m4_defn([AC_PROG_OBJC])[_AM_DEPENDENCIES([OBJC])])])dnl
+AC_PROVIDE_IFELSE([AC_PROG_OBJCXX],
+		  [_AM_DEPENDENCIES([OBJCXX])],
+		  [m4_define([AC_PROG_OBJCXX],
+			     m4_defn([AC_PROG_OBJCXX])[_AM_DEPENDENCIES([OBJCXX])])])dnl
+])
+AC_REQUIRE([AM_SILENT_RULES])dnl
+dnl The testsuite driver may need to know about EXEEXT, so add the
+dnl 'am__EXEEXT' conditional if _AM_COMPILER_EXEEXT was seen.  This
+dnl macro is hooked onto _AC_COMPILER_EXEEXT early, see below.
+AC_CONFIG_COMMANDS_PRE(dnl
+[m4_provide_if([_AM_COMPILER_EXEEXT],
+  [AM_CONDITIONAL([am__EXEEXT], [test -n "$EXEEXT"])])])dnl
+
+# POSIX will say in a future version that running "rm -f" with no argument
+# is OK; and we want to be able to make that assumption in our Makefile
+# recipes.  So use an aggressive probe to check that the usage we want is
+# actually supported "in the wild" to an acceptable degree.
+# See automake bug#10828.
+# To make any issue more visible, cause the running configure to be aborted
+# by default if the 'rm' program in use doesn't match our expectations; the
+# user can still override this though.
+if rm -f && rm -fr && rm -rf; then : OK; else
+  cat >&2 <<'END'
+Oops!
+
+Your 'rm' program seems unable to run without file operands specified
+on the command line, even when the '-f' option is present.  This is contrary
+to the behaviour of most rm programs out there, and not conforming with
+the upcoming POSIX standard: <http://austingroupbugs.net/view.php?id=542>
+
+Please tell bug-automake at gnu.org about your system, including the value
+of your $PATH and any error possibly output before this message.  This
+can help us improve future automake versions.
+
+END
+  if test x"$ACCEPT_INFERIOR_RM_PROGRAM" = x"yes"; then
+    echo 'Configuration will proceed anyway, since you have set the' >&2
+    echo 'ACCEPT_INFERIOR_RM_PROGRAM variable to "yes"' >&2
+    echo >&2
+  else
+    cat >&2 <<'END'
+Aborting the configuration process, to ensure you take notice of the issue.
+
+You can download and install GNU coreutils to get an 'rm' implementation
+that behaves properly: <http://www.gnu.org/software/coreutils/>.
+
+If you want to complete the configuration process using your problematic
+'rm' anyway, export the environment variable ACCEPT_INFERIOR_RM_PROGRAM
+to "yes", and re-run configure.
+
+END
+    AC_MSG_ERROR([Your 'rm' program is bad, sorry.])
+  fi
+fi])
+
+dnl Hook into '_AC_COMPILER_EXEEXT' early to learn its expansion.  Do not
+dnl add the conditional right here, as _AC_COMPILER_EXEEXT may be further
+dnl mangled by Autoconf and run in a shell conditional statement.
+m4_define([_AC_COMPILER_EXEEXT],
+m4_defn([_AC_COMPILER_EXEEXT])[m4_provide([_AM_COMPILER_EXEEXT])])
+
+# When config.status generates a header, we must update the stamp-h file.
+# This file resides in the same directory as the config header
+# that is generated.  The stamp files are numbered to have different names.
+
+# Autoconf calls _AC_AM_CONFIG_HEADER_HOOK (when defined) in the
+# loop where config.status creates the headers, so we can generate
+# our stamp files there.
+AC_DEFUN([_AC_AM_CONFIG_HEADER_HOOK],
+[# Compute $1's index in $config_headers.
+_am_arg=$1
+_am_stamp_count=1
+for _am_header in $config_headers :; do
+  case $_am_header in
+    $_am_arg | $_am_arg:* )
+      break ;;
+    * )
+      _am_stamp_count=`expr $_am_stamp_count + 1` ;;
+  esac
+done
+echo "timestamp for $_am_arg" >`AS_DIRNAME(["$_am_arg"])`/stamp-h[]$_am_stamp_count])
+
+# Copyright (C) 2001-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_PROG_INSTALL_SH
+# ------------------
+# Define $install_sh.
+AC_DEFUN([AM_PROG_INSTALL_SH],
+[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl
+if test x"${install_sh}" != xset; then
+  case $am_aux_dir in
+  *\ * | *\	*)
+    install_sh="\${SHELL} '$am_aux_dir/install-sh'" ;;
+  *)
+    install_sh="\${SHELL} $am_aux_dir/install-sh"
+  esac
+fi
+AC_SUBST([install_sh])])
+
+# Copyright (C) 2003-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# Check whether the underlying file-system supports filenames
+# with a leading dot.  For instance MS-DOS doesn't.
+AC_DEFUN([AM_SET_LEADING_DOT],
+[rm -rf .tst 2>/dev/null
+mkdir .tst 2>/dev/null
+if test -d .tst; then
+  am__leading_dot=.
+else
+  am__leading_dot=_
+fi
+rmdir .tst 2>/dev/null
+AC_SUBST([am__leading_dot])])
+
+# Check to see how 'make' treats includes.	            -*- Autoconf -*-
+
+# Copyright (C) 2001-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_MAKE_INCLUDE()
+# -----------------
+# Check to see how make treats includes.
+AC_DEFUN([AM_MAKE_INCLUDE],
+[am_make=${MAKE-make}
+cat > confinc << 'END'
+am__doit:
+	@echo this is the am__doit target
+.PHONY: am__doit
+END
+# If we don't find an include directive, just comment out the code.
+AC_MSG_CHECKING([for style of include used by $am_make])
+am__include="#"
+am__quote=
+_am_result=none
+# First try GNU make style include.
+echo "include confinc" > confmf
+# Ignore all kinds of additional output from 'make'.
+case `$am_make -s -f confmf 2> /dev/null` in #(
+*the\ am__doit\ target*)
+  am__include=include
+  am__quote=
+  _am_result=GNU
+  ;;
+esac
+# Now try BSD make style include.
+if test "$am__include" = "#"; then
+   echo '.include "confinc"' > confmf
+   case `$am_make -s -f confmf 2> /dev/null` in #(
+   *the\ am__doit\ target*)
+     am__include=.include
+     am__quote="\""
+     _am_result=BSD
+     ;;
+   esac
+fi
+AC_SUBST([am__include])
+AC_SUBST([am__quote])
+AC_MSG_RESULT([$_am_result])
+rm -f confinc confmf
+])
+
+# Fake the existence of programs that GNU maintainers use.  -*- Autoconf -*-
+
+# Copyright (C) 1997-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_MISSING_PROG(NAME, PROGRAM)
+# ------------------------------
+AC_DEFUN([AM_MISSING_PROG],
+[AC_REQUIRE([AM_MISSING_HAS_RUN])
+$1=${$1-"${am_missing_run}$2"}
+AC_SUBST($1)])
+
+# AM_MISSING_HAS_RUN
+# ------------------
+# Define MISSING if not defined so far and test if it is modern enough.
+# If it is, set am_missing_run to use it, otherwise, to nothing.
+AC_DEFUN([AM_MISSING_HAS_RUN],
+[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl
+AC_REQUIRE_AUX_FILE([missing])dnl
+if test x"${MISSING+set}" != xset; then
+  case $am_aux_dir in
+  *\ * | *\	*)
+    MISSING="\${SHELL} \"$am_aux_dir/missing\"" ;;
+  *)
+    MISSING="\${SHELL} $am_aux_dir/missing" ;;
+  esac
+fi
+# Use eval to expand $SHELL
+if eval "$MISSING --is-lightweight"; then
+  am_missing_run="$MISSING "
+else
+  am_missing_run=
+  AC_MSG_WARN(['missing' script is too old or missing])
+fi
+])
+
+# Helper functions for option handling.                     -*- Autoconf -*-
+
+# Copyright (C) 2001-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# _AM_MANGLE_OPTION(NAME)
+# -----------------------
+AC_DEFUN([_AM_MANGLE_OPTION],
+[[_AM_OPTION_]m4_bpatsubst($1, [[^a-zA-Z0-9_]], [_])])
+
+# _AM_SET_OPTION(NAME)
+# --------------------
+# Set option NAME.  Presently that only means defining a flag for this option.
+AC_DEFUN([_AM_SET_OPTION],
+[m4_define(_AM_MANGLE_OPTION([$1]), [1])])
+
+# _AM_SET_OPTIONS(OPTIONS)
+# ------------------------
+# OPTIONS is a space-separated list of Automake options.
+AC_DEFUN([_AM_SET_OPTIONS],
+[m4_foreach_w([_AM_Option], [$1], [_AM_SET_OPTION(_AM_Option)])])
+
+# _AM_IF_OPTION(OPTION, IF-SET, [IF-NOT-SET])
+# -------------------------------------------
+# Execute IF-SET if OPTION is set, IF-NOT-SET otherwise.
+AC_DEFUN([_AM_IF_OPTION],
+[m4_ifset(_AM_MANGLE_OPTION([$1]), [$2], [$3])])
+
+# Copyright (C) 1999-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# _AM_PROG_CC_C_O
+# ---------------
+# Like AC_PROG_CC_C_O, but changed for automake.  We rewrite AC_PROG_CC
+# to automatically call this.
+AC_DEFUN([_AM_PROG_CC_C_O],
+[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl
+AC_REQUIRE_AUX_FILE([compile])dnl
+AC_LANG_PUSH([C])dnl
+AC_CACHE_CHECK(
+  [whether $CC understands -c and -o together],
+  [am_cv_prog_cc_c_o],
+  [AC_LANG_CONFTEST([AC_LANG_PROGRAM([])])
+  # Make sure it works both with $CC and with simple cc.
+  # Following AC_PROG_CC_C_O, we do the test twice because some
+  # compilers refuse to overwrite an existing .o file with -o,
+  # though they will create one.
+  am_cv_prog_cc_c_o=yes
+  for am_i in 1 2; do
+    if AM_RUN_LOG([$CC -c conftest.$ac_ext -o conftest2.$ac_objext]) \
+         && test -f conftest2.$ac_objext; then
+      : OK
+    else
+      am_cv_prog_cc_c_o=no
+      break
+    fi
+  done
+  rm -f core conftest*
+  unset am_i])
+if test "$am_cv_prog_cc_c_o" != yes; then
+   # Losing compiler, so override with the script.
+   # FIXME: It is wrong to rewrite CC.
+   # But if we don't then we get into trouble of one sort or another.
+   # A longer-term fix would be to have automake use am__CC in this case,
+   # and then we could set am__CC="\$(top_srcdir)/compile \$(CC)"
+   CC="$am_aux_dir/compile $CC"
+fi
+AC_LANG_POP([C])])
+
+# For backward compatibility.
+AC_DEFUN_ONCE([AM_PROG_CC_C_O], [AC_REQUIRE([AC_PROG_CC])])
+
+# Copyright (C) 2001-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_RUN_LOG(COMMAND)
+# -------------------
+# Run COMMAND, save the exit status in ac_status, and log it.
+# (This has been adapted from Autoconf's _AC_RUN_LOG macro.)
+AC_DEFUN([AM_RUN_LOG],
+[{ echo "$as_me:$LINENO: $1" >&AS_MESSAGE_LOG_FD
+   ($1) >&AS_MESSAGE_LOG_FD 2>&AS_MESSAGE_LOG_FD
+   ac_status=$?
+   echo "$as_me:$LINENO: \$? = $ac_status" >&AS_MESSAGE_LOG_FD
+   (exit $ac_status); }])
+
+# Check to make sure that the build environment is sane.    -*- Autoconf -*-
+
+# Copyright (C) 1996-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_SANITY_CHECK
+# ---------------
+AC_DEFUN([AM_SANITY_CHECK],
+[AC_MSG_CHECKING([whether build environment is sane])
+# Reject unsafe characters in $srcdir or the absolute working directory
+# name.  Accept space and tab only in the latter.
+am_lf='
+'
+case `pwd` in
+  *[[\\\"\#\$\&\'\`$am_lf]]*)
+    AC_MSG_ERROR([unsafe absolute working directory name]);;
+esac
+case $srcdir in
+  *[[\\\"\#\$\&\'\`$am_lf\ \	]]*)
+    AC_MSG_ERROR([unsafe srcdir value: '$srcdir']);;
+esac
+
+# Do 'set' in a subshell so we don't clobber the current shell's
+# arguments.  Must try -L first in case configure is actually a
+# symlink; some systems play weird games with the mod time of symlinks
+# (eg FreeBSD returns the mod time of the symlink's containing
+# directory).
+if (
+   am_has_slept=no
+   for am_try in 1 2; do
+     echo "timestamp, slept: $am_has_slept" > conftest.file
+     set X `ls -Lt "$srcdir/configure" conftest.file 2> /dev/null`
+     if test "$[*]" = "X"; then
+	# -L didn't work.
+	set X `ls -t "$srcdir/configure" conftest.file`
+     fi
+     if test "$[*]" != "X $srcdir/configure conftest.file" \
+	&& test "$[*]" != "X conftest.file $srcdir/configure"; then
+
+	# If neither matched, then we have a broken ls.  This can happen
+	# if, for instance, CONFIG_SHELL is bash and it inherits a
+	# broken ls alias from the environment.  This has actually
+	# happened.  Such a system could not be considered "sane".
+	AC_MSG_ERROR([ls -t appears to fail.  Make sure there is not a broken
+  alias in your environment])
+     fi
+     if test "$[2]" = conftest.file || test $am_try -eq 2; then
+       break
+     fi
+     # Just in case.
+     sleep 1
+     am_has_slept=yes
+   done
+   test "$[2]" = conftest.file
+   )
+then
+   # Ok.
+   :
+else
+   AC_MSG_ERROR([newly created file is older than distributed files!
+Check your system clock])
+fi
+AC_MSG_RESULT([yes])
+# If we didn't sleep, we still need to ensure time stamps of config.status and
+# generated files are strictly newer.
+am_sleep_pid=
+if grep 'slept: no' conftest.file >/dev/null 2>&1; then
+  ( sleep 1 ) &
+  am_sleep_pid=$!
+fi
+AC_CONFIG_COMMANDS_PRE(
+  [AC_MSG_CHECKING([that generated files are newer than configure])
+   if test -n "$am_sleep_pid"; then
+     # Hide warnings about reused PIDs.
+     wait $am_sleep_pid 2>/dev/null
+   fi
+   AC_MSG_RESULT([done])])
+rm -f conftest.file
+])
+
+# Copyright (C) 2009-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_SILENT_RULES([DEFAULT])
+# --------------------------
+# Enable less verbose build rules; with the default set to DEFAULT
+# ("yes" being less verbose, "no" or empty being verbose).
+AC_DEFUN([AM_SILENT_RULES],
+[AC_ARG_ENABLE([silent-rules], [dnl
+AS_HELP_STRING(
+  [--enable-silent-rules],
+  [less verbose build output (undo: "make V=1")])
+AS_HELP_STRING(
+  [--disable-silent-rules],
+  [verbose build output (undo: "make V=0")])dnl
+])
+case $enable_silent_rules in @%:@ (((
+  yes) AM_DEFAULT_VERBOSITY=0;;
+   no) AM_DEFAULT_VERBOSITY=1;;
+    *) AM_DEFAULT_VERBOSITY=m4_if([$1], [yes], [0], [1]);;
+esac
+dnl
+dnl A few 'make' implementations (e.g., NonStop OS and NextStep)
+dnl do not support nested variable expansions.
+dnl See automake bug#9928 and bug#10237.
+am_make=${MAKE-make}
+AC_CACHE_CHECK([whether $am_make supports nested variables],
+   [am_cv_make_support_nested_variables],
+   [if AS_ECHO([['TRUE=$(BAR$(V))
+BAR0=false
+BAR1=true
+V=1
+am__doit:
+	@$(TRUE)
+.PHONY: am__doit']]) | $am_make -f - >/dev/null 2>&1; then
+  am_cv_make_support_nested_variables=yes
+else
+  am_cv_make_support_nested_variables=no
+fi])
+if test $am_cv_make_support_nested_variables = yes; then
+  dnl Using '$V' instead of '$(V)' breaks IRIX make.
+  AM_V='$(V)'
+  AM_DEFAULT_V='$(AM_DEFAULT_VERBOSITY)'
+else
+  AM_V=$AM_DEFAULT_VERBOSITY
+  AM_DEFAULT_V=$AM_DEFAULT_VERBOSITY
+fi
+AC_SUBST([AM_V])dnl
+AM_SUBST_NOTMAKE([AM_V])dnl
+AC_SUBST([AM_DEFAULT_V])dnl
+AM_SUBST_NOTMAKE([AM_DEFAULT_V])dnl
+AC_SUBST([AM_DEFAULT_VERBOSITY])dnl
+AM_BACKSLASH='\'
+AC_SUBST([AM_BACKSLASH])dnl
+_AM_SUBST_NOTMAKE([AM_BACKSLASH])dnl
+])
+
+# Copyright (C) 2001-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_PROG_INSTALL_STRIP
+# ---------------------
+# One issue with vendor 'install' (even GNU) is that you can't
+# specify the program used to strip binaries.  This is especially
+# annoying in cross-compiling environments, where the build's strip
+# is unlikely to handle the host's binaries.
+# Fortunately install-sh will honor a STRIPPROG variable, so we
+# always use install-sh in "make install-strip", and initialize
+# STRIPPROG with the value of the STRIP variable (set by the user).
+AC_DEFUN([AM_PROG_INSTALL_STRIP],
+[AC_REQUIRE([AM_PROG_INSTALL_SH])dnl
+# Installed binaries are usually stripped using 'strip' when the user
+# run "make install-strip".  However 'strip' might not be the right
+# tool to use in cross-compilation environments, therefore Automake
+# will honor the 'STRIP' environment variable to overrule this program.
+dnl Don't test for $cross_compiling = yes, because it might be 'maybe'.
+if test "$cross_compiling" != no; then
+  AC_CHECK_TOOL([STRIP], [strip], :)
+fi
+INSTALL_STRIP_PROGRAM="\$(install_sh) -c -s"
+AC_SUBST([INSTALL_STRIP_PROGRAM])])
+
+# Copyright (C) 2006-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# _AM_SUBST_NOTMAKE(VARIABLE)
+# ---------------------------
+# Prevent Automake from outputting VARIABLE = @VARIABLE@ in Makefile.in.
+# This macro is traced by Automake.
+AC_DEFUN([_AM_SUBST_NOTMAKE])
+
+# AM_SUBST_NOTMAKE(VARIABLE)
+# --------------------------
+# Public sister of _AM_SUBST_NOTMAKE.
+AC_DEFUN([AM_SUBST_NOTMAKE], [_AM_SUBST_NOTMAKE($@)])
+
+# Check how to create a tarball.                            -*- Autoconf -*-
+
+# Copyright (C) 2004-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# _AM_PROG_TAR(FORMAT)
+# --------------------
+# Check how to create a tarball in format FORMAT.
+# FORMAT should be one of 'v7', 'ustar', or 'pax'.
+#
+# Substitute a variable $(am__tar) that is a command
+# writing to stdout a FORMAT-tarball containing the directory
+# $tardir.
+#     tardir=directory && $(am__tar) > result.tar
+#
+# Substitute a variable $(am__untar) that extract such
+# a tarball read from stdin.
+#     $(am__untar) < result.tar
+#
+AC_DEFUN([_AM_PROG_TAR],
+[# Always define AMTAR for backward compatibility.  Yes, it's still used
+# in the wild :-(  We should find a proper way to deprecate it ...
+AC_SUBST([AMTAR], ['$${TAR-tar}'])
+
+# We'll loop over all known methods to create a tar archive until one works.
+_am_tools='gnutar m4_if([$1], [ustar], [plaintar]) pax cpio none'
+
+m4_if([$1], [v7],
+  [am__tar='$${TAR-tar} chof - "$$tardir"' am__untar='$${TAR-tar} xf -'],
+
+  [m4_case([$1],
+    [ustar],
+     [# The POSIX 1988 'ustar' format is defined with fixed-size fields.
+      # There is notably a 21 bits limit for the UID and the GID.  In fact,
+      # the 'pax' utility can hang on bigger UID/GID (see automake bug#8343
+      # and bug#13588).
+      am_max_uid=2097151 # 2^21 - 1
+      am_max_gid=$am_max_uid
+      # The $UID and $GID variables are not portable, so we need to resort
+      # to the POSIX-mandated id(1) utility.  Errors in the 'id' calls
+      # below are definitely unexpected, so allow the users to see them
+      # (that is, avoid stderr redirection).
+      am_uid=`id -u || echo unknown`
+      am_gid=`id -g || echo unknown`
+      AC_MSG_CHECKING([whether UID '$am_uid' is supported by ustar format])
+      if test $am_uid -le $am_max_uid; then
+         AC_MSG_RESULT([yes])
+      else
+         AC_MSG_RESULT([no])
+         _am_tools=none
+      fi
+      AC_MSG_CHECKING([whether GID '$am_gid' is supported by ustar format])
+      if test $am_gid -le $am_max_gid; then
+         AC_MSG_RESULT([yes])
+      else
+        AC_MSG_RESULT([no])
+        _am_tools=none
+      fi],
+
+  [pax],
+    [],
+
+  [m4_fatal([Unknown tar format])])
+
+  AC_MSG_CHECKING([how to create a $1 tar archive])
+
+  # Go ahead even if we have the value already cached.  We do so because we
+  # need to set the values for the 'am__tar' and 'am__untar' variables.
+  _am_tools=${am_cv_prog_tar_$1-$_am_tools}
+
+  for _am_tool in $_am_tools; do
+    case $_am_tool in
+    gnutar)
+      for _am_tar in tar gnutar gtar; do
+        AM_RUN_LOG([$_am_tar --version]) && break
+      done
+      am__tar="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$$tardir"'
+      am__tar_="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$tardir"'
+      am__untar="$_am_tar -xf -"
+      ;;
+    plaintar)
+      # Must skip GNU tar: if it does not support --format= it doesn't create
+      # ustar tarball either.
+      (tar --version) >/dev/null 2>&1 && continue
+      am__tar='tar chf - "$$tardir"'
+      am__tar_='tar chf - "$tardir"'
+      am__untar='tar xf -'
+      ;;
+    pax)
+      am__tar='pax -L -x $1 -w "$$tardir"'
+      am__tar_='pax -L -x $1 -w "$tardir"'
+      am__untar='pax -r'
+      ;;
+    cpio)
+      am__tar='find "$$tardir" -print | cpio -o -H $1 -L'
+      am__tar_='find "$tardir" -print | cpio -o -H $1 -L'
+      am__untar='cpio -i -H $1 -d'
+      ;;
+    none)
+      am__tar=false
+      am__tar_=false
+      am__untar=false
+      ;;
+    esac
+
+    # If the value was cached, stop now.  We just wanted to have am__tar
+    # and am__untar set.
+    test -n "${am_cv_prog_tar_$1}" && break
+
+    # tar/untar a dummy directory, and stop if the command works.
+    rm -rf conftest.dir
+    mkdir conftest.dir
+    echo GrepMe > conftest.dir/file
+    AM_RUN_LOG([tardir=conftest.dir && eval $am__tar_ >conftest.tar])
+    rm -rf conftest.dir
+    if test -s conftest.tar; then
+      AM_RUN_LOG([$am__untar <conftest.tar])
+      AM_RUN_LOG([cat conftest.dir/file])
+      grep GrepMe conftest.dir/file >/dev/null 2>&1 && break
+    fi
+  done
+  rm -rf conftest.dir
+
+  AC_CACHE_VAL([am_cv_prog_tar_$1], [am_cv_prog_tar_$1=$_am_tool])
+  AC_MSG_RESULT([$am_cv_prog_tar_$1])])
+
+AC_SUBST([am__tar])
+AC_SUBST([am__untar])
+]) # _AM_PROG_TAR
+

Added: vendor/jansson/dist/android/jansson_config.h
===================================================================
--- vendor/jansson/dist/android/jansson_config.h	                        (rev 0)
+++ vendor/jansson/dist/android/jansson_config.h	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,39 @@
+/*
+ * Copyright (c) 2010-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ *
+ *
+ * This file specifies a part of the site-specific configuration for
+ * Jansson, namely those things that affect the public API in
+ * jansson.h.
+ *
+ * The configure script copies this file to jansson_config.h and
+ * replaces @var@ substitutions by values that fit your system. If you
+ * cannot run the configure script, you can do the value substitution
+ * by hand.
+ */
+
+#ifndef JANSSON_CONFIG_H
+#define JANSSON_CONFIG_H
+
+/* If your compiler supports the inline keyword in C, JSON_INLINE is
+   defined to `inline', otherwise empty. In C++, the inline is always
+   supported. */
+#ifdef __cplusplus
+#define JSON_INLINE inline
+#else
+#define JSON_INLINE inline
+#endif
+
+/* If your compiler supports the `long long` type and the strtoll()
+   library function, JSON_INTEGER_IS_LONG_LONG is defined to 1,
+   otherwise to 0. */
+#define JSON_INTEGER_IS_LONG_LONG 1
+
+/* If locale.h and localeconv() are available, define to 1,
+   otherwise to 0. */
+#define JSON_HAVE_LOCALECONV 0
+
+#endif

Added: vendor/jansson/dist/cmake/CheckFunctionKeywords.cmake
===================================================================
--- vendor/jansson/dist/cmake/CheckFunctionKeywords.cmake	                        (rev 0)
+++ vendor/jansson/dist/cmake/CheckFunctionKeywords.cmake	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,15 @@
+include(CheckCSourceCompiles)
+
+macro(check_function_keywords _wordlist)
+  set(${_result} "")
+  foreach(flag ${_wordlist})
+    string(REGEX REPLACE "[-+/ ()]" "_" flagname "${flag}")
+    string(TOUPPER "${flagname}" flagname)
+    set(have_flag "HAVE_${flagname}")
+    check_c_source_compiles("${flag} void func(); void func() { } int main() { func(); return 0; }" ${have_flag})
+    if(${have_flag} AND NOT ${_result})
+      set(${_result} "${flag}")
+#      break()
+    endif(${have_flag} AND NOT ${_result})
+  endforeach(flag)
+endmacro(check_function_keywords)

Added: vendor/jansson/dist/cmake/FindSphinx.cmake
===================================================================
--- vendor/jansson/dist/cmake/FindSphinx.cmake	                        (rev 0)
+++ vendor/jansson/dist/cmake/FindSphinx.cmake	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,301 @@
+#
+# PART B. DOWNLOADING AGREEMENT - LICENSE FROM SBIA WITH RIGHT TO SUBLICENSE ("SOFTWARE LICENSE").
+#  ------------------------------------------------------------------------------------------------
+#
+#  1. As used in this Software License, "you" means the individual downloading and/or
+#     using, reproducing, modifying, displaying and/or distributing the Software and
+#     the institution or entity which employs or is otherwise affiliated with such
+#     individual in connection therewith. The Section of Biomedical Image Analysis,
+#     Department of Radiology at the Universiy of Pennsylvania ("SBIA") hereby grants
+#     you, with right to sublicense, with respect to SBIA's rights in the software,
+#     and data, if any, which is the subject of this Software License (collectively,
+#     the "Software"), a royalty-free, non-exclusive license to use, reproduce, make
+#     derivative works of, display and distribute the Software, provided that:
+#     (a) you accept and adhere to all of the terms and conditions of this Software
+#     License; (b) in connection with any copy of or sublicense of all or any portion
+#     of the Software, all of the terms and conditions in this Software License shall
+#     appear in and shall apply to such copy and such sublicense, including without
+#     limitation all source and executable forms and on any user documentation,
+#     prefaced with the following words: "All or portions of this licensed product
+#     (such portions are the "Software") have been obtained under license from the
+#     Section of Biomedical Image Analysis, Department of Radiology at the University
+#     of Pennsylvania and are subject to the following terms and conditions:"
+#     (c) you preserve and maintain all applicable attributions, copyright notices
+#     and licenses included in or applicable to the Software; (d) modified versions
+#     of the Software must be clearly identified and marked as such, and must not
+#     be misrepresented as being the original Software; and (e) you consider making,
+#     but are under no obligation to make, the source code of any of your modifications
+#     to the Software freely available to others on an open source basis.
+#
+#  2. The license granted in this Software License includes without limitation the
+#     right to (i) incorporate the Software into proprietary programs (subject to
+#     any restrictions applicable to such programs), (ii) add your own copyright
+#     statement to your modifications of the Software, and (iii) provide additional
+#     or different license terms and conditions in your sublicenses of modifications
+#     of the Software; provided that in each case your use, reproduction or
+#     distribution of such modifications otherwise complies with the conditions
+#     stated in this Software License.
+#
+#  3. This Software License does not grant any rights with respect to third party
+#     software, except those rights that SBIA has been authorized by a third
+#     party to grant to you, and accordingly you are solely responsible for
+#     (i) obtaining any permissions from third parties that you need to use,
+#     reproduce, make derivative works of, display and distribute the Software,
+#     and (ii) informing your sublicensees, including without limitation your
+#     end-users, of their obligations to secure any such required permissions.
+#
+#  4. The Software has been designed for research purposes only and has not been
+#     reviewed or approved by the Food and Drug Administration or by any other
+#     agency. YOU ACKNOWLEDGE AND AGREE THAT CLINICAL APPLICATIONS ARE NEITHER
+#     RECOMMENDED NOR ADVISED. Any commercialization of the Software is at the
+#     sole risk of the party or parties engaged in such commercialization.
+#     You further agree to use, reproduce, make derivative works of, display
+#     and distribute the Software in compliance with all applicable governmental
+#     laws, regulations and orders, including without limitation those relating
+#     to export and import control.
+#
+#  5. The Software is provided "AS IS" and neither SBIA nor any contributor to
+#     the software (each a "Contributor") shall have any obligation to provide
+#     maintenance, support, updates, enhancements or modifications thereto.
+#     SBIA AND ALL CONTRIBUTORS SPECIFICALLY DISCLAIM ALL EXPRESS AND IMPLIED
+#     WARRANTIES OF ANY KIND INCLUDING, BUT NOT LIMITED TO, ANY WARRANTIES OF
+#     MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT.
+#     IN NO EVENT SHALL SBIA OR ANY CONTRIBUTOR BE LIABLE TO ANY PARTY FOR
+#     DIRECT, INDIRECT, SPECIAL, INCIDENTAL, EXEMPLARY OR CONSEQUENTIAL DAMAGES
+#     HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY ARISING IN ANY WAY RELATED
+#     TO THE SOFTWARE, EVEN IF SBIA OR ANY CONTRIBUTOR HAS BEEN ADVISED OF THE
+#     POSSIBILITY OF SUCH DAMAGES. TO THE MAXIMUM EXTENT NOT PROHIBITED BY LAW OR
+#     REGULATION, YOU FURTHER ASSUME ALL LIABILITY FOR YOUR USE, REPRODUCTION,
+#     MAKING OF DERIVATIVE WORKS, DISPLAY, LICENSE OR DISTRIBUTION OF THE SOFTWARE
+#     AND AGREE TO INDEMNIFY AND HOLD HARMLESS SBIA AND ALL CONTRIBUTORS FROM
+#     AND AGAINST ANY AND ALL CLAIMS, SUITS, ACTIONS, DEMANDS AND JUDGMENTS ARISING
+#     THEREFROM.
+#
+#  6. None of the names, logos or trademarks of SBIA or any of SBIA's affiliates
+#     or any of the Contributors, or any funding agency, may be used to endorse
+#     or promote products produced in whole or in part by operation of the Software
+#     or derived from or based on the Software without specific prior written
+#     permission from the applicable party.
+#
+#  7. Any use, reproduction or distribution of the Software which is not in accordance
+#     with this Software License shall automatically revoke all rights granted to you
+#     under this Software License and render Paragraphs 1 and 2 of this Software
+#     License null and void.
+#
+#  8. This Software License does not grant any rights in or to any intellectual
+#     property owned by SBIA or any Contributor except those rights expressly
+#     granted hereunder.
+#
+#
+#  PART C. MISCELLANEOUS
+#  ---------------------
+#
+#  This Agreement shall be governed by and construed in accordance with the laws
+#  of The Commonwealth of Pennsylvania without regard to principles of conflicts
+#  of law. This Agreement shall supercede and replace any license terms that you
+#  may have agreed to previously with respect to Software from SBIA.
+#
+##############################################################################
+# @file  FindSphinx.cmake
+# @brief Find Sphinx documentation build tools.
+#
+# @par Input variables:
+# <table border="0">
+#   <tr>
+#     @tp @b Sphinx_DIR @endtp
+#     <td>Installation directory of Sphinx tools. Can also be set as environment variable.</td>
+#   </tr>
+#   <tr>
+#     @tp @b SPHINX_DIR @endtp
+#     <td>Alternative environment variable for @c Sphinx_DIR.</td>
+#   </tr>
+#   <tr>
+#     @tp @b Sphinx_FIND_COMPONENTS @endtp
+#     <td>Sphinx build tools to look for, i.e., 'apidoc' and/or 'build'.</td>
+#   </tr>
+# </table>
+#
+# @par Output variables:
+# <table border="0">
+#   <tr>
+#     @tp @b Sphinx_FOUND @endtp
+#     <td>Whether all or only the requested Sphinx build tools were found.</td>
+#   </tr>
+#   <tr>
+#     @tp @b SPHINX_FOUND @endtp
+#     <td>Alias for @c Sphinx_FOUND.<td>
+#   </tr>
+#   <tr>
+#     @tp @b SPHINX_EXECUTABLE @endtp
+#     <td>Non-cached alias for @c Sphinx-build_EXECUTABLE.</td>
+#   </tr>
+#   <tr>
+#     @tp @b Sphinx_PYTHON_EXECUTABLE @endtp
+#     <td>Python executable used to run sphinx-build. This is either the
+#         by default found Python interpreter or a specific version as
+#         specified by the shebang (#!) of the sphinx-build script.</td>
+#   </tr>
+#   <tr>
+#     @tp @b Sphinx_PYTHON_OPTIONS @endtp
+#     <td>A list of Python options extracted from the shebang (#!) of the
+#         sphinx-build script. The -E option is added by this module
+#         if the Python executable is not the system default to avoid
+#         problems with a differing setting of the @c PYTHONHOME.</td>
+#   </tr>
+#   <tr>
+#     @tp @b Sphinx-build_EXECUTABLE @endtp
+#     <td>Absolute path of the found sphinx-build tool.</td>
+#   </tr>
+#   <tr>
+#     @tp @b Sphinx-apidoc_EXECUTABLE @endtp
+#     <td>Absolute path of the found sphinx-apidoc tool.</td>
+#   </tr>
+#   <tr>
+#     @tp @b Sphinx_VERSION_STRING @endtp
+#     <td>Sphinx version found e.g. 1.1.2.</td>
+#   </tr>
+#   <tr>
+#     @tp @b Sphinx_VERSION_MAJOR @endtp
+#     <td>Sphinx major version found e.g. 1.</td>
+#   </tr>
+#   <tr>
+#     @tp @b Sphinx_VERSION_MINOR @endtp
+#     <td>Sphinx minor version found e.g. 1.</td>
+#   </tr>
+#   <tr>
+#     @tp @b Sphinx_VERSION_PATCH @endtp
+#     <td>Sphinx patch version found e.g. 2.</td>
+#   </tr>
+# </table>
+#
+# @ingroup CMakeFindModules
+##############################################################################
+
+set (_Sphinx_REQUIRED_VARS)
+
+# ----------------------------------------------------------------------------
+# initialize search
+if (NOT Sphinx_DIR)
+  if (NOT $ENV{Sphinx_DIR} STREQUAL "")
+    set (Sphinx_DIR "$ENV{Sphinx_DIR}" CACHE PATH "Installation prefix of Sphinx (docutils)." FORCE)
+  else ()
+    set (Sphinx_DIR "$ENV{SPHINX_DIR}" CACHE PATH "Installation prefix of Sphinx (docutils)." FORCE)
+  endif ()
+endif ()
+
+# ----------------------------------------------------------------------------
+# default components to look for
+if (NOT Sphinx_FIND_COMPONENTS)
+  set (Sphinx_FIND_COMPONENTS "build")
+elseif (NOT Sphinx_FIND_COMPONENTS MATCHES "^(build|apidoc)$")
+  message (FATAL_ERROR "Invalid Sphinx component in: ${Sphinx_FIND_COMPONENTS}")
+endif ()
+
+# ----------------------------------------------------------------------------
+# find components, i.e., build tools
+foreach (_Sphinx_TOOL IN LISTS Sphinx_FIND_COMPONENTS)
+  if (Sphinx_DIR)
+    find_program (
+      Sphinx-${_Sphinx_TOOL}_EXECUTABLE
+      NAMES         sphinx-${_Sphinx_TOOL} sphinx-${_Sphinx_TOOL}.py
+      HINTS         "${Sphinx_DIR}"
+      PATH_SUFFIXES bin
+      DOC           "The sphinx-${_Sphinx_TOOL} Python script."
+      NO_DEFAULT_PATH
+    )
+  else ()
+    find_program (
+      Sphinx-${_Sphinx_TOOL}_EXECUTABLE
+      NAMES sphinx-${_Sphinx_TOOL} sphinx-${_Sphinx_TOOL}.py
+      DOC   "The sphinx-${_Sphinx_TOOL} Python script."
+    )
+  endif ()
+  mark_as_advanced (Sphinx-${_Sphinx_TOOL}_EXECUTABLE)
+  list (APPEND _Sphinx_REQUIRED_VARS Sphinx-${_Sphinx_TOOL}_EXECUTABLE)
+endforeach ()
+
+# ----------------------------------------------------------------------------
+# determine Python executable used by Sphinx
+if (Sphinx-build_EXECUTABLE)
+  # extract python executable from shebang of sphinx-build
+  find_package (PythonInterp QUIET)
+  set (Sphinx_PYTHON_EXECUTABLE "${PYTHON_EXECUTABLE}")
+  set (Sphinx_PYTHON_OPTIONS)
+  file (STRINGS "${Sphinx-build_EXECUTABLE}" FIRST_LINE LIMIT_COUNT 1)
+  if (FIRST_LINE MATCHES "^#!(.*/python.*)") # does not match "#!/usr/bin/env python" !
+    string (REGEX REPLACE "^ +| +$" "" Sphinx_PYTHON_EXECUTABLE "${CMAKE_MATCH_1}")
+    if (Sphinx_PYTHON_EXECUTABLE MATCHES "([^ ]+) (.*)")
+      set (Sphinx_PYTHON_EXECUTABLE "${CMAKE_MATCH_1}")
+      string (REGEX REPLACE " +" ";" Sphinx_PYTHON_OPTIONS "${CMAKE_MATCH_2}")
+    endif ()
+  endif ()
+  # this is done to avoid problems with multiple Python versions being installed
+  # remember: CMake command if(STR EQUAL STR) is bad and may cause many troubles !
+  string (REGEX REPLACE "([.+*?^$])" "\\\\\\1" _Sphinx_PYTHON_EXECUTABLE_RE "${PYTHON_EXECUTABLE}")
+  list (FIND Sphinx_PYTHON_OPTIONS -E IDX)
+  if (IDX EQUAL -1 AND NOT Sphinx_PYTHON_EXECUTABLE MATCHES "^${_Sphinx_PYTHON_EXECUTABLE_RE}$")
+    list (INSERT Sphinx_PYTHON_OPTIONS 0 -E)
+  endif ()
+  unset (_Sphinx_PYTHON_EXECUTABLE_RE)
+endif ()
+
+# ----------------------------------------------------------------------------
+# determine Sphinx version
+if (Sphinx-build_EXECUTABLE)
+  # intentionally use invalid -h option here as the help that is shown then
+  # will include the Sphinx version information
+  if (Sphinx_PYTHON_EXECUTABLE)
+    execute_process (
+      COMMAND "${Sphinx_PYTHON_EXECUTABLE}" ${Sphinx_PYTHON_OPTIONS} "${Sphinx-build_EXECUTABLE}" -h
+      OUTPUT_VARIABLE _Sphinx_VERSION
+      ERROR_VARIABLE  _Sphinx_VERSION
+    )
+  elseif (UNIX)
+    execute_process (
+      COMMAND "${Sphinx-build_EXECUTABLE}" -h
+      OUTPUT_VARIABLE _Sphinx_VERSION
+      ERROR_VARIABLE  _Sphinx_VERSION
+    )
+  endif ()
+
+  # The sphinx version can also contain a "b" instead of the last dot.
+  # For example "Sphinx v1.2b1" so we cannot just split on "."
+  if (_Sphinx_VERSION MATCHES "Sphinx v([0-9]+\\.[0-9]+(\\.|b)[0-9]+)")
+    set (Sphinx_VERSION_STRING "${CMAKE_MATCH_1}")
+    string(REGEX REPLACE "([0-9]+)\\.[0-9]+(\\.|b)[0-9]+" "\\1" Sphinx_VERSION_MAJOR ${Sphinx_VERSION_STRING})
+    string(REGEX REPLACE "[0-9]+\\.([0-9]+)(\\.|b)[0-9]+" "\\1" Sphinx_VERSION_MINOR ${Sphinx_VERSION_STRING})
+    string(REGEX REPLACE "[0-9]+\\.[0-9]+(\\.|b)([0-9]+)" "\\1" Sphinx_VERSION_PATCH ${Sphinx_VERSION_STRING})
+
+    # v1.2.0 -> v1.2
+    if (Sphinx_VERSION_PATCH EQUAL 0)
+      string (REGEX REPLACE "\\.0$" "" Sphinx_VERSION_STRING "${Sphinx_VERSION_STRING}")
+    endif ()
+  endif()
+endif ()
+
+# ----------------------------------------------------------------------------
+# compatibility with FindPythonInterp.cmake and FindPerl.cmake
+set (SPHINX_EXECUTABLE "${Sphinx-build_EXECUTABLE}")
+
+# ----------------------------------------------------------------------------
+# handle the QUIETLY and REQUIRED arguments and set SPHINX_FOUND to TRUE if
+# all listed variables are TRUE
+include (FindPackageHandleStandardArgs)
+FIND_PACKAGE_HANDLE_STANDARD_ARGS (
+  Sphinx
+  REQUIRED_VARS
+    ${_Sphinx_REQUIRED_VARS}
+#  VERSION_VAR # This isn't available until CMake 2.8.8 so don't use it.
+    Sphinx_VERSION_STRING
+)
+
+# ----------------------------------------------------------------------------
+# set Sphinx_DIR
+if (NOT Sphinx_DIR AND Sphinx-build_EXECUTABLE)
+  get_filename_component (Sphinx_DIR "${Sphinx-build_EXECUTABLE}" PATH)
+  string (REGEX REPLACE "/bin/?" "" Sphinx_DIR "${Sphinx_DIR}")
+  set (Sphinx_DIR "${Sphinx_DIR}" CACHE PATH "Installation directory of Sphinx tools." FORCE)
+endif ()
+
+unset (_Sphinx_VERSION)
+unset (_Sphinx_REQUIRED_VARS)
\ No newline at end of file

Added: vendor/jansson/dist/cmake/JanssonConfig.cmake.in
===================================================================
--- vendor/jansson/dist/cmake/JanssonConfig.cmake.in	                        (rev 0)
+++ vendor/jansson/dist/cmake/JanssonConfig.cmake.in	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,17 @@
+# - Config file for the jansson package
+# It defines the following variables
+#  JANSSON_INCLUDE_DIRS - include directories for FooBar
+#  JANSSON_LIBRARIES    - libraries to link against
+
+# Get the path of the current file.
+get_filename_component(JANSSON_CMAKE_DIR "${CMAKE_CURRENT_LIST_FILE}" PATH)
+
+# Set the include directories.
+set(JANSSON_INCLUDE_DIRS "@JANSSON__INCLUDE_DIRS@")
+
+# Include the project Targets file, this contains definitions for IMPORTED targets.
+include(${JANSSON_CMAKE_DIR}/JanssonTargets.cmake)
+
+# IMPORTED targets from JanssonTargets.cmake
+set(JANSSON_LIBRARIES jansson)
+

Added: vendor/jansson/dist/cmake/JanssonConfigVersion.cmake.in
===================================================================
--- vendor/jansson/dist/cmake/JanssonConfigVersion.cmake.in	                        (rev 0)
+++ vendor/jansson/dist/cmake/JanssonConfigVersion.cmake.in	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,11 @@
+set(PACKAGE_VERSION "@JANSSON_DISPLAY_VERSION@")
+
+# Check whether the requested PACKAGE_FIND_VERSION is compatible
+if("${PACKAGE_VERSION}" VERSION_LESS "${PACKAGE_FIND_VERSION}")
+  set(PACKAGE_VERSION_COMPATIBLE FALSE)
+else()
+  set(PACKAGE_VERSION_COMPATIBLE TRUE)
+  if ("${PACKAGE_VERSION}" VERSION_EQUAL "${PACKAGE_FIND_VERSION}")
+    set(PACKAGE_VERSION_EXACT TRUE)
+  endif()
+endif()	

Added: vendor/jansson/dist/cmake/jansson_config.h.cmake
===================================================================
--- vendor/jansson/dist/cmake/jansson_config.h.cmake	                        (rev 0)
+++ vendor/jansson/dist/cmake/jansson_config.h.cmake	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,64 @@
+/*
+ * Copyright (c) 2010-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ *
+ *
+ * This file specifies a part of the site-specific configuration for
+ * Jansson, namely those things that affect the public API in
+ * jansson.h.
+ *
+ * The CMake system will generate the jansson_config.h file and
+ * copy it to the build and install directories.
+ */
+
+#ifndef JANSSON_CONFIG_H
+#define JANSSON_CONFIG_H
+
+/* Define this so that we can disable scattered automake configuration in source files */
+#ifndef JANSSON_USING_CMAKE
+#define JANSSON_USING_CMAKE
+#endif
+
+/* Note: when using cmake, JSON_INTEGER_IS_LONG_LONG is not defined nor used,
+ * as we will also check for __int64 etc types.
+ * (the definition was used in the automake system) */
+
+/* Bring in the cmake-detected defines */
+#cmakedefine HAVE_STDINT_H 1
+#cmakedefine HAVE_INTTYPES_H 1
+#cmakedefine HAVE_SYS_TYPES_H 1
+
+/* Include our standard type header for the integer typedef */
+
+#if defined(HAVE_STDINT_H)
+#  include <stdint.h>
+#elif defined(HAVE_INTTYPES_H)
+#  include <inttypes.h>
+#elif defined(HAVE_SYS_TYPES_H)
+#  include <sys/types.h>
+#endif
+
+
+/* If your compiler supports the inline keyword in C, JSON_INLINE is
+   defined to `inline', otherwise empty. In C++, the inline is always
+   supported. */
+#ifdef __cplusplus
+#define JSON_INLINE inline
+#else
+#define JSON_INLINE @JSON_INLINE@
+#endif
+
+
+#define json_int_t @JSON_INT_T@
+#define json_strtoint @JSON_STRTOINT@
+#define JSON_INTEGER_FORMAT @JSON_INTEGER_FORMAT@
+
+
+/* If locale.h and localeconv() are available, define to 1, otherwise to 0. */
+#define JSON_HAVE_LOCALECONV @JSON_HAVE_LOCALECONV@
+
+
+
+#endif

Added: vendor/jansson/dist/cmake/jansson_private_config.h.cmake
===================================================================
--- vendor/jansson/dist/cmake/jansson_private_config.h.cmake	                        (rev 0)
+++ vendor/jansson/dist/cmake/jansson_private_config.h.cmake	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,59 @@
+#cmakedefine HAVE_ENDIAN_H 1
+#cmakedefine HAVE_FCNTL_H 1
+#cmakedefine HAVE_SCHED_H 1
+#cmakedefine HAVE_UNISTD_H 1
+#cmakedefine HAVE_SYS_PARAM_H 1
+#cmakedefine HAVE_SYS_STAT_H 1
+#cmakedefine HAVE_SYS_TIME_H 1
+#cmakedefine HAVE_SYS_TYPES_H 1
+#cmakedefine HAVE_STDINT_H 1
+
+#cmakedefine HAVE_CLOSE 1
+#cmakedefine HAVE_GETPID 1
+#cmakedefine HAVE_GETTIMEOFDAY 1
+#cmakedefine HAVE_OPEN 1
+#cmakedefine HAVE_READ 1
+#cmakedefine HAVE_SCHED_YIELD 1
+
+#cmakedefine HAVE_SYNC_BUILTINS 1
+#cmakedefine HAVE_ATOMIC_BUILTINS 1
+
+#cmakedefine HAVE_LOCALE_H 1
+#cmakedefine HAVE_SETLOCALE 1
+
+#cmakedefine HAVE_INT32_T 1
+#ifndef HAVE_INT32_T
+#  define int32_t @JSON_INT32@
+#endif
+
+#cmakedefine HAVE_UINT32_T 1
+#ifndef HAVE_UINT32_T
+#  define uint32_t @JSON_UINT32@
+#endif
+
+#cmakedefine HAVE_UINT16_T 1
+#ifndef HAVE_UINT16_T
+#  define uint16_t @JSON_UINT16@
+#endif
+
+#cmakedefine HAVE_UINT8_T 1
+#ifndef HAVE_UINT8_T
+#  define uint8_t @JSON_UINT8@
+#endif
+
+#cmakedefine HAVE_SSIZE_T 1
+
+#ifndef HAVE_SSIZE_T
+#  define ssize_t @JSON_SSIZE@
+#endif
+
+#cmakedefine HAVE_SNPRINTF 1
+
+#ifndef HAVE_SNPRINTF
+#  define snprintf @JSON_SNPRINTF@
+#endif
+
+#cmakedefine HAVE_VSNPRINTF
+
+#cmakedefine USE_URANDOM 1
+#cmakedefine USE_WINDOWS_CRYPTOAPI 1

Added: vendor/jansson/dist/compile
===================================================================
--- vendor/jansson/dist/compile	                        (rev 0)
+++ vendor/jansson/dist/compile	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,347 @@
+#! /bin/sh
+# Wrapper for compilers which do not understand '-c -o'.
+
+scriptversion=2012-10-14.11; # UTC
+
+# Copyright (C) 1999-2013 Free Software Foundation, Inc.
+# Written by Tom Tromey <tromey at cygnus.com>.
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2, or (at your option)
+# any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# This file is maintained in Automake, please report
+# bugs to <bug-automake at gnu.org> or send patches to
+# <automake-patches at gnu.org>.
+
+nl='
+'
+
+# We need space, tab and new line, in precisely that order.  Quoting is
+# there to prevent tools from complaining about whitespace usage.
+IFS=" ""	$nl"
+
+file_conv=
+
+# func_file_conv build_file lazy
+# Convert a $build file to $host form and store it in $file
+# Currently only supports Windows hosts. If the determined conversion
+# type is listed in (the comma separated) LAZY, no conversion will
+# take place.
+func_file_conv ()
+{
+  file=$1
+  case $file in
+    / | /[!/]*) # absolute file, and not a UNC file
+      if test -z "$file_conv"; then
+	# lazily determine how to convert abs files
+	case `uname -s` in
+	  MINGW*)
+	    file_conv=mingw
+	    ;;
+	  CYGWIN*)
+	    file_conv=cygwin
+	    ;;
+	  *)
+	    file_conv=wine
+	    ;;
+	esac
+      fi
+      case $file_conv/,$2, in
+	*,$file_conv,*)
+	  ;;
+	mingw/*)
+	  file=`cmd //C echo "$file " | sed -e 's/"\(.*\) " *$/\1/'`
+	  ;;
+	cygwin/*)
+	  file=`cygpath -m "$file" || echo "$file"`
+	  ;;
+	wine/*)
+	  file=`winepath -w "$file" || echo "$file"`
+	  ;;
+      esac
+      ;;
+  esac
+}
+
+# func_cl_dashL linkdir
+# Make cl look for libraries in LINKDIR
+func_cl_dashL ()
+{
+  func_file_conv "$1"
+  if test -z "$lib_path"; then
+    lib_path=$file
+  else
+    lib_path="$lib_path;$file"
+  fi
+  linker_opts="$linker_opts -LIBPATH:$file"
+}
+
+# func_cl_dashl library
+# Do a library search-path lookup for cl
+func_cl_dashl ()
+{
+  lib=$1
+  found=no
+  save_IFS=$IFS
+  IFS=';'
+  for dir in $lib_path $LIB
+  do
+    IFS=$save_IFS
+    if $shared && test -f "$dir/$lib.dll.lib"; then
+      found=yes
+      lib=$dir/$lib.dll.lib
+      break
+    fi
+    if test -f "$dir/$lib.lib"; then
+      found=yes
+      lib=$dir/$lib.lib
+      break
+    fi
+    if test -f "$dir/lib$lib.a"; then
+      found=yes
+      lib=$dir/lib$lib.a
+      break
+    fi
+  done
+  IFS=$save_IFS
+
+  if test "$found" != yes; then
+    lib=$lib.lib
+  fi
+}
+
+# func_cl_wrapper cl arg...
+# Adjust compile command to suit cl
+func_cl_wrapper ()
+{
+  # Assume a capable shell
+  lib_path=
+  shared=:
+  linker_opts=
+  for arg
+  do
+    if test -n "$eat"; then
+      eat=
+    else
+      case $1 in
+	-o)
+	  # configure might choose to run compile as 'compile cc -o foo foo.c'.
+	  eat=1
+	  case $2 in
+	    *.o | *.[oO][bB][jJ])
+	      func_file_conv "$2"
+	      set x "$@" -Fo"$file"
+	      shift
+	      ;;
+	    *)
+	      func_file_conv "$2"
+	      set x "$@" -Fe"$file"
+	      shift
+	      ;;
+	  esac
+	  ;;
+	-I)
+	  eat=1
+	  func_file_conv "$2" mingw
+	  set x "$@" -I"$file"
+	  shift
+	  ;;
+	-I*)
+	  func_file_conv "${1#-I}" mingw
+	  set x "$@" -I"$file"
+	  shift
+	  ;;
+	-l)
+	  eat=1
+	  func_cl_dashl "$2"
+	  set x "$@" "$lib"
+	  shift
+	  ;;
+	-l*)
+	  func_cl_dashl "${1#-l}"
+	  set x "$@" "$lib"
+	  shift
+	  ;;
+	-L)
+	  eat=1
+	  func_cl_dashL "$2"
+	  ;;
+	-L*)
+	  func_cl_dashL "${1#-L}"
+	  ;;
+	-static)
+	  shared=false
+	  ;;
+	-Wl,*)
+	  arg=${1#-Wl,}
+	  save_ifs="$IFS"; IFS=','
+	  for flag in $arg; do
+	    IFS="$save_ifs"
+	    linker_opts="$linker_opts $flag"
+	  done
+	  IFS="$save_ifs"
+	  ;;
+	-Xlinker)
+	  eat=1
+	  linker_opts="$linker_opts $2"
+	  ;;
+	-*)
+	  set x "$@" "$1"
+	  shift
+	  ;;
+	*.cc | *.CC | *.cxx | *.CXX | *.[cC]++)
+	  func_file_conv "$1"
+	  set x "$@" -Tp"$file"
+	  shift
+	  ;;
+	*.c | *.cpp | *.CPP | *.lib | *.LIB | *.Lib | *.OBJ | *.obj | *.[oO])
+	  func_file_conv "$1" mingw
+	  set x "$@" "$file"
+	  shift
+	  ;;
+	*)
+	  set x "$@" "$1"
+	  shift
+	  ;;
+      esac
+    fi
+    shift
+  done
+  if test -n "$linker_opts"; then
+    linker_opts="-link$linker_opts"
+  fi
+  exec "$@" $linker_opts
+  exit 1
+}
+
+eat=
+
+case $1 in
+  '')
+     echo "$0: No command.  Try '$0 --help' for more information." 1>&2
+     exit 1;
+     ;;
+  -h | --h*)
+    cat <<\EOF
+Usage: compile [--help] [--version] PROGRAM [ARGS]
+
+Wrapper for compilers which do not understand '-c -o'.
+Remove '-o dest.o' from ARGS, run PROGRAM with the remaining
+arguments, and rename the output as expected.
+
+If you are trying to build a whole package this is not the
+right script to run: please start by reading the file 'INSTALL'.
+
+Report bugs to <bug-automake at gnu.org>.
+EOF
+    exit $?
+    ;;
+  -v | --v*)
+    echo "compile $scriptversion"
+    exit $?
+    ;;
+  cl | *[/\\]cl | cl.exe | *[/\\]cl.exe )
+    func_cl_wrapper "$@"      # Doesn't return...
+    ;;
+esac
+
+ofile=
+cfile=
+
+for arg
+do
+  if test -n "$eat"; then
+    eat=
+  else
+    case $1 in
+      -o)
+	# configure might choose to run compile as 'compile cc -o foo foo.c'.
+	# So we strip '-o arg' only if arg is an object.
+	eat=1
+	case $2 in
+	  *.o | *.obj)
+	    ofile=$2
+	    ;;
+	  *)
+	    set x "$@" -o "$2"
+	    shift
+	    ;;
+	esac
+	;;
+      *.c)
+	cfile=$1
+	set x "$@" "$1"
+	shift
+	;;
+      *)
+	set x "$@" "$1"
+	shift
+	;;
+    esac
+  fi
+  shift
+done
+
+if test -z "$ofile" || test -z "$cfile"; then
+  # If no '-o' option was seen then we might have been invoked from a
+  # pattern rule where we don't need one.  That is ok -- this is a
+  # normal compilation that the losing compiler can handle.  If no
+  # '.c' file was seen then we are probably linking.  That is also
+  # ok.
+  exec "$@"
+fi
+
+# Name of file we expect compiler to create.
+cofile=`echo "$cfile" | sed 's|^.*[\\/]||; s|^[a-zA-Z]:||; s/\.c$/.o/'`
+
+# Create the lock directory.
+# Note: use '[/\\:.-]' here to ensure that we don't use the same name
+# that we are using for the .o file.  Also, base the name on the expected
+# object file name, since that is what matters with a parallel build.
+lockdir=`echo "$cofile" | sed -e 's|[/\\:.-]|_|g'`.d
+while true; do
+  if mkdir "$lockdir" >/dev/null 2>&1; then
+    break
+  fi
+  sleep 1
+done
+# FIXME: race condition here if user kills between mkdir and trap.
+trap "rmdir '$lockdir'; exit 1" 1 2 15
+
+# Run the compile.
+"$@"
+ret=$?
+
+if test -f "$cofile"; then
+  test "$cofile" = "$ofile" || mv "$cofile" "$ofile"
+elif test -f "${cofile}bj"; then
+  test "${cofile}bj" = "$ofile" || mv "${cofile}bj" "$ofile"
+fi
+
+rmdir "$lockdir"
+exit $ret
+
+# Local Variables:
+# mode: shell-script
+# sh-indentation: 2
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "scriptversion="
+# time-stamp-format: "%:y-%02m-%02d.%02H"
+# time-stamp-time-zone: "UTC"
+# time-stamp-end: "; # UTC"
+# End:

Added: vendor/jansson/dist/config.guess
===================================================================
--- vendor/jansson/dist/config.guess	                        (rev 0)
+++ vendor/jansson/dist/config.guess	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,1558 @@
+#! /bin/sh
+# Attempt to guess a canonical system name.
+#   Copyright 1992-2013 Free Software Foundation, Inc.
+
+timestamp='2013-06-10'
+
+# This file is free software; you can redistribute it and/or modify it
+# under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, see <http://www.gnu.org/licenses/>.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that
+# program.  This Exception is an additional permission under section 7
+# of the GNU General Public License, version 3 ("GPLv3").
+#
+# Originally written by Per Bothner.
+#
+# You can get the latest version of this script from:
+# http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.guess;hb=HEAD
+#
+# Please send patches with a ChangeLog entry to config-patches at gnu.org.
+
+
+me=`echo "$0" | sed -e 's,.*/,,'`
+
+usage="\
+Usage: $0 [OPTION]
+
+Output the configuration name of the system \`$me' is run on.
+
+Operation modes:
+  -h, --help         print this help, then exit
+  -t, --time-stamp   print date of last modification, then exit
+  -v, --version      print version number, then exit
+
+Report bugs and patches to <config-patches at gnu.org>."
+
+version="\
+GNU config.guess ($timestamp)
+
+Originally written by Per Bothner.
+Copyright 1992-2013 Free Software Foundation, Inc.
+
+This is free software; see the source for copying conditions.  There is NO
+warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE."
+
+help="
+Try \`$me --help' for more information."
+
+# Parse command line
+while test $# -gt 0 ; do
+  case $1 in
+    --time-stamp | --time* | -t )
+       echo "$timestamp" ; exit ;;
+    --version | -v )
+       echo "$version" ; exit ;;
+    --help | --h* | -h )
+       echo "$usage"; exit ;;
+    -- )     # Stop option processing
+       shift; break ;;
+    - )	# Use stdin as input.
+       break ;;
+    -* )
+       echo "$me: invalid option $1$help" >&2
+       exit 1 ;;
+    * )
+       break ;;
+  esac
+done
+
+if test $# != 0; then
+  echo "$me: too many arguments$help" >&2
+  exit 1
+fi
+
+trap 'exit 1' 1 2 15
+
+# CC_FOR_BUILD -- compiler used by this script. Note that the use of a
+# compiler to aid in system detection is discouraged as it requires
+# temporary files to be created and, as you can see below, it is a
+# headache to deal with in a portable fashion.
+
+# Historically, `CC_FOR_BUILD' used to be named `HOST_CC'. We still
+# use `HOST_CC' if defined, but it is deprecated.
+
+# Portable tmp directory creation inspired by the Autoconf team.
+
+set_cc_for_build='
+trap "exitcode=\$?; (rm -f \$tmpfiles 2>/dev/null; rmdir \$tmp 2>/dev/null) && exit \$exitcode" 0 ;
+trap "rm -f \$tmpfiles 2>/dev/null; rmdir \$tmp 2>/dev/null; exit 1" 1 2 13 15 ;
+: ${TMPDIR=/tmp} ;
+ { tmp=`(umask 077 && mktemp -d "$TMPDIR/cgXXXXXX") 2>/dev/null` && test -n "$tmp" && test -d "$tmp" ; } ||
+ { test -n "$RANDOM" && tmp=$TMPDIR/cg$$-$RANDOM && (umask 077 && mkdir $tmp) ; } ||
+ { tmp=$TMPDIR/cg-$$ && (umask 077 && mkdir $tmp) && echo "Warning: creating insecure temp directory" >&2 ; } ||
+ { echo "$me: cannot create a temporary directory in $TMPDIR" >&2 ; exit 1 ; } ;
+dummy=$tmp/dummy ;
+tmpfiles="$dummy.c $dummy.o $dummy.rel $dummy" ;
+case $CC_FOR_BUILD,$HOST_CC,$CC in
+ ,,)    echo "int x;" > $dummy.c ;
+	for c in cc gcc c89 c99 ; do
+	  if ($c -c -o $dummy.o $dummy.c) >/dev/null 2>&1 ; then
+	     CC_FOR_BUILD="$c"; break ;
+	  fi ;
+	done ;
+	if test x"$CC_FOR_BUILD" = x ; then
+	  CC_FOR_BUILD=no_compiler_found ;
+	fi
+	;;
+ ,,*)   CC_FOR_BUILD=$CC ;;
+ ,*,*)  CC_FOR_BUILD=$HOST_CC ;;
+esac ; set_cc_for_build= ;'
+
+# This is needed to find uname on a Pyramid OSx when run in the BSD universe.
+# (ghazi at noc.rutgers.edu 1994-08-24)
+if (test -f /.attbin/uname) >/dev/null 2>&1 ; then
+	PATH=$PATH:/.attbin ; export PATH
+fi
+
+UNAME_MACHINE=`(uname -m) 2>/dev/null` || UNAME_MACHINE=unknown
+UNAME_RELEASE=`(uname -r) 2>/dev/null` || UNAME_RELEASE=unknown
+UNAME_SYSTEM=`(uname -s) 2>/dev/null`  || UNAME_SYSTEM=unknown
+UNAME_VERSION=`(uname -v) 2>/dev/null` || UNAME_VERSION=unknown
+
+case "${UNAME_SYSTEM}" in
+Linux|GNU|GNU/*)
+	# If the system lacks a compiler, then just pick glibc.
+	# We could probably try harder.
+	LIBC=gnu
+
+	eval $set_cc_for_build
+	cat <<-EOF > $dummy.c
+	#include <features.h>
+	#if defined(__UCLIBC__)
+	LIBC=uclibc
+	#elif defined(__dietlibc__)
+	LIBC=dietlibc
+	#else
+	LIBC=gnu
+	#endif
+	EOF
+	eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep '^LIBC'`
+	;;
+esac
+
+# Note: order is significant - the case branches are not exclusive.
+
+case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in
+    *:NetBSD:*:*)
+	# NetBSD (nbsd) targets should (where applicable) match one or
+	# more of the tuples: *-*-netbsdelf*, *-*-netbsdaout*,
+	# *-*-netbsdecoff* and *-*-netbsd*.  For targets that recently
+	# switched to ELF, *-*-netbsd* would select the old
+	# object file format.  This provides both forward
+	# compatibility and a consistent mechanism for selecting the
+	# object file format.
+	#
+	# Note: NetBSD doesn't particularly care about the vendor
+	# portion of the name.  We always set it to "unknown".
+	sysctl="sysctl -n hw.machine_arch"
+	UNAME_MACHINE_ARCH=`(/sbin/$sysctl 2>/dev/null || \
+	    /usr/sbin/$sysctl 2>/dev/null || echo unknown)`
+	case "${UNAME_MACHINE_ARCH}" in
+	    armeb) machine=armeb-unknown ;;
+	    arm*) machine=arm-unknown ;;
+	    sh3el) machine=shl-unknown ;;
+	    sh3eb) machine=sh-unknown ;;
+	    sh5el) machine=sh5le-unknown ;;
+	    *) machine=${UNAME_MACHINE_ARCH}-unknown ;;
+	esac
+	# The Operating System including object format, if it has switched
+	# to ELF recently, or will in the future.
+	case "${UNAME_MACHINE_ARCH}" in
+	    arm*|i386|m68k|ns32k|sh3*|sparc|vax)
+		eval $set_cc_for_build
+		if echo __ELF__ | $CC_FOR_BUILD -E - 2>/dev/null \
+			| grep -q __ELF__
+		then
+		    # Once all utilities can be ECOFF (netbsdecoff) or a.out (netbsdaout).
+		    # Return netbsd for either.  FIX?
+		    os=netbsd
+		else
+		    os=netbsdelf
+		fi
+		;;
+	    *)
+		os=netbsd
+		;;
+	esac
+	# The OS release
+	# Debian GNU/NetBSD machines have a different userland, and
+	# thus, need a distinct triplet. However, they do not need
+	# kernel version information, so it can be replaced with a
+	# suitable tag, in the style of linux-gnu.
+	case "${UNAME_VERSION}" in
+	    Debian*)
+		release='-gnu'
+		;;
+	    *)
+		release=`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'`
+		;;
+	esac
+	# Since CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM:
+	# contains redundant information, the shorter form:
+	# CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM is used.
+	echo "${machine}-${os}${release}"
+	exit ;;
+    *:Bitrig:*:*)
+	UNAME_MACHINE_ARCH=`arch | sed 's/Bitrig.//'`
+	echo ${UNAME_MACHINE_ARCH}-unknown-bitrig${UNAME_RELEASE}
+	exit ;;
+    *:OpenBSD:*:*)
+	UNAME_MACHINE_ARCH=`arch | sed 's/OpenBSD.//'`
+	echo ${UNAME_MACHINE_ARCH}-unknown-openbsd${UNAME_RELEASE}
+	exit ;;
+    *:ekkoBSD:*:*)
+	echo ${UNAME_MACHINE}-unknown-ekkobsd${UNAME_RELEASE}
+	exit ;;
+    *:SolidBSD:*:*)
+	echo ${UNAME_MACHINE}-unknown-solidbsd${UNAME_RELEASE}
+	exit ;;
+    macppc:MirBSD:*:*)
+	echo powerpc-unknown-mirbsd${UNAME_RELEASE}
+	exit ;;
+    *:MirBSD:*:*)
+	echo ${UNAME_MACHINE}-unknown-mirbsd${UNAME_RELEASE}
+	exit ;;
+    alpha:OSF1:*:*)
+	case $UNAME_RELEASE in
+	*4.0)
+		UNAME_RELEASE=`/usr/sbin/sizer -v | awk '{print $3}'`
+		;;
+	*5.*)
+		UNAME_RELEASE=`/usr/sbin/sizer -v | awk '{print $4}'`
+		;;
+	esac
+	# According to Compaq, /usr/sbin/psrinfo has been available on
+	# OSF/1 and Tru64 systems produced since 1995.  I hope that
+	# covers most systems running today.  This code pipes the CPU
+	# types through head -n 1, so we only detect the type of CPU 0.
+	ALPHA_CPU_TYPE=`/usr/sbin/psrinfo -v | sed -n -e 's/^  The alpha \(.*\) processor.*$/\1/p' | head -n 1`
+	case "$ALPHA_CPU_TYPE" in
+	    "EV4 (21064)")
+		UNAME_MACHINE="alpha" ;;
+	    "EV4.5 (21064)")
+		UNAME_MACHINE="alpha" ;;
+	    "LCA4 (21066/21068)")
+		UNAME_MACHINE="alpha" ;;
+	    "EV5 (21164)")
+		UNAME_MACHINE="alphaev5" ;;
+	    "EV5.6 (21164A)")
+		UNAME_MACHINE="alphaev56" ;;
+	    "EV5.6 (21164PC)")
+		UNAME_MACHINE="alphapca56" ;;
+	    "EV5.7 (21164PC)")
+		UNAME_MACHINE="alphapca57" ;;
+	    "EV6 (21264)")
+		UNAME_MACHINE="alphaev6" ;;
+	    "EV6.7 (21264A)")
+		UNAME_MACHINE="alphaev67" ;;
+	    "EV6.8CB (21264C)")
+		UNAME_MACHINE="alphaev68" ;;
+	    "EV6.8AL (21264B)")
+		UNAME_MACHINE="alphaev68" ;;
+	    "EV6.8CX (21264D)")
+		UNAME_MACHINE="alphaev68" ;;
+	    "EV6.9A (21264/EV69A)")
+		UNAME_MACHINE="alphaev69" ;;
+	    "EV7 (21364)")
+		UNAME_MACHINE="alphaev7" ;;
+	    "EV7.9 (21364A)")
+		UNAME_MACHINE="alphaev79" ;;
+	esac
+	# A Pn.n version is a patched version.
+	# A Vn.n version is a released version.
+	# A Tn.n version is a released field test version.
+	# A Xn.n version is an unreleased experimental baselevel.
+	# 1.2 uses "1.2" for uname -r.
+	echo ${UNAME_MACHINE}-dec-osf`echo ${UNAME_RELEASE} | sed -e 's/^[PVTX]//' | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz'`
+	# Reset EXIT trap before exiting to avoid spurious non-zero exit code.
+	exitcode=$?
+	trap '' 0
+	exit $exitcode ;;
+    Alpha\ *:Windows_NT*:*)
+	# How do we know it's Interix rather than the generic POSIX subsystem?
+	# Should we change UNAME_MACHINE based on the output of uname instead
+	# of the specific Alpha model?
+	echo alpha-pc-interix
+	exit ;;
+    21064:Windows_NT:50:3)
+	echo alpha-dec-winnt3.5
+	exit ;;
+    Amiga*:UNIX_System_V:4.0:*)
+	echo m68k-unknown-sysv4
+	exit ;;
+    *:[Aa]miga[Oo][Ss]:*:*)
+	echo ${UNAME_MACHINE}-unknown-amigaos
+	exit ;;
+    *:[Mm]orph[Oo][Ss]:*:*)
+	echo ${UNAME_MACHINE}-unknown-morphos
+	exit ;;
+    *:OS/390:*:*)
+	echo i370-ibm-openedition
+	exit ;;
+    *:z/VM:*:*)
+	echo s390-ibm-zvmoe
+	exit ;;
+    *:OS400:*:*)
+	echo powerpc-ibm-os400
+	exit ;;
+    arm:RISC*:1.[012]*:*|arm:riscix:1.[012]*:*)
+	echo arm-acorn-riscix${UNAME_RELEASE}
+	exit ;;
+    arm*:riscos:*:*|arm*:RISCOS:*:*)
+	echo arm-unknown-riscos
+	exit ;;
+    SR2?01:HI-UX/MPP:*:* | SR8000:HI-UX/MPP:*:*)
+	echo hppa1.1-hitachi-hiuxmpp
+	exit ;;
+    Pyramid*:OSx*:*:* | MIS*:OSx*:*:* | MIS*:SMP_DC-OSx*:*:*)
+	# akee at wpdis03.wpafb.af.mil (Earle F. Ake) contributed MIS and NILE.
+	if test "`(/bin/universe) 2>/dev/null`" = att ; then
+		echo pyramid-pyramid-sysv3
+	else
+		echo pyramid-pyramid-bsd
+	fi
+	exit ;;
+    NILE*:*:*:dcosx)
+	echo pyramid-pyramid-svr4
+	exit ;;
+    DRS?6000:unix:4.0:6*)
+	echo sparc-icl-nx6
+	exit ;;
+    DRS?6000:UNIX_SV:4.2*:7* | DRS?6000:isis:4.2*:7*)
+	case `/usr/bin/uname -p` in
+	    sparc) echo sparc-icl-nx7; exit ;;
+	esac ;;
+    s390x:SunOS:*:*)
+	echo ${UNAME_MACHINE}-ibm-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+	exit ;;
+    sun4H:SunOS:5.*:*)
+	echo sparc-hal-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+	exit ;;
+    sun4*:SunOS:5.*:* | tadpole*:SunOS:5.*:*)
+	echo sparc-sun-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+	exit ;;
+    i86pc:AuroraUX:5.*:* | i86xen:AuroraUX:5.*:*)
+	echo i386-pc-auroraux${UNAME_RELEASE}
+	exit ;;
+    i86pc:SunOS:5.*:* | i86xen:SunOS:5.*:*)
+	eval $set_cc_for_build
+	SUN_ARCH="i386"
+	# If there is a compiler, see if it is configured for 64-bit objects.
+	# Note that the Sun cc does not turn __LP64__ into 1 like gcc does.
+	# This test works for both compilers.
+	if [ "$CC_FOR_BUILD" != 'no_compiler_found' ]; then
+	    if (echo '#ifdef __amd64'; echo IS_64BIT_ARCH; echo '#endif') | \
+		(CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) | \
+		grep IS_64BIT_ARCH >/dev/null
+	    then
+		SUN_ARCH="x86_64"
+	    fi
+	fi
+	echo ${SUN_ARCH}-pc-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+	exit ;;
+    sun4*:SunOS:6*:*)
+	# According to config.sub, this is the proper way to canonicalize
+	# SunOS6.  Hard to guess exactly what SunOS6 will be like, but
+	# it's likely to be more like Solaris than SunOS4.
+	echo sparc-sun-solaris3`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+	exit ;;
+    sun4*:SunOS:*:*)
+	case "`/usr/bin/arch -k`" in
+	    Series*|S4*)
+		UNAME_RELEASE=`uname -v`
+		;;
+	esac
+	# Japanese Language versions have a version number like `4.1.3-JL'.
+	echo sparc-sun-sunos`echo ${UNAME_RELEASE}|sed -e 's/-/_/'`
+	exit ;;
+    sun3*:SunOS:*:*)
+	echo m68k-sun-sunos${UNAME_RELEASE}
+	exit ;;
+    sun*:*:4.2BSD:*)
+	UNAME_RELEASE=`(sed 1q /etc/motd | awk '{print substr($5,1,3)}') 2>/dev/null`
+	test "x${UNAME_RELEASE}" = "x" && UNAME_RELEASE=3
+	case "`/bin/arch`" in
+	    sun3)
+		echo m68k-sun-sunos${UNAME_RELEASE}
+		;;
+	    sun4)
+		echo sparc-sun-sunos${UNAME_RELEASE}
+		;;
+	esac
+	exit ;;
+    aushp:SunOS:*:*)
+	echo sparc-auspex-sunos${UNAME_RELEASE}
+	exit ;;
+    # The situation for MiNT is a little confusing.  The machine name
+    # can be virtually everything (everything which is not
+    # "atarist" or "atariste" at least should have a processor
+    # > m68000).  The system name ranges from "MiNT" over "FreeMiNT"
+    # to the lowercase version "mint" (or "freemint").  Finally
+    # the system name "TOS" denotes a system which is actually not
+    # MiNT.  But MiNT is downward compatible to TOS, so this should
+    # be no problem.
+    atarist[e]:*MiNT:*:* | atarist[e]:*mint:*:* | atarist[e]:*TOS:*:*)
+	echo m68k-atari-mint${UNAME_RELEASE}
+	exit ;;
+    atari*:*MiNT:*:* | atari*:*mint:*:* | atarist[e]:*TOS:*:*)
+	echo m68k-atari-mint${UNAME_RELEASE}
+	exit ;;
+    *falcon*:*MiNT:*:* | *falcon*:*mint:*:* | *falcon*:*TOS:*:*)
+	echo m68k-atari-mint${UNAME_RELEASE}
+	exit ;;
+    milan*:*MiNT:*:* | milan*:*mint:*:* | *milan*:*TOS:*:*)
+	echo m68k-milan-mint${UNAME_RELEASE}
+	exit ;;
+    hades*:*MiNT:*:* | hades*:*mint:*:* | *hades*:*TOS:*:*)
+	echo m68k-hades-mint${UNAME_RELEASE}
+	exit ;;
+    *:*MiNT:*:* | *:*mint:*:* | *:*TOS:*:*)
+	echo m68k-unknown-mint${UNAME_RELEASE}
+	exit ;;
+    m68k:machten:*:*)
+	echo m68k-apple-machten${UNAME_RELEASE}
+	exit ;;
+    powerpc:machten:*:*)
+	echo powerpc-apple-machten${UNAME_RELEASE}
+	exit ;;
+    RISC*:Mach:*:*)
+	echo mips-dec-mach_bsd4.3
+	exit ;;
+    RISC*:ULTRIX:*:*)
+	echo mips-dec-ultrix${UNAME_RELEASE}
+	exit ;;
+    VAX*:ULTRIX*:*:*)
+	echo vax-dec-ultrix${UNAME_RELEASE}
+	exit ;;
+    2020:CLIX:*:* | 2430:CLIX:*:*)
+	echo clipper-intergraph-clix${UNAME_RELEASE}
+	exit ;;
+    mips:*:*:UMIPS | mips:*:*:RISCos)
+	eval $set_cc_for_build
+	sed 's/^	//' << EOF >$dummy.c
+#ifdef __cplusplus
+#include <stdio.h>  /* for printf() prototype */
+	int main (int argc, char *argv[]) {
+#else
+	int main (argc, argv) int argc; char *argv[]; {
+#endif
+	#if defined (host_mips) && defined (MIPSEB)
+	#if defined (SYSTYPE_SYSV)
+	  printf ("mips-mips-riscos%ssysv\n", argv[1]); exit (0);
+	#endif
+	#if defined (SYSTYPE_SVR4)
+	  printf ("mips-mips-riscos%ssvr4\n", argv[1]); exit (0);
+	#endif
+	#if defined (SYSTYPE_BSD43) || defined(SYSTYPE_BSD)
+	  printf ("mips-mips-riscos%sbsd\n", argv[1]); exit (0);
+	#endif
+	#endif
+	  exit (-1);
+	}
+EOF
+	$CC_FOR_BUILD -o $dummy $dummy.c &&
+	  dummyarg=`echo "${UNAME_RELEASE}" | sed -n 's/\([0-9]*\).*/\1/p'` &&
+	  SYSTEM_NAME=`$dummy $dummyarg` &&
+	    { echo "$SYSTEM_NAME"; exit; }
+	echo mips-mips-riscos${UNAME_RELEASE}
+	exit ;;
+    Motorola:PowerMAX_OS:*:*)
+	echo powerpc-motorola-powermax
+	exit ;;
+    Motorola:*:4.3:PL8-*)
+	echo powerpc-harris-powermax
+	exit ;;
+    Night_Hawk:*:*:PowerMAX_OS | Synergy:PowerMAX_OS:*:*)
+	echo powerpc-harris-powermax
+	exit ;;
+    Night_Hawk:Power_UNIX:*:*)
+	echo powerpc-harris-powerunix
+	exit ;;
+    m88k:CX/UX:7*:*)
+	echo m88k-harris-cxux7
+	exit ;;
+    m88k:*:4*:R4*)
+	echo m88k-motorola-sysv4
+	exit ;;
+    m88k:*:3*:R3*)
+	echo m88k-motorola-sysv3
+	exit ;;
+    AViiON:dgux:*:*)
+	# DG/UX returns AViiON for all architectures
+	UNAME_PROCESSOR=`/usr/bin/uname -p`
+	if [ $UNAME_PROCESSOR = mc88100 ] || [ $UNAME_PROCESSOR = mc88110 ]
+	then
+	    if [ ${TARGET_BINARY_INTERFACE}x = m88kdguxelfx ] || \
+	       [ ${TARGET_BINARY_INTERFACE}x = x ]
+	    then
+		echo m88k-dg-dgux${UNAME_RELEASE}
+	    else
+		echo m88k-dg-dguxbcs${UNAME_RELEASE}
+	    fi
+	else
+	    echo i586-dg-dgux${UNAME_RELEASE}
+	fi
+	exit ;;
+    M88*:DolphinOS:*:*)	# DolphinOS (SVR3)
+	echo m88k-dolphin-sysv3
+	exit ;;
+    M88*:*:R3*:*)
+	# Delta 88k system running SVR3
+	echo m88k-motorola-sysv3
+	exit ;;
+    XD88*:*:*:*) # Tektronix XD88 system running UTekV (SVR3)
+	echo m88k-tektronix-sysv3
+	exit ;;
+    Tek43[0-9][0-9]:UTek:*:*) # Tektronix 4300 system running UTek (BSD)
+	echo m68k-tektronix-bsd
+	exit ;;
+    *:IRIX*:*:*)
+	echo mips-sgi-irix`echo ${UNAME_RELEASE}|sed -e 's/-/_/g'`
+	exit ;;
+    ????????:AIX?:[12].1:2)   # AIX 2.2.1 or AIX 2.1.1 is RT/PC AIX.
+	echo romp-ibm-aix     # uname -m gives an 8 hex-code CPU id
+	exit ;;               # Note that: echo "'`uname -s`'" gives 'AIX '
+    i*86:AIX:*:*)
+	echo i386-ibm-aix
+	exit ;;
+    ia64:AIX:*:*)
+	if [ -x /usr/bin/oslevel ] ; then
+		IBM_REV=`/usr/bin/oslevel`
+	else
+		IBM_REV=${UNAME_VERSION}.${UNAME_RELEASE}
+	fi
+	echo ${UNAME_MACHINE}-ibm-aix${IBM_REV}
+	exit ;;
+    *:AIX:2:3)
+	if grep bos325 /usr/include/stdio.h >/dev/null 2>&1; then
+		eval $set_cc_for_build
+		sed 's/^		//' << EOF >$dummy.c
+		#include <sys/systemcfg.h>
+
+		main()
+			{
+			if (!__power_pc())
+				exit(1);
+			puts("powerpc-ibm-aix3.2.5");
+			exit(0);
+			}
+EOF
+		if $CC_FOR_BUILD -o $dummy $dummy.c && SYSTEM_NAME=`$dummy`
+		then
+			echo "$SYSTEM_NAME"
+		else
+			echo rs6000-ibm-aix3.2.5
+		fi
+	elif grep bos324 /usr/include/stdio.h >/dev/null 2>&1; then
+		echo rs6000-ibm-aix3.2.4
+	else
+		echo rs6000-ibm-aix3.2
+	fi
+	exit ;;
+    *:AIX:*:[4567])
+	IBM_CPU_ID=`/usr/sbin/lsdev -C -c processor -S available | sed 1q | awk '{ print $1 }'`
+	if /usr/sbin/lsattr -El ${IBM_CPU_ID} | grep ' POWER' >/dev/null 2>&1; then
+		IBM_ARCH=rs6000
+	else
+		IBM_ARCH=powerpc
+	fi
+	if [ -x /usr/bin/oslevel ] ; then
+		IBM_REV=`/usr/bin/oslevel`
+	else
+		IBM_REV=${UNAME_VERSION}.${UNAME_RELEASE}
+	fi
+	echo ${IBM_ARCH}-ibm-aix${IBM_REV}
+	exit ;;
+    *:AIX:*:*)
+	echo rs6000-ibm-aix
+	exit ;;
+    ibmrt:4.4BSD:*|romp-ibm:BSD:*)
+	echo romp-ibm-bsd4.4
+	exit ;;
+    ibmrt:*BSD:*|romp-ibm:BSD:*)            # covers RT/PC BSD and
+	echo romp-ibm-bsd${UNAME_RELEASE}   # 4.3 with uname added to
+	exit ;;                             # report: romp-ibm BSD 4.3
+    *:BOSX:*:*)
+	echo rs6000-bull-bosx
+	exit ;;
+    DPX/2?00:B.O.S.:*:*)
+	echo m68k-bull-sysv3
+	exit ;;
+    9000/[34]??:4.3bsd:1.*:*)
+	echo m68k-hp-bsd
+	exit ;;
+    hp300:4.4BSD:*:* | 9000/[34]??:4.3bsd:2.*:*)
+	echo m68k-hp-bsd4.4
+	exit ;;
+    9000/[34678]??:HP-UX:*:*)
+	HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'`
+	case "${UNAME_MACHINE}" in
+	    9000/31? )            HP_ARCH=m68000 ;;
+	    9000/[34]?? )         HP_ARCH=m68k ;;
+	    9000/[678][0-9][0-9])
+		if [ -x /usr/bin/getconf ]; then
+		    sc_cpu_version=`/usr/bin/getconf SC_CPU_VERSION 2>/dev/null`
+		    sc_kernel_bits=`/usr/bin/getconf SC_KERNEL_BITS 2>/dev/null`
+		    case "${sc_cpu_version}" in
+		      523) HP_ARCH="hppa1.0" ;; # CPU_PA_RISC1_0
+		      528) HP_ARCH="hppa1.1" ;; # CPU_PA_RISC1_1
+		      532)                      # CPU_PA_RISC2_0
+			case "${sc_kernel_bits}" in
+			  32) HP_ARCH="hppa2.0n" ;;
+			  64) HP_ARCH="hppa2.0w" ;;
+			  '') HP_ARCH="hppa2.0" ;;   # HP-UX 10.20
+			esac ;;
+		    esac
+		fi
+		if [ "${HP_ARCH}" = "" ]; then
+		    eval $set_cc_for_build
+		    sed 's/^		//' << EOF >$dummy.c
+
+		#define _HPUX_SOURCE
+		#include <stdlib.h>
+		#include <unistd.h>
+
+		int main ()
+		{
+		#if defined(_SC_KERNEL_BITS)
+		    long bits = sysconf(_SC_KERNEL_BITS);
+		#endif
+		    long cpu  = sysconf (_SC_CPU_VERSION);
+
+		    switch (cpu)
+			{
+			case CPU_PA_RISC1_0: puts ("hppa1.0"); break;
+			case CPU_PA_RISC1_1: puts ("hppa1.1"); break;
+			case CPU_PA_RISC2_0:
+		#if defined(_SC_KERNEL_BITS)
+			    switch (bits)
+				{
+				case 64: puts ("hppa2.0w"); break;
+				case 32: puts ("hppa2.0n"); break;
+				default: puts ("hppa2.0"); break;
+				} break;
+		#else  /* !defined(_SC_KERNEL_BITS) */
+			    puts ("hppa2.0"); break;
+		#endif
+			default: puts ("hppa1.0"); break;
+			}
+		    exit (0);
+		}
+EOF
+		    (CCOPTS= $CC_FOR_BUILD -o $dummy $dummy.c 2>/dev/null) && HP_ARCH=`$dummy`
+		    test -z "$HP_ARCH" && HP_ARCH=hppa
+		fi ;;
+	esac
+	if [ ${HP_ARCH} = "hppa2.0w" ]
+	then
+	    eval $set_cc_for_build
+
+	    # hppa2.0w-hp-hpux* has a 64-bit kernel and a compiler generating
+	    # 32-bit code.  hppa64-hp-hpux* has the same kernel and a compiler
+	    # generating 64-bit code.  GNU and HP use different nomenclature:
+	    #
+	    # $ CC_FOR_BUILD=cc ./config.guess
+	    # => hppa2.0w-hp-hpux11.23
+	    # $ CC_FOR_BUILD="cc +DA2.0w" ./config.guess
+	    # => hppa64-hp-hpux11.23
+
+	    if echo __LP64__ | (CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) |
+		grep -q __LP64__
+	    then
+		HP_ARCH="hppa2.0w"
+	    else
+		HP_ARCH="hppa64"
+	    fi
+	fi
+	echo ${HP_ARCH}-hp-hpux${HPUX_REV}
+	exit ;;
+    ia64:HP-UX:*:*)
+	HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'`
+	echo ia64-hp-hpux${HPUX_REV}
+	exit ;;
+    3050*:HI-UX:*:*)
+	eval $set_cc_for_build
+	sed 's/^	//' << EOF >$dummy.c
+	#include <unistd.h>
+	int
+	main ()
+	{
+	  long cpu = sysconf (_SC_CPU_VERSION);
+	  /* The order matters, because CPU_IS_HP_MC68K erroneously returns
+	     true for CPU_PA_RISC1_0.  CPU_IS_PA_RISC returns correct
+	     results, however.  */
+	  if (CPU_IS_PA_RISC (cpu))
+	    {
+	      switch (cpu)
+		{
+		  case CPU_PA_RISC1_0: puts ("hppa1.0-hitachi-hiuxwe2"); break;
+		  case CPU_PA_RISC1_1: puts ("hppa1.1-hitachi-hiuxwe2"); break;
+		  case CPU_PA_RISC2_0: puts ("hppa2.0-hitachi-hiuxwe2"); break;
+		  default: puts ("hppa-hitachi-hiuxwe2"); break;
+		}
+	    }
+	  else if (CPU_IS_HP_MC68K (cpu))
+	    puts ("m68k-hitachi-hiuxwe2");
+	  else puts ("unknown-hitachi-hiuxwe2");
+	  exit (0);
+	}
+EOF
+	$CC_FOR_BUILD -o $dummy $dummy.c && SYSTEM_NAME=`$dummy` &&
+		{ echo "$SYSTEM_NAME"; exit; }
+	echo unknown-hitachi-hiuxwe2
+	exit ;;
+    9000/7??:4.3bsd:*:* | 9000/8?[79]:4.3bsd:*:* )
+	echo hppa1.1-hp-bsd
+	exit ;;
+    9000/8??:4.3bsd:*:*)
+	echo hppa1.0-hp-bsd
+	exit ;;
+    *9??*:MPE/iX:*:* | *3000*:MPE/iX:*:*)
+	echo hppa1.0-hp-mpeix
+	exit ;;
+    hp7??:OSF1:*:* | hp8?[79]:OSF1:*:* )
+	echo hppa1.1-hp-osf
+	exit ;;
+    hp8??:OSF1:*:*)
+	echo hppa1.0-hp-osf
+	exit ;;
+    i*86:OSF1:*:*)
+	if [ -x /usr/sbin/sysversion ] ; then
+	    echo ${UNAME_MACHINE}-unknown-osf1mk
+	else
+	    echo ${UNAME_MACHINE}-unknown-osf1
+	fi
+	exit ;;
+    parisc*:Lites*:*:*)
+	echo hppa1.1-hp-lites
+	exit ;;
+    C1*:ConvexOS:*:* | convex:ConvexOS:C1*:*)
+	echo c1-convex-bsd
+	exit ;;
+    C2*:ConvexOS:*:* | convex:ConvexOS:C2*:*)
+	if getsysinfo -f scalar_acc
+	then echo c32-convex-bsd
+	else echo c2-convex-bsd
+	fi
+	exit ;;
+    C34*:ConvexOS:*:* | convex:ConvexOS:C34*:*)
+	echo c34-convex-bsd
+	exit ;;
+    C38*:ConvexOS:*:* | convex:ConvexOS:C38*:*)
+	echo c38-convex-bsd
+	exit ;;
+    C4*:ConvexOS:*:* | convex:ConvexOS:C4*:*)
+	echo c4-convex-bsd
+	exit ;;
+    CRAY*Y-MP:*:*:*)
+	echo ymp-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+	exit ;;
+    CRAY*[A-Z]90:*:*:*)
+	echo ${UNAME_MACHINE}-cray-unicos${UNAME_RELEASE} \
+	| sed -e 's/CRAY.*\([A-Z]90\)/\1/' \
+	      -e y/ABCDEFGHIJKLMNOPQRSTUVWXYZ/abcdefghijklmnopqrstuvwxyz/ \
+	      -e 's/\.[^.]*$/.X/'
+	exit ;;
+    CRAY*TS:*:*:*)
+	echo t90-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+	exit ;;
+    CRAY*T3E:*:*:*)
+	echo alphaev5-cray-unicosmk${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+	exit ;;
+    CRAY*SV1:*:*:*)
+	echo sv1-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+	exit ;;
+    *:UNICOS/mp:*:*)
+	echo craynv-cray-unicosmp${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+	exit ;;
+    F30[01]:UNIX_System_V:*:* | F700:UNIX_System_V:*:*)
+	FUJITSU_PROC=`uname -m | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz'`
+	FUJITSU_SYS=`uname -p | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/\///'`
+	FUJITSU_REL=`echo ${UNAME_RELEASE} | sed -e 's/ /_/'`
+	echo "${FUJITSU_PROC}-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}"
+	exit ;;
+    5000:UNIX_System_V:4.*:*)
+	FUJITSU_SYS=`uname -p | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/\///'`
+	FUJITSU_REL=`echo ${UNAME_RELEASE} | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/ /_/'`
+	echo "sparc-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}"
+	exit ;;
+    i*86:BSD/386:*:* | i*86:BSD/OS:*:* | *:Ascend\ Embedded/OS:*:*)
+	echo ${UNAME_MACHINE}-pc-bsdi${UNAME_RELEASE}
+	exit ;;
+    sparc*:BSD/OS:*:*)
+	echo sparc-unknown-bsdi${UNAME_RELEASE}
+	exit ;;
+    *:BSD/OS:*:*)
+	echo ${UNAME_MACHINE}-unknown-bsdi${UNAME_RELEASE}
+	exit ;;
+    *:FreeBSD:*:*)
+	UNAME_PROCESSOR=`/usr/bin/uname -p`
+	case ${UNAME_PROCESSOR} in
+	    amd64)
+		echo x86_64-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` ;;
+	    *)
+		echo ${UNAME_PROCESSOR}-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` ;;
+	esac
+	exit ;;
+    i*:CYGWIN*:*)
+	echo ${UNAME_MACHINE}-pc-cygwin
+	exit ;;
+    *:MINGW64*:*)
+	echo ${UNAME_MACHINE}-pc-mingw64
+	exit ;;
+    *:MINGW*:*)
+	echo ${UNAME_MACHINE}-pc-mingw32
+	exit ;;
+    i*:MSYS*:*)
+	echo ${UNAME_MACHINE}-pc-msys
+	exit ;;
+    i*:windows32*:*)
+	# uname -m includes "-pc" on this system.
+	echo ${UNAME_MACHINE}-mingw32
+	exit ;;
+    i*:PW*:*)
+	echo ${UNAME_MACHINE}-pc-pw32
+	exit ;;
+    *:Interix*:*)
+	case ${UNAME_MACHINE} in
+	    x86)
+		echo i586-pc-interix${UNAME_RELEASE}
+		exit ;;
+	    authenticamd | genuineintel | EM64T)
+		echo x86_64-unknown-interix${UNAME_RELEASE}
+		exit ;;
+	    IA64)
+		echo ia64-unknown-interix${UNAME_RELEASE}
+		exit ;;
+	esac ;;
+    [345]86:Windows_95:* | [345]86:Windows_98:* | [345]86:Windows_NT:*)
+	echo i${UNAME_MACHINE}-pc-mks
+	exit ;;
+    8664:Windows_NT:*)
+	echo x86_64-pc-mks
+	exit ;;
+    i*:Windows_NT*:* | Pentium*:Windows_NT*:*)
+	# How do we know it's Interix rather than the generic POSIX subsystem?
+	# It also conflicts with pre-2.0 versions of AT&T UWIN. Should we
+	# UNAME_MACHINE based on the output of uname instead of i386?
+	echo i586-pc-interix
+	exit ;;
+    i*:UWIN*:*)
+	echo ${UNAME_MACHINE}-pc-uwin
+	exit ;;
+    amd64:CYGWIN*:*:* | x86_64:CYGWIN*:*:*)
+	echo x86_64-unknown-cygwin
+	exit ;;
+    p*:CYGWIN*:*)
+	echo powerpcle-unknown-cygwin
+	exit ;;
+    prep*:SunOS:5.*:*)
+	echo powerpcle-unknown-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+	exit ;;
+    *:GNU:*:*)
+	# the GNU system
+	echo `echo ${UNAME_MACHINE}|sed -e 's,[-/].*$,,'`-unknown-${LIBC}`echo ${UNAME_RELEASE}|sed -e 's,/.*$,,'`
+	exit ;;
+    *:GNU/*:*:*)
+	# other systems with GNU libc and userland
+	echo ${UNAME_MACHINE}-unknown-`echo ${UNAME_SYSTEM} | sed 's,^[^/]*/,,' | tr '[A-Z]' '[a-z]'``echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'`-${LIBC}
+	exit ;;
+    i*86:Minix:*:*)
+	echo ${UNAME_MACHINE}-pc-minix
+	exit ;;
+    aarch64:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    aarch64_be:Linux:*:*)
+	UNAME_MACHINE=aarch64_be
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    alpha:Linux:*:*)
+	case `sed -n '/^cpu model/s/^.*: \(.*\)/\1/p' < /proc/cpuinfo` in
+	  EV5)   UNAME_MACHINE=alphaev5 ;;
+	  EV56)  UNAME_MACHINE=alphaev56 ;;
+	  PCA56) UNAME_MACHINE=alphapca56 ;;
+	  PCA57) UNAME_MACHINE=alphapca56 ;;
+	  EV6)   UNAME_MACHINE=alphaev6 ;;
+	  EV67)  UNAME_MACHINE=alphaev67 ;;
+	  EV68*) UNAME_MACHINE=alphaev68 ;;
+	esac
+	objdump --private-headers /bin/sh | grep -q ld.so.1
+	if test "$?" = 0 ; then LIBC="gnulibc1" ; fi
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    arc:Linux:*:* | arceb:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    arm*:Linux:*:*)
+	eval $set_cc_for_build
+	if echo __ARM_EABI__ | $CC_FOR_BUILD -E - 2>/dev/null \
+	    | grep -q __ARM_EABI__
+	then
+	    echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	else
+	    if echo __ARM_PCS_VFP | $CC_FOR_BUILD -E - 2>/dev/null \
+		| grep -q __ARM_PCS_VFP
+	    then
+		echo ${UNAME_MACHINE}-unknown-linux-${LIBC}eabi
+	    else
+		echo ${UNAME_MACHINE}-unknown-linux-${LIBC}eabihf
+	    fi
+	fi
+	exit ;;
+    avr32*:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    cris:Linux:*:*)
+	echo ${UNAME_MACHINE}-axis-linux-${LIBC}
+	exit ;;
+    crisv32:Linux:*:*)
+	echo ${UNAME_MACHINE}-axis-linux-${LIBC}
+	exit ;;
+    frv:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    hexagon:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    i*86:Linux:*:*)
+	echo ${UNAME_MACHINE}-pc-linux-${LIBC}
+	exit ;;
+    ia64:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    m32r*:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    m68*:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    mips:Linux:*:* | mips64:Linux:*:*)
+	eval $set_cc_for_build
+	sed 's/^	//' << EOF >$dummy.c
+	#undef CPU
+	#undef ${UNAME_MACHINE}
+	#undef ${UNAME_MACHINE}el
+	#if defined(__MIPSEL__) || defined(__MIPSEL) || defined(_MIPSEL) || defined(MIPSEL)
+	CPU=${UNAME_MACHINE}el
+	#else
+	#if defined(__MIPSEB__) || defined(__MIPSEB) || defined(_MIPSEB) || defined(MIPSEB)
+	CPU=${UNAME_MACHINE}
+	#else
+	CPU=
+	#endif
+	#endif
+EOF
+	eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep '^CPU'`
+	test x"${CPU}" != x && { echo "${CPU}-unknown-linux-${LIBC}"; exit; }
+	;;
+    or1k:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    or32:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    padre:Linux:*:*)
+	echo sparc-unknown-linux-${LIBC}
+	exit ;;
+    parisc64:Linux:*:* | hppa64:Linux:*:*)
+	echo hppa64-unknown-linux-${LIBC}
+	exit ;;
+    parisc:Linux:*:* | hppa:Linux:*:*)
+	# Look for CPU level
+	case `grep '^cpu[^a-z]*:' /proc/cpuinfo 2>/dev/null | cut -d' ' -f2` in
+	  PA7*) echo hppa1.1-unknown-linux-${LIBC} ;;
+	  PA8*) echo hppa2.0-unknown-linux-${LIBC} ;;
+	  *)    echo hppa-unknown-linux-${LIBC} ;;
+	esac
+	exit ;;
+    ppc64:Linux:*:*)
+	echo powerpc64-unknown-linux-${LIBC}
+	exit ;;
+    ppc:Linux:*:*)
+	echo powerpc-unknown-linux-${LIBC}
+	exit ;;
+    ppc64le:Linux:*:*)
+	echo powerpc64le-unknown-linux-${LIBC}
+	exit ;;
+    ppcle:Linux:*:*)
+	echo powerpcle-unknown-linux-${LIBC}
+	exit ;;
+    s390:Linux:*:* | s390x:Linux:*:*)
+	echo ${UNAME_MACHINE}-ibm-linux-${LIBC}
+	exit ;;
+    sh64*:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    sh*:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    sparc:Linux:*:* | sparc64:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    tile*:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    vax:Linux:*:*)
+	echo ${UNAME_MACHINE}-dec-linux-${LIBC}
+	exit ;;
+    x86_64:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    xtensa*:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-${LIBC}
+	exit ;;
+    i*86:DYNIX/ptx:4*:*)
+	# ptx 4.0 does uname -s correctly, with DYNIX/ptx in there.
+	# earlier versions are messed up and put the nodename in both
+	# sysname and nodename.
+	echo i386-sequent-sysv4
+	exit ;;
+    i*86:UNIX_SV:4.2MP:2.*)
+	# Unixware is an offshoot of SVR4, but it has its own version
+	# number series starting with 2...
+	# I am not positive that other SVR4 systems won't match this,
+	# I just have to hope.  -- rms.
+	# Use sysv4.2uw... so that sysv4* matches it.
+	echo ${UNAME_MACHINE}-pc-sysv4.2uw${UNAME_VERSION}
+	exit ;;
+    i*86:OS/2:*:*)
+	# If we were able to find `uname', then EMX Unix compatibility
+	# is probably installed.
+	echo ${UNAME_MACHINE}-pc-os2-emx
+	exit ;;
+    i*86:XTS-300:*:STOP)
+	echo ${UNAME_MACHINE}-unknown-stop
+	exit ;;
+    i*86:atheos:*:*)
+	echo ${UNAME_MACHINE}-unknown-atheos
+	exit ;;
+    i*86:syllable:*:*)
+	echo ${UNAME_MACHINE}-pc-syllable
+	exit ;;
+    i*86:LynxOS:2.*:* | i*86:LynxOS:3.[01]*:* | i*86:LynxOS:4.[02]*:*)
+	echo i386-unknown-lynxos${UNAME_RELEASE}
+	exit ;;
+    i*86:*DOS:*:*)
+	echo ${UNAME_MACHINE}-pc-msdosdjgpp
+	exit ;;
+    i*86:*:4.*:* | i*86:SYSTEM_V:4.*:*)
+	UNAME_REL=`echo ${UNAME_RELEASE} | sed 's/\/MP$//'`
+	if grep Novell /usr/include/link.h >/dev/null 2>/dev/null; then
+		echo ${UNAME_MACHINE}-univel-sysv${UNAME_REL}
+	else
+		echo ${UNAME_MACHINE}-pc-sysv${UNAME_REL}
+	fi
+	exit ;;
+    i*86:*:5:[678]*)
+	# UnixWare 7.x, OpenUNIX and OpenServer 6.
+	case `/bin/uname -X | grep "^Machine"` in
+	    *486*)	     UNAME_MACHINE=i486 ;;
+	    *Pentium)	     UNAME_MACHINE=i586 ;;
+	    *Pent*|*Celeron) UNAME_MACHINE=i686 ;;
+	esac
+	echo ${UNAME_MACHINE}-unknown-sysv${UNAME_RELEASE}${UNAME_SYSTEM}${UNAME_VERSION}
+	exit ;;
+    i*86:*:3.2:*)
+	if test -f /usr/options/cb.name; then
+		UNAME_REL=`sed -n 's/.*Version //p' </usr/options/cb.name`
+		echo ${UNAME_MACHINE}-pc-isc$UNAME_REL
+	elif /bin/uname -X 2>/dev/null >/dev/null ; then
+		UNAME_REL=`(/bin/uname -X|grep Release|sed -e 's/.*= //')`
+		(/bin/uname -X|grep i80486 >/dev/null) && UNAME_MACHINE=i486
+		(/bin/uname -X|grep '^Machine.*Pentium' >/dev/null) \
+			&& UNAME_MACHINE=i586
+		(/bin/uname -X|grep '^Machine.*Pent *II' >/dev/null) \
+			&& UNAME_MACHINE=i686
+		(/bin/uname -X|grep '^Machine.*Pentium Pro' >/dev/null) \
+			&& UNAME_MACHINE=i686
+		echo ${UNAME_MACHINE}-pc-sco$UNAME_REL
+	else
+		echo ${UNAME_MACHINE}-pc-sysv32
+	fi
+	exit ;;
+    pc:*:*:*)
+	# Left here for compatibility:
+	# uname -m prints for DJGPP always 'pc', but it prints nothing about
+	# the processor, so we play safe by assuming i586.
+	# Note: whatever this is, it MUST be the same as what config.sub
+	# prints for the "djgpp" host, or else GDB configury will decide that
+	# this is a cross-build.
+	echo i586-pc-msdosdjgpp
+	exit ;;
+    Intel:Mach:3*:*)
+	echo i386-pc-mach3
+	exit ;;
+    paragon:*:*:*)
+	echo i860-intel-osf1
+	exit ;;
+    i860:*:4.*:*) # i860-SVR4
+	if grep Stardent /usr/include/sys/uadmin.h >/dev/null 2>&1 ; then
+	  echo i860-stardent-sysv${UNAME_RELEASE} # Stardent Vistra i860-SVR4
+	else # Add other i860-SVR4 vendors below as they are discovered.
+	  echo i860-unknown-sysv${UNAME_RELEASE}  # Unknown i860-SVR4
+	fi
+	exit ;;
+    mini*:CTIX:SYS*5:*)
+	# "miniframe"
+	echo m68010-convergent-sysv
+	exit ;;
+    mc68k:UNIX:SYSTEM5:3.51m)
+	echo m68k-convergent-sysv
+	exit ;;
+    M680?0:D-NIX:5.3:*)
+	echo m68k-diab-dnix
+	exit ;;
+    M68*:*:R3V[5678]*:*)
+	test -r /sysV68 && { echo 'm68k-motorola-sysv'; exit; } ;;
+    3[345]??:*:4.0:3.0 | 3[34]??A:*:4.0:3.0 | 3[34]??,*:*:4.0:3.0 | 3[34]??/*:*:4.0:3.0 | 4400:*:4.0:3.0 | 4850:*:4.0:3.0 | SKA40:*:4.0:3.0 | SDS2:*:4.0:3.0 | SHG2:*:4.0:3.0 | S7501*:*:4.0:3.0)
+	OS_REL=''
+	test -r /etc/.relid \
+	&& OS_REL=.`sed -n 's/[^ ]* [^ ]* \([0-9][0-9]\).*/\1/p' < /etc/.relid`
+	/bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+	  && { echo i486-ncr-sysv4.3${OS_REL}; exit; }
+	/bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \
+	  && { echo i586-ncr-sysv4.3${OS_REL}; exit; } ;;
+    3[34]??:*:4.0:* | 3[34]??,*:*:4.0:*)
+	/bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+	  && { echo i486-ncr-sysv4; exit; } ;;
+    NCR*:*:4.2:* | MPRAS*:*:4.2:*)
+	OS_REL='.3'
+	test -r /etc/.relid \
+	    && OS_REL=.`sed -n 's/[^ ]* [^ ]* \([0-9][0-9]\).*/\1/p' < /etc/.relid`
+	/bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+	    && { echo i486-ncr-sysv4.3${OS_REL}; exit; }
+	/bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \
+	    && { echo i586-ncr-sysv4.3${OS_REL}; exit; }
+	/bin/uname -p 2>/dev/null | /bin/grep pteron >/dev/null \
+	    && { echo i586-ncr-sysv4.3${OS_REL}; exit; } ;;
+    m68*:LynxOS:2.*:* | m68*:LynxOS:3.0*:*)
+	echo m68k-unknown-lynxos${UNAME_RELEASE}
+	exit ;;
+    mc68030:UNIX_System_V:4.*:*)
+	echo m68k-atari-sysv4
+	exit ;;
+    TSUNAMI:LynxOS:2.*:*)
+	echo sparc-unknown-lynxos${UNAME_RELEASE}
+	exit ;;
+    rs6000:LynxOS:2.*:*)
+	echo rs6000-unknown-lynxos${UNAME_RELEASE}
+	exit ;;
+    PowerPC:LynxOS:2.*:* | PowerPC:LynxOS:3.[01]*:* | PowerPC:LynxOS:4.[02]*:*)
+	echo powerpc-unknown-lynxos${UNAME_RELEASE}
+	exit ;;
+    SM[BE]S:UNIX_SV:*:*)
+	echo mips-dde-sysv${UNAME_RELEASE}
+	exit ;;
+    RM*:ReliantUNIX-*:*:*)
+	echo mips-sni-sysv4
+	exit ;;
+    RM*:SINIX-*:*:*)
+	echo mips-sni-sysv4
+	exit ;;
+    *:SINIX-*:*:*)
+	if uname -p 2>/dev/null >/dev/null ; then
+		UNAME_MACHINE=`(uname -p) 2>/dev/null`
+		echo ${UNAME_MACHINE}-sni-sysv4
+	else
+		echo ns32k-sni-sysv
+	fi
+	exit ;;
+    PENTIUM:*:4.0*:*)	# Unisys `ClearPath HMP IX 4000' SVR4/MP effort
+			# says <Richard.M.Bartel at ccMail.Census.GOV>
+	echo i586-unisys-sysv4
+	exit ;;
+    *:UNIX_System_V:4*:FTX*)
+	# From Gerald Hewes <hewes at openmarket.com>.
+	# How about differentiating between stratus architectures? -djm
+	echo hppa1.1-stratus-sysv4
+	exit ;;
+    *:*:*:FTX*)
+	# From seanf at swdc.stratus.com.
+	echo i860-stratus-sysv4
+	exit ;;
+    i*86:VOS:*:*)
+	# From Paul.Green at stratus.com.
+	echo ${UNAME_MACHINE}-stratus-vos
+	exit ;;
+    *:VOS:*:*)
+	# From Paul.Green at stratus.com.
+	echo hppa1.1-stratus-vos
+	exit ;;
+    mc68*:A/UX:*:*)
+	echo m68k-apple-aux${UNAME_RELEASE}
+	exit ;;
+    news*:NEWS-OS:6*:*)
+	echo mips-sony-newsos6
+	exit ;;
+    R[34]000:*System_V*:*:* | R4000:UNIX_SYSV:*:* | R*000:UNIX_SV:*:*)
+	if [ -d /usr/nec ]; then
+		echo mips-nec-sysv${UNAME_RELEASE}
+	else
+		echo mips-unknown-sysv${UNAME_RELEASE}
+	fi
+	exit ;;
+    BeBox:BeOS:*:*)	# BeOS running on hardware made by Be, PPC only.
+	echo powerpc-be-beos
+	exit ;;
+    BeMac:BeOS:*:*)	# BeOS running on Mac or Mac clone, PPC only.
+	echo powerpc-apple-beos
+	exit ;;
+    BePC:BeOS:*:*)	# BeOS running on Intel PC compatible.
+	echo i586-pc-beos
+	exit ;;
+    BePC:Haiku:*:*)	# Haiku running on Intel PC compatible.
+	echo i586-pc-haiku
+	exit ;;
+    x86_64:Haiku:*:*)
+	echo x86_64-unknown-haiku
+	exit ;;
+    SX-4:SUPER-UX:*:*)
+	echo sx4-nec-superux${UNAME_RELEASE}
+	exit ;;
+    SX-5:SUPER-UX:*:*)
+	echo sx5-nec-superux${UNAME_RELEASE}
+	exit ;;
+    SX-6:SUPER-UX:*:*)
+	echo sx6-nec-superux${UNAME_RELEASE}
+	exit ;;
+    SX-7:SUPER-UX:*:*)
+	echo sx7-nec-superux${UNAME_RELEASE}
+	exit ;;
+    SX-8:SUPER-UX:*:*)
+	echo sx8-nec-superux${UNAME_RELEASE}
+	exit ;;
+    SX-8R:SUPER-UX:*:*)
+	echo sx8r-nec-superux${UNAME_RELEASE}
+	exit ;;
+    Power*:Rhapsody:*:*)
+	echo powerpc-apple-rhapsody${UNAME_RELEASE}
+	exit ;;
+    *:Rhapsody:*:*)
+	echo ${UNAME_MACHINE}-apple-rhapsody${UNAME_RELEASE}
+	exit ;;
+    *:Darwin:*:*)
+	UNAME_PROCESSOR=`uname -p` || UNAME_PROCESSOR=unknown
+	eval $set_cc_for_build
+	if test "$UNAME_PROCESSOR" = unknown ; then
+	    UNAME_PROCESSOR=powerpc
+	fi
+	if [ "$CC_FOR_BUILD" != 'no_compiler_found' ]; then
+	    if (echo '#ifdef __LP64__'; echo IS_64BIT_ARCH; echo '#endif') | \
+		(CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) | \
+		grep IS_64BIT_ARCH >/dev/null
+	    then
+		case $UNAME_PROCESSOR in
+		    i386) UNAME_PROCESSOR=x86_64 ;;
+		    powerpc) UNAME_PROCESSOR=powerpc64 ;;
+		esac
+	    fi
+	fi
+	echo ${UNAME_PROCESSOR}-apple-darwin${UNAME_RELEASE}
+	exit ;;
+    *:procnto*:*:* | *:QNX:[0123456789]*:*)
+	UNAME_PROCESSOR=`uname -p`
+	if test "$UNAME_PROCESSOR" = "x86"; then
+		UNAME_PROCESSOR=i386
+		UNAME_MACHINE=pc
+	fi
+	echo ${UNAME_PROCESSOR}-${UNAME_MACHINE}-nto-qnx${UNAME_RELEASE}
+	exit ;;
+    *:QNX:*:4*)
+	echo i386-pc-qnx
+	exit ;;
+    NEO-?:NONSTOP_KERNEL:*:*)
+	echo neo-tandem-nsk${UNAME_RELEASE}
+	exit ;;
+    NSE-*:NONSTOP_KERNEL:*:*)
+	echo nse-tandem-nsk${UNAME_RELEASE}
+	exit ;;
+    NSR-?:NONSTOP_KERNEL:*:*)
+	echo nsr-tandem-nsk${UNAME_RELEASE}
+	exit ;;
+    *:NonStop-UX:*:*)
+	echo mips-compaq-nonstopux
+	exit ;;
+    BS2000:POSIX*:*:*)
+	echo bs2000-siemens-sysv
+	exit ;;
+    DS/*:UNIX_System_V:*:*)
+	echo ${UNAME_MACHINE}-${UNAME_SYSTEM}-${UNAME_RELEASE}
+	exit ;;
+    *:Plan9:*:*)
+	# "uname -m" is not consistent, so use $cputype instead. 386
+	# is converted to i386 for consistency with other x86
+	# operating systems.
+	if test "$cputype" = "386"; then
+	    UNAME_MACHINE=i386
+	else
+	    UNAME_MACHINE="$cputype"
+	fi
+	echo ${UNAME_MACHINE}-unknown-plan9
+	exit ;;
+    *:TOPS-10:*:*)
+	echo pdp10-unknown-tops10
+	exit ;;
+    *:TENEX:*:*)
+	echo pdp10-unknown-tenex
+	exit ;;
+    KS10:TOPS-20:*:* | KL10:TOPS-20:*:* | TYPE4:TOPS-20:*:*)
+	echo pdp10-dec-tops20
+	exit ;;
+    XKL-1:TOPS-20:*:* | TYPE5:TOPS-20:*:*)
+	echo pdp10-xkl-tops20
+	exit ;;
+    *:TOPS-20:*:*)
+	echo pdp10-unknown-tops20
+	exit ;;
+    *:ITS:*:*)
+	echo pdp10-unknown-its
+	exit ;;
+    SEI:*:*:SEIUX)
+	echo mips-sei-seiux${UNAME_RELEASE}
+	exit ;;
+    *:DragonFly:*:*)
+	echo ${UNAME_MACHINE}-unknown-dragonfly`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'`
+	exit ;;
+    *:*VMS:*:*)
+	UNAME_MACHINE=`(uname -p) 2>/dev/null`
+	case "${UNAME_MACHINE}" in
+	    A*) echo alpha-dec-vms ; exit ;;
+	    I*) echo ia64-dec-vms ; exit ;;
+	    V*) echo vax-dec-vms ; exit ;;
+	esac ;;
+    *:XENIX:*:SysV)
+	echo i386-pc-xenix
+	exit ;;
+    i*86:skyos:*:*)
+	echo ${UNAME_MACHINE}-pc-skyos`echo ${UNAME_RELEASE}` | sed -e 's/ .*$//'
+	exit ;;
+    i*86:rdos:*:*)
+	echo ${UNAME_MACHINE}-pc-rdos
+	exit ;;
+    i*86:AROS:*:*)
+	echo ${UNAME_MACHINE}-pc-aros
+	exit ;;
+    x86_64:VMkernel:*:*)
+	echo ${UNAME_MACHINE}-unknown-esx
+	exit ;;
+esac
+
+eval $set_cc_for_build
+cat >$dummy.c <<EOF
+#ifdef _SEQUENT_
+# include <sys/types.h>
+# include <sys/utsname.h>
+#endif
+main ()
+{
+#if defined (sony)
+#if defined (MIPSEB)
+  /* BFD wants "bsd" instead of "newsos".  Perhaps BFD should be changed,
+     I don't know....  */
+  printf ("mips-sony-bsd\n"); exit (0);
+#else
+#include <sys/param.h>
+  printf ("m68k-sony-newsos%s\n",
+#ifdef NEWSOS4
+	"4"
+#else
+	""
+#endif
+	); exit (0);
+#endif
+#endif
+
+#if defined (__arm) && defined (__acorn) && defined (__unix)
+  printf ("arm-acorn-riscix\n"); exit (0);
+#endif
+
+#if defined (hp300) && !defined (hpux)
+  printf ("m68k-hp-bsd\n"); exit (0);
+#endif
+
+#if defined (NeXT)
+#if !defined (__ARCHITECTURE__)
+#define __ARCHITECTURE__ "m68k"
+#endif
+  int version;
+  version=`(hostinfo | sed -n 's/.*NeXT Mach \([0-9]*\).*/\1/p') 2>/dev/null`;
+  if (version < 4)
+    printf ("%s-next-nextstep%d\n", __ARCHITECTURE__, version);
+  else
+    printf ("%s-next-openstep%d\n", __ARCHITECTURE__, version);
+  exit (0);
+#endif
+
+#if defined (MULTIMAX) || defined (n16)
+#if defined (UMAXV)
+  printf ("ns32k-encore-sysv\n"); exit (0);
+#else
+#if defined (CMU)
+  printf ("ns32k-encore-mach\n"); exit (0);
+#else
+  printf ("ns32k-encore-bsd\n"); exit (0);
+#endif
+#endif
+#endif
+
+#if defined (__386BSD__)
+  printf ("i386-pc-bsd\n"); exit (0);
+#endif
+
+#if defined (sequent)
+#if defined (i386)
+  printf ("i386-sequent-dynix\n"); exit (0);
+#endif
+#if defined (ns32000)
+  printf ("ns32k-sequent-dynix\n"); exit (0);
+#endif
+#endif
+
+#if defined (_SEQUENT_)
+    struct utsname un;
+
+    uname(&un);
+
+    if (strncmp(un.version, "V2", 2) == 0) {
+	printf ("i386-sequent-ptx2\n"); exit (0);
+    }
+    if (strncmp(un.version, "V1", 2) == 0) { /* XXX is V1 correct? */
+	printf ("i386-sequent-ptx1\n"); exit (0);
+    }
+    printf ("i386-sequent-ptx\n"); exit (0);
+
+#endif
+
+#if defined (vax)
+# if !defined (ultrix)
+#  include <sys/param.h>
+#  if defined (BSD)
+#   if BSD == 43
+      printf ("vax-dec-bsd4.3\n"); exit (0);
+#   else
+#    if BSD == 199006
+      printf ("vax-dec-bsd4.3reno\n"); exit (0);
+#    else
+      printf ("vax-dec-bsd\n"); exit (0);
+#    endif
+#   endif
+#  else
+    printf ("vax-dec-bsd\n"); exit (0);
+#  endif
+# else
+    printf ("vax-dec-ultrix\n"); exit (0);
+# endif
+#endif
+
+#if defined (alliant) && defined (i860)
+  printf ("i860-alliant-bsd\n"); exit (0);
+#endif
+
+  exit (1);
+}
+EOF
+
+$CC_FOR_BUILD -o $dummy $dummy.c 2>/dev/null && SYSTEM_NAME=`$dummy` &&
+	{ echo "$SYSTEM_NAME"; exit; }
+
+# Apollos put the system type in the environment.
+
+test -d /usr/apollo && { echo ${ISP}-apollo-${SYSTYPE}; exit; }
+
+# Convex versions that predate uname can use getsysinfo(1)
+
+if [ -x /usr/convex/getsysinfo ]
+then
+    case `getsysinfo -f cpu_type` in
+    c1*)
+	echo c1-convex-bsd
+	exit ;;
+    c2*)
+	if getsysinfo -f scalar_acc
+	then echo c32-convex-bsd
+	else echo c2-convex-bsd
+	fi
+	exit ;;
+    c34*)
+	echo c34-convex-bsd
+	exit ;;
+    c38*)
+	echo c38-convex-bsd
+	exit ;;
+    c4*)
+	echo c4-convex-bsd
+	exit ;;
+    esac
+fi
+
+cat >&2 <<EOF
+$0: unable to guess system type
+
+This script, last modified $timestamp, has failed to recognize
+the operating system you are using. It is advised that you
+download the most up to date version of the config scripts from
+
+  http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.guess;hb=HEAD
+and
+  http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.sub;hb=HEAD
+
+If the version you run ($0) is already up to date, please
+send the following data and any information you think might be
+pertinent to <config-patches at gnu.org> in order to provide the needed
+information to handle your system.
+
+config.guess timestamp = $timestamp
+
+uname -m = `(uname -m) 2>/dev/null || echo unknown`
+uname -r = `(uname -r) 2>/dev/null || echo unknown`
+uname -s = `(uname -s) 2>/dev/null || echo unknown`
+uname -v = `(uname -v) 2>/dev/null || echo unknown`
+
+/usr/bin/uname -p = `(/usr/bin/uname -p) 2>/dev/null`
+/bin/uname -X     = `(/bin/uname -X) 2>/dev/null`
+
+hostinfo               = `(hostinfo) 2>/dev/null`
+/bin/universe          = `(/bin/universe) 2>/dev/null`
+/usr/bin/arch -k       = `(/usr/bin/arch -k) 2>/dev/null`
+/bin/arch              = `(/bin/arch) 2>/dev/null`
+/usr/bin/oslevel       = `(/usr/bin/oslevel) 2>/dev/null`
+/usr/convex/getsysinfo = `(/usr/convex/getsysinfo) 2>/dev/null`
+
+UNAME_MACHINE = ${UNAME_MACHINE}
+UNAME_RELEASE = ${UNAME_RELEASE}
+UNAME_SYSTEM  = ${UNAME_SYSTEM}
+UNAME_VERSION = ${UNAME_VERSION}
+EOF
+
+exit 1
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "timestamp='"
+# time-stamp-format: "%:y-%02m-%02d"
+# time-stamp-end: "'"
+# End:

Added: vendor/jansson/dist/config.sub
===================================================================
--- vendor/jansson/dist/config.sub	                        (rev 0)
+++ vendor/jansson/dist/config.sub	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,1791 @@
+#! /bin/sh
+# Configuration validation subroutine script.
+#   Copyright 1992-2013 Free Software Foundation, Inc.
+
+timestamp='2013-08-10'
+
+# This file is free software; you can redistribute it and/or modify it
+# under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, see <http://www.gnu.org/licenses/>.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that
+# program.  This Exception is an additional permission under section 7
+# of the GNU General Public License, version 3 ("GPLv3").
+
+
+# Please send patches with a ChangeLog entry to config-patches at gnu.org.
+#
+# Configuration subroutine to validate and canonicalize a configuration type.
+# Supply the specified configuration type as an argument.
+# If it is invalid, we print an error message on stderr and exit with code 1.
+# Otherwise, we print the canonical config type on stdout and succeed.
+
+# You can get the latest version of this script from:
+# http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.sub;hb=HEAD
+
+# This file is supposed to be the same for all GNU packages
+# and recognize all the CPU types, system types and aliases
+# that are meaningful with *any* GNU software.
+# Each package is responsible for reporting which valid configurations
+# it does not support.  The user should be able to distinguish
+# a failure to support a valid configuration from a meaningless
+# configuration.
+
+# The goal of this file is to map all the various variations of a given
+# machine specification into a single specification in the form:
+#	CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM
+# or in some cases, the newer four-part form:
+#	CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM
+# It is wrong to echo any other type of specification.
+
+me=`echo "$0" | sed -e 's,.*/,,'`
+
+usage="\
+Usage: $0 [OPTION] CPU-MFR-OPSYS
+       $0 [OPTION] ALIAS
+
+Canonicalize a configuration name.
+
+Operation modes:
+  -h, --help         print this help, then exit
+  -t, --time-stamp   print date of last modification, then exit
+  -v, --version      print version number, then exit
+
+Report bugs and patches to <config-patches at gnu.org>."
+
+version="\
+GNU config.sub ($timestamp)
+
+Copyright 1992-2013 Free Software Foundation, Inc.
+
+This is free software; see the source for copying conditions.  There is NO
+warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE."
+
+help="
+Try \`$me --help' for more information."
+
+# Parse command line
+while test $# -gt 0 ; do
+  case $1 in
+    --time-stamp | --time* | -t )
+       echo "$timestamp" ; exit ;;
+    --version | -v )
+       echo "$version" ; exit ;;
+    --help | --h* | -h )
+       echo "$usage"; exit ;;
+    -- )     # Stop option processing
+       shift; break ;;
+    - )	# Use stdin as input.
+       break ;;
+    -* )
+       echo "$me: invalid option $1$help"
+       exit 1 ;;
+
+    *local*)
+       # First pass through any local machine types.
+       echo $1
+       exit ;;
+
+    * )
+       break ;;
+  esac
+done
+
+case $# in
+ 0) echo "$me: missing argument$help" >&2
+    exit 1;;
+ 1) ;;
+ *) echo "$me: too many arguments$help" >&2
+    exit 1;;
+esac
+
+# Separate what the user gave into CPU-COMPANY and OS or KERNEL-OS (if any).
+# Here we must recognize all the valid KERNEL-OS combinations.
+maybe_os=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\2/'`
+case $maybe_os in
+  nto-qnx* | linux-gnu* | linux-android* | linux-dietlibc | linux-newlib* | \
+  linux-musl* | linux-uclibc* | uclinux-uclibc* | uclinux-gnu* | kfreebsd*-gnu* | \
+  knetbsd*-gnu* | netbsd*-gnu* | \
+  kopensolaris*-gnu* | \
+  storm-chaos* | os2-emx* | rtmk-nova*)
+    os=-$maybe_os
+    basic_machine=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\1/'`
+    ;;
+  android-linux)
+    os=-linux-android
+    basic_machine=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\1/'`-unknown
+    ;;
+  *)
+    basic_machine=`echo $1 | sed 's/-[^-]*$//'`
+    if [ $basic_machine != $1 ]
+    then os=`echo $1 | sed 's/.*-/-/'`
+    else os=; fi
+    ;;
+esac
+
+### Let's recognize common machines as not being operating systems so
+### that things like config.sub decstation-3100 work.  We also
+### recognize some manufacturers as not being operating systems, so we
+### can provide default operating systems below.
+case $os in
+	-sun*os*)
+		# Prevent following clause from handling this invalid input.
+		;;
+	-dec* | -mips* | -sequent* | -encore* | -pc532* | -sgi* | -sony* | \
+	-att* | -7300* | -3300* | -delta* | -motorola* | -sun[234]* | \
+	-unicom* | -ibm* | -next | -hp | -isi* | -apollo | -altos* | \
+	-convergent* | -ncr* | -news | -32* | -3600* | -3100* | -hitachi* |\
+	-c[123]* | -convex* | -sun | -crds | -omron* | -dg | -ultra | -tti* | \
+	-harris | -dolphin | -highlevel | -gould | -cbm | -ns | -masscomp | \
+	-apple | -axis | -knuth | -cray | -microblaze*)
+		os=
+		basic_machine=$1
+		;;
+	-bluegene*)
+		os=-cnk
+		;;
+	-sim | -cisco | -oki | -wec | -winbond)
+		os=
+		basic_machine=$1
+		;;
+	-scout)
+		;;
+	-wrs)
+		os=-vxworks
+		basic_machine=$1
+		;;
+	-chorusos*)
+		os=-chorusos
+		basic_machine=$1
+		;;
+	-chorusrdb)
+		os=-chorusrdb
+		basic_machine=$1
+		;;
+	-hiux*)
+		os=-hiuxwe2
+		;;
+	-sco6)
+		os=-sco5v6
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-sco5)
+		os=-sco3.2v5
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-sco4)
+		os=-sco3.2v4
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-sco3.2.[4-9]*)
+		os=`echo $os | sed -e 's/sco3.2./sco3.2v/'`
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-sco3.2v[4-9]*)
+		# Don't forget version if it is 3.2v4 or newer.
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-sco5v6*)
+		# Don't forget version if it is 3.2v4 or newer.
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-sco*)
+		os=-sco3.2v2
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-udk*)
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-isc)
+		os=-isc2.2
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-clix*)
+		basic_machine=clipper-intergraph
+		;;
+	-isc*)
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-lynx*178)
+		os=-lynxos178
+		;;
+	-lynx*5)
+		os=-lynxos5
+		;;
+	-lynx*)
+		os=-lynxos
+		;;
+	-ptx*)
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-sequent/'`
+		;;
+	-windowsnt*)
+		os=`echo $os | sed -e 's/windowsnt/winnt/'`
+		;;
+	-psos*)
+		os=-psos
+		;;
+	-mint | -mint[0-9]*)
+		basic_machine=m68k-atari
+		os=-mint
+		;;
+esac
+
+# Decode aliases for certain CPU-COMPANY combinations.
+case $basic_machine in
+	# Recognize the basic CPU types without company name.
+	# Some are omitted here because they have special meanings below.
+	1750a | 580 \
+	| a29k \
+	| aarch64 | aarch64_be \
+	| alpha | alphaev[4-8] | alphaev56 | alphaev6[78] | alphapca5[67] \
+	| alpha64 | alpha64ev[4-8] | alpha64ev56 | alpha64ev6[78] | alpha64pca5[67] \
+	| am33_2.0 \
+	| arc | arceb \
+	| arm | arm[bl]e | arme[lb] | armv[2-8] | armv[3-8][lb] | armv7[arm] \
+	| avr | avr32 \
+	| be32 | be64 \
+	| bfin \
+	| c4x | c8051 | clipper \
+	| d10v | d30v | dlx | dsp16xx \
+	| epiphany \
+	| fido | fr30 | frv \
+	| h8300 | h8500 | hppa | hppa1.[01] | hppa2.0 | hppa2.0[nw] | hppa64 \
+	| hexagon \
+	| i370 | i860 | i960 | ia64 \
+	| ip2k | iq2000 \
+	| le32 | le64 \
+	| lm32 \
+	| m32c | m32r | m32rle | m68000 | m68k | m88k \
+	| maxq | mb | microblaze | microblazeel | mcore | mep | metag \
+	| mips | mipsbe | mipseb | mipsel | mipsle \
+	| mips16 \
+	| mips64 | mips64el \
+	| mips64octeon | mips64octeonel \
+	| mips64orion | mips64orionel \
+	| mips64r5900 | mips64r5900el \
+	| mips64vr | mips64vrel \
+	| mips64vr4100 | mips64vr4100el \
+	| mips64vr4300 | mips64vr4300el \
+	| mips64vr5000 | mips64vr5000el \
+	| mips64vr5900 | mips64vr5900el \
+	| mipsisa32 | mipsisa32el \
+	| mipsisa32r2 | mipsisa32r2el \
+	| mipsisa64 | mipsisa64el \
+	| mipsisa64r2 | mipsisa64r2el \
+	| mipsisa64sb1 | mipsisa64sb1el \
+	| mipsisa64sr71k | mipsisa64sr71kel \
+	| mipsr5900 | mipsr5900el \
+	| mipstx39 | mipstx39el \
+	| mn10200 | mn10300 \
+	| moxie \
+	| mt \
+	| msp430 \
+	| nds32 | nds32le | nds32be \
+	| nios | nios2 | nios2eb | nios2el \
+	| ns16k | ns32k \
+	| open8 \
+	| or1k | or32 \
+	| pdp10 | pdp11 | pj | pjl \
+	| powerpc | powerpc64 | powerpc64le | powerpcle \
+	| pyramid \
+	| rl78 | rx \
+	| score \
+	| sh | sh[1234] | sh[24]a | sh[24]aeb | sh[23]e | sh[34]eb | sheb | shbe | shle | sh[1234]le | sh3ele \
+	| sh64 | sh64le \
+	| sparc | sparc64 | sparc64b | sparc64v | sparc86x | sparclet | sparclite \
+	| sparcv8 | sparcv9 | sparcv9b | sparcv9v \
+	| spu \
+	| tahoe | tic4x | tic54x | tic55x | tic6x | tic80 | tron \
+	| ubicom32 \
+	| v850 | v850e | v850e1 | v850e2 | v850es | v850e2v3 \
+	| we32k \
+	| x86 | xc16x | xstormy16 | xtensa \
+	| z8k | z80)
+		basic_machine=$basic_machine-unknown
+		;;
+	c54x)
+		basic_machine=tic54x-unknown
+		;;
+	c55x)
+		basic_machine=tic55x-unknown
+		;;
+	c6x)
+		basic_machine=tic6x-unknown
+		;;
+	m6811 | m68hc11 | m6812 | m68hc12 | m68hcs12x | picochip)
+		basic_machine=$basic_machine-unknown
+		os=-none
+		;;
+	m88110 | m680[12346]0 | m683?2 | m68360 | m5200 | v70 | w65 | z8k)
+		;;
+	ms1)
+		basic_machine=mt-unknown
+		;;
+
+	strongarm | thumb | xscale)
+		basic_machine=arm-unknown
+		;;
+	xgate)
+		basic_machine=$basic_machine-unknown
+		os=-none
+		;;
+	xscaleeb)
+		basic_machine=armeb-unknown
+		;;
+
+	xscaleel)
+		basic_machine=armel-unknown
+		;;
+
+	# We use `pc' rather than `unknown'
+	# because (1) that's what they normally are, and
+	# (2) the word "unknown" tends to confuse beginning users.
+	i*86 | x86_64)
+	  basic_machine=$basic_machine-pc
+	  ;;
+	# Object if more than one company name word.
+	*-*-*)
+		echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2
+		exit 1
+		;;
+	# Recognize the basic CPU types with company name.
+	580-* \
+	| a29k-* \
+	| aarch64-* | aarch64_be-* \
+	| alpha-* | alphaev[4-8]-* | alphaev56-* | alphaev6[78]-* \
+	| alpha64-* | alpha64ev[4-8]-* | alpha64ev56-* | alpha64ev6[78]-* \
+	| alphapca5[67]-* | alpha64pca5[67]-* | arc-* | arceb-* \
+	| arm-*  | armbe-* | armle-* | armeb-* | armv*-* \
+	| avr-* | avr32-* \
+	| be32-* | be64-* \
+	| bfin-* | bs2000-* \
+	| c[123]* | c30-* | [cjt]90-* | c4x-* \
+	| c8051-* | clipper-* | craynv-* | cydra-* \
+	| d10v-* | d30v-* | dlx-* \
+	| elxsi-* \
+	| f30[01]-* | f700-* | fido-* | fr30-* | frv-* | fx80-* \
+	| h8300-* | h8500-* \
+	| hppa-* | hppa1.[01]-* | hppa2.0-* | hppa2.0[nw]-* | hppa64-* \
+	| hexagon-* \
+	| i*86-* | i860-* | i960-* | ia64-* \
+	| ip2k-* | iq2000-* \
+	| le32-* | le64-* \
+	| lm32-* \
+	| m32c-* | m32r-* | m32rle-* \
+	| m68000-* | m680[012346]0-* | m68360-* | m683?2-* | m68k-* \
+	| m88110-* | m88k-* | maxq-* | mcore-* | metag-* \
+	| microblaze-* | microblazeel-* \
+	| mips-* | mipsbe-* | mipseb-* | mipsel-* | mipsle-* \
+	| mips16-* \
+	| mips64-* | mips64el-* \
+	| mips64octeon-* | mips64octeonel-* \
+	| mips64orion-* | mips64orionel-* \
+	| mips64r5900-* | mips64r5900el-* \
+	| mips64vr-* | mips64vrel-* \
+	| mips64vr4100-* | mips64vr4100el-* \
+	| mips64vr4300-* | mips64vr4300el-* \
+	| mips64vr5000-* | mips64vr5000el-* \
+	| mips64vr5900-* | mips64vr5900el-* \
+	| mipsisa32-* | mipsisa32el-* \
+	| mipsisa32r2-* | mipsisa32r2el-* \
+	| mipsisa64-* | mipsisa64el-* \
+	| mipsisa64r2-* | mipsisa64r2el-* \
+	| mipsisa64sb1-* | mipsisa64sb1el-* \
+	| mipsisa64sr71k-* | mipsisa64sr71kel-* \
+	| mipsr5900-* | mipsr5900el-* \
+	| mipstx39-* | mipstx39el-* \
+	| mmix-* \
+	| mt-* \
+	| msp430-* \
+	| nds32-* | nds32le-* | nds32be-* \
+	| nios-* | nios2-* | nios2eb-* | nios2el-* \
+	| none-* | np1-* | ns16k-* | ns32k-* \
+	| open8-* \
+	| orion-* \
+	| pdp10-* | pdp11-* | pj-* | pjl-* | pn-* | power-* \
+	| powerpc-* | powerpc64-* | powerpc64le-* | powerpcle-* \
+	| pyramid-* \
+	| rl78-* | romp-* | rs6000-* | rx-* \
+	| sh-* | sh[1234]-* | sh[24]a-* | sh[24]aeb-* | sh[23]e-* | sh[34]eb-* | sheb-* | shbe-* \
+	| shle-* | sh[1234]le-* | sh3ele-* | sh64-* | sh64le-* \
+	| sparc-* | sparc64-* | sparc64b-* | sparc64v-* | sparc86x-* | sparclet-* \
+	| sparclite-* \
+	| sparcv8-* | sparcv9-* | sparcv9b-* | sparcv9v-* | sv1-* | sx?-* \
+	| tahoe-* \
+	| tic30-* | tic4x-* | tic54x-* | tic55x-* | tic6x-* | tic80-* \
+	| tile*-* \
+	| tron-* \
+	| ubicom32-* \
+	| v850-* | v850e-* | v850e1-* | v850es-* | v850e2-* | v850e2v3-* \
+	| vax-* \
+	| we32k-* \
+	| x86-* | x86_64-* | xc16x-* | xps100-* \
+	| xstormy16-* | xtensa*-* \
+	| ymp-* \
+	| z8k-* | z80-*)
+		;;
+	# Recognize the basic CPU types without company name, with glob match.
+	xtensa*)
+		basic_machine=$basic_machine-unknown
+		;;
+	# Recognize the various machine names and aliases which stand
+	# for a CPU type and a company and sometimes even an OS.
+	386bsd)
+		basic_machine=i386-unknown
+		os=-bsd
+		;;
+	3b1 | 7300 | 7300-att | att-7300 | pc7300 | safari | unixpc)
+		basic_machine=m68000-att
+		;;
+	3b*)
+		basic_machine=we32k-att
+		;;
+	a29khif)
+		basic_machine=a29k-amd
+		os=-udi
+		;;
+	abacus)
+		basic_machine=abacus-unknown
+		;;
+	adobe68k)
+		basic_machine=m68010-adobe
+		os=-scout
+		;;
+	alliant | fx80)
+		basic_machine=fx80-alliant
+		;;
+	altos | altos3068)
+		basic_machine=m68k-altos
+		;;
+	am29k)
+		basic_machine=a29k-none
+		os=-bsd
+		;;
+	amd64)
+		basic_machine=x86_64-pc
+		;;
+	amd64-*)
+		basic_machine=x86_64-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	amdahl)
+		basic_machine=580-amdahl
+		os=-sysv
+		;;
+	amiga | amiga-*)
+		basic_machine=m68k-unknown
+		;;
+	amigaos | amigados)
+		basic_machine=m68k-unknown
+		os=-amigaos
+		;;
+	amigaunix | amix)
+		basic_machine=m68k-unknown
+		os=-sysv4
+		;;
+	apollo68)
+		basic_machine=m68k-apollo
+		os=-sysv
+		;;
+	apollo68bsd)
+		basic_machine=m68k-apollo
+		os=-bsd
+		;;
+	aros)
+		basic_machine=i386-pc
+		os=-aros
+		;;
+	aux)
+		basic_machine=m68k-apple
+		os=-aux
+		;;
+	balance)
+		basic_machine=ns32k-sequent
+		os=-dynix
+		;;
+	blackfin)
+		basic_machine=bfin-unknown
+		os=-linux
+		;;
+	blackfin-*)
+		basic_machine=bfin-`echo $basic_machine | sed 's/^[^-]*-//'`
+		os=-linux
+		;;
+	bluegene*)
+		basic_machine=powerpc-ibm
+		os=-cnk
+		;;
+	c54x-*)
+		basic_machine=tic54x-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	c55x-*)
+		basic_machine=tic55x-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	c6x-*)
+		basic_machine=tic6x-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	c90)
+		basic_machine=c90-cray
+		os=-unicos
+		;;
+	cegcc)
+		basic_machine=arm-unknown
+		os=-cegcc
+		;;
+	convex-c1)
+		basic_machine=c1-convex
+		os=-bsd
+		;;
+	convex-c2)
+		basic_machine=c2-convex
+		os=-bsd
+		;;
+	convex-c32)
+		basic_machine=c32-convex
+		os=-bsd
+		;;
+	convex-c34)
+		basic_machine=c34-convex
+		os=-bsd
+		;;
+	convex-c38)
+		basic_machine=c38-convex
+		os=-bsd
+		;;
+	cray | j90)
+		basic_machine=j90-cray
+		os=-unicos
+		;;
+	craynv)
+		basic_machine=craynv-cray
+		os=-unicosmp
+		;;
+	cr16 | cr16-*)
+		basic_machine=cr16-unknown
+		os=-elf
+		;;
+	crds | unos)
+		basic_machine=m68k-crds
+		;;
+	crisv32 | crisv32-* | etraxfs*)
+		basic_machine=crisv32-axis
+		;;
+	cris | cris-* | etrax*)
+		basic_machine=cris-axis
+		;;
+	crx)
+		basic_machine=crx-unknown
+		os=-elf
+		;;
+	da30 | da30-*)
+		basic_machine=m68k-da30
+		;;
+	decstation | decstation-3100 | pmax | pmax-* | pmin | dec3100 | decstatn)
+		basic_machine=mips-dec
+		;;
+	decsystem10* | dec10*)
+		basic_machine=pdp10-dec
+		os=-tops10
+		;;
+	decsystem20* | dec20*)
+		basic_machine=pdp10-dec
+		os=-tops20
+		;;
+	delta | 3300 | motorola-3300 | motorola-delta \
+	      | 3300-motorola | delta-motorola)
+		basic_machine=m68k-motorola
+		;;
+	delta88)
+		basic_machine=m88k-motorola
+		os=-sysv3
+		;;
+	dicos)
+		basic_machine=i686-pc
+		os=-dicos
+		;;
+	djgpp)
+		basic_machine=i586-pc
+		os=-msdosdjgpp
+		;;
+	dpx20 | dpx20-*)
+		basic_machine=rs6000-bull
+		os=-bosx
+		;;
+	dpx2* | dpx2*-bull)
+		basic_machine=m68k-bull
+		os=-sysv3
+		;;
+	ebmon29k)
+		basic_machine=a29k-amd
+		os=-ebmon
+		;;
+	elxsi)
+		basic_machine=elxsi-elxsi
+		os=-bsd
+		;;
+	encore | umax | mmax)
+		basic_machine=ns32k-encore
+		;;
+	es1800 | OSE68k | ose68k | ose | OSE)
+		basic_machine=m68k-ericsson
+		os=-ose
+		;;
+	fx2800)
+		basic_machine=i860-alliant
+		;;
+	genix)
+		basic_machine=ns32k-ns
+		;;
+	gmicro)
+		basic_machine=tron-gmicro
+		os=-sysv
+		;;
+	go32)
+		basic_machine=i386-pc
+		os=-go32
+		;;
+	h3050r* | hiux*)
+		basic_machine=hppa1.1-hitachi
+		os=-hiuxwe2
+		;;
+	h8300hms)
+		basic_machine=h8300-hitachi
+		os=-hms
+		;;
+	h8300xray)
+		basic_machine=h8300-hitachi
+		os=-xray
+		;;
+	h8500hms)
+		basic_machine=h8500-hitachi
+		os=-hms
+		;;
+	harris)
+		basic_machine=m88k-harris
+		os=-sysv3
+		;;
+	hp300-*)
+		basic_machine=m68k-hp
+		;;
+	hp300bsd)
+		basic_machine=m68k-hp
+		os=-bsd
+		;;
+	hp300hpux)
+		basic_machine=m68k-hp
+		os=-hpux
+		;;
+	hp3k9[0-9][0-9] | hp9[0-9][0-9])
+		basic_machine=hppa1.0-hp
+		;;
+	hp9k2[0-9][0-9] | hp9k31[0-9])
+		basic_machine=m68000-hp
+		;;
+	hp9k3[2-9][0-9])
+		basic_machine=m68k-hp
+		;;
+	hp9k6[0-9][0-9] | hp6[0-9][0-9])
+		basic_machine=hppa1.0-hp
+		;;
+	hp9k7[0-79][0-9] | hp7[0-79][0-9])
+		basic_machine=hppa1.1-hp
+		;;
+	hp9k78[0-9] | hp78[0-9])
+		# FIXME: really hppa2.0-hp
+		basic_machine=hppa1.1-hp
+		;;
+	hp9k8[67]1 | hp8[67]1 | hp9k80[24] | hp80[24] | hp9k8[78]9 | hp8[78]9 | hp9k893 | hp893)
+		# FIXME: really hppa2.0-hp
+		basic_machine=hppa1.1-hp
+		;;
+	hp9k8[0-9][13679] | hp8[0-9][13679])
+		basic_machine=hppa1.1-hp
+		;;
+	hp9k8[0-9][0-9] | hp8[0-9][0-9])
+		basic_machine=hppa1.0-hp
+		;;
+	hppa-next)
+		os=-nextstep3
+		;;
+	hppaosf)
+		basic_machine=hppa1.1-hp
+		os=-osf
+		;;
+	hppro)
+		basic_machine=hppa1.1-hp
+		os=-proelf
+		;;
+	i370-ibm* | ibm*)
+		basic_machine=i370-ibm
+		;;
+	i*86v32)
+		basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+		os=-sysv32
+		;;
+	i*86v4*)
+		basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+		os=-sysv4
+		;;
+	i*86v)
+		basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+		os=-sysv
+		;;
+	i*86sol2)
+		basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+		os=-solaris2
+		;;
+	i386mach)
+		basic_machine=i386-mach
+		os=-mach
+		;;
+	i386-vsta | vsta)
+		basic_machine=i386-unknown
+		os=-vsta
+		;;
+	iris | iris4d)
+		basic_machine=mips-sgi
+		case $os in
+		    -irix*)
+			;;
+		    *)
+			os=-irix4
+			;;
+		esac
+		;;
+	isi68 | isi)
+		basic_machine=m68k-isi
+		os=-sysv
+		;;
+	m68knommu)
+		basic_machine=m68k-unknown
+		os=-linux
+		;;
+	m68knommu-*)
+		basic_machine=m68k-`echo $basic_machine | sed 's/^[^-]*-//'`
+		os=-linux
+		;;
+	m88k-omron*)
+		basic_machine=m88k-omron
+		;;
+	magnum | m3230)
+		basic_machine=mips-mips
+		os=-sysv
+		;;
+	merlin)
+		basic_machine=ns32k-utek
+		os=-sysv
+		;;
+	microblaze*)
+		basic_machine=microblaze-xilinx
+		;;
+	mingw64)
+		basic_machine=x86_64-pc
+		os=-mingw64
+		;;
+	mingw32)
+		basic_machine=i686-pc
+		os=-mingw32
+		;;
+	mingw32ce)
+		basic_machine=arm-unknown
+		os=-mingw32ce
+		;;
+	miniframe)
+		basic_machine=m68000-convergent
+		;;
+	*mint | -mint[0-9]* | *MiNT | *MiNT[0-9]*)
+		basic_machine=m68k-atari
+		os=-mint
+		;;
+	mips3*-*)
+		basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`
+		;;
+	mips3*)
+		basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`-unknown
+		;;
+	monitor)
+		basic_machine=m68k-rom68k
+		os=-coff
+		;;
+	morphos)
+		basic_machine=powerpc-unknown
+		os=-morphos
+		;;
+	msdos)
+		basic_machine=i386-pc
+		os=-msdos
+		;;
+	ms1-*)
+		basic_machine=`echo $basic_machine | sed -e 's/ms1-/mt-/'`
+		;;
+	msys)
+		basic_machine=i686-pc
+		os=-msys
+		;;
+	mvs)
+		basic_machine=i370-ibm
+		os=-mvs
+		;;
+	nacl)
+		basic_machine=le32-unknown
+		os=-nacl
+		;;
+	ncr3000)
+		basic_machine=i486-ncr
+		os=-sysv4
+		;;
+	netbsd386)
+		basic_machine=i386-unknown
+		os=-netbsd
+		;;
+	netwinder)
+		basic_machine=armv4l-rebel
+		os=-linux
+		;;
+	news | news700 | news800 | news900)
+		basic_machine=m68k-sony
+		os=-newsos
+		;;
+	news1000)
+		basic_machine=m68030-sony
+		os=-newsos
+		;;
+	news-3600 | risc-news)
+		basic_machine=mips-sony
+		os=-newsos
+		;;
+	necv70)
+		basic_machine=v70-nec
+		os=-sysv
+		;;
+	next | m*-next )
+		basic_machine=m68k-next
+		case $os in
+		    -nextstep* )
+			;;
+		    -ns2*)
+		      os=-nextstep2
+			;;
+		    *)
+		      os=-nextstep3
+			;;
+		esac
+		;;
+	nh3000)
+		basic_machine=m68k-harris
+		os=-cxux
+		;;
+	nh[45]000)
+		basic_machine=m88k-harris
+		os=-cxux
+		;;
+	nindy960)
+		basic_machine=i960-intel
+		os=-nindy
+		;;
+	mon960)
+		basic_machine=i960-intel
+		os=-mon960
+		;;
+	nonstopux)
+		basic_machine=mips-compaq
+		os=-nonstopux
+		;;
+	np1)
+		basic_machine=np1-gould
+		;;
+	neo-tandem)
+		basic_machine=neo-tandem
+		;;
+	nse-tandem)
+		basic_machine=nse-tandem
+		;;
+	nsr-tandem)
+		basic_machine=nsr-tandem
+		;;
+	op50n-* | op60c-*)
+		basic_machine=hppa1.1-oki
+		os=-proelf
+		;;
+	openrisc | openrisc-*)
+		basic_machine=or32-unknown
+		;;
+	os400)
+		basic_machine=powerpc-ibm
+		os=-os400
+		;;
+	OSE68000 | ose68000)
+		basic_machine=m68000-ericsson
+		os=-ose
+		;;
+	os68k)
+		basic_machine=m68k-none
+		os=-os68k
+		;;
+	pa-hitachi)
+		basic_machine=hppa1.1-hitachi
+		os=-hiuxwe2
+		;;
+	paragon)
+		basic_machine=i860-intel
+		os=-osf
+		;;
+	parisc)
+		basic_machine=hppa-unknown
+		os=-linux
+		;;
+	parisc-*)
+		basic_machine=hppa-`echo $basic_machine | sed 's/^[^-]*-//'`
+		os=-linux
+		;;
+	pbd)
+		basic_machine=sparc-tti
+		;;
+	pbb)
+		basic_machine=m68k-tti
+		;;
+	pc532 | pc532-*)
+		basic_machine=ns32k-pc532
+		;;
+	pc98)
+		basic_machine=i386-pc
+		;;
+	pc98-*)
+		basic_machine=i386-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	pentium | p5 | k5 | k6 | nexgen | viac3)
+		basic_machine=i586-pc
+		;;
+	pentiumpro | p6 | 6x86 | athlon | athlon_*)
+		basic_machine=i686-pc
+		;;
+	pentiumii | pentium2 | pentiumiii | pentium3)
+		basic_machine=i686-pc
+		;;
+	pentium4)
+		basic_machine=i786-pc
+		;;
+	pentium-* | p5-* | k5-* | k6-* | nexgen-* | viac3-*)
+		basic_machine=i586-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	pentiumpro-* | p6-* | 6x86-* | athlon-*)
+		basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	pentiumii-* | pentium2-* | pentiumiii-* | pentium3-*)
+		basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	pentium4-*)
+		basic_machine=i786-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	pn)
+		basic_machine=pn-gould
+		;;
+	power)	basic_machine=power-ibm
+		;;
+	ppc | ppcbe)	basic_machine=powerpc-unknown
+		;;
+	ppc-* | ppcbe-*)
+		basic_machine=powerpc-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	ppcle | powerpclittle | ppc-le | powerpc-little)
+		basic_machine=powerpcle-unknown
+		;;
+	ppcle-* | powerpclittle-*)
+		basic_machine=powerpcle-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	ppc64)	basic_machine=powerpc64-unknown
+		;;
+	ppc64-*) basic_machine=powerpc64-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	ppc64le | powerpc64little | ppc64-le | powerpc64-little)
+		basic_machine=powerpc64le-unknown
+		;;
+	ppc64le-* | powerpc64little-*)
+		basic_machine=powerpc64le-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	ps2)
+		basic_machine=i386-ibm
+		;;
+	pw32)
+		basic_machine=i586-unknown
+		os=-pw32
+		;;
+	rdos | rdos64)
+		basic_machine=x86_64-pc
+		os=-rdos
+		;;
+	rdos32)
+		basic_machine=i386-pc
+		os=-rdos
+		;;
+	rom68k)
+		basic_machine=m68k-rom68k
+		os=-coff
+		;;
+	rm[46]00)
+		basic_machine=mips-siemens
+		;;
+	rtpc | rtpc-*)
+		basic_machine=romp-ibm
+		;;
+	s390 | s390-*)
+		basic_machine=s390-ibm
+		;;
+	s390x | s390x-*)
+		basic_machine=s390x-ibm
+		;;
+	sa29200)
+		basic_machine=a29k-amd
+		os=-udi
+		;;
+	sb1)
+		basic_machine=mipsisa64sb1-unknown
+		;;
+	sb1el)
+		basic_machine=mipsisa64sb1el-unknown
+		;;
+	sde)
+		basic_machine=mipsisa32-sde
+		os=-elf
+		;;
+	sei)
+		basic_machine=mips-sei
+		os=-seiux
+		;;
+	sequent)
+		basic_machine=i386-sequent
+		;;
+	sh)
+		basic_machine=sh-hitachi
+		os=-hms
+		;;
+	sh5el)
+		basic_machine=sh5le-unknown
+		;;
+	sh64)
+		basic_machine=sh64-unknown
+		;;
+	sparclite-wrs | simso-wrs)
+		basic_machine=sparclite-wrs
+		os=-vxworks
+		;;
+	sps7)
+		basic_machine=m68k-bull
+		os=-sysv2
+		;;
+	spur)
+		basic_machine=spur-unknown
+		;;
+	st2000)
+		basic_machine=m68k-tandem
+		;;
+	stratus)
+		basic_machine=i860-stratus
+		os=-sysv4
+		;;
+	strongarm-* | thumb-*)
+		basic_machine=arm-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	sun2)
+		basic_machine=m68000-sun
+		;;
+	sun2os3)
+		basic_machine=m68000-sun
+		os=-sunos3
+		;;
+	sun2os4)
+		basic_machine=m68000-sun
+		os=-sunos4
+		;;
+	sun3os3)
+		basic_machine=m68k-sun
+		os=-sunos3
+		;;
+	sun3os4)
+		basic_machine=m68k-sun
+		os=-sunos4
+		;;
+	sun4os3)
+		basic_machine=sparc-sun
+		os=-sunos3
+		;;
+	sun4os4)
+		basic_machine=sparc-sun
+		os=-sunos4
+		;;
+	sun4sol2)
+		basic_machine=sparc-sun
+		os=-solaris2
+		;;
+	sun3 | sun3-*)
+		basic_machine=m68k-sun
+		;;
+	sun4)
+		basic_machine=sparc-sun
+		;;
+	sun386 | sun386i | roadrunner)
+		basic_machine=i386-sun
+		;;
+	sv1)
+		basic_machine=sv1-cray
+		os=-unicos
+		;;
+	symmetry)
+		basic_machine=i386-sequent
+		os=-dynix
+		;;
+	t3e)
+		basic_machine=alphaev5-cray
+		os=-unicos
+		;;
+	t90)
+		basic_machine=t90-cray
+		os=-unicos
+		;;
+	tile*)
+		basic_machine=$basic_machine-unknown
+		os=-linux-gnu
+		;;
+	tx39)
+		basic_machine=mipstx39-unknown
+		;;
+	tx39el)
+		basic_machine=mipstx39el-unknown
+		;;
+	toad1)
+		basic_machine=pdp10-xkl
+		os=-tops20
+		;;
+	tower | tower-32)
+		basic_machine=m68k-ncr
+		;;
+	tpf)
+		basic_machine=s390x-ibm
+		os=-tpf
+		;;
+	udi29k)
+		basic_machine=a29k-amd
+		os=-udi
+		;;
+	ultra3)
+		basic_machine=a29k-nyu
+		os=-sym1
+		;;
+	v810 | necv810)
+		basic_machine=v810-nec
+		os=-none
+		;;
+	vaxv)
+		basic_machine=vax-dec
+		os=-sysv
+		;;
+	vms)
+		basic_machine=vax-dec
+		os=-vms
+		;;
+	vpp*|vx|vx-*)
+		basic_machine=f301-fujitsu
+		;;
+	vxworks960)
+		basic_machine=i960-wrs
+		os=-vxworks
+		;;
+	vxworks68)
+		basic_machine=m68k-wrs
+		os=-vxworks
+		;;
+	vxworks29k)
+		basic_machine=a29k-wrs
+		os=-vxworks
+		;;
+	w65*)
+		basic_machine=w65-wdc
+		os=-none
+		;;
+	w89k-*)
+		basic_machine=hppa1.1-winbond
+		os=-proelf
+		;;
+	xbox)
+		basic_machine=i686-pc
+		os=-mingw32
+		;;
+	xps | xps100)
+		basic_machine=xps100-honeywell
+		;;
+	xscale-* | xscalee[bl]-*)
+		basic_machine=`echo $basic_machine | sed 's/^xscale/arm/'`
+		;;
+	ymp)
+		basic_machine=ymp-cray
+		os=-unicos
+		;;
+	z8k-*-coff)
+		basic_machine=z8k-unknown
+		os=-sim
+		;;
+	z80-*-coff)
+		basic_machine=z80-unknown
+		os=-sim
+		;;
+	none)
+		basic_machine=none-none
+		os=-none
+		;;
+
+# Here we handle the default manufacturer of certain CPU types.  It is in
+# some cases the only manufacturer, in others, it is the most popular.
+	w89k)
+		basic_machine=hppa1.1-winbond
+		;;
+	op50n)
+		basic_machine=hppa1.1-oki
+		;;
+	op60c)
+		basic_machine=hppa1.1-oki
+		;;
+	romp)
+		basic_machine=romp-ibm
+		;;
+	mmix)
+		basic_machine=mmix-knuth
+		;;
+	rs6000)
+		basic_machine=rs6000-ibm
+		;;
+	vax)
+		basic_machine=vax-dec
+		;;
+	pdp10)
+		# there are many clones, so DEC is not a safe bet
+		basic_machine=pdp10-unknown
+		;;
+	pdp11)
+		basic_machine=pdp11-dec
+		;;
+	we32k)
+		basic_machine=we32k-att
+		;;
+	sh[1234] | sh[24]a | sh[24]aeb | sh[34]eb | sh[1234]le | sh[23]ele)
+		basic_machine=sh-unknown
+		;;
+	sparc | sparcv8 | sparcv9 | sparcv9b | sparcv9v)
+		basic_machine=sparc-sun
+		;;
+	cydra)
+		basic_machine=cydra-cydrome
+		;;
+	orion)
+		basic_machine=orion-highlevel
+		;;
+	orion105)
+		basic_machine=clipper-highlevel
+		;;
+	mac | mpw | mac-mpw)
+		basic_machine=m68k-apple
+		;;
+	pmac | pmac-mpw)
+		basic_machine=powerpc-apple
+		;;
+	*-unknown)
+		# Make sure to match an already-canonicalized machine name.
+		;;
+	*)
+		echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2
+		exit 1
+		;;
+esac
+
+# Here we canonicalize certain aliases for manufacturers.
+case $basic_machine in
+	*-digital*)
+		basic_machine=`echo $basic_machine | sed 's/digital.*/dec/'`
+		;;
+	*-commodore*)
+		basic_machine=`echo $basic_machine | sed 's/commodore.*/cbm/'`
+		;;
+	*)
+		;;
+esac
+
+# Decode manufacturer-specific aliases for certain operating systems.
+
+if [ x"$os" != x"" ]
+then
+case $os in
+	# First match some system type aliases
+	# that might get confused with valid system types.
+	# -solaris* is a basic system type, with this one exception.
+	-auroraux)
+		os=-auroraux
+		;;
+	-solaris1 | -solaris1.*)
+		os=`echo $os | sed -e 's|solaris1|sunos4|'`
+		;;
+	-solaris)
+		os=-solaris2
+		;;
+	-svr4*)
+		os=-sysv4
+		;;
+	-unixware*)
+		os=-sysv4.2uw
+		;;
+	-gnu/linux*)
+		os=`echo $os | sed -e 's|gnu/linux|linux-gnu|'`
+		;;
+	# First accept the basic system types.
+	# The portable systems comes first.
+	# Each alternative MUST END IN A *, to match a version number.
+	# -sysv* is not here because it comes later, after sysvr4.
+	-gnu* | -bsd* | -mach* | -minix* | -genix* | -ultrix* | -irix* \
+	      | -*vms* | -sco* | -esix* | -isc* | -aix* | -cnk* | -sunos | -sunos[34]*\
+	      | -hpux* | -unos* | -osf* | -luna* | -dgux* | -auroraux* | -solaris* \
+	      | -sym* | -kopensolaris* | -plan9* \
+	      | -amigaos* | -amigados* | -msdos* | -newsos* | -unicos* | -aof* \
+	      | -aos* | -aros* \
+	      | -nindy* | -vxsim* | -vxworks* | -ebmon* | -hms* | -mvs* \
+	      | -clix* | -riscos* | -uniplus* | -iris* | -rtu* | -xenix* \
+	      | -hiux* | -386bsd* | -knetbsd* | -mirbsd* | -netbsd* \
+	      | -bitrig* | -openbsd* | -solidbsd* \
+	      | -ekkobsd* | -kfreebsd* | -freebsd* | -riscix* | -lynxos* \
+	      | -bosx* | -nextstep* | -cxux* | -aout* | -elf* | -oabi* \
+	      | -ptx* | -coff* | -ecoff* | -winnt* | -domain* | -vsta* \
+	      | -udi* | -eabi* | -lites* | -ieee* | -go32* | -aux* \
+	      | -chorusos* | -chorusrdb* | -cegcc* \
+	      | -cygwin* | -msys* | -pe* | -psos* | -moss* | -proelf* | -rtems* \
+	      | -mingw32* | -mingw64* | -linux-gnu* | -linux-android* \
+	      | -linux-newlib* | -linux-musl* | -linux-uclibc* \
+	      | -uxpv* | -beos* | -mpeix* | -udk* \
+	      | -interix* | -uwin* | -mks* | -rhapsody* | -darwin* | -opened* \
+	      | -openstep* | -oskit* | -conix* | -pw32* | -nonstopux* \
+	      | -storm-chaos* | -tops10* | -tenex* | -tops20* | -its* \
+	      | -os2* | -vos* | -palmos* | -uclinux* | -nucleus* \
+	      | -morphos* | -superux* | -rtmk* | -rtmk-nova* | -windiss* \
+	      | -powermax* | -dnix* | -nx6 | -nx7 | -sei* | -dragonfly* \
+	      | -skyos* | -haiku* | -rdos* | -toppers* | -drops* | -es*)
+	# Remember, each alternative MUST END IN *, to match a version number.
+		;;
+	-qnx*)
+		case $basic_machine in
+		    x86-* | i*86-*)
+			;;
+		    *)
+			os=-nto$os
+			;;
+		esac
+		;;
+	-nto-qnx*)
+		;;
+	-nto*)
+		os=`echo $os | sed -e 's|nto|nto-qnx|'`
+		;;
+	-sim | -es1800* | -hms* | -xray | -os68k* | -none* | -v88r* \
+	      | -windows* | -osx | -abug | -netware* | -os9* | -beos* | -haiku* \
+	      | -macos* | -mpw* | -magic* | -mmixware* | -mon960* | -lnews*)
+		;;
+	-mac*)
+		os=`echo $os | sed -e 's|mac|macos|'`
+		;;
+	-linux-dietlibc)
+		os=-linux-dietlibc
+		;;
+	-linux*)
+		os=`echo $os | sed -e 's|linux|linux-gnu|'`
+		;;
+	-sunos5*)
+		os=`echo $os | sed -e 's|sunos5|solaris2|'`
+		;;
+	-sunos6*)
+		os=`echo $os | sed -e 's|sunos6|solaris3|'`
+		;;
+	-opened*)
+		os=-openedition
+		;;
+	-os400*)
+		os=-os400
+		;;
+	-wince*)
+		os=-wince
+		;;
+	-osfrose*)
+		os=-osfrose
+		;;
+	-osf*)
+		os=-osf
+		;;
+	-utek*)
+		os=-bsd
+		;;
+	-dynix*)
+		os=-bsd
+		;;
+	-acis*)
+		os=-aos
+		;;
+	-atheos*)
+		os=-atheos
+		;;
+	-syllable*)
+		os=-syllable
+		;;
+	-386bsd)
+		os=-bsd
+		;;
+	-ctix* | -uts*)
+		os=-sysv
+		;;
+	-nova*)
+		os=-rtmk-nova
+		;;
+	-ns2 )
+		os=-nextstep2
+		;;
+	-nsk*)
+		os=-nsk
+		;;
+	# Preserve the version number of sinix5.
+	-sinix5.*)
+		os=`echo $os | sed -e 's|sinix|sysv|'`
+		;;
+	-sinix*)
+		os=-sysv4
+		;;
+	-tpf*)
+		os=-tpf
+		;;
+	-triton*)
+		os=-sysv3
+		;;
+	-oss*)
+		os=-sysv3
+		;;
+	-svr4)
+		os=-sysv4
+		;;
+	-svr3)
+		os=-sysv3
+		;;
+	-sysvr4)
+		os=-sysv4
+		;;
+	# This must come after -sysvr4.
+	-sysv*)
+		;;
+	-ose*)
+		os=-ose
+		;;
+	-es1800*)
+		os=-ose
+		;;
+	-xenix)
+		os=-xenix
+		;;
+	-*mint | -mint[0-9]* | -*MiNT | -MiNT[0-9]*)
+		os=-mint
+		;;
+	-aros*)
+		os=-aros
+		;;
+	-zvmoe)
+		os=-zvmoe
+		;;
+	-dicos*)
+		os=-dicos
+		;;
+	-nacl*)
+		;;
+	-none)
+		;;
+	*)
+		# Get rid of the `-' at the beginning of $os.
+		os=`echo $os | sed 's/[^-]*-//'`
+		echo Invalid configuration \`$1\': system \`$os\' not recognized 1>&2
+		exit 1
+		;;
+esac
+else
+
+# Here we handle the default operating systems that come with various machines.
+# The value should be what the vendor currently ships out the door with their
+# machine or put another way, the most popular os provided with the machine.
+
+# Note that if you're going to try to match "-MANUFACTURER" here (say,
+# "-sun"), then you have to tell the case statement up towards the top
+# that MANUFACTURER isn't an operating system.  Otherwise, code above
+# will signal an error saying that MANUFACTURER isn't an operating
+# system, and we'll never get to this point.
+
+case $basic_machine in
+	score-*)
+		os=-elf
+		;;
+	spu-*)
+		os=-elf
+		;;
+	*-acorn)
+		os=-riscix1.2
+		;;
+	arm*-rebel)
+		os=-linux
+		;;
+	arm*-semi)
+		os=-aout
+		;;
+	c4x-* | tic4x-*)
+		os=-coff
+		;;
+	c8051-*)
+		os=-elf
+		;;
+	hexagon-*)
+		os=-elf
+		;;
+	tic54x-*)
+		os=-coff
+		;;
+	tic55x-*)
+		os=-coff
+		;;
+	tic6x-*)
+		os=-coff
+		;;
+	# This must come before the *-dec entry.
+	pdp10-*)
+		os=-tops20
+		;;
+	pdp11-*)
+		os=-none
+		;;
+	*-dec | vax-*)
+		os=-ultrix4.2
+		;;
+	m68*-apollo)
+		os=-domain
+		;;
+	i386-sun)
+		os=-sunos4.0.2
+		;;
+	m68000-sun)
+		os=-sunos3
+		;;
+	m68*-cisco)
+		os=-aout
+		;;
+	mep-*)
+		os=-elf
+		;;
+	mips*-cisco)
+		os=-elf
+		;;
+	mips*-*)
+		os=-elf
+		;;
+	or1k-*)
+		os=-elf
+		;;
+	or32-*)
+		os=-coff
+		;;
+	*-tti)	# must be before sparc entry or we get the wrong os.
+		os=-sysv3
+		;;
+	sparc-* | *-sun)
+		os=-sunos4.1.1
+		;;
+	*-be)
+		os=-beos
+		;;
+	*-haiku)
+		os=-haiku
+		;;
+	*-ibm)
+		os=-aix
+		;;
+	*-knuth)
+		os=-mmixware
+		;;
+	*-wec)
+		os=-proelf
+		;;
+	*-winbond)
+		os=-proelf
+		;;
+	*-oki)
+		os=-proelf
+		;;
+	*-hp)
+		os=-hpux
+		;;
+	*-hitachi)
+		os=-hiux
+		;;
+	i860-* | *-att | *-ncr | *-altos | *-motorola | *-convergent)
+		os=-sysv
+		;;
+	*-cbm)
+		os=-amigaos
+		;;
+	*-dg)
+		os=-dgux
+		;;
+	*-dolphin)
+		os=-sysv3
+		;;
+	m68k-ccur)
+		os=-rtu
+		;;
+	m88k-omron*)
+		os=-luna
+		;;
+	*-next )
+		os=-nextstep
+		;;
+	*-sequent)
+		os=-ptx
+		;;
+	*-crds)
+		os=-unos
+		;;
+	*-ns)
+		os=-genix
+		;;
+	i370-*)
+		os=-mvs
+		;;
+	*-next)
+		os=-nextstep3
+		;;
+	*-gould)
+		os=-sysv
+		;;
+	*-highlevel)
+		os=-bsd
+		;;
+	*-encore)
+		os=-bsd
+		;;
+	*-sgi)
+		os=-irix
+		;;
+	*-siemens)
+		os=-sysv4
+		;;
+	*-masscomp)
+		os=-rtu
+		;;
+	f30[01]-fujitsu | f700-fujitsu)
+		os=-uxpv
+		;;
+	*-rom68k)
+		os=-coff
+		;;
+	*-*bug)
+		os=-coff
+		;;
+	*-apple)
+		os=-macos
+		;;
+	*-atari*)
+		os=-mint
+		;;
+	*)
+		os=-none
+		;;
+esac
+fi
+
+# Here we handle the case where we know the os, and the CPU type, but not the
+# manufacturer.  We pick the logical manufacturer.
+vendor=unknown
+case $basic_machine in
+	*-unknown)
+		case $os in
+			-riscix*)
+				vendor=acorn
+				;;
+			-sunos*)
+				vendor=sun
+				;;
+			-cnk*|-aix*)
+				vendor=ibm
+				;;
+			-beos*)
+				vendor=be
+				;;
+			-hpux*)
+				vendor=hp
+				;;
+			-mpeix*)
+				vendor=hp
+				;;
+			-hiux*)
+				vendor=hitachi
+				;;
+			-unos*)
+				vendor=crds
+				;;
+			-dgux*)
+				vendor=dg
+				;;
+			-luna*)
+				vendor=omron
+				;;
+			-genix*)
+				vendor=ns
+				;;
+			-mvs* | -opened*)
+				vendor=ibm
+				;;
+			-os400*)
+				vendor=ibm
+				;;
+			-ptx*)
+				vendor=sequent
+				;;
+			-tpf*)
+				vendor=ibm
+				;;
+			-vxsim* | -vxworks* | -windiss*)
+				vendor=wrs
+				;;
+			-aux*)
+				vendor=apple
+				;;
+			-hms*)
+				vendor=hitachi
+				;;
+			-mpw* | -macos*)
+				vendor=apple
+				;;
+			-*mint | -mint[0-9]* | -*MiNT | -MiNT[0-9]*)
+				vendor=atari
+				;;
+			-vos*)
+				vendor=stratus
+				;;
+		esac
+		basic_machine=`echo $basic_machine | sed "s/unknown/$vendor/"`
+		;;
+esac
+
+echo $basic_machine$os
+exit
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "timestamp='"
+# time-stamp-format: "%:y-%02m-%02d"
+# time-stamp-end: "'"
+# End:

Added: vendor/jansson/dist/configure
===================================================================
--- vendor/jansson/dist/configure	                        (rev 0)
+++ vendor/jansson/dist/configure	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,14326 @@
+#! /bin/sh
+# Guess values for system-dependent variables and create Makefiles.
+# Generated by GNU Autoconf 2.69 for jansson 2.7.
+#
+# Report bugs to <petri at digip.org>.
+#
+#
+# Copyright (C) 1992-1996, 1998-2012 Free Software Foundation, Inc.
+#
+#
+# This configure script is free software; the Free Software Foundation
+# gives unlimited permission to copy, distribute and modify it.
+## -------------------- ##
+## M4sh Initialization. ##
+## -------------------- ##
+
+# Be more Bourne compatible
+DUALCASE=1; export DUALCASE # for MKS sh
+if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then :
+  emulate sh
+  NULLCMD=:
+  # Pre-4.2 versions of Zsh do word splitting on ${1+"$@"}, which
+  # is contrary to our usage.  Disable this feature.
+  alias -g '${1+"$@"}'='"$@"'
+  setopt NO_GLOB_SUBST
+else
+  case `(set -o) 2>/dev/null` in #(
+  *posix*) :
+    set -o posix ;; #(
+  *) :
+     ;;
+esac
+fi
+
+
+as_nl='
+'
+export as_nl
+# Printing a long string crashes Solaris 7 /usr/bin/printf.
+as_echo='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo
+as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo$as_echo
+# Prefer a ksh shell builtin over an external printf program on Solaris,
+# but without wasting forks for bash or zsh.
+if test -z "$BASH_VERSION$ZSH_VERSION" \
+    && (test "X`print -r -- $as_echo`" = "X$as_echo") 2>/dev/null; then
+  as_echo='print -r --'
+  as_echo_n='print -rn --'
+elif (test "X`printf %s $as_echo`" = "X$as_echo") 2>/dev/null; then
+  as_echo='printf %s\n'
+  as_echo_n='printf %s'
+else
+  if test "X`(/usr/ucb/echo -n -n $as_echo) 2>/dev/null`" = "X-n $as_echo"; then
+    as_echo_body='eval /usr/ucb/echo -n "$1$as_nl"'
+    as_echo_n='/usr/ucb/echo -n'
+  else
+    as_echo_body='eval expr "X$1" : "X\\(.*\\)"'
+    as_echo_n_body='eval
+      arg=$1;
+      case $arg in #(
+      *"$as_nl"*)
+	expr "X$arg" : "X\\(.*\\)$as_nl";
+	arg=`expr "X$arg" : ".*$as_nl\\(.*\\)"`;;
+      esac;
+      expr "X$arg" : "X\\(.*\\)" | tr -d "$as_nl"
+    '
+    export as_echo_n_body
+    as_echo_n='sh -c $as_echo_n_body as_echo'
+  fi
+  export as_echo_body
+  as_echo='sh -c $as_echo_body as_echo'
+fi
+
+# The user is always right.
+if test "${PATH_SEPARATOR+set}" != set; then
+  PATH_SEPARATOR=:
+  (PATH='/bin;/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 && {
+    (PATH='/bin:/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 ||
+      PATH_SEPARATOR=';'
+  }
+fi
+
+
+# IFS
+# We need space, tab and new line, in precisely that order.  Quoting is
+# there to prevent editors from complaining about space-tab.
+# (If _AS_PATH_WALK were called with IFS unset, it would disable word
+# splitting by setting IFS to empty value.)
+IFS=" ""	$as_nl"
+
+# Find who we are.  Look in the path if we contain no directory separator.
+as_myself=
+case $0 in #((
+  *[\\/]* ) as_myself=$0 ;;
+  *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break
+  done
+IFS=$as_save_IFS
+
+     ;;
+esac
+# We did not find ourselves, most probably we were run as `sh COMMAND'
+# in which case we are not to be found in the path.
+if test "x$as_myself" = x; then
+  as_myself=$0
+fi
+if test ! -f "$as_myself"; then
+  $as_echo "$as_myself: error: cannot find myself; rerun with an absolute file name" >&2
+  exit 1
+fi
+
+# Unset variables that we do not need and which cause bugs (e.g. in
+# pre-3.0 UWIN ksh).  But do not cause bugs in bash 2.01; the "|| exit 1"
+# suppresses any "Segmentation fault" message there.  '((' could
+# trigger a bug in pdksh 5.2.14.
+for as_var in BASH_ENV ENV MAIL MAILPATH
+do eval test x\${$as_var+set} = xset \
+  && ( (unset $as_var) || exit 1) >/dev/null 2>&1 && unset $as_var || :
+done
+PS1='$ '
+PS2='> '
+PS4='+ '
+
+# NLS nuisances.
+LC_ALL=C
+export LC_ALL
+LANGUAGE=C
+export LANGUAGE
+
+# CDPATH.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+# Use a proper internal environment variable to ensure we don't fall
+  # into an infinite loop, continuously re-executing ourselves.
+  if test x"${_as_can_reexec}" != xno && test "x$CONFIG_SHELL" != x; then
+    _as_can_reexec=no; export _as_can_reexec;
+    # We cannot yet assume a decent shell, so we have to provide a
+# neutralization value for shells without unset; and this also
+# works around shells that cannot unset nonexistent variables.
+# Preserve -v and -x to the replacement shell.
+BASH_ENV=/dev/null
+ENV=/dev/null
+(unset BASH_ENV) >/dev/null 2>&1 && unset BASH_ENV ENV
+case $- in # ((((
+  *v*x* | *x*v* ) as_opts=-vx ;;
+  *v* ) as_opts=-v ;;
+  *x* ) as_opts=-x ;;
+  * ) as_opts= ;;
+esac
+exec $CONFIG_SHELL $as_opts "$as_myself" ${1+"$@"}
+# Admittedly, this is quite paranoid, since all the known shells bail
+# out after a failed `exec'.
+$as_echo "$0: could not re-execute with $CONFIG_SHELL" >&2
+as_fn_exit 255
+  fi
+  # We don't want this to propagate to other subprocesses.
+          { _as_can_reexec=; unset _as_can_reexec;}
+if test "x$CONFIG_SHELL" = x; then
+  as_bourne_compatible="if test -n \"\${ZSH_VERSION+set}\" && (emulate sh) >/dev/null 2>&1; then :
+  emulate sh
+  NULLCMD=:
+  # Pre-4.2 versions of Zsh do word splitting on \${1+\"\$@\"}, which
+  # is contrary to our usage.  Disable this feature.
+  alias -g '\${1+\"\$@\"}'='\"\$@\"'
+  setopt NO_GLOB_SUBST
+else
+  case \`(set -o) 2>/dev/null\` in #(
+  *posix*) :
+    set -o posix ;; #(
+  *) :
+     ;;
+esac
+fi
+"
+  as_required="as_fn_return () { (exit \$1); }
+as_fn_success () { as_fn_return 0; }
+as_fn_failure () { as_fn_return 1; }
+as_fn_ret_success () { return 0; }
+as_fn_ret_failure () { return 1; }
+
+exitcode=0
+as_fn_success || { exitcode=1; echo as_fn_success failed.; }
+as_fn_failure && { exitcode=1; echo as_fn_failure succeeded.; }
+as_fn_ret_success || { exitcode=1; echo as_fn_ret_success failed.; }
+as_fn_ret_failure && { exitcode=1; echo as_fn_ret_failure succeeded.; }
+if ( set x; as_fn_ret_success y && test x = \"\$1\" ); then :
+
+else
+  exitcode=1; echo positional parameters were not saved.
+fi
+test x\$exitcode = x0 || exit 1
+test -x / || exit 1"
+  as_suggested="  as_lineno_1=";as_suggested=$as_suggested$LINENO;as_suggested=$as_suggested" as_lineno_1a=\$LINENO
+  as_lineno_2=";as_suggested=$as_suggested$LINENO;as_suggested=$as_suggested" as_lineno_2a=\$LINENO
+  eval 'test \"x\$as_lineno_1'\$as_run'\" != \"x\$as_lineno_2'\$as_run'\" &&
+  test \"x\`expr \$as_lineno_1'\$as_run' + 1\`\" = \"x\$as_lineno_2'\$as_run'\"' || exit 1
+
+  test -n \"\${ZSH_VERSION+set}\${BASH_VERSION+set}\" || (
+    ECHO='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+    ECHO=\$ECHO\$ECHO\$ECHO\$ECHO\$ECHO
+    ECHO=\$ECHO\$ECHO\$ECHO\$ECHO\$ECHO\$ECHO
+    PATH=/empty FPATH=/empty; export PATH FPATH
+    test \"X\`printf %s \$ECHO\`\" = \"X\$ECHO\" \\
+      || test \"X\`print -r -- \$ECHO\`\" = \"X\$ECHO\" ) || exit 1
+test \$(( 1 + 1 )) = 2 || exit 1"
+  if (eval "$as_required") 2>/dev/null; then :
+  as_have_required=yes
+else
+  as_have_required=no
+fi
+  if test x$as_have_required = xyes && (eval "$as_suggested") 2>/dev/null; then :
+
+else
+  as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+as_found=false
+for as_dir in /bin$PATH_SEPARATOR/usr/bin$PATH_SEPARATOR$PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+  as_found=:
+  case $as_dir in #(
+	 /*)
+	   for as_base in sh bash ksh sh5; do
+	     # Try only shells that exist, to save several forks.
+	     as_shell=$as_dir/$as_base
+	     if { test -f "$as_shell" || test -f "$as_shell.exe"; } &&
+		    { $as_echo "$as_bourne_compatible""$as_required" | as_run=a "$as_shell"; } 2>/dev/null; then :
+  CONFIG_SHELL=$as_shell as_have_required=yes
+		   if { $as_echo "$as_bourne_compatible""$as_suggested" | as_run=a "$as_shell"; } 2>/dev/null; then :
+  break 2
+fi
+fi
+	   done;;
+       esac
+  as_found=false
+done
+$as_found || { if { test -f "$SHELL" || test -f "$SHELL.exe"; } &&
+	      { $as_echo "$as_bourne_compatible""$as_required" | as_run=a "$SHELL"; } 2>/dev/null; then :
+  CONFIG_SHELL=$SHELL as_have_required=yes
+fi; }
+IFS=$as_save_IFS
+
+
+      if test "x$CONFIG_SHELL" != x; then :
+  export CONFIG_SHELL
+             # We cannot yet assume a decent shell, so we have to provide a
+# neutralization value for shells without unset; and this also
+# works around shells that cannot unset nonexistent variables.
+# Preserve -v and -x to the replacement shell.
+BASH_ENV=/dev/null
+ENV=/dev/null
+(unset BASH_ENV) >/dev/null 2>&1 && unset BASH_ENV ENV
+case $- in # ((((
+  *v*x* | *x*v* ) as_opts=-vx ;;
+  *v* ) as_opts=-v ;;
+  *x* ) as_opts=-x ;;
+  * ) as_opts= ;;
+esac
+exec $CONFIG_SHELL $as_opts "$as_myself" ${1+"$@"}
+# Admittedly, this is quite paranoid, since all the known shells bail
+# out after a failed `exec'.
+$as_echo "$0: could not re-execute with $CONFIG_SHELL" >&2
+exit 255
+fi
+
+    if test x$as_have_required = xno; then :
+  $as_echo "$0: This script requires a shell more modern than all"
+  $as_echo "$0: the shells that I found on your system."
+  if test x${ZSH_VERSION+set} = xset ; then
+    $as_echo "$0: In particular, zsh $ZSH_VERSION has bugs and should"
+    $as_echo "$0: be upgraded to zsh 4.3.4 or later."
+  else
+    $as_echo "$0: Please tell bug-autoconf at gnu.org and petri at digip.org
+$0: about your system, including any error possibly output
+$0: before this message. Then install a modern shell, or
+$0: manually run the script under such a shell if you do
+$0: have one."
+  fi
+  exit 1
+fi
+fi
+fi
+SHELL=${CONFIG_SHELL-/bin/sh}
+export SHELL
+# Unset more variables known to interfere with behavior of common tools.
+CLICOLOR_FORCE= GREP_OPTIONS=
+unset CLICOLOR_FORCE GREP_OPTIONS
+
+## --------------------- ##
+## M4sh Shell Functions. ##
+## --------------------- ##
+# as_fn_unset VAR
+# ---------------
+# Portably unset VAR.
+as_fn_unset ()
+{
+  { eval $1=; unset $1;}
+}
+as_unset=as_fn_unset
+
+# as_fn_set_status STATUS
+# -----------------------
+# Set $? to STATUS, without forking.
+as_fn_set_status ()
+{
+  return $1
+} # as_fn_set_status
+
+# as_fn_exit STATUS
+# -----------------
+# Exit the shell with STATUS, even in a "trap 0" or "set -e" context.
+as_fn_exit ()
+{
+  set +e
+  as_fn_set_status $1
+  exit $1
+} # as_fn_exit
+
+# as_fn_mkdir_p
+# -------------
+# Create "$as_dir" as a directory, including parents if necessary.
+as_fn_mkdir_p ()
+{
+
+  case $as_dir in #(
+  -*) as_dir=./$as_dir;;
+  esac
+  test -d "$as_dir" || eval $as_mkdir_p || {
+    as_dirs=
+    while :; do
+      case $as_dir in #(
+      *\'*) as_qdir=`$as_echo "$as_dir" | sed "s/'/'\\\\\\\\''/g"`;; #'(
+      *) as_qdir=$as_dir;;
+      esac
+      as_dirs="'$as_qdir' $as_dirs"
+      as_dir=`$as_dirname -- "$as_dir" ||
+$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+	 X"$as_dir" : 'X\(//\)[^/]' \| \
+	 X"$as_dir" : 'X\(//\)$' \| \
+	 X"$as_dir" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$as_dir" |
+    sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\/\)[^/].*/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\/\)$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\).*/{
+	    s//\1/
+	    q
+	  }
+	  s/.*/./; q'`
+      test -d "$as_dir" && break
+    done
+    test -z "$as_dirs" || eval "mkdir $as_dirs"
+  } || test -d "$as_dir" || as_fn_error $? "cannot create directory $as_dir"
+
+
+} # as_fn_mkdir_p
+
+# as_fn_executable_p FILE
+# -----------------------
+# Test if FILE is an executable regular file.
+as_fn_executable_p ()
+{
+  test -f "$1" && test -x "$1"
+} # as_fn_executable_p
+# as_fn_append VAR VALUE
+# ----------------------
+# Append the text in VALUE to the end of the definition contained in VAR. Take
+# advantage of any shell optimizations that allow amortized linear growth over
+# repeated appends, instead of the typical quadratic growth present in naive
+# implementations.
+if (eval "as_var=1; as_var+=2; test x\$as_var = x12") 2>/dev/null; then :
+  eval 'as_fn_append ()
+  {
+    eval $1+=\$2
+  }'
+else
+  as_fn_append ()
+  {
+    eval $1=\$$1\$2
+  }
+fi # as_fn_append
+
+# as_fn_arith ARG...
+# ------------------
+# Perform arithmetic evaluation on the ARGs, and store the result in the
+# global $as_val. Take advantage of shells that can avoid forks. The arguments
+# must be portable across $(()) and expr.
+if (eval "test \$(( 1 + 1 )) = 2") 2>/dev/null; then :
+  eval 'as_fn_arith ()
+  {
+    as_val=$(( $* ))
+  }'
+else
+  as_fn_arith ()
+  {
+    as_val=`expr "$@" || test $? -eq 1`
+  }
+fi # as_fn_arith
+
+
+# as_fn_error STATUS ERROR [LINENO LOG_FD]
+# ----------------------------------------
+# Output "`basename $0`: error: ERROR" to stderr. If LINENO and LOG_FD are
+# provided, also output the error to LOG_FD, referencing LINENO. Then exit the
+# script with STATUS, using 1 if that was 0.
+as_fn_error ()
+{
+  as_status=$1; test $as_status -eq 0 && as_status=1
+  if test "$4"; then
+    as_lineno=${as_lineno-"$3"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+    $as_echo "$as_me:${as_lineno-$LINENO}: error: $2" >&$4
+  fi
+  $as_echo "$as_me: error: $2" >&2
+  as_fn_exit $as_status
+} # as_fn_error
+
+if expr a : '\(a\)' >/dev/null 2>&1 &&
+   test "X`expr 00001 : '.*\(...\)'`" = X001; then
+  as_expr=expr
+else
+  as_expr=false
+fi
+
+if (basename -- /) >/dev/null 2>&1 && test "X`basename -- / 2>&1`" = "X/"; then
+  as_basename=basename
+else
+  as_basename=false
+fi
+
+if (as_dir=`dirname -- /` && test "X$as_dir" = X/) >/dev/null 2>&1; then
+  as_dirname=dirname
+else
+  as_dirname=false
+fi
+
+as_me=`$as_basename -- "$0" ||
+$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \
+	 X"$0" : 'X\(//\)$' \| \
+	 X"$0" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X/"$0" |
+    sed '/^.*\/\([^/][^/]*\)\/*$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\/\(\/\/\)$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\/\(\/\).*/{
+	    s//\1/
+	    q
+	  }
+	  s/.*/./; q'`
+
+# Avoid depending upon Character Ranges.
+as_cr_letters='abcdefghijklmnopqrstuvwxyz'
+as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ'
+as_cr_Letters=$as_cr_letters$as_cr_LETTERS
+as_cr_digits='0123456789'
+as_cr_alnum=$as_cr_Letters$as_cr_digits
+
+
+  as_lineno_1=$LINENO as_lineno_1a=$LINENO
+  as_lineno_2=$LINENO as_lineno_2a=$LINENO
+  eval 'test "x$as_lineno_1'$as_run'" != "x$as_lineno_2'$as_run'" &&
+  test "x`expr $as_lineno_1'$as_run' + 1`" = "x$as_lineno_2'$as_run'"' || {
+  # Blame Lee E. McMahon (1931-1989) for sed's syntax.  :-)
+  sed -n '
+    p
+    /[$]LINENO/=
+  ' <$as_myself |
+    sed '
+      s/[$]LINENO.*/&-/
+      t lineno
+      b
+      :lineno
+      N
+      :loop
+      s/[$]LINENO\([^'$as_cr_alnum'_].*\n\)\(.*\)/\2\1\2/
+      t loop
+      s/-\n.*//
+    ' >$as_me.lineno &&
+  chmod +x "$as_me.lineno" ||
+    { $as_echo "$as_me: error: cannot create $as_me.lineno; rerun with a POSIX shell" >&2; as_fn_exit 1; }
+
+  # If we had to re-execute with $CONFIG_SHELL, we're ensured to have
+  # already done that, so ensure we don't try to do so again and fall
+  # in an infinite loop.  This has already happened in practice.
+  _as_can_reexec=no; export _as_can_reexec
+  # Don't try to exec as it changes $[0], causing all sort of problems
+  # (the dirname of $[0] is not the place where we might find the
+  # original and so on.  Autoconf is especially sensitive to this).
+  . "./$as_me.lineno"
+  # Exit status is that of the last command.
+  exit
+}
+
+ECHO_C= ECHO_N= ECHO_T=
+case `echo -n x` in #(((((
+-n*)
+  case `echo 'xy\c'` in
+  *c*) ECHO_T='	';;	# ECHO_T is single tab character.
+  xy)  ECHO_C='\c';;
+  *)   echo `echo ksh88 bug on AIX 6.1` > /dev/null
+       ECHO_T='	';;
+  esac;;
+*)
+  ECHO_N='-n';;
+esac
+
+rm -f conf$$ conf$$.exe conf$$.file
+if test -d conf$$.dir; then
+  rm -f conf$$.dir/conf$$.file
+else
+  rm -f conf$$.dir
+  mkdir conf$$.dir 2>/dev/null
+fi
+if (echo >conf$$.file) 2>/dev/null; then
+  if ln -s conf$$.file conf$$ 2>/dev/null; then
+    as_ln_s='ln -s'
+    # ... but there are two gotchas:
+    # 1) On MSYS, both `ln -s file dir' and `ln file dir' fail.
+    # 2) DJGPP < 2.04 has no symlinks; `ln -s' creates a wrapper executable.
+    # In both cases, we have to default to `cp -pR'.
+    ln -s conf$$.file conf$$.dir 2>/dev/null && test ! -f conf$$.exe ||
+      as_ln_s='cp -pR'
+  elif ln conf$$.file conf$$ 2>/dev/null; then
+    as_ln_s=ln
+  else
+    as_ln_s='cp -pR'
+  fi
+else
+  as_ln_s='cp -pR'
+fi
+rm -f conf$$ conf$$.exe conf$$.dir/conf$$.file conf$$.file
+rmdir conf$$.dir 2>/dev/null
+
+if mkdir -p . 2>/dev/null; then
+  as_mkdir_p='mkdir -p "$as_dir"'
+else
+  test -d ./-p && rmdir ./-p
+  as_mkdir_p=false
+fi
+
+as_test_x='test -x'
+as_executable_p=as_fn_executable_p
+
+# Sed expression to map a string onto a valid CPP name.
+as_tr_cpp="eval sed 'y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g'"
+
+# Sed expression to map a string onto a valid variable name.
+as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'"
+
+SHELL=${CONFIG_SHELL-/bin/sh}
+
+
+test -n "$DJDIR" || exec 7<&0 </dev/null
+exec 6>&1
+
+# Name of the host.
+# hostname on some systems (SVR3.2, old GNU/Linux) returns a bogus exit status,
+# so uname gets run too.
+ac_hostname=`(hostname || uname -n) 2>/dev/null | sed 1q`
+
+#
+# Initializations.
+#
+ac_default_prefix=/usr/local
+ac_clean_files=
+ac_config_libobj_dir=.
+LIBOBJS=
+cross_compiling=no
+subdirs=
+MFLAGS=
+MAKEFLAGS=
+
+# Identity of this package.
+PACKAGE_NAME='jansson'
+PACKAGE_TARNAME='jansson'
+PACKAGE_VERSION='2.7'
+PACKAGE_STRING='jansson 2.7'
+PACKAGE_BUGREPORT='petri at digip.org'
+PACKAGE_URL=''
+
+ac_unique_file="src/value.c"
+# Factoring default headers for most tests.
+ac_includes_default="\
+#include <stdio.h>
+#ifdef HAVE_SYS_TYPES_H
+# include <sys/types.h>
+#endif
+#ifdef HAVE_SYS_STAT_H
+# include <sys/stat.h>
+#endif
+#ifdef STDC_HEADERS
+# include <stdlib.h>
+# include <stddef.h>
+#else
+# ifdef HAVE_STDLIB_H
+#  include <stdlib.h>
+# endif
+#endif
+#ifdef HAVE_STRING_H
+# if !defined STDC_HEADERS && defined HAVE_MEMORY_H
+#  include <memory.h>
+# endif
+# include <string.h>
+#endif
+#ifdef HAVE_STRINGS_H
+# include <strings.h>
+#endif
+#ifdef HAVE_INTTYPES_H
+# include <inttypes.h>
+#endif
+#ifdef HAVE_STDINT_H
+# include <stdint.h>
+#endif
+#ifdef HAVE_UNISTD_H
+# include <unistd.h>
+#endif"
+
+ac_subst_vars='am__EXEEXT_FALSE
+am__EXEEXT_TRUE
+LTLIBOBJS
+LIBOBJS
+AM_CFLAGS
+json_have_localeconv
+json_have_long_long
+json_inline
+GCC_FALSE
+GCC_TRUE
+CPP
+OTOOL64
+OTOOL
+LIPO
+NMEDIT
+DSYMUTIL
+MANIFEST_TOOL
+RANLIB
+ac_ct_AR
+AR
+DLLTOOL
+OBJDUMP
+LN_S
+NM
+ac_ct_DUMPBIN
+DUMPBIN
+LD
+FGREP
+EGREP
+GREP
+SED
+host_os
+host_vendor
+host_cpu
+host
+build_os
+build_vendor
+build_cpu
+build
+LIBTOOL
+am__fastdepCC_FALSE
+am__fastdepCC_TRUE
+CCDEPMODE
+am__nodep
+AMDEPBACKSLASH
+AMDEP_FALSE
+AMDEP_TRUE
+am__quote
+am__include
+DEPDIR
+OBJEXT
+EXEEXT
+ac_ct_CC
+CPPFLAGS
+LDFLAGS
+CFLAGS
+CC
+AM_BACKSLASH
+AM_DEFAULT_VERBOSITY
+AM_DEFAULT_V
+AM_V
+am__untar
+am__tar
+AMTAR
+am__leading_dot
+SET_MAKE
+AWK
+mkdir_p
+MKDIR_P
+INSTALL_STRIP_PROGRAM
+STRIP
+install_sh
+MAKEINFO
+AUTOHEADER
+AUTOMAKE
+AUTOCONF
+ACLOCAL
+VERSION
+PACKAGE
+CYGPATH_W
+am__isrc
+INSTALL_DATA
+INSTALL_SCRIPT
+INSTALL_PROGRAM
+target_alias
+host_alias
+build_alias
+LIBS
+ECHO_T
+ECHO_N
+ECHO_C
+DEFS
+mandir
+localedir
+libdir
+psdir
+pdfdir
+dvidir
+htmldir
+infodir
+docdir
+oldincludedir
+includedir
+localstatedir
+sharedstatedir
+sysconfdir
+datadir
+datarootdir
+libexecdir
+sbindir
+bindir
+program_transform_name
+prefix
+exec_prefix
+PACKAGE_URL
+PACKAGE_BUGREPORT
+PACKAGE_STRING
+PACKAGE_VERSION
+PACKAGE_TARNAME
+PACKAGE_NAME
+PATH_SEPARATOR
+SHELL'
+ac_subst_files=''
+ac_user_opts='
+enable_option_checking
+enable_silent_rules
+enable_dependency_tracking
+enable_shared
+enable_static
+with_pic
+enable_fast_install
+with_gnu_ld
+with_sysroot
+enable_libtool_lock
+enable_urandom
+enable_windows_cryptoapi
+'
+      ac_precious_vars='build_alias
+host_alias
+target_alias
+CC
+CFLAGS
+LDFLAGS
+LIBS
+CPPFLAGS
+CPP'
+
+
+# Initialize some variables set by options.
+ac_init_help=
+ac_init_version=false
+ac_unrecognized_opts=
+ac_unrecognized_sep=
+# The variables have the same names as the options, with
+# dashes changed to underlines.
+cache_file=/dev/null
+exec_prefix=NONE
+no_create=
+no_recursion=
+prefix=NONE
+program_prefix=NONE
+program_suffix=NONE
+program_transform_name=s,x,x,
+silent=
+site=
+srcdir=
+verbose=
+x_includes=NONE
+x_libraries=NONE
+
+# Installation directory options.
+# These are left unexpanded so users can "make install exec_prefix=/foo"
+# and all the variables that are supposed to be based on exec_prefix
+# by default will actually change.
+# Use braces instead of parens because sh, perl, etc. also accept them.
+# (The list follows the same order as the GNU Coding Standards.)
+bindir='${exec_prefix}/bin'
+sbindir='${exec_prefix}/sbin'
+libexecdir='${exec_prefix}/libexec'
+datarootdir='${prefix}/share'
+datadir='${datarootdir}'
+sysconfdir='${prefix}/etc'
+sharedstatedir='${prefix}/com'
+localstatedir='${prefix}/var'
+includedir='${prefix}/include'
+oldincludedir='/usr/include'
+docdir='${datarootdir}/doc/${PACKAGE_TARNAME}'
+infodir='${datarootdir}/info'
+htmldir='${docdir}'
+dvidir='${docdir}'
+pdfdir='${docdir}'
+psdir='${docdir}'
+libdir='${exec_prefix}/lib'
+localedir='${datarootdir}/locale'
+mandir='${datarootdir}/man'
+
+ac_prev=
+ac_dashdash=
+for ac_option
+do
+  # If the previous option needs an argument, assign it.
+  if test -n "$ac_prev"; then
+    eval $ac_prev=\$ac_option
+    ac_prev=
+    continue
+  fi
+
+  case $ac_option in
+  *=?*) ac_optarg=`expr "X$ac_option" : '[^=]*=\(.*\)'` ;;
+  *=)   ac_optarg= ;;
+  *)    ac_optarg=yes ;;
+  esac
+
+  # Accept the important Cygnus configure options, so we can diagnose typos.
+
+  case $ac_dashdash$ac_option in
+  --)
+    ac_dashdash=yes ;;
+
+  -bindir | --bindir | --bindi | --bind | --bin | --bi)
+    ac_prev=bindir ;;
+  -bindir=* | --bindir=* | --bindi=* | --bind=* | --bin=* | --bi=*)
+    bindir=$ac_optarg ;;
+
+  -build | --build | --buil | --bui | --bu)
+    ac_prev=build_alias ;;
+  -build=* | --build=* | --buil=* | --bui=* | --bu=*)
+    build_alias=$ac_optarg ;;
+
+  -cache-file | --cache-file | --cache-fil | --cache-fi \
+  | --cache-f | --cache- | --cache | --cach | --cac | --ca | --c)
+    ac_prev=cache_file ;;
+  -cache-file=* | --cache-file=* | --cache-fil=* | --cache-fi=* \
+  | --cache-f=* | --cache-=* | --cache=* | --cach=* | --cac=* | --ca=* | --c=*)
+    cache_file=$ac_optarg ;;
+
+  --config-cache | -C)
+    cache_file=config.cache ;;
+
+  -datadir | --datadir | --datadi | --datad)
+    ac_prev=datadir ;;
+  -datadir=* | --datadir=* | --datadi=* | --datad=*)
+    datadir=$ac_optarg ;;
+
+  -datarootdir | --datarootdir | --datarootdi | --datarootd | --dataroot \
+  | --dataroo | --dataro | --datar)
+    ac_prev=datarootdir ;;
+  -datarootdir=* | --datarootdir=* | --datarootdi=* | --datarootd=* \
+  | --dataroot=* | --dataroo=* | --dataro=* | --datar=*)
+    datarootdir=$ac_optarg ;;
+
+  -disable-* | --disable-*)
+    ac_useropt=`expr "x$ac_option" : 'x-*disable-\(.*\)'`
+    # Reject names that are not valid shell variable names.
+    expr "x$ac_useropt" : ".*[^-+._$as_cr_alnum]" >/dev/null &&
+      as_fn_error $? "invalid feature name: $ac_useropt"
+    ac_useropt_orig=$ac_useropt
+    ac_useropt=`$as_echo "$ac_useropt" | sed 's/[-+.]/_/g'`
+    case $ac_user_opts in
+      *"
+"enable_$ac_useropt"
+"*) ;;
+      *) ac_unrecognized_opts="$ac_unrecognized_opts$ac_unrecognized_sep--disable-$ac_useropt_orig"
+	 ac_unrecognized_sep=', ';;
+    esac
+    eval enable_$ac_useropt=no ;;
+
+  -docdir | --docdir | --docdi | --doc | --do)
+    ac_prev=docdir ;;
+  -docdir=* | --docdir=* | --docdi=* | --doc=* | --do=*)
+    docdir=$ac_optarg ;;
+
+  -dvidir | --dvidir | --dvidi | --dvid | --dvi | --dv)
+    ac_prev=dvidir ;;
+  -dvidir=* | --dvidir=* | --dvidi=* | --dvid=* | --dvi=* | --dv=*)
+    dvidir=$ac_optarg ;;
+
+  -enable-* | --enable-*)
+    ac_useropt=`expr "x$ac_option" : 'x-*enable-\([^=]*\)'`
+    # Reject names that are not valid shell variable names.
+    expr "x$ac_useropt" : ".*[^-+._$as_cr_alnum]" >/dev/null &&
+      as_fn_error $? "invalid feature name: $ac_useropt"
+    ac_useropt_orig=$ac_useropt
+    ac_useropt=`$as_echo "$ac_useropt" | sed 's/[-+.]/_/g'`
+    case $ac_user_opts in
+      *"
+"enable_$ac_useropt"
+"*) ;;
+      *) ac_unrecognized_opts="$ac_unrecognized_opts$ac_unrecognized_sep--enable-$ac_useropt_orig"
+	 ac_unrecognized_sep=', ';;
+    esac
+    eval enable_$ac_useropt=\$ac_optarg ;;
+
+  -exec-prefix | --exec_prefix | --exec-prefix | --exec-prefi \
+  | --exec-pref | --exec-pre | --exec-pr | --exec-p | --exec- \
+  | --exec | --exe | --ex)
+    ac_prev=exec_prefix ;;
+  -exec-prefix=* | --exec_prefix=* | --exec-prefix=* | --exec-prefi=* \
+  | --exec-pref=* | --exec-pre=* | --exec-pr=* | --exec-p=* | --exec-=* \
+  | --exec=* | --exe=* | --ex=*)
+    exec_prefix=$ac_optarg ;;
+
+  -gas | --gas | --ga | --g)
+    # Obsolete; use --with-gas.
+    with_gas=yes ;;
+
+  -help | --help | --hel | --he | -h)
+    ac_init_help=long ;;
+  -help=r* | --help=r* | --hel=r* | --he=r* | -hr*)
+    ac_init_help=recursive ;;
+  -help=s* | --help=s* | --hel=s* | --he=s* | -hs*)
+    ac_init_help=short ;;
+
+  -host | --host | --hos | --ho)
+    ac_prev=host_alias ;;
+  -host=* | --host=* | --hos=* | --ho=*)
+    host_alias=$ac_optarg ;;
+
+  -htmldir | --htmldir | --htmldi | --htmld | --html | --htm | --ht)
+    ac_prev=htmldir ;;
+  -htmldir=* | --htmldir=* | --htmldi=* | --htmld=* | --html=* | --htm=* \
+  | --ht=*)
+    htmldir=$ac_optarg ;;
+
+  -includedir | --includedir | --includedi | --included | --include \
+  | --includ | --inclu | --incl | --inc)
+    ac_prev=includedir ;;
+  -includedir=* | --includedir=* | --includedi=* | --included=* | --include=* \
+  | --includ=* | --inclu=* | --incl=* | --inc=*)
+    includedir=$ac_optarg ;;
+
+  -infodir | --infodir | --infodi | --infod | --info | --inf)
+    ac_prev=infodir ;;
+  -infodir=* | --infodir=* | --infodi=* | --infod=* | --info=* | --inf=*)
+    infodir=$ac_optarg ;;
+
+  -libdir | --libdir | --libdi | --libd)
+    ac_prev=libdir ;;
+  -libdir=* | --libdir=* | --libdi=* | --libd=*)
+    libdir=$ac_optarg ;;
+
+  -libexecdir | --libexecdir | --libexecdi | --libexecd | --libexec \
+  | --libexe | --libex | --libe)
+    ac_prev=libexecdir ;;
+  -libexecdir=* | --libexecdir=* | --libexecdi=* | --libexecd=* | --libexec=* \
+  | --libexe=* | --libex=* | --libe=*)
+    libexecdir=$ac_optarg ;;
+
+  -localedir | --localedir | --localedi | --localed | --locale)
+    ac_prev=localedir ;;
+  -localedir=* | --localedir=* | --localedi=* | --localed=* | --locale=*)
+    localedir=$ac_optarg ;;
+
+  -localstatedir | --localstatedir | --localstatedi | --localstated \
+  | --localstate | --localstat | --localsta | --localst | --locals)
+    ac_prev=localstatedir ;;
+  -localstatedir=* | --localstatedir=* | --localstatedi=* | --localstated=* \
+  | --localstate=* | --localstat=* | --localsta=* | --localst=* | --locals=*)
+    localstatedir=$ac_optarg ;;
+
+  -mandir | --mandir | --mandi | --mand | --man | --ma | --m)
+    ac_prev=mandir ;;
+  -mandir=* | --mandir=* | --mandi=* | --mand=* | --man=* | --ma=* | --m=*)
+    mandir=$ac_optarg ;;
+
+  -nfp | --nfp | --nf)
+    # Obsolete; use --without-fp.
+    with_fp=no ;;
+
+  -no-create | --no-create | --no-creat | --no-crea | --no-cre \
+  | --no-cr | --no-c | -n)
+    no_create=yes ;;
+
+  -no-recursion | --no-recursion | --no-recursio | --no-recursi \
+  | --no-recurs | --no-recur | --no-recu | --no-rec | --no-re | --no-r)
+    no_recursion=yes ;;
+
+  -oldincludedir | --oldincludedir | --oldincludedi | --oldincluded \
+  | --oldinclude | --oldinclud | --oldinclu | --oldincl | --oldinc \
+  | --oldin | --oldi | --old | --ol | --o)
+    ac_prev=oldincludedir ;;
+  -oldincludedir=* | --oldincludedir=* | --oldincludedi=* | --oldincluded=* \
+  | --oldinclude=* | --oldinclud=* | --oldinclu=* | --oldincl=* | --oldinc=* \
+  | --oldin=* | --oldi=* | --old=* | --ol=* | --o=*)
+    oldincludedir=$ac_optarg ;;
+
+  -prefix | --prefix | --prefi | --pref | --pre | --pr | --p)
+    ac_prev=prefix ;;
+  -prefix=* | --prefix=* | --prefi=* | --pref=* | --pre=* | --pr=* | --p=*)
+    prefix=$ac_optarg ;;
+
+  -program-prefix | --program-prefix | --program-prefi | --program-pref \
+  | --program-pre | --program-pr | --program-p)
+    ac_prev=program_prefix ;;
+  -program-prefix=* | --program-prefix=* | --program-prefi=* \
+  | --program-pref=* | --program-pre=* | --program-pr=* | --program-p=*)
+    program_prefix=$ac_optarg ;;
+
+  -program-suffix | --program-suffix | --program-suffi | --program-suff \
+  | --program-suf | --program-su | --program-s)
+    ac_prev=program_suffix ;;
+  -program-suffix=* | --program-suffix=* | --program-suffi=* \
+  | --program-suff=* | --program-suf=* | --program-su=* | --program-s=*)
+    program_suffix=$ac_optarg ;;
+
+  -program-transform-name | --program-transform-name \
+  | --program-transform-nam | --program-transform-na \
+  | --program-transform-n | --program-transform- \
+  | --program-transform | --program-transfor \
+  | --program-transfo | --program-transf \
+  | --program-trans | --program-tran \
+  | --progr-tra | --program-tr | --program-t)
+    ac_prev=program_transform_name ;;
+  -program-transform-name=* | --program-transform-name=* \
+  | --program-transform-nam=* | --program-transform-na=* \
+  | --program-transform-n=* | --program-transform-=* \
+  | --program-transform=* | --program-transfor=* \
+  | --program-transfo=* | --program-transf=* \
+  | --program-trans=* | --program-tran=* \
+  | --progr-tra=* | --program-tr=* | --program-t=*)
+    program_transform_name=$ac_optarg ;;
+
+  -pdfdir | --pdfdir | --pdfdi | --pdfd | --pdf | --pd)
+    ac_prev=pdfdir ;;
+  -pdfdir=* | --pdfdir=* | --pdfdi=* | --pdfd=* | --pdf=* | --pd=*)
+    pdfdir=$ac_optarg ;;
+
+  -psdir | --psdir | --psdi | --psd | --ps)
+    ac_prev=psdir ;;
+  -psdir=* | --psdir=* | --psdi=* | --psd=* | --ps=*)
+    psdir=$ac_optarg ;;
+
+  -q | -quiet | --quiet | --quie | --qui | --qu | --q \
+  | -silent | --silent | --silen | --sile | --sil)
+    silent=yes ;;
+
+  -sbindir | --sbindir | --sbindi | --sbind | --sbin | --sbi | --sb)
+    ac_prev=sbindir ;;
+  -sbindir=* | --sbindir=* | --sbindi=* | --sbind=* | --sbin=* \
+  | --sbi=* | --sb=*)
+    sbindir=$ac_optarg ;;
+
+  -sharedstatedir | --sharedstatedir | --sharedstatedi \
+  | --sharedstated | --sharedstate | --sharedstat | --sharedsta \
+  | --sharedst | --shareds | --shared | --share | --shar \
+  | --sha | --sh)
+    ac_prev=sharedstatedir ;;
+  -sharedstatedir=* | --sharedstatedir=* | --sharedstatedi=* \
+  | --sharedstated=* | --sharedstate=* | --sharedstat=* | --sharedsta=* \
+  | --sharedst=* | --shareds=* | --shared=* | --share=* | --shar=* \
+  | --sha=* | --sh=*)
+    sharedstatedir=$ac_optarg ;;
+
+  -site | --site | --sit)
+    ac_prev=site ;;
+  -site=* | --site=* | --sit=*)
+    site=$ac_optarg ;;
+
+  -srcdir | --srcdir | --srcdi | --srcd | --src | --sr)
+    ac_prev=srcdir ;;
+  -srcdir=* | --srcdir=* | --srcdi=* | --srcd=* | --src=* | --sr=*)
+    srcdir=$ac_optarg ;;
+
+  -sysconfdir | --sysconfdir | --sysconfdi | --sysconfd | --sysconf \
+  | --syscon | --sysco | --sysc | --sys | --sy)
+    ac_prev=sysconfdir ;;
+  -sysconfdir=* | --sysconfdir=* | --sysconfdi=* | --sysconfd=* | --sysconf=* \
+  | --syscon=* | --sysco=* | --sysc=* | --sys=* | --sy=*)
+    sysconfdir=$ac_optarg ;;
+
+  -target | --target | --targe | --targ | --tar | --ta | --t)
+    ac_prev=target_alias ;;
+  -target=* | --target=* | --targe=* | --targ=* | --tar=* | --ta=* | --t=*)
+    target_alias=$ac_optarg ;;
+
+  -v | -verbose | --verbose | --verbos | --verbo | --verb)
+    verbose=yes ;;
+
+  -version | --version | --versio | --versi | --vers | -V)
+    ac_init_version=: ;;
+
+  -with-* | --with-*)
+    ac_useropt=`expr "x$ac_option" : 'x-*with-\([^=]*\)'`
+    # Reject names that are not valid shell variable names.
+    expr "x$ac_useropt" : ".*[^-+._$as_cr_alnum]" >/dev/null &&
+      as_fn_error $? "invalid package name: $ac_useropt"
+    ac_useropt_orig=$ac_useropt
+    ac_useropt=`$as_echo "$ac_useropt" | sed 's/[-+.]/_/g'`
+    case $ac_user_opts in
+      *"
+"with_$ac_useropt"
+"*) ;;
+      *) ac_unrecognized_opts="$ac_unrecognized_opts$ac_unrecognized_sep--with-$ac_useropt_orig"
+	 ac_unrecognized_sep=', ';;
+    esac
+    eval with_$ac_useropt=\$ac_optarg ;;
+
+  -without-* | --without-*)
+    ac_useropt=`expr "x$ac_option" : 'x-*without-\(.*\)'`
+    # Reject names that are not valid shell variable names.
+    expr "x$ac_useropt" : ".*[^-+._$as_cr_alnum]" >/dev/null &&
+      as_fn_error $? "invalid package name: $ac_useropt"
+    ac_useropt_orig=$ac_useropt
+    ac_useropt=`$as_echo "$ac_useropt" | sed 's/[-+.]/_/g'`
+    case $ac_user_opts in
+      *"
+"with_$ac_useropt"
+"*) ;;
+      *) ac_unrecognized_opts="$ac_unrecognized_opts$ac_unrecognized_sep--without-$ac_useropt_orig"
+	 ac_unrecognized_sep=', ';;
+    esac
+    eval with_$ac_useropt=no ;;
+
+  --x)
+    # Obsolete; use --with-x.
+    with_x=yes ;;
+
+  -x-includes | --x-includes | --x-include | --x-includ | --x-inclu \
+  | --x-incl | --x-inc | --x-in | --x-i)
+    ac_prev=x_includes ;;
+  -x-includes=* | --x-includes=* | --x-include=* | --x-includ=* | --x-inclu=* \
+  | --x-incl=* | --x-inc=* | --x-in=* | --x-i=*)
+    x_includes=$ac_optarg ;;
+
+  -x-libraries | --x-libraries | --x-librarie | --x-librari \
+  | --x-librar | --x-libra | --x-libr | --x-lib | --x-li | --x-l)
+    ac_prev=x_libraries ;;
+  -x-libraries=* | --x-libraries=* | --x-librarie=* | --x-librari=* \
+  | --x-librar=* | --x-libra=* | --x-libr=* | --x-lib=* | --x-li=* | --x-l=*)
+    x_libraries=$ac_optarg ;;
+
+  -*) as_fn_error $? "unrecognized option: \`$ac_option'
+Try \`$0 --help' for more information"
+    ;;
+
+  *=*)
+    ac_envvar=`expr "x$ac_option" : 'x\([^=]*\)='`
+    # Reject names that are not valid shell variable names.
+    case $ac_envvar in #(
+      '' | [0-9]* | *[!_$as_cr_alnum]* )
+      as_fn_error $? "invalid variable name: \`$ac_envvar'" ;;
+    esac
+    eval $ac_envvar=\$ac_optarg
+    export $ac_envvar ;;
+
+  *)
+    # FIXME: should be removed in autoconf 3.0.
+    $as_echo "$as_me: WARNING: you should use --build, --host, --target" >&2
+    expr "x$ac_option" : ".*[^-._$as_cr_alnum]" >/dev/null &&
+      $as_echo "$as_me: WARNING: invalid host type: $ac_option" >&2
+    : "${build_alias=$ac_option} ${host_alias=$ac_option} ${target_alias=$ac_option}"
+    ;;
+
+  esac
+done
+
+if test -n "$ac_prev"; then
+  ac_option=--`echo $ac_prev | sed 's/_/-/g'`
+  as_fn_error $? "missing argument to $ac_option"
+fi
+
+if test -n "$ac_unrecognized_opts"; then
+  case $enable_option_checking in
+    no) ;;
+    fatal) as_fn_error $? "unrecognized options: $ac_unrecognized_opts" ;;
+    *)     $as_echo "$as_me: WARNING: unrecognized options: $ac_unrecognized_opts" >&2 ;;
+  esac
+fi
+
+# Check all directory arguments for consistency.
+for ac_var in	exec_prefix prefix bindir sbindir libexecdir datarootdir \
+		datadir sysconfdir sharedstatedir localstatedir includedir \
+		oldincludedir docdir infodir htmldir dvidir pdfdir psdir \
+		libdir localedir mandir
+do
+  eval ac_val=\$$ac_var
+  # Remove trailing slashes.
+  case $ac_val in
+    */ )
+      ac_val=`expr "X$ac_val" : 'X\(.*[^/]\)' \| "X$ac_val" : 'X\(.*\)'`
+      eval $ac_var=\$ac_val;;
+  esac
+  # Be sure to have absolute directory names.
+  case $ac_val in
+    [\\/$]* | ?:[\\/]* )  continue;;
+    NONE | '' ) case $ac_var in *prefix ) continue;; esac;;
+  esac
+  as_fn_error $? "expected an absolute directory name for --$ac_var: $ac_val"
+done
+
+# There might be people who depend on the old broken behavior: `$host'
+# used to hold the argument of --host etc.
+# FIXME: To remove some day.
+build=$build_alias
+host=$host_alias
+target=$target_alias
+
+# FIXME: To remove some day.
+if test "x$host_alias" != x; then
+  if test "x$build_alias" = x; then
+    cross_compiling=maybe
+  elif test "x$build_alias" != "x$host_alias"; then
+    cross_compiling=yes
+  fi
+fi
+
+ac_tool_prefix=
+test -n "$host_alias" && ac_tool_prefix=$host_alias-
+
+test "$silent" = yes && exec 6>/dev/null
+
+
+ac_pwd=`pwd` && test -n "$ac_pwd" &&
+ac_ls_di=`ls -di .` &&
+ac_pwd_ls_di=`cd "$ac_pwd" && ls -di .` ||
+  as_fn_error $? "working directory cannot be determined"
+test "X$ac_ls_di" = "X$ac_pwd_ls_di" ||
+  as_fn_error $? "pwd does not report name of working directory"
+
+
+# Find the source files, if location was not specified.
+if test -z "$srcdir"; then
+  ac_srcdir_defaulted=yes
+  # Try the directory containing this script, then the parent directory.
+  ac_confdir=`$as_dirname -- "$as_myself" ||
+$as_expr X"$as_myself" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+	 X"$as_myself" : 'X\(//\)[^/]' \| \
+	 X"$as_myself" : 'X\(//\)$' \| \
+	 X"$as_myself" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$as_myself" |
+    sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\/\)[^/].*/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\/\)$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\).*/{
+	    s//\1/
+	    q
+	  }
+	  s/.*/./; q'`
+  srcdir=$ac_confdir
+  if test ! -r "$srcdir/$ac_unique_file"; then
+    srcdir=..
+  fi
+else
+  ac_srcdir_defaulted=no
+fi
+if test ! -r "$srcdir/$ac_unique_file"; then
+  test "$ac_srcdir_defaulted" = yes && srcdir="$ac_confdir or .."
+  as_fn_error $? "cannot find sources ($ac_unique_file) in $srcdir"
+fi
+ac_msg="sources are in $srcdir, but \`cd $srcdir' does not work"
+ac_abs_confdir=`(
+	cd "$srcdir" && test -r "./$ac_unique_file" || as_fn_error $? "$ac_msg"
+	pwd)`
+# When building in place, set srcdir=.
+if test "$ac_abs_confdir" = "$ac_pwd"; then
+  srcdir=.
+fi
+# Remove unnecessary trailing slashes from srcdir.
+# Double slashes in file names in object file debugging info
+# mess up M-x gdb in Emacs.
+case $srcdir in
+*/) srcdir=`expr "X$srcdir" : 'X\(.*[^/]\)' \| "X$srcdir" : 'X\(.*\)'`;;
+esac
+for ac_var in $ac_precious_vars; do
+  eval ac_env_${ac_var}_set=\${${ac_var}+set}
+  eval ac_env_${ac_var}_value=\$${ac_var}
+  eval ac_cv_env_${ac_var}_set=\${${ac_var}+set}
+  eval ac_cv_env_${ac_var}_value=\$${ac_var}
+done
+
+#
+# Report the --help message.
+#
+if test "$ac_init_help" = "long"; then
+  # Omit some internal or obsolete options to make the list less imposing.
+  # This message is too long to be a string in the A/UX 3.1 sh.
+  cat <<_ACEOF
+\`configure' configures jansson 2.7 to adapt to many kinds of systems.
+
+Usage: $0 [OPTION]... [VAR=VALUE]...
+
+To assign environment variables (e.g., CC, CFLAGS...), specify them as
+VAR=VALUE.  See below for descriptions of some of the useful variables.
+
+Defaults for the options are specified in brackets.
+
+Configuration:
+  -h, --help              display this help and exit
+      --help=short        display options specific to this package
+      --help=recursive    display the short help of all the included packages
+  -V, --version           display version information and exit
+  -q, --quiet, --silent   do not print \`checking ...' messages
+      --cache-file=FILE   cache test results in FILE [disabled]
+  -C, --config-cache      alias for \`--cache-file=config.cache'
+  -n, --no-create         do not create output files
+      --srcdir=DIR        find the sources in DIR [configure dir or \`..']
+
+Installation directories:
+  --prefix=PREFIX         install architecture-independent files in PREFIX
+                          [$ac_default_prefix]
+  --exec-prefix=EPREFIX   install architecture-dependent files in EPREFIX
+                          [PREFIX]
+
+By default, \`make install' will install all the files in
+\`$ac_default_prefix/bin', \`$ac_default_prefix/lib' etc.  You can specify
+an installation prefix other than \`$ac_default_prefix' using \`--prefix',
+for instance \`--prefix=\$HOME'.
+
+For better control, use the options below.
+
+Fine tuning of the installation directories:
+  --bindir=DIR            user executables [EPREFIX/bin]
+  --sbindir=DIR           system admin executables [EPREFIX/sbin]
+  --libexecdir=DIR        program executables [EPREFIX/libexec]
+  --sysconfdir=DIR        read-only single-machine data [PREFIX/etc]
+  --sharedstatedir=DIR    modifiable architecture-independent data [PREFIX/com]
+  --localstatedir=DIR     modifiable single-machine data [PREFIX/var]
+  --libdir=DIR            object code libraries [EPREFIX/lib]
+  --includedir=DIR        C header files [PREFIX/include]
+  --oldincludedir=DIR     C header files for non-gcc [/usr/include]
+  --datarootdir=DIR       read-only arch.-independent data root [PREFIX/share]
+  --datadir=DIR           read-only architecture-independent data [DATAROOTDIR]
+  --infodir=DIR           info documentation [DATAROOTDIR/info]
+  --localedir=DIR         locale-dependent data [DATAROOTDIR/locale]
+  --mandir=DIR            man documentation [DATAROOTDIR/man]
+  --docdir=DIR            documentation root [DATAROOTDIR/doc/jansson]
+  --htmldir=DIR           html documentation [DOCDIR]
+  --dvidir=DIR            dvi documentation [DOCDIR]
+  --pdfdir=DIR            pdf documentation [DOCDIR]
+  --psdir=DIR             ps documentation [DOCDIR]
+_ACEOF
+
+  cat <<\_ACEOF
+
+Program names:
+  --program-prefix=PREFIX            prepend PREFIX to installed program names
+  --program-suffix=SUFFIX            append SUFFIX to installed program names
+  --program-transform-name=PROGRAM   run sed PROGRAM on installed program names
+
+System types:
+  --build=BUILD     configure for building on BUILD [guessed]
+  --host=HOST       cross-compile to build programs to run on HOST [BUILD]
+_ACEOF
+fi
+
+if test -n "$ac_init_help"; then
+  case $ac_init_help in
+     short | recursive ) echo "Configuration of jansson 2.7:";;
+   esac
+  cat <<\_ACEOF
+
+Optional Features:
+  --disable-option-checking  ignore unrecognized --enable/--with options
+  --disable-FEATURE       do not include FEATURE (same as --enable-FEATURE=no)
+  --enable-FEATURE[=ARG]  include FEATURE [ARG=yes]
+  --enable-silent-rules   less verbose build output (undo: "make V=1")
+  --disable-silent-rules  verbose build output (undo: "make V=0")
+  --enable-dependency-tracking
+                          do not reject slow dependency extractors
+  --disable-dependency-tracking
+                          speeds up one-time build
+  --enable-shared[=PKGS]  build shared libraries [default=yes]
+  --enable-static[=PKGS]  build static libraries [default=yes]
+  --enable-fast-install[=PKGS]
+                          optimize for fast installation [default=yes]
+  --disable-libtool-lock  avoid locking (might break parallel builds)
+  --disable-urandom       Don't use /dev/urandom to seed the hash function
+  --disable-windows-cryptoapi
+                          Don't use CryptGenRandom to seed the hash function
+
+Optional Packages:
+  --with-PACKAGE[=ARG]    use PACKAGE [ARG=yes]
+  --without-PACKAGE       do not use PACKAGE (same as --with-PACKAGE=no)
+  --with-pic[=PKGS]       try to use only PIC/non-PIC objects [default=use
+                          both]
+  --with-gnu-ld           assume the C compiler uses GNU ld [default=no]
+  --with-sysroot=DIR Search for dependent libraries within DIR
+                        (or the compiler's sysroot if not specified).
+
+Some influential environment variables:
+  CC          C compiler command
+  CFLAGS      C compiler flags
+  LDFLAGS     linker flags, e.g. -L<lib dir> if you have libraries in a
+              nonstandard directory <lib dir>
+  LIBS        libraries to pass to the linker, e.g. -l<library>
+  CPPFLAGS    (Objective) C/C++ preprocessor flags, e.g. -I<include dir> if
+              you have headers in a nonstandard directory <include dir>
+  CPP         C preprocessor
+
+Use these variables to override the choices made by `configure' or to help
+it to find libraries and programs with nonstandard names/locations.
+
+Report bugs to <petri at digip.org>.
+_ACEOF
+ac_status=$?
+fi
+
+if test "$ac_init_help" = "recursive"; then
+  # If there are subdirs, report their specific --help.
+  for ac_dir in : $ac_subdirs_all; do test "x$ac_dir" = x: && continue
+    test -d "$ac_dir" ||
+      { cd "$srcdir" && ac_pwd=`pwd` && srcdir=. && test -d "$ac_dir"; } ||
+      continue
+    ac_builddir=.
+
+case "$ac_dir" in
+.) ac_dir_suffix= ac_top_builddir_sub=. ac_top_build_prefix= ;;
+*)
+  ac_dir_suffix=/`$as_echo "$ac_dir" | sed 's|^\.[\\/]||'`
+  # A ".." for each directory in $ac_dir_suffix.
+  ac_top_builddir_sub=`$as_echo "$ac_dir_suffix" | sed 's|/[^\\/]*|/..|g;s|/||'`
+  case $ac_top_builddir_sub in
+  "") ac_top_builddir_sub=. ac_top_build_prefix= ;;
+  *)  ac_top_build_prefix=$ac_top_builddir_sub/ ;;
+  esac ;;
+esac
+ac_abs_top_builddir=$ac_pwd
+ac_abs_builddir=$ac_pwd$ac_dir_suffix
+# for backward compatibility:
+ac_top_builddir=$ac_top_build_prefix
+
+case $srcdir in
+  .)  # We are building in place.
+    ac_srcdir=.
+    ac_top_srcdir=$ac_top_builddir_sub
+    ac_abs_top_srcdir=$ac_pwd ;;
+  [\\/]* | ?:[\\/]* )  # Absolute name.
+    ac_srcdir=$srcdir$ac_dir_suffix;
+    ac_top_srcdir=$srcdir
+    ac_abs_top_srcdir=$srcdir ;;
+  *) # Relative name.
+    ac_srcdir=$ac_top_build_prefix$srcdir$ac_dir_suffix
+    ac_top_srcdir=$ac_top_build_prefix$srcdir
+    ac_abs_top_srcdir=$ac_pwd/$srcdir ;;
+esac
+ac_abs_srcdir=$ac_abs_top_srcdir$ac_dir_suffix
+
+    cd "$ac_dir" || { ac_status=$?; continue; }
+    # Check for guested configure.
+    if test -f "$ac_srcdir/configure.gnu"; then
+      echo &&
+      $SHELL "$ac_srcdir/configure.gnu" --help=recursive
+    elif test -f "$ac_srcdir/configure"; then
+      echo &&
+      $SHELL "$ac_srcdir/configure" --help=recursive
+    else
+      $as_echo "$as_me: WARNING: no configuration information is in $ac_dir" >&2
+    fi || ac_status=$?
+    cd "$ac_pwd" || { ac_status=$?; break; }
+  done
+fi
+
+test -n "$ac_init_help" && exit $ac_status
+if $ac_init_version; then
+  cat <<\_ACEOF
+jansson configure 2.7
+generated by GNU Autoconf 2.69
+
+Copyright (C) 2012 Free Software Foundation, Inc.
+This configure script is free software; the Free Software Foundation
+gives unlimited permission to copy, distribute and modify it.
+_ACEOF
+  exit
+fi
+
+## ------------------------ ##
+## Autoconf initialization. ##
+## ------------------------ ##
+
+# ac_fn_c_try_compile LINENO
+# --------------------------
+# Try to compile conftest.$ac_ext, and return whether this succeeded.
+ac_fn_c_try_compile ()
+{
+  as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+  rm -f conftest.$ac_objext
+  if { { ac_try="$ac_compile"
+case "(($ac_try" in
+  *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+  *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+  (eval "$ac_compile") 2>conftest.err
+  ac_status=$?
+  if test -s conftest.err; then
+    grep -v '^ *+' conftest.err >conftest.er1
+    cat conftest.er1 >&5
+    mv -f conftest.er1 conftest.err
+  fi
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; } && {
+	 test -z "$ac_c_werror_flag" ||
+	 test ! -s conftest.err
+       } && test -s conftest.$ac_objext; then :
+  ac_retval=0
+else
+  $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+	ac_retval=1
+fi
+  eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+  as_fn_set_status $ac_retval
+
+} # ac_fn_c_try_compile
+
+# ac_fn_c_try_link LINENO
+# -----------------------
+# Try to link conftest.$ac_ext, and return whether this succeeded.
+ac_fn_c_try_link ()
+{
+  as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+  rm -f conftest.$ac_objext conftest$ac_exeext
+  if { { ac_try="$ac_link"
+case "(($ac_try" in
+  *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+  *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+  (eval "$ac_link") 2>conftest.err
+  ac_status=$?
+  if test -s conftest.err; then
+    grep -v '^ *+' conftest.err >conftest.er1
+    cat conftest.er1 >&5
+    mv -f conftest.er1 conftest.err
+  fi
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; } && {
+	 test -z "$ac_c_werror_flag" ||
+	 test ! -s conftest.err
+       } && test -s conftest$ac_exeext && {
+	 test "$cross_compiling" = yes ||
+	 test -x conftest$ac_exeext
+       }; then :
+  ac_retval=0
+else
+  $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+	ac_retval=1
+fi
+  # Delete the IPA/IPO (Inter Procedural Analysis/Optimization) information
+  # created by the PGI compiler (conftest_ipa8_conftest.oo), as it would
+  # interfere with the next link command; also delete a directory that is
+  # left behind by Apple's compiler.  We do this before executing the actions.
+  rm -rf conftest.dSYM conftest_ipa8_conftest.oo
+  eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+  as_fn_set_status $ac_retval
+
+} # ac_fn_c_try_link
+
+# ac_fn_c_check_header_compile LINENO HEADER VAR INCLUDES
+# -------------------------------------------------------
+# Tests whether HEADER exists and can be compiled using the include files in
+# INCLUDES, setting the cache variable VAR accordingly.
+ac_fn_c_check_header_compile ()
+{
+  as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5
+$as_echo_n "checking for $2... " >&6; }
+if eval \${$3+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+$4
+#include <$2>
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+  eval "$3=yes"
+else
+  eval "$3=no"
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+eval ac_res=\$$3
+	       { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+  eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+
+} # ac_fn_c_check_header_compile
+
+# ac_fn_c_try_cpp LINENO
+# ----------------------
+# Try to preprocess conftest.$ac_ext, and return whether this succeeded.
+ac_fn_c_try_cpp ()
+{
+  as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+  if { { ac_try="$ac_cpp conftest.$ac_ext"
+case "(($ac_try" in
+  *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+  *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+  (eval "$ac_cpp conftest.$ac_ext") 2>conftest.err
+  ac_status=$?
+  if test -s conftest.err; then
+    grep -v '^ *+' conftest.err >conftest.er1
+    cat conftest.er1 >&5
+    mv -f conftest.er1 conftest.err
+  fi
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; } > conftest.i && {
+	 test -z "$ac_c_preproc_warn_flag$ac_c_werror_flag" ||
+	 test ! -s conftest.err
+       }; then :
+  ac_retval=0
+else
+  $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+    ac_retval=1
+fi
+  eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+  as_fn_set_status $ac_retval
+
+} # ac_fn_c_try_cpp
+
+# ac_fn_c_try_run LINENO
+# ----------------------
+# Try to link conftest.$ac_ext, and return whether this succeeded. Assumes
+# that executables *can* be run.
+ac_fn_c_try_run ()
+{
+  as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+  if { { ac_try="$ac_link"
+case "(($ac_try" in
+  *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+  *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+  (eval "$ac_link") 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; } && { ac_try='./conftest$ac_exeext'
+  { { case "(($ac_try" in
+  *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+  *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+  (eval "$ac_try") 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; }; }; then :
+  ac_retval=0
+else
+  $as_echo "$as_me: program exited with status $ac_status" >&5
+       $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+       ac_retval=$ac_status
+fi
+  rm -rf conftest.dSYM conftest_ipa8_conftest.oo
+  eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+  as_fn_set_status $ac_retval
+
+} # ac_fn_c_try_run
+
+# ac_fn_c_check_func LINENO FUNC VAR
+# ----------------------------------
+# Tests whether FUNC exists, setting the cache variable VAR accordingly
+ac_fn_c_check_func ()
+{
+  as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5
+$as_echo_n "checking for $2... " >&6; }
+if eval \${$3+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+/* Define $2 to an innocuous variant, in case <limits.h> declares $2.
+   For example, HP-UX 11i <limits.h> declares gettimeofday.  */
+#define $2 innocuous_$2
+
+/* System header to define __stub macros and hopefully few prototypes,
+    which can conflict with char $2 (); below.
+    Prefer <limits.h> to <assert.h> if __STDC__ is defined, since
+    <limits.h> exists even on freestanding compilers.  */
+
+#ifdef __STDC__
+# include <limits.h>
+#else
+# include <assert.h>
+#endif
+
+#undef $2
+
+/* Override any GCC internal prototype to avoid an error.
+   Use char because int might match the return type of a GCC
+   builtin and then its argument prototype would still apply.  */
+#ifdef __cplusplus
+extern "C"
+#endif
+char $2 ();
+/* The GNU C library defines this for functions which it implements
+    to always fail with ENOSYS.  Some functions are actually named
+    something starting with __ and the normal name is an alias.  */
+#if defined __stub_$2 || defined __stub___$2
+choke me
+#endif
+
+int
+main ()
+{
+return $2 ();
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+  eval "$3=yes"
+else
+  eval "$3=no"
+fi
+rm -f core conftest.err conftest.$ac_objext \
+    conftest$ac_exeext conftest.$ac_ext
+fi
+eval ac_res=\$$3
+	       { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+  eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+
+} # ac_fn_c_check_func
+
+# ac_fn_c_check_header_mongrel LINENO HEADER VAR INCLUDES
+# -------------------------------------------------------
+# Tests whether HEADER exists, giving a warning if it cannot be compiled using
+# the include files in INCLUDES and setting the cache variable VAR
+# accordingly.
+ac_fn_c_check_header_mongrel ()
+{
+  as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+  if eval \${$3+:} false; then :
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5
+$as_echo_n "checking for $2... " >&6; }
+if eval \${$3+:} false; then :
+  $as_echo_n "(cached) " >&6
+fi
+eval ac_res=\$$3
+	       { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+else
+  # Is the header compilable?
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking $2 usability" >&5
+$as_echo_n "checking $2 usability... " >&6; }
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+$4
+#include <$2>
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+  ac_header_compiler=yes
+else
+  ac_header_compiler=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_header_compiler" >&5
+$as_echo "$ac_header_compiler" >&6; }
+
+# Is the header present?
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking $2 presence" >&5
+$as_echo_n "checking $2 presence... " >&6; }
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+#include <$2>
+_ACEOF
+if ac_fn_c_try_cpp "$LINENO"; then :
+  ac_header_preproc=yes
+else
+  ac_header_preproc=no
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_header_preproc" >&5
+$as_echo "$ac_header_preproc" >&6; }
+
+# So?  What about this header?
+case $ac_header_compiler:$ac_header_preproc:$ac_c_preproc_warn_flag in #((
+  yes:no: )
+    { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: accepted by the compiler, rejected by the preprocessor!" >&5
+$as_echo "$as_me: WARNING: $2: accepted by the compiler, rejected by the preprocessor!" >&2;}
+    { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: proceeding with the compiler's result" >&5
+$as_echo "$as_me: WARNING: $2: proceeding with the compiler's result" >&2;}
+    ;;
+  no:yes:* )
+    { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: present but cannot be compiled" >&5
+$as_echo "$as_me: WARNING: $2: present but cannot be compiled" >&2;}
+    { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2:     check for missing prerequisite headers?" >&5
+$as_echo "$as_me: WARNING: $2:     check for missing prerequisite headers?" >&2;}
+    { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: see the Autoconf documentation" >&5
+$as_echo "$as_me: WARNING: $2: see the Autoconf documentation" >&2;}
+    { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2:     section \"Present But Cannot Be Compiled\"" >&5
+$as_echo "$as_me: WARNING: $2:     section \"Present But Cannot Be Compiled\"" >&2;}
+    { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: proceeding with the compiler's result" >&5
+$as_echo "$as_me: WARNING: $2: proceeding with the compiler's result" >&2;}
+( $as_echo "## ------------------------------ ##
+## Report this to petri at digip.org ##
+## ------------------------------ ##"
+     ) | sed "s/^/$as_me: WARNING:     /" >&2
+    ;;
+esac
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5
+$as_echo_n "checking for $2... " >&6; }
+if eval \${$3+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  eval "$3=\$ac_header_compiler"
+fi
+eval ac_res=\$$3
+	       { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+fi
+  eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+
+} # ac_fn_c_check_header_mongrel
+
+# ac_fn_c_find_intX_t LINENO BITS VAR
+# -----------------------------------
+# Finds a signed integer type with width BITS, setting cache variable VAR
+# accordingly.
+ac_fn_c_find_intX_t ()
+{
+  as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking for int$2_t" >&5
+$as_echo_n "checking for int$2_t... " >&6; }
+if eval \${$3+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  eval "$3=no"
+     # Order is important - never check a type that is potentially smaller
+     # than half of the expected target width.
+     for ac_type in int$2_t 'int' 'long int' \
+	 'long long int' 'short int' 'signed char'; do
+       cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+$ac_includes_default
+	     enum { N = $2 / 2 - 1 };
+int
+main ()
+{
+static int test_array [1 - 2 * !(0 < ($ac_type) ((((($ac_type) 1 << N) << N) - 1) * 2 + 1))];
+test_array [0] = 0;
+return test_array [0];
+
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+$ac_includes_default
+	        enum { N = $2 / 2 - 1 };
+int
+main ()
+{
+static int test_array [1 - 2 * !(($ac_type) ((((($ac_type) 1 << N) << N) - 1) * 2 + 1)
+		 < ($ac_type) ((((($ac_type) 1 << N) << N) - 1) * 2 + 2))];
+test_array [0] = 0;
+return test_array [0];
+
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+
+else
+  case $ac_type in #(
+  int$2_t) :
+    eval "$3=yes" ;; #(
+  *) :
+    eval "$3=\$ac_type" ;;
+esac
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+       if eval test \"x\$"$3"\" = x"no"; then :
+
+else
+  break
+fi
+     done
+fi
+eval ac_res=\$$3
+	       { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+  eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+
+} # ac_fn_c_find_intX_t
+
+# ac_fn_c_find_uintX_t LINENO BITS VAR
+# ------------------------------------
+# Finds an unsigned integer type with width BITS, setting cache variable VAR
+# accordingly.
+ac_fn_c_find_uintX_t ()
+{
+  as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking for uint$2_t" >&5
+$as_echo_n "checking for uint$2_t... " >&6; }
+if eval \${$3+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  eval "$3=no"
+     # Order is important - never check a type that is potentially smaller
+     # than half of the expected target width.
+     for ac_type in uint$2_t 'unsigned int' 'unsigned long int' \
+	 'unsigned long long int' 'unsigned short int' 'unsigned char'; do
+       cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+$ac_includes_default
+int
+main ()
+{
+static int test_array [1 - 2 * !((($ac_type) -1 >> ($2 / 2 - 1)) >> ($2 / 2 - 1) == 3)];
+test_array [0] = 0;
+return test_array [0];
+
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+  case $ac_type in #(
+  uint$2_t) :
+    eval "$3=yes" ;; #(
+  *) :
+    eval "$3=\$ac_type" ;;
+esac
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+       if eval test \"x\$"$3"\" = x"no"; then :
+
+else
+  break
+fi
+     done
+fi
+eval ac_res=\$$3
+	       { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+  eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+
+} # ac_fn_c_find_uintX_t
+cat >config.log <<_ACEOF
+This file contains any messages produced by compilers while
+running configure, to aid debugging if configure makes a mistake.
+
+It was created by jansson $as_me 2.7, which was
+generated by GNU Autoconf 2.69.  Invocation command line was
+
+  $ $0 $@
+
+_ACEOF
+exec 5>>config.log
+{
+cat <<_ASUNAME
+## --------- ##
+## Platform. ##
+## --------- ##
+
+hostname = `(hostname || uname -n) 2>/dev/null | sed 1q`
+uname -m = `(uname -m) 2>/dev/null || echo unknown`
+uname -r = `(uname -r) 2>/dev/null || echo unknown`
+uname -s = `(uname -s) 2>/dev/null || echo unknown`
+uname -v = `(uname -v) 2>/dev/null || echo unknown`
+
+/usr/bin/uname -p = `(/usr/bin/uname -p) 2>/dev/null || echo unknown`
+/bin/uname -X     = `(/bin/uname -X) 2>/dev/null     || echo unknown`
+
+/bin/arch              = `(/bin/arch) 2>/dev/null              || echo unknown`
+/usr/bin/arch -k       = `(/usr/bin/arch -k) 2>/dev/null       || echo unknown`
+/usr/convex/getsysinfo = `(/usr/convex/getsysinfo) 2>/dev/null || echo unknown`
+/usr/bin/hostinfo      = `(/usr/bin/hostinfo) 2>/dev/null      || echo unknown`
+/bin/machine           = `(/bin/machine) 2>/dev/null           || echo unknown`
+/usr/bin/oslevel       = `(/usr/bin/oslevel) 2>/dev/null       || echo unknown`
+/bin/universe          = `(/bin/universe) 2>/dev/null          || echo unknown`
+
+_ASUNAME
+
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    $as_echo "PATH: $as_dir"
+  done
+IFS=$as_save_IFS
+
+} >&5
+
+cat >&5 <<_ACEOF
+
+
+## ----------- ##
+## Core tests. ##
+## ----------- ##
+
+_ACEOF
+
+
+# Keep a trace of the command line.
+# Strip out --no-create and --no-recursion so they do not pile up.
+# Strip out --silent because we don't want to record it for future runs.
+# Also quote any args containing shell meta-characters.
+# Make two passes to allow for proper duplicate-argument suppression.
+ac_configure_args=
+ac_configure_args0=
+ac_configure_args1=
+ac_must_keep_next=false
+for ac_pass in 1 2
+do
+  for ac_arg
+  do
+    case $ac_arg in
+    -no-create | --no-c* | -n | -no-recursion | --no-r*) continue ;;
+    -q | -quiet | --quiet | --quie | --qui | --qu | --q \
+    | -silent | --silent | --silen | --sile | --sil)
+      continue ;;
+    *\'*)
+      ac_arg=`$as_echo "$ac_arg" | sed "s/'/'\\\\\\\\''/g"` ;;
+    esac
+    case $ac_pass in
+    1) as_fn_append ac_configure_args0 " '$ac_arg'" ;;
+    2)
+      as_fn_append ac_configure_args1 " '$ac_arg'"
+      if test $ac_must_keep_next = true; then
+	ac_must_keep_next=false # Got value, back to normal.
+      else
+	case $ac_arg in
+	  *=* | --config-cache | -C | -disable-* | --disable-* \
+	  | -enable-* | --enable-* | -gas | --g* | -nfp | --nf* \
+	  | -q | -quiet | --q* | -silent | --sil* | -v | -verb* \
+	  | -with-* | --with-* | -without-* | --without-* | --x)
+	    case "$ac_configure_args0 " in
+	      "$ac_configure_args1"*" '$ac_arg' "* ) continue ;;
+	    esac
+	    ;;
+	  -* ) ac_must_keep_next=true ;;
+	esac
+      fi
+      as_fn_append ac_configure_args " '$ac_arg'"
+      ;;
+    esac
+  done
+done
+{ ac_configure_args0=; unset ac_configure_args0;}
+{ ac_configure_args1=; unset ac_configure_args1;}
+
+# When interrupted or exit'd, cleanup temporary files, and complete
+# config.log.  We remove comments because anyway the quotes in there
+# would cause problems or look ugly.
+# WARNING: Use '\'' to represent an apostrophe within the trap.
+# WARNING: Do not start the trap code with a newline, due to a FreeBSD 4.0 bug.
+trap 'exit_status=$?
+  # Save into config.log some information that might help in debugging.
+  {
+    echo
+
+    $as_echo "## ---------------- ##
+## Cache variables. ##
+## ---------------- ##"
+    echo
+    # The following way of writing the cache mishandles newlines in values,
+(
+  for ac_var in `(set) 2>&1 | sed -n '\''s/^\([a-zA-Z_][a-zA-Z0-9_]*\)=.*/\1/p'\''`; do
+    eval ac_val=\$$ac_var
+    case $ac_val in #(
+    *${as_nl}*)
+      case $ac_var in #(
+      *_cv_*) { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: cache variable $ac_var contains a newline" >&5
+$as_echo "$as_me: WARNING: cache variable $ac_var contains a newline" >&2;} ;;
+      esac
+      case $ac_var in #(
+      _ | IFS | as_nl) ;; #(
+      BASH_ARGV | BASH_SOURCE) eval $ac_var= ;; #(
+      *) { eval $ac_var=; unset $ac_var;} ;;
+      esac ;;
+    esac
+  done
+  (set) 2>&1 |
+    case $as_nl`(ac_space='\'' '\''; set) 2>&1` in #(
+    *${as_nl}ac_space=\ *)
+      sed -n \
+	"s/'\''/'\''\\\\'\'''\''/g;
+	  s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1='\''\\2'\''/p"
+      ;; #(
+    *)
+      sed -n "/^[_$as_cr_alnum]*_cv_[_$as_cr_alnum]*=/p"
+      ;;
+    esac |
+    sort
+)
+    echo
+
+    $as_echo "## ----------------- ##
+## Output variables. ##
+## ----------------- ##"
+    echo
+    for ac_var in $ac_subst_vars
+    do
+      eval ac_val=\$$ac_var
+      case $ac_val in
+      *\'\''*) ac_val=`$as_echo "$ac_val" | sed "s/'\''/'\''\\\\\\\\'\'''\''/g"`;;
+      esac
+      $as_echo "$ac_var='\''$ac_val'\''"
+    done | sort
+    echo
+
+    if test -n "$ac_subst_files"; then
+      $as_echo "## ------------------- ##
+## File substitutions. ##
+## ------------------- ##"
+      echo
+      for ac_var in $ac_subst_files
+      do
+	eval ac_val=\$$ac_var
+	case $ac_val in
+	*\'\''*) ac_val=`$as_echo "$ac_val" | sed "s/'\''/'\''\\\\\\\\'\'''\''/g"`;;
+	esac
+	$as_echo "$ac_var='\''$ac_val'\''"
+      done | sort
+      echo
+    fi
+
+    if test -s confdefs.h; then
+      $as_echo "## ----------- ##
+## confdefs.h. ##
+## ----------- ##"
+      echo
+      cat confdefs.h
+      echo
+    fi
+    test "$ac_signal" != 0 &&
+      $as_echo "$as_me: caught signal $ac_signal"
+    $as_echo "$as_me: exit $exit_status"
+  } >&5
+  rm -f core *.core core.conftest.* &&
+    rm -f -r conftest* confdefs* conf$$* $ac_clean_files &&
+    exit $exit_status
+' 0
+for ac_signal in 1 2 13 15; do
+  trap 'ac_signal='$ac_signal'; as_fn_exit 1' $ac_signal
+done
+ac_signal=0
+
+# confdefs.h avoids OS command line length limits that DEFS can exceed.
+rm -f -r conftest* confdefs.h
+
+$as_echo "/* confdefs.h */" > confdefs.h
+
+# Predefined preprocessor variables.
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_NAME "$PACKAGE_NAME"
+_ACEOF
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_TARNAME "$PACKAGE_TARNAME"
+_ACEOF
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_VERSION "$PACKAGE_VERSION"
+_ACEOF
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_STRING "$PACKAGE_STRING"
+_ACEOF
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_BUGREPORT "$PACKAGE_BUGREPORT"
+_ACEOF
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_URL "$PACKAGE_URL"
+_ACEOF
+
+
+# Let the site file select an alternate cache file if it wants to.
+# Prefer an explicitly selected file to automatically selected ones.
+ac_site_file1=NONE
+ac_site_file2=NONE
+if test -n "$CONFIG_SITE"; then
+  # We do not want a PATH search for config.site.
+  case $CONFIG_SITE in #((
+    -*)  ac_site_file1=./$CONFIG_SITE;;
+    */*) ac_site_file1=$CONFIG_SITE;;
+    *)   ac_site_file1=./$CONFIG_SITE;;
+  esac
+elif test "x$prefix" != xNONE; then
+  ac_site_file1=$prefix/share/config.site
+  ac_site_file2=$prefix/etc/config.site
+else
+  ac_site_file1=$ac_default_prefix/share/config.site
+  ac_site_file2=$ac_default_prefix/etc/config.site
+fi
+for ac_site_file in "$ac_site_file1" "$ac_site_file2"
+do
+  test "x$ac_site_file" = xNONE && continue
+  if test /dev/null != "$ac_site_file" && test -r "$ac_site_file"; then
+    { $as_echo "$as_me:${as_lineno-$LINENO}: loading site script $ac_site_file" >&5
+$as_echo "$as_me: loading site script $ac_site_file" >&6;}
+    sed 's/^/| /' "$ac_site_file" >&5
+    . "$ac_site_file" \
+      || { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "failed to load site script $ac_site_file
+See \`config.log' for more details" "$LINENO" 5; }
+  fi
+done
+
+if test -r "$cache_file"; then
+  # Some versions of bash will fail to source /dev/null (special files
+  # actually), so we avoid doing that.  DJGPP emulates it as a regular file.
+  if test /dev/null != "$cache_file" && test -f "$cache_file"; then
+    { $as_echo "$as_me:${as_lineno-$LINENO}: loading cache $cache_file" >&5
+$as_echo "$as_me: loading cache $cache_file" >&6;}
+    case $cache_file in
+      [\\/]* | ?:[\\/]* ) . "$cache_file";;
+      *)                      . "./$cache_file";;
+    esac
+  fi
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: creating cache $cache_file" >&5
+$as_echo "$as_me: creating cache $cache_file" >&6;}
+  >$cache_file
+fi
+
+# Check that the precious variables saved in the cache have kept the same
+# value.
+ac_cache_corrupted=false
+for ac_var in $ac_precious_vars; do
+  eval ac_old_set=\$ac_cv_env_${ac_var}_set
+  eval ac_new_set=\$ac_env_${ac_var}_set
+  eval ac_old_val=\$ac_cv_env_${ac_var}_value
+  eval ac_new_val=\$ac_env_${ac_var}_value
+  case $ac_old_set,$ac_new_set in
+    set,)
+      { $as_echo "$as_me:${as_lineno-$LINENO}: error: \`$ac_var' was set to \`$ac_old_val' in the previous run" >&5
+$as_echo "$as_me: error: \`$ac_var' was set to \`$ac_old_val' in the previous run" >&2;}
+      ac_cache_corrupted=: ;;
+    ,set)
+      { $as_echo "$as_me:${as_lineno-$LINENO}: error: \`$ac_var' was not set in the previous run" >&5
+$as_echo "$as_me: error: \`$ac_var' was not set in the previous run" >&2;}
+      ac_cache_corrupted=: ;;
+    ,);;
+    *)
+      if test "x$ac_old_val" != "x$ac_new_val"; then
+	# differences in whitespace do not lead to failure.
+	ac_old_val_w=`echo x $ac_old_val`
+	ac_new_val_w=`echo x $ac_new_val`
+	if test "$ac_old_val_w" != "$ac_new_val_w"; then
+	  { $as_echo "$as_me:${as_lineno-$LINENO}: error: \`$ac_var' has changed since the previous run:" >&5
+$as_echo "$as_me: error: \`$ac_var' has changed since the previous run:" >&2;}
+	  ac_cache_corrupted=:
+	else
+	  { $as_echo "$as_me:${as_lineno-$LINENO}: warning: ignoring whitespace changes in \`$ac_var' since the previous run:" >&5
+$as_echo "$as_me: warning: ignoring whitespace changes in \`$ac_var' since the previous run:" >&2;}
+	  eval $ac_var=\$ac_old_val
+	fi
+	{ $as_echo "$as_me:${as_lineno-$LINENO}:   former value:  \`$ac_old_val'" >&5
+$as_echo "$as_me:   former value:  \`$ac_old_val'" >&2;}
+	{ $as_echo "$as_me:${as_lineno-$LINENO}:   current value: \`$ac_new_val'" >&5
+$as_echo "$as_me:   current value: \`$ac_new_val'" >&2;}
+      fi;;
+  esac
+  # Pass precious variables to config.status.
+  if test "$ac_new_set" = set; then
+    case $ac_new_val in
+    *\'*) ac_arg=$ac_var=`$as_echo "$ac_new_val" | sed "s/'/'\\\\\\\\''/g"` ;;
+    *) ac_arg=$ac_var=$ac_new_val ;;
+    esac
+    case " $ac_configure_args " in
+      *" '$ac_arg' "*) ;; # Avoid dups.  Use of quotes ensures accuracy.
+      *) as_fn_append ac_configure_args " '$ac_arg'" ;;
+    esac
+  fi
+done
+if $ac_cache_corrupted; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+  { $as_echo "$as_me:${as_lineno-$LINENO}: error: changes in the environment can compromise the build" >&5
+$as_echo "$as_me: error: changes in the environment can compromise the build" >&2;}
+  as_fn_error $? "run \`make distclean' and/or \`rm $cache_file' and start over" "$LINENO" 5
+fi
+## -------------------- ##
+## Main body of script. ##
+## -------------------- ##
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+
+
+ac_aux_dir=
+for ac_dir in . "$srcdir"/.; do
+  if test -f "$ac_dir/install-sh"; then
+    ac_aux_dir=$ac_dir
+    ac_install_sh="$ac_aux_dir/install-sh -c"
+    break
+  elif test -f "$ac_dir/install.sh"; then
+    ac_aux_dir=$ac_dir
+    ac_install_sh="$ac_aux_dir/install.sh -c"
+    break
+  elif test -f "$ac_dir/shtool"; then
+    ac_aux_dir=$ac_dir
+    ac_install_sh="$ac_aux_dir/shtool install -c"
+    break
+  fi
+done
+if test -z "$ac_aux_dir"; then
+  as_fn_error $? "cannot find install-sh, install.sh, or shtool in . \"$srcdir\"/." "$LINENO" 5
+fi
+
+# These three variables are undocumented and unsupported,
+# and are intended to be withdrawn in a future Autoconf release.
+# They can cause serious problems if a builder's source tree is in a directory
+# whose full name contains unusual characters.
+ac_config_guess="$SHELL $ac_aux_dir/config.guess"  # Please don't use this var.
+ac_config_sub="$SHELL $ac_aux_dir/config.sub"  # Please don't use this var.
+ac_configure="$SHELL $ac_aux_dir/configure"  # Please don't use this var.
+
+
+am__api_version='1.14'
+
+# Find a good install program.  We prefer a C program (faster),
+# so one script is as good as another.  But avoid the broken or
+# incompatible versions:
+# SysV /etc/install, /usr/sbin/install
+# SunOS /usr/etc/install
+# IRIX /sbin/install
+# AIX /bin/install
+# AmigaOS /C/install, which installs bootblocks on floppy discs
+# AIX 4 /usr/bin/installbsd, which doesn't work without a -g flag
+# AFS /usr/afsws/bin/install, which mishandles nonexistent args
+# SVR4 /usr/ucb/install, which tries to use the nonexistent group "staff"
+# OS/2's system install, which has a completely different semantic
+# ./install, which can be erroneously created by make from ./install.sh.
+# Reject install programs that cannot install multiple files.
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for a BSD-compatible install" >&5
+$as_echo_n "checking for a BSD-compatible install... " >&6; }
+if test -z "$INSTALL"; then
+if ${ac_cv_path_install+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    # Account for people who put trailing slashes in PATH elements.
+case $as_dir/ in #((
+  ./ | .// | /[cC]/* | \
+  /etc/* | /usr/sbin/* | /usr/etc/* | /sbin/* | /usr/afsws/bin/* | \
+  ?:[\\/]os2[\\/]install[\\/]* | ?:[\\/]OS2[\\/]INSTALL[\\/]* | \
+  /usr/ucb/* ) ;;
+  *)
+    # OSF1 and SCO ODT 3.0 have their own names for install.
+    # Don't use installbsd from OSF since it installs stuff as root
+    # by default.
+    for ac_prog in ginstall scoinst install; do
+      for ac_exec_ext in '' $ac_executable_extensions; do
+	if as_fn_executable_p "$as_dir/$ac_prog$ac_exec_ext"; then
+	  if test $ac_prog = install &&
+	    grep dspmsg "$as_dir/$ac_prog$ac_exec_ext" >/dev/null 2>&1; then
+	    # AIX install.  It has an incompatible calling convention.
+	    :
+	  elif test $ac_prog = install &&
+	    grep pwplus "$as_dir/$ac_prog$ac_exec_ext" >/dev/null 2>&1; then
+	    # program-specific install script used by HP pwplus--don't use.
+	    :
+	  else
+	    rm -rf conftest.one conftest.two conftest.dir
+	    echo one > conftest.one
+	    echo two > conftest.two
+	    mkdir conftest.dir
+	    if "$as_dir/$ac_prog$ac_exec_ext" -c conftest.one conftest.two "`pwd`/conftest.dir" &&
+	      test -s conftest.one && test -s conftest.two &&
+	      test -s conftest.dir/conftest.one &&
+	      test -s conftest.dir/conftest.two
+	    then
+	      ac_cv_path_install="$as_dir/$ac_prog$ac_exec_ext -c"
+	      break 3
+	    fi
+	  fi
+	fi
+      done
+    done
+    ;;
+esac
+
+  done
+IFS=$as_save_IFS
+
+rm -rf conftest.one conftest.two conftest.dir
+
+fi
+  if test "${ac_cv_path_install+set}" = set; then
+    INSTALL=$ac_cv_path_install
+  else
+    # As a last resort, use the slow shell script.  Don't cache a
+    # value for INSTALL within a source directory, because that will
+    # break other packages using the cache if that directory is
+    # removed, or if the value is a relative name.
+    INSTALL=$ac_install_sh
+  fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $INSTALL" >&5
+$as_echo "$INSTALL" >&6; }
+
+# Use test -z because SunOS4 sh mishandles braces in ${var-val}.
+# It thinks the first close brace ends the variable substitution.
+test -z "$INSTALL_PROGRAM" && INSTALL_PROGRAM='${INSTALL}'
+
+test -z "$INSTALL_SCRIPT" && INSTALL_SCRIPT='${INSTALL}'
+
+test -z "$INSTALL_DATA" && INSTALL_DATA='${INSTALL} -m 644'
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether build environment is sane" >&5
+$as_echo_n "checking whether build environment is sane... " >&6; }
+# Reject unsafe characters in $srcdir or the absolute working directory
+# name.  Accept space and tab only in the latter.
+am_lf='
+'
+case `pwd` in
+  *[\\\"\#\$\&\'\`$am_lf]*)
+    as_fn_error $? "unsafe absolute working directory name" "$LINENO" 5;;
+esac
+case $srcdir in
+  *[\\\"\#\$\&\'\`$am_lf\ \	]*)
+    as_fn_error $? "unsafe srcdir value: '$srcdir'" "$LINENO" 5;;
+esac
+
+# Do 'set' in a subshell so we don't clobber the current shell's
+# arguments.  Must try -L first in case configure is actually a
+# symlink; some systems play weird games with the mod time of symlinks
+# (eg FreeBSD returns the mod time of the symlink's containing
+# directory).
+if (
+   am_has_slept=no
+   for am_try in 1 2; do
+     echo "timestamp, slept: $am_has_slept" > conftest.file
+     set X `ls -Lt "$srcdir/configure" conftest.file 2> /dev/null`
+     if test "$*" = "X"; then
+	# -L didn't work.
+	set X `ls -t "$srcdir/configure" conftest.file`
+     fi
+     if test "$*" != "X $srcdir/configure conftest.file" \
+	&& test "$*" != "X conftest.file $srcdir/configure"; then
+
+	# If neither matched, then we have a broken ls.  This can happen
+	# if, for instance, CONFIG_SHELL is bash and it inherits a
+	# broken ls alias from the environment.  This has actually
+	# happened.  Such a system could not be considered "sane".
+	as_fn_error $? "ls -t appears to fail.  Make sure there is not a broken
+  alias in your environment" "$LINENO" 5
+     fi
+     if test "$2" = conftest.file || test $am_try -eq 2; then
+       break
+     fi
+     # Just in case.
+     sleep 1
+     am_has_slept=yes
+   done
+   test "$2" = conftest.file
+   )
+then
+   # Ok.
+   :
+else
+   as_fn_error $? "newly created file is older than distributed files!
+Check your system clock" "$LINENO" 5
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+# If we didn't sleep, we still need to ensure time stamps of config.status and
+# generated files are strictly newer.
+am_sleep_pid=
+if grep 'slept: no' conftest.file >/dev/null 2>&1; then
+  ( sleep 1 ) &
+  am_sleep_pid=$!
+fi
+
+rm -f conftest.file
+
+test "$program_prefix" != NONE &&
+  program_transform_name="s&^&$program_prefix&;$program_transform_name"
+# Use a double $ so make ignores it.
+test "$program_suffix" != NONE &&
+  program_transform_name="s&\$&$program_suffix&;$program_transform_name"
+# Double any \ or $.
+# By default was `s,x,x', remove it if useless.
+ac_script='s/[\\$]/&&/g;s/;s,x,x,$//'
+program_transform_name=`$as_echo "$program_transform_name" | sed "$ac_script"`
+
+# expand $ac_aux_dir to an absolute path
+am_aux_dir=`cd $ac_aux_dir && pwd`
+
+if test x"${MISSING+set}" != xset; then
+  case $am_aux_dir in
+  *\ * | *\	*)
+    MISSING="\${SHELL} \"$am_aux_dir/missing\"" ;;
+  *)
+    MISSING="\${SHELL} $am_aux_dir/missing" ;;
+  esac
+fi
+# Use eval to expand $SHELL
+if eval "$MISSING --is-lightweight"; then
+  am_missing_run="$MISSING "
+else
+  am_missing_run=
+  { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: 'missing' script is too old or missing" >&5
+$as_echo "$as_me: WARNING: 'missing' script is too old or missing" >&2;}
+fi
+
+if test x"${install_sh}" != xset; then
+  case $am_aux_dir in
+  *\ * | *\	*)
+    install_sh="\${SHELL} '$am_aux_dir/install-sh'" ;;
+  *)
+    install_sh="\${SHELL} $am_aux_dir/install-sh"
+  esac
+fi
+
+# Installed binaries are usually stripped using 'strip' when the user
+# run "make install-strip".  However 'strip' might not be the right
+# tool to use in cross-compilation environments, therefore Automake
+# will honor the 'STRIP' environment variable to overrule this program.
+if test "$cross_compiling" != no; then
+  if test -n "$ac_tool_prefix"; then
+  # Extract the first word of "${ac_tool_prefix}strip", so it can be a program name with args.
+set dummy ${ac_tool_prefix}strip; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_STRIP+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$STRIP"; then
+  ac_cv_prog_STRIP="$STRIP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_STRIP="${ac_tool_prefix}strip"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+STRIP=$ac_cv_prog_STRIP
+if test -n "$STRIP"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $STRIP" >&5
+$as_echo "$STRIP" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_STRIP"; then
+  ac_ct_STRIP=$STRIP
+  # Extract the first word of "strip", so it can be a program name with args.
+set dummy strip; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_STRIP+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$ac_ct_STRIP"; then
+  ac_cv_prog_ac_ct_STRIP="$ac_ct_STRIP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_ac_ct_STRIP="strip"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_STRIP=$ac_cv_prog_ac_ct_STRIP
+if test -n "$ac_ct_STRIP"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_STRIP" >&5
+$as_echo "$ac_ct_STRIP" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+  if test "x$ac_ct_STRIP" = x; then
+    STRIP=":"
+  else
+    case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+    STRIP=$ac_ct_STRIP
+  fi
+else
+  STRIP="$ac_cv_prog_STRIP"
+fi
+
+fi
+INSTALL_STRIP_PROGRAM="\$(install_sh) -c -s"
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for a thread-safe mkdir -p" >&5
+$as_echo_n "checking for a thread-safe mkdir -p... " >&6; }
+if test -z "$MKDIR_P"; then
+  if ${ac_cv_path_mkdir+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH$PATH_SEPARATOR/opt/sfw/bin
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_prog in mkdir gmkdir; do
+	 for ac_exec_ext in '' $ac_executable_extensions; do
+	   as_fn_executable_p "$as_dir/$ac_prog$ac_exec_ext" || continue
+	   case `"$as_dir/$ac_prog$ac_exec_ext" --version 2>&1` in #(
+	     'mkdir (GNU coreutils) '* | \
+	     'mkdir (coreutils) '* | \
+	     'mkdir (fileutils) '4.1*)
+	       ac_cv_path_mkdir=$as_dir/$ac_prog$ac_exec_ext
+	       break 3;;
+	   esac
+	 done
+       done
+  done
+IFS=$as_save_IFS
+
+fi
+
+  test -d ./--version && rmdir ./--version
+  if test "${ac_cv_path_mkdir+set}" = set; then
+    MKDIR_P="$ac_cv_path_mkdir -p"
+  else
+    # As a last resort, use the slow shell script.  Don't cache a
+    # value for MKDIR_P within a source directory, because that will
+    # break other packages using the cache if that directory is
+    # removed, or if the value is a relative name.
+    MKDIR_P="$ac_install_sh -d"
+  fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $MKDIR_P" >&5
+$as_echo "$MKDIR_P" >&6; }
+
+for ac_prog in gawk mawk nawk awk
+do
+  # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_AWK+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$AWK"; then
+  ac_cv_prog_AWK="$AWK" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_AWK="$ac_prog"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+AWK=$ac_cv_prog_AWK
+if test -n "$AWK"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $AWK" >&5
+$as_echo "$AWK" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+  test -n "$AWK" && break
+done
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether ${MAKE-make} sets \$(MAKE)" >&5
+$as_echo_n "checking whether ${MAKE-make} sets \$(MAKE)... " >&6; }
+set x ${MAKE-make}
+ac_make=`$as_echo "$2" | sed 's/+/p/g; s/[^a-zA-Z0-9_]/_/g'`
+if eval \${ac_cv_prog_make_${ac_make}_set+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  cat >conftest.make <<\_ACEOF
+SHELL = /bin/sh
+all:
+	@echo '@@@%%%=$(MAKE)=@@@%%%'
+_ACEOF
+# GNU make sometimes prints "make[1]: Entering ...", which would confuse us.
+case `${MAKE-make} -f conftest.make 2>/dev/null` in
+  *@@@%%%=?*=@@@%%%*)
+    eval ac_cv_prog_make_${ac_make}_set=yes;;
+  *)
+    eval ac_cv_prog_make_${ac_make}_set=no;;
+esac
+rm -f conftest.make
+fi
+if eval test \$ac_cv_prog_make_${ac_make}_set = yes; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+  SET_MAKE=
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+  SET_MAKE="MAKE=${MAKE-make}"
+fi
+
+rm -rf .tst 2>/dev/null
+mkdir .tst 2>/dev/null
+if test -d .tst; then
+  am__leading_dot=.
+else
+  am__leading_dot=_
+fi
+rmdir .tst 2>/dev/null
+
+# Check whether --enable-silent-rules was given.
+if test "${enable_silent_rules+set}" = set; then :
+  enableval=$enable_silent_rules;
+fi
+
+case $enable_silent_rules in # (((
+  yes) AM_DEFAULT_VERBOSITY=0;;
+   no) AM_DEFAULT_VERBOSITY=1;;
+    *) AM_DEFAULT_VERBOSITY=1;;
+esac
+am_make=${MAKE-make}
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $am_make supports nested variables" >&5
+$as_echo_n "checking whether $am_make supports nested variables... " >&6; }
+if ${am_cv_make_support_nested_variables+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if $as_echo 'TRUE=$(BAR$(V))
+BAR0=false
+BAR1=true
+V=1
+am__doit:
+	@$(TRUE)
+.PHONY: am__doit' | $am_make -f - >/dev/null 2>&1; then
+  am_cv_make_support_nested_variables=yes
+else
+  am_cv_make_support_nested_variables=no
+fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $am_cv_make_support_nested_variables" >&5
+$as_echo "$am_cv_make_support_nested_variables" >&6; }
+if test $am_cv_make_support_nested_variables = yes; then
+    AM_V='$(V)'
+  AM_DEFAULT_V='$(AM_DEFAULT_VERBOSITY)'
+else
+  AM_V=$AM_DEFAULT_VERBOSITY
+  AM_DEFAULT_V=$AM_DEFAULT_VERBOSITY
+fi
+AM_BACKSLASH='\'
+
+if test "`cd $srcdir && pwd`" != "`pwd`"; then
+  # Use -I$(srcdir) only when $(srcdir) != ., so that make's output
+  # is not polluted with repeated "-I."
+  am__isrc=' -I$(srcdir)'
+  # test to see if srcdir already configured
+  if test -f $srcdir/config.status; then
+    as_fn_error $? "source directory already configured; run \"make distclean\" there first" "$LINENO" 5
+  fi
+fi
+
+# test whether we have cygpath
+if test -z "$CYGPATH_W"; then
+  if (cygpath --version) >/dev/null 2>/dev/null; then
+    CYGPATH_W='cygpath -w'
+  else
+    CYGPATH_W=echo
+  fi
+fi
+
+
+# Define the identity of the package.
+ PACKAGE='jansson'
+ VERSION='2.7'
+
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE "$PACKAGE"
+_ACEOF
+
+
+cat >>confdefs.h <<_ACEOF
+#define VERSION "$VERSION"
+_ACEOF
+
+# Some tools Automake needs.
+
+ACLOCAL=${ACLOCAL-"${am_missing_run}aclocal-${am__api_version}"}
+
+
+AUTOCONF=${AUTOCONF-"${am_missing_run}autoconf"}
+
+
+AUTOMAKE=${AUTOMAKE-"${am_missing_run}automake-${am__api_version}"}
+
+
+AUTOHEADER=${AUTOHEADER-"${am_missing_run}autoheader"}
+
+
+MAKEINFO=${MAKEINFO-"${am_missing_run}makeinfo"}
+
+# For better backward compatibility.  To be removed once Automake 1.9.x
+# dies out for good.  For more background, see:
+# <http://lists.gnu.org/archive/html/automake/2012-07/msg00001.html>
+# <http://lists.gnu.org/archive/html/automake/2012-07/msg00014.html>
+mkdir_p='$(MKDIR_P)'
+
+# We need awk for the "check" target.  The system "awk" is bad on
+# some platforms.
+# Always define AMTAR for backward compatibility.  Yes, it's still used
+# in the wild :-(  We should find a proper way to deprecate it ...
+AMTAR='$${TAR-tar}'
+
+
+# We'll loop over all known methods to create a tar archive until one works.
+_am_tools='gnutar  pax cpio none'
+
+am__tar='$${TAR-tar} chof - "$$tardir"' am__untar='$${TAR-tar} xf -'
+
+
+
+
+
+
+# POSIX will say in a future version that running "rm -f" with no argument
+# is OK; and we want to be able to make that assumption in our Makefile
+# recipes.  So use an aggressive probe to check that the usage we want is
+# actually supported "in the wild" to an acceptable degree.
+# See automake bug#10828.
+# To make any issue more visible, cause the running configure to be aborted
+# by default if the 'rm' program in use doesn't match our expectations; the
+# user can still override this though.
+if rm -f && rm -fr && rm -rf; then : OK; else
+  cat >&2 <<'END'
+Oops!
+
+Your 'rm' program seems unable to run without file operands specified
+on the command line, even when the '-f' option is present.  This is contrary
+to the behaviour of most rm programs out there, and not conforming with
+the upcoming POSIX standard: <http://austingroupbugs.net/view.php?id=542>
+
+Please tell bug-automake at gnu.org about your system, including the value
+of your $PATH and any error possibly output before this message.  This
+can help us improve future automake versions.
+
+END
+  if test x"$ACCEPT_INFERIOR_RM_PROGRAM" = x"yes"; then
+    echo 'Configuration will proceed anyway, since you have set the' >&2
+    echo 'ACCEPT_INFERIOR_RM_PROGRAM variable to "yes"' >&2
+    echo >&2
+  else
+    cat >&2 <<'END'
+Aborting the configuration process, to ensure you take notice of the issue.
+
+You can download and install GNU coreutils to get an 'rm' implementation
+that behaves properly: <http://www.gnu.org/software/coreutils/>.
+
+If you want to complete the configuration process using your problematic
+'rm' anyway, export the environment variable ACCEPT_INFERIOR_RM_PROGRAM
+to "yes", and re-run configure.
+
+END
+    as_fn_error $? "Your 'rm' program is bad, sorry." "$LINENO" 5
+  fi
+fi
+
+
+ac_config_headers="$ac_config_headers jansson_private_config.h"
+
+
+# Checks for programs.
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+if test -n "$ac_tool_prefix"; then
+  # Extract the first word of "${ac_tool_prefix}gcc", so it can be a program name with args.
+set dummy ${ac_tool_prefix}gcc; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_CC+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$CC"; then
+  ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_CC="${ac_tool_prefix}gcc"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $CC" >&5
+$as_echo "$CC" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_CC"; then
+  ac_ct_CC=$CC
+  # Extract the first word of "gcc", so it can be a program name with args.
+set dummy gcc; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_CC+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$ac_ct_CC"; then
+  ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_ac_ct_CC="gcc"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_CC=$ac_cv_prog_ac_ct_CC
+if test -n "$ac_ct_CC"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_CC" >&5
+$as_echo "$ac_ct_CC" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+  if test "x$ac_ct_CC" = x; then
+    CC=""
+  else
+    case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+    CC=$ac_ct_CC
+  fi
+else
+  CC="$ac_cv_prog_CC"
+fi
+
+if test -z "$CC"; then
+          if test -n "$ac_tool_prefix"; then
+    # Extract the first word of "${ac_tool_prefix}cc", so it can be a program name with args.
+set dummy ${ac_tool_prefix}cc; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_CC+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$CC"; then
+  ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_CC="${ac_tool_prefix}cc"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $CC" >&5
+$as_echo "$CC" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+  fi
+fi
+if test -z "$CC"; then
+  # Extract the first word of "cc", so it can be a program name with args.
+set dummy cc; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_CC+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$CC"; then
+  ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+  ac_prog_rejected=no
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    if test "$as_dir/$ac_word$ac_exec_ext" = "/usr/ucb/cc"; then
+       ac_prog_rejected=yes
+       continue
+     fi
+    ac_cv_prog_CC="cc"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+if test $ac_prog_rejected = yes; then
+  # We found a bogon in the path, so make sure we never use it.
+  set dummy $ac_cv_prog_CC
+  shift
+  if test $# != 0; then
+    # We chose a different compiler from the bogus one.
+    # However, it has the same basename, so the bogon will be chosen
+    # first if we set CC to just the basename; use the full file name.
+    shift
+    ac_cv_prog_CC="$as_dir/$ac_word${1+' '}$@"
+  fi
+fi
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $CC" >&5
+$as_echo "$CC" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$CC"; then
+  if test -n "$ac_tool_prefix"; then
+  for ac_prog in cl.exe
+  do
+    # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args.
+set dummy $ac_tool_prefix$ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_CC+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$CC"; then
+  ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_CC="$ac_tool_prefix$ac_prog"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $CC" >&5
+$as_echo "$CC" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+    test -n "$CC" && break
+  done
+fi
+if test -z "$CC"; then
+  ac_ct_CC=$CC
+  for ac_prog in cl.exe
+do
+  # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_CC+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$ac_ct_CC"; then
+  ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_ac_ct_CC="$ac_prog"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_CC=$ac_cv_prog_ac_ct_CC
+if test -n "$ac_ct_CC"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_CC" >&5
+$as_echo "$ac_ct_CC" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+  test -n "$ac_ct_CC" && break
+done
+
+  if test "x$ac_ct_CC" = x; then
+    CC=""
+  else
+    case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+    CC=$ac_ct_CC
+  fi
+fi
+
+fi
+
+
+test -z "$CC" && { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "no acceptable C compiler found in \$PATH
+See \`config.log' for more details" "$LINENO" 5; }
+
+# Provide some information about the compiler.
+$as_echo "$as_me:${as_lineno-$LINENO}: checking for C compiler version" >&5
+set X $ac_compile
+ac_compiler=$2
+for ac_option in --version -v -V -qversion; do
+  { { ac_try="$ac_compiler $ac_option >&5"
+case "(($ac_try" in
+  *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+  *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+  (eval "$ac_compiler $ac_option >&5") 2>conftest.err
+  ac_status=$?
+  if test -s conftest.err; then
+    sed '10a\
+... rest of stderr output deleted ...
+         10q' conftest.err >conftest.er1
+    cat conftest.er1 >&5
+  fi
+  rm -f conftest.er1 conftest.err
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; }
+done
+
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+int
+main ()
+{
+
+  ;
+  return 0;
+}
+_ACEOF
+ac_clean_files_save=$ac_clean_files
+ac_clean_files="$ac_clean_files a.out a.out.dSYM a.exe b.out"
+# Try to create an executable without -o first, disregard a.out.
+# It will help us diagnose broken compilers, and finding out an intuition
+# of exeext.
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the C compiler works" >&5
+$as_echo_n "checking whether the C compiler works... " >&6; }
+ac_link_default=`$as_echo "$ac_link" | sed 's/ -o *conftest[^ ]*//'`
+
+# The possible output files:
+ac_files="a.out conftest.exe conftest a.exe a_out.exe b.out conftest.*"
+
+ac_rmfiles=
+for ac_file in $ac_files
+do
+  case $ac_file in
+    *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.dSYM | *.o | *.obj ) ;;
+    * ) ac_rmfiles="$ac_rmfiles $ac_file";;
+  esac
+done
+rm -f $ac_rmfiles
+
+if { { ac_try="$ac_link_default"
+case "(($ac_try" in
+  *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+  *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+  (eval "$ac_link_default") 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; }; then :
+  # Autoconf-2.13 could set the ac_cv_exeext variable to `no'.
+# So ignore a value of `no', otherwise this would lead to `EXEEXT = no'
+# in a Makefile.  We should not override ac_cv_exeext if it was cached,
+# so that the user can short-circuit this test for compilers unknown to
+# Autoconf.
+for ac_file in $ac_files ''
+do
+  test -f "$ac_file" || continue
+  case $ac_file in
+    *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.dSYM | *.o | *.obj )
+	;;
+    [ab].out )
+	# We found the default executable, but exeext='' is most
+	# certainly right.
+	break;;
+    *.* )
+	if test "${ac_cv_exeext+set}" = set && test "$ac_cv_exeext" != no;
+	then :; else
+	   ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'`
+	fi
+	# We set ac_cv_exeext here because the later test for it is not
+	# safe: cross compilers may not add the suffix if given an `-o'
+	# argument, so we may need to know it at that point already.
+	# Even if this section looks crufty: it has the advantage of
+	# actually working.
+	break;;
+    * )
+	break;;
+  esac
+done
+test "$ac_cv_exeext" = no && ac_cv_exeext=
+
+else
+  ac_file=''
+fi
+if test -z "$ac_file"; then :
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+$as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+{ { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error 77 "C compiler cannot create executables
+See \`config.log' for more details" "$LINENO" 5; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for C compiler default output file name" >&5
+$as_echo_n "checking for C compiler default output file name... " >&6; }
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_file" >&5
+$as_echo "$ac_file" >&6; }
+ac_exeext=$ac_cv_exeext
+
+rm -f -r a.out a.out.dSYM a.exe conftest$ac_cv_exeext b.out
+ac_clean_files=$ac_clean_files_save
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for suffix of executables" >&5
+$as_echo_n "checking for suffix of executables... " >&6; }
+if { { ac_try="$ac_link"
+case "(($ac_try" in
+  *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+  *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+  (eval "$ac_link") 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; }; then :
+  # If both `conftest.exe' and `conftest' are `present' (well, observable)
+# catch `conftest.exe'.  For instance with Cygwin, `ls conftest' will
+# work properly (i.e., refer to `conftest.exe'), while it won't with
+# `rm'.
+for ac_file in conftest.exe conftest conftest.*; do
+  test -f "$ac_file" || continue
+  case $ac_file in
+    *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.dSYM | *.o | *.obj ) ;;
+    *.* ) ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'`
+	  break;;
+    * ) break;;
+  esac
+done
+else
+  { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "cannot compute suffix of executables: cannot compile and link
+See \`config.log' for more details" "$LINENO" 5; }
+fi
+rm -f conftest conftest$ac_cv_exeext
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_exeext" >&5
+$as_echo "$ac_cv_exeext" >&6; }
+
+rm -f conftest.$ac_ext
+EXEEXT=$ac_cv_exeext
+ac_exeext=$EXEEXT
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+#include <stdio.h>
+int
+main ()
+{
+FILE *f = fopen ("conftest.out", "w");
+ return ferror (f) || fclose (f) != 0;
+
+  ;
+  return 0;
+}
+_ACEOF
+ac_clean_files="$ac_clean_files conftest.out"
+# Check that the compiler produces executables we can run.  If not, either
+# the compiler is broken, or we cross compile.
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether we are cross compiling" >&5
+$as_echo_n "checking whether we are cross compiling... " >&6; }
+if test "$cross_compiling" != yes; then
+  { { ac_try="$ac_link"
+case "(($ac_try" in
+  *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+  *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+  (eval "$ac_link") 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; }
+  if { ac_try='./conftest$ac_cv_exeext'
+  { { case "(($ac_try" in
+  *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+  *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+  (eval "$ac_try") 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; }; }; then
+    cross_compiling=no
+  else
+    if test "$cross_compiling" = maybe; then
+	cross_compiling=yes
+    else
+	{ { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "cannot run C compiled programs.
+If you meant to cross compile, use \`--host'.
+See \`config.log' for more details" "$LINENO" 5; }
+    fi
+  fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $cross_compiling" >&5
+$as_echo "$cross_compiling" >&6; }
+
+rm -f conftest.$ac_ext conftest$ac_cv_exeext conftest.out
+ac_clean_files=$ac_clean_files_save
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for suffix of object files" >&5
+$as_echo_n "checking for suffix of object files... " >&6; }
+if ${ac_cv_objext+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+int
+main ()
+{
+
+  ;
+  return 0;
+}
+_ACEOF
+rm -f conftest.o conftest.obj
+if { { ac_try="$ac_compile"
+case "(($ac_try" in
+  *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+  *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+  (eval "$ac_compile") 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; }; then :
+  for ac_file in conftest.o conftest.obj conftest.*; do
+  test -f "$ac_file" || continue;
+  case $ac_file in
+    *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.dSYM ) ;;
+    *) ac_cv_objext=`expr "$ac_file" : '.*\.\(.*\)'`
+       break;;
+  esac
+done
+else
+  $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+{ { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "cannot compute suffix of object files: cannot compile
+See \`config.log' for more details" "$LINENO" 5; }
+fi
+rm -f conftest.$ac_cv_objext conftest.$ac_ext
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_objext" >&5
+$as_echo "$ac_cv_objext" >&6; }
+OBJEXT=$ac_cv_objext
+ac_objext=$OBJEXT
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether we are using the GNU C compiler" >&5
+$as_echo_n "checking whether we are using the GNU C compiler... " >&6; }
+if ${ac_cv_c_compiler_gnu+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+int
+main ()
+{
+#ifndef __GNUC__
+       choke me
+#endif
+
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+  ac_compiler_gnu=yes
+else
+  ac_compiler_gnu=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+ac_cv_c_compiler_gnu=$ac_compiler_gnu
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_c_compiler_gnu" >&5
+$as_echo "$ac_cv_c_compiler_gnu" >&6; }
+if test $ac_compiler_gnu = yes; then
+  GCC=yes
+else
+  GCC=
+fi
+ac_test_CFLAGS=${CFLAGS+set}
+ac_save_CFLAGS=$CFLAGS
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $CC accepts -g" >&5
+$as_echo_n "checking whether $CC accepts -g... " >&6; }
+if ${ac_cv_prog_cc_g+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  ac_save_c_werror_flag=$ac_c_werror_flag
+   ac_c_werror_flag=yes
+   ac_cv_prog_cc_g=no
+   CFLAGS="-g"
+   cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+int
+main ()
+{
+
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+  ac_cv_prog_cc_g=yes
+else
+  CFLAGS=""
+      cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+int
+main ()
+{
+
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+
+else
+  ac_c_werror_flag=$ac_save_c_werror_flag
+	 CFLAGS="-g"
+	 cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+int
+main ()
+{
+
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+  ac_cv_prog_cc_g=yes
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+   ac_c_werror_flag=$ac_save_c_werror_flag
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_prog_cc_g" >&5
+$as_echo "$ac_cv_prog_cc_g" >&6; }
+if test "$ac_test_CFLAGS" = set; then
+  CFLAGS=$ac_save_CFLAGS
+elif test $ac_cv_prog_cc_g = yes; then
+  if test "$GCC" = yes; then
+    CFLAGS="-g -O2"
+  else
+    CFLAGS="-g"
+  fi
+else
+  if test "$GCC" = yes; then
+    CFLAGS="-O2"
+  else
+    CFLAGS=
+  fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $CC option to accept ISO C89" >&5
+$as_echo_n "checking for $CC option to accept ISO C89... " >&6; }
+if ${ac_cv_prog_cc_c89+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  ac_cv_prog_cc_c89=no
+ac_save_CC=$CC
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+#include <stdarg.h>
+#include <stdio.h>
+struct stat;
+/* Most of the following tests are stolen from RCS 5.7's src/conf.sh.  */
+struct buf { int x; };
+FILE * (*rcsopen) (struct buf *, struct stat *, int);
+static char *e (p, i)
+     char **p;
+     int i;
+{
+  return p[i];
+}
+static char *f (char * (*g) (char **, int), char **p, ...)
+{
+  char *s;
+  va_list v;
+  va_start (v,p);
+  s = g (p, va_arg (v,int));
+  va_end (v);
+  return s;
+}
+
+/* OSF 4.0 Compaq cc is some sort of almost-ANSI by default.  It has
+   function prototypes and stuff, but not '\xHH' hex character constants.
+   These don't provoke an error unfortunately, instead are silently treated
+   as 'x'.  The following induces an error, until -std is added to get
+   proper ANSI mode.  Curiously '\x00'!='x' always comes out true, for an
+   array size at least.  It's necessary to write '\x00'==0 to get something
+   that's true only with -std.  */
+int osf4_cc_array ['\x00' == 0 ? 1 : -1];
+
+/* IBM C 6 for AIX is almost-ANSI by default, but it replaces macro parameters
+   inside strings and character constants.  */
+#define FOO(x) 'x'
+int xlc6_cc_array[FOO(a) == 'x' ? 1 : -1];
+
+int test (int i, double x);
+struct s1 {int (*f) (int a);};
+struct s2 {int (*f) (double a);};
+int pairnames (int, char **, FILE *(*)(struct buf *, struct stat *, int), int, int);
+int argc;
+char **argv;
+int
+main ()
+{
+return f (e, argv, 0) != argv[0]  ||  f (e, argv, 1) != argv[1];
+  ;
+  return 0;
+}
+_ACEOF
+for ac_arg in '' -qlanglvl=extc89 -qlanglvl=ansi -std \
+	-Ae "-Aa -D_HPUX_SOURCE" "-Xc -D__EXTENSIONS__"
+do
+  CC="$ac_save_CC $ac_arg"
+  if ac_fn_c_try_compile "$LINENO"; then :
+  ac_cv_prog_cc_c89=$ac_arg
+fi
+rm -f core conftest.err conftest.$ac_objext
+  test "x$ac_cv_prog_cc_c89" != "xno" && break
+done
+rm -f conftest.$ac_ext
+CC=$ac_save_CC
+
+fi
+# AC_CACHE_VAL
+case "x$ac_cv_prog_cc_c89" in
+  x)
+    { $as_echo "$as_me:${as_lineno-$LINENO}: result: none needed" >&5
+$as_echo "none needed" >&6; } ;;
+  xno)
+    { $as_echo "$as_me:${as_lineno-$LINENO}: result: unsupported" >&5
+$as_echo "unsupported" >&6; } ;;
+  *)
+    CC="$CC $ac_cv_prog_cc_c89"
+    { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_prog_cc_c89" >&5
+$as_echo "$ac_cv_prog_cc_c89" >&6; } ;;
+esac
+if test "x$ac_cv_prog_cc_c89" != xno; then :
+
+fi
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $CC understands -c and -o together" >&5
+$as_echo_n "checking whether $CC understands -c and -o together... " >&6; }
+if ${am_cv_prog_cc_c_o+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+int
+main ()
+{
+
+  ;
+  return 0;
+}
+_ACEOF
+  # Make sure it works both with $CC and with simple cc.
+  # Following AC_PROG_CC_C_O, we do the test twice because some
+  # compilers refuse to overwrite an existing .o file with -o,
+  # though they will create one.
+  am_cv_prog_cc_c_o=yes
+  for am_i in 1 2; do
+    if { echo "$as_me:$LINENO: $CC -c conftest.$ac_ext -o conftest2.$ac_objext" >&5
+   ($CC -c conftest.$ac_ext -o conftest2.$ac_objext) >&5 2>&5
+   ac_status=$?
+   echo "$as_me:$LINENO: \$? = $ac_status" >&5
+   (exit $ac_status); } \
+         && test -f conftest2.$ac_objext; then
+      : OK
+    else
+      am_cv_prog_cc_c_o=no
+      break
+    fi
+  done
+  rm -f core conftest*
+  unset am_i
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $am_cv_prog_cc_c_o" >&5
+$as_echo "$am_cv_prog_cc_c_o" >&6; }
+if test "$am_cv_prog_cc_c_o" != yes; then
+   # Losing compiler, so override with the script.
+   # FIXME: It is wrong to rewrite CC.
+   # But if we don't then we get into trouble of one sort or another.
+   # A longer-term fix would be to have automake use am__CC in this case,
+   # and then we could set am__CC="\$(top_srcdir)/compile \$(CC)"
+   CC="$am_aux_dir/compile $CC"
+fi
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+DEPDIR="${am__leading_dot}deps"
+
+ac_config_commands="$ac_config_commands depfiles"
+
+
+am_make=${MAKE-make}
+cat > confinc << 'END'
+am__doit:
+	@echo this is the am__doit target
+.PHONY: am__doit
+END
+# If we don't find an include directive, just comment out the code.
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for style of include used by $am_make" >&5
+$as_echo_n "checking for style of include used by $am_make... " >&6; }
+am__include="#"
+am__quote=
+_am_result=none
+# First try GNU make style include.
+echo "include confinc" > confmf
+# Ignore all kinds of additional output from 'make'.
+case `$am_make -s -f confmf 2> /dev/null` in #(
+*the\ am__doit\ target*)
+  am__include=include
+  am__quote=
+  _am_result=GNU
+  ;;
+esac
+# Now try BSD make style include.
+if test "$am__include" = "#"; then
+   echo '.include "confinc"' > confmf
+   case `$am_make -s -f confmf 2> /dev/null` in #(
+   *the\ am__doit\ target*)
+     am__include=.include
+     am__quote="\""
+     _am_result=BSD
+     ;;
+   esac
+fi
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $_am_result" >&5
+$as_echo "$_am_result" >&6; }
+rm -f confinc confmf
+
+# Check whether --enable-dependency-tracking was given.
+if test "${enable_dependency_tracking+set}" = set; then :
+  enableval=$enable_dependency_tracking;
+fi
+
+if test "x$enable_dependency_tracking" != xno; then
+  am_depcomp="$ac_aux_dir/depcomp"
+  AMDEPBACKSLASH='\'
+  am__nodep='_no'
+fi
+ if test "x$enable_dependency_tracking" != xno; then
+  AMDEP_TRUE=
+  AMDEP_FALSE='#'
+else
+  AMDEP_TRUE='#'
+  AMDEP_FALSE=
+fi
+
+
+
+depcc="$CC"   am_compiler_list=
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking dependency style of $depcc" >&5
+$as_echo_n "checking dependency style of $depcc... " >&6; }
+if ${am_cv_CC_dependencies_compiler_type+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then
+  # We make a subdir and do the tests there.  Otherwise we can end up
+  # making bogus files that we don't know about and never remove.  For
+  # instance it was reported that on HP-UX the gcc test will end up
+  # making a dummy file named 'D' -- because '-MD' means "put the output
+  # in D".
+  rm -rf conftest.dir
+  mkdir conftest.dir
+  # Copy depcomp to subdir because otherwise we won't find it if we're
+  # using a relative directory.
+  cp "$am_depcomp" conftest.dir
+  cd conftest.dir
+  # We will build objects and dependencies in a subdirectory because
+  # it helps to detect inapplicable dependency modes.  For instance
+  # both Tru64's cc and ICC support -MD to output dependencies as a
+  # side effect of compilation, but ICC will put the dependencies in
+  # the current directory while Tru64 will put them in the object
+  # directory.
+  mkdir sub
+
+  am_cv_CC_dependencies_compiler_type=none
+  if test "$am_compiler_list" = ""; then
+     am_compiler_list=`sed -n 's/^#*\([a-zA-Z0-9]*\))$/\1/p' < ./depcomp`
+  fi
+  am__universal=false
+  case " $depcc " in #(
+     *\ -arch\ *\ -arch\ *) am__universal=true ;;
+     esac
+
+  for depmode in $am_compiler_list; do
+    # Setup a source with many dependencies, because some compilers
+    # like to wrap large dependency lists on column 80 (with \), and
+    # we should not choose a depcomp mode which is confused by this.
+    #
+    # We need to recreate these files for each test, as the compiler may
+    # overwrite some of them when testing with obscure command lines.
+    # This happens at least with the AIX C compiler.
+    : > sub/conftest.c
+    for i in 1 2 3 4 5 6; do
+      echo '#include "conftst'$i'.h"' >> sub/conftest.c
+      # Using ": > sub/conftst$i.h" creates only sub/conftst1.h with
+      # Solaris 10 /bin/sh.
+      echo '/* dummy */' > sub/conftst$i.h
+    done
+    echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf
+
+    # We check with '-c' and '-o' for the sake of the "dashmstdout"
+    # mode.  It turns out that the SunPro C++ compiler does not properly
+    # handle '-M -o', and we need to detect this.  Also, some Intel
+    # versions had trouble with output in subdirs.
+    am__obj=sub/conftest.${OBJEXT-o}
+    am__minus_obj="-o $am__obj"
+    case $depmode in
+    gcc)
+      # This depmode causes a compiler race in universal mode.
+      test "$am__universal" = false || continue
+      ;;
+    nosideeffect)
+      # After this tag, mechanisms are not by side-effect, so they'll
+      # only be used when explicitly requested.
+      if test "x$enable_dependency_tracking" = xyes; then
+	continue
+      else
+	break
+      fi
+      ;;
+    msvc7 | msvc7msys | msvisualcpp | msvcmsys)
+      # This compiler won't grok '-c -o', but also, the minuso test has
+      # not run yet.  These depmodes are late enough in the game, and
+      # so weak that their functioning should not be impacted.
+      am__obj=conftest.${OBJEXT-o}
+      am__minus_obj=
+      ;;
+    none) break ;;
+    esac
+    if depmode=$depmode \
+       source=sub/conftest.c object=$am__obj \
+       depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \
+       $SHELL ./depcomp $depcc -c $am__minus_obj sub/conftest.c \
+         >/dev/null 2>conftest.err &&
+       grep sub/conftst1.h sub/conftest.Po > /dev/null 2>&1 &&
+       grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 &&
+       grep $am__obj sub/conftest.Po > /dev/null 2>&1 &&
+       ${MAKE-make} -s -f confmf > /dev/null 2>&1; then
+      # icc doesn't choke on unknown options, it will just issue warnings
+      # or remarks (even with -Werror).  So we grep stderr for any message
+      # that says an option was ignored or not supported.
+      # When given -MP, icc 7.0 and 7.1 complain thusly:
+      #   icc: Command line warning: ignoring option '-M'; no argument required
+      # The diagnosis changed in icc 8.0:
+      #   icc: Command line remark: option '-MP' not supported
+      if (grep 'ignoring option' conftest.err ||
+          grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else
+        am_cv_CC_dependencies_compiler_type=$depmode
+        break
+      fi
+    fi
+  done
+
+  cd ..
+  rm -rf conftest.dir
+else
+  am_cv_CC_dependencies_compiler_type=none
+fi
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $am_cv_CC_dependencies_compiler_type" >&5
+$as_echo "$am_cv_CC_dependencies_compiler_type" >&6; }
+CCDEPMODE=depmode=$am_cv_CC_dependencies_compiler_type
+
+ if
+  test "x$enable_dependency_tracking" != xno \
+  && test "$am_cv_CC_dependencies_compiler_type" = gcc3; then
+  am__fastdepCC_TRUE=
+  am__fastdepCC_FALSE='#'
+else
+  am__fastdepCC_TRUE='#'
+  am__fastdepCC_FALSE=
+fi
+
+
+case `pwd` in
+  *\ * | *\	*)
+    { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: Libtool does not cope well with whitespace in \`pwd\`" >&5
+$as_echo "$as_me: WARNING: Libtool does not cope well with whitespace in \`pwd\`" >&2;} ;;
+esac
+
+
+
+macro_version='2.4.2'
+macro_revision='1.3337'
+
+
+
+
+
+
+
+
+
+
+
+
+
+ltmain="$ac_aux_dir/ltmain.sh"
+
+# Make sure we can run config.sub.
+$SHELL "$ac_aux_dir/config.sub" sun4 >/dev/null 2>&1 ||
+  as_fn_error $? "cannot run $SHELL $ac_aux_dir/config.sub" "$LINENO" 5
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking build system type" >&5
+$as_echo_n "checking build system type... " >&6; }
+if ${ac_cv_build+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  ac_build_alias=$build_alias
+test "x$ac_build_alias" = x &&
+  ac_build_alias=`$SHELL "$ac_aux_dir/config.guess"`
+test "x$ac_build_alias" = x &&
+  as_fn_error $? "cannot guess build type; you must specify one" "$LINENO" 5
+ac_cv_build=`$SHELL "$ac_aux_dir/config.sub" $ac_build_alias` ||
+  as_fn_error $? "$SHELL $ac_aux_dir/config.sub $ac_build_alias failed" "$LINENO" 5
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_build" >&5
+$as_echo "$ac_cv_build" >&6; }
+case $ac_cv_build in
+*-*-*) ;;
+*) as_fn_error $? "invalid value of canonical build" "$LINENO" 5;;
+esac
+build=$ac_cv_build
+ac_save_IFS=$IFS; IFS='-'
+set x $ac_cv_build
+shift
+build_cpu=$1
+build_vendor=$2
+shift; shift
+# Remember, the first character of IFS is used to create $*,
+# except with old shells:
+build_os=$*
+IFS=$ac_save_IFS
+case $build_os in *\ *) build_os=`echo "$build_os" | sed 's/ /-/g'`;; esac
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking host system type" >&5
+$as_echo_n "checking host system type... " >&6; }
+if ${ac_cv_host+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test "x$host_alias" = x; then
+  ac_cv_host=$ac_cv_build
+else
+  ac_cv_host=`$SHELL "$ac_aux_dir/config.sub" $host_alias` ||
+    as_fn_error $? "$SHELL $ac_aux_dir/config.sub $host_alias failed" "$LINENO" 5
+fi
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_host" >&5
+$as_echo "$ac_cv_host" >&6; }
+case $ac_cv_host in
+*-*-*) ;;
+*) as_fn_error $? "invalid value of canonical host" "$LINENO" 5;;
+esac
+host=$ac_cv_host
+ac_save_IFS=$IFS; IFS='-'
+set x $ac_cv_host
+shift
+host_cpu=$1
+host_vendor=$2
+shift; shift
+# Remember, the first character of IFS is used to create $*,
+# except with old shells:
+host_os=$*
+IFS=$ac_save_IFS
+case $host_os in *\ *) host_os=`echo "$host_os" | sed 's/ /-/g'`;; esac
+
+
+# Backslashify metacharacters that are still active within
+# double-quoted strings.
+sed_quote_subst='s/\(["`$\\]\)/\\\1/g'
+
+# Same as above, but do not quote variable references.
+double_quote_subst='s/\(["`\\]\)/\\\1/g'
+
+# Sed substitution to delay expansion of an escaped shell variable in a
+# double_quote_subst'ed string.
+delay_variable_subst='s/\\\\\\\\\\\$/\\\\\\$/g'
+
+# Sed substitution to delay expansion of an escaped single quote.
+delay_single_quote_subst='s/'\''/'\'\\\\\\\'\''/g'
+
+# Sed substitution to avoid accidental globbing in evaled expressions
+no_glob_subst='s/\*/\\\*/g'
+
+ECHO='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO
+ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO$ECHO
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to print strings" >&5
+$as_echo_n "checking how to print strings... " >&6; }
+# Test print first, because it will be a builtin if present.
+if test "X`( print -r -- -n ) 2>/dev/null`" = X-n && \
+   test "X`print -r -- $ECHO 2>/dev/null`" = "X$ECHO"; then
+  ECHO='print -r --'
+elif test "X`printf %s $ECHO 2>/dev/null`" = "X$ECHO"; then
+  ECHO='printf %s\n'
+else
+  # Use this function as a fallback that always works.
+  func_fallback_echo ()
+  {
+    eval 'cat <<_LTECHO_EOF
+$1
+_LTECHO_EOF'
+  }
+  ECHO='func_fallback_echo'
+fi
+
+# func_echo_all arg...
+# Invoke $ECHO with all args, space-separated.
+func_echo_all ()
+{
+    $ECHO ""
+}
+
+case "$ECHO" in
+  printf*) { $as_echo "$as_me:${as_lineno-$LINENO}: result: printf" >&5
+$as_echo "printf" >&6; } ;;
+  print*) { $as_echo "$as_me:${as_lineno-$LINENO}: result: print -r" >&5
+$as_echo "print -r" >&6; } ;;
+  *) { $as_echo "$as_me:${as_lineno-$LINENO}: result: cat" >&5
+$as_echo "cat" >&6; } ;;
+esac
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for a sed that does not truncate output" >&5
+$as_echo_n "checking for a sed that does not truncate output... " >&6; }
+if ${ac_cv_path_SED+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+            ac_script=s/aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa/bbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbb/
+     for ac_i in 1 2 3 4 5 6 7; do
+       ac_script="$ac_script$as_nl$ac_script"
+     done
+     echo "$ac_script" 2>/dev/null | sed 99q >conftest.sed
+     { ac_script=; unset ac_script;}
+     if test -z "$SED"; then
+  ac_path_SED_found=false
+  # Loop through the user's path and test for each of PROGNAME-LIST
+  as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_prog in sed gsed; do
+    for ac_exec_ext in '' $ac_executable_extensions; do
+      ac_path_SED="$as_dir/$ac_prog$ac_exec_ext"
+      as_fn_executable_p "$ac_path_SED" || continue
+# Check for GNU ac_path_SED and select it if it is found.
+  # Check for GNU $ac_path_SED
+case `"$ac_path_SED" --version 2>&1` in
+*GNU*)
+  ac_cv_path_SED="$ac_path_SED" ac_path_SED_found=:;;
+*)
+  ac_count=0
+  $as_echo_n 0123456789 >"conftest.in"
+  while :
+  do
+    cat "conftest.in" "conftest.in" >"conftest.tmp"
+    mv "conftest.tmp" "conftest.in"
+    cp "conftest.in" "conftest.nl"
+    $as_echo '' >> "conftest.nl"
+    "$ac_path_SED" -f conftest.sed < "conftest.nl" >"conftest.out" 2>/dev/null || break
+    diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break
+    as_fn_arith $ac_count + 1 && ac_count=$as_val
+    if test $ac_count -gt ${ac_path_SED_max-0}; then
+      # Best one so far, save it but keep looking for a better one
+      ac_cv_path_SED="$ac_path_SED"
+      ac_path_SED_max=$ac_count
+    fi
+    # 10*(2^10) chars as input seems more than enough
+    test $ac_count -gt 10 && break
+  done
+  rm -f conftest.in conftest.tmp conftest.nl conftest.out;;
+esac
+
+      $ac_path_SED_found && break 3
+    done
+  done
+  done
+IFS=$as_save_IFS
+  if test -z "$ac_cv_path_SED"; then
+    as_fn_error $? "no acceptable sed could be found in \$PATH" "$LINENO" 5
+  fi
+else
+  ac_cv_path_SED=$SED
+fi
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_SED" >&5
+$as_echo "$ac_cv_path_SED" >&6; }
+ SED="$ac_cv_path_SED"
+  rm -f conftest.sed
+
+test -z "$SED" && SED=sed
+Xsed="$SED -e 1s/^X//"
+
+
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for grep that handles long lines and -e" >&5
+$as_echo_n "checking for grep that handles long lines and -e... " >&6; }
+if ${ac_cv_path_GREP+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -z "$GREP"; then
+  ac_path_GREP_found=false
+  # Loop through the user's path and test for each of PROGNAME-LIST
+  as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH$PATH_SEPARATOR/usr/xpg4/bin
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_prog in grep ggrep; do
+    for ac_exec_ext in '' $ac_executable_extensions; do
+      ac_path_GREP="$as_dir/$ac_prog$ac_exec_ext"
+      as_fn_executable_p "$ac_path_GREP" || continue
+# Check for GNU ac_path_GREP and select it if it is found.
+  # Check for GNU $ac_path_GREP
+case `"$ac_path_GREP" --version 2>&1` in
+*GNU*)
+  ac_cv_path_GREP="$ac_path_GREP" ac_path_GREP_found=:;;
+*)
+  ac_count=0
+  $as_echo_n 0123456789 >"conftest.in"
+  while :
+  do
+    cat "conftest.in" "conftest.in" >"conftest.tmp"
+    mv "conftest.tmp" "conftest.in"
+    cp "conftest.in" "conftest.nl"
+    $as_echo 'GREP' >> "conftest.nl"
+    "$ac_path_GREP" -e 'GREP$' -e '-(cannot match)-' < "conftest.nl" >"conftest.out" 2>/dev/null || break
+    diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break
+    as_fn_arith $ac_count + 1 && ac_count=$as_val
+    if test $ac_count -gt ${ac_path_GREP_max-0}; then
+      # Best one so far, save it but keep looking for a better one
+      ac_cv_path_GREP="$ac_path_GREP"
+      ac_path_GREP_max=$ac_count
+    fi
+    # 10*(2^10) chars as input seems more than enough
+    test $ac_count -gt 10 && break
+  done
+  rm -f conftest.in conftest.tmp conftest.nl conftest.out;;
+esac
+
+      $ac_path_GREP_found && break 3
+    done
+  done
+  done
+IFS=$as_save_IFS
+  if test -z "$ac_cv_path_GREP"; then
+    as_fn_error $? "no acceptable grep could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" "$LINENO" 5
+  fi
+else
+  ac_cv_path_GREP=$GREP
+fi
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_GREP" >&5
+$as_echo "$ac_cv_path_GREP" >&6; }
+ GREP="$ac_cv_path_GREP"
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for egrep" >&5
+$as_echo_n "checking for egrep... " >&6; }
+if ${ac_cv_path_EGREP+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if echo a | $GREP -E '(a|b)' >/dev/null 2>&1
+   then ac_cv_path_EGREP="$GREP -E"
+   else
+     if test -z "$EGREP"; then
+  ac_path_EGREP_found=false
+  # Loop through the user's path and test for each of PROGNAME-LIST
+  as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH$PATH_SEPARATOR/usr/xpg4/bin
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_prog in egrep; do
+    for ac_exec_ext in '' $ac_executable_extensions; do
+      ac_path_EGREP="$as_dir/$ac_prog$ac_exec_ext"
+      as_fn_executable_p "$ac_path_EGREP" || continue
+# Check for GNU ac_path_EGREP and select it if it is found.
+  # Check for GNU $ac_path_EGREP
+case `"$ac_path_EGREP" --version 2>&1` in
+*GNU*)
+  ac_cv_path_EGREP="$ac_path_EGREP" ac_path_EGREP_found=:;;
+*)
+  ac_count=0
+  $as_echo_n 0123456789 >"conftest.in"
+  while :
+  do
+    cat "conftest.in" "conftest.in" >"conftest.tmp"
+    mv "conftest.tmp" "conftest.in"
+    cp "conftest.in" "conftest.nl"
+    $as_echo 'EGREP' >> "conftest.nl"
+    "$ac_path_EGREP" 'EGREP$' < "conftest.nl" >"conftest.out" 2>/dev/null || break
+    diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break
+    as_fn_arith $ac_count + 1 && ac_count=$as_val
+    if test $ac_count -gt ${ac_path_EGREP_max-0}; then
+      # Best one so far, save it but keep looking for a better one
+      ac_cv_path_EGREP="$ac_path_EGREP"
+      ac_path_EGREP_max=$ac_count
+    fi
+    # 10*(2^10) chars as input seems more than enough
+    test $ac_count -gt 10 && break
+  done
+  rm -f conftest.in conftest.tmp conftest.nl conftest.out;;
+esac
+
+      $ac_path_EGREP_found && break 3
+    done
+  done
+  done
+IFS=$as_save_IFS
+  if test -z "$ac_cv_path_EGREP"; then
+    as_fn_error $? "no acceptable egrep could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" "$LINENO" 5
+  fi
+else
+  ac_cv_path_EGREP=$EGREP
+fi
+
+   fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_EGREP" >&5
+$as_echo "$ac_cv_path_EGREP" >&6; }
+ EGREP="$ac_cv_path_EGREP"
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for fgrep" >&5
+$as_echo_n "checking for fgrep... " >&6; }
+if ${ac_cv_path_FGREP+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if echo 'ab*c' | $GREP -F 'ab*c' >/dev/null 2>&1
+   then ac_cv_path_FGREP="$GREP -F"
+   else
+     if test -z "$FGREP"; then
+  ac_path_FGREP_found=false
+  # Loop through the user's path and test for each of PROGNAME-LIST
+  as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH$PATH_SEPARATOR/usr/xpg4/bin
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_prog in fgrep; do
+    for ac_exec_ext in '' $ac_executable_extensions; do
+      ac_path_FGREP="$as_dir/$ac_prog$ac_exec_ext"
+      as_fn_executable_p "$ac_path_FGREP" || continue
+# Check for GNU ac_path_FGREP and select it if it is found.
+  # Check for GNU $ac_path_FGREP
+case `"$ac_path_FGREP" --version 2>&1` in
+*GNU*)
+  ac_cv_path_FGREP="$ac_path_FGREP" ac_path_FGREP_found=:;;
+*)
+  ac_count=0
+  $as_echo_n 0123456789 >"conftest.in"
+  while :
+  do
+    cat "conftest.in" "conftest.in" >"conftest.tmp"
+    mv "conftest.tmp" "conftest.in"
+    cp "conftest.in" "conftest.nl"
+    $as_echo 'FGREP' >> "conftest.nl"
+    "$ac_path_FGREP" FGREP < "conftest.nl" >"conftest.out" 2>/dev/null || break
+    diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break
+    as_fn_arith $ac_count + 1 && ac_count=$as_val
+    if test $ac_count -gt ${ac_path_FGREP_max-0}; then
+      # Best one so far, save it but keep looking for a better one
+      ac_cv_path_FGREP="$ac_path_FGREP"
+      ac_path_FGREP_max=$ac_count
+    fi
+    # 10*(2^10) chars as input seems more than enough
+    test $ac_count -gt 10 && break
+  done
+  rm -f conftest.in conftest.tmp conftest.nl conftest.out;;
+esac
+
+      $ac_path_FGREP_found && break 3
+    done
+  done
+  done
+IFS=$as_save_IFS
+  if test -z "$ac_cv_path_FGREP"; then
+    as_fn_error $? "no acceptable fgrep could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" "$LINENO" 5
+  fi
+else
+  ac_cv_path_FGREP=$FGREP
+fi
+
+   fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_FGREP" >&5
+$as_echo "$ac_cv_path_FGREP" >&6; }
+ FGREP="$ac_cv_path_FGREP"
+
+
+test -z "$GREP" && GREP=grep
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+# Check whether --with-gnu-ld was given.
+if test "${with_gnu_ld+set}" = set; then :
+  withval=$with_gnu_ld; test "$withval" = no || with_gnu_ld=yes
+else
+  with_gnu_ld=no
+fi
+
+ac_prog=ld
+if test "$GCC" = yes; then
+  # Check if gcc -print-prog-name=ld gives a path.
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking for ld used by $CC" >&5
+$as_echo_n "checking for ld used by $CC... " >&6; }
+  case $host in
+  *-*-mingw*)
+    # gcc leaves a trailing carriage return which upsets mingw
+    ac_prog=`($CC -print-prog-name=ld) 2>&5 | tr -d '\015'` ;;
+  *)
+    ac_prog=`($CC -print-prog-name=ld) 2>&5` ;;
+  esac
+  case $ac_prog in
+    # Accept absolute paths.
+    [\\/]* | ?:[\\/]*)
+      re_direlt='/[^/][^/]*/\.\./'
+      # Canonicalize the pathname of ld
+      ac_prog=`$ECHO "$ac_prog"| $SED 's%\\\\%/%g'`
+      while $ECHO "$ac_prog" | $GREP "$re_direlt" > /dev/null 2>&1; do
+	ac_prog=`$ECHO $ac_prog| $SED "s%$re_direlt%/%"`
+      done
+      test -z "$LD" && LD="$ac_prog"
+      ;;
+  "")
+    # If it fails, then pretend we aren't using GCC.
+    ac_prog=ld
+    ;;
+  *)
+    # If it is relative, then search for the first ld in PATH.
+    with_gnu_ld=unknown
+    ;;
+  esac
+elif test "$with_gnu_ld" = yes; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking for GNU ld" >&5
+$as_echo_n "checking for GNU ld... " >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking for non-GNU ld" >&5
+$as_echo_n "checking for non-GNU ld... " >&6; }
+fi
+if ${lt_cv_path_LD+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -z "$LD"; then
+  lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+  for ac_dir in $PATH; do
+    IFS="$lt_save_ifs"
+    test -z "$ac_dir" && ac_dir=.
+    if test -f "$ac_dir/$ac_prog" || test -f "$ac_dir/$ac_prog$ac_exeext"; then
+      lt_cv_path_LD="$ac_dir/$ac_prog"
+      # Check to see if the program is GNU ld.  I'd rather use --version,
+      # but apparently some variants of GNU ld only accept -v.
+      # Break only if it was the GNU/non-GNU ld that we prefer.
+      case `"$lt_cv_path_LD" -v 2>&1 </dev/null` in
+      *GNU* | *'with BFD'*)
+	test "$with_gnu_ld" != no && break
+	;;
+      *)
+	test "$with_gnu_ld" != yes && break
+	;;
+      esac
+    fi
+  done
+  IFS="$lt_save_ifs"
+else
+  lt_cv_path_LD="$LD" # Let the user override the test with a path.
+fi
+fi
+
+LD="$lt_cv_path_LD"
+if test -n "$LD"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $LD" >&5
+$as_echo "$LD" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+test -z "$LD" && as_fn_error $? "no acceptable ld found in \$PATH" "$LINENO" 5
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if the linker ($LD) is GNU ld" >&5
+$as_echo_n "checking if the linker ($LD) is GNU ld... " >&6; }
+if ${lt_cv_prog_gnu_ld+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  # I'd rather use --version here, but apparently some GNU lds only accept -v.
+case `$LD -v 2>&1 </dev/null` in
+*GNU* | *'with BFD'*)
+  lt_cv_prog_gnu_ld=yes
+  ;;
+*)
+  lt_cv_prog_gnu_ld=no
+  ;;
+esac
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_gnu_ld" >&5
+$as_echo "$lt_cv_prog_gnu_ld" >&6; }
+with_gnu_ld=$lt_cv_prog_gnu_ld
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for BSD- or MS-compatible name lister (nm)" >&5
+$as_echo_n "checking for BSD- or MS-compatible name lister (nm)... " >&6; }
+if ${lt_cv_path_NM+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$NM"; then
+  # Let the user override the test.
+  lt_cv_path_NM="$NM"
+else
+  lt_nm_to_check="${ac_tool_prefix}nm"
+  if test -n "$ac_tool_prefix" && test "$build" = "$host"; then
+    lt_nm_to_check="$lt_nm_to_check nm"
+  fi
+  for lt_tmp_nm in $lt_nm_to_check; do
+    lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+    for ac_dir in $PATH /usr/ccs/bin/elf /usr/ccs/bin /usr/ucb /bin; do
+      IFS="$lt_save_ifs"
+      test -z "$ac_dir" && ac_dir=.
+      tmp_nm="$ac_dir/$lt_tmp_nm"
+      if test -f "$tmp_nm" || test -f "$tmp_nm$ac_exeext" ; then
+	# Check to see if the nm accepts a BSD-compat flag.
+	# Adding the `sed 1q' prevents false positives on HP-UX, which says:
+	#   nm: unknown option "B" ignored
+	# Tru64's nm complains that /dev/null is an invalid object file
+	case `"$tmp_nm" -B /dev/null 2>&1 | sed '1q'` in
+	*/dev/null* | *'Invalid file or object type'*)
+	  lt_cv_path_NM="$tmp_nm -B"
+	  break
+	  ;;
+	*)
+	  case `"$tmp_nm" -p /dev/null 2>&1 | sed '1q'` in
+	  */dev/null*)
+	    lt_cv_path_NM="$tmp_nm -p"
+	    break
+	    ;;
+	  *)
+	    lt_cv_path_NM=${lt_cv_path_NM="$tmp_nm"} # keep the first match, but
+	    continue # so that we can try to find one that supports BSD flags
+	    ;;
+	  esac
+	  ;;
+	esac
+      fi
+    done
+    IFS="$lt_save_ifs"
+  done
+  : ${lt_cv_path_NM=no}
+fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_path_NM" >&5
+$as_echo "$lt_cv_path_NM" >&6; }
+if test "$lt_cv_path_NM" != "no"; then
+  NM="$lt_cv_path_NM"
+else
+  # Didn't find any BSD compatible name lister, look for dumpbin.
+  if test -n "$DUMPBIN"; then :
+    # Let the user override the test.
+  else
+    if test -n "$ac_tool_prefix"; then
+  for ac_prog in dumpbin "link -dump"
+  do
+    # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args.
+set dummy $ac_tool_prefix$ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_DUMPBIN+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$DUMPBIN"; then
+  ac_cv_prog_DUMPBIN="$DUMPBIN" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_DUMPBIN="$ac_tool_prefix$ac_prog"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+DUMPBIN=$ac_cv_prog_DUMPBIN
+if test -n "$DUMPBIN"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $DUMPBIN" >&5
+$as_echo "$DUMPBIN" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+    test -n "$DUMPBIN" && break
+  done
+fi
+if test -z "$DUMPBIN"; then
+  ac_ct_DUMPBIN=$DUMPBIN
+  for ac_prog in dumpbin "link -dump"
+do
+  # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_DUMPBIN+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$ac_ct_DUMPBIN"; then
+  ac_cv_prog_ac_ct_DUMPBIN="$ac_ct_DUMPBIN" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_ac_ct_DUMPBIN="$ac_prog"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_DUMPBIN=$ac_cv_prog_ac_ct_DUMPBIN
+if test -n "$ac_ct_DUMPBIN"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_DUMPBIN" >&5
+$as_echo "$ac_ct_DUMPBIN" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+  test -n "$ac_ct_DUMPBIN" && break
+done
+
+  if test "x$ac_ct_DUMPBIN" = x; then
+    DUMPBIN=":"
+  else
+    case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+    DUMPBIN=$ac_ct_DUMPBIN
+  fi
+fi
+
+    case `$DUMPBIN -symbols /dev/null 2>&1 | sed '1q'` in
+    *COFF*)
+      DUMPBIN="$DUMPBIN -symbols"
+      ;;
+    *)
+      DUMPBIN=:
+      ;;
+    esac
+  fi
+
+  if test "$DUMPBIN" != ":"; then
+    NM="$DUMPBIN"
+  fi
+fi
+test -z "$NM" && NM=nm
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking the name lister ($NM) interface" >&5
+$as_echo_n "checking the name lister ($NM) interface... " >&6; }
+if ${lt_cv_nm_interface+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  lt_cv_nm_interface="BSD nm"
+  echo "int some_variable = 0;" > conftest.$ac_ext
+  (eval echo "\"\$as_me:$LINENO: $ac_compile\"" >&5)
+  (eval "$ac_compile" 2>conftest.err)
+  cat conftest.err >&5
+  (eval echo "\"\$as_me:$LINENO: $NM \\\"conftest.$ac_objext\\\"\"" >&5)
+  (eval "$NM \"conftest.$ac_objext\"" 2>conftest.err > conftest.out)
+  cat conftest.err >&5
+  (eval echo "\"\$as_me:$LINENO: output\"" >&5)
+  cat conftest.out >&5
+  if $GREP 'External.*some_variable' conftest.out > /dev/null; then
+    lt_cv_nm_interface="MS dumpbin"
+  fi
+  rm -f conftest*
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_nm_interface" >&5
+$as_echo "$lt_cv_nm_interface" >&6; }
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether ln -s works" >&5
+$as_echo_n "checking whether ln -s works... " >&6; }
+LN_S=$as_ln_s
+if test "$LN_S" = "ln -s"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no, using $LN_S" >&5
+$as_echo "no, using $LN_S" >&6; }
+fi
+
+# find the maximum length of command line arguments
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking the maximum length of command line arguments" >&5
+$as_echo_n "checking the maximum length of command line arguments... " >&6; }
+if ${lt_cv_sys_max_cmd_len+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+    i=0
+  teststring="ABCD"
+
+  case $build_os in
+  msdosdjgpp*)
+    # On DJGPP, this test can blow up pretty badly due to problems in libc
+    # (any single argument exceeding 2000 bytes causes a buffer overrun
+    # during glob expansion).  Even if it were fixed, the result of this
+    # check would be larger than it should be.
+    lt_cv_sys_max_cmd_len=12288;    # 12K is about right
+    ;;
+
+  gnu*)
+    # Under GNU Hurd, this test is not required because there is
+    # no limit to the length of command line arguments.
+    # Libtool will interpret -1 as no limit whatsoever
+    lt_cv_sys_max_cmd_len=-1;
+    ;;
+
+  cygwin* | mingw* | cegcc*)
+    # On Win9x/ME, this test blows up -- it succeeds, but takes
+    # about 5 minutes as the teststring grows exponentially.
+    # Worse, since 9x/ME are not pre-emptively multitasking,
+    # you end up with a "frozen" computer, even though with patience
+    # the test eventually succeeds (with a max line length of 256k).
+    # Instead, let's just punt: use the minimum linelength reported by
+    # all of the supported platforms: 8192 (on NT/2K/XP).
+    lt_cv_sys_max_cmd_len=8192;
+    ;;
+
+  mint*)
+    # On MiNT this can take a long time and run out of memory.
+    lt_cv_sys_max_cmd_len=8192;
+    ;;
+
+  amigaos*)
+    # On AmigaOS with pdksh, this test takes hours, literally.
+    # So we just punt and use a minimum line length of 8192.
+    lt_cv_sys_max_cmd_len=8192;
+    ;;
+
+  netbsd* | freebsd* | openbsd* | darwin* | dragonfly*)
+    # This has been around since 386BSD, at least.  Likely further.
+    if test -x /sbin/sysctl; then
+      lt_cv_sys_max_cmd_len=`/sbin/sysctl -n kern.argmax`
+    elif test -x /usr/sbin/sysctl; then
+      lt_cv_sys_max_cmd_len=`/usr/sbin/sysctl -n kern.argmax`
+    else
+      lt_cv_sys_max_cmd_len=65536	# usable default for all BSDs
+    fi
+    # And add a safety zone
+    lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4`
+    lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3`
+    ;;
+
+  interix*)
+    # We know the value 262144 and hardcode it with a safety zone (like BSD)
+    lt_cv_sys_max_cmd_len=196608
+    ;;
+
+  os2*)
+    # The test takes a long time on OS/2.
+    lt_cv_sys_max_cmd_len=8192
+    ;;
+
+  osf*)
+    # Dr. Hans Ekkehard Plesser reports seeing a kernel panic running configure
+    # due to this test when exec_disable_arg_limit is 1 on Tru64. It is not
+    # nice to cause kernel panics so lets avoid the loop below.
+    # First set a reasonable default.
+    lt_cv_sys_max_cmd_len=16384
+    #
+    if test -x /sbin/sysconfig; then
+      case `/sbin/sysconfig -q proc exec_disable_arg_limit` in
+        *1*) lt_cv_sys_max_cmd_len=-1 ;;
+      esac
+    fi
+    ;;
+  sco3.2v5*)
+    lt_cv_sys_max_cmd_len=102400
+    ;;
+  sysv5* | sco5v6* | sysv4.2uw2*)
+    kargmax=`grep ARG_MAX /etc/conf/cf.d/stune 2>/dev/null`
+    if test -n "$kargmax"; then
+      lt_cv_sys_max_cmd_len=`echo $kargmax | sed 's/.*[	 ]//'`
+    else
+      lt_cv_sys_max_cmd_len=32768
+    fi
+    ;;
+  *)
+    lt_cv_sys_max_cmd_len=`(getconf ARG_MAX) 2> /dev/null`
+    if test -n "$lt_cv_sys_max_cmd_len" && \
+	test undefined != "$lt_cv_sys_max_cmd_len"; then
+      lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4`
+      lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3`
+    else
+      # Make teststring a little bigger before we do anything with it.
+      # a 1K string should be a reasonable start.
+      for i in 1 2 3 4 5 6 7 8 ; do
+        teststring=$teststring$teststring
+      done
+      SHELL=${SHELL-${CONFIG_SHELL-/bin/sh}}
+      # If test is not a shell built-in, we'll probably end up computing a
+      # maximum length that is only half of the actual maximum length, but
+      # we can't tell.
+      while { test "X"`env echo "$teststring$teststring" 2>/dev/null` \
+	         = "X$teststring$teststring"; } >/dev/null 2>&1 &&
+	      test $i != 17 # 1/2 MB should be enough
+      do
+        i=`expr $i + 1`
+        teststring=$teststring$teststring
+      done
+      # Only check the string length outside the loop.
+      lt_cv_sys_max_cmd_len=`expr "X$teststring" : ".*" 2>&1`
+      teststring=
+      # Add a significant safety factor because C++ compilers can tack on
+      # massive amounts of additional arguments before passing them to the
+      # linker.  It appears as though 1/2 is a usable value.
+      lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 2`
+    fi
+    ;;
+  esac
+
+fi
+
+if test -n $lt_cv_sys_max_cmd_len ; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_sys_max_cmd_len" >&5
+$as_echo "$lt_cv_sys_max_cmd_len" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: none" >&5
+$as_echo "none" >&6; }
+fi
+max_cmd_len=$lt_cv_sys_max_cmd_len
+
+
+
+
+
+
+: ${CP="cp -f"}
+: ${MV="mv -f"}
+: ${RM="rm -f"}
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the shell understands some XSI constructs" >&5
+$as_echo_n "checking whether the shell understands some XSI constructs... " >&6; }
+# Try some XSI features
+xsi_shell=no
+( _lt_dummy="a/b/c"
+  test "${_lt_dummy##*/},${_lt_dummy%/*},${_lt_dummy#??}"${_lt_dummy%"$_lt_dummy"}, \
+      = c,a/b,b/c, \
+    && eval 'test $(( 1 + 1 )) -eq 2 \
+    && test "${#_lt_dummy}" -eq 5' ) >/dev/null 2>&1 \
+  && xsi_shell=yes
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $xsi_shell" >&5
+$as_echo "$xsi_shell" >&6; }
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the shell understands \"+=\"" >&5
+$as_echo_n "checking whether the shell understands \"+=\"... " >&6; }
+lt_shell_append=no
+( foo=bar; set foo baz; eval "$1+=\$2" && test "$foo" = barbaz ) \
+    >/dev/null 2>&1 \
+  && lt_shell_append=yes
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_shell_append" >&5
+$as_echo "$lt_shell_append" >&6; }
+
+
+if ( (MAIL=60; unset MAIL) || exit) >/dev/null 2>&1; then
+  lt_unset=unset
+else
+  lt_unset=false
+fi
+
+
+
+
+
+# test EBCDIC or ASCII
+case `echo X|tr X '\101'` in
+ A) # ASCII based system
+    # \n is not interpreted correctly by Solaris 8 /usr/ucb/tr
+  lt_SP2NL='tr \040 \012'
+  lt_NL2SP='tr \015\012 \040\040'
+  ;;
+ *) # EBCDIC based system
+  lt_SP2NL='tr \100 \n'
+  lt_NL2SP='tr \r\n \100\100'
+  ;;
+esac
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to convert $build file names to $host format" >&5
+$as_echo_n "checking how to convert $build file names to $host format... " >&6; }
+if ${lt_cv_to_host_file_cmd+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  case $host in
+  *-*-mingw* )
+    case $build in
+      *-*-mingw* ) # actually msys
+        lt_cv_to_host_file_cmd=func_convert_file_msys_to_w32
+        ;;
+      *-*-cygwin* )
+        lt_cv_to_host_file_cmd=func_convert_file_cygwin_to_w32
+        ;;
+      * ) # otherwise, assume *nix
+        lt_cv_to_host_file_cmd=func_convert_file_nix_to_w32
+        ;;
+    esac
+    ;;
+  *-*-cygwin* )
+    case $build in
+      *-*-mingw* ) # actually msys
+        lt_cv_to_host_file_cmd=func_convert_file_msys_to_cygwin
+        ;;
+      *-*-cygwin* )
+        lt_cv_to_host_file_cmd=func_convert_file_noop
+        ;;
+      * ) # otherwise, assume *nix
+        lt_cv_to_host_file_cmd=func_convert_file_nix_to_cygwin
+        ;;
+    esac
+    ;;
+  * ) # unhandled hosts (and "normal" native builds)
+    lt_cv_to_host_file_cmd=func_convert_file_noop
+    ;;
+esac
+
+fi
+
+to_host_file_cmd=$lt_cv_to_host_file_cmd
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_to_host_file_cmd" >&5
+$as_echo "$lt_cv_to_host_file_cmd" >&6; }
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to convert $build file names to toolchain format" >&5
+$as_echo_n "checking how to convert $build file names to toolchain format... " >&6; }
+if ${lt_cv_to_tool_file_cmd+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  #assume ordinary cross tools, or native build.
+lt_cv_to_tool_file_cmd=func_convert_file_noop
+case $host in
+  *-*-mingw* )
+    case $build in
+      *-*-mingw* ) # actually msys
+        lt_cv_to_tool_file_cmd=func_convert_file_msys_to_w32
+        ;;
+    esac
+    ;;
+esac
+
+fi
+
+to_tool_file_cmd=$lt_cv_to_tool_file_cmd
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_to_tool_file_cmd" >&5
+$as_echo "$lt_cv_to_tool_file_cmd" >&6; }
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $LD option to reload object files" >&5
+$as_echo_n "checking for $LD option to reload object files... " >&6; }
+if ${lt_cv_ld_reload_flag+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  lt_cv_ld_reload_flag='-r'
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_ld_reload_flag" >&5
+$as_echo "$lt_cv_ld_reload_flag" >&6; }
+reload_flag=$lt_cv_ld_reload_flag
+case $reload_flag in
+"" | " "*) ;;
+*) reload_flag=" $reload_flag" ;;
+esac
+reload_cmds='$LD$reload_flag -o $output$reload_objs'
+case $host_os in
+  cygwin* | mingw* | pw32* | cegcc*)
+    if test "$GCC" != yes; then
+      reload_cmds=false
+    fi
+    ;;
+  darwin*)
+    if test "$GCC" = yes; then
+      reload_cmds='$LTCC $LTCFLAGS -nostdlib ${wl}-r -o $output$reload_objs'
+    else
+      reload_cmds='$LD$reload_flag -o $output$reload_objs'
+    fi
+    ;;
+esac
+
+
+
+
+
+
+
+
+
+if test -n "$ac_tool_prefix"; then
+  # Extract the first word of "${ac_tool_prefix}objdump", so it can be a program name with args.
+set dummy ${ac_tool_prefix}objdump; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_OBJDUMP+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$OBJDUMP"; then
+  ac_cv_prog_OBJDUMP="$OBJDUMP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_OBJDUMP="${ac_tool_prefix}objdump"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+OBJDUMP=$ac_cv_prog_OBJDUMP
+if test -n "$OBJDUMP"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $OBJDUMP" >&5
+$as_echo "$OBJDUMP" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_OBJDUMP"; then
+  ac_ct_OBJDUMP=$OBJDUMP
+  # Extract the first word of "objdump", so it can be a program name with args.
+set dummy objdump; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_OBJDUMP+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$ac_ct_OBJDUMP"; then
+  ac_cv_prog_ac_ct_OBJDUMP="$ac_ct_OBJDUMP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_ac_ct_OBJDUMP="objdump"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_OBJDUMP=$ac_cv_prog_ac_ct_OBJDUMP
+if test -n "$ac_ct_OBJDUMP"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_OBJDUMP" >&5
+$as_echo "$ac_ct_OBJDUMP" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+  if test "x$ac_ct_OBJDUMP" = x; then
+    OBJDUMP="false"
+  else
+    case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+    OBJDUMP=$ac_ct_OBJDUMP
+  fi
+else
+  OBJDUMP="$ac_cv_prog_OBJDUMP"
+fi
+
+test -z "$OBJDUMP" && OBJDUMP=objdump
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to recognize dependent libraries" >&5
+$as_echo_n "checking how to recognize dependent libraries... " >&6; }
+if ${lt_cv_deplibs_check_method+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  lt_cv_file_magic_cmd='$MAGIC_CMD'
+lt_cv_file_magic_test_file=
+lt_cv_deplibs_check_method='unknown'
+# Need to set the preceding variable on all platforms that support
+# interlibrary dependencies.
+# 'none' -- dependencies not supported.
+# `unknown' -- same as none, but documents that we really don't know.
+# 'pass_all' -- all dependencies passed with no checks.
+# 'test_compile' -- check by making test program.
+# 'file_magic [[regex]]' -- check by looking for files in library path
+# which responds to the $file_magic_cmd with a given extended regex.
+# If you have `file' or equivalent on your system and you're not sure
+# whether `pass_all' will *always* work, you probably want this one.
+
+case $host_os in
+aix[4-9]*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+beos*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+bsdi[45]*)
+  lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (shared object|dynamic lib)'
+  lt_cv_file_magic_cmd='/usr/bin/file -L'
+  lt_cv_file_magic_test_file=/shlib/libc.so
+  ;;
+
+cygwin*)
+  # func_win32_libid is a shell function defined in ltmain.sh
+  lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL'
+  lt_cv_file_magic_cmd='func_win32_libid'
+  ;;
+
+mingw* | pw32*)
+  # Base MSYS/MinGW do not provide the 'file' command needed by
+  # func_win32_libid shell function, so use a weaker test based on 'objdump',
+  # unless we find 'file', for example because we are cross-compiling.
+  # func_win32_libid assumes BSD nm, so disallow it if using MS dumpbin.
+  if ( test "$lt_cv_nm_interface" = "BSD nm" && file / ) >/dev/null 2>&1; then
+    lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL'
+    lt_cv_file_magic_cmd='func_win32_libid'
+  else
+    # Keep this pattern in sync with the one in func_win32_libid.
+    lt_cv_deplibs_check_method='file_magic file format (pei*-i386(.*architecture: i386)?|pe-arm-wince|pe-x86-64)'
+    lt_cv_file_magic_cmd='$OBJDUMP -f'
+  fi
+  ;;
+
+cegcc*)
+  # use the weaker test based on 'objdump'. See mingw*.
+  lt_cv_deplibs_check_method='file_magic file format pe-arm-.*little(.*architecture: arm)?'
+  lt_cv_file_magic_cmd='$OBJDUMP -f'
+  ;;
+
+darwin* | rhapsody*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+freebsd* | dragonfly*)
+  if echo __ELF__ | $CC -E - | $GREP __ELF__ > /dev/null; then
+    case $host_cpu in
+    i*86 )
+      # Not sure whether the presence of OpenBSD here was a mistake.
+      # Let's accept both of them until this is cleared up.
+      lt_cv_deplibs_check_method='file_magic (FreeBSD|OpenBSD|DragonFly)/i[3-9]86 (compact )?demand paged shared library'
+      lt_cv_file_magic_cmd=/usr/bin/file
+      lt_cv_file_magic_test_file=`echo /usr/lib/libc.so.*`
+      ;;
+    esac
+  else
+    lt_cv_deplibs_check_method=pass_all
+  fi
+  ;;
+
+haiku*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+hpux10.20* | hpux11*)
+  lt_cv_file_magic_cmd=/usr/bin/file
+  case $host_cpu in
+  ia64*)
+    lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF-[0-9][0-9]) shared object file - IA64'
+    lt_cv_file_magic_test_file=/usr/lib/hpux32/libc.so
+    ;;
+  hppa*64*)
+    lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF[ -][0-9][0-9])(-bit)?( [LM]SB)? shared object( file)?[, -]* PA-RISC [0-9]\.[0-9]'
+    lt_cv_file_magic_test_file=/usr/lib/pa20_64/libc.sl
+    ;;
+  *)
+    lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|PA-RISC[0-9]\.[0-9]) shared library'
+    lt_cv_file_magic_test_file=/usr/lib/libc.sl
+    ;;
+  esac
+  ;;
+
+interix[3-9]*)
+  # PIC code is broken on Interix 3.x, that's why |\.a not |_pic\.a here
+  lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so|\.a)$'
+  ;;
+
+irix5* | irix6* | nonstopux*)
+  case $LD in
+  *-32|*"-32 ") libmagic=32-bit;;
+  *-n32|*"-n32 ") libmagic=N32;;
+  *-64|*"-64 ") libmagic=64-bit;;
+  *) libmagic=never-match;;
+  esac
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+# This must be glibc/ELF.
+linux* | k*bsd*-gnu | kopensolaris*-gnu | gnu*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+netbsd* | netbsdelf*-gnu)
+  if echo __ELF__ | $CC -E - | $GREP __ELF__ > /dev/null; then
+    lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|_pic\.a)$'
+  else
+    lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so|_pic\.a)$'
+  fi
+  ;;
+
+newos6*)
+  lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (executable|dynamic lib)'
+  lt_cv_file_magic_cmd=/usr/bin/file
+  lt_cv_file_magic_test_file=/usr/lib/libnls.so
+  ;;
+
+*nto* | *qnx*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+openbsd*)
+  if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+    lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|\.so|_pic\.a)$'
+  else
+    lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|_pic\.a)$'
+  fi
+  ;;
+
+osf3* | osf4* | osf5*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+rdos*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+solaris*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+
+sysv4 | sysv4.3*)
+  case $host_vendor in
+  motorola)
+    lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (shared object|dynamic lib) M[0-9][0-9]* Version [0-9]'
+    lt_cv_file_magic_test_file=`echo /usr/lib/libc.so*`
+    ;;
+  ncr)
+    lt_cv_deplibs_check_method=pass_all
+    ;;
+  sequent)
+    lt_cv_file_magic_cmd='/bin/file'
+    lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [LM]SB (shared object|dynamic lib )'
+    ;;
+  sni)
+    lt_cv_file_magic_cmd='/bin/file'
+    lt_cv_deplibs_check_method="file_magic ELF [0-9][0-9]*-bit [LM]SB dynamic lib"
+    lt_cv_file_magic_test_file=/lib/libc.so
+    ;;
+  siemens)
+    lt_cv_deplibs_check_method=pass_all
+    ;;
+  pc)
+    lt_cv_deplibs_check_method=pass_all
+    ;;
+  esac
+  ;;
+
+tpf*)
+  lt_cv_deplibs_check_method=pass_all
+  ;;
+esac
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_deplibs_check_method" >&5
+$as_echo "$lt_cv_deplibs_check_method" >&6; }
+
+file_magic_glob=
+want_nocaseglob=no
+if test "$build" = "$host"; then
+  case $host_os in
+  mingw* | pw32*)
+    if ( shopt | grep nocaseglob ) >/dev/null 2>&1; then
+      want_nocaseglob=yes
+    else
+      file_magic_glob=`echo aAbBcCdDeEfFgGhHiIjJkKlLmMnNoOpPqQrRsStTuUvVwWxXyYzZ | $SED -e "s/\(..\)/s\/[\1]\/[\1]\/g;/g"`
+    fi
+    ;;
+  esac
+fi
+
+file_magic_cmd=$lt_cv_file_magic_cmd
+deplibs_check_method=$lt_cv_deplibs_check_method
+test -z "$deplibs_check_method" && deplibs_check_method=unknown
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+if test -n "$ac_tool_prefix"; then
+  # Extract the first word of "${ac_tool_prefix}dlltool", so it can be a program name with args.
+set dummy ${ac_tool_prefix}dlltool; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_DLLTOOL+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$DLLTOOL"; then
+  ac_cv_prog_DLLTOOL="$DLLTOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_DLLTOOL="${ac_tool_prefix}dlltool"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+DLLTOOL=$ac_cv_prog_DLLTOOL
+if test -n "$DLLTOOL"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $DLLTOOL" >&5
+$as_echo "$DLLTOOL" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_DLLTOOL"; then
+  ac_ct_DLLTOOL=$DLLTOOL
+  # Extract the first word of "dlltool", so it can be a program name with args.
+set dummy dlltool; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_DLLTOOL+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$ac_ct_DLLTOOL"; then
+  ac_cv_prog_ac_ct_DLLTOOL="$ac_ct_DLLTOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_ac_ct_DLLTOOL="dlltool"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_DLLTOOL=$ac_cv_prog_ac_ct_DLLTOOL
+if test -n "$ac_ct_DLLTOOL"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_DLLTOOL" >&5
+$as_echo "$ac_ct_DLLTOOL" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+  if test "x$ac_ct_DLLTOOL" = x; then
+    DLLTOOL="false"
+  else
+    case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+    DLLTOOL=$ac_ct_DLLTOOL
+  fi
+else
+  DLLTOOL="$ac_cv_prog_DLLTOOL"
+fi
+
+test -z "$DLLTOOL" && DLLTOOL=dlltool
+
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to associate runtime and link libraries" >&5
+$as_echo_n "checking how to associate runtime and link libraries... " >&6; }
+if ${lt_cv_sharedlib_from_linklib_cmd+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  lt_cv_sharedlib_from_linklib_cmd='unknown'
+
+case $host_os in
+cygwin* | mingw* | pw32* | cegcc*)
+  # two different shell functions defined in ltmain.sh
+  # decide which to use based on capabilities of $DLLTOOL
+  case `$DLLTOOL --help 2>&1` in
+  *--identify-strict*)
+    lt_cv_sharedlib_from_linklib_cmd=func_cygming_dll_for_implib
+    ;;
+  *)
+    lt_cv_sharedlib_from_linklib_cmd=func_cygming_dll_for_implib_fallback
+    ;;
+  esac
+  ;;
+*)
+  # fallback: assume linklib IS sharedlib
+  lt_cv_sharedlib_from_linklib_cmd="$ECHO"
+  ;;
+esac
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_sharedlib_from_linklib_cmd" >&5
+$as_echo "$lt_cv_sharedlib_from_linklib_cmd" >&6; }
+sharedlib_from_linklib_cmd=$lt_cv_sharedlib_from_linklib_cmd
+test -z "$sharedlib_from_linklib_cmd" && sharedlib_from_linklib_cmd=$ECHO
+
+
+
+
+
+
+
+
+if test -n "$ac_tool_prefix"; then
+  for ac_prog in ar
+  do
+    # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args.
+set dummy $ac_tool_prefix$ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_AR+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$AR"; then
+  ac_cv_prog_AR="$AR" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_AR="$ac_tool_prefix$ac_prog"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+AR=$ac_cv_prog_AR
+if test -n "$AR"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $AR" >&5
+$as_echo "$AR" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+    test -n "$AR" && break
+  done
+fi
+if test -z "$AR"; then
+  ac_ct_AR=$AR
+  for ac_prog in ar
+do
+  # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_AR+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$ac_ct_AR"; then
+  ac_cv_prog_ac_ct_AR="$ac_ct_AR" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_ac_ct_AR="$ac_prog"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_AR=$ac_cv_prog_ac_ct_AR
+if test -n "$ac_ct_AR"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_AR" >&5
+$as_echo "$ac_ct_AR" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+  test -n "$ac_ct_AR" && break
+done
+
+  if test "x$ac_ct_AR" = x; then
+    AR="false"
+  else
+    case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+    AR=$ac_ct_AR
+  fi
+fi
+
+: ${AR=ar}
+: ${AR_FLAGS=cru}
+
+
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for archiver @FILE support" >&5
+$as_echo_n "checking for archiver @FILE support... " >&6; }
+if ${lt_cv_ar_at_file+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  lt_cv_ar_at_file=no
+   cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+int
+main ()
+{
+
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+  echo conftest.$ac_objext > conftest.lst
+      lt_ar_try='$AR $AR_FLAGS libconftest.a @conftest.lst >&5'
+      { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$lt_ar_try\""; } >&5
+  (eval $lt_ar_try) 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; }
+      if test "$ac_status" -eq 0; then
+	# Ensure the archiver fails upon bogus file names.
+	rm -f conftest.$ac_objext libconftest.a
+	{ { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$lt_ar_try\""; } >&5
+  (eval $lt_ar_try) 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; }
+	if test "$ac_status" -ne 0; then
+          lt_cv_ar_at_file=@
+        fi
+      fi
+      rm -f conftest.* libconftest.a
+
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_ar_at_file" >&5
+$as_echo "$lt_cv_ar_at_file" >&6; }
+
+if test "x$lt_cv_ar_at_file" = xno; then
+  archiver_list_spec=
+else
+  archiver_list_spec=$lt_cv_ar_at_file
+fi
+
+
+
+
+
+
+
+if test -n "$ac_tool_prefix"; then
+  # Extract the first word of "${ac_tool_prefix}strip", so it can be a program name with args.
+set dummy ${ac_tool_prefix}strip; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_STRIP+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$STRIP"; then
+  ac_cv_prog_STRIP="$STRIP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_STRIP="${ac_tool_prefix}strip"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+STRIP=$ac_cv_prog_STRIP
+if test -n "$STRIP"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $STRIP" >&5
+$as_echo "$STRIP" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_STRIP"; then
+  ac_ct_STRIP=$STRIP
+  # Extract the first word of "strip", so it can be a program name with args.
+set dummy strip; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_STRIP+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$ac_ct_STRIP"; then
+  ac_cv_prog_ac_ct_STRIP="$ac_ct_STRIP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_ac_ct_STRIP="strip"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_STRIP=$ac_cv_prog_ac_ct_STRIP
+if test -n "$ac_ct_STRIP"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_STRIP" >&5
+$as_echo "$ac_ct_STRIP" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+  if test "x$ac_ct_STRIP" = x; then
+    STRIP=":"
+  else
+    case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+    STRIP=$ac_ct_STRIP
+  fi
+else
+  STRIP="$ac_cv_prog_STRIP"
+fi
+
+test -z "$STRIP" && STRIP=:
+
+
+
+
+
+
+if test -n "$ac_tool_prefix"; then
+  # Extract the first word of "${ac_tool_prefix}ranlib", so it can be a program name with args.
+set dummy ${ac_tool_prefix}ranlib; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_RANLIB+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$RANLIB"; then
+  ac_cv_prog_RANLIB="$RANLIB" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_RANLIB="${ac_tool_prefix}ranlib"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+RANLIB=$ac_cv_prog_RANLIB
+if test -n "$RANLIB"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $RANLIB" >&5
+$as_echo "$RANLIB" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_RANLIB"; then
+  ac_ct_RANLIB=$RANLIB
+  # Extract the first word of "ranlib", so it can be a program name with args.
+set dummy ranlib; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_RANLIB+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$ac_ct_RANLIB"; then
+  ac_cv_prog_ac_ct_RANLIB="$ac_ct_RANLIB" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_ac_ct_RANLIB="ranlib"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_RANLIB=$ac_cv_prog_ac_ct_RANLIB
+if test -n "$ac_ct_RANLIB"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_RANLIB" >&5
+$as_echo "$ac_ct_RANLIB" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+  if test "x$ac_ct_RANLIB" = x; then
+    RANLIB=":"
+  else
+    case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+    RANLIB=$ac_ct_RANLIB
+  fi
+else
+  RANLIB="$ac_cv_prog_RANLIB"
+fi
+
+test -z "$RANLIB" && RANLIB=:
+
+
+
+
+
+
+# Determine commands to create old-style static archives.
+old_archive_cmds='$AR $AR_FLAGS $oldlib$oldobjs'
+old_postinstall_cmds='chmod 644 $oldlib'
+old_postuninstall_cmds=
+
+if test -n "$RANLIB"; then
+  case $host_os in
+  openbsd*)
+    old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB -t \$tool_oldlib"
+    ;;
+  *)
+    old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB \$tool_oldlib"
+    ;;
+  esac
+  old_archive_cmds="$old_archive_cmds~\$RANLIB \$tool_oldlib"
+fi
+
+case $host_os in
+  darwin*)
+    lock_old_archive_extraction=yes ;;
+  *)
+    lock_old_archive_extraction=no ;;
+esac
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+# If no C compiler was specified, use CC.
+LTCC=${LTCC-"$CC"}
+
+# If no C compiler flags were specified, use CFLAGS.
+LTCFLAGS=${LTCFLAGS-"$CFLAGS"}
+
+# Allow CC to be a program name with arguments.
+compiler=$CC
+
+
+# Check for command to grab the raw symbol name followed by C symbol from nm.
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking command to parse $NM output from $compiler object" >&5
+$as_echo_n "checking command to parse $NM output from $compiler object... " >&6; }
+if ${lt_cv_sys_global_symbol_pipe+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+
+# These are sane defaults that work on at least a few old systems.
+# [They come from Ultrix.  What could be older than Ultrix?!! ;)]
+
+# Character class describing NM global symbol codes.
+symcode='[BCDEGRST]'
+
+# Regexp to match symbols that can be accessed directly from C.
+sympat='\([_A-Za-z][_A-Za-z0-9]*\)'
+
+# Define system-specific variables.
+case $host_os in
+aix*)
+  symcode='[BCDT]'
+  ;;
+cygwin* | mingw* | pw32* | cegcc*)
+  symcode='[ABCDGISTW]'
+  ;;
+hpux*)
+  if test "$host_cpu" = ia64; then
+    symcode='[ABCDEGRST]'
+  fi
+  ;;
+irix* | nonstopux*)
+  symcode='[BCDEGRST]'
+  ;;
+osf*)
+  symcode='[BCDEGQRST]'
+  ;;
+solaris*)
+  symcode='[BDRT]'
+  ;;
+sco3.2v5*)
+  symcode='[DT]'
+  ;;
+sysv4.2uw2*)
+  symcode='[DT]'
+  ;;
+sysv5* | sco5v6* | unixware* | OpenUNIX*)
+  symcode='[ABDT]'
+  ;;
+sysv4)
+  symcode='[DFNSTU]'
+  ;;
+esac
+
+# If we're using GNU nm, then use its standard symbol codes.
+case `$NM -V 2>&1` in
+*GNU* | *'with BFD'*)
+  symcode='[ABCDGIRSTW]' ;;
+esac
+
+# Transform an extracted symbol line into a proper C declaration.
+# Some systems (esp. on ia64) link data and code symbols differently,
+# so use this general approach.
+lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^T .* \(.*\)$/extern int \1();/p' -e 's/^$symcode* .* \(.*\)$/extern char \1;/p'"
+
+# Transform an extracted symbol line into symbol name and symbol address
+lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([^ ]*\)[ ]*$/  {\\\"\1\\\", (void *) 0},/p' -e 's/^$symcode* \([^ ]*\) \([^ ]*\)$/  {\"\2\", (void *) \&\2},/p'"
+lt_cv_sys_global_symbol_to_c_name_address_lib_prefix="sed -n -e 's/^: \([^ ]*\)[ ]*$/  {\\\"\1\\\", (void *) 0},/p' -e 's/^$symcode* \([^ ]*\) \(lib[^ ]*\)$/  {\"\2\", (void *) \&\2},/p' -e 's/^$symcode* \([^ ]*\) \([^ ]*\)$/  {\"lib\2\", (void *) \&\2},/p'"
+
+# Handle CRLF in mingw tool chain
+opt_cr=
+case $build_os in
+mingw*)
+  opt_cr=`$ECHO 'x\{0,1\}' | tr x '\015'` # option cr in regexp
+  ;;
+esac
+
+# Try without a prefix underscore, then with it.
+for ac_symprfx in "" "_"; do
+
+  # Transform symcode, sympat, and symprfx into a raw symbol and a C symbol.
+  symxfrm="\\1 $ac_symprfx\\2 \\2"
+
+  # Write the raw and C identifiers.
+  if test "$lt_cv_nm_interface" = "MS dumpbin"; then
+    # Fake it for dumpbin and say T for any non-static function
+    # and D for any global variable.
+    # Also find C++ and __fastcall symbols from MSVC++,
+    # which start with @ or ?.
+    lt_cv_sys_global_symbol_pipe="$AWK '"\
+"     {last_section=section; section=\$ 3};"\
+"     /^COFF SYMBOL TABLE/{for(i in hide) delete hide[i]};"\
+"     /Section length .*#relocs.*(pick any)/{hide[last_section]=1};"\
+"     \$ 0!~/External *\|/{next};"\
+"     / 0+ UNDEF /{next}; / UNDEF \([^|]\)*()/{next};"\
+"     {if(hide[section]) next};"\
+"     {f=0}; \$ 0~/\(\).*\|/{f=1}; {printf f ? \"T \" : \"D \"};"\
+"     {split(\$ 0, a, /\||\r/); split(a[2], s)};"\
+"     s[1]~/^[@?]/{print s[1], s[1]; next};"\
+"     s[1]~prfx {split(s[1],t,\"@\"); print t[1], substr(t[1],length(prfx))}"\
+"     ' prfx=^$ac_symprfx"
+  else
+    lt_cv_sys_global_symbol_pipe="sed -n -e 's/^.*[	 ]\($symcode$symcode*\)[	 ][	 ]*$ac_symprfx$sympat$opt_cr$/$symxfrm/p'"
+  fi
+  lt_cv_sys_global_symbol_pipe="$lt_cv_sys_global_symbol_pipe | sed '/ __gnu_lto/d'"
+
+  # Check to see that the pipe works correctly.
+  pipe_works=no
+
+  rm -f conftest*
+  cat > conftest.$ac_ext <<_LT_EOF
+#ifdef __cplusplus
+extern "C" {
+#endif
+char nm_test_var;
+void nm_test_func(void);
+void nm_test_func(void){}
+#ifdef __cplusplus
+}
+#endif
+int main(){nm_test_var='a';nm_test_func();return(0);}
+_LT_EOF
+
+  if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+  (eval $ac_compile) 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; }; then
+    # Now try to grab the symbols.
+    nlist=conftest.nm
+    if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$NM conftest.$ac_objext \| "$lt_cv_sys_global_symbol_pipe" \> $nlist\""; } >&5
+  (eval $NM conftest.$ac_objext \| "$lt_cv_sys_global_symbol_pipe" \> $nlist) 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; } && test -s "$nlist"; then
+      # Try sorting and uniquifying the output.
+      if sort "$nlist" | uniq > "$nlist"T; then
+	mv -f "$nlist"T "$nlist"
+      else
+	rm -f "$nlist"T
+      fi
+
+      # Make sure that we snagged all the symbols we need.
+      if $GREP ' nm_test_var$' "$nlist" >/dev/null; then
+	if $GREP ' nm_test_func$' "$nlist" >/dev/null; then
+	  cat <<_LT_EOF > conftest.$ac_ext
+/* Keep this code in sync between libtool.m4, ltmain, lt_system.h, and tests.  */
+#if defined(_WIN32) || defined(__CYGWIN__) || defined(_WIN32_WCE)
+/* DATA imports from DLLs on WIN32 con't be const, because runtime
+   relocations are performed -- see ld's documentation on pseudo-relocs.  */
+# define LT_DLSYM_CONST
+#elif defined(__osf__)
+/* This system does not cope well with relocations in const data.  */
+# define LT_DLSYM_CONST
+#else
+# define LT_DLSYM_CONST const
+#endif
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+_LT_EOF
+	  # Now generate the symbol file.
+	  eval "$lt_cv_sys_global_symbol_to_cdecl"' < "$nlist" | $GREP -v main >> conftest.$ac_ext'
+
+	  cat <<_LT_EOF >> conftest.$ac_ext
+
+/* The mapping between symbol names and symbols.  */
+LT_DLSYM_CONST struct {
+  const char *name;
+  void       *address;
+}
+lt__PROGRAM__LTX_preloaded_symbols[] =
+{
+  { "@PROGRAM@", (void *) 0 },
+_LT_EOF
+	  $SED "s/^$symcode$symcode* \(.*\) \(.*\)$/  {\"\2\", (void *) \&\2},/" < "$nlist" | $GREP -v main >> conftest.$ac_ext
+	  cat <<\_LT_EOF >> conftest.$ac_ext
+  {0, (void *) 0}
+};
+
+/* This works around a problem in FreeBSD linker */
+#ifdef FREEBSD_WORKAROUND
+static const void *lt_preloaded_setup() {
+  return lt__PROGRAM__LTX_preloaded_symbols;
+}
+#endif
+
+#ifdef __cplusplus
+}
+#endif
+_LT_EOF
+	  # Now try linking the two files.
+	  mv conftest.$ac_objext conftstm.$ac_objext
+	  lt_globsym_save_LIBS=$LIBS
+	  lt_globsym_save_CFLAGS=$CFLAGS
+	  LIBS="conftstm.$ac_objext"
+	  CFLAGS="$CFLAGS$lt_prog_compiler_no_builtin_flag"
+	  if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_link\""; } >&5
+  (eval $ac_link) 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; } && test -s conftest${ac_exeext}; then
+	    pipe_works=yes
+	  fi
+	  LIBS=$lt_globsym_save_LIBS
+	  CFLAGS=$lt_globsym_save_CFLAGS
+	else
+	  echo "cannot find nm_test_func in $nlist" >&5
+	fi
+      else
+	echo "cannot find nm_test_var in $nlist" >&5
+      fi
+    else
+      echo "cannot run $lt_cv_sys_global_symbol_pipe" >&5
+    fi
+  else
+    echo "$progname: failed program was:" >&5
+    cat conftest.$ac_ext >&5
+  fi
+  rm -rf conftest* conftst*
+
+  # Do not use the global_symbol_pipe unless it works.
+  if test "$pipe_works" = yes; then
+    break
+  else
+    lt_cv_sys_global_symbol_pipe=
+  fi
+done
+
+fi
+
+if test -z "$lt_cv_sys_global_symbol_pipe"; then
+  lt_cv_sys_global_symbol_to_cdecl=
+fi
+if test -z "$lt_cv_sys_global_symbol_pipe$lt_cv_sys_global_symbol_to_cdecl"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: failed" >&5
+$as_echo "failed" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: ok" >&5
+$as_echo "ok" >&6; }
+fi
+
+# Response file support.
+if test "$lt_cv_nm_interface" = "MS dumpbin"; then
+  nm_file_list_spec='@'
+elif $NM --help 2>/dev/null | grep '[@]FILE' >/dev/null; then
+  nm_file_list_spec='@'
+fi
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for sysroot" >&5
+$as_echo_n "checking for sysroot... " >&6; }
+
+# Check whether --with-sysroot was given.
+if test "${with_sysroot+set}" = set; then :
+  withval=$with_sysroot;
+else
+  with_sysroot=no
+fi
+
+
+lt_sysroot=
+case ${with_sysroot} in #(
+ yes)
+   if test "$GCC" = yes; then
+     lt_sysroot=`$CC --print-sysroot 2>/dev/null`
+   fi
+   ;; #(
+ /*)
+   lt_sysroot=`echo "$with_sysroot" | sed -e "$sed_quote_subst"`
+   ;; #(
+ no|'')
+   ;; #(
+ *)
+   { $as_echo "$as_me:${as_lineno-$LINENO}: result: ${with_sysroot}" >&5
+$as_echo "${with_sysroot}" >&6; }
+   as_fn_error $? "The sysroot must be an absolute path." "$LINENO" 5
+   ;;
+esac
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: ${lt_sysroot:-no}" >&5
+$as_echo "${lt_sysroot:-no}" >&6; }
+
+
+
+
+
+# Check whether --enable-libtool-lock was given.
+if test "${enable_libtool_lock+set}" = set; then :
+  enableval=$enable_libtool_lock;
+fi
+
+test "x$enable_libtool_lock" != xno && enable_libtool_lock=yes
+
+# Some flags need to be propagated to the compiler or linker for good
+# libtool support.
+case $host in
+ia64-*-hpux*)
+  # Find out which ABI we are using.
+  echo 'int i;' > conftest.$ac_ext
+  if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+  (eval $ac_compile) 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; }; then
+    case `/usr/bin/file conftest.$ac_objext` in
+      *ELF-32*)
+	HPUX_IA64_MODE="32"
+	;;
+      *ELF-64*)
+	HPUX_IA64_MODE="64"
+	;;
+    esac
+  fi
+  rm -rf conftest*
+  ;;
+*-*-irix6*)
+  # Find out which ABI we are using.
+  echo '#line '$LINENO' "configure"' > conftest.$ac_ext
+  if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+  (eval $ac_compile) 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; }; then
+    if test "$lt_cv_prog_gnu_ld" = yes; then
+      case `/usr/bin/file conftest.$ac_objext` in
+	*32-bit*)
+	  LD="${LD-ld} -melf32bsmip"
+	  ;;
+	*N32*)
+	  LD="${LD-ld} -melf32bmipn32"
+	  ;;
+	*64-bit*)
+	  LD="${LD-ld} -melf64bmip"
+	;;
+      esac
+    else
+      case `/usr/bin/file conftest.$ac_objext` in
+	*32-bit*)
+	  LD="${LD-ld} -32"
+	  ;;
+	*N32*)
+	  LD="${LD-ld} -n32"
+	  ;;
+	*64-bit*)
+	  LD="${LD-ld} -64"
+	  ;;
+      esac
+    fi
+  fi
+  rm -rf conftest*
+  ;;
+
+x86_64-*kfreebsd*-gnu|x86_64-*linux*|powerpc*-*linux*| \
+s390*-*linux*|s390*-*tpf*|sparc*-*linux*)
+  # Find out which ABI we are using.
+  echo 'int i;' > conftest.$ac_ext
+  if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+  (eval $ac_compile) 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; }; then
+    case `/usr/bin/file conftest.o` in
+      *32-bit*)
+	case $host in
+	  x86_64-*kfreebsd*-gnu)
+	    LD="${LD-ld} -m elf_i386_fbsd"
+	    ;;
+	  x86_64-*linux*)
+	    case `/usr/bin/file conftest.o` in
+	      *x86-64*)
+		LD="${LD-ld} -m elf32_x86_64"
+		;;
+	      *)
+		LD="${LD-ld} -m elf_i386"
+		;;
+	    esac
+	    ;;
+	  powerpc64le-*)
+	    LD="${LD-ld} -m elf32lppclinux"
+	    ;;
+	  powerpc64-*)
+	    LD="${LD-ld} -m elf32ppclinux"
+	    ;;
+	  s390x-*linux*)
+	    LD="${LD-ld} -m elf_s390"
+	    ;;
+	  sparc64-*linux*)
+	    LD="${LD-ld} -m elf32_sparc"
+	    ;;
+	esac
+	;;
+      *64-bit*)
+	case $host in
+	  x86_64-*kfreebsd*-gnu)
+	    LD="${LD-ld} -m elf_x86_64_fbsd"
+	    ;;
+	  x86_64-*linux*)
+	    LD="${LD-ld} -m elf_x86_64"
+	    ;;
+	  powerpcle-*)
+	    LD="${LD-ld} -m elf64lppc"
+	    ;;
+	  powerpc-*)
+	    LD="${LD-ld} -m elf64ppc"
+	    ;;
+	  s390*-*linux*|s390*-*tpf*)
+	    LD="${LD-ld} -m elf64_s390"
+	    ;;
+	  sparc*-*linux*)
+	    LD="${LD-ld} -m elf64_sparc"
+	    ;;
+	esac
+	;;
+    esac
+  fi
+  rm -rf conftest*
+  ;;
+
+*-*-sco3.2v5*)
+  # On SCO OpenServer 5, we need -belf to get full-featured binaries.
+  SAVE_CFLAGS="$CFLAGS"
+  CFLAGS="$CFLAGS -belf"
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the C compiler needs -belf" >&5
+$as_echo_n "checking whether the C compiler needs -belf... " >&6; }
+if ${lt_cv_cc_needs_belf+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+     cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+int
+main ()
+{
+
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+  lt_cv_cc_needs_belf=yes
+else
+  lt_cv_cc_needs_belf=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+    conftest$ac_exeext conftest.$ac_ext
+     ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_cc_needs_belf" >&5
+$as_echo "$lt_cv_cc_needs_belf" >&6; }
+  if test x"$lt_cv_cc_needs_belf" != x"yes"; then
+    # this is probably gcc 2.8.0, egcs 1.0 or newer; no need for -belf
+    CFLAGS="$SAVE_CFLAGS"
+  fi
+  ;;
+*-*solaris*)
+  # Find out which ABI we are using.
+  echo 'int i;' > conftest.$ac_ext
+  if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+  (eval $ac_compile) 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; }; then
+    case `/usr/bin/file conftest.o` in
+    *64-bit*)
+      case $lt_cv_prog_gnu_ld in
+      yes*)
+        case $host in
+        i?86-*-solaris*)
+          LD="${LD-ld} -m elf_x86_64"
+          ;;
+        sparc*-*-solaris*)
+          LD="${LD-ld} -m elf64_sparc"
+          ;;
+        esac
+        # GNU ld 2.21 introduced _sol2 emulations.  Use them if available.
+        if ${LD-ld} -V | grep _sol2 >/dev/null 2>&1; then
+          LD="${LD-ld}_sol2"
+        fi
+        ;;
+      *)
+	if ${LD-ld} -64 -r -o conftest2.o conftest.o >/dev/null 2>&1; then
+	  LD="${LD-ld} -64"
+	fi
+	;;
+      esac
+      ;;
+    esac
+  fi
+  rm -rf conftest*
+  ;;
+esac
+
+need_locks="$enable_libtool_lock"
+
+if test -n "$ac_tool_prefix"; then
+  # Extract the first word of "${ac_tool_prefix}mt", so it can be a program name with args.
+set dummy ${ac_tool_prefix}mt; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_MANIFEST_TOOL+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$MANIFEST_TOOL"; then
+  ac_cv_prog_MANIFEST_TOOL="$MANIFEST_TOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_MANIFEST_TOOL="${ac_tool_prefix}mt"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+MANIFEST_TOOL=$ac_cv_prog_MANIFEST_TOOL
+if test -n "$MANIFEST_TOOL"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $MANIFEST_TOOL" >&5
+$as_echo "$MANIFEST_TOOL" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_MANIFEST_TOOL"; then
+  ac_ct_MANIFEST_TOOL=$MANIFEST_TOOL
+  # Extract the first word of "mt", so it can be a program name with args.
+set dummy mt; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_MANIFEST_TOOL+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$ac_ct_MANIFEST_TOOL"; then
+  ac_cv_prog_ac_ct_MANIFEST_TOOL="$ac_ct_MANIFEST_TOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_ac_ct_MANIFEST_TOOL="mt"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_MANIFEST_TOOL=$ac_cv_prog_ac_ct_MANIFEST_TOOL
+if test -n "$ac_ct_MANIFEST_TOOL"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_MANIFEST_TOOL" >&5
+$as_echo "$ac_ct_MANIFEST_TOOL" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+  if test "x$ac_ct_MANIFEST_TOOL" = x; then
+    MANIFEST_TOOL=":"
+  else
+    case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+    MANIFEST_TOOL=$ac_ct_MANIFEST_TOOL
+  fi
+else
+  MANIFEST_TOOL="$ac_cv_prog_MANIFEST_TOOL"
+fi
+
+test -z "$MANIFEST_TOOL" && MANIFEST_TOOL=mt
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if $MANIFEST_TOOL is a manifest tool" >&5
+$as_echo_n "checking if $MANIFEST_TOOL is a manifest tool... " >&6; }
+if ${lt_cv_path_mainfest_tool+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  lt_cv_path_mainfest_tool=no
+  echo "$as_me:$LINENO: $MANIFEST_TOOL '-?'" >&5
+  $MANIFEST_TOOL '-?' 2>conftest.err > conftest.out
+  cat conftest.err >&5
+  if $GREP 'Manifest Tool' conftest.out > /dev/null; then
+    lt_cv_path_mainfest_tool=yes
+  fi
+  rm -f conftest*
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_path_mainfest_tool" >&5
+$as_echo "$lt_cv_path_mainfest_tool" >&6; }
+if test "x$lt_cv_path_mainfest_tool" != xyes; then
+  MANIFEST_TOOL=:
+fi
+
+
+
+
+
+
+  case $host_os in
+    rhapsody* | darwin*)
+    if test -n "$ac_tool_prefix"; then
+  # Extract the first word of "${ac_tool_prefix}dsymutil", so it can be a program name with args.
+set dummy ${ac_tool_prefix}dsymutil; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_DSYMUTIL+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$DSYMUTIL"; then
+  ac_cv_prog_DSYMUTIL="$DSYMUTIL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_DSYMUTIL="${ac_tool_prefix}dsymutil"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+DSYMUTIL=$ac_cv_prog_DSYMUTIL
+if test -n "$DSYMUTIL"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $DSYMUTIL" >&5
+$as_echo "$DSYMUTIL" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_DSYMUTIL"; then
+  ac_ct_DSYMUTIL=$DSYMUTIL
+  # Extract the first word of "dsymutil", so it can be a program name with args.
+set dummy dsymutil; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_DSYMUTIL+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$ac_ct_DSYMUTIL"; then
+  ac_cv_prog_ac_ct_DSYMUTIL="$ac_ct_DSYMUTIL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_ac_ct_DSYMUTIL="dsymutil"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_DSYMUTIL=$ac_cv_prog_ac_ct_DSYMUTIL
+if test -n "$ac_ct_DSYMUTIL"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_DSYMUTIL" >&5
+$as_echo "$ac_ct_DSYMUTIL" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+  if test "x$ac_ct_DSYMUTIL" = x; then
+    DSYMUTIL=":"
+  else
+    case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+    DSYMUTIL=$ac_ct_DSYMUTIL
+  fi
+else
+  DSYMUTIL="$ac_cv_prog_DSYMUTIL"
+fi
+
+    if test -n "$ac_tool_prefix"; then
+  # Extract the first word of "${ac_tool_prefix}nmedit", so it can be a program name with args.
+set dummy ${ac_tool_prefix}nmedit; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_NMEDIT+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$NMEDIT"; then
+  ac_cv_prog_NMEDIT="$NMEDIT" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_NMEDIT="${ac_tool_prefix}nmedit"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+NMEDIT=$ac_cv_prog_NMEDIT
+if test -n "$NMEDIT"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $NMEDIT" >&5
+$as_echo "$NMEDIT" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_NMEDIT"; then
+  ac_ct_NMEDIT=$NMEDIT
+  # Extract the first word of "nmedit", so it can be a program name with args.
+set dummy nmedit; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_NMEDIT+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$ac_ct_NMEDIT"; then
+  ac_cv_prog_ac_ct_NMEDIT="$ac_ct_NMEDIT" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_ac_ct_NMEDIT="nmedit"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_NMEDIT=$ac_cv_prog_ac_ct_NMEDIT
+if test -n "$ac_ct_NMEDIT"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_NMEDIT" >&5
+$as_echo "$ac_ct_NMEDIT" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+  if test "x$ac_ct_NMEDIT" = x; then
+    NMEDIT=":"
+  else
+    case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+    NMEDIT=$ac_ct_NMEDIT
+  fi
+else
+  NMEDIT="$ac_cv_prog_NMEDIT"
+fi
+
+    if test -n "$ac_tool_prefix"; then
+  # Extract the first word of "${ac_tool_prefix}lipo", so it can be a program name with args.
+set dummy ${ac_tool_prefix}lipo; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_LIPO+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$LIPO"; then
+  ac_cv_prog_LIPO="$LIPO" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_LIPO="${ac_tool_prefix}lipo"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+LIPO=$ac_cv_prog_LIPO
+if test -n "$LIPO"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $LIPO" >&5
+$as_echo "$LIPO" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_LIPO"; then
+  ac_ct_LIPO=$LIPO
+  # Extract the first word of "lipo", so it can be a program name with args.
+set dummy lipo; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_LIPO+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$ac_ct_LIPO"; then
+  ac_cv_prog_ac_ct_LIPO="$ac_ct_LIPO" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_ac_ct_LIPO="lipo"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_LIPO=$ac_cv_prog_ac_ct_LIPO
+if test -n "$ac_ct_LIPO"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_LIPO" >&5
+$as_echo "$ac_ct_LIPO" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+  if test "x$ac_ct_LIPO" = x; then
+    LIPO=":"
+  else
+    case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+    LIPO=$ac_ct_LIPO
+  fi
+else
+  LIPO="$ac_cv_prog_LIPO"
+fi
+
+    if test -n "$ac_tool_prefix"; then
+  # Extract the first word of "${ac_tool_prefix}otool", so it can be a program name with args.
+set dummy ${ac_tool_prefix}otool; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_OTOOL+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$OTOOL"; then
+  ac_cv_prog_OTOOL="$OTOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_OTOOL="${ac_tool_prefix}otool"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+OTOOL=$ac_cv_prog_OTOOL
+if test -n "$OTOOL"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $OTOOL" >&5
+$as_echo "$OTOOL" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_OTOOL"; then
+  ac_ct_OTOOL=$OTOOL
+  # Extract the first word of "otool", so it can be a program name with args.
+set dummy otool; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_OTOOL+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$ac_ct_OTOOL"; then
+  ac_cv_prog_ac_ct_OTOOL="$ac_ct_OTOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_ac_ct_OTOOL="otool"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_OTOOL=$ac_cv_prog_ac_ct_OTOOL
+if test -n "$ac_ct_OTOOL"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_OTOOL" >&5
+$as_echo "$ac_ct_OTOOL" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+  if test "x$ac_ct_OTOOL" = x; then
+    OTOOL=":"
+  else
+    case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+    OTOOL=$ac_ct_OTOOL
+  fi
+else
+  OTOOL="$ac_cv_prog_OTOOL"
+fi
+
+    if test -n "$ac_tool_prefix"; then
+  # Extract the first word of "${ac_tool_prefix}otool64", so it can be a program name with args.
+set dummy ${ac_tool_prefix}otool64; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_OTOOL64+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$OTOOL64"; then
+  ac_cv_prog_OTOOL64="$OTOOL64" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_OTOOL64="${ac_tool_prefix}otool64"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+OTOOL64=$ac_cv_prog_OTOOL64
+if test -n "$OTOOL64"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $OTOOL64" >&5
+$as_echo "$OTOOL64" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_OTOOL64"; then
+  ac_ct_OTOOL64=$OTOOL64
+  # Extract the first word of "otool64", so it can be a program name with args.
+set dummy otool64; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_OTOOL64+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$ac_ct_OTOOL64"; then
+  ac_cv_prog_ac_ct_OTOOL64="$ac_ct_OTOOL64" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_ac_ct_OTOOL64="otool64"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_OTOOL64=$ac_cv_prog_ac_ct_OTOOL64
+if test -n "$ac_ct_OTOOL64"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_OTOOL64" >&5
+$as_echo "$ac_ct_OTOOL64" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+  if test "x$ac_ct_OTOOL64" = x; then
+    OTOOL64=":"
+  else
+    case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+    OTOOL64=$ac_ct_OTOOL64
+  fi
+else
+  OTOOL64="$ac_cv_prog_OTOOL64"
+fi
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+    { $as_echo "$as_me:${as_lineno-$LINENO}: checking for -single_module linker flag" >&5
+$as_echo_n "checking for -single_module linker flag... " >&6; }
+if ${lt_cv_apple_cc_single_mod+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  lt_cv_apple_cc_single_mod=no
+      if test -z "${LT_MULTI_MODULE}"; then
+	# By default we will add the -single_module flag. You can override
+	# by either setting the environment variable LT_MULTI_MODULE
+	# non-empty at configure time, or by adding -multi_module to the
+	# link flags.
+	rm -rf libconftest.dylib*
+	echo "int foo(void){return 1;}" > conftest.c
+	echo "$LTCC $LTCFLAGS $LDFLAGS -o libconftest.dylib \
+-dynamiclib -Wl,-single_module conftest.c" >&5
+	$LTCC $LTCFLAGS $LDFLAGS -o libconftest.dylib \
+	  -dynamiclib -Wl,-single_module conftest.c 2>conftest.err
+        _lt_result=$?
+	# If there is a non-empty error log, and "single_module"
+	# appears in it, assume the flag caused a linker warning
+        if test -s conftest.err && $GREP single_module conftest.err; then
+	  cat conftest.err >&5
+	# Otherwise, if the output was created with a 0 exit code from
+	# the compiler, it worked.
+	elif test -f libconftest.dylib && test $_lt_result -eq 0; then
+	  lt_cv_apple_cc_single_mod=yes
+	else
+	  cat conftest.err >&5
+	fi
+	rm -rf libconftest.dylib*
+	rm -f conftest.*
+      fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_apple_cc_single_mod" >&5
+$as_echo "$lt_cv_apple_cc_single_mod" >&6; }
+
+    { $as_echo "$as_me:${as_lineno-$LINENO}: checking for -exported_symbols_list linker flag" >&5
+$as_echo_n "checking for -exported_symbols_list linker flag... " >&6; }
+if ${lt_cv_ld_exported_symbols_list+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  lt_cv_ld_exported_symbols_list=no
+      save_LDFLAGS=$LDFLAGS
+      echo "_main" > conftest.sym
+      LDFLAGS="$LDFLAGS -Wl,-exported_symbols_list,conftest.sym"
+      cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+int
+main ()
+{
+
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+  lt_cv_ld_exported_symbols_list=yes
+else
+  lt_cv_ld_exported_symbols_list=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+    conftest$ac_exeext conftest.$ac_ext
+	LDFLAGS="$save_LDFLAGS"
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_ld_exported_symbols_list" >&5
+$as_echo "$lt_cv_ld_exported_symbols_list" >&6; }
+
+    { $as_echo "$as_me:${as_lineno-$LINENO}: checking for -force_load linker flag" >&5
+$as_echo_n "checking for -force_load linker flag... " >&6; }
+if ${lt_cv_ld_force_load+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  lt_cv_ld_force_load=no
+      cat > conftest.c << _LT_EOF
+int forced_loaded() { return 2;}
+_LT_EOF
+      echo "$LTCC $LTCFLAGS -c -o conftest.o conftest.c" >&5
+      $LTCC $LTCFLAGS -c -o conftest.o conftest.c 2>&5
+      echo "$AR cru libconftest.a conftest.o" >&5
+      $AR cru libconftest.a conftest.o 2>&5
+      echo "$RANLIB libconftest.a" >&5
+      $RANLIB libconftest.a 2>&5
+      cat > conftest.c << _LT_EOF
+int main() { return 0;}
+_LT_EOF
+      echo "$LTCC $LTCFLAGS $LDFLAGS -o conftest conftest.c -Wl,-force_load,./libconftest.a" >&5
+      $LTCC $LTCFLAGS $LDFLAGS -o conftest conftest.c -Wl,-force_load,./libconftest.a 2>conftest.err
+      _lt_result=$?
+      if test -s conftest.err && $GREP force_load conftest.err; then
+	cat conftest.err >&5
+      elif test -f conftest && test $_lt_result -eq 0 && $GREP forced_load conftest >/dev/null 2>&1 ; then
+	lt_cv_ld_force_load=yes
+      else
+	cat conftest.err >&5
+      fi
+        rm -f conftest.err libconftest.a conftest conftest.c
+        rm -rf conftest.dSYM
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_ld_force_load" >&5
+$as_echo "$lt_cv_ld_force_load" >&6; }
+    case $host_os in
+    rhapsody* | darwin1.[012])
+      _lt_dar_allow_undefined='${wl}-undefined ${wl}suppress' ;;
+    darwin1.*)
+      _lt_dar_allow_undefined='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' ;;
+    darwin*) # darwin 5.x on
+      # if running on 10.5 or later, the deployment target defaults
+      # to the OS version, if on x86, and 10.4, the deployment
+      # target defaults to 10.4. Don't you love it?
+      case ${MACOSX_DEPLOYMENT_TARGET-10.0},$host in
+	10.0,*86*-darwin8*|10.0,*-darwin[91]*)
+	  _lt_dar_allow_undefined='${wl}-undefined ${wl}dynamic_lookup' ;;
+	10.[012]*)
+	  _lt_dar_allow_undefined='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' ;;
+	10.*)
+	  _lt_dar_allow_undefined='${wl}-undefined ${wl}dynamic_lookup' ;;
+      esac
+    ;;
+  esac
+    if test "$lt_cv_apple_cc_single_mod" = "yes"; then
+      _lt_dar_single_mod='$single_module'
+    fi
+    if test "$lt_cv_ld_exported_symbols_list" = "yes"; then
+      _lt_dar_export_syms=' ${wl}-exported_symbols_list,$output_objdir/${libname}-symbols.expsym'
+    else
+      _lt_dar_export_syms='~$NMEDIT -s $output_objdir/${libname}-symbols.expsym ${lib}'
+    fi
+    if test "$DSYMUTIL" != ":" && test "$lt_cv_ld_force_load" = "no"; then
+      _lt_dsymutil='~$DSYMUTIL $lib || :'
+    else
+      _lt_dsymutil=
+    fi
+    ;;
+  esac
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to run the C preprocessor" >&5
+$as_echo_n "checking how to run the C preprocessor... " >&6; }
+# On Suns, sometimes $CPP names a directory.
+if test -n "$CPP" && test -d "$CPP"; then
+  CPP=
+fi
+if test -z "$CPP"; then
+  if ${ac_cv_prog_CPP+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+      # Double quotes because CPP needs to be expanded
+    for CPP in "$CC -E" "$CC -E -traditional-cpp" "/lib/cpp"
+    do
+      ac_preproc_ok=false
+for ac_c_preproc_warn_flag in '' yes
+do
+  # Use a header file that comes with gcc, so configuring glibc
+  # with a fresh cross-compiler works.
+  # Prefer <limits.h> to <assert.h> if __STDC__ is defined, since
+  # <limits.h> exists even on freestanding compilers.
+  # On the NeXT, cc -E runs the code through the compiler's parser,
+  # not just through cpp. "Syntax error" is here to catch this case.
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+#ifdef __STDC__
+# include <limits.h>
+#else
+# include <assert.h>
+#endif
+		     Syntax error
+_ACEOF
+if ac_fn_c_try_cpp "$LINENO"; then :
+
+else
+  # Broken: fails on valid input.
+continue
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+
+  # OK, works on sane cases.  Now check whether nonexistent headers
+  # can be detected and how.
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+#include <ac_nonexistent.h>
+_ACEOF
+if ac_fn_c_try_cpp "$LINENO"; then :
+  # Broken: success on invalid input.
+continue
+else
+  # Passes both tests.
+ac_preproc_ok=:
+break
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+
+done
+# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped.
+rm -f conftest.i conftest.err conftest.$ac_ext
+if $ac_preproc_ok; then :
+  break
+fi
+
+    done
+    ac_cv_prog_CPP=$CPP
+
+fi
+  CPP=$ac_cv_prog_CPP
+else
+  ac_cv_prog_CPP=$CPP
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $CPP" >&5
+$as_echo "$CPP" >&6; }
+ac_preproc_ok=false
+for ac_c_preproc_warn_flag in '' yes
+do
+  # Use a header file that comes with gcc, so configuring glibc
+  # with a fresh cross-compiler works.
+  # Prefer <limits.h> to <assert.h> if __STDC__ is defined, since
+  # <limits.h> exists even on freestanding compilers.
+  # On the NeXT, cc -E runs the code through the compiler's parser,
+  # not just through cpp. "Syntax error" is here to catch this case.
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+#ifdef __STDC__
+# include <limits.h>
+#else
+# include <assert.h>
+#endif
+		     Syntax error
+_ACEOF
+if ac_fn_c_try_cpp "$LINENO"; then :
+
+else
+  # Broken: fails on valid input.
+continue
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+
+  # OK, works on sane cases.  Now check whether nonexistent headers
+  # can be detected and how.
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+#include <ac_nonexistent.h>
+_ACEOF
+if ac_fn_c_try_cpp "$LINENO"; then :
+  # Broken: success on invalid input.
+continue
+else
+  # Passes both tests.
+ac_preproc_ok=:
+break
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+
+done
+# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped.
+rm -f conftest.i conftest.err conftest.$ac_ext
+if $ac_preproc_ok; then :
+
+else
+  { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "C preprocessor \"$CPP\" fails sanity check
+See \`config.log' for more details" "$LINENO" 5; }
+fi
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for ANSI C header files" >&5
+$as_echo_n "checking for ANSI C header files... " >&6; }
+if ${ac_cv_header_stdc+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+#include <stdlib.h>
+#include <stdarg.h>
+#include <string.h>
+#include <float.h>
+
+int
+main ()
+{
+
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+  ac_cv_header_stdc=yes
+else
+  ac_cv_header_stdc=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+
+if test $ac_cv_header_stdc = yes; then
+  # SunOS 4.x string.h does not declare mem*, contrary to ANSI.
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+#include <string.h>
+
+_ACEOF
+if (eval "$ac_cpp conftest.$ac_ext") 2>&5 |
+  $EGREP "memchr" >/dev/null 2>&1; then :
+
+else
+  ac_cv_header_stdc=no
+fi
+rm -f conftest*
+
+fi
+
+if test $ac_cv_header_stdc = yes; then
+  # ISC 2.0.2 stdlib.h does not declare free, contrary to ANSI.
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+#include <stdlib.h>
+
+_ACEOF
+if (eval "$ac_cpp conftest.$ac_ext") 2>&5 |
+  $EGREP "free" >/dev/null 2>&1; then :
+
+else
+  ac_cv_header_stdc=no
+fi
+rm -f conftest*
+
+fi
+
+if test $ac_cv_header_stdc = yes; then
+  # /bin/cc in Irix-4.0.5 gets non-ANSI ctype macros unless using -ansi.
+  if test "$cross_compiling" = yes; then :
+  :
+else
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+#include <ctype.h>
+#include <stdlib.h>
+#if ((' ' & 0x0FF) == 0x020)
+# define ISLOWER(c) ('a' <= (c) && (c) <= 'z')
+# define TOUPPER(c) (ISLOWER(c) ? 'A' + ((c) - 'a') : (c))
+#else
+# define ISLOWER(c) \
+		   (('a' <= (c) && (c) <= 'i') \
+		     || ('j' <= (c) && (c) <= 'r') \
+		     || ('s' <= (c) && (c) <= 'z'))
+# define TOUPPER(c) (ISLOWER(c) ? ((c) | 0x40) : (c))
+#endif
+
+#define XOR(e, f) (((e) && !(f)) || (!(e) && (f)))
+int
+main ()
+{
+  int i;
+  for (i = 0; i < 256; i++)
+    if (XOR (islower (i), ISLOWER (i))
+	|| toupper (i) != TOUPPER (i))
+      return 2;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_run "$LINENO"; then :
+
+else
+  ac_cv_header_stdc=no
+fi
+rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext \
+  conftest.$ac_objext conftest.beam conftest.$ac_ext
+fi
+
+fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_header_stdc" >&5
+$as_echo "$ac_cv_header_stdc" >&6; }
+if test $ac_cv_header_stdc = yes; then
+
+$as_echo "#define STDC_HEADERS 1" >>confdefs.h
+
+fi
+
+# On IRIX 5.3, sys/types and inttypes.h are conflicting.
+for ac_header in sys/types.h sys/stat.h stdlib.h string.h memory.h strings.h \
+		  inttypes.h stdint.h unistd.h
+do :
+  as_ac_Header=`$as_echo "ac_cv_header_$ac_header" | $as_tr_sh`
+ac_fn_c_check_header_compile "$LINENO" "$ac_header" "$as_ac_Header" "$ac_includes_default
+"
+if eval test \"x\$"$as_ac_Header"\" = x"yes"; then :
+  cat >>confdefs.h <<_ACEOF
+#define `$as_echo "HAVE_$ac_header" | $as_tr_cpp` 1
+_ACEOF
+
+fi
+
+done
+
+
+for ac_header in dlfcn.h
+do :
+  ac_fn_c_check_header_compile "$LINENO" "dlfcn.h" "ac_cv_header_dlfcn_h" "$ac_includes_default
+"
+if test "x$ac_cv_header_dlfcn_h" = xyes; then :
+  cat >>confdefs.h <<_ACEOF
+#define HAVE_DLFCN_H 1
+_ACEOF
+
+fi
+
+done
+
+
+
+
+
+# Set options
+
+
+
+        enable_dlopen=no
+
+
+  enable_win32_dll=no
+
+
+            # Check whether --enable-shared was given.
+if test "${enable_shared+set}" = set; then :
+  enableval=$enable_shared; p=${PACKAGE-default}
+    case $enableval in
+    yes) enable_shared=yes ;;
+    no) enable_shared=no ;;
+    *)
+      enable_shared=no
+      # Look at the argument we got.  We use all the common list separators.
+      lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+      for pkg in $enableval; do
+	IFS="$lt_save_ifs"
+	if test "X$pkg" = "X$p"; then
+	  enable_shared=yes
+	fi
+      done
+      IFS="$lt_save_ifs"
+      ;;
+    esac
+else
+  enable_shared=yes
+fi
+
+
+
+
+
+
+
+
+
+  # Check whether --enable-static was given.
+if test "${enable_static+set}" = set; then :
+  enableval=$enable_static; p=${PACKAGE-default}
+    case $enableval in
+    yes) enable_static=yes ;;
+    no) enable_static=no ;;
+    *)
+     enable_static=no
+      # Look at the argument we got.  We use all the common list separators.
+      lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+      for pkg in $enableval; do
+	IFS="$lt_save_ifs"
+	if test "X$pkg" = "X$p"; then
+	  enable_static=yes
+	fi
+      done
+      IFS="$lt_save_ifs"
+      ;;
+    esac
+else
+  enable_static=yes
+fi
+
+
+
+
+
+
+
+
+
+
+# Check whether --with-pic was given.
+if test "${with_pic+set}" = set; then :
+  withval=$with_pic; lt_p=${PACKAGE-default}
+    case $withval in
+    yes|no) pic_mode=$withval ;;
+    *)
+      pic_mode=default
+      # Look at the argument we got.  We use all the common list separators.
+      lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+      for lt_pkg in $withval; do
+	IFS="$lt_save_ifs"
+	if test "X$lt_pkg" = "X$lt_p"; then
+	  pic_mode=yes
+	fi
+      done
+      IFS="$lt_save_ifs"
+      ;;
+    esac
+else
+  pic_mode=default
+fi
+
+
+test -z "$pic_mode" && pic_mode=default
+
+
+
+
+
+
+
+  # Check whether --enable-fast-install was given.
+if test "${enable_fast_install+set}" = set; then :
+  enableval=$enable_fast_install; p=${PACKAGE-default}
+    case $enableval in
+    yes) enable_fast_install=yes ;;
+    no) enable_fast_install=no ;;
+    *)
+      enable_fast_install=no
+      # Look at the argument we got.  We use all the common list separators.
+      lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+      for pkg in $enableval; do
+	IFS="$lt_save_ifs"
+	if test "X$pkg" = "X$p"; then
+	  enable_fast_install=yes
+	fi
+      done
+      IFS="$lt_save_ifs"
+      ;;
+    esac
+else
+  enable_fast_install=yes
+fi
+
+
+
+
+
+
+
+
+
+
+
+# This can be used to rebuild libtool when needed
+LIBTOOL_DEPS="$ltmain"
+
+# Always use our own libtool.
+LIBTOOL='$(SHELL) $(top_builddir)/libtool'
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+test -z "$LN_S" && LN_S="ln -s"
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+if test -n "${ZSH_VERSION+set}" ; then
+   setopt NO_GLOB_SUBST
+fi
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for objdir" >&5
+$as_echo_n "checking for objdir... " >&6; }
+if ${lt_cv_objdir+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  rm -f .libs 2>/dev/null
+mkdir .libs 2>/dev/null
+if test -d .libs; then
+  lt_cv_objdir=.libs
+else
+  # MS-DOS does not allow filenames that begin with a dot.
+  lt_cv_objdir=_libs
+fi
+rmdir .libs 2>/dev/null
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_objdir" >&5
+$as_echo "$lt_cv_objdir" >&6; }
+objdir=$lt_cv_objdir
+
+
+
+
+
+cat >>confdefs.h <<_ACEOF
+#define LT_OBJDIR "$lt_cv_objdir/"
+_ACEOF
+
+
+
+
+case $host_os in
+aix3*)
+  # AIX sometimes has problems with the GCC collect2 program.  For some
+  # reason, if we set the COLLECT_NAMES environment variable, the problems
+  # vanish in a puff of smoke.
+  if test "X${COLLECT_NAMES+set}" != Xset; then
+    COLLECT_NAMES=
+    export COLLECT_NAMES
+  fi
+  ;;
+esac
+
+# Global variables:
+ofile=libtool
+can_build_shared=yes
+
+# All known linkers require a `.a' archive for static linking (except MSVC,
+# which needs '.lib').
+libext=a
+
+with_gnu_ld="$lt_cv_prog_gnu_ld"
+
+old_CC="$CC"
+old_CFLAGS="$CFLAGS"
+
+# Set sane defaults for various variables
+test -z "$CC" && CC=cc
+test -z "$LTCC" && LTCC=$CC
+test -z "$LTCFLAGS" && LTCFLAGS=$CFLAGS
+test -z "$LD" && LD=ld
+test -z "$ac_objext" && ac_objext=o
+
+for cc_temp in $compiler""; do
+  case $cc_temp in
+    compile | *[\\/]compile | ccache | *[\\/]ccache ) ;;
+    distcc | *[\\/]distcc | purify | *[\\/]purify ) ;;
+    \-*) ;;
+    *) break;;
+  esac
+done
+cc_basename=`$ECHO "$cc_temp" | $SED "s%.*/%%; s%^$host_alias-%%"`
+
+
+# Only perform the check for file, if the check method requires it
+test -z "$MAGIC_CMD" && MAGIC_CMD=file
+case $deplibs_check_method in
+file_magic*)
+  if test "$file_magic_cmd" = '$MAGIC_CMD'; then
+    { $as_echo "$as_me:${as_lineno-$LINENO}: checking for ${ac_tool_prefix}file" >&5
+$as_echo_n "checking for ${ac_tool_prefix}file... " >&6; }
+if ${lt_cv_path_MAGIC_CMD+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  case $MAGIC_CMD in
+[\\/*] |  ?:[\\/]*)
+  lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a path.
+  ;;
+*)
+  lt_save_MAGIC_CMD="$MAGIC_CMD"
+  lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+  ac_dummy="/usr/bin$PATH_SEPARATOR$PATH"
+  for ac_dir in $ac_dummy; do
+    IFS="$lt_save_ifs"
+    test -z "$ac_dir" && ac_dir=.
+    if test -f $ac_dir/${ac_tool_prefix}file; then
+      lt_cv_path_MAGIC_CMD="$ac_dir/${ac_tool_prefix}file"
+      if test -n "$file_magic_test_file"; then
+	case $deplibs_check_method in
+	"file_magic "*)
+	  file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"`
+	  MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+	  if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null |
+	    $EGREP "$file_magic_regex" > /dev/null; then
+	    :
+	  else
+	    cat <<_LT_EOF 1>&2
+
+*** Warning: the command libtool uses to detect shared libraries,
+*** $file_magic_cmd, produces output that libtool cannot recognize.
+*** The result is that libtool may fail to recognize shared libraries
+*** as such.  This will affect the creation of libtool libraries that
+*** depend on shared libraries, but programs linked with such libtool
+*** libraries will work regardless of this problem.  Nevertheless, you
+*** may want to report the problem to your system manager and/or to
+*** bug-libtool at gnu.org
+
+_LT_EOF
+	  fi ;;
+	esac
+      fi
+      break
+    fi
+  done
+  IFS="$lt_save_ifs"
+  MAGIC_CMD="$lt_save_MAGIC_CMD"
+  ;;
+esac
+fi
+
+MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+if test -n "$MAGIC_CMD"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $MAGIC_CMD" >&5
+$as_echo "$MAGIC_CMD" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+
+
+
+if test -z "$lt_cv_path_MAGIC_CMD"; then
+  if test -n "$ac_tool_prefix"; then
+    { $as_echo "$as_me:${as_lineno-$LINENO}: checking for file" >&5
+$as_echo_n "checking for file... " >&6; }
+if ${lt_cv_path_MAGIC_CMD+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  case $MAGIC_CMD in
+[\\/*] |  ?:[\\/]*)
+  lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a path.
+  ;;
+*)
+  lt_save_MAGIC_CMD="$MAGIC_CMD"
+  lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+  ac_dummy="/usr/bin$PATH_SEPARATOR$PATH"
+  for ac_dir in $ac_dummy; do
+    IFS="$lt_save_ifs"
+    test -z "$ac_dir" && ac_dir=.
+    if test -f $ac_dir/file; then
+      lt_cv_path_MAGIC_CMD="$ac_dir/file"
+      if test -n "$file_magic_test_file"; then
+	case $deplibs_check_method in
+	"file_magic "*)
+	  file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"`
+	  MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+	  if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null |
+	    $EGREP "$file_magic_regex" > /dev/null; then
+	    :
+	  else
+	    cat <<_LT_EOF 1>&2
+
+*** Warning: the command libtool uses to detect shared libraries,
+*** $file_magic_cmd, produces output that libtool cannot recognize.
+*** The result is that libtool may fail to recognize shared libraries
+*** as such.  This will affect the creation of libtool libraries that
+*** depend on shared libraries, but programs linked with such libtool
+*** libraries will work regardless of this problem.  Nevertheless, you
+*** may want to report the problem to your system manager and/or to
+*** bug-libtool at gnu.org
+
+_LT_EOF
+	  fi ;;
+	esac
+      fi
+      break
+    fi
+  done
+  IFS="$lt_save_ifs"
+  MAGIC_CMD="$lt_save_MAGIC_CMD"
+  ;;
+esac
+fi
+
+MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+if test -n "$MAGIC_CMD"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $MAGIC_CMD" >&5
+$as_echo "$MAGIC_CMD" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+  else
+    MAGIC_CMD=:
+  fi
+fi
+
+  fi
+  ;;
+esac
+
+# Use C for the default configuration in the libtool script
+
+lt_save_CC="$CC"
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+
+# Source file extension for C test sources.
+ac_ext=c
+
+# Object file extension for compiled C test sources.
+objext=o
+objext=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code="int some_variable = 0;"
+
+# Code to be used in simple link tests
+lt_simple_link_test_code='int main(){return(0);}'
+
+
+
+
+
+
+
+# If no C compiler was specified, use CC.
+LTCC=${LTCC-"$CC"}
+
+# If no C compiler flags were specified, use CFLAGS.
+LTCFLAGS=${LTCFLAGS-"$CFLAGS"}
+
+# Allow CC to be a program name with arguments.
+compiler=$CC
+
+# Save the default compiler, since it gets overwritten when the other
+# tags are being tested, and _LT_TAGVAR(compiler, []) is a NOP.
+compiler_DEFAULT=$CC
+
+# save warnings/boilerplate of simple test code
+ac_outfile=conftest.$ac_objext
+echo "$lt_simple_compile_test_code" >conftest.$ac_ext
+eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_compiler_boilerplate=`cat conftest.err`
+$RM conftest*
+
+ac_outfile=conftest.$ac_objext
+echo "$lt_simple_link_test_code" >conftest.$ac_ext
+eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_linker_boilerplate=`cat conftest.err`
+$RM -r conftest*
+
+
+if test -n "$compiler"; then
+
+lt_prog_compiler_no_builtin_flag=
+
+if test "$GCC" = yes; then
+  case $cc_basename in
+  nvcc*)
+    lt_prog_compiler_no_builtin_flag=' -Xcompiler -fno-builtin' ;;
+  *)
+    lt_prog_compiler_no_builtin_flag=' -fno-builtin' ;;
+  esac
+
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler supports -fno-rtti -fno-exceptions" >&5
+$as_echo_n "checking if $compiler supports -fno-rtti -fno-exceptions... " >&6; }
+if ${lt_cv_prog_compiler_rtti_exceptions+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  lt_cv_prog_compiler_rtti_exceptions=no
+   ac_outfile=conftest.$ac_objext
+   echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+   lt_compiler_flag="-fno-rtti -fno-exceptions"
+   # Insert the option either (1) after the last *FLAGS variable, or
+   # (2) before a word containing "conftest.", or (3) at the end.
+   # Note that $ac_compile itself does not contain backslashes and begins
+   # with a dollar sign (not a hyphen), so the echo should work correctly.
+   # The option is referenced via a variable to avoid confusing sed.
+   lt_compile=`echo "$ac_compile" | $SED \
+   -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+   -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+   -e 's:$: $lt_compiler_flag:'`
+   (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5)
+   (eval "$lt_compile" 2>conftest.err)
+   ac_status=$?
+   cat conftest.err >&5
+   echo "$as_me:$LINENO: \$? = $ac_status" >&5
+   if (exit $ac_status) && test -s "$ac_outfile"; then
+     # The compiler can only warn and ignore the option if not recognized
+     # So say no if there are warnings other than the usual output.
+     $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' >conftest.exp
+     $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+     if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then
+       lt_cv_prog_compiler_rtti_exceptions=yes
+     fi
+   fi
+   $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_rtti_exceptions" >&5
+$as_echo "$lt_cv_prog_compiler_rtti_exceptions" >&6; }
+
+if test x"$lt_cv_prog_compiler_rtti_exceptions" = xyes; then
+    lt_prog_compiler_no_builtin_flag="$lt_prog_compiler_no_builtin_flag -fno-rtti -fno-exceptions"
+else
+    :
+fi
+
+fi
+
+
+
+
+
+
+  lt_prog_compiler_wl=
+lt_prog_compiler_pic=
+lt_prog_compiler_static=
+
+
+  if test "$GCC" = yes; then
+    lt_prog_compiler_wl='-Wl,'
+    lt_prog_compiler_static='-static'
+
+    case $host_os in
+      aix*)
+      # All AIX code is PIC.
+      if test "$host_cpu" = ia64; then
+	# AIX 5 now supports IA64 processor
+	lt_prog_compiler_static='-Bstatic'
+      fi
+      ;;
+
+    amigaos*)
+      case $host_cpu in
+      powerpc)
+            # see comment about AmigaOS4 .so support
+            lt_prog_compiler_pic='-fPIC'
+        ;;
+      m68k)
+            # FIXME: we need at least 68020 code to build shared libraries, but
+            # adding the `-m68020' flag to GCC prevents building anything better,
+            # like `-m68040'.
+            lt_prog_compiler_pic='-m68020 -resident32 -malways-restore-a4'
+        ;;
+      esac
+      ;;
+
+    beos* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*)
+      # PIC is the default for these OSes.
+      ;;
+
+    mingw* | cygwin* | pw32* | os2* | cegcc*)
+      # This hack is so that the source file can tell whether it is being
+      # built for inclusion in a dll (and should export symbols for example).
+      # Although the cygwin gcc ignores -fPIC, still need this for old-style
+      # (--disable-auto-import) libraries
+      lt_prog_compiler_pic='-DDLL_EXPORT'
+      ;;
+
+    darwin* | rhapsody*)
+      # PIC is the default on this platform
+      # Common symbols not allowed in MH_DYLIB files
+      lt_prog_compiler_pic='-fno-common'
+      ;;
+
+    haiku*)
+      # PIC is the default for Haiku.
+      # The "-static" flag exists, but is broken.
+      lt_prog_compiler_static=
+      ;;
+
+    hpux*)
+      # PIC is the default for 64-bit PA HP-UX, but not for 32-bit
+      # PA HP-UX.  On IA64 HP-UX, PIC is the default but the pic flag
+      # sets the default TLS model and affects inlining.
+      case $host_cpu in
+      hppa*64*)
+	# +Z the default
+	;;
+      *)
+	lt_prog_compiler_pic='-fPIC'
+	;;
+      esac
+      ;;
+
+    interix[3-9]*)
+      # Interix 3.x gcc -fpic/-fPIC options generate broken code.
+      # Instead, we relocate shared libraries at runtime.
+      ;;
+
+    msdosdjgpp*)
+      # Just because we use GCC doesn't mean we suddenly get shared libraries
+      # on systems that don't support them.
+      lt_prog_compiler_can_build_shared=no
+      enable_shared=no
+      ;;
+
+    *nto* | *qnx*)
+      # QNX uses GNU C++, but need to define -shared option too, otherwise
+      # it will coredump.
+      lt_prog_compiler_pic='-fPIC -shared'
+      ;;
+
+    sysv4*MP*)
+      if test -d /usr/nec; then
+	lt_prog_compiler_pic=-Kconform_pic
+      fi
+      ;;
+
+    *)
+      lt_prog_compiler_pic='-fPIC'
+      ;;
+    esac
+
+    case $cc_basename in
+    nvcc*) # Cuda Compiler Driver 2.2
+      lt_prog_compiler_wl='-Xlinker '
+      if test -n "$lt_prog_compiler_pic"; then
+        lt_prog_compiler_pic="-Xcompiler $lt_prog_compiler_pic"
+      fi
+      ;;
+    esac
+  else
+    # PORTME Check for flag to pass linker flags through the system compiler.
+    case $host_os in
+    aix*)
+      lt_prog_compiler_wl='-Wl,'
+      if test "$host_cpu" = ia64; then
+	# AIX 5 now supports IA64 processor
+	lt_prog_compiler_static='-Bstatic'
+      else
+	lt_prog_compiler_static='-bnso -bI:/lib/syscalls.exp'
+      fi
+      ;;
+
+    mingw* | cygwin* | pw32* | os2* | cegcc*)
+      # This hack is so that the source file can tell whether it is being
+      # built for inclusion in a dll (and should export symbols for example).
+      lt_prog_compiler_pic='-DDLL_EXPORT'
+      ;;
+
+    hpux9* | hpux10* | hpux11*)
+      lt_prog_compiler_wl='-Wl,'
+      # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but
+      # not for PA HP-UX.
+      case $host_cpu in
+      hppa*64*|ia64*)
+	# +Z the default
+	;;
+      *)
+	lt_prog_compiler_pic='+Z'
+	;;
+      esac
+      # Is there a better lt_prog_compiler_static that works with the bundled CC?
+      lt_prog_compiler_static='${wl}-a ${wl}archive'
+      ;;
+
+    irix5* | irix6* | nonstopux*)
+      lt_prog_compiler_wl='-Wl,'
+      # PIC (with -KPIC) is the default.
+      lt_prog_compiler_static='-non_shared'
+      ;;
+
+    linux* | k*bsd*-gnu | kopensolaris*-gnu | gnu*)
+      case $cc_basename in
+      # old Intel for x86_64 which still supported -KPIC.
+      ecc*)
+	lt_prog_compiler_wl='-Wl,'
+	lt_prog_compiler_pic='-KPIC'
+	lt_prog_compiler_static='-static'
+        ;;
+      # icc used to be incompatible with GCC.
+      # ICC 10 doesn't accept -KPIC any more.
+      icc* | ifort*)
+	lt_prog_compiler_wl='-Wl,'
+	lt_prog_compiler_pic='-fPIC'
+	lt_prog_compiler_static='-static'
+        ;;
+      # Lahey Fortran 8.1.
+      lf95*)
+	lt_prog_compiler_wl='-Wl,'
+	lt_prog_compiler_pic='--shared'
+	lt_prog_compiler_static='--static'
+	;;
+      nagfor*)
+	# NAG Fortran compiler
+	lt_prog_compiler_wl='-Wl,-Wl,,'
+	lt_prog_compiler_pic='-PIC'
+	lt_prog_compiler_static='-Bstatic'
+	;;
+      pgcc* | pgf77* | pgf90* | pgf95* | pgfortran*)
+        # Portland Group compilers (*not* the Pentium gcc compiler,
+	# which looks to be a dead project)
+	lt_prog_compiler_wl='-Wl,'
+	lt_prog_compiler_pic='-fpic'
+	lt_prog_compiler_static='-Bstatic'
+        ;;
+      ccc*)
+        lt_prog_compiler_wl='-Wl,'
+        # All Alpha code is PIC.
+        lt_prog_compiler_static='-non_shared'
+        ;;
+      xl* | bgxl* | bgf* | mpixl*)
+	# IBM XL C 8.0/Fortran 10.1, 11.1 on PPC and BlueGene
+	lt_prog_compiler_wl='-Wl,'
+	lt_prog_compiler_pic='-qpic'
+	lt_prog_compiler_static='-qstaticlink'
+	;;
+      *)
+	case `$CC -V 2>&1 | sed 5q` in
+	*Sun\ Ceres\ Fortran* | *Sun*Fortran*\ [1-7].* | *Sun*Fortran*\ 8.[0-3]*)
+	  # Sun Fortran 8.3 passes all unrecognized flags to the linker
+	  lt_prog_compiler_pic='-KPIC'
+	  lt_prog_compiler_static='-Bstatic'
+	  lt_prog_compiler_wl=''
+	  ;;
+	*Sun\ F* | *Sun*Fortran*)
+	  lt_prog_compiler_pic='-KPIC'
+	  lt_prog_compiler_static='-Bstatic'
+	  lt_prog_compiler_wl='-Qoption ld '
+	  ;;
+	*Sun\ C*)
+	  # Sun C 5.9
+	  lt_prog_compiler_pic='-KPIC'
+	  lt_prog_compiler_static='-Bstatic'
+	  lt_prog_compiler_wl='-Wl,'
+	  ;;
+        *Intel*\ [CF]*Compiler*)
+	  lt_prog_compiler_wl='-Wl,'
+	  lt_prog_compiler_pic='-fPIC'
+	  lt_prog_compiler_static='-static'
+	  ;;
+	*Portland\ Group*)
+	  lt_prog_compiler_wl='-Wl,'
+	  lt_prog_compiler_pic='-fpic'
+	  lt_prog_compiler_static='-Bstatic'
+	  ;;
+	esac
+	;;
+      esac
+      ;;
+
+    newsos6)
+      lt_prog_compiler_pic='-KPIC'
+      lt_prog_compiler_static='-Bstatic'
+      ;;
+
+    *nto* | *qnx*)
+      # QNX uses GNU C++, but need to define -shared option too, otherwise
+      # it will coredump.
+      lt_prog_compiler_pic='-fPIC -shared'
+      ;;
+
+    osf3* | osf4* | osf5*)
+      lt_prog_compiler_wl='-Wl,'
+      # All OSF/1 code is PIC.
+      lt_prog_compiler_static='-non_shared'
+      ;;
+
+    rdos*)
+      lt_prog_compiler_static='-non_shared'
+      ;;
+
+    solaris*)
+      lt_prog_compiler_pic='-KPIC'
+      lt_prog_compiler_static='-Bstatic'
+      case $cc_basename in
+      f77* | f90* | f95* | sunf77* | sunf90* | sunf95*)
+	lt_prog_compiler_wl='-Qoption ld ';;
+      *)
+	lt_prog_compiler_wl='-Wl,';;
+      esac
+      ;;
+
+    sunos4*)
+      lt_prog_compiler_wl='-Qoption ld '
+      lt_prog_compiler_pic='-PIC'
+      lt_prog_compiler_static='-Bstatic'
+      ;;
+
+    sysv4 | sysv4.2uw2* | sysv4.3*)
+      lt_prog_compiler_wl='-Wl,'
+      lt_prog_compiler_pic='-KPIC'
+      lt_prog_compiler_static='-Bstatic'
+      ;;
+
+    sysv4*MP*)
+      if test -d /usr/nec ;then
+	lt_prog_compiler_pic='-Kconform_pic'
+	lt_prog_compiler_static='-Bstatic'
+      fi
+      ;;
+
+    sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*)
+      lt_prog_compiler_wl='-Wl,'
+      lt_prog_compiler_pic='-KPIC'
+      lt_prog_compiler_static='-Bstatic'
+      ;;
+
+    unicos*)
+      lt_prog_compiler_wl='-Wl,'
+      lt_prog_compiler_can_build_shared=no
+      ;;
+
+    uts4*)
+      lt_prog_compiler_pic='-pic'
+      lt_prog_compiler_static='-Bstatic'
+      ;;
+
+    *)
+      lt_prog_compiler_can_build_shared=no
+      ;;
+    esac
+  fi
+
+case $host_os in
+  # For platforms which do not support PIC, -DPIC is meaningless:
+  *djgpp*)
+    lt_prog_compiler_pic=
+    ;;
+  *)
+    lt_prog_compiler_pic="$lt_prog_compiler_pic -DPIC"
+    ;;
+esac
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $compiler option to produce PIC" >&5
+$as_echo_n "checking for $compiler option to produce PIC... " >&6; }
+if ${lt_cv_prog_compiler_pic+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  lt_cv_prog_compiler_pic=$lt_prog_compiler_pic
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_pic" >&5
+$as_echo "$lt_cv_prog_compiler_pic" >&6; }
+lt_prog_compiler_pic=$lt_cv_prog_compiler_pic
+
+#
+# Check to make sure the PIC flag actually works.
+#
+if test -n "$lt_prog_compiler_pic"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler PIC flag $lt_prog_compiler_pic works" >&5
+$as_echo_n "checking if $compiler PIC flag $lt_prog_compiler_pic works... " >&6; }
+if ${lt_cv_prog_compiler_pic_works+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  lt_cv_prog_compiler_pic_works=no
+   ac_outfile=conftest.$ac_objext
+   echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+   lt_compiler_flag="$lt_prog_compiler_pic -DPIC"
+   # Insert the option either (1) after the last *FLAGS variable, or
+   # (2) before a word containing "conftest.", or (3) at the end.
+   # Note that $ac_compile itself does not contain backslashes and begins
+   # with a dollar sign (not a hyphen), so the echo should work correctly.
+   # The option is referenced via a variable to avoid confusing sed.
+   lt_compile=`echo "$ac_compile" | $SED \
+   -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+   -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+   -e 's:$: $lt_compiler_flag:'`
+   (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5)
+   (eval "$lt_compile" 2>conftest.err)
+   ac_status=$?
+   cat conftest.err >&5
+   echo "$as_me:$LINENO: \$? = $ac_status" >&5
+   if (exit $ac_status) && test -s "$ac_outfile"; then
+     # The compiler can only warn and ignore the option if not recognized
+     # So say no if there are warnings other than the usual output.
+     $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' >conftest.exp
+     $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+     if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then
+       lt_cv_prog_compiler_pic_works=yes
+     fi
+   fi
+   $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_pic_works" >&5
+$as_echo "$lt_cv_prog_compiler_pic_works" >&6; }
+
+if test x"$lt_cv_prog_compiler_pic_works" = xyes; then
+    case $lt_prog_compiler_pic in
+     "" | " "*) ;;
+     *) lt_prog_compiler_pic=" $lt_prog_compiler_pic" ;;
+     esac
+else
+    lt_prog_compiler_pic=
+     lt_prog_compiler_can_build_shared=no
+fi
+
+fi
+
+
+
+
+
+
+
+
+
+
+
+#
+# Check to make sure the static flag actually works.
+#
+wl=$lt_prog_compiler_wl eval lt_tmp_static_flag=\"$lt_prog_compiler_static\"
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler static flag $lt_tmp_static_flag works" >&5
+$as_echo_n "checking if $compiler static flag $lt_tmp_static_flag works... " >&6; }
+if ${lt_cv_prog_compiler_static_works+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  lt_cv_prog_compiler_static_works=no
+   save_LDFLAGS="$LDFLAGS"
+   LDFLAGS="$LDFLAGS $lt_tmp_static_flag"
+   echo "$lt_simple_link_test_code" > conftest.$ac_ext
+   if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then
+     # The linker can only warn and ignore the option if not recognized
+     # So say no if there are warnings
+     if test -s conftest.err; then
+       # Append any errors to the config.log.
+       cat conftest.err 1>&5
+       $ECHO "$_lt_linker_boilerplate" | $SED '/^$/d' > conftest.exp
+       $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+       if diff conftest.exp conftest.er2 >/dev/null; then
+         lt_cv_prog_compiler_static_works=yes
+       fi
+     else
+       lt_cv_prog_compiler_static_works=yes
+     fi
+   fi
+   $RM -r conftest*
+   LDFLAGS="$save_LDFLAGS"
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_static_works" >&5
+$as_echo "$lt_cv_prog_compiler_static_works" >&6; }
+
+if test x"$lt_cv_prog_compiler_static_works" = xyes; then
+    :
+else
+    lt_prog_compiler_static=
+fi
+
+
+
+
+
+
+
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler supports -c -o file.$ac_objext" >&5
+$as_echo_n "checking if $compiler supports -c -o file.$ac_objext... " >&6; }
+if ${lt_cv_prog_compiler_c_o+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  lt_cv_prog_compiler_c_o=no
+   $RM -r conftest 2>/dev/null
+   mkdir conftest
+   cd conftest
+   mkdir out
+   echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+   lt_compiler_flag="-o out/conftest2.$ac_objext"
+   # Insert the option either (1) after the last *FLAGS variable, or
+   # (2) before a word containing "conftest.", or (3) at the end.
+   # Note that $ac_compile itself does not contain backslashes and begins
+   # with a dollar sign (not a hyphen), so the echo should work correctly.
+   lt_compile=`echo "$ac_compile" | $SED \
+   -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+   -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+   -e 's:$: $lt_compiler_flag:'`
+   (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5)
+   (eval "$lt_compile" 2>out/conftest.err)
+   ac_status=$?
+   cat out/conftest.err >&5
+   echo "$as_me:$LINENO: \$? = $ac_status" >&5
+   if (exit $ac_status) && test -s out/conftest2.$ac_objext
+   then
+     # The compiler can only warn and ignore the option if not recognized
+     # So say no if there are warnings
+     $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' > out/conftest.exp
+     $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2
+     if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then
+       lt_cv_prog_compiler_c_o=yes
+     fi
+   fi
+   chmod u+w . 2>&5
+   $RM conftest*
+   # SGI C++ compiler will create directory out/ii_files/ for
+   # template instantiation
+   test -d out/ii_files && $RM out/ii_files/* && rmdir out/ii_files
+   $RM out/* && rmdir out
+   cd ..
+   $RM -r conftest
+   $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_c_o" >&5
+$as_echo "$lt_cv_prog_compiler_c_o" >&6; }
+
+
+
+
+
+
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler supports -c -o file.$ac_objext" >&5
+$as_echo_n "checking if $compiler supports -c -o file.$ac_objext... " >&6; }
+if ${lt_cv_prog_compiler_c_o+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  lt_cv_prog_compiler_c_o=no
+   $RM -r conftest 2>/dev/null
+   mkdir conftest
+   cd conftest
+   mkdir out
+   echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+   lt_compiler_flag="-o out/conftest2.$ac_objext"
+   # Insert the option either (1) after the last *FLAGS variable, or
+   # (2) before a word containing "conftest.", or (3) at the end.
+   # Note that $ac_compile itself does not contain backslashes and begins
+   # with a dollar sign (not a hyphen), so the echo should work correctly.
+   lt_compile=`echo "$ac_compile" | $SED \
+   -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+   -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+   -e 's:$: $lt_compiler_flag:'`
+   (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5)
+   (eval "$lt_compile" 2>out/conftest.err)
+   ac_status=$?
+   cat out/conftest.err >&5
+   echo "$as_me:$LINENO: \$? = $ac_status" >&5
+   if (exit $ac_status) && test -s out/conftest2.$ac_objext
+   then
+     # The compiler can only warn and ignore the option if not recognized
+     # So say no if there are warnings
+     $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' > out/conftest.exp
+     $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2
+     if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then
+       lt_cv_prog_compiler_c_o=yes
+     fi
+   fi
+   chmod u+w . 2>&5
+   $RM conftest*
+   # SGI C++ compiler will create directory out/ii_files/ for
+   # template instantiation
+   test -d out/ii_files && $RM out/ii_files/* && rmdir out/ii_files
+   $RM out/* && rmdir out
+   cd ..
+   $RM -r conftest
+   $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_c_o" >&5
+$as_echo "$lt_cv_prog_compiler_c_o" >&6; }
+
+
+
+
+hard_links="nottested"
+if test "$lt_cv_prog_compiler_c_o" = no && test "$need_locks" != no; then
+  # do not overwrite the value of need_locks provided by the user
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking if we can lock with hard links" >&5
+$as_echo_n "checking if we can lock with hard links... " >&6; }
+  hard_links=yes
+  $RM conftest*
+  ln conftest.a conftest.b 2>/dev/null && hard_links=no
+  touch conftest.a
+  ln conftest.a conftest.b 2>&5 || hard_links=no
+  ln conftest.a conftest.b 2>/dev/null && hard_links=no
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $hard_links" >&5
+$as_echo "$hard_links" >&6; }
+  if test "$hard_links" = no; then
+    { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&5
+$as_echo "$as_me: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&2;}
+    need_locks=warn
+  fi
+else
+  need_locks=no
+fi
+
+
+
+
+
+
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the $compiler linker ($LD) supports shared libraries" >&5
+$as_echo_n "checking whether the $compiler linker ($LD) supports shared libraries... " >&6; }
+
+  runpath_var=
+  allow_undefined_flag=
+  always_export_symbols=no
+  archive_cmds=
+  archive_expsym_cmds=
+  compiler_needs_object=no
+  enable_shared_with_static_runtimes=no
+  export_dynamic_flag_spec=
+  export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+  hardcode_automatic=no
+  hardcode_direct=no
+  hardcode_direct_absolute=no
+  hardcode_libdir_flag_spec=
+  hardcode_libdir_separator=
+  hardcode_minus_L=no
+  hardcode_shlibpath_var=unsupported
+  inherit_rpath=no
+  link_all_deplibs=unknown
+  module_cmds=
+  module_expsym_cmds=
+  old_archive_from_new_cmds=
+  old_archive_from_expsyms_cmds=
+  thread_safe_flag_spec=
+  whole_archive_flag_spec=
+  # include_expsyms should be a list of space-separated symbols to be *always*
+  # included in the symbol list
+  include_expsyms=
+  # exclude_expsyms can be an extended regexp of symbols to exclude
+  # it will be wrapped by ` (' and `)$', so one must not match beginning or
+  # end of line.  Example: `a|bc|.*d.*' will exclude the symbols `a' and `bc',
+  # as well as any symbol that contains `d'.
+  exclude_expsyms='_GLOBAL_OFFSET_TABLE_|_GLOBAL__F[ID]_.*'
+  # Although _GLOBAL_OFFSET_TABLE_ is a valid symbol C name, most a.out
+  # platforms (ab)use it in PIC code, but their linkers get confused if
+  # the symbol is explicitly referenced.  Since portable code cannot
+  # rely on this symbol name, it's probably fine to never include it in
+  # preloaded symbol tables.
+  # Exclude shared library initialization/finalization symbols.
+  extract_expsyms_cmds=
+
+  case $host_os in
+  cygwin* | mingw* | pw32* | cegcc*)
+    # FIXME: the MSVC++ port hasn't been tested in a loooong time
+    # When not using gcc, we currently assume that we are using
+    # Microsoft Visual C++.
+    if test "$GCC" != yes; then
+      with_gnu_ld=no
+    fi
+    ;;
+  interix*)
+    # we just hope/assume this is gcc and not c89 (= MSVC++)
+    with_gnu_ld=yes
+    ;;
+  openbsd*)
+    with_gnu_ld=no
+    ;;
+  linux* | k*bsd*-gnu | gnu*)
+    link_all_deplibs=no
+    ;;
+  esac
+
+  ld_shlibs=yes
+
+  # On some targets, GNU ld is compatible enough with the native linker
+  # that we're better off using the native interface for both.
+  lt_use_gnu_ld_interface=no
+  if test "$with_gnu_ld" = yes; then
+    case $host_os in
+      aix*)
+	# The AIX port of GNU ld has always aspired to compatibility
+	# with the native linker.  However, as the warning in the GNU ld
+	# block says, versions before 2.19.5* couldn't really create working
+	# shared libraries, regardless of the interface used.
+	case `$LD -v 2>&1` in
+	  *\ \(GNU\ Binutils\)\ 2.19.5*) ;;
+	  *\ \(GNU\ Binutils\)\ 2.[2-9]*) ;;
+	  *\ \(GNU\ Binutils\)\ [3-9]*) ;;
+	  *)
+	    lt_use_gnu_ld_interface=yes
+	    ;;
+	esac
+	;;
+      *)
+	lt_use_gnu_ld_interface=yes
+	;;
+    esac
+  fi
+
+  if test "$lt_use_gnu_ld_interface" = yes; then
+    # If archive_cmds runs LD, not CC, wlarc should be empty
+    wlarc='${wl}'
+
+    # Set some defaults for GNU ld with shared library support. These
+    # are reset later if shared libraries are not supported. Putting them
+    # here allows them to be overridden if necessary.
+    runpath_var=LD_RUN_PATH
+    hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+    export_dynamic_flag_spec='${wl}--export-dynamic'
+    # ancient GNU ld didn't support --whole-archive et. al.
+    if $LD --help 2>&1 | $GREP 'no-whole-archive' > /dev/null; then
+      whole_archive_flag_spec="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+    else
+      whole_archive_flag_spec=
+    fi
+    supports_anon_versioning=no
+    case `$LD -v 2>&1` in
+      *GNU\ gold*) supports_anon_versioning=yes ;;
+      *\ [01].* | *\ 2.[0-9].* | *\ 2.10.*) ;; # catch versions < 2.11
+      *\ 2.11.93.0.2\ *) supports_anon_versioning=yes ;; # RH7.3 ...
+      *\ 2.11.92.0.12\ *) supports_anon_versioning=yes ;; # Mandrake 8.2 ...
+      *\ 2.11.*) ;; # other 2.11 versions
+      *) supports_anon_versioning=yes ;;
+    esac
+
+    # See if GNU ld supports shared libraries.
+    case $host_os in
+    aix[3-9]*)
+      # On AIX/PPC, the GNU linker is very broken
+      if test "$host_cpu" != ia64; then
+	ld_shlibs=no
+	cat <<_LT_EOF 1>&2
+
+*** Warning: the GNU linker, at least up to release 2.19, is reported
+*** to be unable to reliably create shared libraries on AIX.
+*** Therefore, libtool is disabling shared libraries support.  If you
+*** really care for shared libraries, you may want to install binutils
+*** 2.20 or above, or modify your PATH so that a non-GNU linker is found.
+*** You will then need to restart the configuration process.
+
+_LT_EOF
+      fi
+      ;;
+
+    amigaos*)
+      case $host_cpu in
+      powerpc)
+            # see comment about AmigaOS4 .so support
+            archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+            archive_expsym_cmds=''
+        ;;
+      m68k)
+            archive_cmds='$RM $output_objdir/a2ixlibrary.data~$ECHO "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$ECHO "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$ECHO "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$ECHO "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+            hardcode_libdir_flag_spec='-L$libdir'
+            hardcode_minus_L=yes
+        ;;
+      esac
+      ;;
+
+    beos*)
+      if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+	allow_undefined_flag=unsupported
+	# Joseph Beckenbach <jrb3 at best.com> says some releases of gcc
+	# support --undefined.  This deserves some investigation.  FIXME
+	archive_cmds='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+      else
+	ld_shlibs=no
+      fi
+      ;;
+
+    cygwin* | mingw* | pw32* | cegcc*)
+      # _LT_TAGVAR(hardcode_libdir_flag_spec, ) is actually meaningless,
+      # as there is no search path for DLLs.
+      hardcode_libdir_flag_spec='-L$libdir'
+      export_dynamic_flag_spec='${wl}--export-all-symbols'
+      allow_undefined_flag=unsupported
+      always_export_symbols=no
+      enable_shared_with_static_runtimes=yes
+      export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS][ ]/s/.*[ ]\([^ ]*\)/\1 DATA/;s/^.*[ ]__nm__\([^ ]*\)[ ][^ ]*/\1 DATA/;/^I[ ]/d;/^[AITW][ ]/s/.* //'\'' | sort | uniq > $export_symbols'
+      exclude_expsyms='[_]+GLOBAL_OFFSET_TABLE_|[_]+GLOBAL__[FID]_.*|[_]+head_[A-Za-z0-9_]+_dll|[A-Za-z0-9_]+_dll_iname'
+
+      if $LD --help 2>&1 | $GREP 'auto-import' > /dev/null; then
+        archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+	# If the export-symbols file already is a .def file (1st line
+	# is EXPORTS), use it as is; otherwise, prepend...
+	archive_expsym_cmds='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+	  cp $export_symbols $output_objdir/$soname.def;
+	else
+	  echo EXPORTS > $output_objdir/$soname.def;
+	  cat $export_symbols >> $output_objdir/$soname.def;
+	fi~
+	$CC -shared $output_objdir/$soname.def $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+      else
+	ld_shlibs=no
+      fi
+      ;;
+
+    haiku*)
+      archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+      link_all_deplibs=yes
+      ;;
+
+    interix[3-9]*)
+      hardcode_direct=no
+      hardcode_shlibpath_var=no
+      hardcode_libdir_flag_spec='${wl}-rpath,$libdir'
+      export_dynamic_flag_spec='${wl}-E'
+      # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc.
+      # Instead, shared libraries are loaded at an image base (0x10000000 by
+      # default) and relocated if they conflict, which is a slow very memory
+      # consuming and fragmenting process.  To avoid this, we pick a random,
+      # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link
+      # time.  Moving up from 0x10000000 also allows more sbrk(2) space.
+      archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+      archive_expsym_cmds='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+      ;;
+
+    gnu* | linux* | tpf* | k*bsd*-gnu | kopensolaris*-gnu)
+      tmp_diet=no
+      if test "$host_os" = linux-dietlibc; then
+	case $cc_basename in
+	  diet\ *) tmp_diet=yes;;	# linux-dietlibc with static linking (!diet-dyn)
+	esac
+      fi
+      if $LD --help 2>&1 | $EGREP ': supported targets:.* elf' > /dev/null \
+	 && test "$tmp_diet" = no
+      then
+	tmp_addflag=' $pic_flag'
+	tmp_sharedflag='-shared'
+	case $cc_basename,$host_cpu in
+        pgcc*)				# Portland Group C compiler
+	  whole_archive_flag_spec='${wl}--whole-archive`for conv in $convenience\"\"; do test  -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+	  tmp_addflag=' $pic_flag'
+	  ;;
+	pgf77* | pgf90* | pgf95* | pgfortran*)
+					# Portland Group f77 and f90 compilers
+	  whole_archive_flag_spec='${wl}--whole-archive`for conv in $convenience\"\"; do test  -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+	  tmp_addflag=' $pic_flag -Mnomain' ;;
+	ecc*,ia64* | icc*,ia64*)	# Intel C compiler on ia64
+	  tmp_addflag=' -i_dynamic' ;;
+	efc*,ia64* | ifort*,ia64*)	# Intel Fortran compiler on ia64
+	  tmp_addflag=' -i_dynamic -nofor_main' ;;
+	ifc* | ifort*)			# Intel Fortran compiler
+	  tmp_addflag=' -nofor_main' ;;
+	lf95*)				# Lahey Fortran 8.1
+	  whole_archive_flag_spec=
+	  tmp_sharedflag='--shared' ;;
+	xl[cC]* | bgxl[cC]* | mpixl[cC]*) # IBM XL C 8.0 on PPC (deal with xlf below)
+	  tmp_sharedflag='-qmkshrobj'
+	  tmp_addflag= ;;
+	nvcc*)	# Cuda Compiler Driver 2.2
+	  whole_archive_flag_spec='${wl}--whole-archive`for conv in $convenience\"\"; do test  -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+	  compiler_needs_object=yes
+	  ;;
+	esac
+	case `$CC -V 2>&1 | sed 5q` in
+	*Sun\ C*)			# Sun C 5.9
+	  whole_archive_flag_spec='${wl}--whole-archive`new_convenience=; for conv in $convenience\"\"; do test -z \"$conv\" || new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+	  compiler_needs_object=yes
+	  tmp_sharedflag='-G' ;;
+	*Sun\ F*)			# Sun Fortran 8.3
+	  tmp_sharedflag='-G' ;;
+	esac
+	archive_cmds='$CC '"$tmp_sharedflag""$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+
+        if test "x$supports_anon_versioning" = xyes; then
+          archive_expsym_cmds='echo "{ global:" > $output_objdir/$libname.ver~
+	    cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~
+	    echo "local: *; };" >> $output_objdir/$libname.ver~
+	    $CC '"$tmp_sharedflag""$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib'
+        fi
+
+	case $cc_basename in
+	xlf* | bgf* | bgxlf* | mpixlf*)
+	  # IBM XL Fortran 10.1 on PPC cannot create shared libs itself
+	  whole_archive_flag_spec='--whole-archive$convenience --no-whole-archive'
+	  hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+	  archive_cmds='$LD -shared $libobjs $deplibs $linker_flags -soname $soname -o $lib'
+	  if test "x$supports_anon_versioning" = xyes; then
+	    archive_expsym_cmds='echo "{ global:" > $output_objdir/$libname.ver~
+	      cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~
+	      echo "local: *; };" >> $output_objdir/$libname.ver~
+	      $LD -shared $libobjs $deplibs $linker_flags -soname $soname -version-script $output_objdir/$libname.ver -o $lib'
+	  fi
+	  ;;
+	esac
+      else
+        ld_shlibs=no
+      fi
+      ;;
+
+    netbsd* | netbsdelf*-gnu)
+      if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+	archive_cmds='$LD -Bshareable $libobjs $deplibs $linker_flags -o $lib'
+	wlarc=
+      else
+	archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+	archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+      fi
+      ;;
+
+    solaris*)
+      if $LD -v 2>&1 | $GREP 'BFD 2\.8' > /dev/null; then
+	ld_shlibs=no
+	cat <<_LT_EOF 1>&2
+
+*** Warning: The releases 2.8.* of the GNU linker cannot reliably
+*** create shared libraries on Solaris systems.  Therefore, libtool
+*** is disabling shared libraries support.  We urge you to upgrade GNU
+*** binutils to release 2.9.1 or newer.  Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+_LT_EOF
+      elif $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+	archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+	archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+      else
+	ld_shlibs=no
+      fi
+      ;;
+
+    sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*)
+      case `$LD -v 2>&1` in
+        *\ [01].* | *\ 2.[0-9].* | *\ 2.1[0-5].*)
+	ld_shlibs=no
+	cat <<_LT_EOF 1>&2
+
+*** Warning: Releases of the GNU linker prior to 2.16.91.0.3 can not
+*** reliably create shared libraries on SCO systems.  Therefore, libtool
+*** is disabling shared libraries support.  We urge you to upgrade GNU
+*** binutils to release 2.16.91.0.3 or newer.  Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+_LT_EOF
+	;;
+	*)
+	  # For security reasons, it is highly recommended that you always
+	  # use absolute paths for naming shared libraries, and exclude the
+	  # DT_RUNPATH tag from executables and libraries.  But doing so
+	  # requires that you compile everything twice, which is a pain.
+	  if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+	    hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+	    archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+	    archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+	  else
+	    ld_shlibs=no
+	  fi
+	;;
+      esac
+      ;;
+
+    sunos4*)
+      archive_cmds='$LD -assert pure-text -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+      wlarc=
+      hardcode_direct=yes
+      hardcode_shlibpath_var=no
+      ;;
+
+    *)
+      if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+	archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+	archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+      else
+	ld_shlibs=no
+      fi
+      ;;
+    esac
+
+    if test "$ld_shlibs" = no; then
+      runpath_var=
+      hardcode_libdir_flag_spec=
+      export_dynamic_flag_spec=
+      whole_archive_flag_spec=
+    fi
+  else
+    # PORTME fill in a description of your system's linker (not GNU ld)
+    case $host_os in
+    aix3*)
+      allow_undefined_flag=unsupported
+      always_export_symbols=yes
+      archive_expsym_cmds='$LD -o $output_objdir/$soname $libobjs $deplibs $linker_flags -bE:$export_symbols -T512 -H512 -bM:SRE~$AR $AR_FLAGS $lib $output_objdir/$soname'
+      # Note: this linker hardcodes the directories in LIBPATH if there
+      # are no directories specified by -L.
+      hardcode_minus_L=yes
+      if test "$GCC" = yes && test -z "$lt_prog_compiler_static"; then
+	# Neither direct hardcoding nor static linking is supported with a
+	# broken collect2.
+	hardcode_direct=unsupported
+      fi
+      ;;
+
+    aix[4-9]*)
+      if test "$host_cpu" = ia64; then
+	# On IA64, the linker does run time linking by default, so we don't
+	# have to do anything special.
+	aix_use_runtimelinking=no
+	exp_sym_flag='-Bexport'
+	no_entry_flag=""
+      else
+	# If we're using GNU nm, then we don't want the "-C" option.
+	# -C means demangle to AIX nm, but means don't demangle with GNU nm
+	# Also, AIX nm treats weak defined symbols like other global
+	# defined symbols, whereas GNU nm marks them as "W".
+	if $NM -V 2>&1 | $GREP 'GNU' > /dev/null; then
+	  export_symbols_cmds='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B") || (\$ 2 == "W")) && (substr(\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols'
+	else
+	  export_symbols_cmds='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B")) && (substr(\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols'
+	fi
+	aix_use_runtimelinking=no
+
+	# Test if we are trying to use run time linking or normal
+	# AIX style linking. If -brtl is somewhere in LDFLAGS, we
+	# need to do runtime linking.
+	case $host_os in aix4.[23]|aix4.[23].*|aix[5-9]*)
+	  for ld_flag in $LDFLAGS; do
+	  if (test $ld_flag = "-brtl" || test $ld_flag = "-Wl,-brtl"); then
+	    aix_use_runtimelinking=yes
+	    break
+	  fi
+	  done
+	  ;;
+	esac
+
+	exp_sym_flag='-bexport'
+	no_entry_flag='-bnoentry'
+      fi
+
+      # When large executables or shared objects are built, AIX ld can
+      # have problems creating the table of contents.  If linking a library
+      # or program results in "error TOC overflow" add -mminimal-toc to
+      # CXXFLAGS/CFLAGS for g++/gcc.  In the cases where that is not
+      # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS.
+
+      archive_cmds=''
+      hardcode_direct=yes
+      hardcode_direct_absolute=yes
+      hardcode_libdir_separator=':'
+      link_all_deplibs=yes
+      file_list_spec='${wl}-f,'
+
+      if test "$GCC" = yes; then
+	case $host_os in aix4.[012]|aix4.[012].*)
+	# We only want to do this on AIX 4.2 and lower, the check
+	# below for broken collect2 doesn't work under 4.3+
+	  collect2name=`${CC} -print-prog-name=collect2`
+	  if test -f "$collect2name" &&
+	   strings "$collect2name" | $GREP resolve_lib_name >/dev/null
+	  then
+	  # We have reworked collect2
+	  :
+	  else
+	  # We have old collect2
+	  hardcode_direct=unsupported
+	  # It fails to find uninstalled libraries when the uninstalled
+	  # path is not listed in the libpath.  Setting hardcode_minus_L
+	  # to unsupported forces relinking
+	  hardcode_minus_L=yes
+	  hardcode_libdir_flag_spec='-L$libdir'
+	  hardcode_libdir_separator=
+	  fi
+	  ;;
+	esac
+	shared_flag='-shared'
+	if test "$aix_use_runtimelinking" = yes; then
+	  shared_flag="$shared_flag "'${wl}-G'
+	fi
+	link_all_deplibs=no
+      else
+	# not using gcc
+	if test "$host_cpu" = ia64; then
+	# VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release
+	# chokes on -Wl,-G. The following line is correct:
+	  shared_flag='-G'
+	else
+	  if test "$aix_use_runtimelinking" = yes; then
+	    shared_flag='${wl}-G'
+	  else
+	    shared_flag='${wl}-bM:SRE'
+	  fi
+	fi
+      fi
+
+      export_dynamic_flag_spec='${wl}-bexpall'
+      # It seems that -bexpall does not export symbols beginning with
+      # underscore (_), so it is better to generate a list of symbols to export.
+      always_export_symbols=yes
+      if test "$aix_use_runtimelinking" = yes; then
+	# Warning - without using the other runtime loading flags (-brtl),
+	# -berok will link without error, but may produce a broken library.
+	allow_undefined_flag='-berok'
+        # Determine the default libpath from the value encoded in an
+        # empty executable.
+        if test "${lt_cv_aix_libpath+set}" = set; then
+  aix_libpath=$lt_cv_aix_libpath
+else
+  if ${lt_cv_aix_libpath_+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+int
+main ()
+{
+
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+
+  lt_aix_libpath_sed='
+      /Import File Strings/,/^$/ {
+	  /^0/ {
+	      s/^0  *\([^ ]*\) *$/\1/
+	      p
+	  }
+      }'
+  lt_cv_aix_libpath_=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+  # Check for a 64-bit object if we didn't find anything.
+  if test -z "$lt_cv_aix_libpath_"; then
+    lt_cv_aix_libpath_=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+  fi
+fi
+rm -f core conftest.err conftest.$ac_objext \
+    conftest$ac_exeext conftest.$ac_ext
+  if test -z "$lt_cv_aix_libpath_"; then
+    lt_cv_aix_libpath_="/usr/lib:/lib"
+  fi
+
+fi
+
+  aix_libpath=$lt_cv_aix_libpath_
+fi
+
+        hardcode_libdir_flag_spec='${wl}-blibpath:$libdir:'"$aix_libpath"
+        archive_expsym_cmds='$CC -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then func_echo_all "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag"
+      else
+	if test "$host_cpu" = ia64; then
+	  hardcode_libdir_flag_spec='${wl}-R $libdir:/usr/lib:/lib'
+	  allow_undefined_flag="-z nodefs"
+	  archive_expsym_cmds="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols"
+	else
+	 # Determine the default libpath from the value encoded in an
+	 # empty executable.
+	 if test "${lt_cv_aix_libpath+set}" = set; then
+  aix_libpath=$lt_cv_aix_libpath
+else
+  if ${lt_cv_aix_libpath_+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+int
+main ()
+{
+
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+
+  lt_aix_libpath_sed='
+      /Import File Strings/,/^$/ {
+	  /^0/ {
+	      s/^0  *\([^ ]*\) *$/\1/
+	      p
+	  }
+      }'
+  lt_cv_aix_libpath_=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+  # Check for a 64-bit object if we didn't find anything.
+  if test -z "$lt_cv_aix_libpath_"; then
+    lt_cv_aix_libpath_=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+  fi
+fi
+rm -f core conftest.err conftest.$ac_objext \
+    conftest$ac_exeext conftest.$ac_ext
+  if test -z "$lt_cv_aix_libpath_"; then
+    lt_cv_aix_libpath_="/usr/lib:/lib"
+  fi
+
+fi
+
+  aix_libpath=$lt_cv_aix_libpath_
+fi
+
+	 hardcode_libdir_flag_spec='${wl}-blibpath:$libdir:'"$aix_libpath"
+	  # Warning - without using the other run time loading flags,
+	  # -berok will link without error, but may produce a broken library.
+	  no_undefined_flag=' ${wl}-bernotok'
+	  allow_undefined_flag=' ${wl}-berok'
+	  if test "$with_gnu_ld" = yes; then
+	    # We only use this code for GNU lds that support --whole-archive.
+	    whole_archive_flag_spec='${wl}--whole-archive$convenience ${wl}--no-whole-archive'
+	  else
+	    # Exported symbols can be pulled into shared objects from archives
+	    whole_archive_flag_spec='$convenience'
+	  fi
+	  archive_cmds_need_lc=yes
+	  # This is similar to how AIX traditionally builds its shared libraries.
+	  archive_expsym_cmds="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname'
+	fi
+      fi
+      ;;
+
+    amigaos*)
+      case $host_cpu in
+      powerpc)
+            # see comment about AmigaOS4 .so support
+            archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+            archive_expsym_cmds=''
+        ;;
+      m68k)
+            archive_cmds='$RM $output_objdir/a2ixlibrary.data~$ECHO "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$ECHO "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$ECHO "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$ECHO "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+            hardcode_libdir_flag_spec='-L$libdir'
+            hardcode_minus_L=yes
+        ;;
+      esac
+      ;;
+
+    bsdi[45]*)
+      export_dynamic_flag_spec=-rdynamic
+      ;;
+
+    cygwin* | mingw* | pw32* | cegcc*)
+      # When not using gcc, we currently assume that we are using
+      # Microsoft Visual C++.
+      # hardcode_libdir_flag_spec is actually meaningless, as there is
+      # no search path for DLLs.
+      case $cc_basename in
+      cl*)
+	# Native MSVC
+	hardcode_libdir_flag_spec=' '
+	allow_undefined_flag=unsupported
+	always_export_symbols=yes
+	file_list_spec='@'
+	# Tell ltmain to make .lib files, not .a files.
+	libext=lib
+	# Tell ltmain to make .dll files, not .so files.
+	shrext_cmds=".dll"
+	# FIXME: Setting linknames here is a bad hack.
+	archive_cmds='$CC -o $output_objdir/$soname $libobjs $compiler_flags $deplibs -Wl,-dll~linknames='
+	archive_expsym_cmds='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+	    sed -n -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' -e '1\\\!p' < $export_symbols > $output_objdir/$soname.exp;
+	  else
+	    sed -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' < $export_symbols > $output_objdir/$soname.exp;
+	  fi~
+	  $CC -o $tool_output_objdir$soname $libobjs $compiler_flags $deplibs "@$tool_output_objdir$soname.exp" -Wl,-DLL,-IMPLIB:"$tool_output_objdir$libname.dll.lib"~
+	  linknames='
+	# The linker will not automatically build a static lib if we build a DLL.
+	# _LT_TAGVAR(old_archive_from_new_cmds, )='true'
+	enable_shared_with_static_runtimes=yes
+	exclude_expsyms='_NULL_IMPORT_DESCRIPTOR|_IMPORT_DESCRIPTOR_.*'
+	export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS][ ]/s/.*[ ]\([^ ]*\)/\1,DATA/'\'' | $SED -e '\''/^[AITW][ ]/s/.*[ ]//'\'' | sort | uniq > $export_symbols'
+	# Don't use ranlib
+	old_postinstall_cmds='chmod 644 $oldlib'
+	postlink_cmds='lt_outputfile="@OUTPUT@"~
+	  lt_tool_outputfile="@TOOL_OUTPUT@"~
+	  case $lt_outputfile in
+	    *.exe|*.EXE) ;;
+	    *)
+	      lt_outputfile="$lt_outputfile.exe"
+	      lt_tool_outputfile="$lt_tool_outputfile.exe"
+	      ;;
+	  esac~
+	  if test "$MANIFEST_TOOL" != ":" && test -f "$lt_outputfile.manifest"; then
+	    $MANIFEST_TOOL -manifest "$lt_tool_outputfile.manifest" -outputresource:"$lt_tool_outputfile" || exit 1;
+	    $RM "$lt_outputfile.manifest";
+	  fi'
+	;;
+      *)
+	# Assume MSVC wrapper
+	hardcode_libdir_flag_spec=' '
+	allow_undefined_flag=unsupported
+	# Tell ltmain to make .lib files, not .a files.
+	libext=lib
+	# Tell ltmain to make .dll files, not .so files.
+	shrext_cmds=".dll"
+	# FIXME: Setting linknames here is a bad hack.
+	archive_cmds='$CC -o $lib $libobjs $compiler_flags `func_echo_all "$deplibs" | $SED '\''s/ -lc$//'\''` -link -dll~linknames='
+	# The linker will automatically build a .lib file if we build a DLL.
+	old_archive_from_new_cmds='true'
+	# FIXME: Should let the user specify the lib program.
+	old_archive_cmds='lib -OUT:$oldlib$oldobjs$old_deplibs'
+	enable_shared_with_static_runtimes=yes
+	;;
+      esac
+      ;;
+
+    darwin* | rhapsody*)
+
+
+  archive_cmds_need_lc=no
+  hardcode_direct=no
+  hardcode_automatic=yes
+  hardcode_shlibpath_var=unsupported
+  if test "$lt_cv_ld_force_load" = "yes"; then
+    whole_archive_flag_spec='`for conv in $convenience\"\"; do test  -n \"$conv\" && new_convenience=\"$new_convenience ${wl}-force_load,$conv\"; done; func_echo_all \"$new_convenience\"`'
+
+  else
+    whole_archive_flag_spec=''
+  fi
+  link_all_deplibs=yes
+  allow_undefined_flag="$_lt_dar_allow_undefined"
+  case $cc_basename in
+     ifort*) _lt_dar_can_shared=yes ;;
+     *) _lt_dar_can_shared=$GCC ;;
+  esac
+  if test "$_lt_dar_can_shared" = "yes"; then
+    output_verbose_link_cmd=func_echo_all
+    archive_cmds="\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring $_lt_dar_single_mod${_lt_dsymutil}"
+    module_cmds="\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags${_lt_dsymutil}"
+    archive_expsym_cmds="sed 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring ${_lt_dar_single_mod}${_lt_dar_export_syms}${_lt_dsymutil}"
+    module_expsym_cmds="sed -e 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags${_lt_dar_export_syms}${_lt_dsymutil}"
+
+  else
+  ld_shlibs=no
+  fi
+
+      ;;
+
+    dgux*)
+      archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+      hardcode_libdir_flag_spec='-L$libdir'
+      hardcode_shlibpath_var=no
+      ;;
+
+    # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor
+    # support.  Future versions do this automatically, but an explicit c++rt0.o
+    # does not break anything, and helps significantly (at the cost of a little
+    # extra space).
+    freebsd2.2*)
+      archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags /usr/lib/c++rt0.o'
+      hardcode_libdir_flag_spec='-R$libdir'
+      hardcode_direct=yes
+      hardcode_shlibpath_var=no
+      ;;
+
+    # Unfortunately, older versions of FreeBSD 2 do not have this feature.
+    freebsd2.*)
+      archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+      hardcode_direct=yes
+      hardcode_minus_L=yes
+      hardcode_shlibpath_var=no
+      ;;
+
+    # FreeBSD 3 and greater uses gcc -shared to do shared libraries.
+    freebsd* | dragonfly*)
+      archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+      hardcode_libdir_flag_spec='-R$libdir'
+      hardcode_direct=yes
+      hardcode_shlibpath_var=no
+      ;;
+
+    hpux9*)
+      if test "$GCC" = yes; then
+	archive_cmds='$RM $output_objdir/$soname~$CC -shared $pic_flag ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $libobjs $deplibs $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+      else
+	archive_cmds='$RM $output_objdir/$soname~$LD -b +b $install_libdir -o $output_objdir/$soname $libobjs $deplibs $linker_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+      fi
+      hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+      hardcode_libdir_separator=:
+      hardcode_direct=yes
+
+      # hardcode_minus_L: Not really in the search PATH,
+      # but as the default location of the library.
+      hardcode_minus_L=yes
+      export_dynamic_flag_spec='${wl}-E'
+      ;;
+
+    hpux10*)
+      if test "$GCC" = yes && test "$with_gnu_ld" = no; then
+	archive_cmds='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+      else
+	archive_cmds='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags'
+      fi
+      if test "$with_gnu_ld" = no; then
+	hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+	hardcode_libdir_separator=:
+	hardcode_direct=yes
+	hardcode_direct_absolute=yes
+	export_dynamic_flag_spec='${wl}-E'
+	# hardcode_minus_L: Not really in the search PATH,
+	# but as the default location of the library.
+	hardcode_minus_L=yes
+      fi
+      ;;
+
+    hpux11*)
+      if test "$GCC" = yes && test "$with_gnu_ld" = no; then
+	case $host_cpu in
+	hppa*64*)
+	  archive_cmds='$CC -shared ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+	  ;;
+	ia64*)
+	  archive_cmds='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+	  ;;
+	*)
+	  archive_cmds='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+	  ;;
+	esac
+      else
+	case $host_cpu in
+	hppa*64*)
+	  archive_cmds='$CC -b ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+	  ;;
+	ia64*)
+	  archive_cmds='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+	  ;;
+	*)
+
+	  # Older versions of the 11.00 compiler do not understand -b yet
+	  # (HP92453-01 A.11.01.20 doesn't, HP92453-01 B.11.X.35175-35176.GP does)
+	  { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $CC understands -b" >&5
+$as_echo_n "checking if $CC understands -b... " >&6; }
+if ${lt_cv_prog_compiler__b+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  lt_cv_prog_compiler__b=no
+   save_LDFLAGS="$LDFLAGS"
+   LDFLAGS="$LDFLAGS -b"
+   echo "$lt_simple_link_test_code" > conftest.$ac_ext
+   if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then
+     # The linker can only warn and ignore the option if not recognized
+     # So say no if there are warnings
+     if test -s conftest.err; then
+       # Append any errors to the config.log.
+       cat conftest.err 1>&5
+       $ECHO "$_lt_linker_boilerplate" | $SED '/^$/d' > conftest.exp
+       $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+       if diff conftest.exp conftest.er2 >/dev/null; then
+         lt_cv_prog_compiler__b=yes
+       fi
+     else
+       lt_cv_prog_compiler__b=yes
+     fi
+   fi
+   $RM -r conftest*
+   LDFLAGS="$save_LDFLAGS"
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler__b" >&5
+$as_echo "$lt_cv_prog_compiler__b" >&6; }
+
+if test x"$lt_cv_prog_compiler__b" = xyes; then
+    archive_cmds='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+else
+    archive_cmds='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags'
+fi
+
+	  ;;
+	esac
+      fi
+      if test "$with_gnu_ld" = no; then
+	hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+	hardcode_libdir_separator=:
+
+	case $host_cpu in
+	hppa*64*|ia64*)
+	  hardcode_direct=no
+	  hardcode_shlibpath_var=no
+	  ;;
+	*)
+	  hardcode_direct=yes
+	  hardcode_direct_absolute=yes
+	  export_dynamic_flag_spec='${wl}-E'
+
+	  # hardcode_minus_L: Not really in the search PATH,
+	  # but as the default location of the library.
+	  hardcode_minus_L=yes
+	  ;;
+	esac
+      fi
+      ;;
+
+    irix5* | irix6* | nonstopux*)
+      if test "$GCC" = yes; then
+	archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+	# Try to use the -exported_symbol ld option, if it does not
+	# work, assume that -exports_file does not work either and
+	# implicitly export all symbols.
+	# This should be the same for all languages, so no per-tag cache variable.
+	{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the $host_os linker accepts -exported_symbol" >&5
+$as_echo_n "checking whether the $host_os linker accepts -exported_symbol... " >&6; }
+if ${lt_cv_irix_exported_symbol+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  save_LDFLAGS="$LDFLAGS"
+	   LDFLAGS="$LDFLAGS -shared ${wl}-exported_symbol ${wl}foo ${wl}-update_registry ${wl}/dev/null"
+	   cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+int foo (void) { return 0; }
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+  lt_cv_irix_exported_symbol=yes
+else
+  lt_cv_irix_exported_symbol=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+    conftest$ac_exeext conftest.$ac_ext
+           LDFLAGS="$save_LDFLAGS"
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_irix_exported_symbol" >&5
+$as_echo "$lt_cv_irix_exported_symbol" >&6; }
+	if test "$lt_cv_irix_exported_symbol" = yes; then
+          archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations ${wl}-exports_file ${wl}$export_symbols -o $lib'
+	fi
+      else
+	archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+	archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -exports_file $export_symbols -o $lib'
+      fi
+      archive_cmds_need_lc='no'
+      hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+      hardcode_libdir_separator=:
+      inherit_rpath=yes
+      link_all_deplibs=yes
+      ;;
+
+    netbsd* | netbsdelf*-gnu)
+      if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+	archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'  # a.out
+      else
+	archive_cmds='$LD -shared -o $lib $libobjs $deplibs $linker_flags'      # ELF
+      fi
+      hardcode_libdir_flag_spec='-R$libdir'
+      hardcode_direct=yes
+      hardcode_shlibpath_var=no
+      ;;
+
+    newsos6)
+      archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+      hardcode_direct=yes
+      hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+      hardcode_libdir_separator=:
+      hardcode_shlibpath_var=no
+      ;;
+
+    *nto* | *qnx*)
+      ;;
+
+    openbsd*)
+      if test -f /usr/libexec/ld.so; then
+	hardcode_direct=yes
+	hardcode_shlibpath_var=no
+	hardcode_direct_absolute=yes
+	if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+	  archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+	  archive_expsym_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-retain-symbols-file,$export_symbols'
+	  hardcode_libdir_flag_spec='${wl}-rpath,$libdir'
+	  export_dynamic_flag_spec='${wl}-E'
+	else
+	  case $host_os in
+	   openbsd[01].* | openbsd2.[0-7] | openbsd2.[0-7].*)
+	     archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+	     hardcode_libdir_flag_spec='-R$libdir'
+	     ;;
+	   *)
+	     archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+	     hardcode_libdir_flag_spec='${wl}-rpath,$libdir'
+	     ;;
+	  esac
+	fi
+      else
+	ld_shlibs=no
+      fi
+      ;;
+
+    os2*)
+      hardcode_libdir_flag_spec='-L$libdir'
+      hardcode_minus_L=yes
+      allow_undefined_flag=unsupported
+      archive_cmds='$ECHO "LIBRARY $libname INITINSTANCE" > $output_objdir/$libname.def~$ECHO "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~echo DATA >> $output_objdir/$libname.def~echo " SINGLE NONSHARED" >> $output_objdir/$libname.def~echo EXPORTS >> $output_objdir/$libname.def~emxexp $libobjs >> $output_objdir/$libname.def~$CC -Zdll -Zcrtdll -o $lib $libobjs $deplibs $compiler_flags $output_objdir/$libname.def'
+      old_archive_from_new_cmds='emximp -o $output_objdir/$libname.a $output_objdir/$libname.def'
+      ;;
+
+    osf3*)
+      if test "$GCC" = yes; then
+	allow_undefined_flag=' ${wl}-expect_unresolved ${wl}\*'
+	archive_cmds='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+      else
+	allow_undefined_flag=' -expect_unresolved \*'
+	archive_cmds='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+      fi
+      archive_cmds_need_lc='no'
+      hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+      hardcode_libdir_separator=:
+      ;;
+
+    osf4* | osf5*)	# as osf3* with the addition of -msym flag
+      if test "$GCC" = yes; then
+	allow_undefined_flag=' ${wl}-expect_unresolved ${wl}\*'
+	archive_cmds='$CC -shared${allow_undefined_flag} $pic_flag $libobjs $deplibs $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+	hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+      else
+	allow_undefined_flag=' -expect_unresolved \*'
+	archive_cmds='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags -msym -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+	archive_expsym_cmds='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done; printf "%s\\n" "-hidden">> $lib.exp~
+	$CC -shared${allow_undefined_flag} ${wl}-input ${wl}$lib.exp $compiler_flags $libobjs $deplibs -soname $soname `test -n "$verstring" && $ECHO "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib~$RM $lib.exp'
+
+	# Both c and cxx compiler support -rpath directly
+	hardcode_libdir_flag_spec='-rpath $libdir'
+      fi
+      archive_cmds_need_lc='no'
+      hardcode_libdir_separator=:
+      ;;
+
+    solaris*)
+      no_undefined_flag=' -z defs'
+      if test "$GCC" = yes; then
+	wlarc='${wl}'
+	archive_cmds='$CC -shared $pic_flag ${wl}-z ${wl}text ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+	archive_expsym_cmds='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+	  $CC -shared $pic_flag ${wl}-z ${wl}text ${wl}-M ${wl}$lib.exp ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags~$RM $lib.exp'
+      else
+	case `$CC -V 2>&1` in
+	*"Compilers 5.0"*)
+	  wlarc=''
+	  archive_cmds='$LD -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $linker_flags'
+	  archive_expsym_cmds='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+	  $LD -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $linker_flags~$RM $lib.exp'
+	  ;;
+	*)
+	  wlarc='${wl}'
+	  archive_cmds='$CC -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $compiler_flags'
+	  archive_expsym_cmds='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+	  $CC -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $compiler_flags~$RM $lib.exp'
+	  ;;
+	esac
+      fi
+      hardcode_libdir_flag_spec='-R$libdir'
+      hardcode_shlibpath_var=no
+      case $host_os in
+      solaris2.[0-5] | solaris2.[0-5].*) ;;
+      *)
+	# The compiler driver will combine and reorder linker options,
+	# but understands `-z linker_flag'.  GCC discards it without `$wl',
+	# but is careful enough not to reorder.
+	# Supported since Solaris 2.6 (maybe 2.5.1?)
+	if test "$GCC" = yes; then
+	  whole_archive_flag_spec='${wl}-z ${wl}allextract$convenience ${wl}-z ${wl}defaultextract'
+	else
+	  whole_archive_flag_spec='-z allextract$convenience -z defaultextract'
+	fi
+	;;
+      esac
+      link_all_deplibs=yes
+      ;;
+
+    sunos4*)
+      if test "x$host_vendor" = xsequent; then
+	# Use $CC to link under sequent, because it throws in some extra .o
+	# files that make .init and .fini sections work.
+	archive_cmds='$CC -G ${wl}-h $soname -o $lib $libobjs $deplibs $compiler_flags'
+      else
+	archive_cmds='$LD -assert pure-text -Bstatic -o $lib $libobjs $deplibs $linker_flags'
+      fi
+      hardcode_libdir_flag_spec='-L$libdir'
+      hardcode_direct=yes
+      hardcode_minus_L=yes
+      hardcode_shlibpath_var=no
+      ;;
+
+    sysv4)
+      case $host_vendor in
+	sni)
+	  archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+	  hardcode_direct=yes # is this really true???
+	;;
+	siemens)
+	  ## LD is ld it makes a PLAMLIB
+	  ## CC just makes a GrossModule.
+	  archive_cmds='$LD -G -o $lib $libobjs $deplibs $linker_flags'
+	  reload_cmds='$CC -r -o $output$reload_objs'
+	  hardcode_direct=no
+        ;;
+	motorola)
+	  archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+	  hardcode_direct=no #Motorola manual says yes, but my tests say they lie
+	;;
+      esac
+      runpath_var='LD_RUN_PATH'
+      hardcode_shlibpath_var=no
+      ;;
+
+    sysv4.3*)
+      archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+      hardcode_shlibpath_var=no
+      export_dynamic_flag_spec='-Bexport'
+      ;;
+
+    sysv4*MP*)
+      if test -d /usr/nec; then
+	archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+	hardcode_shlibpath_var=no
+	runpath_var=LD_RUN_PATH
+	hardcode_runpath_var=yes
+	ld_shlibs=yes
+      fi
+      ;;
+
+    sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[01].[10]* | unixware7* | sco3.2v5.0.[024]*)
+      no_undefined_flag='${wl}-z,text'
+      archive_cmds_need_lc=no
+      hardcode_shlibpath_var=no
+      runpath_var='LD_RUN_PATH'
+
+      if test "$GCC" = yes; then
+	archive_cmds='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+	archive_expsym_cmds='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+      else
+	archive_cmds='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+	archive_expsym_cmds='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+      fi
+      ;;
+
+    sysv5* | sco3.2v5* | sco5v6*)
+      # Note: We can NOT use -z defs as we might desire, because we do not
+      # link with -lc, and that would cause any symbols used from libc to
+      # always be unresolved, which means just about no library would
+      # ever link correctly.  If we're not using GNU ld we use -z text
+      # though, which does catch some bad symbols but isn't as heavy-handed
+      # as -z defs.
+      no_undefined_flag='${wl}-z,text'
+      allow_undefined_flag='${wl}-z,nodefs'
+      archive_cmds_need_lc=no
+      hardcode_shlibpath_var=no
+      hardcode_libdir_flag_spec='${wl}-R,$libdir'
+      hardcode_libdir_separator=':'
+      link_all_deplibs=yes
+      export_dynamic_flag_spec='${wl}-Bexport'
+      runpath_var='LD_RUN_PATH'
+
+      if test "$GCC" = yes; then
+	archive_cmds='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+	archive_expsym_cmds='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+      else
+	archive_cmds='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+	archive_expsym_cmds='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+      fi
+      ;;
+
+    uts4*)
+      archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+      hardcode_libdir_flag_spec='-L$libdir'
+      hardcode_shlibpath_var=no
+      ;;
+
+    *)
+      ld_shlibs=no
+      ;;
+    esac
+
+    if test x$host_vendor = xsni; then
+      case $host in
+      sysv4 | sysv4.2uw2* | sysv4.3* | sysv5*)
+	export_dynamic_flag_spec='${wl}-Blargedynsym'
+	;;
+      esac
+    fi
+  fi
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ld_shlibs" >&5
+$as_echo "$ld_shlibs" >&6; }
+test "$ld_shlibs" = no && can_build_shared=no
+
+with_gnu_ld=$with_gnu_ld
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+#
+# Do we need to explicitly link libc?
+#
+case "x$archive_cmds_need_lc" in
+x|xyes)
+  # Assume -lc should be added
+  archive_cmds_need_lc=yes
+
+  if test "$enable_shared" = yes && test "$GCC" = yes; then
+    case $archive_cmds in
+    *'~'*)
+      # FIXME: we may have to deal with multi-command sequences.
+      ;;
+    '$CC '*)
+      # Test whether the compiler implicitly links with -lc since on some
+      # systems, -lgcc has to come before -lc. If gcc already passes -lc
+      # to ld, don't add -lc before -lgcc.
+      { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether -lc should be explicitly linked in" >&5
+$as_echo_n "checking whether -lc should be explicitly linked in... " >&6; }
+if ${lt_cv_archive_cmds_need_lc+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  $RM conftest*
+	echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+	if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+  (eval $ac_compile) 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; } 2>conftest.err; then
+	  soname=conftest
+	  lib=conftest
+	  libobjs=conftest.$ac_objext
+	  deplibs=
+	  wl=$lt_prog_compiler_wl
+	  pic_flag=$lt_prog_compiler_pic
+	  compiler_flags=-v
+	  linker_flags=-v
+	  verstring=
+	  output_objdir=.
+	  libname=conftest
+	  lt_save_allow_undefined_flag=$allow_undefined_flag
+	  allow_undefined_flag=
+	  if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$archive_cmds 2\>\&1 \| $GREP \" -lc \" \>/dev/null 2\>\&1\""; } >&5
+  (eval $archive_cmds 2\>\&1 \| $GREP \" -lc \" \>/dev/null 2\>\&1) 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; }
+	  then
+	    lt_cv_archive_cmds_need_lc=no
+	  else
+	    lt_cv_archive_cmds_need_lc=yes
+	  fi
+	  allow_undefined_flag=$lt_save_allow_undefined_flag
+	else
+	  cat conftest.err 1>&5
+	fi
+	$RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_archive_cmds_need_lc" >&5
+$as_echo "$lt_cv_archive_cmds_need_lc" >&6; }
+      archive_cmds_need_lc=$lt_cv_archive_cmds_need_lc
+      ;;
+    esac
+  fi
+  ;;
+esac
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking dynamic linker characteristics" >&5
+$as_echo_n "checking dynamic linker characteristics... " >&6; }
+
+if test "$GCC" = yes; then
+  case $host_os in
+    darwin*) lt_awk_arg="/^libraries:/,/LR/" ;;
+    *) lt_awk_arg="/^libraries:/" ;;
+  esac
+  case $host_os in
+    mingw* | cegcc*) lt_sed_strip_eq="s,=\([A-Za-z]:\),\1,g" ;;
+    *) lt_sed_strip_eq="s,=/,/,g" ;;
+  esac
+  lt_search_path_spec=`$CC -print-search-dirs | awk $lt_awk_arg | $SED -e "s/^libraries://" -e $lt_sed_strip_eq`
+  case $lt_search_path_spec in
+  *\;*)
+    # if the path contains ";" then we assume it to be the separator
+    # otherwise default to the standard path separator (i.e. ":") - it is
+    # assumed that no part of a normal pathname contains ";" but that should
+    # okay in the real world where ";" in dirpaths is itself problematic.
+    lt_search_path_spec=`$ECHO "$lt_search_path_spec" | $SED 's/;/ /g'`
+    ;;
+  *)
+    lt_search_path_spec=`$ECHO "$lt_search_path_spec" | $SED "s/$PATH_SEPARATOR/ /g"`
+    ;;
+  esac
+  # Ok, now we have the path, separated by spaces, we can step through it
+  # and add multilib dir if necessary.
+  lt_tmp_lt_search_path_spec=
+  lt_multi_os_dir=`$CC $CPPFLAGS $CFLAGS $LDFLAGS -print-multi-os-directory 2>/dev/null`
+  for lt_sys_path in $lt_search_path_spec; do
+    if test -d "$lt_sys_path/$lt_multi_os_dir"; then
+      lt_tmp_lt_search_path_spec="$lt_tmp_lt_search_path_spec $lt_sys_path/$lt_multi_os_dir"
+    else
+      test -d "$lt_sys_path" && \
+	lt_tmp_lt_search_path_spec="$lt_tmp_lt_search_path_spec $lt_sys_path"
+    fi
+  done
+  lt_search_path_spec=`$ECHO "$lt_tmp_lt_search_path_spec" | awk '
+BEGIN {RS=" "; FS="/|\n";} {
+  lt_foo="";
+  lt_count=0;
+  for (lt_i = NF; lt_i > 0; lt_i--) {
+    if ($lt_i != "" && $lt_i != ".") {
+      if ($lt_i == "..") {
+        lt_count++;
+      } else {
+        if (lt_count == 0) {
+          lt_foo="/" $lt_i lt_foo;
+        } else {
+          lt_count--;
+        }
+      }
+    }
+  }
+  if (lt_foo != "") { lt_freq[lt_foo]++; }
+  if (lt_freq[lt_foo] == 1) { print lt_foo; }
+}'`
+  # AWK program above erroneously prepends '/' to C:/dos/paths
+  # for these hosts.
+  case $host_os in
+    mingw* | cegcc*) lt_search_path_spec=`$ECHO "$lt_search_path_spec" |\
+      $SED 's,/\([A-Za-z]:\),\1,g'` ;;
+  esac
+  sys_lib_search_path_spec=`$ECHO "$lt_search_path_spec" | $lt_NL2SP`
+else
+  sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib"
+fi
+library_names_spec=
+libname_spec='lib$name'
+soname_spec=
+shrext_cmds=".so"
+postinstall_cmds=
+postuninstall_cmds=
+finish_cmds=
+finish_eval=
+shlibpath_var=
+shlibpath_overrides_runpath=unknown
+version_type=none
+dynamic_linker="$host_os ld.so"
+sys_lib_dlsearch_path_spec="/lib /usr/lib"
+need_lib_prefix=unknown
+hardcode_into_libs=no
+
+# when you set need_version to no, make sure it does not cause -set_version
+# flags to be left without arguments
+need_version=unknown
+
+case $host_os in
+aix3*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  library_names_spec='${libname}${release}${shared_ext}$versuffix $libname.a'
+  shlibpath_var=LIBPATH
+
+  # AIX 3 has no versioning support, so we append a major version to the name.
+  soname_spec='${libname}${release}${shared_ext}$major'
+  ;;
+
+aix[4-9]*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  need_lib_prefix=no
+  need_version=no
+  hardcode_into_libs=yes
+  if test "$host_cpu" = ia64; then
+    # AIX 5 supports IA64
+    library_names_spec='${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext}$versuffix $libname${shared_ext}'
+    shlibpath_var=LD_LIBRARY_PATH
+  else
+    # With GCC up to 2.95.x, collect2 would create an import file
+    # for dependence libraries.  The import file would start with
+    # the line `#! .'.  This would cause the generated library to
+    # depend on `.', always an invalid library.  This was fixed in
+    # development snapshots of GCC prior to 3.0.
+    case $host_os in
+      aix4 | aix4.[01] | aix4.[01].*)
+      if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)'
+	   echo ' yes '
+	   echo '#endif'; } | ${CC} -E - | $GREP yes > /dev/null; then
+	:
+      else
+	can_build_shared=no
+      fi
+      ;;
+    esac
+    # AIX (on Power*) has no versioning support, so currently we can not hardcode correct
+    # soname into executable. Probably we can add versioning support to
+    # collect2, so additional links can be useful in future.
+    if test "$aix_use_runtimelinking" = yes; then
+      # If using run time linking (on AIX 4.2 or later) use lib<name>.so
+      # instead of lib<name>.a to let people know that these are not
+      # typical AIX shared libraries.
+      library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+    else
+      # We preserve .a as extension for shared libraries through AIX4.2
+      # and later when we are not doing run time linking.
+      library_names_spec='${libname}${release}.a $libname.a'
+      soname_spec='${libname}${release}${shared_ext}$major'
+    fi
+    shlibpath_var=LIBPATH
+  fi
+  ;;
+
+amigaos*)
+  case $host_cpu in
+  powerpc)
+    # Since July 2007 AmigaOS4 officially supports .so libraries.
+    # When compiling the executable, add -use-dynld -Lsobjs: to the compileline.
+    library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+    ;;
+  m68k)
+    library_names_spec='$libname.ixlibrary $libname.a'
+    # Create ${libname}_ixlibrary.a entries in /sys/libs.
+    finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`func_echo_all "$lib" | $SED '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; test $RM /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done'
+    ;;
+  esac
+  ;;
+
+beos*)
+  library_names_spec='${libname}${shared_ext}'
+  dynamic_linker="$host_os ld.so"
+  shlibpath_var=LIBRARY_PATH
+  ;;
+
+bsdi[45]*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir'
+  shlibpath_var=LD_LIBRARY_PATH
+  sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib"
+  sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib"
+  # the default ld.so.conf also contains /usr/contrib/lib and
+  # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow
+  # libtool to hard-code these into programs
+  ;;
+
+cygwin* | mingw* | pw32* | cegcc*)
+  version_type=windows
+  shrext_cmds=".dll"
+  need_version=no
+  need_lib_prefix=no
+
+  case $GCC,$cc_basename in
+  yes,*)
+    # gcc
+    library_names_spec='$libname.dll.a'
+    # DLL is installed to $(libdir)/../bin by postinstall_cmds
+    postinstall_cmds='base_file=`basename \${file}`~
+      dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i; echo \$dlname'\''`~
+      dldir=$destdir/`dirname \$dlpath`~
+      test -d \$dldir || mkdir -p \$dldir~
+      $install_prog $dir/$dlname \$dldir/$dlname~
+      chmod a+x \$dldir/$dlname~
+      if test -n '\''$stripme'\'' && test -n '\''$striplib'\''; then
+        eval '\''$striplib \$dldir/$dlname'\'' || exit \$?;
+      fi'
+    postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~
+      dlpath=$dir/\$dldll~
+       $RM \$dlpath'
+    shlibpath_overrides_runpath=yes
+
+    case $host_os in
+    cygwin*)
+      # Cygwin DLLs use 'cyg' prefix rather than 'lib'
+      soname_spec='`echo ${libname} | sed -e 's/^lib/cyg/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+
+      sys_lib_search_path_spec="$sys_lib_search_path_spec /usr/lib/w32api"
+      ;;
+    mingw* | cegcc*)
+      # MinGW DLLs use traditional 'lib' prefix
+      soname_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+      ;;
+    pw32*)
+      # pw32 DLLs use 'pw' prefix rather than 'lib'
+      library_names_spec='`echo ${libname} | sed -e 's/^lib/pw/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+      ;;
+    esac
+    dynamic_linker='Win32 ld.exe'
+    ;;
+
+  *,cl*)
+    # Native MSVC
+    libname_spec='$name'
+    soname_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+    library_names_spec='${libname}.dll.lib'
+
+    case $build_os in
+    mingw*)
+      sys_lib_search_path_spec=
+      lt_save_ifs=$IFS
+      IFS=';'
+      for lt_path in $LIB
+      do
+        IFS=$lt_save_ifs
+        # Let DOS variable expansion print the short 8.3 style file name.
+        lt_path=`cd "$lt_path" 2>/dev/null && cmd //C "for %i in (".") do @echo %~si"`
+        sys_lib_search_path_spec="$sys_lib_search_path_spec $lt_path"
+      done
+      IFS=$lt_save_ifs
+      # Convert to MSYS style.
+      sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | sed -e 's|\\\\|/|g' -e 's| \\([a-zA-Z]\\):| /\\1|g' -e 's|^ ||'`
+      ;;
+    cygwin*)
+      # Convert to unix form, then to dos form, then back to unix form
+      # but this time dos style (no spaces!) so that the unix form looks
+      # like /cygdrive/c/PROGRA~1:/cygdr...
+      sys_lib_search_path_spec=`cygpath --path --unix "$LIB"`
+      sys_lib_search_path_spec=`cygpath --path --dos "$sys_lib_search_path_spec" 2>/dev/null`
+      sys_lib_search_path_spec=`cygpath --path --unix "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+      ;;
+    *)
+      sys_lib_search_path_spec="$LIB"
+      if $ECHO "$sys_lib_search_path_spec" | $GREP ';[c-zC-Z]:/' >/dev/null; then
+        # It is most probably a Windows format PATH.
+        sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'`
+      else
+        sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+      fi
+      # FIXME: find the short name or the path components, as spaces are
+      # common. (e.g. "Program Files" -> "PROGRA~1")
+      ;;
+    esac
+
+    # DLL is installed to $(libdir)/../bin by postinstall_cmds
+    postinstall_cmds='base_file=`basename \${file}`~
+      dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i; echo \$dlname'\''`~
+      dldir=$destdir/`dirname \$dlpath`~
+      test -d \$dldir || mkdir -p \$dldir~
+      $install_prog $dir/$dlname \$dldir/$dlname'
+    postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~
+      dlpath=$dir/\$dldll~
+       $RM \$dlpath'
+    shlibpath_overrides_runpath=yes
+    dynamic_linker='Win32 link.exe'
+    ;;
+
+  *)
+    # Assume MSVC wrapper
+    library_names_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext} $libname.lib'
+    dynamic_linker='Win32 ld.exe'
+    ;;
+  esac
+  # FIXME: first we should search . and the directory the executable is in
+  shlibpath_var=PATH
+  ;;
+
+darwin* | rhapsody*)
+  dynamic_linker="$host_os dyld"
+  version_type=darwin
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${major}$shared_ext ${libname}$shared_ext'
+  soname_spec='${libname}${release}${major}$shared_ext'
+  shlibpath_overrides_runpath=yes
+  shlibpath_var=DYLD_LIBRARY_PATH
+  shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`'
+
+  sys_lib_search_path_spec="$sys_lib_search_path_spec /usr/local/lib"
+  sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib'
+  ;;
+
+dgux*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname$shared_ext'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  shlibpath_var=LD_LIBRARY_PATH
+  ;;
+
+freebsd* | dragonfly*)
+  # DragonFly does not have aout.  When/if they implement a new
+  # versioning mechanism, adjust this.
+  if test -x /usr/bin/objformat; then
+    objformat=`/usr/bin/objformat`
+  else
+    case $host_os in
+    freebsd[23].*) objformat=aout ;;
+    *) objformat=elf ;;
+    esac
+  fi
+  version_type=freebsd-$objformat
+  case $version_type in
+    freebsd-elf*)
+      library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+      need_version=no
+      need_lib_prefix=no
+      ;;
+    freebsd-*)
+      library_names_spec='${libname}${release}${shared_ext}$versuffix $libname${shared_ext}$versuffix'
+      need_version=yes
+      ;;
+  esac
+  shlibpath_var=LD_LIBRARY_PATH
+  case $host_os in
+  freebsd2.*)
+    shlibpath_overrides_runpath=yes
+    ;;
+  freebsd3.[01]* | freebsdelf3.[01]*)
+    shlibpath_overrides_runpath=yes
+    hardcode_into_libs=yes
+    ;;
+  freebsd3.[2-9]* | freebsdelf3.[2-9]* | \
+  freebsd4.[0-5] | freebsdelf4.[0-5] | freebsd4.1.1 | freebsdelf4.1.1)
+    shlibpath_overrides_runpath=no
+    hardcode_into_libs=yes
+    ;;
+  *) # from 4.6 on, and DragonFly
+    shlibpath_overrides_runpath=yes
+    hardcode_into_libs=yes
+    ;;
+  esac
+  ;;
+
+haiku*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  need_lib_prefix=no
+  need_version=no
+  dynamic_linker="$host_os runtime_loader"
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  shlibpath_var=LIBRARY_PATH
+  shlibpath_overrides_runpath=yes
+  sys_lib_dlsearch_path_spec='/boot/home/config/lib /boot/common/lib /boot/system/lib'
+  hardcode_into_libs=yes
+  ;;
+
+hpux9* | hpux10* | hpux11*)
+  # Give a soname corresponding to the major version so that dld.sl refuses to
+  # link against other versions.
+  version_type=sunos
+  need_lib_prefix=no
+  need_version=no
+  case $host_cpu in
+  ia64*)
+    shrext_cmds='.so'
+    hardcode_into_libs=yes
+    dynamic_linker="$host_os dld.so"
+    shlibpath_var=LD_LIBRARY_PATH
+    shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+    library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+    soname_spec='${libname}${release}${shared_ext}$major'
+    if test "X$HPUX_IA64_MODE" = X32; then
+      sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib"
+    else
+      sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64"
+    fi
+    sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+    ;;
+  hppa*64*)
+    shrext_cmds='.sl'
+    hardcode_into_libs=yes
+    dynamic_linker="$host_os dld.sl"
+    shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH
+    shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+    library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+    soname_spec='${libname}${release}${shared_ext}$major'
+    sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64"
+    sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+    ;;
+  *)
+    shrext_cmds='.sl'
+    dynamic_linker="$host_os dld.sl"
+    shlibpath_var=SHLIB_PATH
+    shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH
+    library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+    soname_spec='${libname}${release}${shared_ext}$major'
+    ;;
+  esac
+  # HP-UX runs *really* slowly unless shared libraries are mode 555, ...
+  postinstall_cmds='chmod 555 $lib'
+  # or fails outright, so override atomically:
+  install_override_mode=555
+  ;;
+
+interix[3-9]*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=no
+  hardcode_into_libs=yes
+  ;;
+
+irix5* | irix6* | nonstopux*)
+  case $host_os in
+    nonstopux*) version_type=nonstopux ;;
+    *)
+	if test "$lt_cv_prog_gnu_ld" = yes; then
+		version_type=linux # correct to gnu/linux during the next big refactor
+	else
+		version_type=irix
+	fi ;;
+  esac
+  need_lib_prefix=no
+  need_version=no
+  soname_spec='${libname}${release}${shared_ext}$major'
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext} $libname${shared_ext}'
+  case $host_os in
+  irix5* | nonstopux*)
+    libsuff= shlibsuff=
+    ;;
+  *)
+    case $LD in # libtool.m4 will add one of these switches to LD
+    *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ")
+      libsuff= shlibsuff= libmagic=32-bit;;
+    *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ")
+      libsuff=32 shlibsuff=N32 libmagic=N32;;
+    *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ")
+      libsuff=64 shlibsuff=64 libmagic=64-bit;;
+    *) libsuff= shlibsuff= libmagic=never-match;;
+    esac
+    ;;
+  esac
+  shlibpath_var=LD_LIBRARY${shlibsuff}_PATH
+  shlibpath_overrides_runpath=no
+  sys_lib_search_path_spec="/usr/lib${libsuff} /lib${libsuff} /usr/local/lib${libsuff}"
+  sys_lib_dlsearch_path_spec="/usr/lib${libsuff} /lib${libsuff}"
+  hardcode_into_libs=yes
+  ;;
+
+# No shared lib support for Linux oldld, aout, or coff.
+linux*oldld* | linux*aout* | linux*coff*)
+  dynamic_linker=no
+  ;;
+
+# This must be glibc/ELF.
+linux* | k*bsd*-gnu | kopensolaris*-gnu | gnu*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=no
+
+  # Some binutils ld are patched to set DT_RUNPATH
+  if ${lt_cv_shlibpath_overrides_runpath+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  lt_cv_shlibpath_overrides_runpath=no
+    save_LDFLAGS=$LDFLAGS
+    save_libdir=$libdir
+    eval "libdir=/foo; wl=\"$lt_prog_compiler_wl\"; \
+	 LDFLAGS=\"\$LDFLAGS $hardcode_libdir_flag_spec\""
+    cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+int
+main ()
+{
+
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+  if  ($OBJDUMP -p conftest$ac_exeext) 2>/dev/null | grep "RUNPATH.*$libdir" >/dev/null; then :
+  lt_cv_shlibpath_overrides_runpath=yes
+fi
+fi
+rm -f core conftest.err conftest.$ac_objext \
+    conftest$ac_exeext conftest.$ac_ext
+    LDFLAGS=$save_LDFLAGS
+    libdir=$save_libdir
+
+fi
+
+  shlibpath_overrides_runpath=$lt_cv_shlibpath_overrides_runpath
+
+  # This implies no fast_install, which is unacceptable.
+  # Some rework will be needed to allow for fast_install
+  # before this can be enabled.
+  hardcode_into_libs=yes
+
+  # Append ld.so.conf contents to the search path
+  if test -f /etc/ld.so.conf; then
+    lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \$2)); skip = 1; } { if (!skip) print \$0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;/^[	 ]*hwcap[	 ]/d;s/[:,	]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;s/"//g;/^$/d' | tr '\n' ' '`
+    sys_lib_dlsearch_path_spec="/lib /usr/lib $lt_ld_extra"
+  fi
+
+  # We used to test for /lib/ld.so.1 and disable shared libraries on
+  # powerpc, because MkLinux only supported shared libraries with the
+  # GNU dynamic linker.  Since this was broken with cross compilers,
+  # most powerpc-linux boxes support dynamic linking these days and
+  # people can always --disable-shared, the test was removed, and we
+  # assume the GNU/Linux dynamic linker is in use.
+  dynamic_linker='GNU/Linux ld.so'
+  ;;
+
+netbsdelf*-gnu)
+  version_type=linux
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=no
+  hardcode_into_libs=yes
+  dynamic_linker='NetBSD ld.elf_so'
+  ;;
+
+netbsd*)
+  version_type=sunos
+  need_lib_prefix=no
+  need_version=no
+  if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+    library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+    finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+    dynamic_linker='NetBSD (a.out) ld.so'
+  else
+    library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+    soname_spec='${libname}${release}${shared_ext}$major'
+    dynamic_linker='NetBSD ld.elf_so'
+  fi
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=yes
+  hardcode_into_libs=yes
+  ;;
+
+newsos6)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=yes
+  ;;
+
+*nto* | *qnx*)
+  version_type=qnx
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=no
+  hardcode_into_libs=yes
+  dynamic_linker='ldqnx.so'
+  ;;
+
+openbsd*)
+  version_type=sunos
+  sys_lib_dlsearch_path_spec="/usr/lib"
+  need_lib_prefix=no
+  # Some older versions of OpenBSD (3.3 at least) *do* need versioned libs.
+  case $host_os in
+    openbsd3.3 | openbsd3.3.*)	need_version=yes ;;
+    *)				need_version=no  ;;
+  esac
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+  finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+  shlibpath_var=LD_LIBRARY_PATH
+  if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+    case $host_os in
+      openbsd2.[89] | openbsd2.[89].*)
+	shlibpath_overrides_runpath=no
+	;;
+      *)
+	shlibpath_overrides_runpath=yes
+	;;
+      esac
+  else
+    shlibpath_overrides_runpath=yes
+  fi
+  ;;
+
+os2*)
+  libname_spec='$name'
+  shrext_cmds=".dll"
+  need_lib_prefix=no
+  library_names_spec='$libname${shared_ext} $libname.a'
+  dynamic_linker='OS/2 ld.exe'
+  shlibpath_var=LIBPATH
+  ;;
+
+osf3* | osf4* | osf5*)
+  version_type=osf
+  need_lib_prefix=no
+  need_version=no
+  soname_spec='${libname}${release}${shared_ext}$major'
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  shlibpath_var=LD_LIBRARY_PATH
+  sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib"
+  sys_lib_dlsearch_path_spec="$sys_lib_search_path_spec"
+  ;;
+
+rdos*)
+  dynamic_linker=no
+  ;;
+
+solaris*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=yes
+  hardcode_into_libs=yes
+  # ldd complains unless libraries are executable
+  postinstall_cmds='chmod +x $lib'
+  ;;
+
+sunos4*)
+  version_type=sunos
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+  finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=yes
+  if test "$with_gnu_ld" = yes; then
+    need_lib_prefix=no
+  fi
+  need_version=yes
+  ;;
+
+sysv4 | sysv4.3*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  shlibpath_var=LD_LIBRARY_PATH
+  case $host_vendor in
+    sni)
+      shlibpath_overrides_runpath=no
+      need_lib_prefix=no
+      runpath_var=LD_RUN_PATH
+      ;;
+    siemens)
+      need_lib_prefix=no
+      ;;
+    motorola)
+      need_lib_prefix=no
+      need_version=no
+      shlibpath_overrides_runpath=no
+      sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib'
+      ;;
+  esac
+  ;;
+
+sysv4*MP*)
+  if test -d /usr/nec ;then
+    version_type=linux # correct to gnu/linux during the next big refactor
+    library_names_spec='$libname${shared_ext}.$versuffix $libname${shared_ext}.$major $libname${shared_ext}'
+    soname_spec='$libname${shared_ext}.$major'
+    shlibpath_var=LD_LIBRARY_PATH
+  fi
+  ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+  version_type=freebsd-elf
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=yes
+  hardcode_into_libs=yes
+  if test "$with_gnu_ld" = yes; then
+    sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib'
+  else
+    sys_lib_search_path_spec='/usr/ccs/lib /usr/lib'
+    case $host_os in
+      sco3.2v5*)
+        sys_lib_search_path_spec="$sys_lib_search_path_spec /lib"
+	;;
+    esac
+  fi
+  sys_lib_dlsearch_path_spec='/usr/lib'
+  ;;
+
+tpf*)
+  # TPF is a cross-target only.  Preferred cross-host = GNU/Linux.
+  version_type=linux # correct to gnu/linux during the next big refactor
+  need_lib_prefix=no
+  need_version=no
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  shlibpath_var=LD_LIBRARY_PATH
+  shlibpath_overrides_runpath=no
+  hardcode_into_libs=yes
+  ;;
+
+uts4*)
+  version_type=linux # correct to gnu/linux during the next big refactor
+  library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+  soname_spec='${libname}${release}${shared_ext}$major'
+  shlibpath_var=LD_LIBRARY_PATH
+  ;;
+
+*)
+  dynamic_linker=no
+  ;;
+esac
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $dynamic_linker" >&5
+$as_echo "$dynamic_linker" >&6; }
+test "$dynamic_linker" = no && can_build_shared=no
+
+variables_saved_for_relink="PATH $shlibpath_var $runpath_var"
+if test "$GCC" = yes; then
+  variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH"
+fi
+
+if test "${lt_cv_sys_lib_search_path_spec+set}" = set; then
+  sys_lib_search_path_spec="$lt_cv_sys_lib_search_path_spec"
+fi
+if test "${lt_cv_sys_lib_dlsearch_path_spec+set}" = set; then
+  sys_lib_dlsearch_path_spec="$lt_cv_sys_lib_dlsearch_path_spec"
+fi
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking how to hardcode library paths into programs" >&5
+$as_echo_n "checking how to hardcode library paths into programs... " >&6; }
+hardcode_action=
+if test -n "$hardcode_libdir_flag_spec" ||
+   test -n "$runpath_var" ||
+   test "X$hardcode_automatic" = "Xyes" ; then
+
+  # We can hardcode non-existent directories.
+  if test "$hardcode_direct" != no &&
+     # If the only mechanism to avoid hardcoding is shlibpath_var, we
+     # have to relink, otherwise we might link with an installed library
+     # when we should be linking with a yet-to-be-installed one
+     ## test "$_LT_TAGVAR(hardcode_shlibpath_var, )" != no &&
+     test "$hardcode_minus_L" != no; then
+    # Linking always hardcodes the temporary library directory.
+    hardcode_action=relink
+  else
+    # We can link without hardcoding, and we can hardcode nonexisting dirs.
+    hardcode_action=immediate
+  fi
+else
+  # We cannot hardcode anything, or else we can only hardcode existing
+  # directories.
+  hardcode_action=unsupported
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $hardcode_action" >&5
+$as_echo "$hardcode_action" >&6; }
+
+if test "$hardcode_action" = relink ||
+   test "$inherit_rpath" = yes; then
+  # Fast installation is not supported
+  enable_fast_install=no
+elif test "$shlibpath_overrides_runpath" = yes ||
+     test "$enable_shared" = no; then
+  # Fast installation is not necessary
+  enable_fast_install=needless
+fi
+
+
+
+
+
+
+  if test "x$enable_dlopen" != xyes; then
+  enable_dlopen=unknown
+  enable_dlopen_self=unknown
+  enable_dlopen_self_static=unknown
+else
+  lt_cv_dlopen=no
+  lt_cv_dlopen_libs=
+
+  case $host_os in
+  beos*)
+    lt_cv_dlopen="load_add_on"
+    lt_cv_dlopen_libs=
+    lt_cv_dlopen_self=yes
+    ;;
+
+  mingw* | pw32* | cegcc*)
+    lt_cv_dlopen="LoadLibrary"
+    lt_cv_dlopen_libs=
+    ;;
+
+  cygwin*)
+    lt_cv_dlopen="dlopen"
+    lt_cv_dlopen_libs=
+    ;;
+
+  darwin*)
+  # if libdl is installed we need to link against it
+    { $as_echo "$as_me:${as_lineno-$LINENO}: checking for dlopen in -ldl" >&5
+$as_echo_n "checking for dlopen in -ldl... " >&6; }
+if ${ac_cv_lib_dl_dlopen+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  ac_check_lib_save_LIBS=$LIBS
+LIBS="-ldl  $LIBS"
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+/* Override any GCC internal prototype to avoid an error.
+   Use char because int might match the return type of a GCC
+   builtin and then its argument prototype would still apply.  */
+#ifdef __cplusplus
+extern "C"
+#endif
+char dlopen ();
+int
+main ()
+{
+return dlopen ();
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+  ac_cv_lib_dl_dlopen=yes
+else
+  ac_cv_lib_dl_dlopen=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+    conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_dl_dlopen" >&5
+$as_echo "$ac_cv_lib_dl_dlopen" >&6; }
+if test "x$ac_cv_lib_dl_dlopen" = xyes; then :
+  lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl"
+else
+
+    lt_cv_dlopen="dyld"
+    lt_cv_dlopen_libs=
+    lt_cv_dlopen_self=yes
+
+fi
+
+    ;;
+
+  *)
+    ac_fn_c_check_func "$LINENO" "shl_load" "ac_cv_func_shl_load"
+if test "x$ac_cv_func_shl_load" = xyes; then :
+  lt_cv_dlopen="shl_load"
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking for shl_load in -ldld" >&5
+$as_echo_n "checking for shl_load in -ldld... " >&6; }
+if ${ac_cv_lib_dld_shl_load+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  ac_check_lib_save_LIBS=$LIBS
+LIBS="-ldld  $LIBS"
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+/* Override any GCC internal prototype to avoid an error.
+   Use char because int might match the return type of a GCC
+   builtin and then its argument prototype would still apply.  */
+#ifdef __cplusplus
+extern "C"
+#endif
+char shl_load ();
+int
+main ()
+{
+return shl_load ();
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+  ac_cv_lib_dld_shl_load=yes
+else
+  ac_cv_lib_dld_shl_load=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+    conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_dld_shl_load" >&5
+$as_echo "$ac_cv_lib_dld_shl_load" >&6; }
+if test "x$ac_cv_lib_dld_shl_load" = xyes; then :
+  lt_cv_dlopen="shl_load" lt_cv_dlopen_libs="-ldld"
+else
+  ac_fn_c_check_func "$LINENO" "dlopen" "ac_cv_func_dlopen"
+if test "x$ac_cv_func_dlopen" = xyes; then :
+  lt_cv_dlopen="dlopen"
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking for dlopen in -ldl" >&5
+$as_echo_n "checking for dlopen in -ldl... " >&6; }
+if ${ac_cv_lib_dl_dlopen+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  ac_check_lib_save_LIBS=$LIBS
+LIBS="-ldl  $LIBS"
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+/* Override any GCC internal prototype to avoid an error.
+   Use char because int might match the return type of a GCC
+   builtin and then its argument prototype would still apply.  */
+#ifdef __cplusplus
+extern "C"
+#endif
+char dlopen ();
+int
+main ()
+{
+return dlopen ();
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+  ac_cv_lib_dl_dlopen=yes
+else
+  ac_cv_lib_dl_dlopen=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+    conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_dl_dlopen" >&5
+$as_echo "$ac_cv_lib_dl_dlopen" >&6; }
+if test "x$ac_cv_lib_dl_dlopen" = xyes; then :
+  lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl"
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking for dlopen in -lsvld" >&5
+$as_echo_n "checking for dlopen in -lsvld... " >&6; }
+if ${ac_cv_lib_svld_dlopen+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  ac_check_lib_save_LIBS=$LIBS
+LIBS="-lsvld  $LIBS"
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+/* Override any GCC internal prototype to avoid an error.
+   Use char because int might match the return type of a GCC
+   builtin and then its argument prototype would still apply.  */
+#ifdef __cplusplus
+extern "C"
+#endif
+char dlopen ();
+int
+main ()
+{
+return dlopen ();
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+  ac_cv_lib_svld_dlopen=yes
+else
+  ac_cv_lib_svld_dlopen=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+    conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_svld_dlopen" >&5
+$as_echo "$ac_cv_lib_svld_dlopen" >&6; }
+if test "x$ac_cv_lib_svld_dlopen" = xyes; then :
+  lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-lsvld"
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking for dld_link in -ldld" >&5
+$as_echo_n "checking for dld_link in -ldld... " >&6; }
+if ${ac_cv_lib_dld_dld_link+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  ac_check_lib_save_LIBS=$LIBS
+LIBS="-ldld  $LIBS"
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+/* Override any GCC internal prototype to avoid an error.
+   Use char because int might match the return type of a GCC
+   builtin and then its argument prototype would still apply.  */
+#ifdef __cplusplus
+extern "C"
+#endif
+char dld_link ();
+int
+main ()
+{
+return dld_link ();
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+  ac_cv_lib_dld_dld_link=yes
+else
+  ac_cv_lib_dld_dld_link=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+    conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_dld_dld_link" >&5
+$as_echo "$ac_cv_lib_dld_dld_link" >&6; }
+if test "x$ac_cv_lib_dld_dld_link" = xyes; then :
+  lt_cv_dlopen="dld_link" lt_cv_dlopen_libs="-ldld"
+fi
+
+
+fi
+
+
+fi
+
+
+fi
+
+
+fi
+
+
+fi
+
+    ;;
+  esac
+
+  if test "x$lt_cv_dlopen" != xno; then
+    enable_dlopen=yes
+  else
+    enable_dlopen=no
+  fi
+
+  case $lt_cv_dlopen in
+  dlopen)
+    save_CPPFLAGS="$CPPFLAGS"
+    test "x$ac_cv_header_dlfcn_h" = xyes && CPPFLAGS="$CPPFLAGS -DHAVE_DLFCN_H"
+
+    save_LDFLAGS="$LDFLAGS"
+    wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $export_dynamic_flag_spec\"
+
+    save_LIBS="$LIBS"
+    LIBS="$lt_cv_dlopen_libs $LIBS"
+
+    { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether a program can dlopen itself" >&5
+$as_echo_n "checking whether a program can dlopen itself... " >&6; }
+if ${lt_cv_dlopen_self+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  	  if test "$cross_compiling" = yes; then :
+  lt_cv_dlopen_self=cross
+else
+  lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2
+  lt_status=$lt_dlunknown
+  cat > conftest.$ac_ext <<_LT_EOF
+#line $LINENO "configure"
+#include "confdefs.h"
+
+#if HAVE_DLFCN_H
+#include <dlfcn.h>
+#endif
+
+#include <stdio.h>
+
+#ifdef RTLD_GLOBAL
+#  define LT_DLGLOBAL		RTLD_GLOBAL
+#else
+#  ifdef DL_GLOBAL
+#    define LT_DLGLOBAL		DL_GLOBAL
+#  else
+#    define LT_DLGLOBAL		0
+#  endif
+#endif
+
+/* We may have to define LT_DLLAZY_OR_NOW in the command line if we
+   find out it does not work in some platform. */
+#ifndef LT_DLLAZY_OR_NOW
+#  ifdef RTLD_LAZY
+#    define LT_DLLAZY_OR_NOW		RTLD_LAZY
+#  else
+#    ifdef DL_LAZY
+#      define LT_DLLAZY_OR_NOW		DL_LAZY
+#    else
+#      ifdef RTLD_NOW
+#        define LT_DLLAZY_OR_NOW	RTLD_NOW
+#      else
+#        ifdef DL_NOW
+#          define LT_DLLAZY_OR_NOW	DL_NOW
+#        else
+#          define LT_DLLAZY_OR_NOW	0
+#        endif
+#      endif
+#    endif
+#  endif
+#endif
+
+/* When -fvisbility=hidden is used, assume the code has been annotated
+   correspondingly for the symbols needed.  */
+#if defined(__GNUC__) && (((__GNUC__ == 3) && (__GNUC_MINOR__ >= 3)) || (__GNUC__ > 3))
+int fnord () __attribute__((visibility("default")));
+#endif
+
+int fnord () { return 42; }
+int main ()
+{
+  void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW);
+  int status = $lt_dlunknown;
+
+  if (self)
+    {
+      if (dlsym (self,"fnord"))       status = $lt_dlno_uscore;
+      else
+        {
+	  if (dlsym( self,"_fnord"))  status = $lt_dlneed_uscore;
+          else puts (dlerror ());
+	}
+      /* dlclose (self); */
+    }
+  else
+    puts (dlerror ());
+
+  return status;
+}
+_LT_EOF
+  if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_link\""; } >&5
+  (eval $ac_link) 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; } && test -s conftest${ac_exeext} 2>/dev/null; then
+    (./conftest; exit; ) >&5 2>/dev/null
+    lt_status=$?
+    case x$lt_status in
+      x$lt_dlno_uscore) lt_cv_dlopen_self=yes ;;
+      x$lt_dlneed_uscore) lt_cv_dlopen_self=yes ;;
+      x$lt_dlunknown|x*) lt_cv_dlopen_self=no ;;
+    esac
+  else :
+    # compilation failed
+    lt_cv_dlopen_self=no
+  fi
+fi
+rm -fr conftest*
+
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_dlopen_self" >&5
+$as_echo "$lt_cv_dlopen_self" >&6; }
+
+    if test "x$lt_cv_dlopen_self" = xyes; then
+      wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $lt_prog_compiler_static\"
+      { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether a statically linked program can dlopen itself" >&5
+$as_echo_n "checking whether a statically linked program can dlopen itself... " >&6; }
+if ${lt_cv_dlopen_self_static+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  	  if test "$cross_compiling" = yes; then :
+  lt_cv_dlopen_self_static=cross
+else
+  lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2
+  lt_status=$lt_dlunknown
+  cat > conftest.$ac_ext <<_LT_EOF
+#line $LINENO "configure"
+#include "confdefs.h"
+
+#if HAVE_DLFCN_H
+#include <dlfcn.h>
+#endif
+
+#include <stdio.h>
+
+#ifdef RTLD_GLOBAL
+#  define LT_DLGLOBAL		RTLD_GLOBAL
+#else
+#  ifdef DL_GLOBAL
+#    define LT_DLGLOBAL		DL_GLOBAL
+#  else
+#    define LT_DLGLOBAL		0
+#  endif
+#endif
+
+/* We may have to define LT_DLLAZY_OR_NOW in the command line if we
+   find out it does not work in some platform. */
+#ifndef LT_DLLAZY_OR_NOW
+#  ifdef RTLD_LAZY
+#    define LT_DLLAZY_OR_NOW		RTLD_LAZY
+#  else
+#    ifdef DL_LAZY
+#      define LT_DLLAZY_OR_NOW		DL_LAZY
+#    else
+#      ifdef RTLD_NOW
+#        define LT_DLLAZY_OR_NOW	RTLD_NOW
+#      else
+#        ifdef DL_NOW
+#          define LT_DLLAZY_OR_NOW	DL_NOW
+#        else
+#          define LT_DLLAZY_OR_NOW	0
+#        endif
+#      endif
+#    endif
+#  endif
+#endif
+
+/* When -fvisbility=hidden is used, assume the code has been annotated
+   correspondingly for the symbols needed.  */
+#if defined(__GNUC__) && (((__GNUC__ == 3) && (__GNUC_MINOR__ >= 3)) || (__GNUC__ > 3))
+int fnord () __attribute__((visibility("default")));
+#endif
+
+int fnord () { return 42; }
+int main ()
+{
+  void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW);
+  int status = $lt_dlunknown;
+
+  if (self)
+    {
+      if (dlsym (self,"fnord"))       status = $lt_dlno_uscore;
+      else
+        {
+	  if (dlsym( self,"_fnord"))  status = $lt_dlneed_uscore;
+          else puts (dlerror ());
+	}
+      /* dlclose (self); */
+    }
+  else
+    puts (dlerror ());
+
+  return status;
+}
+_LT_EOF
+  if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_link\""; } >&5
+  (eval $ac_link) 2>&5
+  ac_status=$?
+  $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+  test $ac_status = 0; } && test -s conftest${ac_exeext} 2>/dev/null; then
+    (./conftest; exit; ) >&5 2>/dev/null
+    lt_status=$?
+    case x$lt_status in
+      x$lt_dlno_uscore) lt_cv_dlopen_self_static=yes ;;
+      x$lt_dlneed_uscore) lt_cv_dlopen_self_static=yes ;;
+      x$lt_dlunknown|x*) lt_cv_dlopen_self_static=no ;;
+    esac
+  else :
+    # compilation failed
+    lt_cv_dlopen_self_static=no
+  fi
+fi
+rm -fr conftest*
+
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_dlopen_self_static" >&5
+$as_echo "$lt_cv_dlopen_self_static" >&6; }
+    fi
+
+    CPPFLAGS="$save_CPPFLAGS"
+    LDFLAGS="$save_LDFLAGS"
+    LIBS="$save_LIBS"
+    ;;
+  esac
+
+  case $lt_cv_dlopen_self in
+  yes|no) enable_dlopen_self=$lt_cv_dlopen_self ;;
+  *) enable_dlopen_self=unknown ;;
+  esac
+
+  case $lt_cv_dlopen_self_static in
+  yes|no) enable_dlopen_self_static=$lt_cv_dlopen_self_static ;;
+  *) enable_dlopen_self_static=unknown ;;
+  esac
+fi
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+striplib=
+old_striplib=
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether stripping libraries is possible" >&5
+$as_echo_n "checking whether stripping libraries is possible... " >&6; }
+if test -n "$STRIP" && $STRIP -V 2>&1 | $GREP "GNU strip" >/dev/null; then
+  test -z "$old_striplib" && old_striplib="$STRIP --strip-debug"
+  test -z "$striplib" && striplib="$STRIP --strip-unneeded"
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+else
+# FIXME - insert some real tests, host_os isn't really good enough
+  case $host_os in
+  darwin*)
+    if test -n "$STRIP" ; then
+      striplib="$STRIP -x"
+      old_striplib="$STRIP -S"
+      { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+    else
+      { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+    fi
+    ;;
+  *)
+    { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+    ;;
+  esac
+fi
+
+
+
+
+
+
+
+
+
+
+
+
+  # Report which library types will actually be built
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking if libtool supports shared libraries" >&5
+$as_echo_n "checking if libtool supports shared libraries... " >&6; }
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $can_build_shared" >&5
+$as_echo "$can_build_shared" >&6; }
+
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether to build shared libraries" >&5
+$as_echo_n "checking whether to build shared libraries... " >&6; }
+  test "$can_build_shared" = "no" && enable_shared=no
+
+  # On AIX, shared libraries and static libraries use the same namespace, and
+  # are all built from PIC.
+  case $host_os in
+  aix3*)
+    test "$enable_shared" = yes && enable_static=no
+    if test -n "$RANLIB"; then
+      archive_cmds="$archive_cmds~\$RANLIB \$lib"
+      postinstall_cmds='$RANLIB $lib'
+    fi
+    ;;
+
+  aix[4-9]*)
+    if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then
+      test "$enable_shared" = yes && enable_static=no
+    fi
+    ;;
+  esac
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $enable_shared" >&5
+$as_echo "$enable_shared" >&6; }
+
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether to build static libraries" >&5
+$as_echo_n "checking whether to build static libraries... " >&6; }
+  # Make sure either enable_shared or enable_static is yes.
+  test "$enable_shared" = yes || enable_static=yes
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $enable_static" >&5
+$as_echo "$enable_static" >&6; }
+
+
+
+
+fi
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+CC="$lt_save_CC"
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+        ac_config_commands="$ac_config_commands libtool"
+
+
+
+
+# Only expand once:
+
+
+ if test x$GCC = xyes; then
+  GCC_TRUE=
+  GCC_FALSE='#'
+else
+  GCC_TRUE='#'
+  GCC_FALSE=
+fi
+
+
+# Checks for libraries.
+
+# Checks for header files.
+for ac_header in endian.h fcntl.h locale.h sched.h unistd.h sys/param.h sys/stat.h sys/time.h sys/types.h
+do :
+  as_ac_Header=`$as_echo "ac_cv_header_$ac_header" | $as_tr_sh`
+ac_fn_c_check_header_mongrel "$LINENO" "$ac_header" "$as_ac_Header" "$ac_includes_default"
+if eval test \"x\$"$as_ac_Header"\" = x"yes"; then :
+  cat >>confdefs.h <<_ACEOF
+#define `$as_echo "HAVE_$ac_header" | $as_tr_cpp` 1
+_ACEOF
+
+fi
+
+done
+
+
+# Checks for typedefs, structures, and compiler characteristics.
+ac_fn_c_find_intX_t "$LINENO" "32" "ac_cv_c_int32_t"
+case $ac_cv_c_int32_t in #(
+  no|yes) ;; #(
+  *)
+
+cat >>confdefs.h <<_ACEOF
+#define int32_t $ac_cv_c_int32_t
+_ACEOF
+;;
+esac
+
+ac_fn_c_find_uintX_t "$LINENO" "32" "ac_cv_c_uint32_t"
+case $ac_cv_c_uint32_t in #(
+  no|yes) ;; #(
+  *)
+
+$as_echo "#define _UINT32_T 1" >>confdefs.h
+
+
+cat >>confdefs.h <<_ACEOF
+#define uint32_t $ac_cv_c_uint32_t
+_ACEOF
+;;
+  esac
+
+ac_fn_c_find_uintX_t "$LINENO" "16" "ac_cv_c_uint16_t"
+case $ac_cv_c_uint16_t in #(
+  no|yes) ;; #(
+  *)
+
+
+cat >>confdefs.h <<_ACEOF
+#define uint16_t $ac_cv_c_uint16_t
+_ACEOF
+;;
+  esac
+
+ac_fn_c_find_uintX_t "$LINENO" "8" "ac_cv_c_uint8_t"
+case $ac_cv_c_uint8_t in #(
+  no|yes) ;; #(
+  *)
+
+$as_echo "#define _UINT8_T 1" >>confdefs.h
+
+
+cat >>confdefs.h <<_ACEOF
+#define uint8_t $ac_cv_c_uint8_t
+_ACEOF
+;;
+  esac
+
+
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking for unsigned long long int" >&5
+$as_echo_n "checking for unsigned long long int... " >&6; }
+if ${ac_cv_type_unsigned_long_long_int+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  ac_cv_type_unsigned_long_long_int=yes
+     if test "x${ac_cv_prog_cc_c99-no}" = xno; then
+       cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+  /* For now, do not test the preprocessor; as of 2007 there are too many
+	 implementations with broken preprocessors.  Perhaps this can
+	 be revisited in 2012.  In the meantime, code should not expect
+	 #if to work with literals wider than 32 bits.  */
+      /* Test literals.  */
+      long long int ll = 9223372036854775807ll;
+      long long int nll = -9223372036854775807LL;
+      unsigned long long int ull = 18446744073709551615ULL;
+      /* Test constant expressions.   */
+      typedef int a[((-9223372036854775807LL < 0 && 0 < 9223372036854775807ll)
+		     ? 1 : -1)];
+      typedef int b[(18446744073709551615ULL <= (unsigned long long int) -1
+		     ? 1 : -1)];
+      int i = 63;
+int
+main ()
+{
+/* Test availability of runtime routines for shift and division.  */
+      long long int llmax = 9223372036854775807ll;
+      unsigned long long int ullmax = 18446744073709551615ull;
+      return ((ll << 63) | (ll >> 63) | (ll < i) | (ll > i)
+	      | (llmax / ll) | (llmax % ll)
+	      | (ull << 63) | (ull >> 63) | (ull << i) | (ull >> i)
+	      | (ullmax / ull) | (ullmax % ull));
+  ;
+  return 0;
+}
+
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+
+else
+  ac_cv_type_unsigned_long_long_int=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+    conftest$ac_exeext conftest.$ac_ext
+     fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_type_unsigned_long_long_int" >&5
+$as_echo "$ac_cv_type_unsigned_long_long_int" >&6; }
+  if test $ac_cv_type_unsigned_long_long_int = yes; then
+
+$as_echo "#define HAVE_UNSIGNED_LONG_LONG_INT 1" >>confdefs.h
+
+  fi
+
+
+
+  { $as_echo "$as_me:${as_lineno-$LINENO}: checking for long long int" >&5
+$as_echo_n "checking for long long int... " >&6; }
+if ${ac_cv_type_long_long_int+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  ac_cv_type_long_long_int=yes
+      if test "x${ac_cv_prog_cc_c99-no}" = xno; then
+	ac_cv_type_long_long_int=$ac_cv_type_unsigned_long_long_int
+	if test $ac_cv_type_long_long_int = yes; then
+	  	  	  	  if test "$cross_compiling" = yes; then :
+  :
+else
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+#include <limits.h>
+		 #ifndef LLONG_MAX
+		 # define HALF \
+			  (1LL << (sizeof (long long int) * CHAR_BIT - 2))
+		 # define LLONG_MAX (HALF - 1 + HALF)
+		 #endif
+int
+main ()
+{
+long long int n = 1;
+		 int i;
+		 for (i = 0; ; i++)
+		   {
+		     long long int m = n << i;
+		     if (m >> i != n)
+		       return 1;
+		     if (LLONG_MAX / 2 < m)
+		       break;
+		   }
+		 return 0;
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_run "$LINENO"; then :
+
+else
+  ac_cv_type_long_long_int=no
+fi
+rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext \
+  conftest.$ac_objext conftest.beam conftest.$ac_ext
+fi
+
+	fi
+      fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_type_long_long_int" >&5
+$as_echo "$ac_cv_type_long_long_int" >&6; }
+  if test $ac_cv_type_long_long_int = yes; then
+
+$as_echo "#define HAVE_LONG_LONG_INT 1" >>confdefs.h
+
+  fi
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for inline" >&5
+$as_echo_n "checking for inline... " >&6; }
+if ${ac_cv_c_inline+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  ac_cv_c_inline=no
+for ac_kw in inline __inline__ __inline; do
+  cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+#ifndef __cplusplus
+typedef int foo_t;
+static $ac_kw foo_t static_foo () {return 0; }
+$ac_kw foo_t foo () {return 0; }
+#endif
+
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+  ac_cv_c_inline=$ac_kw
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+  test "$ac_cv_c_inline" != no && break
+done
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_c_inline" >&5
+$as_echo "$ac_cv_c_inline" >&6; }
+
+case $ac_cv_c_inline in
+  inline | yes) ;;
+  *)
+    case $ac_cv_c_inline in
+      no) ac_val=;;
+      *) ac_val=$ac_cv_c_inline;;
+    esac
+    cat >>confdefs.h <<_ACEOF
+#ifndef __cplusplus
+#define inline $ac_val
+#endif
+_ACEOF
+    ;;
+esac
+
+case $ac_cv_c_inline in
+    yes) json_inline=inline;;
+    no) json_inline=;;
+    *) json_inline=$ac_cv_c_inline;;
+esac
+
+
+# Checks for library functions.
+for ac_func in close getpid gettimeofday localeconv open read sched_yield strtoll
+do :
+  as_ac_var=`$as_echo "ac_cv_func_$ac_func" | $as_tr_sh`
+ac_fn_c_check_func "$LINENO" "$ac_func" "$as_ac_var"
+if eval test \"x\$"$as_ac_var"\" = x"yes"; then :
+  cat >>confdefs.h <<_ACEOF
+#define `$as_echo "HAVE_$ac_func" | $as_tr_cpp` 1
+_ACEOF
+
+fi
+done
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for gcc __sync builtins" >&5
+$as_echo_n "checking for gcc __sync builtins... " >&6; }
+have_sync_builtins=no
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+int
+main ()
+{
+unsigned long val; __sync_bool_compare_and_swap(&val, 0, 1);
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+  have_sync_builtins=yes
+fi
+rm -f core conftest.err conftest.$ac_objext \
+    conftest$ac_exeext conftest.$ac_ext
+if test "x$have_sync_builtins" = "xyes"; then
+
+$as_echo "#define HAVE_SYNC_BUILTINS 1" >>confdefs.h
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $have_sync_builtins" >&5
+$as_echo "$have_sync_builtins" >&6; }
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for gcc __atomic builtins" >&5
+$as_echo_n "checking for gcc __atomic builtins... " >&6; }
+have_atomic_builtins=no
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h.  */
+
+int
+main ()
+{
+char l; unsigned long v; __atomic_test_and_set(&l, __ATOMIC_RELAXED); __atomic_store_n(&v, 1, __ATOMIC_RELEASE); __atomic_load_n(&v, __ATOMIC_ACQUIRE);
+  ;
+  return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+  have_atomic_builtins=yes
+fi
+rm -f core conftest.err conftest.$ac_objext \
+    conftest$ac_exeext conftest.$ac_ext
+if test "x$have_atomic_builtins" = "xyes"; then
+
+$as_echo "#define HAVE_ATOMIC_BUILTINS 1" >>confdefs.h
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $have_atomic_builtins" >&5
+$as_echo "$have_atomic_builtins" >&6; }
+
+case "$ac_cv_type_long_long_int$ac_cv_func_strtoll" in
+     yesyes) json_have_long_long=1;;
+     *) json_have_long_long=0;;
+esac
+
+
+case "$ac_cv_header_locale_h$ac_cv_func_localeconv" in
+     yesyes) json_have_localeconv=1;;
+     *) json_have_localeconv=0;;
+esac
+
+
+# Features
+# Check whether --enable-urandom was given.
+if test "${enable_urandom+set}" = set; then :
+  enableval=$enable_urandom; use_urandom=$enableval
+else
+  use_urandom=yes
+fi
+
+
+if test "x$use_urandom" = xyes; then
+
+$as_echo "#define USE_URANDOM 1" >>confdefs.h
+
+fi
+
+# Check whether --enable-windows-cryptoapi was given.
+if test "${enable_windows_cryptoapi+set}" = set; then :
+  enableval=$enable_windows_cryptoapi; use_windows_cryptoapi=$enableval
+else
+  use_windows_cryptoapi=yes
+fi
+
+
+if test "x$use_windows_cryptoapi" = xyes; then
+
+$as_echo "#define USE_WINDOWS_CRYPTOAPI 1" >>confdefs.h
+
+fi
+
+if test x$GCC = xyes; then
+    AM_CFLAGS="-Wall -Wextra -Wdeclaration-after-statement"
+fi
+
+
+ac_config_files="$ac_config_files jansson.pc Makefile doc/Makefile src/Makefile src/jansson_config.h test/Makefile test/bin/Makefile test/suites/Makefile test/suites/api/Makefile"
+
+cat >confcache <<\_ACEOF
+# This file is a shell script that caches the results of configure
+# tests run on this system so they can be shared between configure
+# scripts and configure runs, see configure's option --config-cache.
+# It is not useful on other systems.  If it contains results you don't
+# want to keep, you may remove or edit it.
+#
+# config.status only pays attention to the cache file if you give it
+# the --recheck option to rerun configure.
+#
+# `ac_cv_env_foo' variables (set or unset) will be overridden when
+# loading this file, other *unset* `ac_cv_foo' will be assigned the
+# following values.
+
+_ACEOF
+
+# The following way of writing the cache mishandles newlines in values,
+# but we know of no workaround that is simple, portable, and efficient.
+# So, we kill variables containing newlines.
+# Ultrix sh set writes to stderr and can't be redirected directly,
+# and sets the high bit in the cache file unless we assign to the vars.
+(
+  for ac_var in `(set) 2>&1 | sed -n 's/^\([a-zA-Z_][a-zA-Z0-9_]*\)=.*/\1/p'`; do
+    eval ac_val=\$$ac_var
+    case $ac_val in #(
+    *${as_nl}*)
+      case $ac_var in #(
+      *_cv_*) { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: cache variable $ac_var contains a newline" >&5
+$as_echo "$as_me: WARNING: cache variable $ac_var contains a newline" >&2;} ;;
+      esac
+      case $ac_var in #(
+      _ | IFS | as_nl) ;; #(
+      BASH_ARGV | BASH_SOURCE) eval $ac_var= ;; #(
+      *) { eval $ac_var=; unset $ac_var;} ;;
+      esac ;;
+    esac
+  done
+
+  (set) 2>&1 |
+    case $as_nl`(ac_space=' '; set) 2>&1` in #(
+    *${as_nl}ac_space=\ *)
+      # `set' does not quote correctly, so add quotes: double-quote
+      # substitution turns \\\\ into \\, and sed turns \\ into \.
+      sed -n \
+	"s/'/'\\\\''/g;
+	  s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1='\\2'/p"
+      ;; #(
+    *)
+      # `set' quotes correctly as required by POSIX, so do not add quotes.
+      sed -n "/^[_$as_cr_alnum]*_cv_[_$as_cr_alnum]*=/p"
+      ;;
+    esac |
+    sort
+) |
+  sed '
+     /^ac_cv_env_/b end
+     t clear
+     :clear
+     s/^\([^=]*\)=\(.*[{}].*\)$/test "${\1+set}" = set || &/
+     t end
+     s/^\([^=]*\)=\(.*\)$/\1=${\1=\2}/
+     :end' >>confcache
+if diff "$cache_file" confcache >/dev/null 2>&1; then :; else
+  if test -w "$cache_file"; then
+    if test "x$cache_file" != "x/dev/null"; then
+      { $as_echo "$as_me:${as_lineno-$LINENO}: updating cache $cache_file" >&5
+$as_echo "$as_me: updating cache $cache_file" >&6;}
+      if test ! -f "$cache_file" || test -h "$cache_file"; then
+	cat confcache >"$cache_file"
+      else
+        case $cache_file in #(
+        */* | ?:*)
+	  mv -f confcache "$cache_file"$$ &&
+	  mv -f "$cache_file"$$ "$cache_file" ;; #(
+        *)
+	  mv -f confcache "$cache_file" ;;
+	esac
+      fi
+    fi
+  else
+    { $as_echo "$as_me:${as_lineno-$LINENO}: not updating unwritable cache $cache_file" >&5
+$as_echo "$as_me: not updating unwritable cache $cache_file" >&6;}
+  fi
+fi
+rm -f confcache
+
+test "x$prefix" = xNONE && prefix=$ac_default_prefix
+# Let make expand exec_prefix.
+test "x$exec_prefix" = xNONE && exec_prefix='${prefix}'
+
+DEFS=-DHAVE_CONFIG_H
+
+ac_libobjs=
+ac_ltlibobjs=
+U=
+for ac_i in : $LIBOBJS; do test "x$ac_i" = x: && continue
+  # 1. Remove the extension, and $U if already installed.
+  ac_script='s/\$U\././;s/\.o$//;s/\.obj$//'
+  ac_i=`$as_echo "$ac_i" | sed "$ac_script"`
+  # 2. Prepend LIBOBJDIR.  When used with automake>=1.10 LIBOBJDIR
+  #    will be set to the directory where LIBOBJS objects are built.
+  as_fn_append ac_libobjs " \${LIBOBJDIR}$ac_i\$U.$ac_objext"
+  as_fn_append ac_ltlibobjs " \${LIBOBJDIR}$ac_i"'$U.lo'
+done
+LIBOBJS=$ac_libobjs
+
+LTLIBOBJS=$ac_ltlibobjs
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking that generated files are newer than configure" >&5
+$as_echo_n "checking that generated files are newer than configure... " >&6; }
+   if test -n "$am_sleep_pid"; then
+     # Hide warnings about reused PIDs.
+     wait $am_sleep_pid 2>/dev/null
+   fi
+   { $as_echo "$as_me:${as_lineno-$LINENO}: result: done" >&5
+$as_echo "done" >&6; }
+ if test -n "$EXEEXT"; then
+  am__EXEEXT_TRUE=
+  am__EXEEXT_FALSE='#'
+else
+  am__EXEEXT_TRUE='#'
+  am__EXEEXT_FALSE=
+fi
+
+if test -z "${AMDEP_TRUE}" && test -z "${AMDEP_FALSE}"; then
+  as_fn_error $? "conditional \"AMDEP\" was never defined.
+Usually this means the macro was only invoked conditionally." "$LINENO" 5
+fi
+if test -z "${am__fastdepCC_TRUE}" && test -z "${am__fastdepCC_FALSE}"; then
+  as_fn_error $? "conditional \"am__fastdepCC\" was never defined.
+Usually this means the macro was only invoked conditionally." "$LINENO" 5
+fi
+if test -z "${GCC_TRUE}" && test -z "${GCC_FALSE}"; then
+  as_fn_error $? "conditional \"GCC\" was never defined.
+Usually this means the macro was only invoked conditionally." "$LINENO" 5
+fi
+
+: "${CONFIG_STATUS=./config.status}"
+ac_write_fail=0
+ac_clean_files_save=$ac_clean_files
+ac_clean_files="$ac_clean_files $CONFIG_STATUS"
+{ $as_echo "$as_me:${as_lineno-$LINENO}: creating $CONFIG_STATUS" >&5
+$as_echo "$as_me: creating $CONFIG_STATUS" >&6;}
+as_write_fail=0
+cat >$CONFIG_STATUS <<_ASEOF || as_write_fail=1
+#! $SHELL
+# Generated by $as_me.
+# Run this file to recreate the current configuration.
+# Compiler output produced by configure, useful for debugging
+# configure, is in config.log if it exists.
+
+debug=false
+ac_cs_recheck=false
+ac_cs_silent=false
+
+SHELL=\${CONFIG_SHELL-$SHELL}
+export SHELL
+_ASEOF
+cat >>$CONFIG_STATUS <<\_ASEOF || as_write_fail=1
+## -------------------- ##
+## M4sh Initialization. ##
+## -------------------- ##
+
+# Be more Bourne compatible
+DUALCASE=1; export DUALCASE # for MKS sh
+if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then :
+  emulate sh
+  NULLCMD=:
+  # Pre-4.2 versions of Zsh do word splitting on ${1+"$@"}, which
+  # is contrary to our usage.  Disable this feature.
+  alias -g '${1+"$@"}'='"$@"'
+  setopt NO_GLOB_SUBST
+else
+  case `(set -o) 2>/dev/null` in #(
+  *posix*) :
+    set -o posix ;; #(
+  *) :
+     ;;
+esac
+fi
+
+
+as_nl='
+'
+export as_nl
+# Printing a long string crashes Solaris 7 /usr/bin/printf.
+as_echo='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo
+as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo$as_echo
+# Prefer a ksh shell builtin over an external printf program on Solaris,
+# but without wasting forks for bash or zsh.
+if test -z "$BASH_VERSION$ZSH_VERSION" \
+    && (test "X`print -r -- $as_echo`" = "X$as_echo") 2>/dev/null; then
+  as_echo='print -r --'
+  as_echo_n='print -rn --'
+elif (test "X`printf %s $as_echo`" = "X$as_echo") 2>/dev/null; then
+  as_echo='printf %s\n'
+  as_echo_n='printf %s'
+else
+  if test "X`(/usr/ucb/echo -n -n $as_echo) 2>/dev/null`" = "X-n $as_echo"; then
+    as_echo_body='eval /usr/ucb/echo -n "$1$as_nl"'
+    as_echo_n='/usr/ucb/echo -n'
+  else
+    as_echo_body='eval expr "X$1" : "X\\(.*\\)"'
+    as_echo_n_body='eval
+      arg=$1;
+      case $arg in #(
+      *"$as_nl"*)
+	expr "X$arg" : "X\\(.*\\)$as_nl";
+	arg=`expr "X$arg" : ".*$as_nl\\(.*\\)"`;;
+      esac;
+      expr "X$arg" : "X\\(.*\\)" | tr -d "$as_nl"
+    '
+    export as_echo_n_body
+    as_echo_n='sh -c $as_echo_n_body as_echo'
+  fi
+  export as_echo_body
+  as_echo='sh -c $as_echo_body as_echo'
+fi
+
+# The user is always right.
+if test "${PATH_SEPARATOR+set}" != set; then
+  PATH_SEPARATOR=:
+  (PATH='/bin;/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 && {
+    (PATH='/bin:/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 ||
+      PATH_SEPARATOR=';'
+  }
+fi
+
+
+# IFS
+# We need space, tab and new line, in precisely that order.  Quoting is
+# there to prevent editors from complaining about space-tab.
+# (If _AS_PATH_WALK were called with IFS unset, it would disable word
+# splitting by setting IFS to empty value.)
+IFS=" ""	$as_nl"
+
+# Find who we are.  Look in the path if we contain no directory separator.
+as_myself=
+case $0 in #((
+  *[\\/]* ) as_myself=$0 ;;
+  *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break
+  done
+IFS=$as_save_IFS
+
+     ;;
+esac
+# We did not find ourselves, most probably we were run as `sh COMMAND'
+# in which case we are not to be found in the path.
+if test "x$as_myself" = x; then
+  as_myself=$0
+fi
+if test ! -f "$as_myself"; then
+  $as_echo "$as_myself: error: cannot find myself; rerun with an absolute file name" >&2
+  exit 1
+fi
+
+# Unset variables that we do not need and which cause bugs (e.g. in
+# pre-3.0 UWIN ksh).  But do not cause bugs in bash 2.01; the "|| exit 1"
+# suppresses any "Segmentation fault" message there.  '((' could
+# trigger a bug in pdksh 5.2.14.
+for as_var in BASH_ENV ENV MAIL MAILPATH
+do eval test x\${$as_var+set} = xset \
+  && ( (unset $as_var) || exit 1) >/dev/null 2>&1 && unset $as_var || :
+done
+PS1='$ '
+PS2='> '
+PS4='+ '
+
+# NLS nuisances.
+LC_ALL=C
+export LC_ALL
+LANGUAGE=C
+export LANGUAGE
+
+# CDPATH.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+
+# as_fn_error STATUS ERROR [LINENO LOG_FD]
+# ----------------------------------------
+# Output "`basename $0`: error: ERROR" to stderr. If LINENO and LOG_FD are
+# provided, also output the error to LOG_FD, referencing LINENO. Then exit the
+# script with STATUS, using 1 if that was 0.
+as_fn_error ()
+{
+  as_status=$1; test $as_status -eq 0 && as_status=1
+  if test "$4"; then
+    as_lineno=${as_lineno-"$3"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+    $as_echo "$as_me:${as_lineno-$LINENO}: error: $2" >&$4
+  fi
+  $as_echo "$as_me: error: $2" >&2
+  as_fn_exit $as_status
+} # as_fn_error
+
+
+# as_fn_set_status STATUS
+# -----------------------
+# Set $? to STATUS, without forking.
+as_fn_set_status ()
+{
+  return $1
+} # as_fn_set_status
+
+# as_fn_exit STATUS
+# -----------------
+# Exit the shell with STATUS, even in a "trap 0" or "set -e" context.
+as_fn_exit ()
+{
+  set +e
+  as_fn_set_status $1
+  exit $1
+} # as_fn_exit
+
+# as_fn_unset VAR
+# ---------------
+# Portably unset VAR.
+as_fn_unset ()
+{
+  { eval $1=; unset $1;}
+}
+as_unset=as_fn_unset
+# as_fn_append VAR VALUE
+# ----------------------
+# Append the text in VALUE to the end of the definition contained in VAR. Take
+# advantage of any shell optimizations that allow amortized linear growth over
+# repeated appends, instead of the typical quadratic growth present in naive
+# implementations.
+if (eval "as_var=1; as_var+=2; test x\$as_var = x12") 2>/dev/null; then :
+  eval 'as_fn_append ()
+  {
+    eval $1+=\$2
+  }'
+else
+  as_fn_append ()
+  {
+    eval $1=\$$1\$2
+  }
+fi # as_fn_append
+
+# as_fn_arith ARG...
+# ------------------
+# Perform arithmetic evaluation on the ARGs, and store the result in the
+# global $as_val. Take advantage of shells that can avoid forks. The arguments
+# must be portable across $(()) and expr.
+if (eval "test \$(( 1 + 1 )) = 2") 2>/dev/null; then :
+  eval 'as_fn_arith ()
+  {
+    as_val=$(( $* ))
+  }'
+else
+  as_fn_arith ()
+  {
+    as_val=`expr "$@" || test $? -eq 1`
+  }
+fi # as_fn_arith
+
+
+if expr a : '\(a\)' >/dev/null 2>&1 &&
+   test "X`expr 00001 : '.*\(...\)'`" = X001; then
+  as_expr=expr
+else
+  as_expr=false
+fi
+
+if (basename -- /) >/dev/null 2>&1 && test "X`basename -- / 2>&1`" = "X/"; then
+  as_basename=basename
+else
+  as_basename=false
+fi
+
+if (as_dir=`dirname -- /` && test "X$as_dir" = X/) >/dev/null 2>&1; then
+  as_dirname=dirname
+else
+  as_dirname=false
+fi
+
+as_me=`$as_basename -- "$0" ||
+$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \
+	 X"$0" : 'X\(//\)$' \| \
+	 X"$0" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X/"$0" |
+    sed '/^.*\/\([^/][^/]*\)\/*$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\/\(\/\/\)$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\/\(\/\).*/{
+	    s//\1/
+	    q
+	  }
+	  s/.*/./; q'`
+
+# Avoid depending upon Character Ranges.
+as_cr_letters='abcdefghijklmnopqrstuvwxyz'
+as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ'
+as_cr_Letters=$as_cr_letters$as_cr_LETTERS
+as_cr_digits='0123456789'
+as_cr_alnum=$as_cr_Letters$as_cr_digits
+
+ECHO_C= ECHO_N= ECHO_T=
+case `echo -n x` in #(((((
+-n*)
+  case `echo 'xy\c'` in
+  *c*) ECHO_T='	';;	# ECHO_T is single tab character.
+  xy)  ECHO_C='\c';;
+  *)   echo `echo ksh88 bug on AIX 6.1` > /dev/null
+       ECHO_T='	';;
+  esac;;
+*)
+  ECHO_N='-n';;
+esac
+
+rm -f conf$$ conf$$.exe conf$$.file
+if test -d conf$$.dir; then
+  rm -f conf$$.dir/conf$$.file
+else
+  rm -f conf$$.dir
+  mkdir conf$$.dir 2>/dev/null
+fi
+if (echo >conf$$.file) 2>/dev/null; then
+  if ln -s conf$$.file conf$$ 2>/dev/null; then
+    as_ln_s='ln -s'
+    # ... but there are two gotchas:
+    # 1) On MSYS, both `ln -s file dir' and `ln file dir' fail.
+    # 2) DJGPP < 2.04 has no symlinks; `ln -s' creates a wrapper executable.
+    # In both cases, we have to default to `cp -pR'.
+    ln -s conf$$.file conf$$.dir 2>/dev/null && test ! -f conf$$.exe ||
+      as_ln_s='cp -pR'
+  elif ln conf$$.file conf$$ 2>/dev/null; then
+    as_ln_s=ln
+  else
+    as_ln_s='cp -pR'
+  fi
+else
+  as_ln_s='cp -pR'
+fi
+rm -f conf$$ conf$$.exe conf$$.dir/conf$$.file conf$$.file
+rmdir conf$$.dir 2>/dev/null
+
+
+# as_fn_mkdir_p
+# -------------
+# Create "$as_dir" as a directory, including parents if necessary.
+as_fn_mkdir_p ()
+{
+
+  case $as_dir in #(
+  -*) as_dir=./$as_dir;;
+  esac
+  test -d "$as_dir" || eval $as_mkdir_p || {
+    as_dirs=
+    while :; do
+      case $as_dir in #(
+      *\'*) as_qdir=`$as_echo "$as_dir" | sed "s/'/'\\\\\\\\''/g"`;; #'(
+      *) as_qdir=$as_dir;;
+      esac
+      as_dirs="'$as_qdir' $as_dirs"
+      as_dir=`$as_dirname -- "$as_dir" ||
+$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+	 X"$as_dir" : 'X\(//\)[^/]' \| \
+	 X"$as_dir" : 'X\(//\)$' \| \
+	 X"$as_dir" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$as_dir" |
+    sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\/\)[^/].*/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\/\)$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\).*/{
+	    s//\1/
+	    q
+	  }
+	  s/.*/./; q'`
+      test -d "$as_dir" && break
+    done
+    test -z "$as_dirs" || eval "mkdir $as_dirs"
+  } || test -d "$as_dir" || as_fn_error $? "cannot create directory $as_dir"
+
+
+} # as_fn_mkdir_p
+if mkdir -p . 2>/dev/null; then
+  as_mkdir_p='mkdir -p "$as_dir"'
+else
+  test -d ./-p && rmdir ./-p
+  as_mkdir_p=false
+fi
+
+
+# as_fn_executable_p FILE
+# -----------------------
+# Test if FILE is an executable regular file.
+as_fn_executable_p ()
+{
+  test -f "$1" && test -x "$1"
+} # as_fn_executable_p
+as_test_x='test -x'
+as_executable_p=as_fn_executable_p
+
+# Sed expression to map a string onto a valid CPP name.
+as_tr_cpp="eval sed 'y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g'"
+
+# Sed expression to map a string onto a valid variable name.
+as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'"
+
+
+exec 6>&1
+## ----------------------------------- ##
+## Main body of $CONFIG_STATUS script. ##
+## ----------------------------------- ##
+_ASEOF
+test $as_write_fail = 0 && chmod +x $CONFIG_STATUS || ac_write_fail=1
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+# Save the log message, to keep $0 and so on meaningful, and to
+# report actual input values of CONFIG_FILES etc. instead of their
+# values after options handling.
+ac_log="
+This file was extended by jansson $as_me 2.7, which was
+generated by GNU Autoconf 2.69.  Invocation command line was
+
+  CONFIG_FILES    = $CONFIG_FILES
+  CONFIG_HEADERS  = $CONFIG_HEADERS
+  CONFIG_LINKS    = $CONFIG_LINKS
+  CONFIG_COMMANDS = $CONFIG_COMMANDS
+  $ $0 $@
+
+on `(hostname || uname -n) 2>/dev/null | sed 1q`
+"
+
+_ACEOF
+
+case $ac_config_files in *"
+"*) set x $ac_config_files; shift; ac_config_files=$*;;
+esac
+
+case $ac_config_headers in *"
+"*) set x $ac_config_headers; shift; ac_config_headers=$*;;
+esac
+
+
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+# Files that config.status was made for.
+config_files="$ac_config_files"
+config_headers="$ac_config_headers"
+config_commands="$ac_config_commands"
+
+_ACEOF
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+ac_cs_usage="\
+\`$as_me' instantiates files and other configuration actions
+from templates according to the current configuration.  Unless the files
+and actions are specified as TAGs, all are instantiated by default.
+
+Usage: $0 [OPTION]... [TAG]...
+
+  -h, --help       print this help, then exit
+  -V, --version    print version number and configuration settings, then exit
+      --config     print configuration, then exit
+  -q, --quiet, --silent
+                   do not print progress messages
+  -d, --debug      don't remove temporary files
+      --recheck    update $as_me by reconfiguring in the same conditions
+      --file=FILE[:TEMPLATE]
+                   instantiate the configuration file FILE
+      --header=FILE[:TEMPLATE]
+                   instantiate the configuration header FILE
+
+Configuration files:
+$config_files
+
+Configuration headers:
+$config_headers
+
+Configuration commands:
+$config_commands
+
+Report bugs to <petri at digip.org>."
+
+_ACEOF
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+ac_cs_config="`$as_echo "$ac_configure_args" | sed 's/^ //; s/[\\""\`\$]/\\\\&/g'`"
+ac_cs_version="\\
+jansson config.status 2.7
+configured by $0, generated by GNU Autoconf 2.69,
+  with options \\"\$ac_cs_config\\"
+
+Copyright (C) 2012 Free Software Foundation, Inc.
+This config.status script is free software; the Free Software Foundation
+gives unlimited permission to copy, distribute and modify it."
+
+ac_pwd='$ac_pwd'
+srcdir='$srcdir'
+INSTALL='$INSTALL'
+MKDIR_P='$MKDIR_P'
+AWK='$AWK'
+test -n "\$AWK" || AWK=awk
+_ACEOF
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+# The default lists apply if the user does not specify any file.
+ac_need_defaults=:
+while test $# != 0
+do
+  case $1 in
+  --*=?*)
+    ac_option=`expr "X$1" : 'X\([^=]*\)='`
+    ac_optarg=`expr "X$1" : 'X[^=]*=\(.*\)'`
+    ac_shift=:
+    ;;
+  --*=)
+    ac_option=`expr "X$1" : 'X\([^=]*\)='`
+    ac_optarg=
+    ac_shift=:
+    ;;
+  *)
+    ac_option=$1
+    ac_optarg=$2
+    ac_shift=shift
+    ;;
+  esac
+
+  case $ac_option in
+  # Handling of the options.
+  -recheck | --recheck | --rechec | --reche | --rech | --rec | --re | --r)
+    ac_cs_recheck=: ;;
+  --version | --versio | --versi | --vers | --ver | --ve | --v | -V )
+    $as_echo "$ac_cs_version"; exit ;;
+  --config | --confi | --conf | --con | --co | --c )
+    $as_echo "$ac_cs_config"; exit ;;
+  --debug | --debu | --deb | --de | --d | -d )
+    debug=: ;;
+  --file | --fil | --fi | --f )
+    $ac_shift
+    case $ac_optarg in
+    *\'*) ac_optarg=`$as_echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"` ;;
+    '') as_fn_error $? "missing file argument" ;;
+    esac
+    as_fn_append CONFIG_FILES " '$ac_optarg'"
+    ac_need_defaults=false;;
+  --header | --heade | --head | --hea )
+    $ac_shift
+    case $ac_optarg in
+    *\'*) ac_optarg=`$as_echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"` ;;
+    esac
+    as_fn_append CONFIG_HEADERS " '$ac_optarg'"
+    ac_need_defaults=false;;
+  --he | --h)
+    # Conflict between --help and --header
+    as_fn_error $? "ambiguous option: \`$1'
+Try \`$0 --help' for more information.";;
+  --help | --hel | -h )
+    $as_echo "$ac_cs_usage"; exit ;;
+  -q | -quiet | --quiet | --quie | --qui | --qu | --q \
+  | -silent | --silent | --silen | --sile | --sil | --si | --s)
+    ac_cs_silent=: ;;
+
+  # This is an error.
+  -*) as_fn_error $? "unrecognized option: \`$1'
+Try \`$0 --help' for more information." ;;
+
+  *) as_fn_append ac_config_targets " $1"
+     ac_need_defaults=false ;;
+
+  esac
+  shift
+done
+
+ac_configure_extra_args=
+
+if $ac_cs_silent; then
+  exec 6>/dev/null
+  ac_configure_extra_args="$ac_configure_extra_args --silent"
+fi
+
+_ACEOF
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+if \$ac_cs_recheck; then
+  set X $SHELL '$0' $ac_configure_args \$ac_configure_extra_args --no-create --no-recursion
+  shift
+  \$as_echo "running CONFIG_SHELL=$SHELL \$*" >&6
+  CONFIG_SHELL='$SHELL'
+  export CONFIG_SHELL
+  exec "\$@"
+fi
+
+_ACEOF
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+exec 5>>config.log
+{
+  echo
+  sed 'h;s/./-/g;s/^.../## /;s/...$/ ##/;p;x;p;x' <<_ASBOX
+## Running $as_me. ##
+_ASBOX
+  $as_echo "$ac_log"
+} >&5
+
+_ACEOF
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+#
+# INIT-COMMANDS
+#
+AMDEP_TRUE="$AMDEP_TRUE" ac_aux_dir="$ac_aux_dir"
+
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+sed_quote_subst='$sed_quote_subst'
+double_quote_subst='$double_quote_subst'
+delay_variable_subst='$delay_variable_subst'
+macro_version='`$ECHO "$macro_version" | $SED "$delay_single_quote_subst"`'
+macro_revision='`$ECHO "$macro_revision" | $SED "$delay_single_quote_subst"`'
+enable_shared='`$ECHO "$enable_shared" | $SED "$delay_single_quote_subst"`'
+enable_static='`$ECHO "$enable_static" | $SED "$delay_single_quote_subst"`'
+pic_mode='`$ECHO "$pic_mode" | $SED "$delay_single_quote_subst"`'
+enable_fast_install='`$ECHO "$enable_fast_install" | $SED "$delay_single_quote_subst"`'
+SHELL='`$ECHO "$SHELL" | $SED "$delay_single_quote_subst"`'
+ECHO='`$ECHO "$ECHO" | $SED "$delay_single_quote_subst"`'
+PATH_SEPARATOR='`$ECHO "$PATH_SEPARATOR" | $SED "$delay_single_quote_subst"`'
+host_alias='`$ECHO "$host_alias" | $SED "$delay_single_quote_subst"`'
+host='`$ECHO "$host" | $SED "$delay_single_quote_subst"`'
+host_os='`$ECHO "$host_os" | $SED "$delay_single_quote_subst"`'
+build_alias='`$ECHO "$build_alias" | $SED "$delay_single_quote_subst"`'
+build='`$ECHO "$build" | $SED "$delay_single_quote_subst"`'
+build_os='`$ECHO "$build_os" | $SED "$delay_single_quote_subst"`'
+SED='`$ECHO "$SED" | $SED "$delay_single_quote_subst"`'
+Xsed='`$ECHO "$Xsed" | $SED "$delay_single_quote_subst"`'
+GREP='`$ECHO "$GREP" | $SED "$delay_single_quote_subst"`'
+EGREP='`$ECHO "$EGREP" | $SED "$delay_single_quote_subst"`'
+FGREP='`$ECHO "$FGREP" | $SED "$delay_single_quote_subst"`'
+LD='`$ECHO "$LD" | $SED "$delay_single_quote_subst"`'
+NM='`$ECHO "$NM" | $SED "$delay_single_quote_subst"`'
+LN_S='`$ECHO "$LN_S" | $SED "$delay_single_quote_subst"`'
+max_cmd_len='`$ECHO "$max_cmd_len" | $SED "$delay_single_quote_subst"`'
+ac_objext='`$ECHO "$ac_objext" | $SED "$delay_single_quote_subst"`'
+exeext='`$ECHO "$exeext" | $SED "$delay_single_quote_subst"`'
+lt_unset='`$ECHO "$lt_unset" | $SED "$delay_single_quote_subst"`'
+lt_SP2NL='`$ECHO "$lt_SP2NL" | $SED "$delay_single_quote_subst"`'
+lt_NL2SP='`$ECHO "$lt_NL2SP" | $SED "$delay_single_quote_subst"`'
+lt_cv_to_host_file_cmd='`$ECHO "$lt_cv_to_host_file_cmd" | $SED "$delay_single_quote_subst"`'
+lt_cv_to_tool_file_cmd='`$ECHO "$lt_cv_to_tool_file_cmd" | $SED "$delay_single_quote_subst"`'
+reload_flag='`$ECHO "$reload_flag" | $SED "$delay_single_quote_subst"`'
+reload_cmds='`$ECHO "$reload_cmds" | $SED "$delay_single_quote_subst"`'
+OBJDUMP='`$ECHO "$OBJDUMP" | $SED "$delay_single_quote_subst"`'
+deplibs_check_method='`$ECHO "$deplibs_check_method" | $SED "$delay_single_quote_subst"`'
+file_magic_cmd='`$ECHO "$file_magic_cmd" | $SED "$delay_single_quote_subst"`'
+file_magic_glob='`$ECHO "$file_magic_glob" | $SED "$delay_single_quote_subst"`'
+want_nocaseglob='`$ECHO "$want_nocaseglob" | $SED "$delay_single_quote_subst"`'
+DLLTOOL='`$ECHO "$DLLTOOL" | $SED "$delay_single_quote_subst"`'
+sharedlib_from_linklib_cmd='`$ECHO "$sharedlib_from_linklib_cmd" | $SED "$delay_single_quote_subst"`'
+AR='`$ECHO "$AR" | $SED "$delay_single_quote_subst"`'
+AR_FLAGS='`$ECHO "$AR_FLAGS" | $SED "$delay_single_quote_subst"`'
+archiver_list_spec='`$ECHO "$archiver_list_spec" | $SED "$delay_single_quote_subst"`'
+STRIP='`$ECHO "$STRIP" | $SED "$delay_single_quote_subst"`'
+RANLIB='`$ECHO "$RANLIB" | $SED "$delay_single_quote_subst"`'
+old_postinstall_cmds='`$ECHO "$old_postinstall_cmds" | $SED "$delay_single_quote_subst"`'
+old_postuninstall_cmds='`$ECHO "$old_postuninstall_cmds" | $SED "$delay_single_quote_subst"`'
+old_archive_cmds='`$ECHO "$old_archive_cmds" | $SED "$delay_single_quote_subst"`'
+lock_old_archive_extraction='`$ECHO "$lock_old_archive_extraction" | $SED "$delay_single_quote_subst"`'
+CC='`$ECHO "$CC" | $SED "$delay_single_quote_subst"`'
+CFLAGS='`$ECHO "$CFLAGS" | $SED "$delay_single_quote_subst"`'
+compiler='`$ECHO "$compiler" | $SED "$delay_single_quote_subst"`'
+GCC='`$ECHO "$GCC" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_pipe='`$ECHO "$lt_cv_sys_global_symbol_pipe" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_to_cdecl='`$ECHO "$lt_cv_sys_global_symbol_to_cdecl" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_to_c_name_address='`$ECHO "$lt_cv_sys_global_symbol_to_c_name_address" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_to_c_name_address_lib_prefix='`$ECHO "$lt_cv_sys_global_symbol_to_c_name_address_lib_prefix" | $SED "$delay_single_quote_subst"`'
+nm_file_list_spec='`$ECHO "$nm_file_list_spec" | $SED "$delay_single_quote_subst"`'
+lt_sysroot='`$ECHO "$lt_sysroot" | $SED "$delay_single_quote_subst"`'
+objdir='`$ECHO "$objdir" | $SED "$delay_single_quote_subst"`'
+MAGIC_CMD='`$ECHO "$MAGIC_CMD" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_no_builtin_flag='`$ECHO "$lt_prog_compiler_no_builtin_flag" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_pic='`$ECHO "$lt_prog_compiler_pic" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_wl='`$ECHO "$lt_prog_compiler_wl" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_static='`$ECHO "$lt_prog_compiler_static" | $SED "$delay_single_quote_subst"`'
+lt_cv_prog_compiler_c_o='`$ECHO "$lt_cv_prog_compiler_c_o" | $SED "$delay_single_quote_subst"`'
+need_locks='`$ECHO "$need_locks" | $SED "$delay_single_quote_subst"`'
+MANIFEST_TOOL='`$ECHO "$MANIFEST_TOOL" | $SED "$delay_single_quote_subst"`'
+DSYMUTIL='`$ECHO "$DSYMUTIL" | $SED "$delay_single_quote_subst"`'
+NMEDIT='`$ECHO "$NMEDIT" | $SED "$delay_single_quote_subst"`'
+LIPO='`$ECHO "$LIPO" | $SED "$delay_single_quote_subst"`'
+OTOOL='`$ECHO "$OTOOL" | $SED "$delay_single_quote_subst"`'
+OTOOL64='`$ECHO "$OTOOL64" | $SED "$delay_single_quote_subst"`'
+libext='`$ECHO "$libext" | $SED "$delay_single_quote_subst"`'
+shrext_cmds='`$ECHO "$shrext_cmds" | $SED "$delay_single_quote_subst"`'
+extract_expsyms_cmds='`$ECHO "$extract_expsyms_cmds" | $SED "$delay_single_quote_subst"`'
+archive_cmds_need_lc='`$ECHO "$archive_cmds_need_lc" | $SED "$delay_single_quote_subst"`'
+enable_shared_with_static_runtimes='`$ECHO "$enable_shared_with_static_runtimes" | $SED "$delay_single_quote_subst"`'
+export_dynamic_flag_spec='`$ECHO "$export_dynamic_flag_spec" | $SED "$delay_single_quote_subst"`'
+whole_archive_flag_spec='`$ECHO "$whole_archive_flag_spec" | $SED "$delay_single_quote_subst"`'
+compiler_needs_object='`$ECHO "$compiler_needs_object" | $SED "$delay_single_quote_subst"`'
+old_archive_from_new_cmds='`$ECHO "$old_archive_from_new_cmds" | $SED "$delay_single_quote_subst"`'
+old_archive_from_expsyms_cmds='`$ECHO "$old_archive_from_expsyms_cmds" | $SED "$delay_single_quote_subst"`'
+archive_cmds='`$ECHO "$archive_cmds" | $SED "$delay_single_quote_subst"`'
+archive_expsym_cmds='`$ECHO "$archive_expsym_cmds" | $SED "$delay_single_quote_subst"`'
+module_cmds='`$ECHO "$module_cmds" | $SED "$delay_single_quote_subst"`'
+module_expsym_cmds='`$ECHO "$module_expsym_cmds" | $SED "$delay_single_quote_subst"`'
+with_gnu_ld='`$ECHO "$with_gnu_ld" | $SED "$delay_single_quote_subst"`'
+allow_undefined_flag='`$ECHO "$allow_undefined_flag" | $SED "$delay_single_quote_subst"`'
+no_undefined_flag='`$ECHO "$no_undefined_flag" | $SED "$delay_single_quote_subst"`'
+hardcode_libdir_flag_spec='`$ECHO "$hardcode_libdir_flag_spec" | $SED "$delay_single_quote_subst"`'
+hardcode_libdir_separator='`$ECHO "$hardcode_libdir_separator" | $SED "$delay_single_quote_subst"`'
+hardcode_direct='`$ECHO "$hardcode_direct" | $SED "$delay_single_quote_subst"`'
+hardcode_direct_absolute='`$ECHO "$hardcode_direct_absolute" | $SED "$delay_single_quote_subst"`'
+hardcode_minus_L='`$ECHO "$hardcode_minus_L" | $SED "$delay_single_quote_subst"`'
+hardcode_shlibpath_var='`$ECHO "$hardcode_shlibpath_var" | $SED "$delay_single_quote_subst"`'
+hardcode_automatic='`$ECHO "$hardcode_automatic" | $SED "$delay_single_quote_subst"`'
+inherit_rpath='`$ECHO "$inherit_rpath" | $SED "$delay_single_quote_subst"`'
+link_all_deplibs='`$ECHO "$link_all_deplibs" | $SED "$delay_single_quote_subst"`'
+always_export_symbols='`$ECHO "$always_export_symbols" | $SED "$delay_single_quote_subst"`'
+export_symbols_cmds='`$ECHO "$export_symbols_cmds" | $SED "$delay_single_quote_subst"`'
+exclude_expsyms='`$ECHO "$exclude_expsyms" | $SED "$delay_single_quote_subst"`'
+include_expsyms='`$ECHO "$include_expsyms" | $SED "$delay_single_quote_subst"`'
+prelink_cmds='`$ECHO "$prelink_cmds" | $SED "$delay_single_quote_subst"`'
+postlink_cmds='`$ECHO "$postlink_cmds" | $SED "$delay_single_quote_subst"`'
+file_list_spec='`$ECHO "$file_list_spec" | $SED "$delay_single_quote_subst"`'
+variables_saved_for_relink='`$ECHO "$variables_saved_for_relink" | $SED "$delay_single_quote_subst"`'
+need_lib_prefix='`$ECHO "$need_lib_prefix" | $SED "$delay_single_quote_subst"`'
+need_version='`$ECHO "$need_version" | $SED "$delay_single_quote_subst"`'
+version_type='`$ECHO "$version_type" | $SED "$delay_single_quote_subst"`'
+runpath_var='`$ECHO "$runpath_var" | $SED "$delay_single_quote_subst"`'
+shlibpath_var='`$ECHO "$shlibpath_var" | $SED "$delay_single_quote_subst"`'
+shlibpath_overrides_runpath='`$ECHO "$shlibpath_overrides_runpath" | $SED "$delay_single_quote_subst"`'
+libname_spec='`$ECHO "$libname_spec" | $SED "$delay_single_quote_subst"`'
+library_names_spec='`$ECHO "$library_names_spec" | $SED "$delay_single_quote_subst"`'
+soname_spec='`$ECHO "$soname_spec" | $SED "$delay_single_quote_subst"`'
+install_override_mode='`$ECHO "$install_override_mode" | $SED "$delay_single_quote_subst"`'
+postinstall_cmds='`$ECHO "$postinstall_cmds" | $SED "$delay_single_quote_subst"`'
+postuninstall_cmds='`$ECHO "$postuninstall_cmds" | $SED "$delay_single_quote_subst"`'
+finish_cmds='`$ECHO "$finish_cmds" | $SED "$delay_single_quote_subst"`'
+finish_eval='`$ECHO "$finish_eval" | $SED "$delay_single_quote_subst"`'
+hardcode_into_libs='`$ECHO "$hardcode_into_libs" | $SED "$delay_single_quote_subst"`'
+sys_lib_search_path_spec='`$ECHO "$sys_lib_search_path_spec" | $SED "$delay_single_quote_subst"`'
+sys_lib_dlsearch_path_spec='`$ECHO "$sys_lib_dlsearch_path_spec" | $SED "$delay_single_quote_subst"`'
+hardcode_action='`$ECHO "$hardcode_action" | $SED "$delay_single_quote_subst"`'
+enable_dlopen='`$ECHO "$enable_dlopen" | $SED "$delay_single_quote_subst"`'
+enable_dlopen_self='`$ECHO "$enable_dlopen_self" | $SED "$delay_single_quote_subst"`'
+enable_dlopen_self_static='`$ECHO "$enable_dlopen_self_static" | $SED "$delay_single_quote_subst"`'
+old_striplib='`$ECHO "$old_striplib" | $SED "$delay_single_quote_subst"`'
+striplib='`$ECHO "$striplib" | $SED "$delay_single_quote_subst"`'
+
+LTCC='$LTCC'
+LTCFLAGS='$LTCFLAGS'
+compiler='$compiler_DEFAULT'
+
+# A function that is used when there is no print builtin or printf.
+func_fallback_echo ()
+{
+  eval 'cat <<_LTECHO_EOF
+\$1
+_LTECHO_EOF'
+}
+
+# Quote evaled strings.
+for var in SHELL \
+ECHO \
+PATH_SEPARATOR \
+SED \
+GREP \
+EGREP \
+FGREP \
+LD \
+NM \
+LN_S \
+lt_SP2NL \
+lt_NL2SP \
+reload_flag \
+OBJDUMP \
+deplibs_check_method \
+file_magic_cmd \
+file_magic_glob \
+want_nocaseglob \
+DLLTOOL \
+sharedlib_from_linklib_cmd \
+AR \
+AR_FLAGS \
+archiver_list_spec \
+STRIP \
+RANLIB \
+CC \
+CFLAGS \
+compiler \
+lt_cv_sys_global_symbol_pipe \
+lt_cv_sys_global_symbol_to_cdecl \
+lt_cv_sys_global_symbol_to_c_name_address \
+lt_cv_sys_global_symbol_to_c_name_address_lib_prefix \
+nm_file_list_spec \
+lt_prog_compiler_no_builtin_flag \
+lt_prog_compiler_pic \
+lt_prog_compiler_wl \
+lt_prog_compiler_static \
+lt_cv_prog_compiler_c_o \
+need_locks \
+MANIFEST_TOOL \
+DSYMUTIL \
+NMEDIT \
+LIPO \
+OTOOL \
+OTOOL64 \
+shrext_cmds \
+export_dynamic_flag_spec \
+whole_archive_flag_spec \
+compiler_needs_object \
+with_gnu_ld \
+allow_undefined_flag \
+no_undefined_flag \
+hardcode_libdir_flag_spec \
+hardcode_libdir_separator \
+exclude_expsyms \
+include_expsyms \
+file_list_spec \
+variables_saved_for_relink \
+libname_spec \
+library_names_spec \
+soname_spec \
+install_override_mode \
+finish_eval \
+old_striplib \
+striplib; do
+    case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in
+    *[\\\\\\\`\\"\\\$]*)
+      eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED \\"\\\$sed_quote_subst\\"\\\`\\\\\\""
+      ;;
+    *)
+      eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\""
+      ;;
+    esac
+done
+
+# Double-quote double-evaled strings.
+for var in reload_cmds \
+old_postinstall_cmds \
+old_postuninstall_cmds \
+old_archive_cmds \
+extract_expsyms_cmds \
+old_archive_from_new_cmds \
+old_archive_from_expsyms_cmds \
+archive_cmds \
+archive_expsym_cmds \
+module_cmds \
+module_expsym_cmds \
+export_symbols_cmds \
+prelink_cmds \
+postlink_cmds \
+postinstall_cmds \
+postuninstall_cmds \
+finish_cmds \
+sys_lib_search_path_spec \
+sys_lib_dlsearch_path_spec; do
+    case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in
+    *[\\\\\\\`\\"\\\$]*)
+      eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED -e \\"\\\$double_quote_subst\\" -e \\"\\\$sed_quote_subst\\" -e \\"\\\$delay_variable_subst\\"\\\`\\\\\\""
+      ;;
+    *)
+      eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\""
+      ;;
+    esac
+done
+
+ac_aux_dir='$ac_aux_dir'
+xsi_shell='$xsi_shell'
+lt_shell_append='$lt_shell_append'
+
+# See if we are running on zsh, and set the options which allow our
+# commands through without removal of \ escapes INIT.
+if test -n "\${ZSH_VERSION+set}" ; then
+   setopt NO_GLOB_SUBST
+fi
+
+
+    PACKAGE='$PACKAGE'
+    VERSION='$VERSION'
+    TIMESTAMP='$TIMESTAMP'
+    RM='$RM'
+    ofile='$ofile'
+
+
+
+
+_ACEOF
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+
+# Handling of arguments.
+for ac_config_target in $ac_config_targets
+do
+  case $ac_config_target in
+    "jansson_private_config.h") CONFIG_HEADERS="$CONFIG_HEADERS jansson_private_config.h" ;;
+    "depfiles") CONFIG_COMMANDS="$CONFIG_COMMANDS depfiles" ;;
+    "libtool") CONFIG_COMMANDS="$CONFIG_COMMANDS libtool" ;;
+    "jansson.pc") CONFIG_FILES="$CONFIG_FILES jansson.pc" ;;
+    "Makefile") CONFIG_FILES="$CONFIG_FILES Makefile" ;;
+    "doc/Makefile") CONFIG_FILES="$CONFIG_FILES doc/Makefile" ;;
+    "src/Makefile") CONFIG_FILES="$CONFIG_FILES src/Makefile" ;;
+    "src/jansson_config.h") CONFIG_FILES="$CONFIG_FILES src/jansson_config.h" ;;
+    "test/Makefile") CONFIG_FILES="$CONFIG_FILES test/Makefile" ;;
+    "test/bin/Makefile") CONFIG_FILES="$CONFIG_FILES test/bin/Makefile" ;;
+    "test/suites/Makefile") CONFIG_FILES="$CONFIG_FILES test/suites/Makefile" ;;
+    "test/suites/api/Makefile") CONFIG_FILES="$CONFIG_FILES test/suites/api/Makefile" ;;
+
+  *) as_fn_error $? "invalid argument: \`$ac_config_target'" "$LINENO" 5;;
+  esac
+done
+
+
+# If the user did not use the arguments to specify the items to instantiate,
+# then the envvar interface is used.  Set only those that are not.
+# We use the long form for the default assignment because of an extremely
+# bizarre bug on SunOS 4.1.3.
+if $ac_need_defaults; then
+  test "${CONFIG_FILES+set}" = set || CONFIG_FILES=$config_files
+  test "${CONFIG_HEADERS+set}" = set || CONFIG_HEADERS=$config_headers
+  test "${CONFIG_COMMANDS+set}" = set || CONFIG_COMMANDS=$config_commands
+fi
+
+# Have a temporary directory for convenience.  Make it in the build tree
+# simply because there is no reason against having it here, and in addition,
+# creating and moving files from /tmp can sometimes cause problems.
+# Hook for its removal unless debugging.
+# Note that there is a small window in which the directory will not be cleaned:
+# after its creation but before its name has been assigned to `$tmp'.
+$debug ||
+{
+  tmp= ac_tmp=
+  trap 'exit_status=$?
+  : "${ac_tmp:=$tmp}"
+  { test ! -d "$ac_tmp" || rm -fr "$ac_tmp"; } && exit $exit_status
+' 0
+  trap 'as_fn_exit 1' 1 2 13 15
+}
+# Create a (secure) tmp directory for tmp files.
+
+{
+  tmp=`(umask 077 && mktemp -d "./confXXXXXX") 2>/dev/null` &&
+  test -d "$tmp"
+}  ||
+{
+  tmp=./conf$$-$RANDOM
+  (umask 077 && mkdir "$tmp")
+} || as_fn_error $? "cannot create a temporary directory in ." "$LINENO" 5
+ac_tmp=$tmp
+
+# Set up the scripts for CONFIG_FILES section.
+# No need to generate them if there are no CONFIG_FILES.
+# This happens for instance with `./config.status config.h'.
+if test -n "$CONFIG_FILES"; then
+
+
+ac_cr=`echo X | tr X '\015'`
+# On cygwin, bash can eat \r inside `` if the user requested igncr.
+# But we know of no other shell where ac_cr would be empty at this
+# point, so we can use a bashism as a fallback.
+if test "x$ac_cr" = x; then
+  eval ac_cr=\$\'\\r\'
+fi
+ac_cs_awk_cr=`$AWK 'BEGIN { print "a\rb" }' </dev/null 2>/dev/null`
+if test "$ac_cs_awk_cr" = "a${ac_cr}b"; then
+  ac_cs_awk_cr='\\r'
+else
+  ac_cs_awk_cr=$ac_cr
+fi
+
+echo 'BEGIN {' >"$ac_tmp/subs1.awk" &&
+_ACEOF
+
+
+{
+  echo "cat >conf$$subs.awk <<_ACEOF" &&
+  echo "$ac_subst_vars" | sed 's/.*/&!$&$ac_delim/' &&
+  echo "_ACEOF"
+} >conf$$subs.sh ||
+  as_fn_error $? "could not make $CONFIG_STATUS" "$LINENO" 5
+ac_delim_num=`echo "$ac_subst_vars" | grep -c '^'`
+ac_delim='%!_!# '
+for ac_last_try in false false false false false :; do
+  . ./conf$$subs.sh ||
+    as_fn_error $? "could not make $CONFIG_STATUS" "$LINENO" 5
+
+  ac_delim_n=`sed -n "s/.*$ac_delim\$/X/p" conf$$subs.awk | grep -c X`
+  if test $ac_delim_n = $ac_delim_num; then
+    break
+  elif $ac_last_try; then
+    as_fn_error $? "could not make $CONFIG_STATUS" "$LINENO" 5
+  else
+    ac_delim="$ac_delim!$ac_delim _$ac_delim!! "
+  fi
+done
+rm -f conf$$subs.sh
+
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+cat >>"\$ac_tmp/subs1.awk" <<\\_ACAWK &&
+_ACEOF
+sed -n '
+h
+s/^/S["/; s/!.*/"]=/
+p
+g
+s/^[^!]*!//
+:repl
+t repl
+s/'"$ac_delim"'$//
+t delim
+:nl
+h
+s/\(.\{148\}\)..*/\1/
+t more1
+s/["\\]/\\&/g; s/^/"/; s/$/\\n"\\/
+p
+n
+b repl
+:more1
+s/["\\]/\\&/g; s/^/"/; s/$/"\\/
+p
+g
+s/.\{148\}//
+t nl
+:delim
+h
+s/\(.\{148\}\)..*/\1/
+t more2
+s/["\\]/\\&/g; s/^/"/; s/$/"/
+p
+b
+:more2
+s/["\\]/\\&/g; s/^/"/; s/$/"\\/
+p
+g
+s/.\{148\}//
+t delim
+' <conf$$subs.awk | sed '
+/^[^""]/{
+  N
+  s/\n//
+}
+' >>$CONFIG_STATUS || ac_write_fail=1
+rm -f conf$$subs.awk
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+_ACAWK
+cat >>"\$ac_tmp/subs1.awk" <<_ACAWK &&
+  for (key in S) S_is_set[key] = 1
+  FS = ""
+
+}
+{
+  line = $ 0
+  nfields = split(line, field, "@")
+  substed = 0
+  len = length(field[1])
+  for (i = 2; i < nfields; i++) {
+    key = field[i]
+    keylen = length(key)
+    if (S_is_set[key]) {
+      value = S[key]
+      line = substr(line, 1, len) "" value "" substr(line, len + keylen + 3)
+      len += length(value) + length(field[++i])
+      substed = 1
+    } else
+      len += 1 + keylen
+  }
+
+  print line
+}
+
+_ACAWK
+_ACEOF
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+if sed "s/$ac_cr//" < /dev/null > /dev/null 2>&1; then
+  sed "s/$ac_cr\$//; s/$ac_cr/$ac_cs_awk_cr/g"
+else
+  cat
+fi < "$ac_tmp/subs1.awk" > "$ac_tmp/subs.awk" \
+  || as_fn_error $? "could not setup config files machinery" "$LINENO" 5
+_ACEOF
+
+# VPATH may cause trouble with some makes, so we remove sole $(srcdir),
+# ${srcdir} and @srcdir@ entries from VPATH if srcdir is ".", strip leading and
+# trailing colons and then remove the whole line if VPATH becomes empty
+# (actually we leave an empty line to preserve line numbers).
+if test "x$srcdir" = x.; then
+  ac_vpsub='/^[	 ]*VPATH[	 ]*=[	 ]*/{
+h
+s///
+s/^/:/
+s/[	 ]*$/:/
+s/:\$(srcdir):/:/g
+s/:\${srcdir}:/:/g
+s/:@srcdir@:/:/g
+s/^:*//
+s/:*$//
+x
+s/\(=[	 ]*\).*/\1/
+G
+s/\n//
+s/^[^=]*=[	 ]*$//
+}'
+fi
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+fi # test -n "$CONFIG_FILES"
+
+# Set up the scripts for CONFIG_HEADERS section.
+# No need to generate them if there are no CONFIG_HEADERS.
+# This happens for instance with `./config.status Makefile'.
+if test -n "$CONFIG_HEADERS"; then
+cat >"$ac_tmp/defines.awk" <<\_ACAWK ||
+BEGIN {
+_ACEOF
+
+# Transform confdefs.h into an awk script `defines.awk', embedded as
+# here-document in config.status, that substitutes the proper values into
+# config.h.in to produce config.h.
+
+# Create a delimiter string that does not exist in confdefs.h, to ease
+# handling of long lines.
+ac_delim='%!_!# '
+for ac_last_try in false false :; do
+  ac_tt=`sed -n "/$ac_delim/p" confdefs.h`
+  if test -z "$ac_tt"; then
+    break
+  elif $ac_last_try; then
+    as_fn_error $? "could not make $CONFIG_HEADERS" "$LINENO" 5
+  else
+    ac_delim="$ac_delim!$ac_delim _$ac_delim!! "
+  fi
+done
+
+# For the awk script, D is an array of macro values keyed by name,
+# likewise P contains macro parameters if any.  Preserve backslash
+# newline sequences.
+
+ac_word_re=[_$as_cr_Letters][_$as_cr_alnum]*
+sed -n '
+s/.\{148\}/&'"$ac_delim"'/g
+t rset
+:rset
+s/^[	 ]*#[	 ]*define[	 ][	 ]*/ /
+t def
+d
+:def
+s/\\$//
+t bsnl
+s/["\\]/\\&/g
+s/^ \('"$ac_word_re"'\)\(([^()]*)\)[	 ]*\(.*\)/P["\1"]="\2"\
+D["\1"]=" \3"/p
+s/^ \('"$ac_word_re"'\)[	 ]*\(.*\)/D["\1"]=" \2"/p
+d
+:bsnl
+s/["\\]/\\&/g
+s/^ \('"$ac_word_re"'\)\(([^()]*)\)[	 ]*\(.*\)/P["\1"]="\2"\
+D["\1"]=" \3\\\\\\n"\\/p
+t cont
+s/^ \('"$ac_word_re"'\)[	 ]*\(.*\)/D["\1"]=" \2\\\\\\n"\\/p
+t cont
+d
+:cont
+n
+s/.\{148\}/&'"$ac_delim"'/g
+t clear
+:clear
+s/\\$//
+t bsnlc
+s/["\\]/\\&/g; s/^/"/; s/$/"/p
+d
+:bsnlc
+s/["\\]/\\&/g; s/^/"/; s/$/\\\\\\n"\\/p
+b cont
+' <confdefs.h | sed '
+s/'"$ac_delim"'/"\\\
+"/g' >>$CONFIG_STATUS || ac_write_fail=1
+
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+  for (key in D) D_is_set[key] = 1
+  FS = ""
+}
+/^[\t ]*#[\t ]*(define|undef)[\t ]+$ac_word_re([\t (]|\$)/ {
+  line = \$ 0
+  split(line, arg, " ")
+  if (arg[1] == "#") {
+    defundef = arg[2]
+    mac1 = arg[3]
+  } else {
+    defundef = substr(arg[1], 2)
+    mac1 = arg[2]
+  }
+  split(mac1, mac2, "(") #)
+  macro = mac2[1]
+  prefix = substr(line, 1, index(line, defundef) - 1)
+  if (D_is_set[macro]) {
+    # Preserve the white space surrounding the "#".
+    print prefix "define", macro P[macro] D[macro]
+    next
+  } else {
+    # Replace #undef with comments.  This is necessary, for example,
+    # in the case of _POSIX_SOURCE, which is predefined and required
+    # on some systems where configure will not decide to define it.
+    if (defundef == "undef") {
+      print "/*", prefix defundef, macro, "*/"
+      next
+    }
+  }
+}
+{ print }
+_ACAWK
+_ACEOF
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+  as_fn_error $? "could not setup config headers machinery" "$LINENO" 5
+fi # test -n "$CONFIG_HEADERS"
+
+
+eval set X "  :F $CONFIG_FILES  :H $CONFIG_HEADERS    :C $CONFIG_COMMANDS"
+shift
+for ac_tag
+do
+  case $ac_tag in
+  :[FHLC]) ac_mode=$ac_tag; continue;;
+  esac
+  case $ac_mode$ac_tag in
+  :[FHL]*:*);;
+  :L* | :C*:*) as_fn_error $? "invalid tag \`$ac_tag'" "$LINENO" 5;;
+  :[FH]-) ac_tag=-:-;;
+  :[FH]*) ac_tag=$ac_tag:$ac_tag.in;;
+  esac
+  ac_save_IFS=$IFS
+  IFS=:
+  set x $ac_tag
+  IFS=$ac_save_IFS
+  shift
+  ac_file=$1
+  shift
+
+  case $ac_mode in
+  :L) ac_source=$1;;
+  :[FH])
+    ac_file_inputs=
+    for ac_f
+    do
+      case $ac_f in
+      -) ac_f="$ac_tmp/stdin";;
+      *) # Look for the file first in the build tree, then in the source tree
+	 # (if the path is not absolute).  The absolute path cannot be DOS-style,
+	 # because $ac_f cannot contain `:'.
+	 test -f "$ac_f" ||
+	   case $ac_f in
+	   [\\/$]*) false;;
+	   *) test -f "$srcdir/$ac_f" && ac_f="$srcdir/$ac_f";;
+	   esac ||
+	   as_fn_error 1 "cannot find input file: \`$ac_f'" "$LINENO" 5;;
+      esac
+      case $ac_f in *\'*) ac_f=`$as_echo "$ac_f" | sed "s/'/'\\\\\\\\''/g"`;; esac
+      as_fn_append ac_file_inputs " '$ac_f'"
+    done
+
+    # Let's still pretend it is `configure' which instantiates (i.e., don't
+    # use $as_me), people would be surprised to read:
+    #    /* config.h.  Generated by config.status.  */
+    configure_input='Generated from '`
+	  $as_echo "$*" | sed 's|^[^:]*/||;s|:[^:]*/|, |g'
+	`' by configure.'
+    if test x"$ac_file" != x-; then
+      configure_input="$ac_file.  $configure_input"
+      { $as_echo "$as_me:${as_lineno-$LINENO}: creating $ac_file" >&5
+$as_echo "$as_me: creating $ac_file" >&6;}
+    fi
+    # Neutralize special characters interpreted by sed in replacement strings.
+    case $configure_input in #(
+    *\&* | *\|* | *\\* )
+       ac_sed_conf_input=`$as_echo "$configure_input" |
+       sed 's/[\\\\&|]/\\\\&/g'`;; #(
+    *) ac_sed_conf_input=$configure_input;;
+    esac
+
+    case $ac_tag in
+    *:-:* | *:-) cat >"$ac_tmp/stdin" \
+      || as_fn_error $? "could not create $ac_file" "$LINENO" 5 ;;
+    esac
+    ;;
+  esac
+
+  ac_dir=`$as_dirname -- "$ac_file" ||
+$as_expr X"$ac_file" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+	 X"$ac_file" : 'X\(//\)[^/]' \| \
+	 X"$ac_file" : 'X\(//\)$' \| \
+	 X"$ac_file" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$ac_file" |
+    sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\/\)[^/].*/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\/\)$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\).*/{
+	    s//\1/
+	    q
+	  }
+	  s/.*/./; q'`
+  as_dir="$ac_dir"; as_fn_mkdir_p
+  ac_builddir=.
+
+case "$ac_dir" in
+.) ac_dir_suffix= ac_top_builddir_sub=. ac_top_build_prefix= ;;
+*)
+  ac_dir_suffix=/`$as_echo "$ac_dir" | sed 's|^\.[\\/]||'`
+  # A ".." for each directory in $ac_dir_suffix.
+  ac_top_builddir_sub=`$as_echo "$ac_dir_suffix" | sed 's|/[^\\/]*|/..|g;s|/||'`
+  case $ac_top_builddir_sub in
+  "") ac_top_builddir_sub=. ac_top_build_prefix= ;;
+  *)  ac_top_build_prefix=$ac_top_builddir_sub/ ;;
+  esac ;;
+esac
+ac_abs_top_builddir=$ac_pwd
+ac_abs_builddir=$ac_pwd$ac_dir_suffix
+# for backward compatibility:
+ac_top_builddir=$ac_top_build_prefix
+
+case $srcdir in
+  .)  # We are building in place.
+    ac_srcdir=.
+    ac_top_srcdir=$ac_top_builddir_sub
+    ac_abs_top_srcdir=$ac_pwd ;;
+  [\\/]* | ?:[\\/]* )  # Absolute name.
+    ac_srcdir=$srcdir$ac_dir_suffix;
+    ac_top_srcdir=$srcdir
+    ac_abs_top_srcdir=$srcdir ;;
+  *) # Relative name.
+    ac_srcdir=$ac_top_build_prefix$srcdir$ac_dir_suffix
+    ac_top_srcdir=$ac_top_build_prefix$srcdir
+    ac_abs_top_srcdir=$ac_pwd/$srcdir ;;
+esac
+ac_abs_srcdir=$ac_abs_top_srcdir$ac_dir_suffix
+
+
+  case $ac_mode in
+  :F)
+  #
+  # CONFIG_FILE
+  #
+
+  case $INSTALL in
+  [\\/$]* | ?:[\\/]* ) ac_INSTALL=$INSTALL ;;
+  *) ac_INSTALL=$ac_top_build_prefix$INSTALL ;;
+  esac
+  ac_MKDIR_P=$MKDIR_P
+  case $MKDIR_P in
+  [\\/$]* | ?:[\\/]* ) ;;
+  */*) ac_MKDIR_P=$ac_top_build_prefix$MKDIR_P ;;
+  esac
+_ACEOF
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+# If the template does not know about datarootdir, expand it.
+# FIXME: This hack should be removed a few years after 2.60.
+ac_datarootdir_hack=; ac_datarootdir_seen=
+ac_sed_dataroot='
+/datarootdir/ {
+  p
+  q
+}
+/@datadir@/p
+/@docdir@/p
+/@infodir@/p
+/@localedir@/p
+/@mandir@/p'
+case `eval "sed -n \"\$ac_sed_dataroot\" $ac_file_inputs"` in
+*datarootdir*) ac_datarootdir_seen=yes;;
+*@datadir@*|*@docdir@*|*@infodir@*|*@localedir@*|*@mandir@*)
+  { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $ac_file_inputs seems to ignore the --datarootdir setting" >&5
+$as_echo "$as_me: WARNING: $ac_file_inputs seems to ignore the --datarootdir setting" >&2;}
+_ACEOF
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+  ac_datarootdir_hack='
+  s&@datadir@&$datadir&g
+  s&@docdir@&$docdir&g
+  s&@infodir@&$infodir&g
+  s&@localedir@&$localedir&g
+  s&@mandir@&$mandir&g
+  s&\\\${datarootdir}&$datarootdir&g' ;;
+esac
+_ACEOF
+
+# Neutralize VPATH when `$srcdir' = `.'.
+# Shell code in configure.ac might set extrasub.
+# FIXME: do we really want to maintain this feature?
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+ac_sed_extra="$ac_vpsub
+$extrasub
+_ACEOF
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+:t
+/@[a-zA-Z_][a-zA-Z_0-9]*@/!b
+s|@configure_input@|$ac_sed_conf_input|;t t
+s&@top_builddir@&$ac_top_builddir_sub&;t t
+s&@top_build_prefix@&$ac_top_build_prefix&;t t
+s&@srcdir@&$ac_srcdir&;t t
+s&@abs_srcdir@&$ac_abs_srcdir&;t t
+s&@top_srcdir@&$ac_top_srcdir&;t t
+s&@abs_top_srcdir@&$ac_abs_top_srcdir&;t t
+s&@builddir@&$ac_builddir&;t t
+s&@abs_builddir@&$ac_abs_builddir&;t t
+s&@abs_top_builddir@&$ac_abs_top_builddir&;t t
+s&@INSTALL@&$ac_INSTALL&;t t
+s&@MKDIR_P@&$ac_MKDIR_P&;t t
+$ac_datarootdir_hack
+"
+eval sed \"\$ac_sed_extra\" "$ac_file_inputs" | $AWK -f "$ac_tmp/subs.awk" \
+  >$ac_tmp/out || as_fn_error $? "could not create $ac_file" "$LINENO" 5
+
+test -z "$ac_datarootdir_hack$ac_datarootdir_seen" &&
+  { ac_out=`sed -n '/\${datarootdir}/p' "$ac_tmp/out"`; test -n "$ac_out"; } &&
+  { ac_out=`sed -n '/^[	 ]*datarootdir[	 ]*:*=/p' \
+      "$ac_tmp/out"`; test -z "$ac_out"; } &&
+  { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $ac_file contains a reference to the variable \`datarootdir'
+which seems to be undefined.  Please make sure it is defined" >&5
+$as_echo "$as_me: WARNING: $ac_file contains a reference to the variable \`datarootdir'
+which seems to be undefined.  Please make sure it is defined" >&2;}
+
+  rm -f "$ac_tmp/stdin"
+  case $ac_file in
+  -) cat "$ac_tmp/out" && rm -f "$ac_tmp/out";;
+  *) rm -f "$ac_file" && mv "$ac_tmp/out" "$ac_file";;
+  esac \
+  || as_fn_error $? "could not create $ac_file" "$LINENO" 5
+ ;;
+  :H)
+  #
+  # CONFIG_HEADER
+  #
+  if test x"$ac_file" != x-; then
+    {
+      $as_echo "/* $configure_input  */" \
+      && eval '$AWK -f "$ac_tmp/defines.awk"' "$ac_file_inputs"
+    } >"$ac_tmp/config.h" \
+      || as_fn_error $? "could not create $ac_file" "$LINENO" 5
+    if diff "$ac_file" "$ac_tmp/config.h" >/dev/null 2>&1; then
+      { $as_echo "$as_me:${as_lineno-$LINENO}: $ac_file is unchanged" >&5
+$as_echo "$as_me: $ac_file is unchanged" >&6;}
+    else
+      rm -f "$ac_file"
+      mv "$ac_tmp/config.h" "$ac_file" \
+	|| as_fn_error $? "could not create $ac_file" "$LINENO" 5
+    fi
+  else
+    $as_echo "/* $configure_input  */" \
+      && eval '$AWK -f "$ac_tmp/defines.awk"' "$ac_file_inputs" \
+      || as_fn_error $? "could not create -" "$LINENO" 5
+  fi
+# Compute "$ac_file"'s index in $config_headers.
+_am_arg="$ac_file"
+_am_stamp_count=1
+for _am_header in $config_headers :; do
+  case $_am_header in
+    $_am_arg | $_am_arg:* )
+      break ;;
+    * )
+      _am_stamp_count=`expr $_am_stamp_count + 1` ;;
+  esac
+done
+echo "timestamp for $_am_arg" >`$as_dirname -- "$_am_arg" ||
+$as_expr X"$_am_arg" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+	 X"$_am_arg" : 'X\(//\)[^/]' \| \
+	 X"$_am_arg" : 'X\(//\)$' \| \
+	 X"$_am_arg" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$_am_arg" |
+    sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\/\)[^/].*/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\/\)$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\).*/{
+	    s//\1/
+	    q
+	  }
+	  s/.*/./; q'`/stamp-h$_am_stamp_count
+ ;;
+
+  :C)  { $as_echo "$as_me:${as_lineno-$LINENO}: executing $ac_file commands" >&5
+$as_echo "$as_me: executing $ac_file commands" >&6;}
+ ;;
+  esac
+
+
+  case $ac_file$ac_mode in
+    "depfiles":C) test x"$AMDEP_TRUE" != x"" || {
+  # Older Autoconf quotes --file arguments for eval, but not when files
+  # are listed without --file.  Let's play safe and only enable the eval
+  # if we detect the quoting.
+  case $CONFIG_FILES in
+  *\'*) eval set x "$CONFIG_FILES" ;;
+  *)   set x $CONFIG_FILES ;;
+  esac
+  shift
+  for mf
+  do
+    # Strip MF so we end up with the name of the file.
+    mf=`echo "$mf" | sed -e 's/:.*$//'`
+    # Check whether this is an Automake generated Makefile or not.
+    # We used to match only the files named 'Makefile.in', but
+    # some people rename them; so instead we look at the file content.
+    # Grep'ing the first line is not enough: some people post-process
+    # each Makefile.in and add a new line on top of each file to say so.
+    # Grep'ing the whole file is not good either: AIX grep has a line
+    # limit of 2048, but all sed's we know have understand at least 4000.
+    if sed -n 's,^#.*generated by automake.*,X,p' "$mf" | grep X >/dev/null 2>&1; then
+      dirpart=`$as_dirname -- "$mf" ||
+$as_expr X"$mf" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+	 X"$mf" : 'X\(//\)[^/]' \| \
+	 X"$mf" : 'X\(//\)$' \| \
+	 X"$mf" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$mf" |
+    sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\/\)[^/].*/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\/\)$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\).*/{
+	    s//\1/
+	    q
+	  }
+	  s/.*/./; q'`
+    else
+      continue
+    fi
+    # Extract the definition of DEPDIR, am__include, and am__quote
+    # from the Makefile without running 'make'.
+    DEPDIR=`sed -n 's/^DEPDIR = //p' < "$mf"`
+    test -z "$DEPDIR" && continue
+    am__include=`sed -n 's/^am__include = //p' < "$mf"`
+    test -z "$am__include" && continue
+    am__quote=`sed -n 's/^am__quote = //p' < "$mf"`
+    # Find all dependency output files, they are included files with
+    # $(DEPDIR) in their names.  We invoke sed twice because it is the
+    # simplest approach to changing $(DEPDIR) to its actual value in the
+    # expansion.
+    for file in `sed -n "
+      s/^$am__include $am__quote\(.*(DEPDIR).*\)$am__quote"'$/\1/p' <"$mf" | \
+	 sed -e 's/\$(DEPDIR)/'"$DEPDIR"'/g'`; do
+      # Make sure the directory exists.
+      test -f "$dirpart/$file" && continue
+      fdir=`$as_dirname -- "$file" ||
+$as_expr X"$file" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+	 X"$file" : 'X\(//\)[^/]' \| \
+	 X"$file" : 'X\(//\)$' \| \
+	 X"$file" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$file" |
+    sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\/\)[^/].*/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\/\)$/{
+	    s//\1/
+	    q
+	  }
+	  /^X\(\/\).*/{
+	    s//\1/
+	    q
+	  }
+	  s/.*/./; q'`
+      as_dir=$dirpart/$fdir; as_fn_mkdir_p
+      # echo "creating $dirpart/$file"
+      echo '# dummy' > "$dirpart/$file"
+    done
+  done
+}
+ ;;
+    "libtool":C)
+
+    # See if we are running on zsh, and set the options which allow our
+    # commands through without removal of \ escapes.
+    if test -n "${ZSH_VERSION+set}" ; then
+      setopt NO_GLOB_SUBST
+    fi
+
+    cfgfile="${ofile}T"
+    trap "$RM \"$cfgfile\"; exit 1" 1 2 15
+    $RM "$cfgfile"
+
+    cat <<_LT_EOF >> "$cfgfile"
+#! $SHELL
+
+# `$ECHO "$ofile" | sed 's%^.*/%%'` - Provide generalized library-building support services.
+# Generated automatically by $as_me ($PACKAGE$TIMESTAMP) $VERSION
+# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+# NOTE: Changes made to this file will be lost: look at ltmain.sh.
+#
+#   Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005,
+#                 2006, 2007, 2008, 2009, 2010, 2011 Free Software
+#                 Foundation, Inc.
+#   Written by Gordon Matzigkeit, 1996
+#
+#   This file is part of GNU Libtool.
+#
+# GNU Libtool is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# As a special exception to the GNU General Public License,
+# if you distribute this file as part of a program or library that
+# is built using GNU Libtool, you may include this file under the
+# same distribution terms that you use for the rest of that program.
+#
+# GNU Libtool is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with GNU Libtool; see the file COPYING.  If not, a copy
+# can be downloaded from http://www.gnu.org/licenses/gpl.html, or
+# obtained by writing to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+
+# The names of the tagged configurations supported by this script.
+available_tags=""
+
+# ### BEGIN LIBTOOL CONFIG
+
+# Which release of libtool.m4 was used?
+macro_version=$macro_version
+macro_revision=$macro_revision
+
+# Whether or not to build shared libraries.
+build_libtool_libs=$enable_shared
+
+# Whether or not to build static libraries.
+build_old_libs=$enable_static
+
+# What type of objects to build.
+pic_mode=$pic_mode
+
+# Whether or not to optimize for fast installation.
+fast_install=$enable_fast_install
+
+# Shell to use when invoking shell scripts.
+SHELL=$lt_SHELL
+
+# An echo program that protects backslashes.
+ECHO=$lt_ECHO
+
+# The PATH separator for the build system.
+PATH_SEPARATOR=$lt_PATH_SEPARATOR
+
+# The host system.
+host_alias=$host_alias
+host=$host
+host_os=$host_os
+
+# The build system.
+build_alias=$build_alias
+build=$build
+build_os=$build_os
+
+# A sed program that does not truncate output.
+SED=$lt_SED
+
+# Sed that helps us avoid accidentally triggering echo(1) options like -n.
+Xsed="\$SED -e 1s/^X//"
+
+# A grep program that handles long lines.
+GREP=$lt_GREP
+
+# An ERE matcher.
+EGREP=$lt_EGREP
+
+# A literal string matcher.
+FGREP=$lt_FGREP
+
+# A BSD- or MS-compatible name lister.
+NM=$lt_NM
+
+# Whether we need soft or hard links.
+LN_S=$lt_LN_S
+
+# What is the maximum length of a command?
+max_cmd_len=$max_cmd_len
+
+# Object file suffix (normally "o").
+objext=$ac_objext
+
+# Executable file suffix (normally "").
+exeext=$exeext
+
+# whether the shell understands "unset".
+lt_unset=$lt_unset
+
+# turn spaces into newlines.
+SP2NL=$lt_lt_SP2NL
+
+# turn newlines into spaces.
+NL2SP=$lt_lt_NL2SP
+
+# convert \$build file names to \$host format.
+to_host_file_cmd=$lt_cv_to_host_file_cmd
+
+# convert \$build files to toolchain format.
+to_tool_file_cmd=$lt_cv_to_tool_file_cmd
+
+# An object symbol dumper.
+OBJDUMP=$lt_OBJDUMP
+
+# Method to check whether dependent libraries are shared objects.
+deplibs_check_method=$lt_deplibs_check_method
+
+# Command to use when deplibs_check_method = "file_magic".
+file_magic_cmd=$lt_file_magic_cmd
+
+# How to find potential files when deplibs_check_method = "file_magic".
+file_magic_glob=$lt_file_magic_glob
+
+# Find potential files using nocaseglob when deplibs_check_method = "file_magic".
+want_nocaseglob=$lt_want_nocaseglob
+
+# DLL creation program.
+DLLTOOL=$lt_DLLTOOL
+
+# Command to associate shared and link libraries.
+sharedlib_from_linklib_cmd=$lt_sharedlib_from_linklib_cmd
+
+# The archiver.
+AR=$lt_AR
+
+# Flags to create an archive.
+AR_FLAGS=$lt_AR_FLAGS
+
+# How to feed a file listing to the archiver.
+archiver_list_spec=$lt_archiver_list_spec
+
+# A symbol stripping program.
+STRIP=$lt_STRIP
+
+# Commands used to install an old-style archive.
+RANLIB=$lt_RANLIB
+old_postinstall_cmds=$lt_old_postinstall_cmds
+old_postuninstall_cmds=$lt_old_postuninstall_cmds
+
+# Whether to use a lock for old archive extraction.
+lock_old_archive_extraction=$lock_old_archive_extraction
+
+# A C compiler.
+LTCC=$lt_CC
+
+# LTCC compiler flags.
+LTCFLAGS=$lt_CFLAGS
+
+# Take the output of nm and produce a listing of raw symbols and C names.
+global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe
+
+# Transform the output of nm in a proper C declaration.
+global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl
+
+# Transform the output of nm in a C name address pair.
+global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address
+
+# Transform the output of nm in a C name address pair when lib prefix is needed.
+global_symbol_to_c_name_address_lib_prefix=$lt_lt_cv_sys_global_symbol_to_c_name_address_lib_prefix
+
+# Specify filename containing input files for \$NM.
+nm_file_list_spec=$lt_nm_file_list_spec
+
+# The root where to search for dependent libraries,and in which our libraries should be installed.
+lt_sysroot=$lt_sysroot
+
+# The name of the directory that contains temporary libtool files.
+objdir=$objdir
+
+# Used to examine libraries when file_magic_cmd begins with "file".
+MAGIC_CMD=$MAGIC_CMD
+
+# Must we lock files when doing compilation?
+need_locks=$lt_need_locks
+
+# Manifest tool.
+MANIFEST_TOOL=$lt_MANIFEST_TOOL
+
+# Tool to manipulate archived DWARF debug symbol files on Mac OS X.
+DSYMUTIL=$lt_DSYMUTIL
+
+# Tool to change global to local symbols on Mac OS X.
+NMEDIT=$lt_NMEDIT
+
+# Tool to manipulate fat objects and archives on Mac OS X.
+LIPO=$lt_LIPO
+
+# ldd/readelf like tool for Mach-O binaries on Mac OS X.
+OTOOL=$lt_OTOOL
+
+# ldd/readelf like tool for 64 bit Mach-O binaries on Mac OS X 10.4.
+OTOOL64=$lt_OTOOL64
+
+# Old archive suffix (normally "a").
+libext=$libext
+
+# Shared library suffix (normally ".so").
+shrext_cmds=$lt_shrext_cmds
+
+# The commands to extract the exported symbol list from a shared archive.
+extract_expsyms_cmds=$lt_extract_expsyms_cmds
+
+# Variables whose values should be saved in libtool wrapper scripts and
+# restored at link time.
+variables_saved_for_relink=$lt_variables_saved_for_relink
+
+# Do we need the "lib" prefix for modules?
+need_lib_prefix=$need_lib_prefix
+
+# Do we need a version for libraries?
+need_version=$need_version
+
+# Library versioning type.
+version_type=$version_type
+
+# Shared library runtime path variable.
+runpath_var=$runpath_var
+
+# Shared library path variable.
+shlibpath_var=$shlibpath_var
+
+# Is shlibpath searched before the hard-coded library search path?
+shlibpath_overrides_runpath=$shlibpath_overrides_runpath
+
+# Format of library name prefix.
+libname_spec=$lt_libname_spec
+
+# List of archive names.  First name is the real one, the rest are links.
+# The last name is the one that the linker finds with -lNAME
+library_names_spec=$lt_library_names_spec
+
+# The coded name of the library, if different from the real name.
+soname_spec=$lt_soname_spec
+
+# Permission mode override for installation of shared libraries.
+install_override_mode=$lt_install_override_mode
+
+# Command to use after installation of a shared archive.
+postinstall_cmds=$lt_postinstall_cmds
+
+# Command to use after uninstallation of a shared archive.
+postuninstall_cmds=$lt_postuninstall_cmds
+
+# Commands used to finish a libtool library installation in a directory.
+finish_cmds=$lt_finish_cmds
+
+# As "finish_cmds", except a single script fragment to be evaled but
+# not shown.
+finish_eval=$lt_finish_eval
+
+# Whether we should hardcode library paths into libraries.
+hardcode_into_libs=$hardcode_into_libs
+
+# Compile-time system search path for libraries.
+sys_lib_search_path_spec=$lt_sys_lib_search_path_spec
+
+# Run-time system search path for libraries.
+sys_lib_dlsearch_path_spec=$lt_sys_lib_dlsearch_path_spec
+
+# Whether dlopen is supported.
+dlopen_support=$enable_dlopen
+
+# Whether dlopen of programs is supported.
+dlopen_self=$enable_dlopen_self
+
+# Whether dlopen of statically linked programs is supported.
+dlopen_self_static=$enable_dlopen_self_static
+
+# Commands to strip libraries.
+old_striplib=$lt_old_striplib
+striplib=$lt_striplib
+
+
+# The linker used to build libraries.
+LD=$lt_LD
+
+# How to create reloadable object files.
+reload_flag=$lt_reload_flag
+reload_cmds=$lt_reload_cmds
+
+# Commands used to build an old-style archive.
+old_archive_cmds=$lt_old_archive_cmds
+
+# A language specific compiler.
+CC=$lt_compiler
+
+# Is the compiler the GNU compiler?
+with_gcc=$GCC
+
+# Compiler flag to turn off builtin functions.
+no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag
+
+# Additional compiler flags for building library objects.
+pic_flag=$lt_lt_prog_compiler_pic
+
+# How to pass a linker flag through the compiler.
+wl=$lt_lt_prog_compiler_wl
+
+# Compiler flag to prevent dynamic linking.
+link_static_flag=$lt_lt_prog_compiler_static
+
+# Does compiler simultaneously support -c and -o options?
+compiler_c_o=$lt_lt_cv_prog_compiler_c_o
+
+# Whether or not to add -lc for building shared libraries.
+build_libtool_need_lc=$archive_cmds_need_lc
+
+# Whether or not to disallow shared libs when runtime libs are static.
+allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes
+
+# Compiler flag to allow reflexive dlopens.
+export_dynamic_flag_spec=$lt_export_dynamic_flag_spec
+
+# Compiler flag to generate shared objects directly from archives.
+whole_archive_flag_spec=$lt_whole_archive_flag_spec
+
+# Whether the compiler copes with passing no objects directly.
+compiler_needs_object=$lt_compiler_needs_object
+
+# Create an old-style archive from a shared archive.
+old_archive_from_new_cmds=$lt_old_archive_from_new_cmds
+
+# Create a temporary old-style archive to link instead of a shared archive.
+old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds
+
+# Commands used to build a shared archive.
+archive_cmds=$lt_archive_cmds
+archive_expsym_cmds=$lt_archive_expsym_cmds
+
+# Commands used to build a loadable module if different from building
+# a shared archive.
+module_cmds=$lt_module_cmds
+module_expsym_cmds=$lt_module_expsym_cmds
+
+# Whether we are building with GNU ld or not.
+with_gnu_ld=$lt_with_gnu_ld
+
+# Flag that allows shared libraries with undefined symbols to be built.
+allow_undefined_flag=$lt_allow_undefined_flag
+
+# Flag that enforces no undefined symbols.
+no_undefined_flag=$lt_no_undefined_flag
+
+# Flag to hardcode \$libdir into a binary during linking.
+# This must work even if \$libdir does not exist
+hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec
+
+# Whether we need a single "-rpath" flag with a separated argument.
+hardcode_libdir_separator=$lt_hardcode_libdir_separator
+
+# Set to "yes" if using DIR/libNAME\${shared_ext} during linking hardcodes
+# DIR into the resulting binary.
+hardcode_direct=$hardcode_direct
+
+# Set to "yes" if using DIR/libNAME\${shared_ext} during linking hardcodes
+# DIR into the resulting binary and the resulting library dependency is
+# "absolute",i.e impossible to change by setting \${shlibpath_var} if the
+# library is relocated.
+hardcode_direct_absolute=$hardcode_direct_absolute
+
+# Set to "yes" if using the -LDIR flag during linking hardcodes DIR
+# into the resulting binary.
+hardcode_minus_L=$hardcode_minus_L
+
+# Set to "yes" if using SHLIBPATH_VAR=DIR during linking hardcodes DIR
+# into the resulting binary.
+hardcode_shlibpath_var=$hardcode_shlibpath_var
+
+# Set to "yes" if building a shared library automatically hardcodes DIR
+# into the library and all subsequent libraries and executables linked
+# against it.
+hardcode_automatic=$hardcode_automatic
+
+# Set to yes if linker adds runtime paths of dependent libraries
+# to runtime path list.
+inherit_rpath=$inherit_rpath
+
+# Whether libtool must link a program against all its dependency libraries.
+link_all_deplibs=$link_all_deplibs
+
+# Set to "yes" if exported symbols are required.
+always_export_symbols=$always_export_symbols
+
+# The commands to list exported symbols.
+export_symbols_cmds=$lt_export_symbols_cmds
+
+# Symbols that should not be listed in the preloaded symbols.
+exclude_expsyms=$lt_exclude_expsyms
+
+# Symbols that must always be exported.
+include_expsyms=$lt_include_expsyms
+
+# Commands necessary for linking programs (against libraries) with templates.
+prelink_cmds=$lt_prelink_cmds
+
+# Commands necessary for finishing linking programs.
+postlink_cmds=$lt_postlink_cmds
+
+# Specify filename containing input files.
+file_list_spec=$lt_file_list_spec
+
+# How to hardcode a shared library path into an executable.
+hardcode_action=$hardcode_action
+
+# ### END LIBTOOL CONFIG
+
+_LT_EOF
+
+  case $host_os in
+  aix3*)
+    cat <<\_LT_EOF >> "$cfgfile"
+# AIX sometimes has problems with the GCC collect2 program.  For some
+# reason, if we set the COLLECT_NAMES environment variable, the problems
+# vanish in a puff of smoke.
+if test "X${COLLECT_NAMES+set}" != Xset; then
+  COLLECT_NAMES=
+  export COLLECT_NAMES
+fi
+_LT_EOF
+    ;;
+  esac
+
+
+ltmain="$ac_aux_dir/ltmain.sh"
+
+
+  # We use sed instead of cat because bash on DJGPP gets confused if
+  # if finds mixed CR/LF and LF-only lines.  Since sed operates in
+  # text mode, it properly converts lines to CR/LF.  This bash problem
+  # is reportedly fixed, but why not run on old versions too?
+  sed '$q' "$ltmain" >> "$cfgfile" \
+     || (rm -f "$cfgfile"; exit 1)
+
+  if test x"$xsi_shell" = xyes; then
+  sed -e '/^func_dirname ()$/,/^} # func_dirname /c\
+func_dirname ()\
+{\
+\    case ${1} in\
+\      */*) func_dirname_result="${1%/*}${2}" ;;\
+\      *  ) func_dirname_result="${3}" ;;\
+\    esac\
+} # Extended-shell func_dirname implementation' "$cfgfile" > $cfgfile.tmp \
+  && mv -f "$cfgfile.tmp" "$cfgfile" \
+    || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+  sed -e '/^func_basename ()$/,/^} # func_basename /c\
+func_basename ()\
+{\
+\    func_basename_result="${1##*/}"\
+} # Extended-shell func_basename implementation' "$cfgfile" > $cfgfile.tmp \
+  && mv -f "$cfgfile.tmp" "$cfgfile" \
+    || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+  sed -e '/^func_dirname_and_basename ()$/,/^} # func_dirname_and_basename /c\
+func_dirname_and_basename ()\
+{\
+\    case ${1} in\
+\      */*) func_dirname_result="${1%/*}${2}" ;;\
+\      *  ) func_dirname_result="${3}" ;;\
+\    esac\
+\    func_basename_result="${1##*/}"\
+} # Extended-shell func_dirname_and_basename implementation' "$cfgfile" > $cfgfile.tmp \
+  && mv -f "$cfgfile.tmp" "$cfgfile" \
+    || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+  sed -e '/^func_stripname ()$/,/^} # func_stripname /c\
+func_stripname ()\
+{\
+\    # pdksh 5.2.14 does not do ${X%$Y} correctly if both X and Y are\
+\    # positional parameters, so assign one to ordinary parameter first.\
+\    func_stripname_result=${3}\
+\    func_stripname_result=${func_stripname_result#"${1}"}\
+\    func_stripname_result=${func_stripname_result%"${2}"}\
+} # Extended-shell func_stripname implementation' "$cfgfile" > $cfgfile.tmp \
+  && mv -f "$cfgfile.tmp" "$cfgfile" \
+    || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+  sed -e '/^func_split_long_opt ()$/,/^} # func_split_long_opt /c\
+func_split_long_opt ()\
+{\
+\    func_split_long_opt_name=${1%%=*}\
+\    func_split_long_opt_arg=${1#*=}\
+} # Extended-shell func_split_long_opt implementation' "$cfgfile" > $cfgfile.tmp \
+  && mv -f "$cfgfile.tmp" "$cfgfile" \
+    || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+  sed -e '/^func_split_short_opt ()$/,/^} # func_split_short_opt /c\
+func_split_short_opt ()\
+{\
+\    func_split_short_opt_arg=${1#??}\
+\    func_split_short_opt_name=${1%"$func_split_short_opt_arg"}\
+} # Extended-shell func_split_short_opt implementation' "$cfgfile" > $cfgfile.tmp \
+  && mv -f "$cfgfile.tmp" "$cfgfile" \
+    || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+  sed -e '/^func_lo2o ()$/,/^} # func_lo2o /c\
+func_lo2o ()\
+{\
+\    case ${1} in\
+\      *.lo) func_lo2o_result=${1%.lo}.${objext} ;;\
+\      *)    func_lo2o_result=${1} ;;\
+\    esac\
+} # Extended-shell func_lo2o implementation' "$cfgfile" > $cfgfile.tmp \
+  && mv -f "$cfgfile.tmp" "$cfgfile" \
+    || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+  sed -e '/^func_xform ()$/,/^} # func_xform /c\
+func_xform ()\
+{\
+    func_xform_result=${1%.*}.lo\
+} # Extended-shell func_xform implementation' "$cfgfile" > $cfgfile.tmp \
+  && mv -f "$cfgfile.tmp" "$cfgfile" \
+    || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+  sed -e '/^func_arith ()$/,/^} # func_arith /c\
+func_arith ()\
+{\
+    func_arith_result=$(( $* ))\
+} # Extended-shell func_arith implementation' "$cfgfile" > $cfgfile.tmp \
+  && mv -f "$cfgfile.tmp" "$cfgfile" \
+    || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+  sed -e '/^func_len ()$/,/^} # func_len /c\
+func_len ()\
+{\
+    func_len_result=${#1}\
+} # Extended-shell func_len implementation' "$cfgfile" > $cfgfile.tmp \
+  && mv -f "$cfgfile.tmp" "$cfgfile" \
+    || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+fi
+
+if test x"$lt_shell_append" = xyes; then
+  sed -e '/^func_append ()$/,/^} # func_append /c\
+func_append ()\
+{\
+    eval "${1}+=\\${2}"\
+} # Extended-shell func_append implementation' "$cfgfile" > $cfgfile.tmp \
+  && mv -f "$cfgfile.tmp" "$cfgfile" \
+    || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+  sed -e '/^func_append_quoted ()$/,/^} # func_append_quoted /c\
+func_append_quoted ()\
+{\
+\    func_quote_for_eval "${2}"\
+\    eval "${1}+=\\\\ \\$func_quote_for_eval_result"\
+} # Extended-shell func_append_quoted implementation' "$cfgfile" > $cfgfile.tmp \
+  && mv -f "$cfgfile.tmp" "$cfgfile" \
+    || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+  # Save a `func_append' function call where possible by direct use of '+='
+  sed -e 's%func_append \([a-zA-Z_]\{1,\}\) "%\1+="%g' $cfgfile > $cfgfile.tmp \
+    && mv -f "$cfgfile.tmp" "$cfgfile" \
+      || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+  test 0 -eq $? || _lt_function_replace_fail=:
+else
+  # Save a `func_append' function call even when '+=' is not available
+  sed -e 's%func_append \([a-zA-Z_]\{1,\}\) "%\1="$\1%g' $cfgfile > $cfgfile.tmp \
+    && mv -f "$cfgfile.tmp" "$cfgfile" \
+      || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+  test 0 -eq $? || _lt_function_replace_fail=:
+fi
+
+if test x"$_lt_function_replace_fail" = x":"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: Unable to substitute extended shell functions in $ofile" >&5
+$as_echo "$as_me: WARNING: Unable to substitute extended shell functions in $ofile" >&2;}
+fi
+
+
+   mv -f "$cfgfile" "$ofile" ||
+    (rm -f "$ofile" && cp "$cfgfile" "$ofile" && rm -f "$cfgfile")
+  chmod +x "$ofile"
+
+ ;;
+
+  esac
+done # for ac_tag
+
+
+as_fn_exit 0
+_ACEOF
+ac_clean_files=$ac_clean_files_save
+
+test $ac_write_fail = 0 ||
+  as_fn_error $? "write failure creating $CONFIG_STATUS" "$LINENO" 5
+
+
+# configure is writing to config.log, and then calls config.status.
+# config.status does its own redirection, appending to config.log.
+# Unfortunately, on DOS this fails, as config.log is still kept open
+# by configure, so config.status won't be able to write to it; its
+# output is simply discarded.  So we exec the FD to /dev/null,
+# effectively closing config.log, so it can be properly (re)opened and
+# appended to by config.status.  When coming back to configure, we
+# need to make the FD available again.
+if test "$no_create" != yes; then
+  ac_cs_success=:
+  ac_config_status_args=
+  test "$silent" = yes &&
+    ac_config_status_args="$ac_config_status_args --quiet"
+  exec 5>/dev/null
+  $SHELL $CONFIG_STATUS $ac_config_status_args || ac_cs_success=false
+  exec 5>>config.log
+  # Use ||, not &&, to avoid exiting from the if with $? = 1, which
+  # would make configure fail if this is the last instruction.
+  $ac_cs_success || as_fn_exit 1
+fi
+if test -n "$ac_unrecognized_opts" && test "$enable_option_checking" != no; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: unrecognized options: $ac_unrecognized_opts" >&5
+$as_echo "$as_me: WARNING: unrecognized options: $ac_unrecognized_opts" >&2;}
+fi
+

Added: vendor/jansson/dist/configure.ac
===================================================================
--- vendor/jansson/dist/configure.ac	                        (rev 0)
+++ vendor/jansson/dist/configure.ac	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,111 @@
+AC_PREREQ([2.60])
+AC_INIT([jansson], [2.7], [petri at digip.org])
+
+AC_CONFIG_AUX_DIR([.])
+AM_INIT_AUTOMAKE([1.10 foreign])
+
+AC_CONFIG_SRCDIR([src/value.c])
+AC_CONFIG_HEADERS([jansson_private_config.h])
+
+# Checks for programs.
+AC_PROG_CC
+AC_PROG_LIBTOOL
+AM_CONDITIONAL([GCC], [test x$GCC = xyes])
+
+# Checks for libraries.
+
+# Checks for header files.
+AC_CHECK_HEADERS([endian.h fcntl.h locale.h sched.h unistd.h sys/param.h sys/stat.h sys/time.h sys/types.h])
+
+# Checks for typedefs, structures, and compiler characteristics.
+AC_TYPE_INT32_T
+AC_TYPE_UINT32_T
+AC_TYPE_UINT16_T
+AC_TYPE_UINT8_T
+AC_TYPE_LONG_LONG_INT
+
+AC_C_INLINE
+case $ac_cv_c_inline in
+    yes) json_inline=inline;;
+    no) json_inline=;;
+    *) json_inline=$ac_cv_c_inline;;
+esac
+AC_SUBST([json_inline])
+
+# Checks for library functions.
+AC_CHECK_FUNCS([close getpid gettimeofday localeconv open read sched_yield strtoll])
+
+AC_MSG_CHECKING([for gcc __sync builtins])
+have_sync_builtins=no
+AC_TRY_LINK(
+  [], [unsigned long val; __sync_bool_compare_and_swap(&val, 0, 1);],
+  [have_sync_builtins=yes],
+)
+if test "x$have_sync_builtins" = "xyes"; then
+  AC_DEFINE([HAVE_SYNC_BUILTINS], [1],
+    [Define to 1 if gcc's __sync builtins are available])
+fi
+AC_MSG_RESULT([$have_sync_builtins])
+
+AC_MSG_CHECKING([for gcc __atomic builtins])
+have_atomic_builtins=no
+AC_TRY_LINK(
+  [], [char l; unsigned long v; __atomic_test_and_set(&l, __ATOMIC_RELAXED); __atomic_store_n(&v, 1, __ATOMIC_RELEASE); __atomic_load_n(&v, __ATOMIC_ACQUIRE);],
+  [have_atomic_builtins=yes],
+)
+if test "x$have_atomic_builtins" = "xyes"; then
+  AC_DEFINE([HAVE_ATOMIC_BUILTINS], [1],
+    [Define to 1 if gcc's __atomic builtins are available])
+fi
+AC_MSG_RESULT([$have_atomic_builtins])
+
+case "$ac_cv_type_long_long_int$ac_cv_func_strtoll" in
+     yesyes) json_have_long_long=1;;
+     *) json_have_long_long=0;;
+esac
+AC_SUBST([json_have_long_long])
+
+case "$ac_cv_header_locale_h$ac_cv_func_localeconv" in
+     yesyes) json_have_localeconv=1;;
+     *) json_have_localeconv=0;;
+esac
+AC_SUBST([json_have_localeconv])
+
+# Features
+AC_ARG_ENABLE([urandom],
+  [AS_HELP_STRING([--disable-urandom],
+    [Don't use /dev/urandom to seed the hash function])],
+  [use_urandom=$enableval], [use_urandom=yes])
+
+if test "x$use_urandom" = xyes; then
+AC_DEFINE([USE_URANDOM], [1],
+  [Define to 1 if /dev/urandom should be used for seeding the hash function])
+fi
+
+AC_ARG_ENABLE([windows-cryptoapi],
+  [AS_HELP_STRING([--disable-windows-cryptoapi],
+    [Don't use CryptGenRandom to seed the hash function])],
+  [use_windows_cryptoapi=$enableval], [use_windows_cryptoapi=yes])
+
+if test "x$use_windows_cryptoapi" = xyes; then
+AC_DEFINE([USE_WINDOWS_CRYPTOAPI], [1],
+  [Define to 1 if CryptGenRandom should be used for seeding the hash function])
+fi
+
+if test x$GCC = xyes; then
+    AM_CFLAGS="-Wall -Wextra -Wdeclaration-after-statement"
+fi
+AC_SUBST([AM_CFLAGS])
+
+AC_CONFIG_FILES([
+        jansson.pc
+        Makefile
+        doc/Makefile
+        src/Makefile
+        src/jansson_config.h
+        test/Makefile
+        test/bin/Makefile
+        test/suites/Makefile
+        test/suites/api/Makefile
+])
+AC_OUTPUT

Added: vendor/jansson/dist/depcomp
===================================================================
--- vendor/jansson/dist/depcomp	                        (rev 0)
+++ vendor/jansson/dist/depcomp	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,791 @@
+#! /bin/sh
+# depcomp - compile a program generating dependencies as side-effects
+
+scriptversion=2013-05-30.07; # UTC
+
+# Copyright (C) 1999-2013 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2, or (at your option)
+# any later version.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# Originally written by Alexandre Oliva <oliva at dcc.unicamp.br>.
+
+case $1 in
+  '')
+    echo "$0: No command.  Try '$0 --help' for more information." 1>&2
+    exit 1;
+    ;;
+  -h | --h*)
+    cat <<\EOF
+Usage: depcomp [--help] [--version] PROGRAM [ARGS]
+
+Run PROGRAMS ARGS to compile a file, generating dependencies
+as side-effects.
+
+Environment variables:
+  depmode     Dependency tracking mode.
+  source      Source file read by 'PROGRAMS ARGS'.
+  object      Object file output by 'PROGRAMS ARGS'.
+  DEPDIR      directory where to store dependencies.
+  depfile     Dependency file to output.
+  tmpdepfile  Temporary file to use when outputting dependencies.
+  libtool     Whether libtool is used (yes/no).
+
+Report bugs to <bug-automake at gnu.org>.
+EOF
+    exit $?
+    ;;
+  -v | --v*)
+    echo "depcomp $scriptversion"
+    exit $?
+    ;;
+esac
+
+# Get the directory component of the given path, and save it in the
+# global variables '$dir'.  Note that this directory component will
+# be either empty or ending with a '/' character.  This is deliberate.
+set_dir_from ()
+{
+  case $1 in
+    */*) dir=`echo "$1" | sed -e 's|/[^/]*$|/|'`;;
+      *) dir=;;
+  esac
+}
+
+# Get the suffix-stripped basename of the given path, and save it the
+# global variable '$base'.
+set_base_from ()
+{
+  base=`echo "$1" | sed -e 's|^.*/||' -e 's/\.[^.]*$//'`
+}
+
+# If no dependency file was actually created by the compiler invocation,
+# we still have to create a dummy depfile, to avoid errors with the
+# Makefile "include basename.Plo" scheme.
+make_dummy_depfile ()
+{
+  echo "#dummy" > "$depfile"
+}
+
+# Factor out some common post-processing of the generated depfile.
+# Requires the auxiliary global variable '$tmpdepfile' to be set.
+aix_post_process_depfile ()
+{
+  # If the compiler actually managed to produce a dependency file,
+  # post-process it.
+  if test -f "$tmpdepfile"; then
+    # Each line is of the form 'foo.o: dependency.h'.
+    # Do two passes, one to just change these to
+    #   $object: dependency.h
+    # and one to simply output
+    #   dependency.h:
+    # which is needed to avoid the deleted-header problem.
+    { sed -e "s,^.*\.[$lower]*:,$object:," < "$tmpdepfile"
+      sed -e "s,^.*\.[$lower]*:[$tab ]*,," -e 's,$,:,' < "$tmpdepfile"
+    } > "$depfile"
+    rm -f "$tmpdepfile"
+  else
+    make_dummy_depfile
+  fi
+}
+
+# A tabulation character.
+tab='	'
+# A newline character.
+nl='
+'
+# Character ranges might be problematic outside the C locale.
+# These definitions help.
+upper=ABCDEFGHIJKLMNOPQRSTUVWXYZ
+lower=abcdefghijklmnopqrstuvwxyz
+digits=0123456789
+alpha=${upper}${lower}
+
+if test -z "$depmode" || test -z "$source" || test -z "$object"; then
+  echo "depcomp: Variables source, object and depmode must be set" 1>&2
+  exit 1
+fi
+
+# Dependencies for sub/bar.o or sub/bar.obj go into sub/.deps/bar.Po.
+depfile=${depfile-`echo "$object" |
+  sed 's|[^\\/]*$|'${DEPDIR-.deps}'/&|;s|\.\([^.]*\)$|.P\1|;s|Pobj$|Po|'`}
+tmpdepfile=${tmpdepfile-`echo "$depfile" | sed 's/\.\([^.]*\)$/.T\1/'`}
+
+rm -f "$tmpdepfile"
+
+# Avoid interferences from the environment.
+gccflag= dashmflag=
+
+# Some modes work just like other modes, but use different flags.  We
+# parameterize here, but still list the modes in the big case below,
+# to make depend.m4 easier to write.  Note that we *cannot* use a case
+# here, because this file can only contain one case statement.
+if test "$depmode" = hp; then
+  # HP compiler uses -M and no extra arg.
+  gccflag=-M
+  depmode=gcc
+fi
+
+if test "$depmode" = dashXmstdout; then
+  # This is just like dashmstdout with a different argument.
+  dashmflag=-xM
+  depmode=dashmstdout
+fi
+
+cygpath_u="cygpath -u -f -"
+if test "$depmode" = msvcmsys; then
+  # This is just like msvisualcpp but w/o cygpath translation.
+  # Just convert the backslash-escaped backslashes to single forward
+  # slashes to satisfy depend.m4
+  cygpath_u='sed s,\\\\,/,g'
+  depmode=msvisualcpp
+fi
+
+if test "$depmode" = msvc7msys; then
+  # This is just like msvc7 but w/o cygpath translation.
+  # Just convert the backslash-escaped backslashes to single forward
+  # slashes to satisfy depend.m4
+  cygpath_u='sed s,\\\\,/,g'
+  depmode=msvc7
+fi
+
+if test "$depmode" = xlc; then
+  # IBM C/C++ Compilers xlc/xlC can output gcc-like dependency information.
+  gccflag=-qmakedep=gcc,-MF
+  depmode=gcc
+fi
+
+case "$depmode" in
+gcc3)
+## gcc 3 implements dependency tracking that does exactly what
+## we want.  Yay!  Note: for some reason libtool 1.4 doesn't like
+## it if -MD -MP comes after the -MF stuff.  Hmm.
+## Unfortunately, FreeBSD c89 acceptance of flags depends upon
+## the command line argument order; so add the flags where they
+## appear in depend2.am.  Note that the slowdown incurred here
+## affects only configure: in makefiles, %FASTDEP% shortcuts this.
+  for arg
+  do
+    case $arg in
+    -c) set fnord "$@" -MT "$object" -MD -MP -MF "$tmpdepfile" "$arg" ;;
+    *)  set fnord "$@" "$arg" ;;
+    esac
+    shift # fnord
+    shift # $arg
+  done
+  "$@"
+  stat=$?
+  if test $stat -ne 0; then
+    rm -f "$tmpdepfile"
+    exit $stat
+  fi
+  mv "$tmpdepfile" "$depfile"
+  ;;
+
+gcc)
+## Note that this doesn't just cater to obsosete pre-3.x GCC compilers.
+## but also to in-use compilers like IMB xlc/xlC and the HP C compiler.
+## (see the conditional assignment to $gccflag above).
+## There are various ways to get dependency output from gcc.  Here's
+## why we pick this rather obscure method:
+## - Don't want to use -MD because we'd like the dependencies to end
+##   up in a subdir.  Having to rename by hand is ugly.
+##   (We might end up doing this anyway to support other compilers.)
+## - The DEPENDENCIES_OUTPUT environment variable makes gcc act like
+##   -MM, not -M (despite what the docs say).  Also, it might not be
+##   supported by the other compilers which use the 'gcc' depmode.
+## - Using -M directly means running the compiler twice (even worse
+##   than renaming).
+  if test -z "$gccflag"; then
+    gccflag=-MD,
+  fi
+  "$@" -Wp,"$gccflag$tmpdepfile"
+  stat=$?
+  if test $stat -ne 0; then
+    rm -f "$tmpdepfile"
+    exit $stat
+  fi
+  rm -f "$depfile"
+  echo "$object : \\" > "$depfile"
+  # The second -e expression handles DOS-style file names with drive
+  # letters.
+  sed -e 's/^[^:]*: / /' \
+      -e 's/^['$alpha']:\/[^:]*: / /' < "$tmpdepfile" >> "$depfile"
+## This next piece of magic avoids the "deleted header file" problem.
+## The problem is that when a header file which appears in a .P file
+## is deleted, the dependency causes make to die (because there is
+## typically no way to rebuild the header).  We avoid this by adding
+## dummy dependencies for each header file.  Too bad gcc doesn't do
+## this for us directly.
+## Some versions of gcc put a space before the ':'.  On the theory
+## that the space means something, we add a space to the output as
+## well.  hp depmode also adds that space, but also prefixes the VPATH
+## to the object.  Take care to not repeat it in the output.
+## Some versions of the HPUX 10.20 sed can't process this invocation
+## correctly.  Breaking it into two sed invocations is a workaround.
+  tr ' ' "$nl" < "$tmpdepfile" \
+    | sed -e 's/^\\$//' -e '/^$/d' -e "s|.*$object$||" -e '/:$/d' \
+    | sed -e 's/$/ :/' >> "$depfile"
+  rm -f "$tmpdepfile"
+  ;;
+
+hp)
+  # This case exists only to let depend.m4 do its work.  It works by
+  # looking at the text of this script.  This case will never be run,
+  # since it is checked for above.
+  exit 1
+  ;;
+
+sgi)
+  if test "$libtool" = yes; then
+    "$@" "-Wp,-MDupdate,$tmpdepfile"
+  else
+    "$@" -MDupdate "$tmpdepfile"
+  fi
+  stat=$?
+  if test $stat -ne 0; then
+    rm -f "$tmpdepfile"
+    exit $stat
+  fi
+  rm -f "$depfile"
+
+  if test -f "$tmpdepfile"; then  # yes, the sourcefile depend on other files
+    echo "$object : \\" > "$depfile"
+    # Clip off the initial element (the dependent).  Don't try to be
+    # clever and replace this with sed code, as IRIX sed won't handle
+    # lines with more than a fixed number of characters (4096 in
+    # IRIX 6.2 sed, 8192 in IRIX 6.5).  We also remove comment lines;
+    # the IRIX cc adds comments like '#:fec' to the end of the
+    # dependency line.
+    tr ' ' "$nl" < "$tmpdepfile" \
+      | sed -e 's/^.*\.o://' -e 's/#.*$//' -e '/^$/ d' \
+      | tr "$nl" ' ' >> "$depfile"
+    echo >> "$depfile"
+    # The second pass generates a dummy entry for each header file.
+    tr ' ' "$nl" < "$tmpdepfile" \
+      | sed -e 's/^.*\.o://' -e 's/#.*$//' -e '/^$/ d' -e 's/$/:/' \
+      >> "$depfile"
+  else
+    make_dummy_depfile
+  fi
+  rm -f "$tmpdepfile"
+  ;;
+
+xlc)
+  # This case exists only to let depend.m4 do its work.  It works by
+  # looking at the text of this script.  This case will never be run,
+  # since it is checked for above.
+  exit 1
+  ;;
+
+aix)
+  # The C for AIX Compiler uses -M and outputs the dependencies
+  # in a .u file.  In older versions, this file always lives in the
+  # current directory.  Also, the AIX compiler puts '$object:' at the
+  # start of each line; $object doesn't have directory information.
+  # Version 6 uses the directory in both cases.
+  set_dir_from "$object"
+  set_base_from "$object"
+  if test "$libtool" = yes; then
+    tmpdepfile1=$dir$base.u
+    tmpdepfile2=$base.u
+    tmpdepfile3=$dir.libs/$base.u
+    "$@" -Wc,-M
+  else
+    tmpdepfile1=$dir$base.u
+    tmpdepfile2=$dir$base.u
+    tmpdepfile3=$dir$base.u
+    "$@" -M
+  fi
+  stat=$?
+  if test $stat -ne 0; then
+    rm -f "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3"
+    exit $stat
+  fi
+
+  for tmpdepfile in "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3"
+  do
+    test -f "$tmpdepfile" && break
+  done
+  aix_post_process_depfile
+  ;;
+
+tcc)
+  # tcc (Tiny C Compiler) understand '-MD -MF file' since version 0.9.26
+  # FIXME: That version still under development at the moment of writing.
+  #        Make that this statement remains true also for stable, released
+  #        versions.
+  # It will wrap lines (doesn't matter whether long or short) with a
+  # trailing '\', as in:
+  #
+  #   foo.o : \
+  #    foo.c \
+  #    foo.h \
+  #
+  # It will put a trailing '\' even on the last line, and will use leading
+  # spaces rather than leading tabs (at least since its commit 0394caf7
+  # "Emit spaces for -MD").
+  "$@" -MD -MF "$tmpdepfile"
+  stat=$?
+  if test $stat -ne 0; then
+    rm -f "$tmpdepfile"
+    exit $stat
+  fi
+  rm -f "$depfile"
+  # Each non-empty line is of the form 'foo.o : \' or ' dep.h \'.
+  # We have to change lines of the first kind to '$object: \'.
+  sed -e "s|.*:|$object :|" < "$tmpdepfile" > "$depfile"
+  # And for each line of the second kind, we have to emit a 'dep.h:'
+  # dummy dependency, to avoid the deleted-header problem.
+  sed -n -e 's|^  *\(.*\) *\\$|\1:|p' < "$tmpdepfile" >> "$depfile"
+  rm -f "$tmpdepfile"
+  ;;
+
+## The order of this option in the case statement is important, since the
+## shell code in configure will try each of these formats in the order
+## listed in this file.  A plain '-MD' option would be understood by many
+## compilers, so we must ensure this comes after the gcc and icc options.
+pgcc)
+  # Portland's C compiler understands '-MD'.
+  # Will always output deps to 'file.d' where file is the root name of the
+  # source file under compilation, even if file resides in a subdirectory.
+  # The object file name does not affect the name of the '.d' file.
+  # pgcc 10.2 will output
+  #    foo.o: sub/foo.c sub/foo.h
+  # and will wrap long lines using '\' :
+  #    foo.o: sub/foo.c ... \
+  #     sub/foo.h ... \
+  #     ...
+  set_dir_from "$object"
+  # Use the source, not the object, to determine the base name, since
+  # that's sadly what pgcc will do too.
+  set_base_from "$source"
+  tmpdepfile=$base.d
+
+  # For projects that build the same source file twice into different object
+  # files, the pgcc approach of using the *source* file root name can cause
+  # problems in parallel builds.  Use a locking strategy to avoid stomping on
+  # the same $tmpdepfile.
+  lockdir=$base.d-lock
+  trap "
+    echo '$0: caught signal, cleaning up...' >&2
+    rmdir '$lockdir'
+    exit 1
+  " 1 2 13 15
+  numtries=100
+  i=$numtries
+  while test $i -gt 0; do
+    # mkdir is a portable test-and-set.
+    if mkdir "$lockdir" 2>/dev/null; then
+      # This process acquired the lock.
+      "$@" -MD
+      stat=$?
+      # Release the lock.
+      rmdir "$lockdir"
+      break
+    else
+      # If the lock is being held by a different process, wait
+      # until the winning process is done or we timeout.
+      while test -d "$lockdir" && test $i -gt 0; do
+        sleep 1
+        i=`expr $i - 1`
+      done
+    fi
+    i=`expr $i - 1`
+  done
+  trap - 1 2 13 15
+  if test $i -le 0; then
+    echo "$0: failed to acquire lock after $numtries attempts" >&2
+    echo "$0: check lockdir '$lockdir'" >&2
+    exit 1
+  fi
+
+  if test $stat -ne 0; then
+    rm -f "$tmpdepfile"
+    exit $stat
+  fi
+  rm -f "$depfile"
+  # Each line is of the form `foo.o: dependent.h',
+  # or `foo.o: dep1.h dep2.h \', or ` dep3.h dep4.h \'.
+  # Do two passes, one to just change these to
+  # `$object: dependent.h' and one to simply `dependent.h:'.
+  sed "s,^[^:]*:,$object :," < "$tmpdepfile" > "$depfile"
+  # Some versions of the HPUX 10.20 sed can't process this invocation
+  # correctly.  Breaking it into two sed invocations is a workaround.
+  sed 's,^[^:]*: \(.*\)$,\1,;s/^\\$//;/^$/d;/:$/d' < "$tmpdepfile" \
+    | sed -e 's/$/ :/' >> "$depfile"
+  rm -f "$tmpdepfile"
+  ;;
+
+hp2)
+  # The "hp" stanza above does not work with aCC (C++) and HP's ia64
+  # compilers, which have integrated preprocessors.  The correct option
+  # to use with these is +Maked; it writes dependencies to a file named
+  # 'foo.d', which lands next to the object file, wherever that
+  # happens to be.
+  # Much of this is similar to the tru64 case; see comments there.
+  set_dir_from  "$object"
+  set_base_from "$object"
+  if test "$libtool" = yes; then
+    tmpdepfile1=$dir$base.d
+    tmpdepfile2=$dir.libs/$base.d
+    "$@" -Wc,+Maked
+  else
+    tmpdepfile1=$dir$base.d
+    tmpdepfile2=$dir$base.d
+    "$@" +Maked
+  fi
+  stat=$?
+  if test $stat -ne 0; then
+     rm -f "$tmpdepfile1" "$tmpdepfile2"
+     exit $stat
+  fi
+
+  for tmpdepfile in "$tmpdepfile1" "$tmpdepfile2"
+  do
+    test -f "$tmpdepfile" && break
+  done
+  if test -f "$tmpdepfile"; then
+    sed -e "s,^.*\.[$lower]*:,$object:," "$tmpdepfile" > "$depfile"
+    # Add 'dependent.h:' lines.
+    sed -ne '2,${
+               s/^ *//
+               s/ \\*$//
+               s/$/:/
+               p
+             }' "$tmpdepfile" >> "$depfile"
+  else
+    make_dummy_depfile
+  fi
+  rm -f "$tmpdepfile" "$tmpdepfile2"
+  ;;
+
+tru64)
+  # The Tru64 compiler uses -MD to generate dependencies as a side
+  # effect.  'cc -MD -o foo.o ...' puts the dependencies into 'foo.o.d'.
+  # At least on Alpha/Redhat 6.1, Compaq CCC V6.2-504 seems to put
+  # dependencies in 'foo.d' instead, so we check for that too.
+  # Subdirectories are respected.
+  set_dir_from  "$object"
+  set_base_from "$object"
+
+  if test "$libtool" = yes; then
+    # Libtool generates 2 separate objects for the 2 libraries.  These
+    # two compilations output dependencies in $dir.libs/$base.o.d and
+    # in $dir$base.o.d.  We have to check for both files, because
+    # one of the two compilations can be disabled.  We should prefer
+    # $dir$base.o.d over $dir.libs/$base.o.d because the latter is
+    # automatically cleaned when .libs/ is deleted, while ignoring
+    # the former would cause a distcleancheck panic.
+    tmpdepfile1=$dir$base.o.d          # libtool 1.5
+    tmpdepfile2=$dir.libs/$base.o.d    # Likewise.
+    tmpdepfile3=$dir.libs/$base.d      # Compaq CCC V6.2-504
+    "$@" -Wc,-MD
+  else
+    tmpdepfile1=$dir$base.d
+    tmpdepfile2=$dir$base.d
+    tmpdepfile3=$dir$base.d
+    "$@" -MD
+  fi
+
+  stat=$?
+  if test $stat -ne 0; then
+    rm -f "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3"
+    exit $stat
+  fi
+
+  for tmpdepfile in "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3"
+  do
+    test -f "$tmpdepfile" && break
+  done
+  # Same post-processing that is required for AIX mode.
+  aix_post_process_depfile
+  ;;
+
+msvc7)
+  if test "$libtool" = yes; then
+    showIncludes=-Wc,-showIncludes
+  else
+    showIncludes=-showIncludes
+  fi
+  "$@" $showIncludes > "$tmpdepfile"
+  stat=$?
+  grep -v '^Note: including file: ' "$tmpdepfile"
+  if test $stat -ne 0; then
+    rm -f "$tmpdepfile"
+    exit $stat
+  fi
+  rm -f "$depfile"
+  echo "$object : \\" > "$depfile"
+  # The first sed program below extracts the file names and escapes
+  # backslashes for cygpath.  The second sed program outputs the file
+  # name when reading, but also accumulates all include files in the
+  # hold buffer in order to output them again at the end.  This only
+  # works with sed implementations that can handle large buffers.
+  sed < "$tmpdepfile" -n '
+/^Note: including file:  *\(.*\)/ {
+  s//\1/
+  s/\\/\\\\/g
+  p
+}' | $cygpath_u | sort -u | sed -n '
+s/ /\\ /g
+s/\(.*\)/'"$tab"'\1 \\/p
+s/.\(.*\) \\/\1:/
+H
+$ {
+  s/.*/'"$tab"'/
+  G
+  p
+}' >> "$depfile"
+  echo >> "$depfile" # make sure the fragment doesn't end with a backslash
+  rm -f "$tmpdepfile"
+  ;;
+
+msvc7msys)
+  # This case exists only to let depend.m4 do its work.  It works by
+  # looking at the text of this script.  This case will never be run,
+  # since it is checked for above.
+  exit 1
+  ;;
+
+#nosideeffect)
+  # This comment above is used by automake to tell side-effect
+  # dependency tracking mechanisms from slower ones.
+
+dashmstdout)
+  # Important note: in order to support this mode, a compiler *must*
+  # always write the preprocessed file to stdout, regardless of -o.
+  "$@" || exit $?
+
+  # Remove the call to Libtool.
+  if test "$libtool" = yes; then
+    while test "X$1" != 'X--mode=compile'; do
+      shift
+    done
+    shift
+  fi
+
+  # Remove '-o $object'.
+  IFS=" "
+  for arg
+  do
+    case $arg in
+    -o)
+      shift
+      ;;
+    $object)
+      shift
+      ;;
+    *)
+      set fnord "$@" "$arg"
+      shift # fnord
+      shift # $arg
+      ;;
+    esac
+  done
+
+  test -z "$dashmflag" && dashmflag=-M
+  # Require at least two characters before searching for ':'
+  # in the target name.  This is to cope with DOS-style filenames:
+  # a dependency such as 'c:/foo/bar' could be seen as target 'c' otherwise.
+  "$@" $dashmflag |
+    sed "s|^[$tab ]*[^:$tab ][^:][^:]*:[$tab ]*|$object: |" > "$tmpdepfile"
+  rm -f "$depfile"
+  cat < "$tmpdepfile" > "$depfile"
+  # Some versions of the HPUX 10.20 sed can't process this sed invocation
+  # correctly.  Breaking it into two sed invocations is a workaround.
+  tr ' ' "$nl" < "$tmpdepfile" \
+    | sed -e 's/^\\$//' -e '/^$/d' -e '/:$/d' \
+    | sed -e 's/$/ :/' >> "$depfile"
+  rm -f "$tmpdepfile"
+  ;;
+
+dashXmstdout)
+  # This case only exists to satisfy depend.m4.  It is never actually
+  # run, as this mode is specially recognized in the preamble.
+  exit 1
+  ;;
+
+makedepend)
+  "$@" || exit $?
+  # Remove any Libtool call
+  if test "$libtool" = yes; then
+    while test "X$1" != 'X--mode=compile'; do
+      shift
+    done
+    shift
+  fi
+  # X makedepend
+  shift
+  cleared=no eat=no
+  for arg
+  do
+    case $cleared in
+    no)
+      set ""; shift
+      cleared=yes ;;
+    esac
+    if test $eat = yes; then
+      eat=no
+      continue
+    fi
+    case "$arg" in
+    -D*|-I*)
+      set fnord "$@" "$arg"; shift ;;
+    # Strip any option that makedepend may not understand.  Remove
+    # the object too, otherwise makedepend will parse it as a source file.
+    -arch)
+      eat=yes ;;
+    -*|$object)
+      ;;
+    *)
+      set fnord "$@" "$arg"; shift ;;
+    esac
+  done
+  obj_suffix=`echo "$object" | sed 's/^.*\././'`
+  touch "$tmpdepfile"
+  ${MAKEDEPEND-makedepend} -o"$obj_suffix" -f"$tmpdepfile" "$@"
+  rm -f "$depfile"
+  # makedepend may prepend the VPATH from the source file name to the object.
+  # No need to regex-escape $object, excess matching of '.' is harmless.
+  sed "s|^.*\($object *:\)|\1|" "$tmpdepfile" > "$depfile"
+  # Some versions of the HPUX 10.20 sed can't process the last invocation
+  # correctly.  Breaking it into two sed invocations is a workaround.
+  sed '1,2d' "$tmpdepfile" \
+    | tr ' ' "$nl" \
+    | sed -e 's/^\\$//' -e '/^$/d' -e '/:$/d' \
+    | sed -e 's/$/ :/' >> "$depfile"
+  rm -f "$tmpdepfile" "$tmpdepfile".bak
+  ;;
+
+cpp)
+  # Important note: in order to support this mode, a compiler *must*
+  # always write the preprocessed file to stdout.
+  "$@" || exit $?
+
+  # Remove the call to Libtool.
+  if test "$libtool" = yes; then
+    while test "X$1" != 'X--mode=compile'; do
+      shift
+    done
+    shift
+  fi
+
+  # Remove '-o $object'.
+  IFS=" "
+  for arg
+  do
+    case $arg in
+    -o)
+      shift
+      ;;
+    $object)
+      shift
+      ;;
+    *)
+      set fnord "$@" "$arg"
+      shift # fnord
+      shift # $arg
+      ;;
+    esac
+  done
+
+  "$@" -E \
+    | sed -n -e '/^# [0-9][0-9]* "\([^"]*\)".*/ s:: \1 \\:p' \
+             -e '/^#line [0-9][0-9]* "\([^"]*\)".*/ s:: \1 \\:p' \
+    | sed '$ s: \\$::' > "$tmpdepfile"
+  rm -f "$depfile"
+  echo "$object : \\" > "$depfile"
+  cat < "$tmpdepfile" >> "$depfile"
+  sed < "$tmpdepfile" '/^$/d;s/^ //;s/ \\$//;s/$/ :/' >> "$depfile"
+  rm -f "$tmpdepfile"
+  ;;
+
+msvisualcpp)
+  # Important note: in order to support this mode, a compiler *must*
+  # always write the preprocessed file to stdout.
+  "$@" || exit $?
+
+  # Remove the call to Libtool.
+  if test "$libtool" = yes; then
+    while test "X$1" != 'X--mode=compile'; do
+      shift
+    done
+    shift
+  fi
+
+  IFS=" "
+  for arg
+  do
+    case "$arg" in
+    -o)
+      shift
+      ;;
+    $object)
+      shift
+      ;;
+    "-Gm"|"/Gm"|"-Gi"|"/Gi"|"-ZI"|"/ZI")
+        set fnord "$@"
+        shift
+        shift
+        ;;
+    *)
+        set fnord "$@" "$arg"
+        shift
+        shift
+        ;;
+    esac
+  done
+  "$@" -E 2>/dev/null |
+  sed -n '/^#line [0-9][0-9]* "\([^"]*\)"/ s::\1:p' | $cygpath_u | sort -u > "$tmpdepfile"
+  rm -f "$depfile"
+  echo "$object : \\" > "$depfile"
+  sed < "$tmpdepfile" -n -e 's% %\\ %g' -e '/^\(.*\)$/ s::'"$tab"'\1 \\:p' >> "$depfile"
+  echo "$tab" >> "$depfile"
+  sed < "$tmpdepfile" -n -e 's% %\\ %g' -e '/^\(.*\)$/ s::\1\::p' >> "$depfile"
+  rm -f "$tmpdepfile"
+  ;;
+
+msvcmsys)
+  # This case exists only to let depend.m4 do its work.  It works by
+  # looking at the text of this script.  This case will never be run,
+  # since it is checked for above.
+  exit 1
+  ;;
+
+none)
+  exec "$@"
+  ;;
+
+*)
+  echo "Unknown depmode $depmode" 1>&2
+  exit 1
+  ;;
+esac
+
+exit 0
+
+# Local Variables:
+# mode: shell-script
+# sh-indentation: 2
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "scriptversion="
+# time-stamp-format: "%:y-%02m-%02d.%02H"
+# time-stamp-time-zone: "UTC"
+# time-stamp-end: "; # UTC"
+# End:

Added: vendor/jansson/dist/doc/Makefile.am
===================================================================
--- vendor/jansson/dist/doc/Makefile.am	                        (rev 0)
+++ vendor/jansson/dist/doc/Makefile.am	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,20 @@
+EXTRA_DIST = conf.py apiref.rst changes.rst conformance.rst		\
+	gettingstarted.rst github_commits.c index.rst portability.rst	\
+	tutorial.rst upgrading.rst ext/refcounting.py
+
+SPHINXBUILD = sphinx-build
+SPHINXOPTS = -d _build/doctrees $(SPHINXOPTS_EXTRA)
+
+html-local:
+	$(SPHINXBUILD) -b html $(SPHINXOPTS) $(srcdir) _build/html
+
+install-html-local: html
+	mkdir -p $(DESTDIR)$(htmldir)
+	cp -r _build/html $(DESTDIR)$(htmldir)
+
+uninstall-local:
+	rm -rf $(DESTDIR)$(htmldir)
+
+clean-local:
+	rm -rf _build
+	rm -f ext/refcounting.pyc

Added: vendor/jansson/dist/doc/Makefile.in
===================================================================
--- vendor/jansson/dist/doc/Makefile.in	                        (rev 0)
+++ vendor/jansson/dist/doc/Makefile.in	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,443 @@
+# Makefile.in generated by automake 1.14.1 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994-2013 Free Software Foundation, Inc.
+
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+ at SET_MAKE@
+VPATH = @srcdir@
+am__is_gnu_make = test -n '$(MAKEFILE_LIST)' && test -n '$(MAKELEVEL)'
+am__make_running_with_option = \
+  case $${target_option-} in \
+      ?) ;; \
+      *) echo "am__make_running_with_option: internal error: invalid" \
+              "target option '$${target_option-}' specified" >&2; \
+         exit 1;; \
+  esac; \
+  has_opt=no; \
+  sane_makeflags=$$MAKEFLAGS; \
+  if $(am__is_gnu_make); then \
+    sane_makeflags=$$MFLAGS; \
+  else \
+    case $$MAKEFLAGS in \
+      *\\[\ \	]*) \
+        bs=\\; \
+        sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \
+          | sed "s/$$bs$$bs[$$bs $$bs	]*//g"`;; \
+    esac; \
+  fi; \
+  skip_next=no; \
+  strip_trailopt () \
+  { \
+    flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \
+  }; \
+  for flg in $$sane_makeflags; do \
+    test $$skip_next = yes && { skip_next=no; continue; }; \
+    case $$flg in \
+      *=*|--*) continue;; \
+        -*I) strip_trailopt 'I'; skip_next=yes;; \
+      -*I?*) strip_trailopt 'I';; \
+        -*O) strip_trailopt 'O'; skip_next=yes;; \
+      -*O?*) strip_trailopt 'O';; \
+        -*l) strip_trailopt 'l'; skip_next=yes;; \
+      -*l?*) strip_trailopt 'l';; \
+      -[dEDm]) skip_next=yes;; \
+      -[JT]) skip_next=yes;; \
+    esac; \
+    case $$flg in \
+      *$$target_option*) has_opt=yes; break;; \
+    esac; \
+  done; \
+  test $$has_opt = yes
+am__make_dryrun = (target_option=n; $(am__make_running_with_option))
+am__make_keepgoing = (target_option=k; $(am__make_running_with_option))
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+subdir = doc
+DIST_COMMON = $(srcdir)/Makefile.in $(srcdir)/Makefile.am README
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+	$(ACLOCAL_M4)
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = $(top_builddir)/jansson_private_config.h
+CONFIG_CLEAN_FILES =
+CONFIG_CLEAN_VPATH_FILES =
+AM_V_P = $(am__v_P_ at AM_V@)
+am__v_P_ = $(am__v_P_ at AM_DEFAULT_V@)
+am__v_P_0 = false
+am__v_P_1 = :
+AM_V_GEN = $(am__v_GEN_ at AM_V@)
+am__v_GEN_ = $(am__v_GEN_ at AM_DEFAULT_V@)
+am__v_GEN_0 = @echo "  GEN     " $@;
+am__v_GEN_1 = 
+AM_V_at = $(am__v_at_ at AM_V@)
+am__v_at_ = $(am__v_at_ at AM_DEFAULT_V@)
+am__v_at_0 = @
+am__v_at_1 = 
+SOURCES =
+DIST_SOURCES =
+am__can_run_installinfo = \
+  case $$AM_UPDATE_INFO_DIR in \
+    n|no|NO) false;; \
+    *) (install-info --version) >/dev/null 2>&1;; \
+  esac
+am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP)
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AM_CFLAGS = @AM_CFLAGS@
+AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DLLTOOL = @DLLTOOL@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+GREP = @GREP@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+LD = @LD@
+LDFLAGS = @LDFLAGS@
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+MAKEINFO = @MAKEINFO@
+MANIFEST_TOOL = @MANIFEST_TOOL@
+MKDIR_P = @MKDIR_P@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_URL = @PACKAGE_URL@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+VERSION = @VERSION@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+json_have_localeconv = @json_have_localeconv@
+json_have_long_long = @json_have_long_long@
+json_inline = @json_inline@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+EXTRA_DIST = conf.py apiref.rst changes.rst conformance.rst		\
+	gettingstarted.rst github_commits.c index.rst portability.rst	\
+	tutorial.rst upgrading.rst ext/refcounting.py
+
+SPHINXBUILD = sphinx-build
+SPHINXOPTS = -d _build/doctrees $(SPHINXOPTS_EXTRA)
+all: all-am
+
+.SUFFIXES:
+$(srcdir)/Makefile.in:  $(srcdir)/Makefile.am  $(am__configure_deps)
+	@for dep in $?; do \
+	  case '$(am__configure_deps)' in \
+	    *$$dep*) \
+	      ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \
+	        && { if test -f $@; then exit 0; else break; fi; }; \
+	      exit 1;; \
+	  esac; \
+	done; \
+	echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign doc/Makefile'; \
+	$(am__cd) $(top_srcdir) && \
+	  $(AUTOMAKE) --foreign doc/Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+	@case '$?' in \
+	  *config.status*) \
+	    cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
+	  *) \
+	    echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
+	    cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+	esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+
+$(top_srcdir)/configure:  $(am__configure_deps)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(ACLOCAL_M4):  $(am__aclocal_m4_deps)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(am__aclocal_m4_deps):
+
+mostlyclean-libtool:
+	-rm -f *.lo
+
+clean-libtool:
+	-rm -rf .libs _libs
+tags TAGS:
+
+ctags CTAGS:
+
+cscope cscopelist:
+
+
+distdir: $(DISTFILES)
+	@srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	list='$(DISTFILES)'; \
+	  dist_files=`for file in $$list; do echo $$file; done | \
+	  sed -e "s|^$$srcdirstrip/||;t" \
+	      -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+	case $$dist_files in \
+	  */*) $(MKDIR_P) `echo "$$dist_files" | \
+			   sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+			   sort -u` ;; \
+	esac; \
+	for file in $$dist_files; do \
+	  if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+	  if test -d $$d/$$file; then \
+	    dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+	    if test -d "$(distdir)/$$file"; then \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+	      cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+	  else \
+	    test -f "$(distdir)/$$file" \
+	    || cp -p $$d/$$file "$(distdir)/$$file" \
+	    || exit 1; \
+	  fi; \
+	done
+check-am: all-am
+check: check-am
+all-am: Makefile
+installdirs:
+install: install-am
+install-exec: install-exec-am
+install-data: install-data-am
+uninstall: uninstall-am
+
+install-am: all-am
+	@$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-am
+install-strip:
+	if test -z '$(STRIP)'; then \
+	  $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+	    install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+	      install; \
+	else \
+	  $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+	    install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+	    "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \
+	fi
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+	-test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+	-test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+
+maintainer-clean-generic:
+	@echo "This command is intended for maintainers to use"
+	@echo "it deletes files that may require special tools to rebuild."
+clean: clean-am
+
+clean-am: clean-generic clean-libtool clean-local mostlyclean-am
+
+distclean: distclean-am
+	-rm -f Makefile
+distclean-am: clean-am distclean-generic
+
+dvi: dvi-am
+
+dvi-am:
+
+html: html-am
+
+html-am: html-local
+
+info: info-am
+
+info-am:
+
+install-data-am:
+
+install-dvi: install-dvi-am
+
+install-dvi-am:
+
+install-exec-am:
+
+install-html: install-html-am
+
+install-html-am: install-html-local
+
+install-info: install-info-am
+
+install-info-am:
+
+install-man:
+
+install-pdf: install-pdf-am
+
+install-pdf-am:
+
+install-ps: install-ps-am
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-am
+	-rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-am
+
+mostlyclean-am: mostlyclean-generic mostlyclean-libtool
+
+pdf: pdf-am
+
+pdf-am:
+
+ps: ps-am
+
+ps-am:
+
+uninstall-am: uninstall-local
+
+.MAKE: install-am install-strip
+
+.PHONY: all all-am check check-am clean clean-generic clean-libtool \
+	clean-local cscopelist-am ctags-am distclean distclean-generic \
+	distclean-libtool distdir dvi dvi-am html html-am html-local \
+	info info-am install install-am install-data install-data-am \
+	install-dvi install-dvi-am install-exec install-exec-am \
+	install-html install-html-am install-html-local install-info \
+	install-info-am install-man install-pdf install-pdf-am \
+	install-ps install-ps-am install-strip installcheck \
+	installcheck-am installdirs maintainer-clean \
+	maintainer-clean-generic mostlyclean mostlyclean-generic \
+	mostlyclean-libtool pdf pdf-am ps ps-am tags-am uninstall \
+	uninstall-am uninstall-local
+
+
+html-local:
+	$(SPHINXBUILD) -b html $(SPHINXOPTS) $(srcdir) _build/html
+
+install-html-local: html
+	mkdir -p $(DESTDIR)$(htmldir)
+	cp -r _build/html $(DESTDIR)$(htmldir)
+
+uninstall-local:
+	rm -rf $(DESTDIR)$(htmldir)
+
+clean-local:
+	rm -rf _build
+	rm -f ext/refcounting.pyc
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:

Added: vendor/jansson/dist/doc/README
===================================================================
--- vendor/jansson/dist/doc/README	                        (rev 0)
+++ vendor/jansson/dist/doc/README	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,5 @@
+To build the documentation, invoke
+
+    make html
+
+Then point your browser to _build/html/index.html.

Added: vendor/jansson/dist/doc/apiref.rst
===================================================================
--- vendor/jansson/dist/doc/apiref.rst	                        (rev 0)
+++ vendor/jansson/dist/doc/apiref.rst	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,1602 @@
+.. _apiref:
+
+*************
+API Reference
+*************
+
+.. highlight:: c
+
+Preliminaries
+=============
+
+All declarations are in :file:`jansson.h`, so it's enough to
+
+::
+
+   #include <jansson.h>
+
+in each source file.
+
+All constants are prefixed with ``JSON_`` (except for those describing
+the library version, prefixed with ``JANSSON_``). Other identifiers
+are prefixed with ``json_``. Type names are suffixed with ``_t`` and
+``typedef``\ 'd so that the ``struct`` keyword need not be used.
+
+
+Library Version
+===============
+
+The Jansson version is of the form *A.B.C*, where *A* is the major
+version, *B* is the minor version and *C* is the micro version. If the
+micro version is zero, it's omitted from the version string, i.e. the
+version string is just *A.B*.
+
+When a new release only fixes bugs and doesn't add new features or
+functionality, the micro version is incremented. When new features are
+added in a backwards compatible way, the minor version is incremented
+and the micro version is set to zero. When there are backwards
+incompatible changes, the major version is incremented and others are
+set to zero.
+
+The following preprocessor constants specify the current version of
+the library:
+
+``JANSSON_MAJOR_VERSION``, ``JANSSON_MINOR_VERSION``, ``JANSSON_MICRO_VERSION``
+  Integers specifying the major, minor and micro versions,
+  respectively.
+
+``JANSSON_VERSION``
+  A string representation of the current version, e.g. ``"1.2.1"`` or
+  ``"1.3"``.
+
+``JANSSON_VERSION_HEX``
+  A 3-byte hexadecimal representation of the version, e.g.
+  ``0x010201`` for version 1.2.1 and ``0x010300`` for version 1.3.
+  This is useful in numeric comparisions, e.g.::
+
+      #if JANSSON_VERSION_HEX >= 0x010300
+      /* Code specific to version 1.3 and above */
+      #endif
+
+
+Value Representation
+====================
+
+The JSON specification (:rfc:`4627`) defines the following data types:
+*object*, *array*, *string*, *number*, *boolean*, and *null*. JSON
+types are used dynamically; arrays and objects can hold any other data
+type, including themselves. For this reason, Jansson's type system is
+also dynamic in nature. There's one C type to represent all JSON
+values, and this structure knows the type of the JSON value it holds.
+
+.. type:: json_t
+
+  This data structure is used throughout the library to represent all
+  JSON values. It always contains the type of the JSON value it holds
+  and the value's reference count. The rest depends on the type of the
+  value.
+
+Objects of :type:`json_t` are always used through a pointer. There
+are APIs for querying the type, manipulating the reference count, and
+for constructing and manipulating values of different types.
+
+Unless noted otherwise, all API functions return an error value if an
+error occurs. Depending on the function's signature, the error value
+is either *NULL* or -1. Invalid arguments or invalid input are
+apparent sources for errors. Memory allocation and I/O operations may
+also cause errors.
+
+
+Type
+----
+
+The type of a JSON value is queried and tested using the following
+functions:
+
+.. type:: enum json_type
+
+   The type of a JSON value. The following members are defined:
+
+   +--------------------+
+   | ``JSON_OBJECT``    |
+   +--------------------+
+   | ``JSON_ARRAY``     |
+   +--------------------+
+   | ``JSON_STRING``    |
+   +--------------------+
+   | ``JSON_INTEGER``   |
+   +--------------------+
+   | ``JSON_REAL``      |
+   +--------------------+
+   | ``JSON_TRUE``      |
+   +--------------------+
+   | ``JSON_FALSE``     |
+   +--------------------+
+   | ``JSON_NULL``      |
+   +--------------------+
+
+   These correspond to JSON object, array, string, number, boolean and
+   null. A number is represented by either a value of the type
+   ``JSON_INTEGER`` or of the type ``JSON_REAL``. A true boolean value
+   is represented by a value of the type ``JSON_TRUE`` and false by a
+   value of the type ``JSON_FALSE``.
+
+.. function:: int json_typeof(const json_t *json)
+
+   Return the type of the JSON value (a :type:`json_type` cast to
+   :type:`int`). *json* MUST NOT be *NULL*. This function is actually
+   implemented as a macro for speed.
+
+.. function:: json_is_object(const json_t *json)
+               json_is_array(const json_t *json)
+               json_is_string(const json_t *json)
+               json_is_integer(const json_t *json)
+               json_is_real(const json_t *json)
+               json_is_true(const json_t *json)
+               json_is_false(const json_t *json)
+               json_is_null(const json_t *json)
+
+   These functions (actually macros) return true (non-zero) for values
+   of the given type, and false (zero) for values of other types and
+   for *NULL*.
+
+.. function:: json_is_number(const json_t *json)
+
+   Returns true for values of types ``JSON_INTEGER`` and
+   ``JSON_REAL``, and false for other types and for *NULL*.
+
+.. function:: json_is_boolean(const json_t *json)
+
+   Returns true for types ``JSON_TRUE`` and ``JSON_FALSE``, and false
+   for values of other types and for *NULL*.
+
+.. function:: json_boolean_value(const json_t *json)
+
+   Alias of :func:`json_is_true()`, i.e. returns 1 for ``JSON_TRUE``
+   and 0 otherwise.
+
+   .. versionadded:: 2.7
+
+
+.. _apiref-reference-count:
+
+Reference Count
+---------------
+
+The reference count is used to track whether a value is still in use
+or not. When a value is created, it's reference count is set to 1. If
+a reference to a value is kept (e.g. a value is stored somewhere for
+later use), its reference count is incremented, and when the value is
+no longer needed, the reference count is decremented. When the
+reference count drops to zero, there are no references left, and the
+value can be destroyed.
+
+The following functions are used to manipulate the reference count.
+
+.. function:: json_t *json_incref(json_t *json)
+
+   Increment the reference count of *json* if it's not *NULL*.
+   Returns *json*.
+
+.. function:: void json_decref(json_t *json)
+
+   Decrement the reference count of *json*. As soon as a call to
+   :func:`json_decref()` drops the reference count to zero, the value
+   is destroyed and it can no longer be used.
+
+Functions creating new JSON values set the reference count to 1. These
+functions are said to return a **new reference**. Other functions
+returning (existing) JSON values do not normally increase the
+reference count. These functions are said to return a **borrowed
+reference**. So, if the user will hold a reference to a value returned
+as a borrowed reference, he must call :func:`json_incref`. As soon as
+the value is no longer needed, :func:`json_decref` should be called
+to release the reference.
+
+Normally, all functions accepting a JSON value as an argument will
+manage the reference, i.e. increase and decrease the reference count
+as needed. However, some functions **steal** the reference, i.e. they
+have the same result as if the user called :func:`json_decref()` on
+the argument right after calling the function. These functions are
+suffixed with ``_new`` or have ``_new_`` somewhere in their name.
+
+For example, the following code creates a new JSON array and appends
+an integer to it::
+
+  json_t *array, *integer;
+
+  array = json_array();
+  integer = json_integer(42);
+
+  json_array_append(array, integer);
+  json_decref(integer);
+
+Note how the caller has to release the reference to the integer value
+by calling :func:`json_decref()`. By using a reference stealing
+function :func:`json_array_append_new()` instead of
+:func:`json_array_append()`, the code becomes much simpler::
+
+  json_t *array = json_array();
+  json_array_append_new(array, json_integer(42));
+
+In this case, the user doesn't have to explicitly release the
+reference to the integer value, as :func:`json_array_append_new()`
+steals the reference when appending the value to the array.
+
+In the following sections it is clearly documented whether a function
+will return a new or borrowed reference or steal a reference to its
+argument.
+
+
+Circular References
+-------------------
+
+A circular reference is created when an object or an array is,
+directly or indirectly, inserted inside itself. The direct case is
+simple::
+
+  json_t *obj = json_object();
+  json_object_set(obj, "foo", obj);
+
+Jansson will refuse to do this, and :func:`json_object_set()` (and
+all the other such functions for objects and arrays) will return with
+an error status. The indirect case is the dangerous one::
+
+  json_t *arr1 = json_array(), *arr2 = json_array();
+  json_array_append(arr1, arr2);
+  json_array_append(arr2, arr1);
+
+In this example, the array ``arr2`` is contained in the array
+``arr1``, and vice versa. Jansson cannot check for this kind of
+indirect circular references without a performance hit, so it's up to
+the user to avoid them.
+
+If a circular reference is created, the memory consumed by the values
+cannot be freed by :func:`json_decref()`. The reference counts never
+drops to zero because the values are keeping the references to each
+other. Moreover, trying to encode the values with any of the encoding
+functions will fail. The encoder detects circular references and
+returns an error status.
+
+
+True, False and Null
+====================
+
+These three values are implemented as singletons, so the returned
+pointers won't change between invocations of these functions.
+
+.. function:: json_t *json_true(void)
+
+   .. refcounting:: new
+
+   Returns the JSON true value.
+
+.. function:: json_t *json_false(void)
+
+   .. refcounting:: new
+
+   Returns the JSON false value.
+
+.. function:: json_t *json_boolean(val)
+
+   .. refcounting:: new
+
+   Returns JSON false if ``val`` is zero, and JSON true otherwise.
+   This is a macro, and equivalent to ``val ? json_true() :
+   json_false()``.
+
+   .. versionadded:: 2.4
+
+
+.. function:: json_t *json_null(void)
+
+   .. refcounting:: new
+
+   Returns the JSON null value.
+
+
+String
+======
+
+Jansson uses UTF-8 as the character encoding. All JSON strings must be
+valid UTF-8 (or ASCII, as it's a subset of UTF-8). All Unicode
+codepoints U+0000 through U+10FFFF are allowed, but you must use
+length-aware functions if you wish to embed NUL bytes in strings.
+
+.. function:: json_t *json_string(const char *value)
+
+   .. refcounting:: new
+
+   Returns a new JSON string, or *NULL* on error. *value* must be a
+   valid null terminated UTF-8 encoded Unicode string.
+
+.. function:: json_t *json_stringn(const char *value, size_t len)
+
+   .. refcounting:: new
+
+   Like :func:`json_string`, but with explicit length, so *value* may
+   contain null characters or not be null terminated.
+
+.. function:: json_t *json_string_nocheck(const char *value)
+
+   .. refcounting:: new
+
+   Like :func:`json_string`, but doesn't check that *value* is valid
+   UTF-8. Use this function only if you are certain that this really
+   is the case (e.g. you have already checked it by other means).
+
+.. function:: json_t *json_stringn_nocheck(const char *value, size_t len)
+
+   .. refcounting:: new
+
+   Like :func:`json_string_nocheck`, but with explicit length, so
+   *value* may contain null characters or not be null terminated.
+
+.. function:: const char *json_string_value(const json_t *string)
+
+   Returns the associated value of *string* as a null terminated UTF-8
+   encoded string, or *NULL* if *string* is not a JSON string.
+
+   The retuned value is read-only and must not be modified or freed by
+   the user. It is valid as long as *string* exists, i.e. as long as
+   its reference count has not dropped to zero.
+
+.. function:: size_t json_string_length(const json_t *string)
+
+   Returns the length of *string* in its UTF-8 presentation, or zero
+   if *string* is not a JSON string.
+
+.. function:: int json_string_set(const json_t *string, const char *value)
+
+   Sets the associated value of *string* to *value*. *value* must be a
+   valid UTF-8 encoded Unicode string. Returns 0 on success and -1 on
+   error.
+
+.. function:: int json_string_setn(json_t *string, const char *value, size_t len)
+
+   Like :func:`json_string_set`, but with explicit length, so *value*
+   may contain null characters or not be null terminated.
+
+.. function:: int json_string_set_nocheck(const json_t *string, const char *value)
+
+   Like :func:`json_string_set`, but doesn't check that *value* is
+   valid UTF-8. Use this function only if you are certain that this
+   really is the case (e.g. you have already checked it by other
+   means).
+
+.. function:: int json_string_setn_nocheck(json_t *string, const char *value, size_t len)
+
+   Like :func:`json_string_set_nocheck`, but with explicit length,
+   so *value* may contain null characters or not be null terminated.
+
+
+Number
+======
+
+The JSON specification only contains one numeric type, "number". The C
+programming language has distinct types for integer and floating-point
+numbers, so for practical reasons Jansson also has distinct types for
+the two. They are called "integer" and "real", respectively. For more
+information, see :ref:`rfc-conformance`.
+
+.. type:: json_int_t
+
+   This is the C type that is used to store JSON integer values. It
+   represents the widest integer type available on your system. In
+   practice it's just a typedef of ``long long`` if your compiler
+   supports it, otherwise ``long``.
+
+   Usually, you can safely use plain ``int`` in place of
+   ``json_int_t``, and the implicit C integer conversion handles the
+   rest. Only when you know that you need the full 64-bit range, you
+   should use ``json_int_t`` explicitly.
+
+``JSON_INTEGER_IS_LONG_LONG``
+   This is a preprocessor variable that holds the value 1 if
+   :type:`json_int_t` is ``long long``, and 0 if it's ``long``. It
+   can be used as follows::
+
+       #if JSON_INTEGER_IS_LONG_LONG
+       /* Code specific for long long */
+       #else
+       /* Code specific for long */
+       #endif
+
+``JSON_INTEGER_FORMAT``
+   This is a macro that expands to a :func:`printf()` conversion
+   specifier that corresponds to :type:`json_int_t`, without the
+   leading ``%`` sign, i.e. either ``"lld"`` or ``"ld"``. This macro
+   is required because the actual type of :type:`json_int_t` can be
+   either ``long`` or ``long long``, and :func:`printf()` reuiqres
+   different length modifiers for the two.
+
+   Example::
+
+       json_int_t x = 123123123;
+       printf("x is %" JSON_INTEGER_FORMAT "\n", x);
+
+
+.. function:: json_t *json_integer(json_int_t value)
+
+   .. refcounting:: new
+
+   Returns a new JSON integer, or *NULL* on error.
+
+.. function:: json_int_t json_integer_value(const json_t *integer)
+
+   Returns the associated value of *integer*, or 0 if *json* is not a
+   JSON integer.
+
+.. function:: int json_integer_set(const json_t *integer, json_int_t value)
+
+   Sets the associated value of *integer* to *value*. Returns 0 on
+   success and -1 if *integer* is not a JSON integer.
+
+.. function:: json_t *json_real(double value)
+
+   .. refcounting:: new
+
+   Returns a new JSON real, or *NULL* on error.
+
+.. function:: double json_real_value(const json_t *real)
+
+   Returns the associated value of *real*, or 0.0 if *real* is not a
+   JSON real.
+
+.. function:: int json_real_set(const json_t *real, double value)
+
+   Sets the associated value of *real* to *value*. Returns 0 on
+   success and -1 if *real* is not a JSON real.
+
+In addition to the functions above, there's a common query function
+for integers and reals:
+
+.. function:: double json_number_value(const json_t *json)
+
+   Returns the associated value of the JSON integer or JSON real
+   *json*, cast to double regardless of the actual type. If *json* is
+   neither JSON real nor JSON integer, 0.0 is returned.
+
+
+Array
+=====
+
+A JSON array is an ordered collection of other JSON values.
+
+.. function:: json_t *json_array(void)
+
+   .. refcounting:: new
+
+   Returns a new JSON array, or *NULL* on error. Initially, the array
+   is empty.
+
+.. function:: size_t json_array_size(const json_t *array)
+
+   Returns the number of elements in *array*, or 0 if *array* is NULL
+   or not a JSON array.
+
+.. function:: json_t *json_array_get(const json_t *array, size_t index)
+
+   .. refcounting:: borrow
+
+   Returns the element in *array* at position *index*. The valid range
+   for *index* is from 0 to the return value of
+   :func:`json_array_size()` minus 1. If *array* is not a JSON array,
+   if *array* is *NULL*, or if *index* is out of range, *NULL* is
+   returned.
+
+.. function:: int json_array_set(json_t *array, size_t index, json_t *value)
+
+   Replaces the element in *array* at position *index* with *value*.
+   The valid range for *index* is from 0 to the return value of
+   :func:`json_array_size()` minus 1. Returns 0 on success and -1 on
+   error.
+
+.. function:: int json_array_set_new(json_t *array, size_t index, json_t *value)
+
+   Like :func:`json_array_set()` but steals the reference to *value*.
+   This is useful when *value* is newly created and not used after
+   the call.
+
+.. function:: int json_array_append(json_t *array, json_t *value)
+
+   Appends *value* to the end of *array*, growing the size of *array*
+   by 1. Returns 0 on success and -1 on error.
+
+.. function:: int json_array_append_new(json_t *array, json_t *value)
+
+   Like :func:`json_array_append()` but steals the reference to
+   *value*. This is useful when *value* is newly created and not used
+   after the call.
+
+.. function:: int json_array_insert(json_t *array, size_t index, json_t *value)
+
+   Inserts *value* to *array* at position *index*, shifting the
+   elements at *index* and after it one position towards the end of
+   the array. Returns 0 on success and -1 on error.
+
+.. function:: int json_array_insert_new(json_t *array, size_t index, json_t *value)
+
+   Like :func:`json_array_insert()` but steals the reference to
+   *value*. This is useful when *value* is newly created and not used
+   after the call.
+
+.. function:: int json_array_remove(json_t *array, size_t index)
+
+   Removes the element in *array* at position *index*, shifting the
+   elements after *index* one position towards the start of the array.
+   Returns 0 on success and -1 on error. The reference count of the
+   removed value is decremented.
+
+.. function:: int json_array_clear(json_t *array)
+
+   Removes all elements from *array*. Returns 0 on sucess and -1 on
+   error. The reference count of all removed values are decremented.
+
+.. function:: int json_array_extend(json_t *array, json_t *other_array)
+
+   Appends all elements in *other_array* to the end of *array*.
+   Returns 0 on success and -1 on error.
+
+The following macro can be used to iterate through all elements
+in an array.
+
+.. function:: json_array_foreach(array, index, value)
+
+   Iterate over every element of ``array``, running the block
+   of code that follows each time with the proper values set to
+   variables ``index`` and ``value``, of types :type:`size_t` and
+   :type:`json_t *` respectively. Example::
+
+       /* array is a JSON array */
+       size_t index;
+       json_t *value;
+
+       json_array_foreach(array, index, value) {
+           /* block of code that uses index and value */
+       }
+
+   The items are returned in increasing index order.
+
+   This macro expands to an ordinary ``for`` statement upon
+   preprocessing, so its performance is equivalent to that of
+   hand-written code using the array access functions.
+   The main advantage of this macro is that it abstracts
+   away the complexity, and makes for shorter, more
+   concise code.
+
+   .. versionadded:: 2.5
+
+
+Object
+======
+
+A JSON object is a dictionary of key-value pairs, where the key is a
+Unicode string and the value is any JSON value.
+
+Even though NUL bytes are allowed in string values, they are not
+allowed in object keys.
+
+.. function:: json_t *json_object(void)
+
+   .. refcounting:: new
+
+   Returns a new JSON object, or *NULL* on error. Initially, the
+   object is empty.
+
+.. function:: size_t json_object_size(const json_t *object)
+
+   Returns the number of elements in *object*, or 0 if *object* is not
+   a JSON object.
+
+.. function:: json_t *json_object_get(const json_t *object, const char *key)
+
+   .. refcounting:: borrow
+
+   Get a value corresponding to *key* from *object*. Returns *NULL* if
+   *key* is not found and on error.
+
+.. function:: int json_object_set(json_t *object, const char *key, json_t *value)
+
+   Set the value of *key* to *value* in *object*. *key* must be a
+   valid null terminated UTF-8 encoded Unicode string. If there
+   already is a value for *key*, it is replaced by the new value.
+   Returns 0 on success and -1 on error.
+
+.. function:: int json_object_set_nocheck(json_t *object, const char *key, json_t *value)
+
+   Like :func:`json_object_set`, but doesn't check that *key* is
+   valid UTF-8. Use this function only if you are certain that this
+   really is the case (e.g. you have already checked it by other
+   means).
+
+.. function:: int json_object_set_new(json_t *object, const char *key, json_t *value)
+
+   Like :func:`json_object_set()` but steals the reference to
+   *value*. This is useful when *value* is newly created and not used
+   after the call.
+
+.. function:: int json_object_set_new_nocheck(json_t *object, const char *key, json_t *value)
+
+   Like :func:`json_object_set_new`, but doesn't check that *key* is
+   valid UTF-8. Use this function only if you are certain that this
+   really is the case (e.g. you have already checked it by other
+   means).
+
+.. function:: int json_object_del(json_t *object, const char *key)
+
+   Delete *key* from *object* if it exists. Returns 0 on success, or
+   -1 if *key* was not found. The reference count of the removed value
+   is decremented.
+
+.. function:: int json_object_clear(json_t *object)
+
+   Remove all elements from *object*. Returns 0 on success and -1 if
+   *object* is not a JSON object. The reference count of all removed
+   values are decremented.
+
+.. function:: int json_object_update(json_t *object, json_t *other)
+
+   Update *object* with the key-value pairs from *other*, overwriting
+   existing keys. Returns 0 on success or -1 on error.
+
+.. function:: int json_object_update_existing(json_t *object, json_t *other)
+
+   Like :func:`json_object_update()`, but only the values of existing
+   keys are updated. No new keys are created. Returns 0 on success or
+   -1 on error.
+
+   .. versionadded:: 2.3
+
+.. function:: int json_object_update_missing(json_t *object, json_t *other)
+
+   Like :func:`json_object_update()`, but only new keys are created.
+   The value of any existing key is not changed. Returns 0 on success
+   or -1 on error.
+
+   .. versionadded:: 2.3
+
+The following macro can be used to iterate through all key-value pairs
+in an object.
+
+.. function:: json_object_foreach(object, key, value)
+
+   Iterate over every key-value pair of ``object``, running the block
+   of code that follows each time with the proper values set to
+   variables ``key`` and ``value``, of types :type:`const char *` and
+   :type:`json_t *` respectively. Example::
+
+       /* obj is a JSON object */
+       const char *key;
+       json_t *value;
+
+       json_object_foreach(obj, key, value) {
+           /* block of code that uses key and value */
+       }
+
+   The items are not returned in any particular order.
+
+   This macro expands to an ordinary ``for`` statement upon
+   preprocessing, so its performance is equivalent to that of
+   hand-written iteration code using the object iteration protocol
+   (see below). The main advantage of this macro is that it abstracts
+   away the complexity behind iteration, and makes for shorter, more
+   concise code.
+
+   .. versionadded:: 2.3
+
+
+The following functions implement an iteration protocol for objects,
+allowing to iterate through all key-value pairs in an object. The
+items are not returned in any particular order, as this would require
+sorting due to the internal hashtable implementation.
+
+.. function:: void *json_object_iter(json_t *object)
+
+   Returns an opaque iterator which can be used to iterate over all
+   key-value pairs in *object*, or *NULL* if *object* is empty.
+
+.. function:: void *json_object_iter_at(json_t *object, const char *key)
+
+   Like :func:`json_object_iter()`, but returns an iterator to the
+   key-value pair in *object* whose key is equal to *key*, or NULL if
+   *key* is not found in *object*. Iterating forward to the end of
+   *object* only yields all key-value pairs of the object if *key*
+   happens to be the first key in the underlying hash table.
+
+.. function:: void *json_object_iter_next(json_t *object, void *iter)
+
+   Returns an iterator pointing to the next key-value pair in *object*
+   after *iter*, or *NULL* if the whole object has been iterated
+   through.
+
+.. function:: const char *json_object_iter_key(void *iter)
+
+   Extract the associated key from *iter*.
+
+.. function:: json_t *json_object_iter_value(void *iter)
+
+   .. refcounting:: borrow
+
+   Extract the associated value from *iter*.
+
+.. function:: int json_object_iter_set(json_t *object, void *iter, json_t *value)
+
+   Set the value of the key-value pair in *object*, that is pointed to
+   by *iter*, to *value*.
+
+.. function:: int json_object_iter_set_new(json_t *object, void *iter, json_t *value)
+
+   Like :func:`json_object_iter_set()`, but steals the reference to
+   *value*. This is useful when *value* is newly created and not used
+   after the call.
+
+.. function:: void *json_object_key_to_iter(const char *key)
+
+   Like :func:`json_object_iter_at()`, but much faster. Only works for
+   values returned by :func:`json_object_iter_key()`. Using other keys
+   will lead to segfaults. This function is used internally to
+   implement :func:`json_object_foreach`.
+
+   .. versionadded:: 2.3
+
+The iteration protocol can be used for example as follows::
+
+   /* obj is a JSON object */
+   const char *key;
+   json_t *value;
+
+   void *iter = json_object_iter(obj);
+   while(iter)
+   {
+       key = json_object_iter_key(iter);
+       value = json_object_iter_value(iter);
+       /* use key and value ... */
+       iter = json_object_iter_next(obj, iter);
+   }
+
+.. function:: void json_object_seed(size_t seed)
+
+    Seed the hash function used in Jansson's hashtable implementation.
+    The seed is used to randomize the hash function so that an
+    attacker cannot control its output.
+
+    If *seed* is 0, Jansson generates the seed itselfy by reading
+    random data from the operating system's entropy sources. If no
+    entropy sources are available, falls back to using a combination
+    of the current timestamp (with microsecond precision if possible)
+    and the process ID.
+
+    If called at all, this function must be called before any calls to
+    :func:`json_object()`, either explicit or implicit. If this
+    function is not called by the user, the first call to
+    :func:`json_object()` (either explicit or implicit) seeds the hash
+    function. See :ref:`portability-thread-safety` for notes on thread
+    safety.
+
+    If repeatable results are required, for e.g. unit tests, the hash
+    function can be "unrandomized" by calling :func:`json_object_seed`
+    with a constant value on program startup, e.g.
+    ``json_object_seed(1)``.
+
+    .. versionadded:: 2.6
+
+
+Error reporting
+===============
+
+Jansson uses a single struct type to pass error information to the
+user. See sections :ref:`apiref-decoding`, :ref:`apiref-pack` and
+:ref:`apiref-unpack` for functions that pass error information using
+this struct.
+
+.. type:: json_error_t
+
+   .. member:: char text[]
+
+      The error message (in UTF-8), or an empty string if a message is
+      not available.
+
+   .. member:: char source[]
+
+      Source of the error. This can be (a part of) the file name or a
+      special identifier in angle brackers (e.g. ``<string>``).
+
+   .. member:: int line
+
+      The line number on which the error occurred.
+
+   .. member:: int column
+
+      The column on which the error occurred. Note that this is the
+      *character column*, not the byte column, i.e. a multibyte UTF-8
+      character counts as one column.
+
+   .. member:: size_t position
+
+      The position in bytes from the start of the input. This is
+      useful for debugging Unicode encoding problems.
+
+The normal use of :type:`json_error_t` is to allocate it on the stack,
+and pass a pointer to a function. Example::
+
+   int main() {
+       json_t *json;
+       json_error_t error;
+
+       json = json_load_file("/path/to/file.json", 0, &error);
+       if(!json) {
+           /* the error variable contains error information */
+       }
+       ...
+   }
+
+Also note that if the call succeeded (``json != NULL`` in the above
+example), the contents of ``error`` are generally left unspecified.
+The decoding functions write to the ``position`` member also on
+success. See :ref:`apiref-decoding` for more info.
+
+All functions also accept *NULL* as the :type:`json_error_t` pointer,
+in which case no error information is returned to the caller.
+
+
+Encoding
+========
+
+This sections describes the functions that can be used to encode
+values to JSON. By default, only objects and arrays can be encoded
+directly, since they are the only valid *root* values of a JSON text.
+To encode any JSON value, use the ``JSON_ENCODE_ANY`` flag (see
+below).
+
+By default, the output has no newlines, and spaces are used between
+array and object elements for a readable output. This behavior can be
+altered by using the ``JSON_INDENT`` and ``JSON_COMPACT`` flags
+described below. A newline is never appended to the end of the encoded
+JSON data.
+
+Each function takes a *flags* parameter that controls some aspects of
+how the data is encoded. Its default value is 0. The following macros
+can be ORed together to obtain *flags*.
+
+``JSON_INDENT(n)``
+   Pretty-print the result, using newlines between array and object
+   items, and indenting with *n* spaces. The valid range for *n* is
+   between 0 and 31 (inclusive), other values result in an undefined
+   output. If ``JSON_INDENT`` is not used or *n* is 0, no newlines are
+   inserted between array and object items.
+
+   The ``JSON_MAX_INDENT`` constant defines the maximum indentation
+   that can be used, and its value is 31.
+
+   .. versionchanged:: 2.7
+      Added ``JSON_MAX_INDENT``.
+
+``JSON_COMPACT``
+   This flag enables a compact representation, i.e. sets the separator
+   between array and object items to ``","`` and between object keys
+   and values to ``":"``. Without this flag, the corresponding
+   separators are ``", "`` and ``": "`` for more readable output.
+
+``JSON_ENSURE_ASCII``
+   If this flag is used, the output is guaranteed to consist only of
+   ASCII characters. This is achived by escaping all Unicode
+   characters outside the ASCII range.
+
+``JSON_SORT_KEYS``
+   If this flag is used, all the objects in output are sorted by key.
+   This is useful e.g. if two JSON texts are diffed or visually
+   compared.
+
+``JSON_PRESERVE_ORDER``
+   If this flag is used, object keys in the output are sorted into the
+   same order in which they were first inserted to the object. For
+   example, decoding a JSON text and then encoding with this flag
+   preserves the order of object keys.
+
+``JSON_ENCODE_ANY``
+   Specifying this flag makes it possible to encode any JSON value on
+   its own. Without it, only objects and arrays can be passed as the
+   *root* value to the encoding functions.
+
+   **Note:** Encoding any value may be useful in some scenarios, but
+   it's generally discouraged as it violates strict compatiblity with
+   :rfc:`4627`. If you use this flag, don't expect interoperatibility
+   with other JSON systems.
+
+   .. versionadded:: 2.1
+
+``JSON_ESCAPE_SLASH``
+   Escape the ``/`` characters in strings with ``\/``.
+
+   .. versionadded:: 2.4
+
+``JSON_REAL_PRECISION(n)``
+   Output all real numbers with at most *n* digits of precision. The
+   valid range for *n* is between 0 and 31 (inclusive), and other
+   values result in an undefined behavior.
+
+   By default, the precision is 17, to correctly and losslessly encode
+   all IEEE 754 double precision floating point numbers.
+
+   .. versionadded:: 2.7
+
+The following functions perform the actual JSON encoding. The result
+is in UTF-8.
+
+.. function:: char *json_dumps(const json_t *root, size_t flags)
+
+   Returns the JSON representation of *root* as a string, or *NULL* on
+   error. *flags* is described above. The return value must be freed
+   by the caller using :func:`free()`.
+
+.. function:: int json_dumpf(const json_t *root, FILE *output, size_t flags)
+
+   Write the JSON representation of *root* to the stream *output*.
+   *flags* is described above. Returns 0 on success and -1 on error.
+   If an error occurs, something may have already been written to
+   *output*. In this case, the output is undefined and most likely not
+   valid JSON.
+
+.. function:: int json_dump_file(const json_t *json, const char *path, size_t flags)
+
+   Write the JSON representation of *root* to the file *path*. If
+   *path* already exists, it is overwritten. *flags* is described
+   above. Returns 0 on success and -1 on error.
+
+.. type:: json_dump_callback_t
+
+   A typedef for a function that's called by
+   :func:`json_dump_callback()`::
+
+       typedef int (*json_dump_callback_t)(const char *buffer, size_t size, void *data);
+
+   *buffer* points to a buffer containing a chunk of output, *size* is
+   the length of the buffer, and *data* is the corresponding
+   :func:`json_dump_callback()` argument passed through.
+
+   On error, the function should return -1 to stop the encoding
+   process. On success, it should return 0.
+
+   .. versionadded:: 2.2
+
+.. function:: int json_dump_callback(const json_t *json, json_dump_callback_t callback, void *data, size_t flags)
+
+   Call *callback* repeatedly, passing a chunk of the JSON
+   representation of *root* each time. *flags* is described above.
+   Returns 0 on success and -1 on error.
+
+   .. versionadded:: 2.2
+
+
+.. _apiref-decoding:
+
+Decoding
+========
+
+This sections describes the functions that can be used to decode JSON
+text to the Jansson representation of JSON data. The JSON
+specification requires that a JSON text is either a serialized array
+or object, and this requirement is also enforced with the following
+functions. In other words, the top level value in the JSON text being
+decoded must be either array or object. To decode any JSON value, use
+the ``JSON_DECODE_ANY`` flag (see below).
+
+See :ref:`rfc-conformance` for a discussion on Jansson's conformance
+to the JSON specification. It explains many design decisions that
+affect especially the behavior of the decoder.
+
+Each function takes a *flags* parameter that can be used to control
+the behavior of the decoder. Its default value is 0. The following
+macros can be ORed together to obtain *flags*.
+
+``JSON_REJECT_DUPLICATES``
+   Issue a decoding error if any JSON object in the input text
+   contains duplicate keys. Without this flag, the value of the last
+   occurence of each key ends up in the result. Key equivalence is
+   checked byte-by-byte, without special Unicode comparison
+   algorithms.
+
+   .. versionadded:: 2.1
+
+``JSON_DECODE_ANY``
+   By default, the decoder expects an array or object as the input.
+   With this flag enabled, the decoder accepts any valid JSON value.
+
+   **Note:** Decoding any value may be useful in some scenarios, but
+   it's generally discouraged as it violates strict compatiblity with
+   :rfc:`4627`. If you use this flag, don't expect interoperatibility
+   with other JSON systems.
+
+   .. versionadded:: 2.3
+
+``JSON_DISABLE_EOF_CHECK``
+   By default, the decoder expects that its whole input constitutes a
+   valid JSON text, and issues an error if there's extra data after
+   the otherwise valid JSON input. With this flag enabled, the decoder
+   stops after decoding a valid JSON array or object, and thus allows
+   extra data after the JSON text.
+
+   Normally, reading will stop when the last ``]`` or ``}`` in the
+   JSON input is encountered. If both ``JSON_DISABLE_EOF_CHECK`` and
+   ``JSON_DECODE_ANY`` flags are used, the decoder may read one extra
+   UTF-8 code unit (up to 4 bytes of input). For example, decoding
+   ``4true`` correctly decodes the integer 4, but also reads the
+   ``t``. For this reason, if reading multiple consecutive values that
+   are not arrays or objects, they should be separated by at least one
+   whitespace character.
+
+   .. versionadded:: 2.1
+
+``JSON_DECODE_INT_AS_REAL``
+   JSON defines only one number type. Jansson distinguishes between
+   ints and reals. For more information see :ref:`real-vs-integer`.
+   With this flag enabled the decoder interprets all numbers as real
+   values. Integers that do not have an exact double representation
+   will silently result in a loss of precision. Integers that cause
+   a double overflow will cause an error.
+
+   .. versionadded:: 2.5
+
+``JSON_ALLOW_NUL``
+   Allow ``\u0000`` escape inside string values. This is a safety
+   measure; If you know your input can contain NUL bytes, use this
+   flag. If you don't use this flag, you don't have to worry about NUL
+   bytes inside strings unless you explicitly create themselves by
+   using e.g. :func:`json_stringn()` or ``s#`` format specifier for
+   :func:`json_pack()`.
+
+   Object keys cannot have embedded NUL bytes even if this flag is
+   used.
+
+   .. versionadded:: 2.6
+
+Each function also takes an optional :type:`json_error_t` parameter
+that is filled with error information if decoding fails. It's also
+updated on success; the number of bytes of input read is written to
+its ``position`` field. This is especially useful when using
+``JSON_DISABLE_EOF_CHECK`` to read multiple consecutive JSON texts.
+
+.. versionadded:: 2.3
+   Number of bytes of input read is written to the ``position`` field
+   of the :type:`json_error_t` structure.
+
+If no error or position information is needed, you can pass *NULL*.
+
+The following functions perform the actual JSON decoding.
+
+.. function:: json_t *json_loads(const char *input, size_t flags, json_error_t *error)
+
+   .. refcounting:: new
+
+   Decodes the JSON string *input* and returns the array or object it
+   contains, or *NULL* on error, in which case *error* is filled with
+   information about the error. *flags* is described above.
+
+.. function:: json_t *json_loadb(const char *buffer, size_t buflen, size_t flags, json_error_t *error)
+
+   .. refcounting:: new
+
+   Decodes the JSON string *buffer*, whose length is *buflen*, and
+   returns the array or object it contains, or *NULL* on error, in
+   which case *error* is filled with information about the error. This
+   is similar to :func:`json_loads()` except that the string doesn't
+   need to be null-terminated. *flags* is described above.
+
+   .. versionadded:: 2.1
+
+.. function:: json_t *json_loadf(FILE *input, size_t flags, json_error_t *error)
+
+   .. refcounting:: new
+
+   Decodes the JSON text in stream *input* and returns the array or
+   object it contains, or *NULL* on error, in which case *error* is
+   filled with information about the error. *flags* is described
+   above.
+
+   This function will start reading the input from whatever position
+   the input file was, without attempting to seek first. If an error
+   occurs, the file position will be left indeterminate. On success,
+   the file position will be at EOF, unless ``JSON_DISABLE_EOF_CHECK``
+   flag was used. In this case, the file position will be at the first
+   character after the last ``]`` or ``}`` in the JSON input. This
+   allows calling :func:`json_loadf()` on the same ``FILE`` object
+   multiple times, if the input consists of consecutive JSON texts,
+   possibly separated by whitespace.
+
+.. function:: json_t *json_load_file(const char *path, size_t flags, json_error_t *error)
+
+   .. refcounting:: new
+
+   Decodes the JSON text in file *path* and returns the array or
+   object it contains, or *NULL* on error, in which case *error* is
+   filled with information about the error. *flags* is described
+   above.
+
+.. type:: json_load_callback_t
+
+   A typedef for a function that's called by
+   :func:`json_load_callback()` to read a chunk of input data::
+
+       typedef size_t (*json_load_callback_t)(void *buffer, size_t buflen, void *data);
+
+   *buffer* points to a buffer of *buflen* bytes, and *data* is the
+   corresponding :func:`json_load_callback()` argument passed through.
+
+   On success, the function should return the number of bytes read; a
+   returned value of 0 indicates that no data was read and that the
+   end of file has been reached. On error, the function should return
+   ``(size_t)-1`` to abort the decoding process.
+
+   .. versionadded:: 2.4
+
+.. function:: json_t *json_load_callback(json_load_callback_t callback, void *data, size_t flags, json_error_t *error)
+
+   .. refcounting:: new
+
+   Decodes the JSON text produced by repeated calls to *callback*, and
+   returns the array or object it contains, or *NULL* on error, in
+   which case *error* is filled with information about the error.
+   *data* is passed through to *callback* on each call. *flags* is
+   described above.
+
+   .. versionadded:: 2.4
+
+
+.. _apiref-pack:
+
+Building Values
+===============
+
+This section describes functions that help to create, or *pack*,
+complex JSON values, especially nested objects and arrays. Value
+building is based on a *format string* that is used to tell the
+functions about the expected arguments.
+
+For example, the format string ``"i"`` specifies a single integer
+value, while the format string ``"[ssb]"`` or the equivalent ``"[s, s,
+b]"`` specifies an array value with two strings and a boolean as its
+items::
+
+    /* Create the JSON integer 42 */
+    json_pack("i", 42);
+
+    /* Create the JSON array ["foo", "bar", true] */
+    json_pack("[ssb]", "foo", "bar", 1);
+
+Here's the full list of format specifiers. The type in parentheses
+denotes the resulting JSON type, and the type in brackets (if any)
+denotes the C type that is expected as the corresponding argument or
+arguments.
+
+``s`` (string) [const char \*]
+    Convert a NULL terminated UTF-8 string to a JSON string.
+
+``s#`` (string) [const char \*, int]
+    Convert a UTF-8 buffer of a given length to a JSON string.
+
+    .. versionadded:: 2.5
+
+``s%`` (string) [const char \*, size_t]
+    Like ``s#`` but the length argument is of type :type:`size_t`.
+
+    .. versionadded:: 2.6
+
+``+`` [const char \*]
+    Like ``s``, but concatenate to the previous string. Only valid
+    after ``s``, ``s#``, ``+`` or ``+#``.
+
+    .. versionadded:: 2.5
+
+``+#`` [const char \*, int]
+    Like ``s#``, but concatenate to the previous string. Only valid
+    after ``s``, ``s#``, ``+`` or ``+#``.
+
+    .. versionadded:: 2.5
+
+``+%`` (string) [const char \*, size_t]
+    Like ``+#`` but the length argument is of type :type:`size_t`.
+
+    .. versionadded:: 2.6
+
+``n`` (null)
+    Output a JSON null value. No argument is consumed.
+
+``b`` (boolean) [int]
+    Convert a C :type:`int` to JSON boolean value. Zero is converted
+    to ``false`` and non-zero to ``true``.
+
+``i`` (integer) [int]
+    Convert a C :type:`int` to JSON integer.
+
+``I`` (integer) [json_int_t]
+    Convert a C :type:`json_int_t` to JSON integer.
+
+``f`` (real) [double]
+    Convert a C :type:`double` to JSON real.
+
+``o`` (any value) [json_t \*]
+    Output any given JSON value as-is. If the value is added to an
+    array or object, the reference to the value passed to ``o`` is
+    stolen by the container.
+
+``O`` (any value) [json_t \*]
+    Like ``o``, but the argument's reference count is incremented.
+    This is useful if you pack into an array or object and want to
+    keep the reference for the JSON value consumed by ``O`` to
+    yourself.
+
+``[fmt]`` (array)
+    Build an array with contents from the inner format string. ``fmt``
+    may contain objects and arrays, i.e. recursive value building is
+    supported.
+
+``{fmt}`` (object)
+    Build an object with contents from the inner format string
+    ``fmt``. The first, third, etc. format specifier represent a key,
+    and must be a string (see ``s``, ``s#``, ``+`` and ``+#`` above),
+    as object keys are always strings. The second, fourth, etc. format
+    specifier represent a value. Any value may be an object or array,
+    i.e. recursive value building is supported.
+
+Whitespace, ``:`` and ``,`` are ignored.
+
+The following functions compose the value building API:
+
+.. function:: json_t *json_pack(const char *fmt, ...)
+
+   .. refcounting:: new
+
+   Build a new JSON value according to the format string *fmt*. For
+   each format specifier (except for ``{}[]n``), one or more arguments
+   are consumed and used to build the corresponding value. Returns
+   *NULL* on error.
+
+.. function:: json_t *json_pack_ex(json_error_t *error, size_t flags, const char *fmt, ...)
+              json_t *json_vpack_ex(json_error_t *error, size_t flags, const char *fmt, va_list ap)
+
+   .. refcounting:: new
+
+   Like :func:`json_pack()`, but an in the case of an error, an error
+   message is written to *error*, if it's not *NULL*. The *flags*
+   parameter is currently unused and should be set to 0.
+
+   As only the errors in format string (and out-of-memory errors) can
+   be caught by the packer, these two functions are most likely only
+   useful for debugging format strings.
+
+More examples::
+
+  /* Build an empty JSON object */
+  json_pack("{}");
+
+  /* Build the JSON object {"foo": 42, "bar": 7} */
+  json_pack("{sisi}", "foo", 42, "bar", 7);
+
+  /* Like above, ':', ',' and whitespace are ignored */
+  json_pack("{s:i, s:i}", "foo", 42, "bar", 7);
+
+  /* Build the JSON array [[1, 2], {"cool": true}] */
+  json_pack("[[i,i],{s:b}]", 1, 2, "cool", 1);
+
+  /* Build a string from a non-NUL terminated buffer */
+  char buffer[4] = {'t', 'e', 's', 't'};
+  json_pack("s#", buffer, 4);
+
+  /* Concatentate strings together to build the JSON string "foobarbaz" */
+  json_pack("s++", "foo", "bar", "baz");
+
+
+.. _apiref-unpack:
+
+Parsing and Validating Values
+=============================
+
+This section describes functions that help to validate complex values
+and extract, or *unpack*, data from them. Like :ref:`building values
+<apiref-pack>`, this is also based on format strings.
+
+While a JSON value is unpacked, the type specified in the format
+string is checked to match that of the JSON value. This is the
+validation part of the process. In addition to this, the unpacking
+functions can also check that all items of arrays and objects are
+unpacked. This check be enabled with the format specifier ``!`` or by
+using the flag ``JSON_STRICT``. See below for details.
+
+Here's the full list of format specifiers. The type in parentheses
+denotes the JSON type, and the type in brackets (if any) denotes the C
+type whose address should be passed.
+
+``s`` (string) [const char \*]
+    Convert a JSON string to a pointer to a NULL terminated UTF-8
+    string. The resulting string is extracted by using
+    :func:`json_string_value()` internally, so it exists as long as
+    there are still references to the corresponding JSON string.
+
+``s%`` (string) [const char \*, size_t \*]
+    Convert a JSON string to a pointer to a NULL terminated UTF-8
+    string and its length.
+
+    .. versionadded:: 2.6
+
+``n`` (null)
+    Expect a JSON null value. Nothing is extracted.
+
+``b`` (boolean) [int]
+    Convert a JSON boolean value to a C :type:`int`, so that ``true``
+    is converted to 1 and ``false`` to 0.
+
+``i`` (integer) [int]
+    Convert a JSON integer to C :type:`int`.
+
+``I`` (integer) [json_int_t]
+    Convert a JSON integer to C :type:`json_int_t`.
+
+``f`` (real) [double]
+    Convert a JSON real to C :type:`double`.
+
+``F`` (integer or real) [double]
+    Convert a JSON number (integer or real) to C :type:`double`.
+
+``o`` (any value) [json_t \*]
+    Store a JSON value with no conversion to a :type:`json_t` pointer.
+
+``O`` (any value) [json_t \*]
+    Like ``O``, but the JSON value's reference count is incremented.
+
+``[fmt]`` (array)
+    Convert each item in the JSON array according to the inner format
+    string. ``fmt`` may contain objects and arrays, i.e. recursive
+    value extraction is supporetd.
+
+``{fmt}`` (object)
+    Convert each item in the JSON object according to the inner format
+    string ``fmt``. The first, third, etc. format specifier represent
+    a key, and must be ``s``. The corresponding argument to unpack
+    functions is read as the object key. The second fourth, etc.
+    format specifier represent a value and is written to the address
+    given as the corresponding argument. **Note** that every other
+    argument is read from and every other is written to.
+
+    ``fmt`` may contain objects and arrays as values, i.e. recursive
+    value extraction is supporetd.
+
+    .. versionadded:: 2.3
+       Any ``s`` representing a key may be suffixed with a ``?`` to
+       make the key optional. If the key is not found, nothing is
+       extracted. See below for an example.
+
+``!``
+    This special format specifier is used to enable the check that
+    all object and array items are accessed, on a per-value basis. It
+    must appear inside an array or object as the last format specifier
+    before the closing bracket or brace. To enable the check globally,
+    use the ``JSON_STRICT`` unpacking flag.
+
+``*``
+    This special format specifier is the opposite of ``!``. If the
+    ``JSON_STRICT`` flag is used, ``*`` can be used to disable the
+    strict check on a per-value basis. It must appear inside an array
+    or object as the last format specifier before the closing bracket
+    or brace.
+
+Whitespace, ``:`` and ``,`` are ignored.
+
+The following functions compose the parsing and validation API:
+
+.. function:: int json_unpack(json_t *root, const char *fmt, ...)
+
+   Validate and unpack the JSON value *root* according to the format
+   string *fmt*. Returns 0 on success and -1 on failure.
+
+.. function:: int json_unpack_ex(json_t *root, json_error_t *error, size_t flags, const char *fmt, ...)
+              int json_vunpack_ex(json_t *root, json_error_t *error, size_t flags, const char *fmt, va_list ap)
+
+   Validate and unpack the JSON value *root* according to the format
+   string *fmt*. If an error occurs and *error* is not *NULL*, write
+   error information to *error*. *flags* can be used to control the
+   behaviour of the unpacker, see below for the flags. Returns 0 on
+   success and -1 on failure.
+
+.. note::
+
+   The first argument of all unpack functions is ``json_t *root``
+   instead of ``const json_t *root``, because the use of ``O`` format
+   specifier causes the reference count of ``root``, or some value
+   reachable from ``root``, to be increased. Furthermore, the ``o``
+   format specifier may be used to extract a value as-is, which allows
+   modifying the structure or contents of a value reachable from
+   ``root``.
+
+   If the ``O`` and ``o`` format specifiers are not used, it's
+   perfectly safe to cast a ``const json_t *`` variable to plain
+   ``json_t *`` when used with these functions.
+
+The following unpacking flags are available:
+
+``JSON_STRICT``
+    Enable the extra validation step checking that all object and
+    array items are unpacked. This is equivalent to appending the
+    format specifier ``!`` to the end of every array and object in the
+    format string.
+
+``JSON_VALIDATE_ONLY``
+    Don't extract any data, just validate the JSON value against the
+    given format string. Note that object keys must still be specified
+    after the format string.
+
+Examples::
+
+    /* root is the JSON integer 42 */
+    int myint;
+    json_unpack(root, "i", &myint);
+    assert(myint == 42);
+
+    /* root is the JSON object {"foo": "bar", "quux": true} */
+    const char *str;
+    int boolean;
+    json_unpack(root, "{s:s, s:b}", "foo", &str, "quux", &boolean);
+    assert(strcmp(str, "bar") == 0 && boolean == 1);
+
+    /* root is the JSON array [[1, 2], {"baz": null} */
+    json_error_t error;
+    json_unpack_ex(root, &error, JSON_VALIDATE_ONLY, "[[i,i], {s:n}]", "baz");
+    /* returns 0 for validation success, nothing is extracted */
+
+    /* root is the JSON array [1, 2, 3, 4, 5] */
+    int myint1, myint2;
+    json_unpack(root, "[ii!]", &myint1, &myint2);
+    /* returns -1 for failed validation */
+
+    /* root is an empty JSON object */
+    int myint = 0, myint2 = 0;
+    json_unpack(root, "{s?i, s?[ii]}",
+                "foo", &myint1,
+                "bar", &myint2, &myint3);
+    /* myint1, myint2 or myint3 is no touched as "foo" and "bar" don't exist */
+
+
+Equality
+========
+
+Testing for equality of two JSON values cannot, in general, be
+achieved using the ``==`` operator. Equality in the terms of the
+``==`` operator states that the two :type:`json_t` pointers point to
+exactly the same JSON value. However, two JSON values can be equal not
+only if they are exactly the same value, but also if they have equal
+"contents":
+
+* Two integer or real values are equal if their contained numeric
+  values are equal. An integer value is never equal to a real value,
+  though.
+
+* Two strings are equal if their contained UTF-8 strings are equal,
+  byte by byte. Unicode comparison algorithms are not implemented.
+
+* Two arrays are equal if they have the same number of elements and
+  each element in the first array is equal to the corresponding
+  element in the second array.
+
+* Two objects are equal if they have exactly the same keys and the
+  value for each key in the first object is equal to the value of the
+  corresponding key in the second object.
+
+* Two true, false or null values have no "contents", so they are equal
+  if their types are equal. (Because these values are singletons,
+  their equality can actually be tested with ``==``.)
+
+The following function can be used to test whether two JSON values are
+equal.
+
+.. function:: int json_equal(json_t *value1, json_t *value2)
+
+   Returns 1 if *value1* and *value2* are equal, as defined above.
+   Returns 0 if they are inequal or one or both of the pointers are
+   *NULL*.
+
+
+Copying
+=======
+
+Because of reference counting, passing JSON values around doesn't
+require copying them. But sometimes a fresh copy of a JSON value is
+needed. For example, if you need to modify an array, but still want to
+use the original afterwards, you should take a copy of it first.
+
+Jansson supports two kinds of copying: shallow and deep. There is a
+difference between these methods only for arrays and objects. Shallow
+copying only copies the first level value (array or object) and uses
+the same child values in the copied value. Deep copying makes a fresh
+copy of the child values, too. Moreover, all the child values are deep
+copied in a recursive fashion.
+
+.. function:: json_t *json_copy(json_t *value)
+
+   .. refcounting:: new
+
+   Returns a shallow copy of *value*, or *NULL* on error.
+
+.. function:: json_t *json_deep_copy(const json_t *value)
+
+   .. refcounting:: new
+
+   Returns a deep copy of *value*, or *NULL* on error.
+
+
+.. _apiref-custom-memory-allocation:
+
+Custom Memory Allocation
+========================
+
+By default, Jansson uses :func:`malloc()` and :func:`free()` for
+memory allocation. These functions can be overridden if custom
+behavior is needed.
+
+.. type:: json_malloc_t
+
+   A typedef for a function pointer with :func:`malloc()`'s
+   signature::
+
+       typedef void *(*json_malloc_t)(size_t);
+
+.. type:: json_free_t
+
+   A typedef for a function pointer with :func:`free()`'s
+   signature::
+
+       typedef void (*json_free_t)(void *);
+
+.. function:: void json_set_alloc_funcs(json_malloc_t malloc_fn, json_free_t free_fn)
+
+   Use *malloc_fn* instead of :func:`malloc()` and *free_fn* instead
+   of :func:`free()`. This function has to be called before any other
+   Jansson's API functions to ensure that all memory operations use
+   the same functions.
+
+**Examples:**
+
+Circumvent problems with different CRT heaps on Windows by using
+application's :func:`malloc()` and :func:`free()`::
+
+    json_set_alloc_funcs(malloc, free);
+
+Use the `Boehm's conservative garbage collector`_ for memory
+operations::
+
+    json_set_alloc_funcs(GC_malloc, GC_free);
+
+.. _Boehm's conservative garbage collector: http://www.hpl.hp.com/personal/Hans_Boehm/gc/
+
+Allow storing sensitive data (e.g. passwords or encryption keys) in
+JSON structures by zeroing all memory when freed::
+
+    static void *secure_malloc(size_t size)
+    {
+        /* Store the memory area size in the beginning of the block */
+        void *ptr = malloc(size + 8);
+        *((size_t *)ptr) = size;
+        return ptr + 8;
+    }
+
+    static void secure_free(void *ptr)
+    {
+        size_t size;
+
+        ptr -= 8;
+        size = *((size_t *)ptr);
+
+        guaranteed_memset(ptr, 0, size + 8);
+        free(ptr);
+    }
+
+    int main()
+    {
+        json_set_alloc_funcs(secure_malloc, secure_free);
+        /* ... */
+    }
+
+For more information about the issues of storing sensitive data in
+memory, see
+http://www.dwheeler.com/secure-programs/Secure-Programs-HOWTO/protect-secrets.html.
+The page also explains the :func:`guaranteed_memset()` function used
+in the example and gives a sample implementation for it.

Added: vendor/jansson/dist/doc/changes.rst
===================================================================
--- vendor/jansson/dist/doc/changes.rst	                        (rev 0)
+++ vendor/jansson/dist/doc/changes.rst	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,5 @@
+******************
+Changes in Jansson
+******************
+
+.. include:: ../CHANGES

Added: vendor/jansson/dist/doc/conf.py
===================================================================
--- vendor/jansson/dist/doc/conf.py	                        (rev 0)
+++ vendor/jansson/dist/doc/conf.py	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,217 @@
+# -*- coding: utf-8 -*-
+#
+# Jansson documentation build configuration file, created by
+# sphinx-quickstart on Sun Sep  5 21:47:20 2010.
+#
+# This file is execfile()d with the current directory set to its containing dir.
+#
+# Note that not all possible configuration values are present in this
+# autogenerated file.
+#
+# All configuration values have a default; values that are commented out
+# serve to show the default.
+
+import sys, os
+
+# If extensions (or modules to document with autodoc) are in another directory,
+# add these directories to sys.path here. If the directory is relative to the
+# documentation root, use os.path.abspath to make it absolute, like shown here.
+sys.path.insert(0, os.path.abspath('ext'))
+
+# -- General configuration -----------------------------------------------------
+
+# If your documentation needs a minimal Sphinx version, state it here.
+needs_sphinx = '1.0'
+
+# Add any Sphinx extension module names here, as strings. They can be extensions
+# coming with Sphinx (named 'sphinx.ext.*') or your custom ones.
+extensions = ['refcounting']
+
+# Add any paths that contain templates here, relative to this directory.
+templates_path = ['_templates']
+
+# The suffix of source filenames.
+source_suffix = '.rst'
+
+# The encoding of source files.
+#source_encoding = 'utf-8-sig'
+
+# The master toctree document.
+master_doc = 'index'
+
+# General information about the project.
+project = u'Jansson'
+copyright = u'2009-2014, Petri Lehtinen'
+
+# The version info for the project you're documenting, acts as replacement for
+# |version| and |release|, also used in various other places throughout the
+# built documents.
+#
+# The short X.Y version.
+version = '2.7'
+# The full version, including alpha/beta/rc tags.
+release = version
+
+# The language for content autogenerated by Sphinx. Refer to documentation
+# for a list of supported languages.
+#language = None
+
+# There are two options for replacing |today|: either, you set today to some
+# non-false value, then it is used:
+#today = ''
+# Else, today_fmt is used as the format for a strftime call.
+#today_fmt = '%B %d, %Y'
+
+# List of patterns, relative to source directory, that match files and
+# directories to ignore when looking for source files.
+exclude_patterns = ['_build']
+
+# The reST default role (used for this markup: `text`) to use for all documents.
+default_role = 'c:func'
+primary_domain = 'c'
+
+# If true, '()' will be appended to :func: etc. cross-reference text.
+#add_function_parentheses = True
+
+# If true, the current module name will be prepended to all description
+# unit titles (such as .. function::).
+#add_module_names = True
+
+# If true, sectionauthor and moduleauthor directives will be shown in the
+# output. They are ignored by default.
+#show_authors = False
+
+# The name of the Pygments (syntax highlighting) style to use.
+pygments_style = 'sphinx'
+
+# A list of ignored prefixes for module index sorting.
+#modindex_common_prefix = []
+
+
+# -- Options for HTML output ---------------------------------------------------
+
+# The theme to use for HTML and HTML Help pages.  See the documentation for
+# a list of builtin themes.
+#html_theme = 'default'
+
+# Theme options are theme-specific and customize the look and feel of a theme
+# further.  For a list of options available for each theme, see the
+# documentation.
+#html_theme_options = {}
+
+# Add any paths that contain custom themes here, relative to this directory.
+#html_theme_path = []
+
+# The name for this set of Sphinx documents.  If None, it defaults to
+# "<project> v<release> documentation".
+#html_title = None
+
+# A shorter title for the navigation bar.  Default is the same as html_title.
+#html_short_title = None
+
+# The name of an image file (relative to this directory) to place at the top
+# of the sidebar.
+#html_logo = None
+
+# The name of an image file (within the static path) to use as favicon of the
+# docs.  This file should be a Windows icon file (.ico) being 16x16 or 32x32
+# pixels large.
+#html_favicon = None
+
+# Add any paths that contain custom static files (such as style sheets) here,
+# relative to this directory. They are copied after the builtin static files,
+# so a file named "default.css" will overwrite the builtin "default.css".
+#html_static_path = ['_static']
+
+# If not '', a 'Last updated on:' timestamp is inserted at every page bottom,
+# using the given strftime format.
+#html_last_updated_fmt = '%b %d, %Y'
+
+# If true, SmartyPants will be used to convert quotes and dashes to
+# typographically correct entities.
+#html_use_smartypants = True
+
+# Custom sidebar templates, maps document names to template names.
+#html_sidebars = {}
+
+# Additional templates that should be rendered to pages, maps page names to
+# template names.
+#html_additional_pages = {}
+
+# If false, no module index is generated.
+#html_domain_indices = True
+
+# If false, no index is generated.
+#html_use_index = True
+
+# If true, the index is split into individual pages for each letter.
+#html_split_index = False
+
+# If true, links to the reST sources are added to the pages.
+#html_show_sourcelink = True
+
+# If true, "Created using Sphinx" is shown in the HTML footer. Default is True.
+#html_show_sphinx = True
+
+# If true, "(C) Copyright ..." is shown in the HTML footer. Default is True.
+#html_show_copyright = True
+
+# If true, an OpenSearch description file will be output, and all pages will
+# contain a <link> tag referring to it.  The value of this option must be the
+# base URL from which the finished HTML is served.
+#html_use_opensearch = ''
+
+# This is the file name suffix for HTML files (e.g. ".xhtml").
+#html_file_suffix = None
+
+# Output file base name for HTML help builder.
+htmlhelp_basename = 'Janssondoc'
+
+
+# -- Options for LaTeX output --------------------------------------------------
+
+# The paper size ('letter' or 'a4').
+#latex_paper_size = 'letter'
+
+# The font size ('10pt', '11pt' or '12pt').
+#latex_font_size = '10pt'
+
+# Grouping the document tree into LaTeX files. List of tuples
+# (source start file, target name, title, author, documentclass [howto/manual]).
+latex_documents = [
+  ('index', 'Jansson.tex', u'Jansson Documentation',
+   u'Petri Lehtinen', 'manual'),
+]
+
+# The name of an image file (relative to this directory) to place at the top of
+# the title page.
+#latex_logo = None
+
+# For "manual" documents, if this is true, then toplevel headings are parts,
+# not chapters.
+#latex_use_parts = False
+
+# If true, show page references after internal links.
+#latex_show_pagerefs = False
+
+# If true, show URL addresses after external links.
+#latex_show_urls = False
+
+# Additional stuff for the LaTeX preamble.
+#latex_preamble = ''
+
+# Documents to append as an appendix to all manuals.
+#latex_appendices = []
+
+# If false, no module index is generated.
+#latex_domain_indices = True
+
+
+# -- Options for manual page output --------------------------------------------
+
+# One entry per manual page. List of tuples
+# (source start file, name, description, authors, manual section).
+man_pages = [
+    ('index', 'jansson', u'Jansson Documentation',
+     [u'Petri Lehtinen'], 1)
+]

Added: vendor/jansson/dist/doc/conformance.rst
===================================================================
--- vendor/jansson/dist/doc/conformance.rst	                        (rev 0)
+++ vendor/jansson/dist/doc/conformance.rst	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,110 @@
+.. _rfc-conformance:
+
+***************
+RFC Conformance
+***************
+
+JSON is specified in :rfc:`4627`, *"The application/json Media Type
+for JavaScript Object Notation (JSON)"*.
+
+Character Encoding
+==================
+
+Jansson only supports UTF-8 encoded JSON texts. It does not support or
+auto-detect any of the other encodings mentioned in the RFC, namely
+UTF-16LE, UTF-16BE, UTF-32LE or UTF-32BE. Pure ASCII is supported, as
+it's a subset of UTF-8.
+
+Strings
+=======
+
+JSON strings are mapped to C-style null-terminated character arrays,
+and UTF-8 encoding is used internally.
+
+All Unicode codepoints U+0000 through U+10FFFF are allowed in string
+values. However, U+0000 is not allowed in object keys because of API
+restrictions.
+
+Unicode normalization or any other transformation is never performed
+on any strings (string values or object keys). When checking for
+equivalence of strings or object keys, the comparison is performed
+byte by byte between the original UTF-8 representations of the
+strings.
+
+Numbers
+=======
+
+.. _real-vs-integer:
+
+Real vs. Integer
+----------------
+
+JSON makes no distinction between real and integer numbers; Jansson
+does. Real numbers are mapped to the ``double`` type and integers to
+the ``json_int_t`` type, which is a typedef of ``long long`` or
+``long``, depending on whether ``long long`` is supported by your
+compiler or not.
+
+A JSON number is considered to be a real number if its lexical
+representation includes one of ``e``, ``E``, or ``.``; regardless if
+its actual numeric value is a true integer (e.g., all of ``1E6``,
+``3.0``, ``400E-2``, and ``3.14E3`` are mathematical integers, but
+will be treated as real values). With the ``JSON_DECODE_INT_AS_REAL``
+decoder flag set all numbers are interpreted as real.
+
+All other JSON numbers are considered integers.
+
+When encoding to JSON, real values are always represented
+with a fractional part; e.g., the ``double`` value 3.0 will be
+represented in JSON as ``3.0``, not ``3``.
+
+Overflow, Underflow & Precision
+-------------------------------
+
+Real numbers whose absolute values are too small to be represented in
+a C ``double`` will be silently estimated with 0.0. Thus, depending on
+platform, JSON numbers very close to zero such as 1E-999 may result in
+0.0.
+
+Real numbers whose absolute values are too large to be represented in
+a C ``double`` will result in an overflow error (a JSON decoding
+error). Thus, depending on platform, JSON numbers like 1E+999 or
+-1E+999 may result in a parsing error.
+
+Likewise, integer numbers whose absolute values are too large to be
+represented in the ``json_int_t`` type (see above) will result in an
+overflow error (a JSON decoding error). Thus, depending on platform,
+JSON numbers like 1000000000000000 may result in parsing error.
+
+Parsing JSON real numbers may result in a loss of precision. As long
+as overflow does not occur (i.e. a total loss of precision), the
+rounded approximate value is silently used. Thus the JSON number
+1.000000000000000005 may, depending on platform, result in the
+``double`` value 1.0.
+
+Signed zeros
+------------
+
+JSON makes no statement about what a number means; however Javascript
+(ECMAscript) does state that +0.0 and -0.0 must be treated as being
+distinct values, i.e. -0.0 |not-equal| 0.0. Jansson relies on the
+underlying floating point library in the C environment in which it is
+compiled. Therefore it is platform-dependent whether 0.0 and -0.0 will
+be distinct values. Most platforms that use the IEEE 754
+floating-point standard will support signed zeros.
+
+Note that this only applies to floating-point; neither JSON, C, or
+IEEE support the concept of signed integer zeros.
+
+.. |not-equal| unicode:: U+2260
+
+Types
+-----
+
+No support is provided in Jansson for any C numeric types other than
+``json_int_t`` and ``double``. This excludes things such as unsigned
+types, ``long double``, etc. Obviously, shorter types like ``short``,
+``int``, ``long`` (if ``json_int_t`` is ``long long``) and ``float``
+are implicitly handled via the ordinary C type coercion rules (subject
+to overflow semantics). Also, no support or hooks are provided for any
+supplemental "bignum" type add-on packages.

Added: vendor/jansson/dist/doc/ext/refcounting.py
===================================================================
--- vendor/jansson/dist/doc/ext/refcounting.py	                        (rev 0)
+++ vendor/jansson/dist/doc/ext/refcounting.py	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,59 @@
+"""
+    refcounting
+    ~~~~~~~~~~~
+
+    Reference count annotations for C API functions. Has the same
+    result as the sphinx.ext.refcounting extension but works for all
+    functions regardless of the signature, and the reference counting
+    information is written inline with the documentation instead of a
+    separate file.
+
+    Adds a new directive "refcounting". The directive has no content
+    and one required positional parameter:: "new" or "borrow".
+
+    Example:
+
+    .. cfunction:: json_t *json_object(void)
+
+       .. refcounting:: new
+
+       <description of the json_object function>
+
+    :copyright: Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+    :license: MIT, see LICENSE for details.
+"""
+
+from docutils import nodes
+
+class refcounting(nodes.emphasis): pass
+
+def visit(self, node):
+    self.visit_emphasis(node)
+
+def depart(self, node):
+    self.depart_emphasis(node)
+
+def html_visit(self, node):
+    self.body.append(self.starttag(node, 'em', '', CLASS='refcount'))
+
+def html_depart(self, node):
+    self.body.append('</em>')
+
+
+def refcounting_directive(name, arguments, options, content, lineno,
+                   content_offset, block_text, state, state_machine):
+    if arguments[0] == 'borrow':
+        text = 'Return value: Borrowed reference.'
+    elif arguments[0] == 'new':
+        text = 'Return value: New reference.'
+    else:
+        raise Error('Valid arguments: new, borrow')
+
+    return [refcounting(text, text)]
+
+def setup(app):
+    app.add_node(refcounting,
+                 html=(html_visit, html_depart),
+                 latex=(visit, depart),
+                 text=(visit, depart))
+    app.add_directive('refcounting', refcounting_directive, 0, (1, 0, 0))

Added: vendor/jansson/dist/doc/gettingstarted.rst
===================================================================
--- vendor/jansson/dist/doc/gettingstarted.rst	                        (rev 0)
+++ vendor/jansson/dist/doc/gettingstarted.rst	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,227 @@
+***************
+Getting Started
+***************
+
+.. highlight:: c
+
+Compiling and Installing Jansson
+================================
+
+The Jansson source is available at
+http://www.digip.org/jansson/releases/.
+
+Unix-like systems (including MinGW)
+-----------------------------------
+
+Unpack the source tarball and change to the source directory:
+
+.. parsed-literal::
+
+    bunzip2 -c jansson-|release|.tar.bz2 | tar xf -
+    cd jansson-|release|
+
+The source uses GNU Autotools (autoconf_, automake_, libtool_), so
+compiling and installing is extremely simple::
+
+    ./configure
+    make
+    make check
+    make install
+
+To change the destination directory (``/usr/local`` by default), use
+the ``--prefix=DIR`` argument to ``./configure``. See ``./configure
+--help`` for the list of all possible installation options. (There are
+no options to customize the resulting Jansson binary.)
+
+The command ``make check`` runs the test suite distributed with
+Jansson. This step is not strictly necessary, but it may find possible
+problems that Jansson has on your platform. If any problems are found,
+please report them.
+
+If you obtained the source from a Git repository (or any other source
+control system), there's no ``./configure`` script as it's not kept in
+version control. To create the script, the build system needs to be
+bootstrapped. There are many ways to do this, but the easiest one is
+to use ``autoreconf``::
+
+    autoreconf -vi
+
+This command creates the ``./configure`` script, which can then be
+used as described above.
+
+.. _autoconf: http://www.gnu.org/software/autoconf/
+.. _automake: http://www.gnu.org/software/automake/
+.. _libtool: http://www.gnu.org/software/libtool/
+
+
+.. _build-cmake:
+
+CMake (various platforms, including Windows)
+--------------------------------------------
+
+Jansson can be built using CMake_. Create a build directory for an
+out-of-tree build, change to that directory, and run ``cmake`` (or ``ccmake``,
+``cmake-gui``, or similar) to configure the project.
+
+See the examples below for more detailed information.
+
+.. note:: In the below examples ``..`` is used as an argument for ``cmake``.
+          This is simply the path to the jansson project root directory.
+          In the example it is assumed you've created a sub-directory ``build``
+          and are using that. You could use any path you want.
+
+.. _build-cmake-unix:
+
+Unix (Make files)
+^^^^^^^^^^^^^^^^^
+Generating make files on unix:
+
+.. parsed-literal::
+
+    bunzip2 -c jansson-|release|.tar.bz2 | tar xf -
+    cd jansson-|release|
+
+    mkdir build
+    cd build
+    cmake .. # or `ccmake ..` for a GUI.
+
+Then to build::
+    
+    make
+    make check
+    make install
+
+Windows (Visual Studio)
+^^^^^^^^^^^^^^^^^^^^^^^
+Creating Visual Studio project files from the command line:
+
+.. parsed-literal::
+
+    <unpack>
+    cd jansson-|release|
+
+    md build
+    cd build
+    cmake -G "Visual Studio 10" ..
+
+You will now have a *Visual Studio Solution* in your build directory.
+To run the unit tests build the ``RUN_TESTS`` project.
+
+If you prefer a GUI the ``cmake`` line in the above example can 
+be replaced with::
+
+    cmake-gui ..
+
+For command line help (including a list of available generators)
+for CMake_ simply run::
+
+    cmake
+
+To list available CMake_ settings (and what they are currently set to) 
+for the project, run::
+
+    cmake -LH ..
+
+Mac OSX (Xcode)
+^^^^^^^^^^^^^^^
+If you prefer using Xcode instead of make files on OSX,
+do the following. (Use the same steps as 
+for :ref:`Unix <build-cmake-unix>`)::
+
+    ...
+    cmake -G "Xcode" ..
+
+Additional CMake settings
+^^^^^^^^^^^^^^^^^^^^^^^^^
+
+Shared library
+""""""""""""""
+By default the CMake_ project will generate build files for building the
+static library. To build the shared version use::
+
+    ...
+    cmake -DJANSSON_BUILD_SHARED_LIBS=1 ..
+
+Changing install directory (same as autoconf --prefix)
+""""""""""""""""""""""""""""""""""""""""""""""""""""""
+Just as with the autoconf_ project you can change the destination directory
+for ``make install``. The equivalent for autoconfs ``./configure --prefix`` 
+in CMake_ is::
+
+    ...
+    cmake -DCMAKE_INSTALL_PREFIX:PATH=/some/other/path ..
+    make install
+
+.. _CMake: http://www.cmake.org
+
+
+Android
+-------
+
+Jansson can be built for Android platforms. Android.mk is in the
+source root directory. The configuration header file is located in the
+``android`` directory in the source distribution.
+
+
+Other Systems
+-------------
+
+On non Unix-like systems, you may be unable to run the ``./configure``
+script. In this case, follow these steps. All the files mentioned can
+be found in the ``src/`` directory.
+
+1. Create ``jansson_config.h`` (which has some platform-specific
+   parameters that are normally filled in by the ``./configure``
+   script). Edit ``jansson_config.h.in``, replacing all ``@variable@``
+   placeholders, and rename the file to ``jansson_config.h``.
+
+2. Make ``jansson.h`` and ``jansson_config.h`` available to the
+   compiler, so that they can be found when compiling programs that
+   use Jansson.
+
+3. Compile all the ``.c`` files (in the ``src/`` directory) into a
+   library file. Make the library available to the compiler, as in
+   step 2.
+
+
+Building the Documentation
+--------------------------
+
+(This subsection describes how to build the HTML documentation you are
+currently reading, so it can be safely skipped.)
+
+Documentation is in the ``doc/`` subdirectory. It's written in
+reStructuredText_ with Sphinx_ annotations. To generate the HTML
+documentation, invoke::
+
+   make html
+
+and point your browser to ``doc/_build/html/index.html``. Sphinx_ 1.0
+or newer is required to generate the documentation.
+
+.. _reStructuredText: http://docutils.sourceforge.net/rst.html
+.. _Sphinx: http://sphinx.pocoo.org/
+
+
+Compiling Programs that Use Jansson
+===================================
+
+Jansson involves one C header file, :file:`jansson.h`, so it's enough
+to put the line
+
+::
+
+    #include <jansson.h>
+
+in the beginning of every source file that uses Jansson.
+
+There's also just one library to link with, ``libjansson``. Compile and
+link the program as follows::
+
+    cc -o prog prog.c -ljansson
+
+Starting from version 1.2, there's also support for pkg-config_::
+
+    cc -o prog prog.c `pkg-config --cflags --libs jansson`
+
+.. _pkg-config: http://pkg-config.freedesktop.org/

Added: vendor/jansson/dist/doc/github_commits.c
===================================================================
--- vendor/jansson/dist/doc/github_commits.c	                        (rev 0)
+++ vendor/jansson/dist/doc/github_commits.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,201 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <stdlib.h>
+#include <string.h>
+
+#include <jansson.h>
+#include <curl/curl.h>
+
+#define BUFFER_SIZE  (256 * 1024)  /* 256 KB */
+
+#define URL_FORMAT   "https://api.github.com/repos/%s/%s/commits"
+#define URL_SIZE     256
+
+/* Return the offset of the first newline in text or the length of
+   text if there's no newline */
+static int newline_offset(const char *text)
+{
+    const char *newline = strchr(text, '\n');
+    if(!newline)
+        return strlen(text);
+    else
+        return (int)(newline - text);
+}
+
+struct write_result
+{
+    char *data;
+    int pos;
+};
+
+static size_t write_response(void *ptr, size_t size, size_t nmemb, void *stream)
+{
+    struct write_result *result = (struct write_result *)stream;
+
+    if(result->pos + size * nmemb >= BUFFER_SIZE - 1)
+    {
+        fprintf(stderr, "error: too small buffer\n");
+        return 0;
+    }
+
+    memcpy(result->data + result->pos, ptr, size * nmemb);
+    result->pos += size * nmemb;
+
+    return size * nmemb;
+}
+
+static char *request(const char *url)
+{
+    CURL *curl = NULL;
+    CURLcode status;
+    struct curl_slist *headers = NULL;
+    char *data = NULL;
+    long code;
+
+    curl_global_init(CURL_GLOBAL_ALL);
+    curl = curl_easy_init();
+    if(!curl)
+        goto error;
+
+    data = malloc(BUFFER_SIZE);
+    if(!data)
+        goto error;
+
+    struct write_result write_result = {
+        .data = data,
+        .pos = 0
+    };
+
+    curl_easy_setopt(curl, CURLOPT_URL, url);
+
+    /* GitHub commits API v3 requires a User-Agent header */
+    headers = curl_slist_append(headers, "User-Agent: Jansson-Tutorial");
+    curl_easy_setopt(curl, CURLOPT_HTTPHEADER, headers);
+
+    curl_easy_setopt(curl, CURLOPT_WRITEFUNCTION, write_response);
+    curl_easy_setopt(curl, CURLOPT_WRITEDATA, &write_result);
+
+    status = curl_easy_perform(curl);
+    if(status != 0)
+    {
+        fprintf(stderr, "error: unable to request data from %s:\n", url);
+        fprintf(stderr, "%s\n", curl_easy_strerror(status));
+        goto error;
+    }
+
+    curl_easy_getinfo(curl, CURLINFO_RESPONSE_CODE, &code);
+    if(code != 200)
+    {
+        fprintf(stderr, "error: server responded with code %ld\n", code);
+        goto error;
+    }
+
+    curl_easy_cleanup(curl);
+    curl_slist_free_all(headers);
+    curl_global_cleanup();
+
+    /* zero-terminate the result */
+    data[write_result.pos] = '\0';
+
+    return data;
+
+error:
+    if(data)
+        free(data);
+    if(curl)
+        curl_easy_cleanup(curl);
+    if(headers)
+        curl_slist_free_all(headers);
+    curl_global_cleanup();
+    return NULL;
+}
+
+int main(int argc, char *argv[])
+{
+    size_t i;
+    char *text;
+    char url[URL_SIZE];
+
+    json_t *root;
+    json_error_t error;
+
+    if(argc != 3)
+    {
+        fprintf(stderr, "usage: %s USER REPOSITORY\n\n", argv[0]);
+        fprintf(stderr, "List commits at USER's REPOSITORY.\n\n");
+        return 2;
+    }
+
+    snprintf(url, URL_SIZE, URL_FORMAT, argv[1], argv[2]);
+
+    text = request(url);
+    if(!text)
+        return 1;
+
+    root = json_loads(text, 0, &error);
+    free(text);
+
+    if(!root)
+    {
+        fprintf(stderr, "error: on line %d: %s\n", error.line, error.text);
+        return 1;
+    }
+
+    if(!json_is_array(root))
+    {
+        fprintf(stderr, "error: root is not an array\n");
+        json_decref(root);
+        return 1;
+    }
+
+    for(i = 0; i < json_array_size(root); i++)
+    {
+        json_t *data, *sha, *commit, *message;
+        const char *message_text;
+
+        data = json_array_get(root, i);
+        if(!json_is_object(data))
+        {
+            fprintf(stderr, "error: commit data %d is not an object\n", (int)(i + 1));
+            json_decref(root);
+            return 1;
+        }
+
+        sha = json_object_get(data, "sha");
+        if(!json_is_string(sha))
+        {
+            fprintf(stderr, "error: commit %d: sha is not a string\n", (int)(i + 1));
+            return 1;
+        }
+
+        commit = json_object_get(data, "commit");
+        if(!json_is_object(commit))
+        {
+            fprintf(stderr, "error: commit %d: commit is not an object\n", (int)(i + 1));
+            json_decref(root);
+            return 1;
+        }
+
+        message = json_object_get(commit, "message");
+        if(!json_is_string(message))
+        {
+            fprintf(stderr, "error: commit %d: message is not a string\n", (int)(i + 1));
+            json_decref(root);
+            return 1;
+        }
+
+        message_text = json_string_value(message);
+        printf("%.8s %.*s\n",
+               json_string_value(sha),
+               newline_offset(message_text),
+               message_text);
+    }
+
+    json_decref(root);
+    return 0;
+}

Added: vendor/jansson/dist/doc/index.rst
===================================================================
--- vendor/jansson/dist/doc/index.rst	                        (rev 0)
+++ vendor/jansson/dist/doc/index.rst	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,53 @@
+Jansson Documentation
+=====================
+
+This is the documentation for Jansson_ |release|, last updated |today|.
+
+Introduction
+------------
+
+Jansson_ is a C library for encoding, decoding and manipulating JSON
+data. Its main features and design principles are:
+
+- Simple and intuitive API and data model
+
+- Comprehensive documentation
+
+- No dependencies on other libraries
+
+- Full Unicode support (UTF-8)
+
+- Extensive test suite
+
+Jansson is licensed under the `MIT license`_; see LICENSE in the
+source distribution for details.
+
+Jansson is used in production and its API is stable. It works on
+numerous platforms, including numerous Unix like systems and Windows.
+It's suitable for use on any system, including desktop, server, and
+small embedded systems.
+
+
+.. _`MIT license`: http://www.opensource.org/licenses/mit-license.php
+.. _Jansson: http://www.digip.org/jansson/
+
+Contents
+--------
+
+.. toctree::
+   :maxdepth: 2
+
+   gettingstarted
+   upgrading
+   tutorial
+   conformance
+   portability
+   apiref
+   changes
+
+
+Indices and Tables
+==================
+
+* :ref:`genindex`
+* :ref:`search`

Added: vendor/jansson/dist/doc/portability.rst
===================================================================
--- vendor/jansson/dist/doc/portability.rst	                        (rev 0)
+++ vendor/jansson/dist/doc/portability.rst	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,83 @@
+***********
+Portability
+***********
+
+.. _portability-thread-safety:
+
+Thread safety
+-------------
+
+Jansson is thread safe and has no mutable global state. The only
+exceptions are the hash function seed and memory allocation functions,
+see below.
+
+There's no locking performed inside Jansson's code, so a multithreaded
+program must perform its own locking if JSON values are shared by
+multiple threads. Jansson's reference counting semantics may make this
+a bit harder than it seems, as it's possible to have a reference to a
+value that's also stored inside a list or object. Modifying the
+container (adding or removing values) may trigger concurrent access to
+such values, as containers manage the reference count of their
+contained values. Bugs involving concurrent incrementing or
+decrementing of deference counts may be hard to track.
+
+The encoding functions (:func:`json_dumps()` and friends) track
+reference loops by modifying the internal state of objects and arrays.
+For this reason, encoding functions must not be run on the same JSON
+values in two separate threads at the same time. As already noted
+above, be especially careful if two arrays or objects share their
+contained values with another array or object.
+
+If you want to make sure that two JSON value hierarchies do not
+contain shared values, use :func:`json_deep_copy()` to make copies.
+
+
+Hash function seed
+==================
+
+To prevent an attacker from intentionally causing large JSON objects
+with specially crafted keys to perform very slow, the hash function
+used by Jansson is randomized using a seed value. The seed is
+automatically generated on the first explicit or implicit call to
+:func:`json_object()`, if :func:`json_object_seed()` has not been
+called beforehand.
+
+The seed is generated by using operating system's entropy sources if
+they are available (``/dev/urandom``, ``CryptGenRandom()``). The
+initialization is done in as thread safe manner as possible, by using
+architecture specific lockless operations if provided by the platform
+or the compiler.
+
+If you're using threads, it's recommended to autoseed the hashtable
+explicitly before spawning any threads by calling
+``json_object_seed(0)`` , especially if you're unsure whether the
+initialization is thread safe on your platform.
+
+
+Memory allocation functions
+===========================
+
+Memory allocation functions should be set at most once, and only on
+program startup. See :ref:`apiref-custom-memory-allocation`.
+
+
+Locale
+------
+
+Jansson works fine under any locale.
+
+However, if the host program is multithreaded and uses ``setlocale()``
+to switch the locale in one thread while Jansson is currently encoding
+or decoding JSON data in another thread, the result may be wrong or
+the program may even crash.
+
+Jansson uses locale specific functions for certain string conversions
+in the encoder and decoder, and then converts the locale specific
+values to/from the JSON representation. This fails if the locale
+changes between the string conversion and the locale-to-JSON
+conversion. This can only happen in multithreaded programs that use
+``setlocale()``, because ``setlocale()`` switches the locale for all
+running threads, not only the thread that calls ``setlocale()``.
+
+If your program uses ``setlocale()`` as described above, consider
+using the thread-safe ``uselocale()`` instead.

Added: vendor/jansson/dist/doc/tutorial.rst
===================================================================
--- vendor/jansson/dist/doc/tutorial.rst	                        (rev 0)
+++ vendor/jansson/dist/doc/tutorial.rst	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,286 @@
+.. _tutorial:
+
+********
+Tutorial
+********
+
+.. highlight:: c
+
+In this tutorial, we create a program that fetches the latest commits
+of a repository in GitHub_ over the web. `GitHub API`_ uses JSON, so
+the result can be parsed using Jansson.
+
+To stick to the the scope of this tutorial, we will only cover the the
+parts of the program related to handling JSON data. For the best user
+experience, the full source code is available:
+:download:`github_commits.c`. To compile it (on Unix-like systems with
+gcc), use the following command::
+
+    gcc -o github_commits github_commits.c -ljansson -lcurl
+
+libcurl_ is used to communicate over the web, so it is required to
+compile the program.
+
+The command line syntax is::
+
+    github_commits USER REPOSITORY
+
+``USER`` is a GitHub user ID and ``REPOSITORY`` is the repository
+name. Please note that the GitHub API is rate limited, so if you run
+the program too many times within a short period of time, the sever
+starts to respond with an error.
+
+.. _GitHub: https://github.com/
+.. _GitHub API: http://developer.github.com/
+.. _libcurl: http://curl.haxx.se/
+
+
+.. _tutorial-github-commits-api:
+
+The GitHub Repo Commits API
+===========================
+
+The `GitHub Repo Commits API`_ is used by sending HTTP requests to
+URLs like ``https://api.github.com/repos/USER/REPOSITORY/commits``,
+where ``USER`` and ``REPOSITORY`` are the GitHub user ID and the name
+of the repository whose commits are to be listed, respectively.
+
+GitHub responds with a JSON array of the following form:
+
+.. code-block:: none
+
+    [
+        {
+            "sha": "<the commit ID>",
+            "commit": {
+                "message": "<the commit message>",
+                <more fields, not important to this tutorial...>
+            },
+            <more fields...>
+        },
+        {
+            "sha": "<the commit ID>",
+            "commit": {
+                "message": "<the commit message>",
+                <more fields...>
+            },
+            <more fields...>
+        },
+        <more commits...>
+    ]
+
+In our program, the HTTP request is sent using the following
+function::
+
+    static char *request(const char *url);
+
+It takes the URL as a parameter, preforms a HTTP GET request, and
+returns a newly allocated string that contains the response body. If
+the request fails, an error message is printed to stderr and the
+return value is *NULL*. For full details, refer to :download:`the code
+<github_commits.c>`, as the actual implementation is not important
+here.
+
+.. _GitHub Repo Commits API: http://developer.github.com/v3/repos/commits/
+
+.. _tutorial-the-program:
+
+The Program
+===========
+
+First the includes::
+
+    #include <string.h>
+    #include <jansson.h>
+
+Like all the programs using Jansson, we need to include
+:file:`jansson.h`.
+
+The following definitions are used to build the GitHub API request
+URL::
+
+   #define URL_FORMAT   "https://api.github.com/repos/%s/%s/commits"
+   #define URL_SIZE     256
+
+The following function is used when formatting the result to find the
+first newline in the commit message::
+
+    /* Return the offset of the first newline in text or the length of
+       text if there's no newline */
+    static int newline_offset(const char *text)
+    {
+        const char *newline = strchr(text, '\n');
+        if(!newline)
+            return strlen(text);
+        else
+            return (int)(newline - text);
+    }
+
+The main function follows. In the beginning, we first declare a bunch
+of variables and check the command line parameters::
+
+    int main(int argc, char *argv[])
+    {
+        size_t i;
+        char *text;
+        char url[URL_SIZE];
+
+        json_t *root;
+        json_error_t error;
+
+        if(argc != 3)
+        {
+            fprintf(stderr, "usage: %s USER REPOSITORY\n\n", argv[0]);
+            fprintf(stderr, "List commits at USER's REPOSITORY.\n\n");
+            return 2;
+        }
+
+Then we build the request URL using the user and repository names
+given as command line parameters::
+
+    snprintf(url, URL_SIZE, URL_FORMAT, argv[1], argv[2]);
+
+This uses the ``URL_SIZE`` and ``URL_FORMAT`` constants defined above.
+Now we're ready to actually request the JSON data over the web::
+
+    text = request(url);
+    if(!text)
+        return 1;
+
+If an error occurs, our function ``request`` prints the error and
+returns *NULL*, so it's enough to just return 1 from the main
+function.
+
+Next we'll call :func:`json_loads()` to decode the JSON text we got
+as a response::
+
+    root = json_loads(text, 0, &error);
+    free(text);
+
+    if(!root)
+    {
+        fprintf(stderr, "error: on line %d: %s\n", error.line, error.text);
+        return 1;
+    }
+
+We don't need the JSON text anymore, so we can free the ``text``
+variable right after decoding it. If :func:`json_loads()` fails, it
+returns *NULL* and sets error information to the :type:`json_error_t`
+structure given as the second parameter. In this case, our program
+prints the error information out and returns 1 from the main function.
+
+Now we're ready to extract the data out of the decoded JSON response.
+The structure of the response JSON was explained in section
+:ref:`tutorial-github-commits-api`.
+
+We check that the returned value really is an array::
+
+    if(!json_is_array(root))
+    {
+        fprintf(stderr, "error: root is not an array\n");
+        json_decref(root);
+        return 1;
+    }
+
+Then we proceed to loop over all the commits in the array::
+
+    for(i = 0; i < json_array_size(root); i++)
+    {
+        json_t *data, *sha, *commit, *message;
+        const char *message_text;
+
+        data = json_array_get(root, i);
+        if(!json_is_object(data))
+        {
+            fprintf(stderr, "error: commit data %d is not an object\n", i + 1);
+            json_decref(root);
+            return 1;
+        }
+    ...
+
+The function :func:`json_array_size()` returns the size of a JSON
+array. First, we again declare some variables and then extract the
+i'th element of the ``root`` array using :func:`json_array_get()`.
+We also check that the resulting value is a JSON object.
+
+Next we'll extract the commit ID (a hexadecimal SHA-1 sum),
+intermediate commit info object, and the commit message from that
+object. We also do proper type checks::
+
+        sha = json_object_get(data, "sha");
+        if(!json_is_string(sha))
+        {
+            fprintf(stderr, "error: commit %d: sha is not a string\n", i + 1);
+            json_decref(root);
+            return 1;
+        }
+
+        commit = json_object_get(data, "commit");
+        if(!json_is_object(commit))
+        {
+            fprintf(stderr, "error: commit %d: commit is not an object\n", i + 1);
+            json_decref(root);
+            return 1;
+        }
+
+        message = json_object_get(commit, "message");
+        if(!json_is_string(message))
+        {
+            fprintf(stderr, "error: commit %d: message is not a string\n", i + 1);
+            json_decref(root);
+            return 1;
+        }
+    ...
+
+And finally, we'll print the first 8 characters of the commit ID and
+the first line of the commit message. A C-style string is extracted
+from a JSON string using :func:`json_string_value()`::
+
+        message_text = json_string_value(message);
+        printf("%.8s %.*s\n",
+               json_string_value(id),
+               newline_offset(message_text),
+               message_text);
+    }
+
+After sending the HTTP request, we decoded the JSON text using
+:func:`json_loads()`, remember? It returns a *new reference* to the
+JSON value it decodes. When we're finished with the value, we'll need
+to decrease the reference count using :func:`json_decref()`. This way
+Jansson can release the resources::
+
+    json_decref(root);
+    return 0;
+
+For a detailed explanation of reference counting in Jansson, see
+:ref:`apiref-reference-count` in :ref:`apiref`.
+
+The program's ready, let's test it and view the latest commits in
+Jansson's repository::
+
+    $ ./github_commits akheron jansson
+    1581f26a Merge branch '2.3'
+    aabfd493 load: Change buffer_pos to be a size_t
+    bd72efbd load: Avoid unexpected behaviour in macro expansion
+    e8fd3e30 Document and tweak json_load_callback()
+    873eddaf Merge pull request #60 from rogerz/contrib
+    bd2c0c73 Ignore the binary test_load_callback
+    17a51a4b Merge branch '2.3'
+    09c39adc Add json_load_callback to the list of exported symbols
+    cbb80baf Merge pull request #57 from rogerz/contrib
+    040bd7b0 Add json_load_callback()
+    2637faa4 Make test stripping locale independent
+    <...>
+
+
+Conclusion
+==========
+
+In this tutorial, we implemented a program that fetches the latest
+commits of a GitHub repository using the GitHub Repo Commits API.
+Jansson was used to decode the JSON response and to extract the commit
+data.
+
+This tutorial only covered a small part of Jansson. For example, we
+did not create or manipulate JSON values at all. Proceed to
+:ref:`apiref` to explore all features of Jansson.

Added: vendor/jansson/dist/doc/upgrading.rst
===================================================================
--- vendor/jansson/dist/doc/upgrading.rst	                        (rev 0)
+++ vendor/jansson/dist/doc/upgrading.rst	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,76 @@
+.. highlight:: c
+
+******************
+Upgrading from 1.x
+******************
+
+This chapter lists the backwards incompatible changes introduced in
+Jansson 2.0, and the steps that are needed for upgrading your code.
+
+**The incompatibilities are not dramatic.** The biggest change is that
+all decoding functions now require and extra parameter. Most programs
+can be modified to work with 2.0 by adding a ``0`` as the second
+parameter to all calls of :func:`json_loads()`, :func:`json_loadf()`
+and :func:`json_load_file()`.
+
+
+Compatibility
+=============
+
+Jansson 2.0 is backwards incompatible with the Jansson 1.x releases.
+It is ABI incompatible, i.e. all programs dynamically linking to the
+Jansson library need to be recompiled. It's also API incompatible,
+i.e. the source code of programs using Jansson 1.x may need
+modifications to make them compile against Jansson 2.0.
+
+All the 2.x releases are guaranteed to be backwards compatible for
+both ABI and API, so no recompilation or source changes are needed
+when upgrading from 2.x to 2.y.
+
+
+List of Incompatible Changes
+============================
+
+**Decoding flags**
+    For future needs, a ``flags`` parameter was added as the second
+    parameter to all decoding functions, i.e. :func:`json_loads()`,
+    :func:`json_loadf()` and :func:`json_load_file()`. All calls to
+    these functions need to be changed by adding a ``0`` as the second
+    argument. For example::
+
+        /* old code */
+        json_loads(input, &error);
+
+        /* new code */
+        json_loads(input, 0, &error);
+
+
+**Underlying type of JSON integers**
+    The underlying C type of JSON integers has been changed from
+    :type:`int` to the widest available signed integer type, i.e.
+    :type:`long long` or :type:`long`, depending on whether
+    :type:`long long` is supported on your system or not. This makes
+    the whole 64-bit integer range available on most modern systems.
+
+    ``jansson.h`` has a typedef :type:`json_int_t` to the underlying
+    integer type. :type:`int` should still be used in most cases when
+    dealing with smallish JSON integers, as the compiler handles
+    implicit type coercion. Only when the full 64-bit range is needed,
+    :type:`json_int_t` should be explicitly used.
+
+
+**Maximum encoder indentation depth**
+    The maximum argument of the ``JSON_INDENT()`` macro has been
+    changed from 255 to 31, to free up bits from the ``flags``
+    parameter of :func:`json_dumps()`, :func:`json_dumpf()` and
+    :func:`json_dump_file()`. If your code uses a bigger indentation
+    than 31, it needs to be changed.
+
+
+**Unsigned integers in API functions**
+    Version 2.0 unifies unsigned integer usage in the API. All uses of
+    :type:`unsigned int` and :type:`unsigned long` have been replaced
+    with :type:`size_t`. This includes flags, container sizes, etc.
+    This should not require source code changes, as both
+    :type:`unsigned int` and :type:`unsigned long` are usually
+    compatible with :type:`size_t`.

Added: vendor/jansson/dist/install-sh
===================================================================
--- vendor/jansson/dist/install-sh	                        (rev 0)
+++ vendor/jansson/dist/install-sh	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,527 @@
+#!/bin/sh
+# install - install a program, script, or datafile
+
+scriptversion=2011-11-20.07; # UTC
+
+# This originates from X11R5 (mit/util/scripts/install.sh), which was
+# later released in X11R6 (xc/config/util/install.sh) with the
+# following copyright and license.
+#
+# Copyright (C) 1994 X Consortium
+#
+# Permission is hereby granted, free of charge, to any person obtaining a copy
+# of this software and associated documentation files (the "Software"), to
+# deal in the Software without restriction, including without limitation the
+# rights to use, copy, modify, merge, publish, distribute, sublicense, and/or
+# sell copies of the Software, and to permit persons to whom the Software is
+# furnished to do so, subject to the following conditions:
+#
+# The above copyright notice and this permission notice shall be included in
+# all copies or substantial portions of the Software.
+#
+# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+# FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.  IN NO EVENT SHALL THE
+# X CONSORTIUM BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN
+# AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNEC-
+# TION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+#
+# Except as contained in this notice, the name of the X Consortium shall not
+# be used in advertising or otherwise to promote the sale, use or other deal-
+# ings in this Software without prior written authorization from the X Consor-
+# tium.
+#
+#
+# FSF changes to this file are in the public domain.
+#
+# Calling this script install-sh is preferred over install.sh, to prevent
+# 'make' implicit rules from creating a file called install from it
+# when there is no Makefile.
+#
+# This script is compatible with the BSD install script, but was written
+# from scratch.
+
+nl='
+'
+IFS=" ""	$nl"
+
+# set DOITPROG to echo to test this script
+
+# Don't use :- since 4.3BSD and earlier shells don't like it.
+doit=${DOITPROG-}
+if test -z "$doit"; then
+  doit_exec=exec
+else
+  doit_exec=$doit
+fi
+
+# Put in absolute file names if you don't have them in your path;
+# or use environment vars.
+
+chgrpprog=${CHGRPPROG-chgrp}
+chmodprog=${CHMODPROG-chmod}
+chownprog=${CHOWNPROG-chown}
+cmpprog=${CMPPROG-cmp}
+cpprog=${CPPROG-cp}
+mkdirprog=${MKDIRPROG-mkdir}
+mvprog=${MVPROG-mv}
+rmprog=${RMPROG-rm}
+stripprog=${STRIPPROG-strip}
+
+posix_glob='?'
+initialize_posix_glob='
+  test "$posix_glob" != "?" || {
+    if (set -f) 2>/dev/null; then
+      posix_glob=
+    else
+      posix_glob=:
+    fi
+  }
+'
+
+posix_mkdir=
+
+# Desired mode of installed file.
+mode=0755
+
+chgrpcmd=
+chmodcmd=$chmodprog
+chowncmd=
+mvcmd=$mvprog
+rmcmd="$rmprog -f"
+stripcmd=
+
+src=
+dst=
+dir_arg=
+dst_arg=
+
+copy_on_change=false
+no_target_directory=
+
+usage="\
+Usage: $0 [OPTION]... [-T] SRCFILE DSTFILE
+   or: $0 [OPTION]... SRCFILES... DIRECTORY
+   or: $0 [OPTION]... -t DIRECTORY SRCFILES...
+   or: $0 [OPTION]... -d DIRECTORIES...
+
+In the 1st form, copy SRCFILE to DSTFILE.
+In the 2nd and 3rd, copy all SRCFILES to DIRECTORY.
+In the 4th, create DIRECTORIES.
+
+Options:
+     --help     display this help and exit.
+     --version  display version info and exit.
+
+  -c            (ignored)
+  -C            install only if different (preserve the last data modification time)
+  -d            create directories instead of installing files.
+  -g GROUP      $chgrpprog installed files to GROUP.
+  -m MODE       $chmodprog installed files to MODE.
+  -o USER       $chownprog installed files to USER.
+  -s            $stripprog installed files.
+  -t DIRECTORY  install into DIRECTORY.
+  -T            report an error if DSTFILE is a directory.
+
+Environment variables override the default commands:
+  CHGRPPROG CHMODPROG CHOWNPROG CMPPROG CPPROG MKDIRPROG MVPROG
+  RMPROG STRIPPROG
+"
+
+while test $# -ne 0; do
+  case $1 in
+    -c) ;;
+
+    -C) copy_on_change=true;;
+
+    -d) dir_arg=true;;
+
+    -g) chgrpcmd="$chgrpprog $2"
+	shift;;
+
+    --help) echo "$usage"; exit $?;;
+
+    -m) mode=$2
+	case $mode in
+	  *' '* | *'	'* | *'
+'*	  | *'*'* | *'?'* | *'['*)
+	    echo "$0: invalid mode: $mode" >&2
+	    exit 1;;
+	esac
+	shift;;
+
+    -o) chowncmd="$chownprog $2"
+	shift;;
+
+    -s) stripcmd=$stripprog;;
+
+    -t) dst_arg=$2
+	# Protect names problematic for 'test' and other utilities.
+	case $dst_arg in
+	  -* | [=\(\)!]) dst_arg=./$dst_arg;;
+	esac
+	shift;;
+
+    -T) no_target_directory=true;;
+
+    --version) echo "$0 $scriptversion"; exit $?;;
+
+    --)	shift
+	break;;
+
+    -*)	echo "$0: invalid option: $1" >&2
+	exit 1;;
+
+    *)  break;;
+  esac
+  shift
+done
+
+if test $# -ne 0 && test -z "$dir_arg$dst_arg"; then
+  # When -d is used, all remaining arguments are directories to create.
+  # When -t is used, the destination is already specified.
+  # Otherwise, the last argument is the destination.  Remove it from $@.
+  for arg
+  do
+    if test -n "$dst_arg"; then
+      # $@ is not empty: it contains at least $arg.
+      set fnord "$@" "$dst_arg"
+      shift # fnord
+    fi
+    shift # arg
+    dst_arg=$arg
+    # Protect names problematic for 'test' and other utilities.
+    case $dst_arg in
+      -* | [=\(\)!]) dst_arg=./$dst_arg;;
+    esac
+  done
+fi
+
+if test $# -eq 0; then
+  if test -z "$dir_arg"; then
+    echo "$0: no input file specified." >&2
+    exit 1
+  fi
+  # It's OK to call 'install-sh -d' without argument.
+  # This can happen when creating conditional directories.
+  exit 0
+fi
+
+if test -z "$dir_arg"; then
+  do_exit='(exit $ret); exit $ret'
+  trap "ret=129; $do_exit" 1
+  trap "ret=130; $do_exit" 2
+  trap "ret=141; $do_exit" 13
+  trap "ret=143; $do_exit" 15
+
+  # Set umask so as not to create temps with too-generous modes.
+  # However, 'strip' requires both read and write access to temps.
+  case $mode in
+    # Optimize common cases.
+    *644) cp_umask=133;;
+    *755) cp_umask=22;;
+
+    *[0-7])
+      if test -z "$stripcmd"; then
+	u_plus_rw=
+      else
+	u_plus_rw='% 200'
+      fi
+      cp_umask=`expr '(' 777 - $mode % 1000 ')' $u_plus_rw`;;
+    *)
+      if test -z "$stripcmd"; then
+	u_plus_rw=
+      else
+	u_plus_rw=,u+rw
+      fi
+      cp_umask=$mode$u_plus_rw;;
+  esac
+fi
+
+for src
+do
+  # Protect names problematic for 'test' and other utilities.
+  case $src in
+    -* | [=\(\)!]) src=./$src;;
+  esac
+
+  if test -n "$dir_arg"; then
+    dst=$src
+    dstdir=$dst
+    test -d "$dstdir"
+    dstdir_status=$?
+  else
+
+    # Waiting for this to be detected by the "$cpprog $src $dsttmp" command
+    # might cause directories to be created, which would be especially bad
+    # if $src (and thus $dsttmp) contains '*'.
+    if test ! -f "$src" && test ! -d "$src"; then
+      echo "$0: $src does not exist." >&2
+      exit 1
+    fi
+
+    if test -z "$dst_arg"; then
+      echo "$0: no destination specified." >&2
+      exit 1
+    fi
+    dst=$dst_arg
+
+    # If destination is a directory, append the input filename; won't work
+    # if double slashes aren't ignored.
+    if test -d "$dst"; then
+      if test -n "$no_target_directory"; then
+	echo "$0: $dst_arg: Is a directory" >&2
+	exit 1
+      fi
+      dstdir=$dst
+      dst=$dstdir/`basename "$src"`
+      dstdir_status=0
+    else
+      # Prefer dirname, but fall back on a substitute if dirname fails.
+      dstdir=`
+	(dirname "$dst") 2>/dev/null ||
+	expr X"$dst" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+	     X"$dst" : 'X\(//\)[^/]' \| \
+	     X"$dst" : 'X\(//\)$' \| \
+	     X"$dst" : 'X\(/\)' \| . 2>/dev/null ||
+	echo X"$dst" |
+	    sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+		   s//\1/
+		   q
+		 }
+		 /^X\(\/\/\)[^/].*/{
+		   s//\1/
+		   q
+		 }
+		 /^X\(\/\/\)$/{
+		   s//\1/
+		   q
+		 }
+		 /^X\(\/\).*/{
+		   s//\1/
+		   q
+		 }
+		 s/.*/./; q'
+      `
+
+      test -d "$dstdir"
+      dstdir_status=$?
+    fi
+  fi
+
+  obsolete_mkdir_used=false
+
+  if test $dstdir_status != 0; then
+    case $posix_mkdir in
+      '')
+	# Create intermediate dirs using mode 755 as modified by the umask.
+	# This is like FreeBSD 'install' as of 1997-10-28.
+	umask=`umask`
+	case $stripcmd.$umask in
+	  # Optimize common cases.
+	  *[2367][2367]) mkdir_umask=$umask;;
+	  .*0[02][02] | .[02][02] | .[02]) mkdir_umask=22;;
+
+	  *[0-7])
+	    mkdir_umask=`expr $umask + 22 \
+	      - $umask % 100 % 40 + $umask % 20 \
+	      - $umask % 10 % 4 + $umask % 2
+	    `;;
+	  *) mkdir_umask=$umask,go-w;;
+	esac
+
+	# With -d, create the new directory with the user-specified mode.
+	# Otherwise, rely on $mkdir_umask.
+	if test -n "$dir_arg"; then
+	  mkdir_mode=-m$mode
+	else
+	  mkdir_mode=
+	fi
+
+	posix_mkdir=false
+	case $umask in
+	  *[123567][0-7][0-7])
+	    # POSIX mkdir -p sets u+wx bits regardless of umask, which
+	    # is incompatible with FreeBSD 'install' when (umask & 300) != 0.
+	    ;;
+	  *)
+	    tmpdir=${TMPDIR-/tmp}/ins$RANDOM-$$
+	    trap 'ret=$?; rmdir "$tmpdir/d" "$tmpdir" 2>/dev/null; exit $ret' 0
+
+	    if (umask $mkdir_umask &&
+		exec $mkdirprog $mkdir_mode -p -- "$tmpdir/d") >/dev/null 2>&1
+	    then
+	      if test -z "$dir_arg" || {
+		   # Check for POSIX incompatibilities with -m.
+		   # HP-UX 11.23 and IRIX 6.5 mkdir -m -p sets group- or
+		   # other-writable bit of parent directory when it shouldn't.
+		   # FreeBSD 6.1 mkdir -m -p sets mode of existing directory.
+		   ls_ld_tmpdir=`ls -ld "$tmpdir"`
+		   case $ls_ld_tmpdir in
+		     d????-?r-*) different_mode=700;;
+		     d????-?--*) different_mode=755;;
+		     *) false;;
+		   esac &&
+		   $mkdirprog -m$different_mode -p -- "$tmpdir" && {
+		     ls_ld_tmpdir_1=`ls -ld "$tmpdir"`
+		     test "$ls_ld_tmpdir" = "$ls_ld_tmpdir_1"
+		   }
+		 }
+	      then posix_mkdir=:
+	      fi
+	      rmdir "$tmpdir/d" "$tmpdir"
+	    else
+	      # Remove any dirs left behind by ancient mkdir implementations.
+	      rmdir ./$mkdir_mode ./-p ./-- 2>/dev/null
+	    fi
+	    trap '' 0;;
+	esac;;
+    esac
+
+    if
+      $posix_mkdir && (
+	umask $mkdir_umask &&
+	$doit_exec $mkdirprog $mkdir_mode -p -- "$dstdir"
+      )
+    then :
+    else
+
+      # The umask is ridiculous, or mkdir does not conform to POSIX,
+      # or it failed possibly due to a race condition.  Create the
+      # directory the slow way, step by step, checking for races as we go.
+
+      case $dstdir in
+	/*) prefix='/';;
+	[-=\(\)!]*) prefix='./';;
+	*)  prefix='';;
+      esac
+
+      eval "$initialize_posix_glob"
+
+      oIFS=$IFS
+      IFS=/
+      $posix_glob set -f
+      set fnord $dstdir
+      shift
+      $posix_glob set +f
+      IFS=$oIFS
+
+      prefixes=
+
+      for d
+      do
+	test X"$d" = X && continue
+
+	prefix=$prefix$d
+	if test -d "$prefix"; then
+	  prefixes=
+	else
+	  if $posix_mkdir; then
+	    (umask=$mkdir_umask &&
+	     $doit_exec $mkdirprog $mkdir_mode -p -- "$dstdir") && break
+	    # Don't fail if two instances are running concurrently.
+	    test -d "$prefix" || exit 1
+	  else
+	    case $prefix in
+	      *\'*) qprefix=`echo "$prefix" | sed "s/'/'\\\\\\\\''/g"`;;
+	      *) qprefix=$prefix;;
+	    esac
+	    prefixes="$prefixes '$qprefix'"
+	  fi
+	fi
+	prefix=$prefix/
+      done
+
+      if test -n "$prefixes"; then
+	# Don't fail if two instances are running concurrently.
+	(umask $mkdir_umask &&
+	 eval "\$doit_exec \$mkdirprog $prefixes") ||
+	  test -d "$dstdir" || exit 1
+	obsolete_mkdir_used=true
+      fi
+    fi
+  fi
+
+  if test -n "$dir_arg"; then
+    { test -z "$chowncmd" || $doit $chowncmd "$dst"; } &&
+    { test -z "$chgrpcmd" || $doit $chgrpcmd "$dst"; } &&
+    { test "$obsolete_mkdir_used$chowncmd$chgrpcmd" = false ||
+      test -z "$chmodcmd" || $doit $chmodcmd $mode "$dst"; } || exit 1
+  else
+
+    # Make a couple of temp file names in the proper directory.
+    dsttmp=$dstdir/_inst.$$_
+    rmtmp=$dstdir/_rm.$$_
+
+    # Trap to clean up those temp files at exit.
+    trap 'ret=$?; rm -f "$dsttmp" "$rmtmp" && exit $ret' 0
+
+    # Copy the file name to the temp name.
+    (umask $cp_umask && $doit_exec $cpprog "$src" "$dsttmp") &&
+
+    # and set any options; do chmod last to preserve setuid bits.
+    #
+    # If any of these fail, we abort the whole thing.  If we want to
+    # ignore errors from any of these, just make sure not to ignore
+    # errors from the above "$doit $cpprog $src $dsttmp" command.
+    #
+    { test -z "$chowncmd" || $doit $chowncmd "$dsttmp"; } &&
+    { test -z "$chgrpcmd" || $doit $chgrpcmd "$dsttmp"; } &&
+    { test -z "$stripcmd" || $doit $stripcmd "$dsttmp"; } &&
+    { test -z "$chmodcmd" || $doit $chmodcmd $mode "$dsttmp"; } &&
+
+    # If -C, don't bother to copy if it wouldn't change the file.
+    if $copy_on_change &&
+       old=`LC_ALL=C ls -dlL "$dst"	2>/dev/null` &&
+       new=`LC_ALL=C ls -dlL "$dsttmp"	2>/dev/null` &&
+
+       eval "$initialize_posix_glob" &&
+       $posix_glob set -f &&
+       set X $old && old=:$2:$4:$5:$6 &&
+       set X $new && new=:$2:$4:$5:$6 &&
+       $posix_glob set +f &&
+
+       test "$old" = "$new" &&
+       $cmpprog "$dst" "$dsttmp" >/dev/null 2>&1
+    then
+      rm -f "$dsttmp"
+    else
+      # Rename the file to the real destination.
+      $doit $mvcmd -f "$dsttmp" "$dst" 2>/dev/null ||
+
+      # The rename failed, perhaps because mv can't rename something else
+      # to itself, or perhaps because mv is so ancient that it does not
+      # support -f.
+      {
+	# Now remove or move aside any old file at destination location.
+	# We try this two ways since rm can't unlink itself on some
+	# systems and the destination file might be busy for other
+	# reasons.  In this case, the final cleanup might fail but the new
+	# file should still install successfully.
+	{
+	  test ! -f "$dst" ||
+	  $doit $rmcmd -f "$dst" 2>/dev/null ||
+	  { $doit $mvcmd -f "$dst" "$rmtmp" 2>/dev/null &&
+	    { $doit $rmcmd -f "$rmtmp" 2>/dev/null; :; }
+	  } ||
+	  { echo "$0: cannot unlink or rename $dst" >&2
+	    (exit 1); exit 1
+	  }
+	} &&
+
+	# Now rename the file to the real destination.
+	$doit $mvcmd "$dsttmp" "$dst"
+      }
+    fi || exit 1
+
+    trap '' 0
+  fi
+done
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "scriptversion="
+# time-stamp-format: "%:y-%02m-%02d.%02H"
+# time-stamp-time-zone: "UTC"
+# time-stamp-end: "; # UTC"
+# End:

Added: vendor/jansson/dist/jansson.pc.in
===================================================================
--- vendor/jansson/dist/jansson.pc.in	                        (rev 0)
+++ vendor/jansson/dist/jansson.pc.in	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,10 @@
+prefix=@prefix@
+exec_prefix=@exec_prefix@
+libdir=@libdir@
+includedir=${prefix}/include
+
+Name: Jansson
+Description: Library for encoding, decoding and manipulating JSON data
+Version: @VERSION@
+Libs: -L${libdir} -ljansson
+Cflags: -I${includedir}

Added: vendor/jansson/dist/jansson_private_config.h.in
===================================================================
--- vendor/jansson/dist/jansson_private_config.h.in	                        (rev 0)
+++ vendor/jansson/dist/jansson_private_config.h.in	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,155 @@
+/* jansson_private_config.h.in.  Generated from configure.ac by autoheader.  */
+
+/* Define to 1 if gcc's __atomic builtins are available */
+#undef HAVE_ATOMIC_BUILTINS
+
+/* Define to 1 if you have the `close' function. */
+#undef HAVE_CLOSE
+
+/* Define to 1 if you have the <dlfcn.h> header file. */
+#undef HAVE_DLFCN_H
+
+/* Define to 1 if you have the <endian.h> header file. */
+#undef HAVE_ENDIAN_H
+
+/* Define to 1 if you have the <fcntl.h> header file. */
+#undef HAVE_FCNTL_H
+
+/* Define to 1 if you have the `getpid' function. */
+#undef HAVE_GETPID
+
+/* Define to 1 if you have the `gettimeofday' function. */
+#undef HAVE_GETTIMEOFDAY
+
+/* Define to 1 if you have the <inttypes.h> header file. */
+#undef HAVE_INTTYPES_H
+
+/* Define to 1 if you have the `localeconv' function. */
+#undef HAVE_LOCALECONV
+
+/* Define to 1 if you have the <locale.h> header file. */
+#undef HAVE_LOCALE_H
+
+/* Define to 1 if the system has the type `long long int'. */
+#undef HAVE_LONG_LONG_INT
+
+/* Define to 1 if you have the <memory.h> header file. */
+#undef HAVE_MEMORY_H
+
+/* Define to 1 if you have the `open' function. */
+#undef HAVE_OPEN
+
+/* Define to 1 if you have the `read' function. */
+#undef HAVE_READ
+
+/* Define to 1 if you have the <sched.h> header file. */
+#undef HAVE_SCHED_H
+
+/* Define to 1 if you have the `sched_yield' function. */
+#undef HAVE_SCHED_YIELD
+
+/* Define to 1 if you have the <stdint.h> header file. */
+#undef HAVE_STDINT_H
+
+/* Define to 1 if you have the <stdlib.h> header file. */
+#undef HAVE_STDLIB_H
+
+/* Define to 1 if you have the <strings.h> header file. */
+#undef HAVE_STRINGS_H
+
+/* Define to 1 if you have the <string.h> header file. */
+#undef HAVE_STRING_H
+
+/* Define to 1 if you have the `strtoll' function. */
+#undef HAVE_STRTOLL
+
+/* Define to 1 if gcc's __sync builtins are available */
+#undef HAVE_SYNC_BUILTINS
+
+/* Define to 1 if you have the <sys/param.h> header file. */
+#undef HAVE_SYS_PARAM_H
+
+/* Define to 1 if you have the <sys/stat.h> header file. */
+#undef HAVE_SYS_STAT_H
+
+/* Define to 1 if you have the <sys/time.h> header file. */
+#undef HAVE_SYS_TIME_H
+
+/* Define to 1 if you have the <sys/types.h> header file. */
+#undef HAVE_SYS_TYPES_H
+
+/* Define to 1 if you have the <unistd.h> header file. */
+#undef HAVE_UNISTD_H
+
+/* Define to 1 if the system has the type `unsigned long long int'. */
+#undef HAVE_UNSIGNED_LONG_LONG_INT
+
+/* Define to the sub-directory in which libtool stores uninstalled libraries.
+   */
+#undef LT_OBJDIR
+
+/* Name of package */
+#undef PACKAGE
+
+/* Define to the address where bug reports for this package should be sent. */
+#undef PACKAGE_BUGREPORT
+
+/* Define to the full name of this package. */
+#undef PACKAGE_NAME
+
+/* Define to the full name and version of this package. */
+#undef PACKAGE_STRING
+
+/* Define to the one symbol short name of this package. */
+#undef PACKAGE_TARNAME
+
+/* Define to the home page for this package. */
+#undef PACKAGE_URL
+
+/* Define to the version of this package. */
+#undef PACKAGE_VERSION
+
+/* Define to 1 if you have the ANSI C header files. */
+#undef STDC_HEADERS
+
+/* Define to 1 if /dev/urandom should be used for seeding the hash function */
+#undef USE_URANDOM
+
+/* Define to 1 if CryptGenRandom should be used for seeding the hash function
+   */
+#undef USE_WINDOWS_CRYPTOAPI
+
+/* Version number of package */
+#undef VERSION
+
+/* Define for Solaris 2.5.1 so the uint32_t typedef from <sys/synch.h>,
+   <pthread.h>, or <semaphore.h> is not used. If the typedef were allowed, the
+   #define below would cause a syntax error. */
+#undef _UINT32_T
+
+/* Define for Solaris 2.5.1 so the uint8_t typedef from <sys/synch.h>,
+   <pthread.h>, or <semaphore.h> is not used. If the typedef were allowed, the
+   #define below would cause a syntax error. */
+#undef _UINT8_T
+
+/* Define to `__inline__' or `__inline' if that's what the C compiler
+   calls it, or to nothing if 'inline' is not supported under any name.  */
+#ifndef __cplusplus
+#undef inline
+#endif
+
+/* Define to the type of a signed integer type of width exactly 32 bits if
+   such a type exists and the standard includes do not define it. */
+#undef int32_t
+
+/* Define to the type of an unsigned integer type of width exactly 16 bits if
+   such a type exists and the standard includes do not define it. */
+#undef uint16_t
+
+/* Define to the type of an unsigned integer type of width exactly 32 bits if
+   such a type exists and the standard includes do not define it. */
+#undef uint32_t
+
+/* Define to the type of an unsigned integer type of width exactly 8 bits if
+   such a type exists and the standard includes do not define it. */
+#undef uint8_t

Added: vendor/jansson/dist/ltmain.sh
===================================================================
--- vendor/jansson/dist/ltmain.sh	                        (rev 0)
+++ vendor/jansson/dist/ltmain.sh	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,9661 @@
+
+# libtool (GNU libtool) 2.4.2
+# Written by Gordon Matzigkeit <gord at gnu.ai.mit.edu>, 1996
+
+# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005, 2006,
+# 2007, 2008, 2009, 2010, 2011 Free Software Foundation, Inc.
+# This is free software; see the source for copying conditions.  There is NO
+# warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.
+
+# GNU Libtool is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# As a special exception to the GNU General Public License,
+# if you distribute this file as part of a program or library that
+# is built using GNU Libtool, you may include this file under the
+# same distribution terms that you use for the rest of that program.
+#
+# GNU Libtool is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with GNU Libtool; see the file COPYING.  If not, a copy
+# can be downloaded from http://www.gnu.org/licenses/gpl.html,
+# or obtained by writing to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+# Usage: $progname [OPTION]... [MODE-ARG]...
+#
+# Provide generalized library-building support services.
+#
+#       --config             show all configuration variables
+#       --debug              enable verbose shell tracing
+#   -n, --dry-run            display commands without modifying any files
+#       --features           display basic configuration information and exit
+#       --mode=MODE          use operation mode MODE
+#       --preserve-dup-deps  don't remove duplicate dependency libraries
+#       --quiet, --silent    don't print informational messages
+#       --no-quiet, --no-silent
+#                            print informational messages (default)
+#       --no-warn            don't display warning messages
+#       --tag=TAG            use configuration variables from tag TAG
+#   -v, --verbose            print more informational messages than default
+#       --no-verbose         don't print the extra informational messages
+#       --version            print version information
+#   -h, --help, --help-all   print short, long, or detailed help message
+#
+# MODE must be one of the following:
+#
+#         clean              remove files from the build directory
+#         compile            compile a source file into a libtool object
+#         execute            automatically set library path, then run a program
+#         finish             complete the installation of libtool libraries
+#         install            install libraries or executables
+#         link               create a library or an executable
+#         uninstall          remove libraries from an installed directory
+#
+# MODE-ARGS vary depending on the MODE.  When passed as first option,
+# `--mode=MODE' may be abbreviated as `MODE' or a unique abbreviation of that.
+# Try `$progname --help --mode=MODE' for a more detailed description of MODE.
+#
+# When reporting a bug, please describe a test case to reproduce it and
+# include the following information:
+#
+#         host-triplet:	$host
+#         shell:		$SHELL
+#         compiler:		$LTCC
+#         compiler flags:		$LTCFLAGS
+#         linker:		$LD (gnu? $with_gnu_ld)
+#         $progname:	(GNU libtool) 2.4.2 Debian-2.4.2-1.7ubuntu1
+#         automake:	$automake_version
+#         autoconf:	$autoconf_version
+#
+# Report bugs to <bug-libtool at gnu.org>.
+# GNU libtool home page: <http://www.gnu.org/software/libtool/>.
+# General help using GNU software: <http://www.gnu.org/gethelp/>.
+
+PROGRAM=libtool
+PACKAGE=libtool
+VERSION="2.4.2 Debian-2.4.2-1.7ubuntu1"
+TIMESTAMP=""
+package_revision=1.3337
+
+# Be Bourne compatible
+if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then
+  emulate sh
+  NULLCMD=:
+  # Zsh 3.x and 4.x performs word splitting on ${1+"$@"}, which
+  # is contrary to our usage.  Disable this feature.
+  alias -g '${1+"$@"}'='"$@"'
+  setopt NO_GLOB_SUBST
+else
+  case `(set -o) 2>/dev/null` in *posix*) set -o posix;; esac
+fi
+BIN_SH=xpg4; export BIN_SH # for Tru64
+DUALCASE=1; export DUALCASE # for MKS sh
+
+# A function that is used when there is no print builtin or printf.
+func_fallback_echo ()
+{
+  eval 'cat <<_LTECHO_EOF
+$1
+_LTECHO_EOF'
+}
+
+# NLS nuisances: We save the old values to restore during execute mode.
+lt_user_locale=
+lt_safe_locale=
+for lt_var in LANG LANGUAGE LC_ALL LC_CTYPE LC_COLLATE LC_MESSAGES
+do
+  eval "if test \"\${$lt_var+set}\" = set; then
+          save_$lt_var=\$$lt_var
+          $lt_var=C
+	  export $lt_var
+	  lt_user_locale=\"$lt_var=\\\$save_\$lt_var; \$lt_user_locale\"
+	  lt_safe_locale=\"$lt_var=C; \$lt_safe_locale\"
+	fi"
+done
+LC_ALL=C
+LANGUAGE=C
+export LANGUAGE LC_ALL
+
+$lt_unset CDPATH
+
+
+# Work around backward compatibility issue on IRIX 6.5. On IRIX 6.4+, sh
+# is ksh but when the shell is invoked as "sh" and the current value of
+# the _XPG environment variable is not equal to 1 (one), the special
+# positional parameter $0, within a function call, is the name of the
+# function.
+progpath="$0"
+
+
+
+: ${CP="cp -f"}
+test "${ECHO+set}" = set || ECHO=${as_echo-'printf %s\n'}
+: ${MAKE="make"}
+: ${MKDIR="mkdir"}
+: ${MV="mv -f"}
+: ${RM="rm -f"}
+: ${SHELL="${CONFIG_SHELL-/bin/sh}"}
+: ${Xsed="$SED -e 1s/^X//"}
+
+# Global variables:
+EXIT_SUCCESS=0
+EXIT_FAILURE=1
+EXIT_MISMATCH=63  # $? = 63 is used to indicate version mismatch to missing.
+EXIT_SKIP=77	  # $? = 77 is used to indicate a skipped test to automake.
+
+exit_status=$EXIT_SUCCESS
+
+# Make sure IFS has a sensible default
+lt_nl='
+'
+IFS=" 	$lt_nl"
+
+dirname="s,/[^/]*$,,"
+basename="s,^.*/,,"
+
+# func_dirname file append nondir_replacement
+# Compute the dirname of FILE.  If nonempty, add APPEND to the result,
+# otherwise set result to NONDIR_REPLACEMENT.
+func_dirname ()
+{
+    func_dirname_result=`$ECHO "${1}" | $SED "$dirname"`
+    if test "X$func_dirname_result" = "X${1}"; then
+      func_dirname_result="${3}"
+    else
+      func_dirname_result="$func_dirname_result${2}"
+    fi
+} # func_dirname may be replaced by extended shell implementation
+
+
+# func_basename file
+func_basename ()
+{
+    func_basename_result=`$ECHO "${1}" | $SED "$basename"`
+} # func_basename may be replaced by extended shell implementation
+
+
+# func_dirname_and_basename file append nondir_replacement
+# perform func_basename and func_dirname in a single function
+# call:
+#   dirname:  Compute the dirname of FILE.  If nonempty,
+#             add APPEND to the result, otherwise set result
+#             to NONDIR_REPLACEMENT.
+#             value returned in "$func_dirname_result"
+#   basename: Compute filename of FILE.
+#             value retuned in "$func_basename_result"
+# Implementation must be kept synchronized with func_dirname
+# and func_basename. For efficiency, we do not delegate to
+# those functions but instead duplicate the functionality here.
+func_dirname_and_basename ()
+{
+    # Extract subdirectory from the argument.
+    func_dirname_result=`$ECHO "${1}" | $SED -e "$dirname"`
+    if test "X$func_dirname_result" = "X${1}"; then
+      func_dirname_result="${3}"
+    else
+      func_dirname_result="$func_dirname_result${2}"
+    fi
+    func_basename_result=`$ECHO "${1}" | $SED -e "$basename"`
+} # func_dirname_and_basename may be replaced by extended shell implementation
+
+
+# func_stripname prefix suffix name
+# strip PREFIX and SUFFIX off of NAME.
+# PREFIX and SUFFIX must not contain globbing or regex special
+# characters, hashes, percent signs, but SUFFIX may contain a leading
+# dot (in which case that matches only a dot).
+# func_strip_suffix prefix name
+func_stripname ()
+{
+    case ${2} in
+      .*) func_stripname_result=`$ECHO "${3}" | $SED "s%^${1}%%; s%\\\\${2}\$%%"`;;
+      *)  func_stripname_result=`$ECHO "${3}" | $SED "s%^${1}%%; s%${2}\$%%"`;;
+    esac
+} # func_stripname may be replaced by extended shell implementation
+
+
+# These SED scripts presuppose an absolute path with a trailing slash.
+pathcar='s,^/\([^/]*\).*$,\1,'
+pathcdr='s,^/[^/]*,,'
+removedotparts=':dotsl
+		s@/\./@/@g
+		t dotsl
+		s,/\.$,/,'
+collapseslashes='s@/\{1,\}@/@g'
+finalslash='s,/*$,/,'
+
+# func_normal_abspath PATH
+# Remove doubled-up and trailing slashes, "." path components,
+# and cancel out any ".." path components in PATH after making
+# it an absolute path.
+#             value returned in "$func_normal_abspath_result"
+func_normal_abspath ()
+{
+  # Start from root dir and reassemble the path.
+  func_normal_abspath_result=
+  func_normal_abspath_tpath=$1
+  func_normal_abspath_altnamespace=
+  case $func_normal_abspath_tpath in
+    "")
+      # Empty path, that just means $cwd.
+      func_stripname '' '/' "`pwd`"
+      func_normal_abspath_result=$func_stripname_result
+      return
+    ;;
+    # The next three entries are used to spot a run of precisely
+    # two leading slashes without using negated character classes;
+    # we take advantage of case's first-match behaviour.
+    ///*)
+      # Unusual form of absolute path, do nothing.
+    ;;
+    //*)
+      # Not necessarily an ordinary path; POSIX reserves leading '//'
+      # and for example Cygwin uses it to access remote file shares
+      # over CIFS/SMB, so we conserve a leading double slash if found.
+      func_normal_abspath_altnamespace=/
+    ;;
+    /*)
+      # Absolute path, do nothing.
+    ;;
+    *)
+      # Relative path, prepend $cwd.
+      func_normal_abspath_tpath=`pwd`/$func_normal_abspath_tpath
+    ;;
+  esac
+  # Cancel out all the simple stuff to save iterations.  We also want
+  # the path to end with a slash for ease of parsing, so make sure
+  # there is one (and only one) here.
+  func_normal_abspath_tpath=`$ECHO "$func_normal_abspath_tpath" | $SED \
+        -e "$removedotparts" -e "$collapseslashes" -e "$finalslash"`
+  while :; do
+    # Processed it all yet?
+    if test "$func_normal_abspath_tpath" = / ; then
+      # If we ascended to the root using ".." the result may be empty now.
+      if test -z "$func_normal_abspath_result" ; then
+        func_normal_abspath_result=/
+      fi
+      break
+    fi
+    func_normal_abspath_tcomponent=`$ECHO "$func_normal_abspath_tpath" | $SED \
+        -e "$pathcar"`
+    func_normal_abspath_tpath=`$ECHO "$func_normal_abspath_tpath" | $SED \
+        -e "$pathcdr"`
+    # Figure out what to do with it
+    case $func_normal_abspath_tcomponent in
+      "")
+        # Trailing empty path component, ignore it.
+      ;;
+      ..)
+        # Parent dir; strip last assembled component from result.
+        func_dirname "$func_normal_abspath_result"
+        func_normal_abspath_result=$func_dirname_result
+      ;;
+      *)
+        # Actual path component, append it.
+        func_normal_abspath_result=$func_normal_abspath_result/$func_normal_abspath_tcomponent
+      ;;
+    esac
+  done
+  # Restore leading double-slash if one was found on entry.
+  func_normal_abspath_result=$func_normal_abspath_altnamespace$func_normal_abspath_result
+}
+
+# func_relative_path SRCDIR DSTDIR
+# generates a relative path from SRCDIR to DSTDIR, with a trailing
+# slash if non-empty, suitable for immediately appending a filename
+# without needing to append a separator.
+#             value returned in "$func_relative_path_result"
+func_relative_path ()
+{
+  func_relative_path_result=
+  func_normal_abspath "$1"
+  func_relative_path_tlibdir=$func_normal_abspath_result
+  func_normal_abspath "$2"
+  func_relative_path_tbindir=$func_normal_abspath_result
+
+  # Ascend the tree starting from libdir
+  while :; do
+    # check if we have found a prefix of bindir
+    case $func_relative_path_tbindir in
+      $func_relative_path_tlibdir)
+        # found an exact match
+        func_relative_path_tcancelled=
+        break
+        ;;
+      $func_relative_path_tlibdir*)
+        # found a matching prefix
+        func_stripname "$func_relative_path_tlibdir" '' "$func_relative_path_tbindir"
+        func_relative_path_tcancelled=$func_stripname_result
+        if test -z "$func_relative_path_result"; then
+          func_relative_path_result=.
+        fi
+        break
+        ;;
+      *)
+        func_dirname $func_relative_path_tlibdir
+        func_relative_path_tlibdir=${func_dirname_result}
+        if test "x$func_relative_path_tlibdir" = x ; then
+          # Have to descend all the way to the root!
+          func_relative_path_result=../$func_relative_path_result
+          func_relative_path_tcancelled=$func_relative_path_tbindir
+          break
+        fi
+        func_relative_path_result=../$func_relative_path_result
+        ;;
+    esac
+  done
+
+  # Now calculate path; take care to avoid doubling-up slashes.
+  func_stripname '' '/' "$func_relative_path_result"
+  func_relative_path_result=$func_stripname_result
+  func_stripname '/' '/' "$func_relative_path_tcancelled"
+  if test "x$func_stripname_result" != x ; then
+    func_relative_path_result=${func_relative_path_result}/${func_stripname_result}
+  fi
+
+  # Normalisation. If bindir is libdir, return empty string,
+  # else relative path ending with a slash; either way, target
+  # file name can be directly appended.
+  if test ! -z "$func_relative_path_result"; then
+    func_stripname './' '' "$func_relative_path_result/"
+    func_relative_path_result=$func_stripname_result
+  fi
+}
+
+# The name of this program:
+func_dirname_and_basename "$progpath"
+progname=$func_basename_result
+
+# Make sure we have an absolute path for reexecution:
+case $progpath in
+  [\\/]*|[A-Za-z]:\\*) ;;
+  *[\\/]*)
+     progdir=$func_dirname_result
+     progdir=`cd "$progdir" && pwd`
+     progpath="$progdir/$progname"
+     ;;
+  *)
+     save_IFS="$IFS"
+     IFS=${PATH_SEPARATOR-:}
+     for progdir in $PATH; do
+       IFS="$save_IFS"
+       test -x "$progdir/$progname" && break
+     done
+     IFS="$save_IFS"
+     test -n "$progdir" || progdir=`pwd`
+     progpath="$progdir/$progname"
+     ;;
+esac
+
+# Sed substitution that helps us do robust quoting.  It backslashifies
+# metacharacters that are still active within double-quoted strings.
+Xsed="${SED}"' -e 1s/^X//'
+sed_quote_subst='s/\([`"$\\]\)/\\\1/g'
+
+# Same as above, but do not quote variable references.
+double_quote_subst='s/\(["`\\]\)/\\\1/g'
+
+# Sed substitution that turns a string into a regex matching for the
+# string literally.
+sed_make_literal_regex='s,[].[^$\\*\/],\\&,g'
+
+# Sed substitution that converts a w32 file name or path
+# which contains forward slashes, into one that contains
+# (escaped) backslashes.  A very naive implementation.
+lt_sed_naive_backslashify='s|\\\\*|\\|g;s|/|\\|g;s|\\|\\\\|g'
+
+# Re-`\' parameter expansions in output of double_quote_subst that were
+# `\'-ed in input to the same.  If an odd number of `\' preceded a '$'
+# in input to double_quote_subst, that '$' was protected from expansion.
+# Since each input `\' is now two `\'s, look for any number of runs of
+# four `\'s followed by two `\'s and then a '$'.  `\' that '$'.
+bs='\\'
+bs2='\\\\'
+bs4='\\\\\\\\'
+dollar='\$'
+sed_double_backslash="\
+  s/$bs4/&\\
+/g
+  s/^$bs2$dollar/$bs&/
+  s/\\([^$bs]\\)$bs2$dollar/\\1$bs2$bs$dollar/g
+  s/\n//g"
+
+# Standard options:
+opt_dry_run=false
+opt_help=false
+opt_quiet=false
+opt_verbose=false
+opt_warning=:
+
+# func_echo arg...
+# Echo program name prefixed message, along with the current mode
+# name if it has been set yet.
+func_echo ()
+{
+    $ECHO "$progname: ${opt_mode+$opt_mode: }$*"
+}
+
+# func_verbose arg...
+# Echo program name prefixed message in verbose mode only.
+func_verbose ()
+{
+    $opt_verbose && func_echo ${1+"$@"}
+
+    # A bug in bash halts the script if the last line of a function
+    # fails when set -e is in force, so we need another command to
+    # work around that:
+    :
+}
+
+# func_echo_all arg...
+# Invoke $ECHO with all args, space-separated.
+func_echo_all ()
+{
+    $ECHO "$*"
+}
+
+# func_error arg...
+# Echo program name prefixed message to standard error.
+func_error ()
+{
+    $ECHO "$progname: ${opt_mode+$opt_mode: }"${1+"$@"} 1>&2
+}
+
+# func_warning arg...
+# Echo program name prefixed warning message to standard error.
+func_warning ()
+{
+    $opt_warning && $ECHO "$progname: ${opt_mode+$opt_mode: }warning: "${1+"$@"} 1>&2
+
+    # bash bug again:
+    :
+}
+
+# func_fatal_error arg...
+# Echo program name prefixed message to standard error, and exit.
+func_fatal_error ()
+{
+    func_error ${1+"$@"}
+    exit $EXIT_FAILURE
+}
+
+# func_fatal_help arg...
+# Echo program name prefixed message to standard error, followed by
+# a help hint, and exit.
+func_fatal_help ()
+{
+    func_error ${1+"$@"}
+    func_fatal_error "$help"
+}
+help="Try \`$progname --help' for more information."  ## default
+
+
+# func_grep expression filename
+# Check whether EXPRESSION matches any line of FILENAME, without output.
+func_grep ()
+{
+    $GREP "$1" "$2" >/dev/null 2>&1
+}
+
+
+# func_mkdir_p directory-path
+# Make sure the entire path to DIRECTORY-PATH is available.
+func_mkdir_p ()
+{
+    my_directory_path="$1"
+    my_dir_list=
+
+    if test -n "$my_directory_path" && test "$opt_dry_run" != ":"; then
+
+      # Protect directory names starting with `-'
+      case $my_directory_path in
+        -*) my_directory_path="./$my_directory_path" ;;
+      esac
+
+      # While some portion of DIR does not yet exist...
+      while test ! -d "$my_directory_path"; do
+        # ...make a list in topmost first order.  Use a colon delimited
+	# list incase some portion of path contains whitespace.
+        my_dir_list="$my_directory_path:$my_dir_list"
+
+        # If the last portion added has no slash in it, the list is done
+        case $my_directory_path in */*) ;; *) break ;; esac
+
+        # ...otherwise throw away the child directory and loop
+        my_directory_path=`$ECHO "$my_directory_path" | $SED -e "$dirname"`
+      done
+      my_dir_list=`$ECHO "$my_dir_list" | $SED 's,:*$,,'`
+
+      save_mkdir_p_IFS="$IFS"; IFS=':'
+      for my_dir in $my_dir_list; do
+	IFS="$save_mkdir_p_IFS"
+        # mkdir can fail with a `File exist' error if two processes
+        # try to create one of the directories concurrently.  Don't
+        # stop in that case!
+        $MKDIR "$my_dir" 2>/dev/null || :
+      done
+      IFS="$save_mkdir_p_IFS"
+
+      # Bail out if we (or some other process) failed to create a directory.
+      test -d "$my_directory_path" || \
+        func_fatal_error "Failed to create \`$1'"
+    fi
+}
+
+
+# func_mktempdir [string]
+# Make a temporary directory that won't clash with other running
+# libtool processes, and avoids race conditions if possible.  If
+# given, STRING is the basename for that directory.
+func_mktempdir ()
+{
+    my_template="${TMPDIR-/tmp}/${1-$progname}"
+
+    if test "$opt_dry_run" = ":"; then
+      # Return a directory name, but don't create it in dry-run mode
+      my_tmpdir="${my_template}-$$"
+    else
+
+      # If mktemp works, use that first and foremost
+      my_tmpdir=`mktemp -d "${my_template}-XXXXXXXX" 2>/dev/null`
+
+      if test ! -d "$my_tmpdir"; then
+        # Failing that, at least try and use $RANDOM to avoid a race
+        my_tmpdir="${my_template}-${RANDOM-0}$$"
+
+        save_mktempdir_umask=`umask`
+        umask 0077
+        $MKDIR "$my_tmpdir"
+        umask $save_mktempdir_umask
+      fi
+
+      # If we're not in dry-run mode, bomb out on failure
+      test -d "$my_tmpdir" || \
+        func_fatal_error "cannot create temporary directory \`$my_tmpdir'"
+    fi
+
+    $ECHO "$my_tmpdir"
+}
+
+
+# func_quote_for_eval arg
+# Aesthetically quote ARG to be evaled later.
+# This function returns two values: FUNC_QUOTE_FOR_EVAL_RESULT
+# is double-quoted, suitable for a subsequent eval, whereas
+# FUNC_QUOTE_FOR_EVAL_UNQUOTED_RESULT has merely all characters
+# which are still active within double quotes backslashified.
+func_quote_for_eval ()
+{
+    case $1 in
+      *[\\\`\"\$]*)
+	func_quote_for_eval_unquoted_result=`$ECHO "$1" | $SED "$sed_quote_subst"` ;;
+      *)
+        func_quote_for_eval_unquoted_result="$1" ;;
+    esac
+
+    case $func_quote_for_eval_unquoted_result in
+      # Double-quote args containing shell metacharacters to delay
+      # word splitting, command substitution and and variable
+      # expansion for a subsequent eval.
+      # Many Bourne shells cannot handle close brackets correctly
+      # in scan sets, so we specify it separately.
+      *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \	]*|*]*|"")
+        func_quote_for_eval_result="\"$func_quote_for_eval_unquoted_result\""
+        ;;
+      *)
+        func_quote_for_eval_result="$func_quote_for_eval_unquoted_result"
+    esac
+}
+
+
+# func_quote_for_expand arg
+# Aesthetically quote ARG to be evaled later; same as above,
+# but do not quote variable references.
+func_quote_for_expand ()
+{
+    case $1 in
+      *[\\\`\"]*)
+	my_arg=`$ECHO "$1" | $SED \
+	    -e "$double_quote_subst" -e "$sed_double_backslash"` ;;
+      *)
+        my_arg="$1" ;;
+    esac
+
+    case $my_arg in
+      # Double-quote args containing shell metacharacters to delay
+      # word splitting and command substitution for a subsequent eval.
+      # Many Bourne shells cannot handle close brackets correctly
+      # in scan sets, so we specify it separately.
+      *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \	]*|*]*|"")
+        my_arg="\"$my_arg\""
+        ;;
+    esac
+
+    func_quote_for_expand_result="$my_arg"
+}
+
+
+# func_show_eval cmd [fail_exp]
+# Unless opt_silent is true, then output CMD.  Then, if opt_dryrun is
+# not true, evaluate CMD.  If the evaluation of CMD fails, and FAIL_EXP
+# is given, then evaluate it.
+func_show_eval ()
+{
+    my_cmd="$1"
+    my_fail_exp="${2-:}"
+
+    ${opt_silent-false} || {
+      func_quote_for_expand "$my_cmd"
+      eval "func_echo $func_quote_for_expand_result"
+    }
+
+    if ${opt_dry_run-false}; then :; else
+      eval "$my_cmd"
+      my_status=$?
+      if test "$my_status" -eq 0; then :; else
+	eval "(exit $my_status); $my_fail_exp"
+      fi
+    fi
+}
+
+
+# func_show_eval_locale cmd [fail_exp]
+# Unless opt_silent is true, then output CMD.  Then, if opt_dryrun is
+# not true, evaluate CMD.  If the evaluation of CMD fails, and FAIL_EXP
+# is given, then evaluate it.  Use the saved locale for evaluation.
+func_show_eval_locale ()
+{
+    my_cmd="$1"
+    my_fail_exp="${2-:}"
+
+    ${opt_silent-false} || {
+      func_quote_for_expand "$my_cmd"
+      eval "func_echo $func_quote_for_expand_result"
+    }
+
+    if ${opt_dry_run-false}; then :; else
+      eval "$lt_user_locale
+	    $my_cmd"
+      my_status=$?
+      eval "$lt_safe_locale"
+      if test "$my_status" -eq 0; then :; else
+	eval "(exit $my_status); $my_fail_exp"
+      fi
+    fi
+}
+
+# func_tr_sh
+# Turn $1 into a string suitable for a shell variable name.
+# Result is stored in $func_tr_sh_result.  All characters
+# not in the set a-zA-Z0-9_ are replaced with '_'. Further,
+# if $1 begins with a digit, a '_' is prepended as well.
+func_tr_sh ()
+{
+  case $1 in
+  [0-9]* | *[!a-zA-Z0-9_]*)
+    func_tr_sh_result=`$ECHO "$1" | $SED 's/^\([0-9]\)/_\1/; s/[^a-zA-Z0-9_]/_/g'`
+    ;;
+  * )
+    func_tr_sh_result=$1
+    ;;
+  esac
+}
+
+
+# func_version
+# Echo version message to standard output and exit.
+func_version ()
+{
+    $opt_debug
+
+    $SED -n '/(C)/!b go
+	:more
+	/\./!{
+	  N
+	  s/\n# / /
+	  b more
+	}
+	:go
+	/^# '$PROGRAM' (GNU /,/# warranty; / {
+        s/^# //
+	s/^# *$//
+        s/\((C)\)[ 0-9,-]*\( [1-9][0-9]*\)/\1\2/
+        p
+     }' < "$progpath"
+     exit $?
+}
+
+# func_usage
+# Echo short help message to standard output and exit.
+func_usage ()
+{
+    $opt_debug
+
+    $SED -n '/^# Usage:/,/^#  *.*--help/ {
+        s/^# //
+	s/^# *$//
+	s/\$progname/'$progname'/
+	p
+    }' < "$progpath"
+    echo
+    $ECHO "run \`$progname --help | more' for full usage"
+    exit $?
+}
+
+# func_help [NOEXIT]
+# Echo long help message to standard output and exit,
+# unless 'noexit' is passed as argument.
+func_help ()
+{
+    $opt_debug
+
+    $SED -n '/^# Usage:/,/# Report bugs to/ {
+	:print
+        s/^# //
+	s/^# *$//
+	s*\$progname*'$progname'*
+	s*\$host*'"$host"'*
+	s*\$SHELL*'"$SHELL"'*
+	s*\$LTCC*'"$LTCC"'*
+	s*\$LTCFLAGS*'"$LTCFLAGS"'*
+	s*\$LD*'"$LD"'*
+	s/\$with_gnu_ld/'"$with_gnu_ld"'/
+	s/\$automake_version/'"`(${AUTOMAKE-automake} --version) 2>/dev/null |$SED 1q`"'/
+	s/\$autoconf_version/'"`(${AUTOCONF-autoconf} --version) 2>/dev/null |$SED 1q`"'/
+	p
+	d
+     }
+     /^# .* home page:/b print
+     /^# General help using/b print
+     ' < "$progpath"
+    ret=$?
+    if test -z "$1"; then
+      exit $ret
+    fi
+}
+
+# func_missing_arg argname
+# Echo program name prefixed message to standard error and set global
+# exit_cmd.
+func_missing_arg ()
+{
+    $opt_debug
+
+    func_error "missing argument for $1."
+    exit_cmd=exit
+}
+
+
+# func_split_short_opt shortopt
+# Set func_split_short_opt_name and func_split_short_opt_arg shell
+# variables after splitting SHORTOPT after the 2nd character.
+func_split_short_opt ()
+{
+    my_sed_short_opt='1s/^\(..\).*$/\1/;q'
+    my_sed_short_rest='1s/^..\(.*\)$/\1/;q'
+
+    func_split_short_opt_name=`$ECHO "$1" | $SED "$my_sed_short_opt"`
+    func_split_short_opt_arg=`$ECHO "$1" | $SED "$my_sed_short_rest"`
+} # func_split_short_opt may be replaced by extended shell implementation
+
+
+# func_split_long_opt longopt
+# Set func_split_long_opt_name and func_split_long_opt_arg shell
+# variables after splitting LONGOPT at the `=' sign.
+func_split_long_opt ()
+{
+    my_sed_long_opt='1s/^\(--[^=]*\)=.*/\1/;q'
+    my_sed_long_arg='1s/^--[^=]*=//'
+
+    func_split_long_opt_name=`$ECHO "$1" | $SED "$my_sed_long_opt"`
+    func_split_long_opt_arg=`$ECHO "$1" | $SED "$my_sed_long_arg"`
+} # func_split_long_opt may be replaced by extended shell implementation
+
+exit_cmd=:
+
+
+
+
+
+magic="%%%MAGIC variable%%%"
+magic_exe="%%%MAGIC EXE variable%%%"
+
+# Global variables.
+nonopt=
+preserve_args=
+lo2o="s/\\.lo\$/.${objext}/"
+o2lo="s/\\.${objext}\$/.lo/"
+extracted_archives=
+extracted_serial=0
+
+# If this variable is set in any of the actions, the command in it
+# will be execed at the end.  This prevents here-documents from being
+# left over by shells.
+exec_cmd=
+
+# func_append var value
+# Append VALUE to the end of shell variable VAR.
+func_append ()
+{
+    eval "${1}=\$${1}\${2}"
+} # func_append may be replaced by extended shell implementation
+
+# func_append_quoted var value
+# Quote VALUE and append to the end of shell variable VAR, separated
+# by a space.
+func_append_quoted ()
+{
+    func_quote_for_eval "${2}"
+    eval "${1}=\$${1}\\ \$func_quote_for_eval_result"
+} # func_append_quoted may be replaced by extended shell implementation
+
+
+# func_arith arithmetic-term...
+func_arith ()
+{
+    func_arith_result=`expr "${@}"`
+} # func_arith may be replaced by extended shell implementation
+
+
+# func_len string
+# STRING may not start with a hyphen.
+func_len ()
+{
+    func_len_result=`expr "${1}" : ".*" 2>/dev/null || echo $max_cmd_len`
+} # func_len may be replaced by extended shell implementation
+
+
+# func_lo2o object
+func_lo2o ()
+{
+    func_lo2o_result=`$ECHO "${1}" | $SED "$lo2o"`
+} # func_lo2o may be replaced by extended shell implementation
+
+
+# func_xform libobj-or-source
+func_xform ()
+{
+    func_xform_result=`$ECHO "${1}" | $SED 's/\.[^.]*$/.lo/'`
+} # func_xform may be replaced by extended shell implementation
+
+
+# func_fatal_configuration arg...
+# Echo program name prefixed message to standard error, followed by
+# a configuration failure hint, and exit.
+func_fatal_configuration ()
+{
+    func_error ${1+"$@"}
+    func_error "See the $PACKAGE documentation for more information."
+    func_fatal_error "Fatal configuration error."
+}
+
+
+# func_config
+# Display the configuration for all the tags in this script.
+func_config ()
+{
+    re_begincf='^# ### BEGIN LIBTOOL'
+    re_endcf='^# ### END LIBTOOL'
+
+    # Default configuration.
+    $SED "1,/$re_begincf CONFIG/d;/$re_endcf CONFIG/,\$d" < "$progpath"
+
+    # Now print the configurations for the tags.
+    for tagname in $taglist; do
+      $SED -n "/$re_begincf TAG CONFIG: $tagname\$/,/$re_endcf TAG CONFIG: $tagname\$/p" < "$progpath"
+    done
+
+    exit $?
+}
+
+# func_features
+# Display the features supported by this script.
+func_features ()
+{
+    echo "host: $host"
+    if test "$build_libtool_libs" = yes; then
+      echo "enable shared libraries"
+    else
+      echo "disable shared libraries"
+    fi
+    if test "$build_old_libs" = yes; then
+      echo "enable static libraries"
+    else
+      echo "disable static libraries"
+    fi
+
+    exit $?
+}
+
+# func_enable_tag tagname
+# Verify that TAGNAME is valid, and either flag an error and exit, or
+# enable the TAGNAME tag.  We also add TAGNAME to the global $taglist
+# variable here.
+func_enable_tag ()
+{
+  # Global variable:
+  tagname="$1"
+
+  re_begincf="^# ### BEGIN LIBTOOL TAG CONFIG: $tagname\$"
+  re_endcf="^# ### END LIBTOOL TAG CONFIG: $tagname\$"
+  sed_extractcf="/$re_begincf/,/$re_endcf/p"
+
+  # Validate tagname.
+  case $tagname in
+    *[!-_A-Za-z0-9,/]*)
+      func_fatal_error "invalid tag name: $tagname"
+      ;;
+  esac
+
+  # Don't test for the "default" C tag, as we know it's
+  # there but not specially marked.
+  case $tagname in
+    CC) ;;
+    *)
+      if $GREP "$re_begincf" "$progpath" >/dev/null 2>&1; then
+	taglist="$taglist $tagname"
+
+	# Evaluate the configuration.  Be careful to quote the path
+	# and the sed script, to avoid splitting on whitespace, but
+	# also don't use non-portable quotes within backquotes within
+	# quotes we have to do it in 2 steps:
+	extractedcf=`$SED -n -e "$sed_extractcf" < "$progpath"`
+	eval "$extractedcf"
+      else
+	func_error "ignoring unknown tag $tagname"
+      fi
+      ;;
+  esac
+}
+
+# func_check_version_match
+# Ensure that we are using m4 macros, and libtool script from the same
+# release of libtool.
+func_check_version_match ()
+{
+  if test "$package_revision" != "$macro_revision"; then
+    if test "$VERSION" != "$macro_version"; then
+      if test -z "$macro_version"; then
+        cat >&2 <<_LT_EOF
+$progname: Version mismatch error.  This is $PACKAGE $VERSION, but the
+$progname: definition of this LT_INIT comes from an older release.
+$progname: You should recreate aclocal.m4 with macros from $PACKAGE $VERSION
+$progname: and run autoconf again.
+_LT_EOF
+      else
+        cat >&2 <<_LT_EOF
+$progname: Version mismatch error.  This is $PACKAGE $VERSION, but the
+$progname: definition of this LT_INIT comes from $PACKAGE $macro_version.
+$progname: You should recreate aclocal.m4 with macros from $PACKAGE $VERSION
+$progname: and run autoconf again.
+_LT_EOF
+      fi
+    else
+      cat >&2 <<_LT_EOF
+$progname: Version mismatch error.  This is $PACKAGE $VERSION, revision $package_revision,
+$progname: but the definition of this LT_INIT comes from revision $macro_revision.
+$progname: You should recreate aclocal.m4 with macros from revision $package_revision
+$progname: of $PACKAGE $VERSION and run autoconf again.
+_LT_EOF
+    fi
+
+    exit $EXIT_MISMATCH
+  fi
+}
+
+
+# Shorthand for --mode=foo, only valid as the first argument
+case $1 in
+clean|clea|cle|cl)
+  shift; set dummy --mode clean ${1+"$@"}; shift
+  ;;
+compile|compil|compi|comp|com|co|c)
+  shift; set dummy --mode compile ${1+"$@"}; shift
+  ;;
+execute|execut|execu|exec|exe|ex|e)
+  shift; set dummy --mode execute ${1+"$@"}; shift
+  ;;
+finish|finis|fini|fin|fi|f)
+  shift; set dummy --mode finish ${1+"$@"}; shift
+  ;;
+install|instal|insta|inst|ins|in|i)
+  shift; set dummy --mode install ${1+"$@"}; shift
+  ;;
+link|lin|li|l)
+  shift; set dummy --mode link ${1+"$@"}; shift
+  ;;
+uninstall|uninstal|uninsta|uninst|unins|unin|uni|un|u)
+  shift; set dummy --mode uninstall ${1+"$@"}; shift
+  ;;
+esac
+
+
+
+# Option defaults:
+opt_debug=:
+opt_dry_run=false
+opt_config=false
+opt_preserve_dup_deps=false
+opt_features=false
+opt_finish=false
+opt_help=false
+opt_help_all=false
+opt_silent=:
+opt_warning=:
+opt_verbose=:
+opt_silent=false
+opt_verbose=false
+
+
+# Parse options once, thoroughly.  This comes as soon as possible in the
+# script to make things like `--version' happen as quickly as we can.
+{
+  # this just eases exit handling
+  while test $# -gt 0; do
+    opt="$1"
+    shift
+    case $opt in
+      --debug|-x)	opt_debug='set -x'
+			func_echo "enabling shell trace mode"
+			$opt_debug
+			;;
+      --dry-run|--dryrun|-n)
+			opt_dry_run=:
+			;;
+      --config)
+			opt_config=:
+func_config
+			;;
+      --dlopen|-dlopen)
+			optarg="$1"
+			opt_dlopen="${opt_dlopen+$opt_dlopen
+}$optarg"
+			shift
+			;;
+      --preserve-dup-deps)
+			opt_preserve_dup_deps=:
+			;;
+      --features)
+			opt_features=:
+func_features
+			;;
+      --finish)
+			opt_finish=:
+set dummy --mode finish ${1+"$@"}; shift
+			;;
+      --help)
+			opt_help=:
+			;;
+      --help-all)
+			opt_help_all=:
+opt_help=': help-all'
+			;;
+      --mode)
+			test $# = 0 && func_missing_arg $opt && break
+			optarg="$1"
+			opt_mode="$optarg"
+case $optarg in
+  # Valid mode arguments:
+  clean|compile|execute|finish|install|link|relink|uninstall) ;;
+
+  # Catch anything else as an error
+  *) func_error "invalid argument for $opt"
+     exit_cmd=exit
+     break
+     ;;
+esac
+			shift
+			;;
+      --no-silent|--no-quiet)
+			opt_silent=false
+func_append preserve_args " $opt"
+			;;
+      --no-warning|--no-warn)
+			opt_warning=false
+func_append preserve_args " $opt"
+			;;
+      --no-verbose)
+			opt_verbose=false
+func_append preserve_args " $opt"
+			;;
+      --silent|--quiet)
+			opt_silent=:
+func_append preserve_args " $opt"
+        opt_verbose=false
+			;;
+      --verbose|-v)
+			opt_verbose=:
+func_append preserve_args " $opt"
+opt_silent=false
+			;;
+      --tag)
+			test $# = 0 && func_missing_arg $opt && break
+			optarg="$1"
+			opt_tag="$optarg"
+func_append preserve_args " $opt $optarg"
+func_enable_tag "$optarg"
+			shift
+			;;
+
+      -\?|-h)		func_usage				;;
+      --help)		func_help				;;
+      --version)	func_version				;;
+
+      # Separate optargs to long options:
+      --*=*)
+			func_split_long_opt "$opt"
+			set dummy "$func_split_long_opt_name" "$func_split_long_opt_arg" ${1+"$@"}
+			shift
+			;;
+
+      # Separate non-argument short options:
+      -\?*|-h*|-n*|-v*)
+			func_split_short_opt "$opt"
+			set dummy "$func_split_short_opt_name" "-$func_split_short_opt_arg" ${1+"$@"}
+			shift
+			;;
+
+      --)		break					;;
+      -*)		func_fatal_help "unrecognized option \`$opt'" ;;
+      *)		set dummy "$opt" ${1+"$@"};	shift; break  ;;
+    esac
+  done
+
+  # Validate options:
+
+  # save first non-option argument
+  if test "$#" -gt 0; then
+    nonopt="$opt"
+    shift
+  fi
+
+  # preserve --debug
+  test "$opt_debug" = : || func_append preserve_args " --debug"
+
+  case $host in
+    *cygwin* | *mingw* | *pw32* | *cegcc*)
+      # don't eliminate duplications in $postdeps and $predeps
+      opt_duplicate_compiler_generated_deps=:
+      ;;
+    *)
+      opt_duplicate_compiler_generated_deps=$opt_preserve_dup_deps
+      ;;
+  esac
+
+  $opt_help || {
+    # Sanity checks first:
+    func_check_version_match
+
+    if test "$build_libtool_libs" != yes && test "$build_old_libs" != yes; then
+      func_fatal_configuration "not configured to build any kind of library"
+    fi
+
+    # Darwin sucks
+    eval std_shrext=\"$shrext_cmds\"
+
+    # Only execute mode is allowed to have -dlopen flags.
+    if test -n "$opt_dlopen" && test "$opt_mode" != execute; then
+      func_error "unrecognized option \`-dlopen'"
+      $ECHO "$help" 1>&2
+      exit $EXIT_FAILURE
+    fi
+
+    # Change the help message to a mode-specific one.
+    generic_help="$help"
+    help="Try \`$progname --help --mode=$opt_mode' for more information."
+  }
+
+
+  # Bail if the options were screwed
+  $exit_cmd $EXIT_FAILURE
+}
+
+
+
+
+## ----------- ##
+##    Main.    ##
+## ----------- ##
+
+# func_lalib_p file
+# True iff FILE is a libtool `.la' library or `.lo' object file.
+# This function is only a basic sanity check; it will hardly flush out
+# determined imposters.
+func_lalib_p ()
+{
+    test -f "$1" &&
+      $SED -e 4q "$1" 2>/dev/null \
+        | $GREP "^# Generated by .*$PACKAGE" > /dev/null 2>&1
+}
+
+# func_lalib_unsafe_p file
+# True iff FILE is a libtool `.la' library or `.lo' object file.
+# This function implements the same check as func_lalib_p without
+# resorting to external programs.  To this end, it redirects stdin and
+# closes it afterwards, without saving the original file descriptor.
+# As a safety measure, use it only where a negative result would be
+# fatal anyway.  Works if `file' does not exist.
+func_lalib_unsafe_p ()
+{
+    lalib_p=no
+    if test -f "$1" && test -r "$1" && exec 5<&0 <"$1"; then
+	for lalib_p_l in 1 2 3 4
+	do
+	    read lalib_p_line
+	    case "$lalib_p_line" in
+		\#\ Generated\ by\ *$PACKAGE* ) lalib_p=yes; break;;
+	    esac
+	done
+	exec 0<&5 5<&-
+    fi
+    test "$lalib_p" = yes
+}
+
+# func_ltwrapper_script_p file
+# True iff FILE is a libtool wrapper script
+# This function is only a basic sanity check; it will hardly flush out
+# determined imposters.
+func_ltwrapper_script_p ()
+{
+    func_lalib_p "$1"
+}
+
+# func_ltwrapper_executable_p file
+# True iff FILE is a libtool wrapper executable
+# This function is only a basic sanity check; it will hardly flush out
+# determined imposters.
+func_ltwrapper_executable_p ()
+{
+    func_ltwrapper_exec_suffix=
+    case $1 in
+    *.exe) ;;
+    *) func_ltwrapper_exec_suffix=.exe ;;
+    esac
+    $GREP "$magic_exe" "$1$func_ltwrapper_exec_suffix" >/dev/null 2>&1
+}
+
+# func_ltwrapper_scriptname file
+# Assumes file is an ltwrapper_executable
+# uses $file to determine the appropriate filename for a
+# temporary ltwrapper_script.
+func_ltwrapper_scriptname ()
+{
+    func_dirname_and_basename "$1" "" "."
+    func_stripname '' '.exe' "$func_basename_result"
+    func_ltwrapper_scriptname_result="$func_dirname_result/$objdir/${func_stripname_result}_ltshwrapper"
+}
+
+# func_ltwrapper_p file
+# True iff FILE is a libtool wrapper script or wrapper executable
+# This function is only a basic sanity check; it will hardly flush out
+# determined imposters.
+func_ltwrapper_p ()
+{
+    func_ltwrapper_script_p "$1" || func_ltwrapper_executable_p "$1"
+}
+
+
+# func_execute_cmds commands fail_cmd
+# Execute tilde-delimited COMMANDS.
+# If FAIL_CMD is given, eval that upon failure.
+# FAIL_CMD may read-access the current command in variable CMD!
+func_execute_cmds ()
+{
+    $opt_debug
+    save_ifs=$IFS; IFS='~'
+    for cmd in $1; do
+      IFS=$save_ifs
+      eval cmd=\"$cmd\"
+      func_show_eval "$cmd" "${2-:}"
+    done
+    IFS=$save_ifs
+}
+
+
+# func_source file
+# Source FILE, adding directory component if necessary.
+# Note that it is not necessary on cygwin/mingw to append a dot to
+# FILE even if both FILE and FILE.exe exist: automatic-append-.exe
+# behavior happens only for exec(3), not for open(2)!  Also, sourcing
+# `FILE.' does not work on cygwin managed mounts.
+func_source ()
+{
+    $opt_debug
+    case $1 in
+    */* | *\\*)	. "$1" ;;
+    *)		. "./$1" ;;
+    esac
+}
+
+
+# func_resolve_sysroot PATH
+# Replace a leading = in PATH with a sysroot.  Store the result into
+# func_resolve_sysroot_result
+func_resolve_sysroot ()
+{
+  func_resolve_sysroot_result=$1
+  case $func_resolve_sysroot_result in
+  =*)
+    func_stripname '=' '' "$func_resolve_sysroot_result"
+    func_resolve_sysroot_result=$lt_sysroot$func_stripname_result
+    ;;
+  esac
+}
+
+# func_replace_sysroot PATH
+# If PATH begins with the sysroot, replace it with = and
+# store the result into func_replace_sysroot_result.
+func_replace_sysroot ()
+{
+  case "$lt_sysroot:$1" in
+  ?*:"$lt_sysroot"*)
+    func_stripname "$lt_sysroot" '' "$1"
+    func_replace_sysroot_result="=$func_stripname_result"
+    ;;
+  *)
+    # Including no sysroot.
+    func_replace_sysroot_result=$1
+    ;;
+  esac
+}
+
+# func_infer_tag arg
+# Infer tagged configuration to use if any are available and
+# if one wasn't chosen via the "--tag" command line option.
+# Only attempt this if the compiler in the base compile
+# command doesn't match the default compiler.
+# arg is usually of the form 'gcc ...'
+func_infer_tag ()
+{
+    $opt_debug
+    if test -n "$available_tags" && test -z "$tagname"; then
+      CC_quoted=
+      for arg in $CC; do
+	func_append_quoted CC_quoted "$arg"
+      done
+      CC_expanded=`func_echo_all $CC`
+      CC_quoted_expanded=`func_echo_all $CC_quoted`
+      case $@ in
+      # Blanks in the command may have been stripped by the calling shell,
+      # but not from the CC environment variable when configure was run.
+      " $CC "* | "$CC "* | " $CC_expanded "* | "$CC_expanded "* | \
+      " $CC_quoted"* | "$CC_quoted "* | " $CC_quoted_expanded "* | "$CC_quoted_expanded "*) ;;
+      # Blanks at the start of $base_compile will cause this to fail
+      # if we don't check for them as well.
+      *)
+	for z in $available_tags; do
+	  if $GREP "^# ### BEGIN LIBTOOL TAG CONFIG: $z$" < "$progpath" > /dev/null; then
+	    # Evaluate the configuration.
+	    eval "`${SED} -n -e '/^# ### BEGIN LIBTOOL TAG CONFIG: '$z'$/,/^# ### END LIBTOOL TAG CONFIG: '$z'$/p' < $progpath`"
+	    CC_quoted=
+	    for arg in $CC; do
+	      # Double-quote args containing other shell metacharacters.
+	      func_append_quoted CC_quoted "$arg"
+	    done
+	    CC_expanded=`func_echo_all $CC`
+	    CC_quoted_expanded=`func_echo_all $CC_quoted`
+	    case "$@ " in
+	    " $CC "* | "$CC "* | " $CC_expanded "* | "$CC_expanded "* | \
+	    " $CC_quoted"* | "$CC_quoted "* | " $CC_quoted_expanded "* | "$CC_quoted_expanded "*)
+	      # The compiler in the base compile command matches
+	      # the one in the tagged configuration.
+	      # Assume this is the tagged configuration we want.
+	      tagname=$z
+	      break
+	      ;;
+	    esac
+	  fi
+	done
+	# If $tagname still isn't set, then no tagged configuration
+	# was found and let the user know that the "--tag" command
+	# line option must be used.
+	if test -z "$tagname"; then
+	  func_echo "unable to infer tagged configuration"
+	  func_fatal_error "specify a tag with \`--tag'"
+#	else
+#	  func_verbose "using $tagname tagged configuration"
+	fi
+	;;
+      esac
+    fi
+}
+
+
+
+# func_write_libtool_object output_name pic_name nonpic_name
+# Create a libtool object file (analogous to a ".la" file),
+# but don't create it if we're doing a dry run.
+func_write_libtool_object ()
+{
+    write_libobj=${1}
+    if test "$build_libtool_libs" = yes; then
+      write_lobj=\'${2}\'
+    else
+      write_lobj=none
+    fi
+
+    if test "$build_old_libs" = yes; then
+      write_oldobj=\'${3}\'
+    else
+      write_oldobj=none
+    fi
+
+    $opt_dry_run || {
+      cat >${write_libobj}T <<EOF
+# $write_libobj - a libtool object file
+# Generated by $PROGRAM (GNU $PACKAGE$TIMESTAMP) $VERSION
+#
+# Please DO NOT delete this file!
+# It is necessary for linking the library.
+
+# Name of the PIC object.
+pic_object=$write_lobj
+
+# Name of the non-PIC object
+non_pic_object=$write_oldobj
+
+EOF
+      $MV "${write_libobj}T" "${write_libobj}"
+    }
+}
+
+
+##################################################
+# FILE NAME AND PATH CONVERSION HELPER FUNCTIONS #
+##################################################
+
+# func_convert_core_file_wine_to_w32 ARG
+# Helper function used by file name conversion functions when $build is *nix,
+# and $host is mingw, cygwin, or some other w32 environment. Relies on a
+# correctly configured wine environment available, with the winepath program
+# in $build's $PATH.
+#
+# ARG is the $build file name to be converted to w32 format.
+# Result is available in $func_convert_core_file_wine_to_w32_result, and will
+# be empty on error (or when ARG is empty)
+func_convert_core_file_wine_to_w32 ()
+{
+  $opt_debug
+  func_convert_core_file_wine_to_w32_result="$1"
+  if test -n "$1"; then
+    # Unfortunately, winepath does not exit with a non-zero error code, so we
+    # are forced to check the contents of stdout. On the other hand, if the
+    # command is not found, the shell will set an exit code of 127 and print
+    # *an error message* to stdout. So we must check for both error code of
+    # zero AND non-empty stdout, which explains the odd construction:
+    func_convert_core_file_wine_to_w32_tmp=`winepath -w "$1" 2>/dev/null`
+    if test "$?" -eq 0 && test -n "${func_convert_core_file_wine_to_w32_tmp}"; then
+      func_convert_core_file_wine_to_w32_result=`$ECHO "$func_convert_core_file_wine_to_w32_tmp" |
+        $SED -e "$lt_sed_naive_backslashify"`
+    else
+      func_convert_core_file_wine_to_w32_result=
+    fi
+  fi
+}
+# end: func_convert_core_file_wine_to_w32
+
+
+# func_convert_core_path_wine_to_w32 ARG
+# Helper function used by path conversion functions when $build is *nix, and
+# $host is mingw, cygwin, or some other w32 environment. Relies on a correctly
+# configured wine environment available, with the winepath program in $build's
+# $PATH. Assumes ARG has no leading or trailing path separator characters.
+#
+# ARG is path to be converted from $build format to win32.
+# Result is available in $func_convert_core_path_wine_to_w32_result.
+# Unconvertible file (directory) names in ARG are skipped; if no directory names
+# are convertible, then the result may be empty.
+func_convert_core_path_wine_to_w32 ()
+{
+  $opt_debug
+  # unfortunately, winepath doesn't convert paths, only file names
+  func_convert_core_path_wine_to_w32_result=""
+  if test -n "$1"; then
+    oldIFS=$IFS
+    IFS=:
+    for func_convert_core_path_wine_to_w32_f in $1; do
+      IFS=$oldIFS
+      func_convert_core_file_wine_to_w32 "$func_convert_core_path_wine_to_w32_f"
+      if test -n "$func_convert_core_file_wine_to_w32_result" ; then
+        if test -z "$func_convert_core_path_wine_to_w32_result"; then
+          func_convert_core_path_wine_to_w32_result="$func_convert_core_file_wine_to_w32_result"
+        else
+          func_append func_convert_core_path_wine_to_w32_result ";$func_convert_core_file_wine_to_w32_result"
+        fi
+      fi
+    done
+    IFS=$oldIFS
+  fi
+}
+# end: func_convert_core_path_wine_to_w32
+
+
+# func_cygpath ARGS...
+# Wrapper around calling the cygpath program via LT_CYGPATH. This is used when
+# when (1) $build is *nix and Cygwin is hosted via a wine environment; or (2)
+# $build is MSYS and $host is Cygwin, or (3) $build is Cygwin. In case (1) or
+# (2), returns the Cygwin file name or path in func_cygpath_result (input
+# file name or path is assumed to be in w32 format, as previously converted
+# from $build's *nix or MSYS format). In case (3), returns the w32 file name
+# or path in func_cygpath_result (input file name or path is assumed to be in
+# Cygwin format). Returns an empty string on error.
+#
+# ARGS are passed to cygpath, with the last one being the file name or path to
+# be converted.
+#
+# Specify the absolute *nix (or w32) name to cygpath in the LT_CYGPATH
+# environment variable; do not put it in $PATH.
+func_cygpath ()
+{
+  $opt_debug
+  if test -n "$LT_CYGPATH" && test -f "$LT_CYGPATH"; then
+    func_cygpath_result=`$LT_CYGPATH "$@" 2>/dev/null`
+    if test "$?" -ne 0; then
+      # on failure, ensure result is empty
+      func_cygpath_result=
+    fi
+  else
+    func_cygpath_result=
+    func_error "LT_CYGPATH is empty or specifies non-existent file: \`$LT_CYGPATH'"
+  fi
+}
+#end: func_cygpath
+
+
+# func_convert_core_msys_to_w32 ARG
+# Convert file name or path ARG from MSYS format to w32 format.  Return
+# result in func_convert_core_msys_to_w32_result.
+func_convert_core_msys_to_w32 ()
+{
+  $opt_debug
+  # awkward: cmd appends spaces to result
+  func_convert_core_msys_to_w32_result=`( cmd //c echo "$1" ) 2>/dev/null |
+    $SED -e 's/[ ]*$//' -e "$lt_sed_naive_backslashify"`
+}
+#end: func_convert_core_msys_to_w32
+
+
+# func_convert_file_check ARG1 ARG2
+# Verify that ARG1 (a file name in $build format) was converted to $host
+# format in ARG2. Otherwise, emit an error message, but continue (resetting
+# func_to_host_file_result to ARG1).
+func_convert_file_check ()
+{
+  $opt_debug
+  if test -z "$2" && test -n "$1" ; then
+    func_error "Could not determine host file name corresponding to"
+    func_error "  \`$1'"
+    func_error "Continuing, but uninstalled executables may not work."
+    # Fallback:
+    func_to_host_file_result="$1"
+  fi
+}
+# end func_convert_file_check
+
+
+# func_convert_path_check FROM_PATHSEP TO_PATHSEP FROM_PATH TO_PATH
+# Verify that FROM_PATH (a path in $build format) was converted to $host
+# format in TO_PATH. Otherwise, emit an error message, but continue, resetting
+# func_to_host_file_result to a simplistic fallback value (see below).
+func_convert_path_check ()
+{
+  $opt_debug
+  if test -z "$4" && test -n "$3"; then
+    func_error "Could not determine the host path corresponding to"
+    func_error "  \`$3'"
+    func_error "Continuing, but uninstalled executables may not work."
+    # Fallback.  This is a deliberately simplistic "conversion" and
+    # should not be "improved".  See libtool.info.
+    if test "x$1" != "x$2"; then
+      lt_replace_pathsep_chars="s|$1|$2|g"
+      func_to_host_path_result=`echo "$3" |
+        $SED -e "$lt_replace_pathsep_chars"`
+    else
+      func_to_host_path_result="$3"
+    fi
+  fi
+}
+# end func_convert_path_check
+
+
+# func_convert_path_front_back_pathsep FRONTPAT BACKPAT REPL ORIG
+# Modifies func_to_host_path_result by prepending REPL if ORIG matches FRONTPAT
+# and appending REPL if ORIG matches BACKPAT.
+func_convert_path_front_back_pathsep ()
+{
+  $opt_debug
+  case $4 in
+  $1 ) func_to_host_path_result="$3$func_to_host_path_result"
+    ;;
+  esac
+  case $4 in
+  $2 ) func_append func_to_host_path_result "$3"
+    ;;
+  esac
+}
+# end func_convert_path_front_back_pathsep
+
+
+##################################################
+# $build to $host FILE NAME CONVERSION FUNCTIONS #
+##################################################
+# invoked via `$to_host_file_cmd ARG'
+#
+# In each case, ARG is the path to be converted from $build to $host format.
+# Result will be available in $func_to_host_file_result.
+
+
+# func_to_host_file ARG
+# Converts the file name ARG from $build format to $host format. Return result
+# in func_to_host_file_result.
+func_to_host_file ()
+{
+  $opt_debug
+  $to_host_file_cmd "$1"
+}
+# end func_to_host_file
+
+
+# func_to_tool_file ARG LAZY
+# converts the file name ARG from $build format to toolchain format. Return
+# result in func_to_tool_file_result.  If the conversion in use is listed
+# in (the comma separated) LAZY, no conversion takes place.
+func_to_tool_file ()
+{
+  $opt_debug
+  case ,$2, in
+    *,"$to_tool_file_cmd",*)
+      func_to_tool_file_result=$1
+      ;;
+    *)
+      $to_tool_file_cmd "$1"
+      func_to_tool_file_result=$func_to_host_file_result
+      ;;
+  esac
+}
+# end func_to_tool_file
+
+
+# func_convert_file_noop ARG
+# Copy ARG to func_to_host_file_result.
+func_convert_file_noop ()
+{
+  func_to_host_file_result="$1"
+}
+# end func_convert_file_noop
+
+
+# func_convert_file_msys_to_w32 ARG
+# Convert file name ARG from (mingw) MSYS to (mingw) w32 format; automatic
+# conversion to w32 is not available inside the cwrapper.  Returns result in
+# func_to_host_file_result.
+func_convert_file_msys_to_w32 ()
+{
+  $opt_debug
+  func_to_host_file_result="$1"
+  if test -n "$1"; then
+    func_convert_core_msys_to_w32 "$1"
+    func_to_host_file_result="$func_convert_core_msys_to_w32_result"
+  fi
+  func_convert_file_check "$1" "$func_to_host_file_result"
+}
+# end func_convert_file_msys_to_w32
+
+
+# func_convert_file_cygwin_to_w32 ARG
+# Convert file name ARG from Cygwin to w32 format.  Returns result in
+# func_to_host_file_result.
+func_convert_file_cygwin_to_w32 ()
+{
+  $opt_debug
+  func_to_host_file_result="$1"
+  if test -n "$1"; then
+    # because $build is cygwin, we call "the" cygpath in $PATH; no need to use
+    # LT_CYGPATH in this case.
+    func_to_host_file_result=`cygpath -m "$1"`
+  fi
+  func_convert_file_check "$1" "$func_to_host_file_result"
+}
+# end func_convert_file_cygwin_to_w32
+
+
+# func_convert_file_nix_to_w32 ARG
+# Convert file name ARG from *nix to w32 format.  Requires a wine environment
+# and a working winepath. Returns result in func_to_host_file_result.
+func_convert_file_nix_to_w32 ()
+{
+  $opt_debug
+  func_to_host_file_result="$1"
+  if test -n "$1"; then
+    func_convert_core_file_wine_to_w32 "$1"
+    func_to_host_file_result="$func_convert_core_file_wine_to_w32_result"
+  fi
+  func_convert_file_check "$1" "$func_to_host_file_result"
+}
+# end func_convert_file_nix_to_w32
+
+
+# func_convert_file_msys_to_cygwin ARG
+# Convert file name ARG from MSYS to Cygwin format.  Requires LT_CYGPATH set.
+# Returns result in func_to_host_file_result.
+func_convert_file_msys_to_cygwin ()
+{
+  $opt_debug
+  func_to_host_file_result="$1"
+  if test -n "$1"; then
+    func_convert_core_msys_to_w32 "$1"
+    func_cygpath -u "$func_convert_core_msys_to_w32_result"
+    func_to_host_file_result="$func_cygpath_result"
+  fi
+  func_convert_file_check "$1" "$func_to_host_file_result"
+}
+# end func_convert_file_msys_to_cygwin
+
+
+# func_convert_file_nix_to_cygwin ARG
+# Convert file name ARG from *nix to Cygwin format.  Requires Cygwin installed
+# in a wine environment, working winepath, and LT_CYGPATH set.  Returns result
+# in func_to_host_file_result.
+func_convert_file_nix_to_cygwin ()
+{
+  $opt_debug
+  func_to_host_file_result="$1"
+  if test -n "$1"; then
+    # convert from *nix to w32, then use cygpath to convert from w32 to cygwin.
+    func_convert_core_file_wine_to_w32 "$1"
+    func_cygpath -u "$func_convert_core_file_wine_to_w32_result"
+    func_to_host_file_result="$func_cygpath_result"
+  fi
+  func_convert_file_check "$1" "$func_to_host_file_result"
+}
+# end func_convert_file_nix_to_cygwin
+
+
+#############################################
+# $build to $host PATH CONVERSION FUNCTIONS #
+#############################################
+# invoked via `$to_host_path_cmd ARG'
+#
+# In each case, ARG is the path to be converted from $build to $host format.
+# The result will be available in $func_to_host_path_result.
+#
+# Path separators are also converted from $build format to $host format.  If
+# ARG begins or ends with a path separator character, it is preserved (but
+# converted to $host format) on output.
+#
+# All path conversion functions are named using the following convention:
+#   file name conversion function    : func_convert_file_X_to_Y ()
+#   path conversion function         : func_convert_path_X_to_Y ()
+# where, for any given $build/$host combination the 'X_to_Y' value is the
+# same.  If conversion functions are added for new $build/$host combinations,
+# the two new functions must follow this pattern, or func_init_to_host_path_cmd
+# will break.
+
+
+# func_init_to_host_path_cmd
+# Ensures that function "pointer" variable $to_host_path_cmd is set to the
+# appropriate value, based on the value of $to_host_file_cmd.
+to_host_path_cmd=
+func_init_to_host_path_cmd ()
+{
+  $opt_debug
+  if test -z "$to_host_path_cmd"; then
+    func_stripname 'func_convert_file_' '' "$to_host_file_cmd"
+    to_host_path_cmd="func_convert_path_${func_stripname_result}"
+  fi
+}
+
+
+# func_to_host_path ARG
+# Converts the path ARG from $build format to $host format. Return result
+# in func_to_host_path_result.
+func_to_host_path ()
+{
+  $opt_debug
+  func_init_to_host_path_cmd
+  $to_host_path_cmd "$1"
+}
+# end func_to_host_path
+
+
+# func_convert_path_noop ARG
+# Copy ARG to func_to_host_path_result.
+func_convert_path_noop ()
+{
+  func_to_host_path_result="$1"
+}
+# end func_convert_path_noop
+
+
+# func_convert_path_msys_to_w32 ARG
+# Convert path ARG from (mingw) MSYS to (mingw) w32 format; automatic
+# conversion to w32 is not available inside the cwrapper.  Returns result in
+# func_to_host_path_result.
+func_convert_path_msys_to_w32 ()
+{
+  $opt_debug
+  func_to_host_path_result="$1"
+  if test -n "$1"; then
+    # Remove leading and trailing path separator characters from ARG.  MSYS
+    # behavior is inconsistent here; cygpath turns them into '.;' and ';.';
+    # and winepath ignores them completely.
+    func_stripname : : "$1"
+    func_to_host_path_tmp1=$func_stripname_result
+    func_convert_core_msys_to_w32 "$func_to_host_path_tmp1"
+    func_to_host_path_result="$func_convert_core_msys_to_w32_result"
+    func_convert_path_check : ";" \
+      "$func_to_host_path_tmp1" "$func_to_host_path_result"
+    func_convert_path_front_back_pathsep ":*" "*:" ";" "$1"
+  fi
+}
+# end func_convert_path_msys_to_w32
+
+
+# func_convert_path_cygwin_to_w32 ARG
+# Convert path ARG from Cygwin to w32 format.  Returns result in
+# func_to_host_file_result.
+func_convert_path_cygwin_to_w32 ()
+{
+  $opt_debug
+  func_to_host_path_result="$1"
+  if test -n "$1"; then
+    # See func_convert_path_msys_to_w32:
+    func_stripname : : "$1"
+    func_to_host_path_tmp1=$func_stripname_result
+    func_to_host_path_result=`cygpath -m -p "$func_to_host_path_tmp1"`
+    func_convert_path_check : ";" \
+      "$func_to_host_path_tmp1" "$func_to_host_path_result"
+    func_convert_path_front_back_pathsep ":*" "*:" ";" "$1"
+  fi
+}
+# end func_convert_path_cygwin_to_w32
+
+
+# func_convert_path_nix_to_w32 ARG
+# Convert path ARG from *nix to w32 format.  Requires a wine environment and
+# a working winepath.  Returns result in func_to_host_file_result.
+func_convert_path_nix_to_w32 ()
+{
+  $opt_debug
+  func_to_host_path_result="$1"
+  if test -n "$1"; then
+    # See func_convert_path_msys_to_w32:
+    func_stripname : : "$1"
+    func_to_host_path_tmp1=$func_stripname_result
+    func_convert_core_path_wine_to_w32 "$func_to_host_path_tmp1"
+    func_to_host_path_result="$func_convert_core_path_wine_to_w32_result"
+    func_convert_path_check : ";" \
+      "$func_to_host_path_tmp1" "$func_to_host_path_result"
+    func_convert_path_front_back_pathsep ":*" "*:" ";" "$1"
+  fi
+}
+# end func_convert_path_nix_to_w32
+
+
+# func_convert_path_msys_to_cygwin ARG
+# Convert path ARG from MSYS to Cygwin format.  Requires LT_CYGPATH set.
+# Returns result in func_to_host_file_result.
+func_convert_path_msys_to_cygwin ()
+{
+  $opt_debug
+  func_to_host_path_result="$1"
+  if test -n "$1"; then
+    # See func_convert_path_msys_to_w32:
+    func_stripname : : "$1"
+    func_to_host_path_tmp1=$func_stripname_result
+    func_convert_core_msys_to_w32 "$func_to_host_path_tmp1"
+    func_cygpath -u -p "$func_convert_core_msys_to_w32_result"
+    func_to_host_path_result="$func_cygpath_result"
+    func_convert_path_check : : \
+      "$func_to_host_path_tmp1" "$func_to_host_path_result"
+    func_convert_path_front_back_pathsep ":*" "*:" : "$1"
+  fi
+}
+# end func_convert_path_msys_to_cygwin
+
+
+# func_convert_path_nix_to_cygwin ARG
+# Convert path ARG from *nix to Cygwin format.  Requires Cygwin installed in a
+# a wine environment, working winepath, and LT_CYGPATH set.  Returns result in
+# func_to_host_file_result.
+func_convert_path_nix_to_cygwin ()
+{
+  $opt_debug
+  func_to_host_path_result="$1"
+  if test -n "$1"; then
+    # Remove leading and trailing path separator characters from
+    # ARG. msys behavior is inconsistent here, cygpath turns them
+    # into '.;' and ';.', and winepath ignores them completely.
+    func_stripname : : "$1"
+    func_to_host_path_tmp1=$func_stripname_result
+    func_convert_core_path_wine_to_w32 "$func_to_host_path_tmp1"
+    func_cygpath -u -p "$func_convert_core_path_wine_to_w32_result"
+    func_to_host_path_result="$func_cygpath_result"
+    func_convert_path_check : : \
+      "$func_to_host_path_tmp1" "$func_to_host_path_result"
+    func_convert_path_front_back_pathsep ":*" "*:" : "$1"
+  fi
+}
+# end func_convert_path_nix_to_cygwin
+
+
+# func_mode_compile arg...
+func_mode_compile ()
+{
+    $opt_debug
+    # Get the compilation command and the source file.
+    base_compile=
+    srcfile="$nonopt"  #  always keep a non-empty value in "srcfile"
+    suppress_opt=yes
+    suppress_output=
+    arg_mode=normal
+    libobj=
+    later=
+    pie_flag=
+
+    for arg
+    do
+      case $arg_mode in
+      arg  )
+	# do not "continue".  Instead, add this to base_compile
+	lastarg="$arg"
+	arg_mode=normal
+	;;
+
+      target )
+	libobj="$arg"
+	arg_mode=normal
+	continue
+	;;
+
+      normal )
+	# Accept any command-line options.
+	case $arg in
+	-o)
+	  test -n "$libobj" && \
+	    func_fatal_error "you cannot specify \`-o' more than once"
+	  arg_mode=target
+	  continue
+	  ;;
+
+	-pie | -fpie | -fPIE)
+          func_append pie_flag " $arg"
+	  continue
+	  ;;
+
+	-shared | -static | -prefer-pic | -prefer-non-pic)
+	  func_append later " $arg"
+	  continue
+	  ;;
+
+	-no-suppress)
+	  suppress_opt=no
+	  continue
+	  ;;
+
+	-Xcompiler)
+	  arg_mode=arg  #  the next one goes into the "base_compile" arg list
+	  continue      #  The current "srcfile" will either be retained or
+	  ;;            #  replaced later.  I would guess that would be a bug.
+
+	-Wc,*)
+	  func_stripname '-Wc,' '' "$arg"
+	  args=$func_stripname_result
+	  lastarg=
+	  save_ifs="$IFS"; IFS=','
+	  for arg in $args; do
+	    IFS="$save_ifs"
+	    func_append_quoted lastarg "$arg"
+	  done
+	  IFS="$save_ifs"
+	  func_stripname ' ' '' "$lastarg"
+	  lastarg=$func_stripname_result
+
+	  # Add the arguments to base_compile.
+	  func_append base_compile " $lastarg"
+	  continue
+	  ;;
+
+	*)
+	  # Accept the current argument as the source file.
+	  # The previous "srcfile" becomes the current argument.
+	  #
+	  lastarg="$srcfile"
+	  srcfile="$arg"
+	  ;;
+	esac  #  case $arg
+	;;
+      esac    #  case $arg_mode
+
+      # Aesthetically quote the previous argument.
+      func_append_quoted base_compile "$lastarg"
+    done # for arg
+
+    case $arg_mode in
+    arg)
+      func_fatal_error "you must specify an argument for -Xcompile"
+      ;;
+    target)
+      func_fatal_error "you must specify a target with \`-o'"
+      ;;
+    *)
+      # Get the name of the library object.
+      test -z "$libobj" && {
+	func_basename "$srcfile"
+	libobj="$func_basename_result"
+      }
+      ;;
+    esac
+
+    # Recognize several different file suffixes.
+    # If the user specifies -o file.o, it is replaced with file.lo
+    case $libobj in
+    *.[cCFSifmso] | \
+    *.ada | *.adb | *.ads | *.asm | \
+    *.c++ | *.cc | *.ii | *.class | *.cpp | *.cxx | \
+    *.[fF][09]? | *.for | *.java | *.go | *.obj | *.sx | *.cu | *.cup)
+      func_xform "$libobj"
+      libobj=$func_xform_result
+      ;;
+    esac
+
+    case $libobj in
+    *.lo) func_lo2o "$libobj"; obj=$func_lo2o_result ;;
+    *)
+      func_fatal_error "cannot determine name of library object from \`$libobj'"
+      ;;
+    esac
+
+    func_infer_tag $base_compile
+
+    for arg in $later; do
+      case $arg in
+      -shared)
+	test "$build_libtool_libs" != yes && \
+	  func_fatal_configuration "can not build a shared library"
+	build_old_libs=no
+	continue
+	;;
+
+      -static)
+	build_libtool_libs=no
+	build_old_libs=yes
+	continue
+	;;
+
+      -prefer-pic)
+	pic_mode=yes
+	continue
+	;;
+
+      -prefer-non-pic)
+	pic_mode=no
+	continue
+	;;
+      esac
+    done
+
+    func_quote_for_eval "$libobj"
+    test "X$libobj" != "X$func_quote_for_eval_result" \
+      && $ECHO "X$libobj" | $GREP '[]~#^*{};<>?"'"'"'	 &()|`$[]' \
+      && func_warning "libobj name \`$libobj' may not contain shell special characters."
+    func_dirname_and_basename "$obj" "/" ""
+    objname="$func_basename_result"
+    xdir="$func_dirname_result"
+    lobj=${xdir}$objdir/$objname
+
+    test -z "$base_compile" && \
+      func_fatal_help "you must specify a compilation command"
+
+    # Delete any leftover library objects.
+    if test "$build_old_libs" = yes; then
+      removelist="$obj $lobj $libobj ${libobj}T"
+    else
+      removelist="$lobj $libobj ${libobj}T"
+    fi
+
+    # On Cygwin there's no "real" PIC flag so we must build both object types
+    case $host_os in
+    cygwin* | mingw* | pw32* | os2* | cegcc*)
+      pic_mode=default
+      ;;
+    esac
+    if test "$pic_mode" = no && test "$deplibs_check_method" != pass_all; then
+      # non-PIC code in shared libraries is not supported
+      pic_mode=default
+    fi
+
+    # Calculate the filename of the output object if compiler does
+    # not support -o with -c
+    if test "$compiler_c_o" = no; then
+      output_obj=`$ECHO "$srcfile" | $SED 's%^.*/%%; s%\.[^.]*$%%'`.${objext}
+      lockfile="$output_obj.lock"
+    else
+      output_obj=
+      need_locks=no
+      lockfile=
+    fi
+
+    # Lock this critical section if it is needed
+    # We use this script file to make the link, it avoids creating a new file
+    if test "$need_locks" = yes; then
+      until $opt_dry_run || ln "$progpath" "$lockfile" 2>/dev/null; do
+	func_echo "Waiting for $lockfile to be removed"
+	sleep 2
+      done
+    elif test "$need_locks" = warn; then
+      if test -f "$lockfile"; then
+	$ECHO "\
+*** ERROR, $lockfile exists and contains:
+`cat $lockfile 2>/dev/null`
+
+This indicates that another process is trying to use the same
+temporary object file, and libtool could not work around it because
+your compiler does not support \`-c' and \`-o' together.  If you
+repeat this compilation, it may succeed, by chance, but you had better
+avoid parallel builds (make -j) in this platform, or get a better
+compiler."
+
+	$opt_dry_run || $RM $removelist
+	exit $EXIT_FAILURE
+      fi
+      func_append removelist " $output_obj"
+      $ECHO "$srcfile" > "$lockfile"
+    fi
+
+    $opt_dry_run || $RM $removelist
+    func_append removelist " $lockfile"
+    trap '$opt_dry_run || $RM $removelist; exit $EXIT_FAILURE' 1 2 15
+
+    func_to_tool_file "$srcfile" func_convert_file_msys_to_w32
+    srcfile=$func_to_tool_file_result
+    func_quote_for_eval "$srcfile"
+    qsrcfile=$func_quote_for_eval_result
+
+    # Only build a PIC object if we are building libtool libraries.
+    if test "$build_libtool_libs" = yes; then
+      # Without this assignment, base_compile gets emptied.
+      fbsd_hideous_sh_bug=$base_compile
+
+      if test "$pic_mode" != no; then
+	command="$base_compile $qsrcfile $pic_flag"
+      else
+	# Don't build PIC code
+	command="$base_compile $qsrcfile"
+      fi
+
+      func_mkdir_p "$xdir$objdir"
+
+      if test -z "$output_obj"; then
+	# Place PIC objects in $objdir
+	func_append command " -o $lobj"
+      fi
+
+      func_show_eval_locale "$command"	\
+          'test -n "$output_obj" && $RM $removelist; exit $EXIT_FAILURE'
+
+      if test "$need_locks" = warn &&
+	 test "X`cat $lockfile 2>/dev/null`" != "X$srcfile"; then
+	$ECHO "\
+*** ERROR, $lockfile contains:
+`cat $lockfile 2>/dev/null`
+
+but it should contain:
+$srcfile
+
+This indicates that another process is trying to use the same
+temporary object file, and libtool could not work around it because
+your compiler does not support \`-c' and \`-o' together.  If you
+repeat this compilation, it may succeed, by chance, but you had better
+avoid parallel builds (make -j) in this platform, or get a better
+compiler."
+
+	$opt_dry_run || $RM $removelist
+	exit $EXIT_FAILURE
+      fi
+
+      # Just move the object if needed, then go on to compile the next one
+      if test -n "$output_obj" && test "X$output_obj" != "X$lobj"; then
+	func_show_eval '$MV "$output_obj" "$lobj"' \
+	  'error=$?; $opt_dry_run || $RM $removelist; exit $error'
+      fi
+
+      # Allow error messages only from the first compilation.
+      if test "$suppress_opt" = yes; then
+	suppress_output=' >/dev/null 2>&1'
+      fi
+    fi
+
+    # Only build a position-dependent object if we build old libraries.
+    if test "$build_old_libs" = yes; then
+      if test "$pic_mode" != yes; then
+	# Don't build PIC code
+	command="$base_compile $qsrcfile$pie_flag"
+      else
+	command="$base_compile $qsrcfile $pic_flag"
+      fi
+      if test "$compiler_c_o" = yes; then
+	func_append command " -o $obj"
+      fi
+
+      # Suppress compiler output if we already did a PIC compilation.
+      func_append command "$suppress_output"
+      func_show_eval_locale "$command" \
+        '$opt_dry_run || $RM $removelist; exit $EXIT_FAILURE'
+
+      if test "$need_locks" = warn &&
+	 test "X`cat $lockfile 2>/dev/null`" != "X$srcfile"; then
+	$ECHO "\
+*** ERROR, $lockfile contains:
+`cat $lockfile 2>/dev/null`
+
+but it should contain:
+$srcfile
+
+This indicates that another process is trying to use the same
+temporary object file, and libtool could not work around it because
+your compiler does not support \`-c' and \`-o' together.  If you
+repeat this compilation, it may succeed, by chance, but you had better
+avoid parallel builds (make -j) in this platform, or get a better
+compiler."
+
+	$opt_dry_run || $RM $removelist
+	exit $EXIT_FAILURE
+      fi
+
+      # Just move the object if needed
+      if test -n "$output_obj" && test "X$output_obj" != "X$obj"; then
+	func_show_eval '$MV "$output_obj" "$obj"' \
+	  'error=$?; $opt_dry_run || $RM $removelist; exit $error'
+      fi
+    fi
+
+    $opt_dry_run || {
+      func_write_libtool_object "$libobj" "$objdir/$objname" "$objname"
+
+      # Unlock the critical section if it was locked
+      if test "$need_locks" != no; then
+	removelist=$lockfile
+        $RM "$lockfile"
+      fi
+    }
+
+    exit $EXIT_SUCCESS
+}
+
+$opt_help || {
+  test "$opt_mode" = compile && func_mode_compile ${1+"$@"}
+}
+
+func_mode_help ()
+{
+    # We need to display help for each of the modes.
+    case $opt_mode in
+      "")
+        # Generic help is extracted from the usage comments
+        # at the start of this file.
+        func_help
+        ;;
+
+      clean)
+        $ECHO \
+"Usage: $progname [OPTION]... --mode=clean RM [RM-OPTION]... FILE...
+
+Remove files from the build directory.
+
+RM is the name of the program to use to delete files associated with each FILE
+(typically \`/bin/rm').  RM-OPTIONS are options (such as \`-f') to be passed
+to RM.
+
+If FILE is a libtool library, object or program, all the files associated
+with it are deleted. Otherwise, only FILE itself is deleted using RM."
+        ;;
+
+      compile)
+      $ECHO \
+"Usage: $progname [OPTION]... --mode=compile COMPILE-COMMAND... SOURCEFILE
+
+Compile a source file into a libtool library object.
+
+This mode accepts the following additional options:
+
+  -o OUTPUT-FILE    set the output file name to OUTPUT-FILE
+  -no-suppress      do not suppress compiler output for multiple passes
+  -prefer-pic       try to build PIC objects only
+  -prefer-non-pic   try to build non-PIC objects only
+  -shared           do not build a \`.o' file suitable for static linking
+  -static           only build a \`.o' file suitable for static linking
+  -Wc,FLAG          pass FLAG directly to the compiler
+
+COMPILE-COMMAND is a command to be used in creating a \`standard' object file
+from the given SOURCEFILE.
+
+The output file name is determined by removing the directory component from
+SOURCEFILE, then substituting the C source code suffix \`.c' with the
+library object suffix, \`.lo'."
+        ;;
+
+      execute)
+        $ECHO \
+"Usage: $progname [OPTION]... --mode=execute COMMAND [ARGS]...
+
+Automatically set library path, then run a program.
+
+This mode accepts the following additional options:
+
+  -dlopen FILE      add the directory containing FILE to the library path
+
+This mode sets the library path environment variable according to \`-dlopen'
+flags.
+
+If any of the ARGS are libtool executable wrappers, then they are translated
+into their corresponding uninstalled binary, and any of their required library
+directories are added to the library path.
+
+Then, COMMAND is executed, with ARGS as arguments."
+        ;;
+
+      finish)
+        $ECHO \
+"Usage: $progname [OPTION]... --mode=finish [LIBDIR]...
+
+Complete the installation of libtool libraries.
+
+Each LIBDIR is a directory that contains libtool libraries.
+
+The commands that this mode executes may require superuser privileges.  Use
+the \`--dry-run' option if you just want to see what would be executed."
+        ;;
+
+      install)
+        $ECHO \
+"Usage: $progname [OPTION]... --mode=install INSTALL-COMMAND...
+
+Install executables or libraries.
+
+INSTALL-COMMAND is the installation command.  The first component should be
+either the \`install' or \`cp' program.
+
+The following components of INSTALL-COMMAND are treated specially:
+
+  -inst-prefix-dir PREFIX-DIR  Use PREFIX-DIR as a staging area for installation
+
+The rest of the components are interpreted as arguments to that command (only
+BSD-compatible install options are recognized)."
+        ;;
+
+      link)
+        $ECHO \
+"Usage: $progname [OPTION]... --mode=link LINK-COMMAND...
+
+Link object files or libraries together to form another library, or to
+create an executable program.
+
+LINK-COMMAND is a command using the C compiler that you would use to create
+a program from several object files.
+
+The following components of LINK-COMMAND are treated specially:
+
+  -all-static       do not do any dynamic linking at all
+  -avoid-version    do not add a version suffix if possible
+  -bindir BINDIR    specify path to binaries directory (for systems where
+                    libraries must be found in the PATH setting at runtime)
+  -dlopen FILE      \`-dlpreopen' FILE if it cannot be dlopened at runtime
+  -dlpreopen FILE   link in FILE and add its symbols to lt_preloaded_symbols
+  -export-dynamic   allow symbols from OUTPUT-FILE to be resolved with dlsym(3)
+  -export-symbols SYMFILE
+                    try to export only the symbols listed in SYMFILE
+  -export-symbols-regex REGEX
+                    try to export only the symbols matching REGEX
+  -LLIBDIR          search LIBDIR for required installed libraries
+  -lNAME            OUTPUT-FILE requires the installed library libNAME
+  -module           build a library that can dlopened
+  -no-fast-install  disable the fast-install mode
+  -no-install       link a not-installable executable
+  -no-undefined     declare that a library does not refer to external symbols
+  -o OUTPUT-FILE    create OUTPUT-FILE from the specified objects
+  -objectlist FILE  Use a list of object files found in FILE to specify objects
+  -precious-files-regex REGEX
+                    don't remove output files matching REGEX
+  -release RELEASE  specify package release information
+  -rpath LIBDIR     the created library will eventually be installed in LIBDIR
+  -R[ ]LIBDIR       add LIBDIR to the runtime path of programs and libraries
+  -shared           only do dynamic linking of libtool libraries
+  -shrext SUFFIX    override the standard shared library file extension
+  -static           do not do any dynamic linking of uninstalled libtool libraries
+  -static-libtool-libs
+                    do not do any dynamic linking of libtool libraries
+  -version-info CURRENT[:REVISION[:AGE]]
+                    specify library version info [each variable defaults to 0]
+  -weak LIBNAME     declare that the target provides the LIBNAME interface
+  -Wc,FLAG
+  -Xcompiler FLAG   pass linker-specific FLAG directly to the compiler
+  -Wl,FLAG
+  -Xlinker FLAG     pass linker-specific FLAG directly to the linker
+  -XCClinker FLAG   pass link-specific FLAG to the compiler driver (CC)
+
+All other options (arguments beginning with \`-') are ignored.
+
+Every other argument is treated as a filename.  Files ending in \`.la' are
+treated as uninstalled libtool libraries, other files are standard or library
+object files.
+
+If the OUTPUT-FILE ends in \`.la', then a libtool library is created,
+only library objects (\`.lo' files) may be specified, and \`-rpath' is
+required, except when creating a convenience library.
+
+If OUTPUT-FILE ends in \`.a' or \`.lib', then a standard library is created
+using \`ar' and \`ranlib', or on Windows using \`lib'.
+
+If OUTPUT-FILE ends in \`.lo' or \`.${objext}', then a reloadable object file
+is created, otherwise an executable program is created."
+        ;;
+
+      uninstall)
+        $ECHO \
+"Usage: $progname [OPTION]... --mode=uninstall RM [RM-OPTION]... FILE...
+
+Remove libraries from an installation directory.
+
+RM is the name of the program to use to delete files associated with each FILE
+(typically \`/bin/rm').  RM-OPTIONS are options (such as \`-f') to be passed
+to RM.
+
+If FILE is a libtool library, all the files associated with it are deleted.
+Otherwise, only FILE itself is deleted using RM."
+        ;;
+
+      *)
+        func_fatal_help "invalid operation mode \`$opt_mode'"
+        ;;
+    esac
+
+    echo
+    $ECHO "Try \`$progname --help' for more information about other modes."
+}
+
+# Now that we've collected a possible --mode arg, show help if necessary
+if $opt_help; then
+  if test "$opt_help" = :; then
+    func_mode_help
+  else
+    {
+      func_help noexit
+      for opt_mode in compile link execute install finish uninstall clean; do
+	func_mode_help
+      done
+    } | sed -n '1p; 2,$s/^Usage:/  or: /p'
+    {
+      func_help noexit
+      for opt_mode in compile link execute install finish uninstall clean; do
+	echo
+	func_mode_help
+      done
+    } |
+    sed '1d
+      /^When reporting/,/^Report/{
+	H
+	d
+      }
+      $x
+      /information about other modes/d
+      /more detailed .*MODE/d
+      s/^Usage:.*--mode=\([^ ]*\) .*/Description of \1 mode:/'
+  fi
+  exit $?
+fi
+
+
+# func_mode_execute arg...
+func_mode_execute ()
+{
+    $opt_debug
+    # The first argument is the command name.
+    cmd="$nonopt"
+    test -z "$cmd" && \
+      func_fatal_help "you must specify a COMMAND"
+
+    # Handle -dlopen flags immediately.
+    for file in $opt_dlopen; do
+      test -f "$file" \
+	|| func_fatal_help "\`$file' is not a file"
+
+      dir=
+      case $file in
+      *.la)
+	func_resolve_sysroot "$file"
+	file=$func_resolve_sysroot_result
+
+	# Check to see that this really is a libtool archive.
+	func_lalib_unsafe_p "$file" \
+	  || func_fatal_help "\`$lib' is not a valid libtool archive"
+
+	# Read the libtool library.
+	dlname=
+	library_names=
+	func_source "$file"
+
+	# Skip this library if it cannot be dlopened.
+	if test -z "$dlname"; then
+	  # Warn if it was a shared library.
+	  test -n "$library_names" && \
+	    func_warning "\`$file' was not linked with \`-export-dynamic'"
+	  continue
+	fi
+
+	func_dirname "$file" "" "."
+	dir="$func_dirname_result"
+
+	if test -f "$dir/$objdir/$dlname"; then
+	  func_append dir "/$objdir"
+	else
+	  if test ! -f "$dir/$dlname"; then
+	    func_fatal_error "cannot find \`$dlname' in \`$dir' or \`$dir/$objdir'"
+	  fi
+	fi
+	;;
+
+      *.lo)
+	# Just add the directory containing the .lo file.
+	func_dirname "$file" "" "."
+	dir="$func_dirname_result"
+	;;
+
+      *)
+	func_warning "\`-dlopen' is ignored for non-libtool libraries and objects"
+	continue
+	;;
+      esac
+
+      # Get the absolute pathname.
+      absdir=`cd "$dir" && pwd`
+      test -n "$absdir" && dir="$absdir"
+
+      # Now add the directory to shlibpath_var.
+      if eval "test -z \"\$$shlibpath_var\""; then
+	eval "$shlibpath_var=\"\$dir\""
+      else
+	eval "$shlibpath_var=\"\$dir:\$$shlibpath_var\""
+      fi
+    done
+
+    # This variable tells wrapper scripts just to set shlibpath_var
+    # rather than running their programs.
+    libtool_execute_magic="$magic"
+
+    # Check if any of the arguments is a wrapper script.
+    args=
+    for file
+    do
+      case $file in
+      -* | *.la | *.lo ) ;;
+      *)
+	# Do a test to see if this is really a libtool program.
+	if func_ltwrapper_script_p "$file"; then
+	  func_source "$file"
+	  # Transform arg to wrapped name.
+	  file="$progdir/$program"
+	elif func_ltwrapper_executable_p "$file"; then
+	  func_ltwrapper_scriptname "$file"
+	  func_source "$func_ltwrapper_scriptname_result"
+	  # Transform arg to wrapped name.
+	  file="$progdir/$program"
+	fi
+	;;
+      esac
+      # Quote arguments (to preserve shell metacharacters).
+      func_append_quoted args "$file"
+    done
+
+    if test "X$opt_dry_run" = Xfalse; then
+      if test -n "$shlibpath_var"; then
+	# Export the shlibpath_var.
+	eval "export $shlibpath_var"
+      fi
+
+      # Restore saved environment variables
+      for lt_var in LANG LANGUAGE LC_ALL LC_CTYPE LC_COLLATE LC_MESSAGES
+      do
+	eval "if test \"\${save_$lt_var+set}\" = set; then
+                $lt_var=\$save_$lt_var; export $lt_var
+	      else
+		$lt_unset $lt_var
+	      fi"
+      done
+
+      # Now prepare to actually exec the command.
+      exec_cmd="\$cmd$args"
+    else
+      # Display what would be done.
+      if test -n "$shlibpath_var"; then
+	eval "\$ECHO \"\$shlibpath_var=\$$shlibpath_var\""
+	echo "export $shlibpath_var"
+      fi
+      $ECHO "$cmd$args"
+      exit $EXIT_SUCCESS
+    fi
+}
+
+test "$opt_mode" = execute && func_mode_execute ${1+"$@"}
+
+
+# func_mode_finish arg...
+func_mode_finish ()
+{
+    $opt_debug
+    libs=
+    libdirs=
+    admincmds=
+
+    for opt in "$nonopt" ${1+"$@"}
+    do
+      if test -d "$opt"; then
+	func_append libdirs " $opt"
+
+      elif test -f "$opt"; then
+	if func_lalib_unsafe_p "$opt"; then
+	  func_append libs " $opt"
+	else
+	  func_warning "\`$opt' is not a valid libtool archive"
+	fi
+
+      else
+	func_fatal_error "invalid argument \`$opt'"
+      fi
+    done
+
+    if test -n "$libs"; then
+      if test -n "$lt_sysroot"; then
+        sysroot_regex=`$ECHO "$lt_sysroot" | $SED "$sed_make_literal_regex"`
+        sysroot_cmd="s/\([ ']\)$sysroot_regex/\1/g;"
+      else
+        sysroot_cmd=
+      fi
+
+      # Remove sysroot references
+      if $opt_dry_run; then
+        for lib in $libs; do
+          echo "removing references to $lt_sysroot and \`=' prefixes from $lib"
+        done
+      else
+        tmpdir=`func_mktempdir`
+        for lib in $libs; do
+	  sed -e "${sysroot_cmd} s/\([ ']-[LR]\)=/\1/g; s/\([ ']\)=/\1/g" $lib \
+	    > $tmpdir/tmp-la
+	  mv -f $tmpdir/tmp-la $lib
+	done
+        ${RM}r "$tmpdir"
+      fi
+    fi
+
+    if test -n "$finish_cmds$finish_eval" && test -n "$libdirs"; then
+      for libdir in $libdirs; do
+	if test -n "$finish_cmds"; then
+	  # Do each command in the finish commands.
+	  func_execute_cmds "$finish_cmds" 'admincmds="$admincmds
+'"$cmd"'"'
+	fi
+	if test -n "$finish_eval"; then
+	  # Do the single finish_eval.
+	  eval cmds=\"$finish_eval\"
+	  $opt_dry_run || eval "$cmds" || func_append admincmds "
+       $cmds"
+	fi
+      done
+    fi
+
+    # Exit here if they wanted silent mode.
+    $opt_silent && exit $EXIT_SUCCESS
+
+    if test -n "$finish_cmds$finish_eval" && test -n "$libdirs"; then
+      echo "----------------------------------------------------------------------"
+      echo "Libraries have been installed in:"
+      for libdir in $libdirs; do
+	$ECHO "   $libdir"
+      done
+      echo
+      echo "If you ever happen to want to link against installed libraries"
+      echo "in a given directory, LIBDIR, you must either use libtool, and"
+      echo "specify the full pathname of the library, or use the \`-LLIBDIR'"
+      echo "flag during linking and do at least one of the following:"
+      if test -n "$shlibpath_var"; then
+	echo "   - add LIBDIR to the \`$shlibpath_var' environment variable"
+	echo "     during execution"
+      fi
+      if test -n "$runpath_var"; then
+	echo "   - add LIBDIR to the \`$runpath_var' environment variable"
+	echo "     during linking"
+      fi
+      if test -n "$hardcode_libdir_flag_spec"; then
+	libdir=LIBDIR
+	eval flag=\"$hardcode_libdir_flag_spec\"
+
+	$ECHO "   - use the \`$flag' linker flag"
+      fi
+      if test -n "$admincmds"; then
+	$ECHO "   - have your system administrator run these commands:$admincmds"
+      fi
+      if test -f /etc/ld.so.conf; then
+	echo "   - have your system administrator add LIBDIR to \`/etc/ld.so.conf'"
+      fi
+      echo
+
+      echo "See any operating system documentation about shared libraries for"
+      case $host in
+	solaris2.[6789]|solaris2.1[0-9])
+	  echo "more information, such as the ld(1), crle(1) and ld.so(8) manual"
+	  echo "pages."
+	  ;;
+	*)
+	  echo "more information, such as the ld(1) and ld.so(8) manual pages."
+	  ;;
+      esac
+      echo "----------------------------------------------------------------------"
+    fi
+    exit $EXIT_SUCCESS
+}
+
+test "$opt_mode" = finish && func_mode_finish ${1+"$@"}
+
+
+# func_mode_install arg...
+func_mode_install ()
+{
+    $opt_debug
+    # There may be an optional sh(1) argument at the beginning of
+    # install_prog (especially on Windows NT).
+    if test "$nonopt" = "$SHELL" || test "$nonopt" = /bin/sh ||
+       # Allow the use of GNU shtool's install command.
+       case $nonopt in *shtool*) :;; *) false;; esac; then
+      # Aesthetically quote it.
+      func_quote_for_eval "$nonopt"
+      install_prog="$func_quote_for_eval_result "
+      arg=$1
+      shift
+    else
+      install_prog=
+      arg=$nonopt
+    fi
+
+    # The real first argument should be the name of the installation program.
+    # Aesthetically quote it.
+    func_quote_for_eval "$arg"
+    func_append install_prog "$func_quote_for_eval_result"
+    install_shared_prog=$install_prog
+    case " $install_prog " in
+      *[\\\ /]cp\ *) install_cp=: ;;
+      *) install_cp=false ;;
+    esac
+
+    # We need to accept at least all the BSD install flags.
+    dest=
+    files=
+    opts=
+    prev=
+    install_type=
+    isdir=no
+    stripme=
+    no_mode=:
+    for arg
+    do
+      arg2=
+      if test -n "$dest"; then
+	func_append files " $dest"
+	dest=$arg
+	continue
+      fi
+
+      case $arg in
+      -d) isdir=yes ;;
+      -f)
+	if $install_cp; then :; else
+	  prev=$arg
+	fi
+	;;
+      -g | -m | -o)
+	prev=$arg
+	;;
+      -s)
+	stripme=" -s"
+	continue
+	;;
+      -*)
+	;;
+      *)
+	# If the previous option needed an argument, then skip it.
+	if test -n "$prev"; then
+	  if test "x$prev" = x-m && test -n "$install_override_mode"; then
+	    arg2=$install_override_mode
+	    no_mode=false
+	  fi
+	  prev=
+	else
+	  dest=$arg
+	  continue
+	fi
+	;;
+      esac
+
+      # Aesthetically quote the argument.
+      func_quote_for_eval "$arg"
+      func_append install_prog " $func_quote_for_eval_result"
+      if test -n "$arg2"; then
+	func_quote_for_eval "$arg2"
+      fi
+      func_append install_shared_prog " $func_quote_for_eval_result"
+    done
+
+    test -z "$install_prog" && \
+      func_fatal_help "you must specify an install program"
+
+    test -n "$prev" && \
+      func_fatal_help "the \`$prev' option requires an argument"
+
+    if test -n "$install_override_mode" && $no_mode; then
+      if $install_cp; then :; else
+	func_quote_for_eval "$install_override_mode"
+	func_append install_shared_prog " -m $func_quote_for_eval_result"
+      fi
+    fi
+
+    if test -z "$files"; then
+      if test -z "$dest"; then
+	func_fatal_help "no file or destination specified"
+      else
+	func_fatal_help "you must specify a destination"
+      fi
+    fi
+
+    # Strip any trailing slash from the destination.
+    func_stripname '' '/' "$dest"
+    dest=$func_stripname_result
+
+    # Check to see that the destination is a directory.
+    test -d "$dest" && isdir=yes
+    if test "$isdir" = yes; then
+      destdir="$dest"
+      destname=
+    else
+      func_dirname_and_basename "$dest" "" "."
+      destdir="$func_dirname_result"
+      destname="$func_basename_result"
+
+      # Not a directory, so check to see that there is only one file specified.
+      set dummy $files; shift
+      test "$#" -gt 1 && \
+	func_fatal_help "\`$dest' is not a directory"
+    fi
+    case $destdir in
+    [\\/]* | [A-Za-z]:[\\/]*) ;;
+    *)
+      for file in $files; do
+	case $file in
+	*.lo) ;;
+	*)
+	  func_fatal_help "\`$destdir' must be an absolute directory name"
+	  ;;
+	esac
+      done
+      ;;
+    esac
+
+    # This variable tells wrapper scripts just to set variables rather
+    # than running their programs.
+    libtool_install_magic="$magic"
+
+    staticlibs=
+    future_libdirs=
+    current_libdirs=
+    for file in $files; do
+
+      # Do each installation.
+      case $file in
+      *.$libext)
+	# Do the static libraries later.
+	func_append staticlibs " $file"
+	;;
+
+      *.la)
+	func_resolve_sysroot "$file"
+	file=$func_resolve_sysroot_result
+
+	# Check to see that this really is a libtool archive.
+	func_lalib_unsafe_p "$file" \
+	  || func_fatal_help "\`$file' is not a valid libtool archive"
+
+	library_names=
+	old_library=
+	relink_command=
+	func_source "$file"
+
+	# Add the libdir to current_libdirs if it is the destination.
+	if test "X$destdir" = "X$libdir"; then
+	  case "$current_libdirs " in
+	  *" $libdir "*) ;;
+	  *) func_append current_libdirs " $libdir" ;;
+	  esac
+	else
+	  # Note the libdir as a future libdir.
+	  case "$future_libdirs " in
+	  *" $libdir "*) ;;
+	  *) func_append future_libdirs " $libdir" ;;
+	  esac
+	fi
+
+	func_dirname "$file" "/" ""
+	dir="$func_dirname_result"
+	func_append dir "$objdir"
+
+	if test -n "$relink_command"; then
+	  # Determine the prefix the user has applied to our future dir.
+	  inst_prefix_dir=`$ECHO "$destdir" | $SED -e "s%$libdir\$%%"`
+
+	  # Don't allow the user to place us outside of our expected
+	  # location b/c this prevents finding dependent libraries that
+	  # are installed to the same prefix.
+	  # At present, this check doesn't affect windows .dll's that
+	  # are installed into $libdir/../bin (currently, that works fine)
+	  # but it's something to keep an eye on.
+	  test "$inst_prefix_dir" = "$destdir" && \
+	    func_fatal_error "error: cannot install \`$file' to a directory not ending in $libdir"
+
+	  if test -n "$inst_prefix_dir"; then
+	    # Stick the inst_prefix_dir data into the link command.
+	    relink_command=`$ECHO "$relink_command" | $SED "s%@inst_prefix_dir@%-inst-prefix-dir $inst_prefix_dir%"`
+	  else
+	    relink_command=`$ECHO "$relink_command" | $SED "s%@inst_prefix_dir@%%"`
+	  fi
+
+	  func_warning "relinking \`$file'"
+	  func_show_eval "$relink_command" \
+	    'func_fatal_error "error: relink \`$file'\'' with the above command before installing it"'
+	fi
+
+	# See the names of the shared library.
+	set dummy $library_names; shift
+	if test -n "$1"; then
+	  realname="$1"
+	  shift
+
+	  srcname="$realname"
+	  test -n "$relink_command" && srcname="$realname"T
+
+	  # Install the shared library and build the symlinks.
+	  func_show_eval "$install_shared_prog $dir/$srcname $destdir/$realname" \
+	      'exit $?'
+	  tstripme="$stripme"
+	  case $host_os in
+	  cygwin* | mingw* | pw32* | cegcc*)
+	    case $realname in
+	    *.dll.a)
+	      tstripme=""
+	      ;;
+	    esac
+	    ;;
+	  esac
+	  if test -n "$tstripme" && test -n "$striplib"; then
+	    func_show_eval "$striplib $destdir/$realname" 'exit $?'
+	  fi
+
+	  if test "$#" -gt 0; then
+	    # Delete the old symlinks, and create new ones.
+	    # Try `ln -sf' first, because the `ln' binary might depend on
+	    # the symlink we replace!  Solaris /bin/ln does not understand -f,
+	    # so we also need to try rm && ln -s.
+	    for linkname
+	    do
+	      test "$linkname" != "$realname" \
+		&& func_show_eval "(cd $destdir && { $LN_S -f $realname $linkname || { $RM $linkname && $LN_S $realname $linkname; }; })"
+	    done
+	  fi
+
+	  # Do each command in the postinstall commands.
+	  lib="$destdir/$realname"
+	  func_execute_cmds "$postinstall_cmds" 'exit $?'
+	fi
+
+	# Install the pseudo-library for information purposes.
+	func_basename "$file"
+	name="$func_basename_result"
+	instname="$dir/$name"i
+	func_show_eval "$install_prog $instname $destdir/$name" 'exit $?'
+
+	# Maybe install the static library, too.
+	test -n "$old_library" && func_append staticlibs " $dir/$old_library"
+	;;
+
+      *.lo)
+	# Install (i.e. copy) a libtool object.
+
+	# Figure out destination file name, if it wasn't already specified.
+	if test -n "$destname"; then
+	  destfile="$destdir/$destname"
+	else
+	  func_basename "$file"
+	  destfile="$func_basename_result"
+	  destfile="$destdir/$destfile"
+	fi
+
+	# Deduce the name of the destination old-style object file.
+	case $destfile in
+	*.lo)
+	  func_lo2o "$destfile"
+	  staticdest=$func_lo2o_result
+	  ;;
+	*.$objext)
+	  staticdest="$destfile"
+	  destfile=
+	  ;;
+	*)
+	  func_fatal_help "cannot copy a libtool object to \`$destfile'"
+	  ;;
+	esac
+
+	# Install the libtool object if requested.
+	test -n "$destfile" && \
+	  func_show_eval "$install_prog $file $destfile" 'exit $?'
+
+	# Install the old object if enabled.
+	if test "$build_old_libs" = yes; then
+	  # Deduce the name of the old-style object file.
+	  func_lo2o "$file"
+	  staticobj=$func_lo2o_result
+	  func_show_eval "$install_prog \$staticobj \$staticdest" 'exit $?'
+	fi
+	exit $EXIT_SUCCESS
+	;;
+
+      *)
+	# Figure out destination file name, if it wasn't already specified.
+	if test -n "$destname"; then
+	  destfile="$destdir/$destname"
+	else
+	  func_basename "$file"
+	  destfile="$func_basename_result"
+	  destfile="$destdir/$destfile"
+	fi
+
+	# If the file is missing, and there is a .exe on the end, strip it
+	# because it is most likely a libtool script we actually want to
+	# install
+	stripped_ext=""
+	case $file in
+	  *.exe)
+	    if test ! -f "$file"; then
+	      func_stripname '' '.exe' "$file"
+	      file=$func_stripname_result
+	      stripped_ext=".exe"
+	    fi
+	    ;;
+	esac
+
+	# Do a test to see if this is really a libtool program.
+	case $host in
+	*cygwin* | *mingw*)
+	    if func_ltwrapper_executable_p "$file"; then
+	      func_ltwrapper_scriptname "$file"
+	      wrapper=$func_ltwrapper_scriptname_result
+	    else
+	      func_stripname '' '.exe' "$file"
+	      wrapper=$func_stripname_result
+	    fi
+	    ;;
+	*)
+	    wrapper=$file
+	    ;;
+	esac
+	if func_ltwrapper_script_p "$wrapper"; then
+	  notinst_deplibs=
+	  relink_command=
+
+	  func_source "$wrapper"
+
+	  # Check the variables that should have been set.
+	  test -z "$generated_by_libtool_version" && \
+	    func_fatal_error "invalid libtool wrapper script \`$wrapper'"
+
+	  finalize=yes
+	  for lib in $notinst_deplibs; do
+	    # Check to see that each library is installed.
+	    libdir=
+	    if test -f "$lib"; then
+	      func_source "$lib"
+	    fi
+	    libfile="$libdir/"`$ECHO "$lib" | $SED 's%^.*/%%g'` ### testsuite: skip nested quoting test
+	    if test -n "$libdir" && test ! -f "$libfile"; then
+	      func_warning "\`$lib' has not been installed in \`$libdir'"
+	      finalize=no
+	    fi
+	  done
+
+	  relink_command=
+	  func_source "$wrapper"
+
+	  outputname=
+	  if test "$fast_install" = no && test -n "$relink_command"; then
+	    $opt_dry_run || {
+	      if test "$finalize" = yes; then
+	        tmpdir=`func_mktempdir`
+		func_basename "$file$stripped_ext"
+		file="$func_basename_result"
+	        outputname="$tmpdir/$file"
+	        # Replace the output file specification.
+	        relink_command=`$ECHO "$relink_command" | $SED 's%@OUTPUT@%'"$outputname"'%g'`
+
+	        $opt_silent || {
+	          func_quote_for_expand "$relink_command"
+		  eval "func_echo $func_quote_for_expand_result"
+	        }
+	        if eval "$relink_command"; then :
+	          else
+		  func_error "error: relink \`$file' with the above command before installing it"
+		  $opt_dry_run || ${RM}r "$tmpdir"
+		  continue
+	        fi
+	        file="$outputname"
+	      else
+	        func_warning "cannot relink \`$file'"
+	      fi
+	    }
+	  else
+	    # Install the binary that we compiled earlier.
+	    file=`$ECHO "$file$stripped_ext" | $SED "s%\([^/]*\)$%$objdir/\1%"`
+	  fi
+	fi
+
+	# remove .exe since cygwin /usr/bin/install will append another
+	# one anyway
+	case $install_prog,$host in
+	*/usr/bin/install*,*cygwin*)
+	  case $file:$destfile in
+	  *.exe:*.exe)
+	    # this is ok
+	    ;;
+	  *.exe:*)
+	    destfile=$destfile.exe
+	    ;;
+	  *:*.exe)
+	    func_stripname '' '.exe' "$destfile"
+	    destfile=$func_stripname_result
+	    ;;
+	  esac
+	  ;;
+	esac
+	func_show_eval "$install_prog\$stripme \$file \$destfile" 'exit $?'
+	$opt_dry_run || if test -n "$outputname"; then
+	  ${RM}r "$tmpdir"
+	fi
+	;;
+      esac
+    done
+
+    for file in $staticlibs; do
+      func_basename "$file"
+      name="$func_basename_result"
+
+      # Set up the ranlib parameters.
+      oldlib="$destdir/$name"
+      func_to_tool_file "$oldlib" func_convert_file_msys_to_w32
+      tool_oldlib=$func_to_tool_file_result
+
+      func_show_eval "$install_prog \$file \$oldlib" 'exit $?'
+
+      if test -n "$stripme" && test -n "$old_striplib"; then
+	func_show_eval "$old_striplib $tool_oldlib" 'exit $?'
+      fi
+
+      # Do each command in the postinstall commands.
+      func_execute_cmds "$old_postinstall_cmds" 'exit $?'
+    done
+
+    test -n "$future_libdirs" && \
+      func_warning "remember to run \`$progname --finish$future_libdirs'"
+
+    if test -n "$current_libdirs"; then
+      # Maybe just do a dry run.
+      $opt_dry_run && current_libdirs=" -n$current_libdirs"
+      exec_cmd='$SHELL $progpath $preserve_args --finish$current_libdirs'
+    else
+      exit $EXIT_SUCCESS
+    fi
+}
+
+test "$opt_mode" = install && func_mode_install ${1+"$@"}
+
+
+# func_generate_dlsyms outputname originator pic_p
+# Extract symbols from dlprefiles and create ${outputname}S.o with
+# a dlpreopen symbol table.
+func_generate_dlsyms ()
+{
+    $opt_debug
+    my_outputname="$1"
+    my_originator="$2"
+    my_pic_p="${3-no}"
+    my_prefix=`$ECHO "$my_originator" | sed 's%[^a-zA-Z0-9]%_%g'`
+    my_dlsyms=
+
+    if test -n "$dlfiles$dlprefiles" || test "$dlself" != no; then
+      if test -n "$NM" && test -n "$global_symbol_pipe"; then
+	my_dlsyms="${my_outputname}S.c"
+      else
+	func_error "not configured to extract global symbols from dlpreopened files"
+      fi
+    fi
+
+    if test -n "$my_dlsyms"; then
+      case $my_dlsyms in
+      "") ;;
+      *.c)
+	# Discover the nlist of each of the dlfiles.
+	nlist="$output_objdir/${my_outputname}.nm"
+
+	func_show_eval "$RM $nlist ${nlist}S ${nlist}T"
+
+	# Parse the name list into a source file.
+	func_verbose "creating $output_objdir/$my_dlsyms"
+
+	$opt_dry_run || $ECHO > "$output_objdir/$my_dlsyms" "\
+/* $my_dlsyms - symbol resolution table for \`$my_outputname' dlsym emulation. */
+/* Generated by $PROGRAM (GNU $PACKAGE$TIMESTAMP) $VERSION */
+
+#ifdef __cplusplus
+extern \"C\" {
+#endif
+
+#if defined(__GNUC__) && (((__GNUC__ == 4) && (__GNUC_MINOR__ >= 4)) || (__GNUC__ > 4))
+#pragma GCC diagnostic ignored \"-Wstrict-prototypes\"
+#endif
+
+/* Keep this code in sync between libtool.m4, ltmain, lt_system.h, and tests.  */
+#if defined(_WIN32) || defined(__CYGWIN__) || defined(_WIN32_WCE)
+/* DATA imports from DLLs on WIN32 con't be const, because runtime
+   relocations are performed -- see ld's documentation on pseudo-relocs.  */
+# define LT_DLSYM_CONST
+#elif defined(__osf__)
+/* This system does not cope well with relocations in const data.  */
+# define LT_DLSYM_CONST
+#else
+# define LT_DLSYM_CONST const
+#endif
+
+/* External symbol declarations for the compiler. */\
+"
+
+	if test "$dlself" = yes; then
+	  func_verbose "generating symbol list for \`$output'"
+
+	  $opt_dry_run || echo ': @PROGRAM@ ' > "$nlist"
+
+	  # Add our own program objects to the symbol list.
+	  progfiles=`$ECHO "$objs$old_deplibs" | $SP2NL | $SED "$lo2o" | $NL2SP`
+	  for progfile in $progfiles; do
+	    func_to_tool_file "$progfile" func_convert_file_msys_to_w32
+	    func_verbose "extracting global C symbols from \`$func_to_tool_file_result'"
+	    $opt_dry_run || eval "$NM $func_to_tool_file_result | $global_symbol_pipe >> '$nlist'"
+	  done
+
+	  if test -n "$exclude_expsyms"; then
+	    $opt_dry_run || {
+	      eval '$EGREP -v " ($exclude_expsyms)$" "$nlist" > "$nlist"T'
+	      eval '$MV "$nlist"T "$nlist"'
+	    }
+	  fi
+
+	  if test -n "$export_symbols_regex"; then
+	    $opt_dry_run || {
+	      eval '$EGREP -e "$export_symbols_regex" "$nlist" > "$nlist"T'
+	      eval '$MV "$nlist"T "$nlist"'
+	    }
+	  fi
+
+	  # Prepare the list of exported symbols
+	  if test -z "$export_symbols"; then
+	    export_symbols="$output_objdir/$outputname.exp"
+	    $opt_dry_run || {
+	      $RM $export_symbols
+	      eval "${SED} -n -e '/^: @PROGRAM@ $/d' -e 's/^.* \(.*\)$/\1/p' "'< "$nlist" > "$export_symbols"'
+	      case $host in
+	      *cygwin* | *mingw* | *cegcc* )
+                eval "echo EXPORTS "'> "$output_objdir/$outputname.def"'
+                eval 'cat "$export_symbols" >> "$output_objdir/$outputname.def"'
+	        ;;
+	      esac
+	    }
+	  else
+	    $opt_dry_run || {
+	      eval "${SED} -e 's/\([].[*^$]\)/\\\\\1/g' -e 's/^/ /' -e 's/$/$/'"' < "$export_symbols" > "$output_objdir/$outputname.exp"'
+	      eval '$GREP -f "$output_objdir/$outputname.exp" < "$nlist" > "$nlist"T'
+	      eval '$MV "$nlist"T "$nlist"'
+	      case $host in
+	        *cygwin* | *mingw* | *cegcc* )
+	          eval "echo EXPORTS "'> "$output_objdir/$outputname.def"'
+	          eval 'cat "$nlist" >> "$output_objdir/$outputname.def"'
+	          ;;
+	      esac
+	    }
+	  fi
+	fi
+
+	for dlprefile in $dlprefiles; do
+	  func_verbose "extracting global C symbols from \`$dlprefile'"
+	  func_basename "$dlprefile"
+	  name="$func_basename_result"
+          case $host in
+	    *cygwin* | *mingw* | *cegcc* )
+	      # if an import library, we need to obtain dlname
+	      if func_win32_import_lib_p "$dlprefile"; then
+	        func_tr_sh "$dlprefile"
+	        eval "curr_lafile=\$libfile_$func_tr_sh_result"
+	        dlprefile_dlbasename=""
+	        if test -n "$curr_lafile" && func_lalib_p "$curr_lafile"; then
+	          # Use subshell, to avoid clobbering current variable values
+	          dlprefile_dlname=`source "$curr_lafile" && echo "$dlname"`
+	          if test -n "$dlprefile_dlname" ; then
+	            func_basename "$dlprefile_dlname"
+	            dlprefile_dlbasename="$func_basename_result"
+	          else
+	            # no lafile. user explicitly requested -dlpreopen <import library>.
+	            $sharedlib_from_linklib_cmd "$dlprefile"
+	            dlprefile_dlbasename=$sharedlib_from_linklib_result
+	          fi
+	        fi
+	        $opt_dry_run || {
+	          if test -n "$dlprefile_dlbasename" ; then
+	            eval '$ECHO ": $dlprefile_dlbasename" >> "$nlist"'
+	          else
+	            func_warning "Could not compute DLL name from $name"
+	            eval '$ECHO ": $name " >> "$nlist"'
+	          fi
+	          func_to_tool_file "$dlprefile" func_convert_file_msys_to_w32
+	          eval "$NM \"$func_to_tool_file_result\" 2>/dev/null | $global_symbol_pipe |
+	            $SED -e '/I __imp/d' -e 's/I __nm_/D /;s/_nm__//' >> '$nlist'"
+	        }
+	      else # not an import lib
+	        $opt_dry_run || {
+	          eval '$ECHO ": $name " >> "$nlist"'
+	          func_to_tool_file "$dlprefile" func_convert_file_msys_to_w32
+	          eval "$NM \"$func_to_tool_file_result\" 2>/dev/null | $global_symbol_pipe >> '$nlist'"
+	        }
+	      fi
+	    ;;
+	    *)
+	      $opt_dry_run || {
+	        eval '$ECHO ": $name " >> "$nlist"'
+	        func_to_tool_file "$dlprefile" func_convert_file_msys_to_w32
+	        eval "$NM \"$func_to_tool_file_result\" 2>/dev/null | $global_symbol_pipe >> '$nlist'"
+	      }
+	    ;;
+          esac
+	done
+
+	$opt_dry_run || {
+	  # Make sure we have at least an empty file.
+	  test -f "$nlist" || : > "$nlist"
+
+	  if test -n "$exclude_expsyms"; then
+	    $EGREP -v " ($exclude_expsyms)$" "$nlist" > "$nlist"T
+	    $MV "$nlist"T "$nlist"
+	  fi
+
+	  # Try sorting and uniquifying the output.
+	  if $GREP -v "^: " < "$nlist" |
+	      if sort -k 3 </dev/null >/dev/null 2>&1; then
+		sort -k 3
+	      else
+		sort +2
+	      fi |
+	      uniq > "$nlist"S; then
+	    :
+	  else
+	    $GREP -v "^: " < "$nlist" > "$nlist"S
+	  fi
+
+	  if test -f "$nlist"S; then
+	    eval "$global_symbol_to_cdecl"' < "$nlist"S >> "$output_objdir/$my_dlsyms"'
+	  else
+	    echo '/* NONE */' >> "$output_objdir/$my_dlsyms"
+	  fi
+
+	  echo >> "$output_objdir/$my_dlsyms" "\
+
+/* The mapping between symbol names and symbols.  */
+typedef struct {
+  const char *name;
+  void *address;
+} lt_dlsymlist;
+extern LT_DLSYM_CONST lt_dlsymlist
+lt_${my_prefix}_LTX_preloaded_symbols[];
+LT_DLSYM_CONST lt_dlsymlist
+lt_${my_prefix}_LTX_preloaded_symbols[] =
+{\
+  { \"$my_originator\", (void *) 0 },"
+
+	  case $need_lib_prefix in
+	  no)
+	    eval "$global_symbol_to_c_name_address" < "$nlist" >> "$output_objdir/$my_dlsyms"
+	    ;;
+	  *)
+	    eval "$global_symbol_to_c_name_address_lib_prefix" < "$nlist" >> "$output_objdir/$my_dlsyms"
+	    ;;
+	  esac
+	  echo >> "$output_objdir/$my_dlsyms" "\
+  {0, (void *) 0}
+};
+
+/* This works around a problem in FreeBSD linker */
+#ifdef FREEBSD_WORKAROUND
+static const void *lt_preloaded_setup() {
+  return lt_${my_prefix}_LTX_preloaded_symbols;
+}
+#endif
+
+#ifdef __cplusplus
+}
+#endif\
+"
+	} # !$opt_dry_run
+
+	pic_flag_for_symtable=
+	case "$compile_command " in
+	*" -static "*) ;;
+	*)
+	  case $host in
+	  # compiling the symbol table file with pic_flag works around
+	  # a FreeBSD bug that causes programs to crash when -lm is
+	  # linked before any other PIC object.  But we must not use
+	  # pic_flag when linking with -static.  The problem exists in
+	  # FreeBSD 2.2.6 and is fixed in FreeBSD 3.1.
+	  *-*-freebsd2.*|*-*-freebsd3.0*|*-*-freebsdelf3.0*)
+	    pic_flag_for_symtable=" $pic_flag -DFREEBSD_WORKAROUND" ;;
+	  *-*-hpux*)
+	    pic_flag_for_symtable=" $pic_flag"  ;;
+	  *)
+	    if test "X$my_pic_p" != Xno; then
+	      pic_flag_for_symtable=" $pic_flag"
+	    fi
+	    ;;
+	  esac
+	  ;;
+	esac
+	symtab_cflags=
+	for arg in $LTCFLAGS; do
+	  case $arg in
+	  -pie | -fpie | -fPIE) ;;
+	  *) func_append symtab_cflags " $arg" ;;
+	  esac
+	done
+
+	# Now compile the dynamic symbol file.
+	func_show_eval '(cd $output_objdir && $LTCC$symtab_cflags -c$no_builtin_flag$pic_flag_for_symtable "$my_dlsyms")' 'exit $?'
+
+	# Clean up the generated files.
+	func_show_eval '$RM "$output_objdir/$my_dlsyms" "$nlist" "${nlist}S" "${nlist}T"'
+
+	# Transform the symbol file into the correct name.
+	symfileobj="$output_objdir/${my_outputname}S.$objext"
+	case $host in
+	*cygwin* | *mingw* | *cegcc* )
+	  if test -f "$output_objdir/$my_outputname.def"; then
+	    compile_command=`$ECHO "$compile_command" | $SED "s%@SYMFILE@%$output_objdir/$my_outputname.def $symfileobj%"`
+	    finalize_command=`$ECHO "$finalize_command" | $SED "s%@SYMFILE@%$output_objdir/$my_outputname.def $symfileobj%"`
+	  else
+	    compile_command=`$ECHO "$compile_command" | $SED "s%@SYMFILE@%$symfileobj%"`
+	    finalize_command=`$ECHO "$finalize_command" | $SED "s%@SYMFILE@%$symfileobj%"`
+	  fi
+	  ;;
+	*)
+	  compile_command=`$ECHO "$compile_command" | $SED "s%@SYMFILE@%$symfileobj%"`
+	  finalize_command=`$ECHO "$finalize_command" | $SED "s%@SYMFILE@%$symfileobj%"`
+	  ;;
+	esac
+	;;
+      *)
+	func_fatal_error "unknown suffix for \`$my_dlsyms'"
+	;;
+      esac
+    else
+      # We keep going just in case the user didn't refer to
+      # lt_preloaded_symbols.  The linker will fail if global_symbol_pipe
+      # really was required.
+
+      # Nullify the symbol file.
+      compile_command=`$ECHO "$compile_command" | $SED "s% @SYMFILE@%%"`
+      finalize_command=`$ECHO "$finalize_command" | $SED "s% @SYMFILE@%%"`
+    fi
+}
+
+# func_win32_libid arg
+# return the library type of file 'arg'
+#
+# Need a lot of goo to handle *both* DLLs and import libs
+# Has to be a shell function in order to 'eat' the argument
+# that is supplied when $file_magic_command is called.
+# Despite the name, also deal with 64 bit binaries.
+func_win32_libid ()
+{
+  $opt_debug
+  win32_libid_type="unknown"
+  win32_fileres=`file -L $1 2>/dev/null`
+  case $win32_fileres in
+  *ar\ archive\ import\ library*) # definitely import
+    win32_libid_type="x86 archive import"
+    ;;
+  *ar\ archive*) # could be an import, or static
+    # Keep the egrep pattern in sync with the one in _LT_CHECK_MAGIC_METHOD.
+    if eval $OBJDUMP -f $1 | $SED -e '10q' 2>/dev/null |
+       $EGREP 'file format (pei*-i386(.*architecture: i386)?|pe-arm-wince|pe-x86-64)' >/dev/null; then
+      func_to_tool_file "$1" func_convert_file_msys_to_w32
+      win32_nmres=`eval $NM -f posix -A \"$func_to_tool_file_result\" |
+	$SED -n -e '
+	    1,100{
+		/ I /{
+		    s,.*,import,
+		    p
+		    q
+		}
+	    }'`
+      case $win32_nmres in
+      import*)  win32_libid_type="x86 archive import";;
+      *)        win32_libid_type="x86 archive static";;
+      esac
+    fi
+    ;;
+  *DLL*)
+    win32_libid_type="x86 DLL"
+    ;;
+  *executable*) # but shell scripts are "executable" too...
+    case $win32_fileres in
+    *MS\ Windows\ PE\ Intel*)
+      win32_libid_type="x86 DLL"
+      ;;
+    esac
+    ;;
+  esac
+  $ECHO "$win32_libid_type"
+}
+
+# func_cygming_dll_for_implib ARG
+#
+# Platform-specific function to extract the
+# name of the DLL associated with the specified
+# import library ARG.
+# Invoked by eval'ing the libtool variable
+#    $sharedlib_from_linklib_cmd
+# Result is available in the variable
+#    $sharedlib_from_linklib_result
+func_cygming_dll_for_implib ()
+{
+  $opt_debug
+  sharedlib_from_linklib_result=`$DLLTOOL --identify-strict --identify "$1"`
+}
+
+# func_cygming_dll_for_implib_fallback_core SECTION_NAME LIBNAMEs
+#
+# The is the core of a fallback implementation of a
+# platform-specific function to extract the name of the
+# DLL associated with the specified import library LIBNAME.
+#
+# SECTION_NAME is either .idata$6 or .idata$7, depending
+# on the platform and compiler that created the implib.
+#
+# Echos the name of the DLL associated with the
+# specified import library.
+func_cygming_dll_for_implib_fallback_core ()
+{
+  $opt_debug
+  match_literal=`$ECHO "$1" | $SED "$sed_make_literal_regex"`
+  $OBJDUMP -s --section "$1" "$2" 2>/dev/null |
+    $SED '/^Contents of section '"$match_literal"':/{
+      # Place marker at beginning of archive member dllname section
+      s/.*/====MARK====/
+      p
+      d
+    }
+    # These lines can sometimes be longer than 43 characters, but
+    # are always uninteresting
+    /:[	 ]*file format pe[i]\{,1\}-/d
+    /^In archive [^:]*:/d
+    # Ensure marker is printed
+    /^====MARK====/p
+    # Remove all lines with less than 43 characters
+    /^.\{43\}/!d
+    # From remaining lines, remove first 43 characters
+    s/^.\{43\}//' |
+    $SED -n '
+      # Join marker and all lines until next marker into a single line
+      /^====MARK====/ b para
+      H
+      $ b para
+      b
+      :para
+      x
+      s/\n//g
+      # Remove the marker
+      s/^====MARK====//
+      # Remove trailing dots and whitespace
+      s/[\. \t]*$//
+      # Print
+      /./p' |
+    # we now have a list, one entry per line, of the stringified
+    # contents of the appropriate section of all members of the
+    # archive which possess that section. Heuristic: eliminate
+    # all those which have a first or second character that is
+    # a '.' (that is, objdump's representation of an unprintable
+    # character.) This should work for all archives with less than
+    # 0x302f exports -- but will fail for DLLs whose name actually
+    # begins with a literal '.' or a single character followed by
+    # a '.'.
+    #
+    # Of those that remain, print the first one.
+    $SED -e '/^\./d;/^.\./d;q'
+}
+
+# func_cygming_gnu_implib_p ARG
+# This predicate returns with zero status (TRUE) if
+# ARG is a GNU/binutils-style import library. Returns
+# with nonzero status (FALSE) otherwise.
+func_cygming_gnu_implib_p ()
+{
+  $opt_debug
+  func_to_tool_file "$1" func_convert_file_msys_to_w32
+  func_cygming_gnu_implib_tmp=`$NM "$func_to_tool_file_result" | eval "$global_symbol_pipe" | $EGREP ' (_head_[A-Za-z0-9_]+_[ad]l*|[A-Za-z0-9_]+_[ad]l*_iname)$'`
+  test -n "$func_cygming_gnu_implib_tmp"
+}
+
+# func_cygming_ms_implib_p ARG
+# This predicate returns with zero status (TRUE) if
+# ARG is an MS-style import library. Returns
+# with nonzero status (FALSE) otherwise.
+func_cygming_ms_implib_p ()
+{
+  $opt_debug
+  func_to_tool_file "$1" func_convert_file_msys_to_w32
+  func_cygming_ms_implib_tmp=`$NM "$func_to_tool_file_result" | eval "$global_symbol_pipe" | $GREP '_NULL_IMPORT_DESCRIPTOR'`
+  test -n "$func_cygming_ms_implib_tmp"
+}
+
+# func_cygming_dll_for_implib_fallback ARG
+# Platform-specific function to extract the
+# name of the DLL associated with the specified
+# import library ARG.
+#
+# This fallback implementation is for use when $DLLTOOL
+# does not support the --identify-strict option.
+# Invoked by eval'ing the libtool variable
+#    $sharedlib_from_linklib_cmd
+# Result is available in the variable
+#    $sharedlib_from_linklib_result
+func_cygming_dll_for_implib_fallback ()
+{
+  $opt_debug
+  if func_cygming_gnu_implib_p "$1" ; then
+    # binutils import library
+    sharedlib_from_linklib_result=`func_cygming_dll_for_implib_fallback_core '.idata$7' "$1"`
+  elif func_cygming_ms_implib_p "$1" ; then
+    # ms-generated import library
+    sharedlib_from_linklib_result=`func_cygming_dll_for_implib_fallback_core '.idata$6' "$1"`
+  else
+    # unknown
+    sharedlib_from_linklib_result=""
+  fi
+}
+
+
+# func_extract_an_archive dir oldlib
+func_extract_an_archive ()
+{
+    $opt_debug
+    f_ex_an_ar_dir="$1"; shift
+    f_ex_an_ar_oldlib="$1"
+    if test "$lock_old_archive_extraction" = yes; then
+      lockfile=$f_ex_an_ar_oldlib.lock
+      until $opt_dry_run || ln "$progpath" "$lockfile" 2>/dev/null; do
+	func_echo "Waiting for $lockfile to be removed"
+	sleep 2
+      done
+    fi
+    func_show_eval "(cd \$f_ex_an_ar_dir && $AR x \"\$f_ex_an_ar_oldlib\")" \
+		   'stat=$?; rm -f "$lockfile"; exit $stat'
+    if test "$lock_old_archive_extraction" = yes; then
+      $opt_dry_run || rm -f "$lockfile"
+    fi
+    if ($AR t "$f_ex_an_ar_oldlib" | sort | sort -uc >/dev/null 2>&1); then
+     :
+    else
+      func_fatal_error "object name conflicts in archive: $f_ex_an_ar_dir/$f_ex_an_ar_oldlib"
+    fi
+}
+
+
+# func_extract_archives gentop oldlib ...
+func_extract_archives ()
+{
+    $opt_debug
+    my_gentop="$1"; shift
+    my_oldlibs=${1+"$@"}
+    my_oldobjs=""
+    my_xlib=""
+    my_xabs=""
+    my_xdir=""
+
+    for my_xlib in $my_oldlibs; do
+      # Extract the objects.
+      case $my_xlib in
+	[\\/]* | [A-Za-z]:[\\/]*) my_xabs="$my_xlib" ;;
+	*) my_xabs=`pwd`"/$my_xlib" ;;
+      esac
+      func_basename "$my_xlib"
+      my_xlib="$func_basename_result"
+      my_xlib_u=$my_xlib
+      while :; do
+        case " $extracted_archives " in
+	*" $my_xlib_u "*)
+	  func_arith $extracted_serial + 1
+	  extracted_serial=$func_arith_result
+	  my_xlib_u=lt$extracted_serial-$my_xlib ;;
+	*) break ;;
+	esac
+      done
+      extracted_archives="$extracted_archives $my_xlib_u"
+      my_xdir="$my_gentop/$my_xlib_u"
+
+      func_mkdir_p "$my_xdir"
+
+      case $host in
+      *-darwin*)
+	func_verbose "Extracting $my_xabs"
+	# Do not bother doing anything if just a dry run
+	$opt_dry_run || {
+	  darwin_orig_dir=`pwd`
+	  cd $my_xdir || exit $?
+	  darwin_archive=$my_xabs
+	  darwin_curdir=`pwd`
+	  darwin_base_archive=`basename "$darwin_archive"`
+	  darwin_arches=`$LIPO -info "$darwin_archive" 2>/dev/null | $GREP Architectures 2>/dev/null || true`
+	  if test -n "$darwin_arches"; then
+	    darwin_arches=`$ECHO "$darwin_arches" | $SED -e 's/.*are://'`
+	    darwin_arch=
+	    func_verbose "$darwin_base_archive has multiple architectures $darwin_arches"
+	    for darwin_arch in  $darwin_arches ; do
+	      func_mkdir_p "unfat-$$/${darwin_base_archive}-${darwin_arch}"
+	      $LIPO -thin $darwin_arch -output "unfat-$$/${darwin_base_archive}-${darwin_arch}/${darwin_base_archive}" "${darwin_archive}"
+	      cd "unfat-$$/${darwin_base_archive}-${darwin_arch}"
+	      func_extract_an_archive "`pwd`" "${darwin_base_archive}"
+	      cd "$darwin_curdir"
+	      $RM "unfat-$$/${darwin_base_archive}-${darwin_arch}/${darwin_base_archive}"
+	    done # $darwin_arches
+            ## Okay now we've a bunch of thin objects, gotta fatten them up :)
+	    darwin_filelist=`find unfat-$$ -type f -name \*.o -print -o -name \*.lo -print | $SED -e "$basename" | sort -u`
+	    darwin_file=
+	    darwin_files=
+	    for darwin_file in $darwin_filelist; do
+	      darwin_files=`find unfat-$$ -name $darwin_file -print | sort | $NL2SP`
+	      $LIPO -create -output "$darwin_file" $darwin_files
+	    done # $darwin_filelist
+	    $RM -rf unfat-$$
+	    cd "$darwin_orig_dir"
+	  else
+	    cd $darwin_orig_dir
+	    func_extract_an_archive "$my_xdir" "$my_xabs"
+	  fi # $darwin_arches
+	} # !$opt_dry_run
+	;;
+      *)
+        func_extract_an_archive "$my_xdir" "$my_xabs"
+	;;
+      esac
+      my_oldobjs="$my_oldobjs "`find $my_xdir -name \*.$objext -print -o -name \*.lo -print | sort | $NL2SP`
+    done
+
+    func_extract_archives_result="$my_oldobjs"
+}
+
+
+# func_emit_wrapper [arg=no]
+#
+# Emit a libtool wrapper script on stdout.
+# Don't directly open a file because we may want to
+# incorporate the script contents within a cygwin/mingw
+# wrapper executable.  Must ONLY be called from within
+# func_mode_link because it depends on a number of variables
+# set therein.
+#
+# ARG is the value that the WRAPPER_SCRIPT_BELONGS_IN_OBJDIR
+# variable will take.  If 'yes', then the emitted script
+# will assume that the directory in which it is stored is
+# the $objdir directory.  This is a cygwin/mingw-specific
+# behavior.
+func_emit_wrapper ()
+{
+	func_emit_wrapper_arg1=${1-no}
+
+	$ECHO "\
+#! $SHELL
+
+# $output - temporary wrapper script for $objdir/$outputname
+# Generated by $PROGRAM (GNU $PACKAGE$TIMESTAMP) $VERSION
+#
+# The $output program cannot be directly executed until all the libtool
+# libraries that it depends on are installed.
+#
+# This wrapper script should never be moved out of the build directory.
+# If it is, it will not operate correctly.
+
+# Sed substitution that helps us do robust quoting.  It backslashifies
+# metacharacters that are still active within double-quoted strings.
+sed_quote_subst='$sed_quote_subst'
+
+# Be Bourne compatible
+if test -n \"\${ZSH_VERSION+set}\" && (emulate sh) >/dev/null 2>&1; then
+  emulate sh
+  NULLCMD=:
+  # Zsh 3.x and 4.x performs word splitting on \${1+\"\$@\"}, which
+  # is contrary to our usage.  Disable this feature.
+  alias -g '\${1+\"\$@\"}'='\"\$@\"'
+  setopt NO_GLOB_SUBST
+else
+  case \`(set -o) 2>/dev/null\` in *posix*) set -o posix;; esac
+fi
+BIN_SH=xpg4; export BIN_SH # for Tru64
+DUALCASE=1; export DUALCASE # for MKS sh
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+relink_command=\"$relink_command\"
+
+# This environment variable determines our operation mode.
+if test \"\$libtool_install_magic\" = \"$magic\"; then
+  # install mode needs the following variables:
+  generated_by_libtool_version='$macro_version'
+  notinst_deplibs='$notinst_deplibs'
+else
+  # When we are sourced in execute mode, \$file and \$ECHO are already set.
+  if test \"\$libtool_execute_magic\" != \"$magic\"; then
+    file=\"\$0\""
+
+    qECHO=`$ECHO "$ECHO" | $SED "$sed_quote_subst"`
+    $ECHO "\
+
+# A function that is used when there is no print builtin or printf.
+func_fallback_echo ()
+{
+  eval 'cat <<_LTECHO_EOF
+\$1
+_LTECHO_EOF'
+}
+    ECHO=\"$qECHO\"
+  fi
+
+# Very basic option parsing. These options are (a) specific to
+# the libtool wrapper, (b) are identical between the wrapper
+# /script/ and the wrapper /executable/ which is used only on
+# windows platforms, and (c) all begin with the string "--lt-"
+# (application programs are unlikely to have options which match
+# this pattern).
+#
+# There are only two supported options: --lt-debug and
+# --lt-dump-script. There is, deliberately, no --lt-help.
+#
+# The first argument to this parsing function should be the
+# script's $0 value, followed by "$@".
+lt_option_debug=
+func_parse_lt_options ()
+{
+  lt_script_arg0=\$0
+  shift
+  for lt_opt
+  do
+    case \"\$lt_opt\" in
+    --lt-debug) lt_option_debug=1 ;;
+    --lt-dump-script)
+        lt_dump_D=\`\$ECHO \"X\$lt_script_arg0\" | $SED -e 's/^X//' -e 's%/[^/]*$%%'\`
+        test \"X\$lt_dump_D\" = \"X\$lt_script_arg0\" && lt_dump_D=.
+        lt_dump_F=\`\$ECHO \"X\$lt_script_arg0\" | $SED -e 's/^X//' -e 's%^.*/%%'\`
+        cat \"\$lt_dump_D/\$lt_dump_F\"
+        exit 0
+      ;;
+    --lt-*)
+        \$ECHO \"Unrecognized --lt- option: '\$lt_opt'\" 1>&2
+        exit 1
+      ;;
+    esac
+  done
+
+  # Print the debug banner immediately:
+  if test -n \"\$lt_option_debug\"; then
+    echo \"${outputname}:${output}:\${LINENO}: libtool wrapper (GNU $PACKAGE$TIMESTAMP) $VERSION\" 1>&2
+  fi
+}
+
+# Used when --lt-debug. Prints its arguments to stdout
+# (redirection is the responsibility of the caller)
+func_lt_dump_args ()
+{
+  lt_dump_args_N=1;
+  for lt_arg
+  do
+    \$ECHO \"${outputname}:${output}:\${LINENO}: newargv[\$lt_dump_args_N]: \$lt_arg\"
+    lt_dump_args_N=\`expr \$lt_dump_args_N + 1\`
+  done
+}
+
+# Core function for launching the target application
+func_exec_program_core ()
+{
+"
+  case $host in
+  # Backslashes separate directories on plain windows
+  *-*-mingw | *-*-os2* | *-cegcc*)
+    $ECHO "\
+      if test -n \"\$lt_option_debug\"; then
+        \$ECHO \"${outputname}:${output}:\${LINENO}: newargv[0]: \$progdir\\\\\$program\" 1>&2
+        func_lt_dump_args \${1+\"\$@\"} 1>&2
+      fi
+      exec \"\$progdir\\\\\$program\" \${1+\"\$@\"}
+"
+    ;;
+
+  *)
+    $ECHO "\
+      if test -n \"\$lt_option_debug\"; then
+        \$ECHO \"${outputname}:${output}:\${LINENO}: newargv[0]: \$progdir/\$program\" 1>&2
+        func_lt_dump_args \${1+\"\$@\"} 1>&2
+      fi
+      exec \"\$progdir/\$program\" \${1+\"\$@\"}
+"
+    ;;
+  esac
+  $ECHO "\
+      \$ECHO \"\$0: cannot exec \$program \$*\" 1>&2
+      exit 1
+}
+
+# A function to encapsulate launching the target application
+# Strips options in the --lt-* namespace from \$@ and
+# launches target application with the remaining arguments.
+func_exec_program ()
+{
+  case \" \$* \" in
+  *\\ --lt-*)
+    for lt_wr_arg
+    do
+      case \$lt_wr_arg in
+      --lt-*) ;;
+      *) set x \"\$@\" \"\$lt_wr_arg\"; shift;;
+      esac
+      shift
+    done ;;
+  esac
+  func_exec_program_core \${1+\"\$@\"}
+}
+
+  # Parse options
+  func_parse_lt_options \"\$0\" \${1+\"\$@\"}
+
+  # Find the directory that this script lives in.
+  thisdir=\`\$ECHO \"\$file\" | $SED 's%/[^/]*$%%'\`
+  test \"x\$thisdir\" = \"x\$file\" && thisdir=.
+
+  # Follow symbolic links until we get to the real thisdir.
+  file=\`ls -ld \"\$file\" | $SED -n 's/.*-> //p'\`
+  while test -n \"\$file\"; do
+    destdir=\`\$ECHO \"\$file\" | $SED 's%/[^/]*\$%%'\`
+
+    # If there was a directory component, then change thisdir.
+    if test \"x\$destdir\" != \"x\$file\"; then
+      case \"\$destdir\" in
+      [\\\\/]* | [A-Za-z]:[\\\\/]*) thisdir=\"\$destdir\" ;;
+      *) thisdir=\"\$thisdir/\$destdir\" ;;
+      esac
+    fi
+
+    file=\`\$ECHO \"\$file\" | $SED 's%^.*/%%'\`
+    file=\`ls -ld \"\$thisdir/\$file\" | $SED -n 's/.*-> //p'\`
+  done
+
+  # Usually 'no', except on cygwin/mingw when embedded into
+  # the cwrapper.
+  WRAPPER_SCRIPT_BELONGS_IN_OBJDIR=$func_emit_wrapper_arg1
+  if test \"\$WRAPPER_SCRIPT_BELONGS_IN_OBJDIR\" = \"yes\"; then
+    # special case for '.'
+    if test \"\$thisdir\" = \".\"; then
+      thisdir=\`pwd\`
+    fi
+    # remove .libs from thisdir
+    case \"\$thisdir\" in
+    *[\\\\/]$objdir ) thisdir=\`\$ECHO \"\$thisdir\" | $SED 's%[\\\\/][^\\\\/]*$%%'\` ;;
+    $objdir )   thisdir=. ;;
+    esac
+  fi
+
+  # Try to get the absolute directory name.
+  absdir=\`cd \"\$thisdir\" && pwd\`
+  test -n \"\$absdir\" && thisdir=\"\$absdir\"
+"
+
+	if test "$fast_install" = yes; then
+	  $ECHO "\
+  program=lt-'$outputname'$exeext
+  progdir=\"\$thisdir/$objdir\"
+
+  if test ! -f \"\$progdir/\$program\" ||
+     { file=\`ls -1dt \"\$progdir/\$program\" \"\$progdir/../\$program\" 2>/dev/null | ${SED} 1q\`; \\
+       test \"X\$file\" != \"X\$progdir/\$program\"; }; then
+
+    file=\"\$\$-\$program\"
+
+    if test ! -d \"\$progdir\"; then
+      $MKDIR \"\$progdir\"
+    else
+      $RM \"\$progdir/\$file\"
+    fi"
+
+	  $ECHO "\
+
+    # relink executable if necessary
+    if test -n \"\$relink_command\"; then
+      if relink_command_output=\`eval \$relink_command 2>&1\`; then :
+      else
+	$ECHO \"\$relink_command_output\" >&2
+	$RM \"\$progdir/\$file\"
+	exit 1
+      fi
+    fi
+
+    $MV \"\$progdir/\$file\" \"\$progdir/\$program\" 2>/dev/null ||
+    { $RM \"\$progdir/\$program\";
+      $MV \"\$progdir/\$file\" \"\$progdir/\$program\"; }
+    $RM \"\$progdir/\$file\"
+  fi"
+	else
+	  $ECHO "\
+  program='$outputname'
+  progdir=\"\$thisdir/$objdir\"
+"
+	fi
+
+	$ECHO "\
+
+  if test -f \"\$progdir/\$program\"; then"
+
+	# fixup the dll searchpath if we need to.
+	#
+	# Fix the DLL searchpath if we need to.  Do this before prepending
+	# to shlibpath, because on Windows, both are PATH and uninstalled
+	# libraries must come first.
+	if test -n "$dllsearchpath"; then
+	  $ECHO "\
+    # Add the dll search path components to the executable PATH
+    PATH=$dllsearchpath:\$PATH
+"
+	fi
+
+	# Export our shlibpath_var if we have one.
+	if test "$shlibpath_overrides_runpath" = yes && test -n "$shlibpath_var" && test -n "$temp_rpath"; then
+	  $ECHO "\
+    # Add our own library path to $shlibpath_var
+    $shlibpath_var=\"$temp_rpath\$$shlibpath_var\"
+
+    # Some systems cannot cope with colon-terminated $shlibpath_var
+    # The second colon is a workaround for a bug in BeOS R4 sed
+    $shlibpath_var=\`\$ECHO \"\$$shlibpath_var\" | $SED 's/::*\$//'\`
+
+    export $shlibpath_var
+"
+	fi
+
+	$ECHO "\
+    if test \"\$libtool_execute_magic\" != \"$magic\"; then
+      # Run the actual program with our arguments.
+      func_exec_program \${1+\"\$@\"}
+    fi
+  else
+    # The program doesn't exist.
+    \$ECHO \"\$0: error: \\\`\$progdir/\$program' does not exist\" 1>&2
+    \$ECHO \"This script is just a wrapper for \$program.\" 1>&2
+    \$ECHO \"See the $PACKAGE documentation for more information.\" 1>&2
+    exit 1
+  fi
+fi\
+"
+}
+
+
+# func_emit_cwrapperexe_src
+# emit the source code for a wrapper executable on stdout
+# Must ONLY be called from within func_mode_link because
+# it depends on a number of variable set therein.
+func_emit_cwrapperexe_src ()
+{
+	cat <<EOF
+
+/* $cwrappersource - temporary wrapper executable for $objdir/$outputname
+   Generated by $PROGRAM (GNU $PACKAGE$TIMESTAMP) $VERSION
+
+   The $output program cannot be directly executed until all the libtool
+   libraries that it depends on are installed.
+
+   This wrapper executable should never be moved out of the build directory.
+   If it is, it will not operate correctly.
+*/
+EOF
+	    cat <<"EOF"
+#ifdef _MSC_VER
+# define _CRT_SECURE_NO_DEPRECATE 1
+#endif
+#include <stdio.h>
+#include <stdlib.h>
+#ifdef _MSC_VER
+# include <direct.h>
+# include <process.h>
+# include <io.h>
+#else
+# include <unistd.h>
+# include <stdint.h>
+# ifdef __CYGWIN__
+#  include <io.h>
+# endif
+#endif
+#include <malloc.h>
+#include <stdarg.h>
+#include <assert.h>
+#include <string.h>
+#include <ctype.h>
+#include <errno.h>
+#include <fcntl.h>
+#include <sys/stat.h>
+
+/* declarations of non-ANSI functions */
+#if defined(__MINGW32__)
+# ifdef __STRICT_ANSI__
+int _putenv (const char *);
+# endif
+#elif defined(__CYGWIN__)
+# ifdef __STRICT_ANSI__
+char *realpath (const char *, char *);
+int putenv (char *);
+int setenv (const char *, const char *, int);
+# endif
+/* #elif defined (other platforms) ... */
+#endif
+
+/* portability defines, excluding path handling macros */
+#if defined(_MSC_VER)
+# define setmode _setmode
+# define stat    _stat
+# define chmod   _chmod
+# define getcwd  _getcwd
+# define putenv  _putenv
+# define S_IXUSR _S_IEXEC
+# ifndef _INTPTR_T_DEFINED
+#  define _INTPTR_T_DEFINED
+#  define intptr_t int
+# endif
+#elif defined(__MINGW32__)
+# define setmode _setmode
+# define stat    _stat
+# define chmod   _chmod
+# define getcwd  _getcwd
+# define putenv  _putenv
+#elif defined(__CYGWIN__)
+# define HAVE_SETENV
+# define FOPEN_WB "wb"
+/* #elif defined (other platforms) ... */
+#endif
+
+#if defined(PATH_MAX)
+# define LT_PATHMAX PATH_MAX
+#elif defined(MAXPATHLEN)
+# define LT_PATHMAX MAXPATHLEN
+#else
+# define LT_PATHMAX 1024
+#endif
+
+#ifndef S_IXOTH
+# define S_IXOTH 0
+#endif
+#ifndef S_IXGRP
+# define S_IXGRP 0
+#endif
+
+/* path handling portability macros */
+#ifndef DIR_SEPARATOR
+# define DIR_SEPARATOR '/'
+# define PATH_SEPARATOR ':'
+#endif
+
+#if defined (_WIN32) || defined (__MSDOS__) || defined (__DJGPP__) || \
+  defined (__OS2__)
+# define HAVE_DOS_BASED_FILE_SYSTEM
+# define FOPEN_WB "wb"
+# ifndef DIR_SEPARATOR_2
+#  define DIR_SEPARATOR_2 '\\'
+# endif
+# ifndef PATH_SEPARATOR_2
+#  define PATH_SEPARATOR_2 ';'
+# endif
+#endif
+
+#ifndef DIR_SEPARATOR_2
+# define IS_DIR_SEPARATOR(ch) ((ch) == DIR_SEPARATOR)
+#else /* DIR_SEPARATOR_2 */
+# define IS_DIR_SEPARATOR(ch) \
+	(((ch) == DIR_SEPARATOR) || ((ch) == DIR_SEPARATOR_2))
+#endif /* DIR_SEPARATOR_2 */
+
+#ifndef PATH_SEPARATOR_2
+# define IS_PATH_SEPARATOR(ch) ((ch) == PATH_SEPARATOR)
+#else /* PATH_SEPARATOR_2 */
+# define IS_PATH_SEPARATOR(ch) ((ch) == PATH_SEPARATOR_2)
+#endif /* PATH_SEPARATOR_2 */
+
+#ifndef FOPEN_WB
+# define FOPEN_WB "w"
+#endif
+#ifndef _O_BINARY
+# define _O_BINARY 0
+#endif
+
+#define XMALLOC(type, num)      ((type *) xmalloc ((num) * sizeof(type)))
+#define XFREE(stale) do { \
+  if (stale) { free ((void *) stale); stale = 0; } \
+} while (0)
+
+#if defined(LT_DEBUGWRAPPER)
+static int lt_debug = 1;
+#else
+static int lt_debug = 0;
+#endif
+
+const char *program_name = "libtool-wrapper"; /* in case xstrdup fails */
+
+void *xmalloc (size_t num);
+char *xstrdup (const char *string);
+const char *base_name (const char *name);
+char *find_executable (const char *wrapper);
+char *chase_symlinks (const char *pathspec);
+int make_executable (const char *path);
+int check_executable (const char *path);
+char *strendzap (char *str, const char *pat);
+void lt_debugprintf (const char *file, int line, const char *fmt, ...);
+void lt_fatal (const char *file, int line, const char *message, ...);
+static const char *nonnull (const char *s);
+static const char *nonempty (const char *s);
+void lt_setenv (const char *name, const char *value);
+char *lt_extend_str (const char *orig_value, const char *add, int to_end);
+void lt_update_exe_path (const char *name, const char *value);
+void lt_update_lib_path (const char *name, const char *value);
+char **prepare_spawn (char **argv);
+void lt_dump_script (FILE *f);
+EOF
+
+	    cat <<EOF
+volatile const char * MAGIC_EXE = "$magic_exe";
+const char * LIB_PATH_VARNAME = "$shlibpath_var";
+EOF
+
+	    if test "$shlibpath_overrides_runpath" = yes && test -n "$shlibpath_var" && test -n "$temp_rpath"; then
+              func_to_host_path "$temp_rpath"
+	      cat <<EOF
+const char * LIB_PATH_VALUE   = "$func_to_host_path_result";
+EOF
+	    else
+	      cat <<"EOF"
+const char * LIB_PATH_VALUE   = "";
+EOF
+	    fi
+
+	    if test -n "$dllsearchpath"; then
+              func_to_host_path "$dllsearchpath:"
+	      cat <<EOF
+const char * EXE_PATH_VARNAME = "PATH";
+const char * EXE_PATH_VALUE   = "$func_to_host_path_result";
+EOF
+	    else
+	      cat <<"EOF"
+const char * EXE_PATH_VARNAME = "";
+const char * EXE_PATH_VALUE   = "";
+EOF
+	    fi
+
+	    if test "$fast_install" = yes; then
+	      cat <<EOF
+const char * TARGET_PROGRAM_NAME = "lt-$outputname"; /* hopefully, no .exe */
+EOF
+	    else
+	      cat <<EOF
+const char * TARGET_PROGRAM_NAME = "$outputname"; /* hopefully, no .exe */
+EOF
+	    fi
+
+
+	    cat <<"EOF"
+
+#define LTWRAPPER_OPTION_PREFIX         "--lt-"
+
+static const char *ltwrapper_option_prefix = LTWRAPPER_OPTION_PREFIX;
+static const char *dumpscript_opt       = LTWRAPPER_OPTION_PREFIX "dump-script";
+static const char *debug_opt            = LTWRAPPER_OPTION_PREFIX "debug";
+
+int
+main (int argc, char *argv[])
+{
+  char **newargz;
+  int  newargc;
+  char *tmp_pathspec;
+  char *actual_cwrapper_path;
+  char *actual_cwrapper_name;
+  char *target_name;
+  char *lt_argv_zero;
+  intptr_t rval = 127;
+
+  int i;
+
+  program_name = (char *) xstrdup (base_name (argv[0]));
+  newargz = XMALLOC (char *, argc + 1);
+
+  /* very simple arg parsing; don't want to rely on getopt
+   * also, copy all non cwrapper options to newargz, except
+   * argz[0], which is handled differently
+   */
+  newargc=0;
+  for (i = 1; i < argc; i++)
+    {
+      if (strcmp (argv[i], dumpscript_opt) == 0)
+	{
+EOF
+	    case "$host" in
+	      *mingw* | *cygwin* )
+		# make stdout use "unix" line endings
+		echo "          setmode(1,_O_BINARY);"
+		;;
+	      esac
+
+	    cat <<"EOF"
+	  lt_dump_script (stdout);
+	  return 0;
+	}
+      if (strcmp (argv[i], debug_opt) == 0)
+	{
+          lt_debug = 1;
+          continue;
+	}
+      if (strcmp (argv[i], ltwrapper_option_prefix) == 0)
+        {
+          /* however, if there is an option in the LTWRAPPER_OPTION_PREFIX
+             namespace, but it is not one of the ones we know about and
+             have already dealt with, above (inluding dump-script), then
+             report an error. Otherwise, targets might begin to believe
+             they are allowed to use options in the LTWRAPPER_OPTION_PREFIX
+             namespace. The first time any user complains about this, we'll
+             need to make LTWRAPPER_OPTION_PREFIX a configure-time option
+             or a configure.ac-settable value.
+           */
+          lt_fatal (__FILE__, __LINE__,
+		    "unrecognized %s option: '%s'",
+                    ltwrapper_option_prefix, argv[i]);
+        }
+      /* otherwise ... */
+      newargz[++newargc] = xstrdup (argv[i]);
+    }
+  newargz[++newargc] = NULL;
+
+EOF
+	    cat <<EOF
+  /* The GNU banner must be the first non-error debug message */
+  lt_debugprintf (__FILE__, __LINE__, "libtool wrapper (GNU $PACKAGE$TIMESTAMP) $VERSION\n");
+EOF
+	    cat <<"EOF"
+  lt_debugprintf (__FILE__, __LINE__, "(main) argv[0]: %s\n", argv[0]);
+  lt_debugprintf (__FILE__, __LINE__, "(main) program_name: %s\n", program_name);
+
+  tmp_pathspec = find_executable (argv[0]);
+  if (tmp_pathspec == NULL)
+    lt_fatal (__FILE__, __LINE__, "couldn't find %s", argv[0]);
+  lt_debugprintf (__FILE__, __LINE__,
+                  "(main) found exe (before symlink chase) at: %s\n",
+		  tmp_pathspec);
+
+  actual_cwrapper_path = chase_symlinks (tmp_pathspec);
+  lt_debugprintf (__FILE__, __LINE__,
+                  "(main) found exe (after symlink chase) at: %s\n",
+		  actual_cwrapper_path);
+  XFREE (tmp_pathspec);
+
+  actual_cwrapper_name = xstrdup (base_name (actual_cwrapper_path));
+  strendzap (actual_cwrapper_path, actual_cwrapper_name);
+
+  /* wrapper name transforms */
+  strendzap (actual_cwrapper_name, ".exe");
+  tmp_pathspec = lt_extend_str (actual_cwrapper_name, ".exe", 1);
+  XFREE (actual_cwrapper_name);
+  actual_cwrapper_name = tmp_pathspec;
+  tmp_pathspec = 0;
+
+  /* target_name transforms -- use actual target program name; might have lt- prefix */
+  target_name = xstrdup (base_name (TARGET_PROGRAM_NAME));
+  strendzap (target_name, ".exe");
+  tmp_pathspec = lt_extend_str (target_name, ".exe", 1);
+  XFREE (target_name);
+  target_name = tmp_pathspec;
+  tmp_pathspec = 0;
+
+  lt_debugprintf (__FILE__, __LINE__,
+		  "(main) libtool target name: %s\n",
+		  target_name);
+EOF
+
+	    cat <<EOF
+  newargz[0] =
+    XMALLOC (char, (strlen (actual_cwrapper_path) +
+		    strlen ("$objdir") + 1 + strlen (actual_cwrapper_name) + 1));
+  strcpy (newargz[0], actual_cwrapper_path);
+  strcat (newargz[0], "$objdir");
+  strcat (newargz[0], "/");
+EOF
+
+	    cat <<"EOF"
+  /* stop here, and copy so we don't have to do this twice */
+  tmp_pathspec = xstrdup (newargz[0]);
+
+  /* do NOT want the lt- prefix here, so use actual_cwrapper_name */
+  strcat (newargz[0], actual_cwrapper_name);
+
+  /* DO want the lt- prefix here if it exists, so use target_name */
+  lt_argv_zero = lt_extend_str (tmp_pathspec, target_name, 1);
+  XFREE (tmp_pathspec);
+  tmp_pathspec = NULL;
+EOF
+
+	    case $host_os in
+	      mingw*)
+	    cat <<"EOF"
+  {
+    char* p;
+    while ((p = strchr (newargz[0], '\\')) != NULL)
+      {
+	*p = '/';
+      }
+    while ((p = strchr (lt_argv_zero, '\\')) != NULL)
+      {
+	*p = '/';
+      }
+  }
+EOF
+	    ;;
+	    esac
+
+	    cat <<"EOF"
+  XFREE (target_name);
+  XFREE (actual_cwrapper_path);
+  XFREE (actual_cwrapper_name);
+
+  lt_setenv ("BIN_SH", "xpg4"); /* for Tru64 */
+  lt_setenv ("DUALCASE", "1");  /* for MSK sh */
+  /* Update the DLL searchpath.  EXE_PATH_VALUE ($dllsearchpath) must
+     be prepended before (that is, appear after) LIB_PATH_VALUE ($temp_rpath)
+     because on Windows, both *_VARNAMEs are PATH but uninstalled
+     libraries must come first. */
+  lt_update_exe_path (EXE_PATH_VARNAME, EXE_PATH_VALUE);
+  lt_update_lib_path (LIB_PATH_VARNAME, LIB_PATH_VALUE);
+
+  lt_debugprintf (__FILE__, __LINE__, "(main) lt_argv_zero: %s\n",
+		  nonnull (lt_argv_zero));
+  for (i = 0; i < newargc; i++)
+    {
+      lt_debugprintf (__FILE__, __LINE__, "(main) newargz[%d]: %s\n",
+		      i, nonnull (newargz[i]));
+    }
+
+EOF
+
+	    case $host_os in
+	      mingw*)
+		cat <<"EOF"
+  /* execv doesn't actually work on mingw as expected on unix */
+  newargz = prepare_spawn (newargz);
+  rval = _spawnv (_P_WAIT, lt_argv_zero, (const char * const *) newargz);
+  if (rval == -1)
+    {
+      /* failed to start process */
+      lt_debugprintf (__FILE__, __LINE__,
+		      "(main) failed to launch target \"%s\": %s\n",
+		      lt_argv_zero, nonnull (strerror (errno)));
+      return 127;
+    }
+  return rval;
+EOF
+		;;
+	      *)
+		cat <<"EOF"
+  execv (lt_argv_zero, newargz);
+  return rval; /* =127, but avoids unused variable warning */
+EOF
+		;;
+	    esac
+
+	    cat <<"EOF"
+}
+
+void *
+xmalloc (size_t num)
+{
+  void *p = (void *) malloc (num);
+  if (!p)
+    lt_fatal (__FILE__, __LINE__, "memory exhausted");
+
+  return p;
+}
+
+char *
+xstrdup (const char *string)
+{
+  return string ? strcpy ((char *) xmalloc (strlen (string) + 1),
+			  string) : NULL;
+}
+
+const char *
+base_name (const char *name)
+{
+  const char *base;
+
+#if defined (HAVE_DOS_BASED_FILE_SYSTEM)
+  /* Skip over the disk name in MSDOS pathnames. */
+  if (isalpha ((unsigned char) name[0]) && name[1] == ':')
+    name += 2;
+#endif
+
+  for (base = name; *name; name++)
+    if (IS_DIR_SEPARATOR (*name))
+      base = name + 1;
+  return base;
+}
+
+int
+check_executable (const char *path)
+{
+  struct stat st;
+
+  lt_debugprintf (__FILE__, __LINE__, "(check_executable): %s\n",
+                  nonempty (path));
+  if ((!path) || (!*path))
+    return 0;
+
+  if ((stat (path, &st) >= 0)
+      && (st.st_mode & (S_IXUSR | S_IXGRP | S_IXOTH)))
+    return 1;
+  else
+    return 0;
+}
+
+int
+make_executable (const char *path)
+{
+  int rval = 0;
+  struct stat st;
+
+  lt_debugprintf (__FILE__, __LINE__, "(make_executable): %s\n",
+                  nonempty (path));
+  if ((!path) || (!*path))
+    return 0;
+
+  if (stat (path, &st) >= 0)
+    {
+      rval = chmod (path, st.st_mode | S_IXOTH | S_IXGRP | S_IXUSR);
+    }
+  return rval;
+}
+
+/* Searches for the full path of the wrapper.  Returns
+   newly allocated full path name if found, NULL otherwise
+   Does not chase symlinks, even on platforms that support them.
+*/
+char *
+find_executable (const char *wrapper)
+{
+  int has_slash = 0;
+  const char *p;
+  const char *p_next;
+  /* static buffer for getcwd */
+  char tmp[LT_PATHMAX + 1];
+  int tmp_len;
+  char *concat_name;
+
+  lt_debugprintf (__FILE__, __LINE__, "(find_executable): %s\n",
+                  nonempty (wrapper));
+
+  if ((wrapper == NULL) || (*wrapper == '\0'))
+    return NULL;
+
+  /* Absolute path? */
+#if defined (HAVE_DOS_BASED_FILE_SYSTEM)
+  if (isalpha ((unsigned char) wrapper[0]) && wrapper[1] == ':')
+    {
+      concat_name = xstrdup (wrapper);
+      if (check_executable (concat_name))
+	return concat_name;
+      XFREE (concat_name);
+    }
+  else
+    {
+#endif
+      if (IS_DIR_SEPARATOR (wrapper[0]))
+	{
+	  concat_name = xstrdup (wrapper);
+	  if (check_executable (concat_name))
+	    return concat_name;
+	  XFREE (concat_name);
+	}
+#if defined (HAVE_DOS_BASED_FILE_SYSTEM)
+    }
+#endif
+
+  for (p = wrapper; *p; p++)
+    if (*p == '/')
+      {
+	has_slash = 1;
+	break;
+      }
+  if (!has_slash)
+    {
+      /* no slashes; search PATH */
+      const char *path = getenv ("PATH");
+      if (path != NULL)
+	{
+	  for (p = path; *p; p = p_next)
+	    {
+	      const char *q;
+	      size_t p_len;
+	      for (q = p; *q; q++)
+		if (IS_PATH_SEPARATOR (*q))
+		  break;
+	      p_len = q - p;
+	      p_next = (*q == '\0' ? q : q + 1);
+	      if (p_len == 0)
+		{
+		  /* empty path: current directory */
+		  if (getcwd (tmp, LT_PATHMAX) == NULL)
+		    lt_fatal (__FILE__, __LINE__, "getcwd failed: %s",
+                              nonnull (strerror (errno)));
+		  tmp_len = strlen (tmp);
+		  concat_name =
+		    XMALLOC (char, tmp_len + 1 + strlen (wrapper) + 1);
+		  memcpy (concat_name, tmp, tmp_len);
+		  concat_name[tmp_len] = '/';
+		  strcpy (concat_name + tmp_len + 1, wrapper);
+		}
+	      else
+		{
+		  concat_name =
+		    XMALLOC (char, p_len + 1 + strlen (wrapper) + 1);
+		  memcpy (concat_name, p, p_len);
+		  concat_name[p_len] = '/';
+		  strcpy (concat_name + p_len + 1, wrapper);
+		}
+	      if (check_executable (concat_name))
+		return concat_name;
+	      XFREE (concat_name);
+	    }
+	}
+      /* not found in PATH; assume curdir */
+    }
+  /* Relative path | not found in path: prepend cwd */
+  if (getcwd (tmp, LT_PATHMAX) == NULL)
+    lt_fatal (__FILE__, __LINE__, "getcwd failed: %s",
+              nonnull (strerror (errno)));
+  tmp_len = strlen (tmp);
+  concat_name = XMALLOC (char, tmp_len + 1 + strlen (wrapper) + 1);
+  memcpy (concat_name, tmp, tmp_len);
+  concat_name[tmp_len] = '/';
+  strcpy (concat_name + tmp_len + 1, wrapper);
+
+  if (check_executable (concat_name))
+    return concat_name;
+  XFREE (concat_name);
+  return NULL;
+}
+
+char *
+chase_symlinks (const char *pathspec)
+{
+#ifndef S_ISLNK
+  return xstrdup (pathspec);
+#else
+  char buf[LT_PATHMAX];
+  struct stat s;
+  char *tmp_pathspec = xstrdup (pathspec);
+  char *p;
+  int has_symlinks = 0;
+  while (strlen (tmp_pathspec) && !has_symlinks)
+    {
+      lt_debugprintf (__FILE__, __LINE__,
+		      "checking path component for symlinks: %s\n",
+		      tmp_pathspec);
+      if (lstat (tmp_pathspec, &s) == 0)
+	{
+	  if (S_ISLNK (s.st_mode) != 0)
+	    {
+	      has_symlinks = 1;
+	      break;
+	    }
+
+	  /* search backwards for last DIR_SEPARATOR */
+	  p = tmp_pathspec + strlen (tmp_pathspec) - 1;
+	  while ((p > tmp_pathspec) && (!IS_DIR_SEPARATOR (*p)))
+	    p--;
+	  if ((p == tmp_pathspec) && (!IS_DIR_SEPARATOR (*p)))
+	    {
+	      /* no more DIR_SEPARATORS left */
+	      break;
+	    }
+	  *p = '\0';
+	}
+      else
+	{
+	  lt_fatal (__FILE__, __LINE__,
+		    "error accessing file \"%s\": %s",
+		    tmp_pathspec, nonnull (strerror (errno)));
+	}
+    }
+  XFREE (tmp_pathspec);
+
+  if (!has_symlinks)
+    {
+      return xstrdup (pathspec);
+    }
+
+  tmp_pathspec = realpath (pathspec, buf);
+  if (tmp_pathspec == 0)
+    {
+      lt_fatal (__FILE__, __LINE__,
+		"could not follow symlinks for %s", pathspec);
+    }
+  return xstrdup (tmp_pathspec);
+#endif
+}
+
+char *
+strendzap (char *str, const char *pat)
+{
+  size_t len, patlen;
+
+  assert (str != NULL);
+  assert (pat != NULL);
+
+  len = strlen (str);
+  patlen = strlen (pat);
+
+  if (patlen <= len)
+    {
+      str += len - patlen;
+      if (strcmp (str, pat) == 0)
+	*str = '\0';
+    }
+  return str;
+}
+
+void
+lt_debugprintf (const char *file, int line, const char *fmt, ...)
+{
+  va_list args;
+  if (lt_debug)
+    {
+      (void) fprintf (stderr, "%s:%s:%d: ", program_name, file, line);
+      va_start (args, fmt);
+      (void) vfprintf (stderr, fmt, args);
+      va_end (args);
+    }
+}
+
+static void
+lt_error_core (int exit_status, const char *file,
+	       int line, const char *mode,
+	       const char *message, va_list ap)
+{
+  fprintf (stderr, "%s:%s:%d: %s: ", program_name, file, line, mode);
+  vfprintf (stderr, message, ap);
+  fprintf (stderr, ".\n");
+
+  if (exit_status >= 0)
+    exit (exit_status);
+}
+
+void
+lt_fatal (const char *file, int line, const char *message, ...)
+{
+  va_list ap;
+  va_start (ap, message);
+  lt_error_core (EXIT_FAILURE, file, line, "FATAL", message, ap);
+  va_end (ap);
+}
+
+static const char *
+nonnull (const char *s)
+{
+  return s ? s : "(null)";
+}
+
+static const char *
+nonempty (const char *s)
+{
+  return (s && !*s) ? "(empty)" : nonnull (s);
+}
+
+void
+lt_setenv (const char *name, const char *value)
+{
+  lt_debugprintf (__FILE__, __LINE__,
+		  "(lt_setenv) setting '%s' to '%s'\n",
+                  nonnull (name), nonnull (value));
+  {
+#ifdef HAVE_SETENV
+    /* always make a copy, for consistency with !HAVE_SETENV */
+    char *str = xstrdup (value);
+    setenv (name, str, 1);
+#else
+    int len = strlen (name) + 1 + strlen (value) + 1;
+    char *str = XMALLOC (char, len);
+    sprintf (str, "%s=%s", name, value);
+    if (putenv (str) != EXIT_SUCCESS)
+      {
+        XFREE (str);
+      }
+#endif
+  }
+}
+
+char *
+lt_extend_str (const char *orig_value, const char *add, int to_end)
+{
+  char *new_value;
+  if (orig_value && *orig_value)
+    {
+      int orig_value_len = strlen (orig_value);
+      int add_len = strlen (add);
+      new_value = XMALLOC (char, add_len + orig_value_len + 1);
+      if (to_end)
+        {
+          strcpy (new_value, orig_value);
+          strcpy (new_value + orig_value_len, add);
+        }
+      else
+        {
+          strcpy (new_value, add);
+          strcpy (new_value + add_len, orig_value);
+        }
+    }
+  else
+    {
+      new_value = xstrdup (add);
+    }
+  return new_value;
+}
+
+void
+lt_update_exe_path (const char *name, const char *value)
+{
+  lt_debugprintf (__FILE__, __LINE__,
+		  "(lt_update_exe_path) modifying '%s' by prepending '%s'\n",
+                  nonnull (name), nonnull (value));
+
+  if (name && *name && value && *value)
+    {
+      char *new_value = lt_extend_str (getenv (name), value, 0);
+      /* some systems can't cope with a ':'-terminated path #' */
+      int len = strlen (new_value);
+      while (((len = strlen (new_value)) > 0) && IS_PATH_SEPARATOR (new_value[len-1]))
+        {
+          new_value[len-1] = '\0';
+        }
+      lt_setenv (name, new_value);
+      XFREE (new_value);
+    }
+}
+
+void
+lt_update_lib_path (const char *name, const char *value)
+{
+  lt_debugprintf (__FILE__, __LINE__,
+		  "(lt_update_lib_path) modifying '%s' by prepending '%s'\n",
+                  nonnull (name), nonnull (value));
+
+  if (name && *name && value && *value)
+    {
+      char *new_value = lt_extend_str (getenv (name), value, 0);
+      lt_setenv (name, new_value);
+      XFREE (new_value);
+    }
+}
+
+EOF
+	    case $host_os in
+	      mingw*)
+		cat <<"EOF"
+
+/* Prepares an argument vector before calling spawn().
+   Note that spawn() does not by itself call the command interpreter
+     (getenv ("COMSPEC") != NULL ? getenv ("COMSPEC") :
+      ({ OSVERSIONINFO v; v.dwOSVersionInfoSize = sizeof(OSVERSIONINFO);
+         GetVersionEx(&v);
+         v.dwPlatformId == VER_PLATFORM_WIN32_NT;
+      }) ? "cmd.exe" : "command.com").
+   Instead it simply concatenates the arguments, separated by ' ', and calls
+   CreateProcess().  We must quote the arguments since Win32 CreateProcess()
+   interprets characters like ' ', '\t', '\\', '"' (but not '<' and '>') in a
+   special way:
+   - Space and tab are interpreted as delimiters. They are not treated as
+     delimiters if they are surrounded by double quotes: "...".
+   - Unescaped double quotes are removed from the input. Their only effect is
+     that within double quotes, space and tab are treated like normal
+     characters.
+   - Backslashes not followed by double quotes are not special.
+   - But 2*n+1 backslashes followed by a double quote become
+     n backslashes followed by a double quote (n >= 0):
+       \" -> "
+       \\\" -> \"
+       \\\\\" -> \\"
+ */
+#define SHELL_SPECIAL_CHARS "\"\\ \001\002\003\004\005\006\007\010\011\012\013\014\015\016\017\020\021\022\023\024\025\026\027\030\031\032\033\034\035\036\037"
+#define SHELL_SPACE_CHARS " \001\002\003\004\005\006\007\010\011\012\013\014\015\016\017\020\021\022\023\024\025\026\027\030\031\032\033\034\035\036\037"
+char **
+prepare_spawn (char **argv)
+{
+  size_t argc;
+  char **new_argv;
+  size_t i;
+
+  /* Count number of arguments.  */
+  for (argc = 0; argv[argc] != NULL; argc++)
+    ;
+
+  /* Allocate new argument vector.  */
+  new_argv = XMALLOC (char *, argc + 1);
+
+  /* Put quoted arguments into the new argument vector.  */
+  for (i = 0; i < argc; i++)
+    {
+      const char *string = argv[i];
+
+      if (string[0] == '\0')
+	new_argv[i] = xstrdup ("\"\"");
+      else if (strpbrk (string, SHELL_SPECIAL_CHARS) != NULL)
+	{
+	  int quote_around = (strpbrk (string, SHELL_SPACE_CHARS) != NULL);
+	  size_t length;
+	  unsigned int backslashes;
+	  const char *s;
+	  char *quoted_string;
+	  char *p;
+
+	  length = 0;
+	  backslashes = 0;
+	  if (quote_around)
+	    length++;
+	  for (s = string; *s != '\0'; s++)
+	    {
+	      char c = *s;
+	      if (c == '"')
+		length += backslashes + 1;
+	      length++;
+	      if (c == '\\')
+		backslashes++;
+	      else
+		backslashes = 0;
+	    }
+	  if (quote_around)
+	    length += backslashes + 1;
+
+	  quoted_string = XMALLOC (char, length + 1);
+
+	  p = quoted_string;
+	  backslashes = 0;
+	  if (quote_around)
+	    *p++ = '"';
+	  for (s = string; *s != '\0'; s++)
+	    {
+	      char c = *s;
+	      if (c == '"')
+		{
+		  unsigned int j;
+		  for (j = backslashes + 1; j > 0; j--)
+		    *p++ = '\\';
+		}
+	      *p++ = c;
+	      if (c == '\\')
+		backslashes++;
+	      else
+		backslashes = 0;
+	    }
+	  if (quote_around)
+	    {
+	      unsigned int j;
+	      for (j = backslashes; j > 0; j--)
+		*p++ = '\\';
+	      *p++ = '"';
+	    }
+	  *p = '\0';
+
+	  new_argv[i] = quoted_string;
+	}
+      else
+	new_argv[i] = (char *) string;
+    }
+  new_argv[argc] = NULL;
+
+  return new_argv;
+}
+EOF
+		;;
+	    esac
+
+            cat <<"EOF"
+void lt_dump_script (FILE* f)
+{
+EOF
+	    func_emit_wrapper yes |
+	      $SED -n -e '
+s/^\(.\{79\}\)\(..*\)/\1\
+\2/
+h
+s/\([\\"]\)/\\\1/g
+s/$/\\n/
+s/\([^\n]*\).*/  fputs ("\1", f);/p
+g
+D'
+            cat <<"EOF"
+}
+EOF
+}
+# end: func_emit_cwrapperexe_src
+
+# func_win32_import_lib_p ARG
+# True if ARG is an import lib, as indicated by $file_magic_cmd
+func_win32_import_lib_p ()
+{
+    $opt_debug
+    case `eval $file_magic_cmd \"\$1\" 2>/dev/null | $SED -e 10q` in
+    *import*) : ;;
+    *) false ;;
+    esac
+}
+
+# func_mode_link arg...
+func_mode_link ()
+{
+    $opt_debug
+    case $host in
+    *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2* | *-cegcc*)
+      # It is impossible to link a dll without this setting, and
+      # we shouldn't force the makefile maintainer to figure out
+      # which system we are compiling for in order to pass an extra
+      # flag for every libtool invocation.
+      # allow_undefined=no
+
+      # FIXME: Unfortunately, there are problems with the above when trying
+      # to make a dll which has undefined symbols, in which case not
+      # even a static library is built.  For now, we need to specify
+      # -no-undefined on the libtool link line when we can be certain
+      # that all symbols are satisfied, otherwise we get a static library.
+      allow_undefined=yes
+      ;;
+    *)
+      allow_undefined=yes
+      ;;
+    esac
+    libtool_args=$nonopt
+    base_compile="$nonopt $@"
+    compile_command=$nonopt
+    finalize_command=$nonopt
+
+    compile_rpath=
+    finalize_rpath=
+    compile_shlibpath=
+    finalize_shlibpath=
+    convenience=
+    old_convenience=
+    deplibs=
+    old_deplibs=
+    compiler_flags=
+    linker_flags=
+    dllsearchpath=
+    lib_search_path=`pwd`
+    inst_prefix_dir=
+    new_inherited_linker_flags=
+
+    avoid_version=no
+    bindir=
+    dlfiles=
+    dlprefiles=
+    dlself=no
+    export_dynamic=no
+    export_symbols=
+    export_symbols_regex=
+    generated=
+    libobjs=
+    ltlibs=
+    module=no
+    no_install=no
+    objs=
+    non_pic_objects=
+    precious_files_regex=
+    prefer_static_libs=no
+    preload=no
+    prev=
+    prevarg=
+    release=
+    rpath=
+    xrpath=
+    perm_rpath=
+    temp_rpath=
+    thread_safe=no
+    vinfo=
+    vinfo_number=no
+    weak_libs=
+    single_module="${wl}-single_module"
+    func_infer_tag $base_compile
+
+    # We need to know -static, to get the right output filenames.
+    for arg
+    do
+      case $arg in
+      -shared)
+	test "$build_libtool_libs" != yes && \
+	  func_fatal_configuration "can not build a shared library"
+	build_old_libs=no
+	break
+	;;
+      -all-static | -static | -static-libtool-libs)
+	case $arg in
+	-all-static)
+	  if test "$build_libtool_libs" = yes && test -z "$link_static_flag"; then
+	    func_warning "complete static linking is impossible in this configuration"
+	  fi
+	  if test -n "$link_static_flag"; then
+	    dlopen_self=$dlopen_self_static
+	  fi
+	  prefer_static_libs=yes
+	  ;;
+	-static)
+	  if test -z "$pic_flag" && test -n "$link_static_flag"; then
+	    dlopen_self=$dlopen_self_static
+	  fi
+	  prefer_static_libs=built
+	  ;;
+	-static-libtool-libs)
+	  if test -z "$pic_flag" && test -n "$link_static_flag"; then
+	    dlopen_self=$dlopen_self_static
+	  fi
+	  prefer_static_libs=yes
+	  ;;
+	esac
+	build_libtool_libs=no
+	build_old_libs=yes
+	break
+	;;
+      esac
+    done
+
+    # See if our shared archives depend on static archives.
+    test -n "$old_archive_from_new_cmds" && build_old_libs=yes
+
+    # Go through the arguments, transforming them on the way.
+    while test "$#" -gt 0; do
+      arg="$1"
+      shift
+      func_quote_for_eval "$arg"
+      qarg=$func_quote_for_eval_unquoted_result
+      func_append libtool_args " $func_quote_for_eval_result"
+
+      # If the previous option needs an argument, assign it.
+      if test -n "$prev"; then
+	case $prev in
+	output)
+	  func_append compile_command " @OUTPUT@"
+	  func_append finalize_command " @OUTPUT@"
+	  ;;
+	esac
+
+	case $prev in
+	bindir)
+	  bindir="$arg"
+	  prev=
+	  continue
+	  ;;
+	dlfiles|dlprefiles)
+	  if test "$preload" = no; then
+	    # Add the symbol object into the linking commands.
+	    func_append compile_command " @SYMFILE@"
+	    func_append finalize_command " @SYMFILE@"
+	    preload=yes
+	  fi
+	  case $arg in
+	  *.la | *.lo) ;;  # We handle these cases below.
+	  force)
+	    if test "$dlself" = no; then
+	      dlself=needless
+	      export_dynamic=yes
+	    fi
+	    prev=
+	    continue
+	    ;;
+	  self)
+	    if test "$prev" = dlprefiles; then
+	      dlself=yes
+	    elif test "$prev" = dlfiles && test "$dlopen_self" != yes; then
+	      dlself=yes
+	    else
+	      dlself=needless
+	      export_dynamic=yes
+	    fi
+	    prev=
+	    continue
+	    ;;
+	  *)
+	    if test "$prev" = dlfiles; then
+	      func_append dlfiles " $arg"
+	    else
+	      func_append dlprefiles " $arg"
+	    fi
+	    prev=
+	    continue
+	    ;;
+	  esac
+	  ;;
+	expsyms)
+	  export_symbols="$arg"
+	  test -f "$arg" \
+	    || func_fatal_error "symbol file \`$arg' does not exist"
+	  prev=
+	  continue
+	  ;;
+	expsyms_regex)
+	  export_symbols_regex="$arg"
+	  prev=
+	  continue
+	  ;;
+	framework)
+	  case $host in
+	    *-*-darwin*)
+	      case "$deplibs " in
+		*" $qarg.ltframework "*) ;;
+		*) func_append deplibs " $qarg.ltframework" # this is fixed later
+		   ;;
+	      esac
+	      ;;
+	  esac
+	  prev=
+	  continue
+	  ;;
+	inst_prefix)
+	  inst_prefix_dir="$arg"
+	  prev=
+	  continue
+	  ;;
+	objectlist)
+	  if test -f "$arg"; then
+	    save_arg=$arg
+	    moreargs=
+	    for fil in `cat "$save_arg"`
+	    do
+#	      func_append moreargs " $fil"
+	      arg=$fil
+	      # A libtool-controlled object.
+
+	      # Check to see that this really is a libtool object.
+	      if func_lalib_unsafe_p "$arg"; then
+		pic_object=
+		non_pic_object=
+
+		# Read the .lo file
+		func_source "$arg"
+
+		if test -z "$pic_object" ||
+		   test -z "$non_pic_object" ||
+		   test "$pic_object" = none &&
+		   test "$non_pic_object" = none; then
+		  func_fatal_error "cannot find name of object for \`$arg'"
+		fi
+
+		# Extract subdirectory from the argument.
+		func_dirname "$arg" "/" ""
+		xdir="$func_dirname_result"
+
+		if test "$pic_object" != none; then
+		  # Prepend the subdirectory the object is found in.
+		  pic_object="$xdir$pic_object"
+
+		  if test "$prev" = dlfiles; then
+		    if test "$build_libtool_libs" = yes && test "$dlopen_support" = yes; then
+		      func_append dlfiles " $pic_object"
+		      prev=
+		      continue
+		    else
+		      # If libtool objects are unsupported, then we need to preload.
+		      prev=dlprefiles
+		    fi
+		  fi
+
+		  # CHECK ME:  I think I busted this.  -Ossama
+		  if test "$prev" = dlprefiles; then
+		    # Preload the old-style object.
+		    func_append dlprefiles " $pic_object"
+		    prev=
+		  fi
+
+		  # A PIC object.
+		  func_append libobjs " $pic_object"
+		  arg="$pic_object"
+		fi
+
+		# Non-PIC object.
+		if test "$non_pic_object" != none; then
+		  # Prepend the subdirectory the object is found in.
+		  non_pic_object="$xdir$non_pic_object"
+
+		  # A standard non-PIC object
+		  func_append non_pic_objects " $non_pic_object"
+		  if test -z "$pic_object" || test "$pic_object" = none ; then
+		    arg="$non_pic_object"
+		  fi
+		else
+		  # If the PIC object exists, use it instead.
+		  # $xdir was prepended to $pic_object above.
+		  non_pic_object="$pic_object"
+		  func_append non_pic_objects " $non_pic_object"
+		fi
+	      else
+		# Only an error if not doing a dry-run.
+		if $opt_dry_run; then
+		  # Extract subdirectory from the argument.
+		  func_dirname "$arg" "/" ""
+		  xdir="$func_dirname_result"
+
+		  func_lo2o "$arg"
+		  pic_object=$xdir$objdir/$func_lo2o_result
+		  non_pic_object=$xdir$func_lo2o_result
+		  func_append libobjs " $pic_object"
+		  func_append non_pic_objects " $non_pic_object"
+	        else
+		  func_fatal_error "\`$arg' is not a valid libtool object"
+		fi
+	      fi
+	    done
+	  else
+	    func_fatal_error "link input file \`$arg' does not exist"
+	  fi
+	  arg=$save_arg
+	  prev=
+	  continue
+	  ;;
+	precious_regex)
+	  precious_files_regex="$arg"
+	  prev=
+	  continue
+	  ;;
+	release)
+	  release="-$arg"
+	  prev=
+	  continue
+	  ;;
+	rpath | xrpath)
+	  # We need an absolute path.
+	  case $arg in
+	  [\\/]* | [A-Za-z]:[\\/]*) ;;
+	  *)
+	    func_fatal_error "only absolute run-paths are allowed"
+	    ;;
+	  esac
+	  if test "$prev" = rpath; then
+	    case "$rpath " in
+	    *" $arg "*) ;;
+	    *) func_append rpath " $arg" ;;
+	    esac
+	  else
+	    case "$xrpath " in
+	    *" $arg "*) ;;
+	    *) func_append xrpath " $arg" ;;
+	    esac
+	  fi
+	  prev=
+	  continue
+	  ;;
+	shrext)
+	  shrext_cmds="$arg"
+	  prev=
+	  continue
+	  ;;
+	weak)
+	  func_append weak_libs " $arg"
+	  prev=
+	  continue
+	  ;;
+	xcclinker)
+	  func_append linker_flags " $qarg"
+	  func_append compiler_flags " $qarg"
+	  prev=
+	  func_append compile_command " $qarg"
+	  func_append finalize_command " $qarg"
+	  continue
+	  ;;
+	xcompiler)
+	  func_append compiler_flags " $qarg"
+	  prev=
+	  func_append compile_command " $qarg"
+	  func_append finalize_command " $qarg"
+	  continue
+	  ;;
+	xlinker)
+	  func_append linker_flags " $qarg"
+	  func_append compiler_flags " $wl$qarg"
+	  prev=
+	  func_append compile_command " $wl$qarg"
+	  func_append finalize_command " $wl$qarg"
+	  continue
+	  ;;
+	*)
+	  eval "$prev=\"\$arg\""
+	  prev=
+	  continue
+	  ;;
+	esac
+      fi # test -n "$prev"
+
+      prevarg="$arg"
+
+      case $arg in
+      -all-static)
+	if test -n "$link_static_flag"; then
+	  # See comment for -static flag below, for more details.
+	  func_append compile_command " $link_static_flag"
+	  func_append finalize_command " $link_static_flag"
+	fi
+	continue
+	;;
+
+      -allow-undefined)
+	# FIXME: remove this flag sometime in the future.
+	func_fatal_error "\`-allow-undefined' must not be used because it is the default"
+	;;
+
+      -avoid-version)
+	avoid_version=yes
+	continue
+	;;
+
+      -bindir)
+	prev=bindir
+	continue
+	;;
+
+      -dlopen)
+	prev=dlfiles
+	continue
+	;;
+
+      -dlpreopen)
+	prev=dlprefiles
+	continue
+	;;
+
+      -export-dynamic)
+	export_dynamic=yes
+	continue
+	;;
+
+      -export-symbols | -export-symbols-regex)
+	if test -n "$export_symbols" || test -n "$export_symbols_regex"; then
+	  func_fatal_error "more than one -exported-symbols argument is not allowed"
+	fi
+	if test "X$arg" = "X-export-symbols"; then
+	  prev=expsyms
+	else
+	  prev=expsyms_regex
+	fi
+	continue
+	;;
+
+      -framework)
+	prev=framework
+	continue
+	;;
+
+      -inst-prefix-dir)
+	prev=inst_prefix
+	continue
+	;;
+
+      # The native IRIX linker understands -LANG:*, -LIST:* and -LNO:*
+      # so, if we see these flags be careful not to treat them like -L
+      -L[A-Z][A-Z]*:*)
+	case $with_gcc/$host in
+	no/*-*-irix* | /*-*-irix*)
+	  func_append compile_command " $arg"
+	  func_append finalize_command " $arg"
+	  ;;
+	esac
+	continue
+	;;
+
+      -L*)
+	func_stripname "-L" '' "$arg"
+	if test -z "$func_stripname_result"; then
+	  if test "$#" -gt 0; then
+	    func_fatal_error "require no space between \`-L' and \`$1'"
+	  else
+	    func_fatal_error "need path for \`-L' option"
+	  fi
+	fi
+	func_resolve_sysroot "$func_stripname_result"
+	dir=$func_resolve_sysroot_result
+	# We need an absolute path.
+	case $dir in
+	[\\/]* | [A-Za-z]:[\\/]*) ;;
+	*)
+	  absdir=`cd "$dir" && pwd`
+	  test -z "$absdir" && \
+	    func_fatal_error "cannot determine absolute directory name of \`$dir'"
+	  dir="$absdir"
+	  ;;
+	esac
+	case "$deplibs " in
+	*" -L$dir "* | *" $arg "*)
+	  # Will only happen for absolute or sysroot arguments
+	  ;;
+	*)
+	  # Preserve sysroot, but never include relative directories
+	  case $dir in
+	    [\\/]* | [A-Za-z]:[\\/]* | =*) func_append deplibs " $arg" ;;
+	    *) func_append deplibs " -L$dir" ;;
+	  esac
+	  func_append lib_search_path " $dir"
+	  ;;
+	esac
+	case $host in
+	*-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2* | *-cegcc*)
+	  testbindir=`$ECHO "$dir" | $SED 's*/lib$*/bin*'`
+	  case :$dllsearchpath: in
+	  *":$dir:"*) ;;
+	  ::) dllsearchpath=$dir;;
+	  *) func_append dllsearchpath ":$dir";;
+	  esac
+	  case :$dllsearchpath: in
+	  *":$testbindir:"*) ;;
+	  ::) dllsearchpath=$testbindir;;
+	  *) func_append dllsearchpath ":$testbindir";;
+	  esac
+	  ;;
+	esac
+	continue
+	;;
+
+      -l*)
+	if test "X$arg" = "X-lc" || test "X$arg" = "X-lm"; then
+	  case $host in
+	  *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-beos* | *-cegcc* | *-*-haiku*)
+	    # These systems don't actually have a C or math library (as such)
+	    continue
+	    ;;
+	  *-*-os2*)
+	    # These systems don't actually have a C library (as such)
+	    test "X$arg" = "X-lc" && continue
+	    ;;
+	  *-*-openbsd* | *-*-freebsd* | *-*-dragonfly*)
+	    # Do not include libc due to us having libc/libc_r.
+	    test "X$arg" = "X-lc" && continue
+	    ;;
+	  *-*-rhapsody* | *-*-darwin1.[012])
+	    # Rhapsody C and math libraries are in the System framework
+	    func_append deplibs " System.ltframework"
+	    continue
+	    ;;
+	  *-*-sco3.2v5* | *-*-sco5v6*)
+	    # Causes problems with __ctype
+	    test "X$arg" = "X-lc" && continue
+	    ;;
+	  *-*-sysv4.2uw2* | *-*-sysv5* | *-*-unixware* | *-*-OpenUNIX*)
+	    # Compiler inserts libc in the correct place for threads to work
+	    test "X$arg" = "X-lc" && continue
+	    ;;
+	  esac
+	elif test "X$arg" = "X-lc_r"; then
+	 case $host in
+	 *-*-openbsd* | *-*-freebsd* | *-*-dragonfly*)
+	   # Do not include libc_r directly, use -pthread flag.
+	   continue
+	   ;;
+	 esac
+	fi
+	func_append deplibs " $arg"
+	continue
+	;;
+
+      -module)
+	module=yes
+	continue
+	;;
+
+      # Tru64 UNIX uses -model [arg] to determine the layout of C++
+      # classes, name mangling, and exception handling.
+      # Darwin uses the -arch flag to determine output architecture.
+      -model|-arch|-isysroot|--sysroot)
+	func_append compiler_flags " $arg"
+	func_append compile_command " $arg"
+	func_append finalize_command " $arg"
+	prev=xcompiler
+	continue
+	;;
+
+      -mt|-mthreads|-kthread|-Kthread|-pthread|-pthreads|--thread-safe \
+      |-threads|-fopenmp|-openmp|-mp|-xopenmp|-omp|-qsmp=*)
+	func_append compiler_flags " $arg"
+	func_append compile_command " $arg"
+	func_append finalize_command " $arg"
+	case "$new_inherited_linker_flags " in
+	    *" $arg "*) ;;
+	    * ) func_append new_inherited_linker_flags " $arg" ;;
+	esac
+	continue
+	;;
+
+      -multi_module)
+	single_module="${wl}-multi_module"
+	continue
+	;;
+
+      -no-fast-install)
+	fast_install=no
+	continue
+	;;
+
+      -no-install)
+	case $host in
+	*-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2* | *-*-darwin* | *-cegcc*)
+	  # The PATH hackery in wrapper scripts is required on Windows
+	  # and Darwin in order for the loader to find any dlls it needs.
+	  func_warning "\`-no-install' is ignored for $host"
+	  func_warning "assuming \`-no-fast-install' instead"
+	  fast_install=no
+	  ;;
+	*) no_install=yes ;;
+	esac
+	continue
+	;;
+
+      -no-undefined)
+	allow_undefined=no
+	continue
+	;;
+
+      -objectlist)
+	prev=objectlist
+	continue
+	;;
+
+      -o) prev=output ;;
+
+      -precious-files-regex)
+	prev=precious_regex
+	continue
+	;;
+
+      -release)
+	prev=release
+	continue
+	;;
+
+      -rpath)
+	prev=rpath
+	continue
+	;;
+
+      -R)
+	prev=xrpath
+	continue
+	;;
+
+      -R*)
+	func_stripname '-R' '' "$arg"
+	dir=$func_stripname_result
+	# We need an absolute path.
+	case $dir in
+	[\\/]* | [A-Za-z]:[\\/]*) ;;
+	=*)
+	  func_stripname '=' '' "$dir"
+	  dir=$lt_sysroot$func_stripname_result
+	  ;;
+	*)
+	  func_fatal_error "only absolute run-paths are allowed"
+	  ;;
+	esac
+	case "$xrpath " in
+	*" $dir "*) ;;
+	*) func_append xrpath " $dir" ;;
+	esac
+	continue
+	;;
+
+      -shared)
+	# The effects of -shared are defined in a previous loop.
+	continue
+	;;
+
+      -shrext)
+	prev=shrext
+	continue
+	;;
+
+      -static | -static-libtool-libs)
+	# The effects of -static are defined in a previous loop.
+	# We used to do the same as -all-static on platforms that
+	# didn't have a PIC flag, but the assumption that the effects
+	# would be equivalent was wrong.  It would break on at least
+	# Digital Unix and AIX.
+	continue
+	;;
+
+      -thread-safe)
+	thread_safe=yes
+	continue
+	;;
+
+      -version-info)
+	prev=vinfo
+	continue
+	;;
+
+      -version-number)
+	prev=vinfo
+	vinfo_number=yes
+	continue
+	;;
+
+      -weak)
+        prev=weak
+	continue
+	;;
+
+      -Wc,*)
+	func_stripname '-Wc,' '' "$arg"
+	args=$func_stripname_result
+	arg=
+	save_ifs="$IFS"; IFS=','
+	for flag in $args; do
+	  IFS="$save_ifs"
+          func_quote_for_eval "$flag"
+	  func_append arg " $func_quote_for_eval_result"
+	  func_append compiler_flags " $func_quote_for_eval_result"
+	done
+	IFS="$save_ifs"
+	func_stripname ' ' '' "$arg"
+	arg=$func_stripname_result
+	;;
+
+      -Wl,*)
+	func_stripname '-Wl,' '' "$arg"
+	args=$func_stripname_result
+	arg=
+	save_ifs="$IFS"; IFS=','
+	for flag in $args; do
+	  IFS="$save_ifs"
+          func_quote_for_eval "$flag"
+	  func_append arg " $wl$func_quote_for_eval_result"
+	  func_append compiler_flags " $wl$func_quote_for_eval_result"
+	  func_append linker_flags " $func_quote_for_eval_result"
+	done
+	IFS="$save_ifs"
+	func_stripname ' ' '' "$arg"
+	arg=$func_stripname_result
+	;;
+
+      -Xcompiler)
+	prev=xcompiler
+	continue
+	;;
+
+      -Xlinker)
+	prev=xlinker
+	continue
+	;;
+
+      -XCClinker)
+	prev=xcclinker
+	continue
+	;;
+
+      # -msg_* for osf cc
+      -msg_*)
+	func_quote_for_eval "$arg"
+	arg="$func_quote_for_eval_result"
+	;;
+
+      # Flags to be passed through unchanged, with rationale:
+      # -64, -mips[0-9]      enable 64-bit mode for the SGI compiler
+      # -r[0-9][0-9]*        specify processor for the SGI compiler
+      # -xarch=*, -xtarget=* enable 64-bit mode for the Sun compiler
+      # +DA*, +DD*           enable 64-bit mode for the HP compiler
+      # -q*                  compiler args for the IBM compiler
+      # -m*, -t[45]*, -txscale* architecture-specific flags for GCC
+      # -F/path              path to uninstalled frameworks, gcc on darwin
+      # -p, -pg, --coverage, -fprofile-*  profiling flags for GCC
+      # @file                GCC response files
+      # -tp=*                Portland pgcc target processor selection
+      # --sysroot=*          for sysroot support
+      # -O*, -flto*, -fwhopr*, -fuse-linker-plugin GCC link-time optimization
+      -64|-mips[0-9]|-r[0-9][0-9]*|-xarch=*|-xtarget=*|+DA*|+DD*|-q*|-m*| \
+      -t[45]*|-txscale*|-p|-pg|--coverage|-fprofile-*|-F*|@*|-tp=*|--sysroot=*| \
+      -O*|-flto*|-fwhopr*|-fuse-linker-plugin)
+        func_quote_for_eval "$arg"
+	arg="$func_quote_for_eval_result"
+        func_append compile_command " $arg"
+        func_append finalize_command " $arg"
+        func_append compiler_flags " $arg"
+        continue
+        ;;
+
+      # Some other compiler flag.
+      -* | +*)
+        func_quote_for_eval "$arg"
+	arg="$func_quote_for_eval_result"
+	;;
+
+      *.$objext)
+	# A standard object.
+	func_append objs " $arg"
+	;;
+
+      *.lo)
+	# A libtool-controlled object.
+
+	# Check to see that this really is a libtool object.
+	if func_lalib_unsafe_p "$arg"; then
+	  pic_object=
+	  non_pic_object=
+
+	  # Read the .lo file
+	  func_source "$arg"
+
+	  if test -z "$pic_object" ||
+	     test -z "$non_pic_object" ||
+	     test "$pic_object" = none &&
+	     test "$non_pic_object" = none; then
+	    func_fatal_error "cannot find name of object for \`$arg'"
+	  fi
+
+	  # Extract subdirectory from the argument.
+	  func_dirname "$arg" "/" ""
+	  xdir="$func_dirname_result"
+
+	  if test "$pic_object" != none; then
+	    # Prepend the subdirectory the object is found in.
+	    pic_object="$xdir$pic_object"
+
+	    if test "$prev" = dlfiles; then
+	      if test "$build_libtool_libs" = yes && test "$dlopen_support" = yes; then
+		func_append dlfiles " $pic_object"
+		prev=
+		continue
+	      else
+		# If libtool objects are unsupported, then we need to preload.
+		prev=dlprefiles
+	      fi
+	    fi
+
+	    # CHECK ME:  I think I busted this.  -Ossama
+	    if test "$prev" = dlprefiles; then
+	      # Preload the old-style object.
+	      func_append dlprefiles " $pic_object"
+	      prev=
+	    fi
+
+	    # A PIC object.
+	    func_append libobjs " $pic_object"
+	    arg="$pic_object"
+	  fi
+
+	  # Non-PIC object.
+	  if test "$non_pic_object" != none; then
+	    # Prepend the subdirectory the object is found in.
+	    non_pic_object="$xdir$non_pic_object"
+
+	    # A standard non-PIC object
+	    func_append non_pic_objects " $non_pic_object"
+	    if test -z "$pic_object" || test "$pic_object" = none ; then
+	      arg="$non_pic_object"
+	    fi
+	  else
+	    # If the PIC object exists, use it instead.
+	    # $xdir was prepended to $pic_object above.
+	    non_pic_object="$pic_object"
+	    func_append non_pic_objects " $non_pic_object"
+	  fi
+	else
+	  # Only an error if not doing a dry-run.
+	  if $opt_dry_run; then
+	    # Extract subdirectory from the argument.
+	    func_dirname "$arg" "/" ""
+	    xdir="$func_dirname_result"
+
+	    func_lo2o "$arg"
+	    pic_object=$xdir$objdir/$func_lo2o_result
+	    non_pic_object=$xdir$func_lo2o_result
+	    func_append libobjs " $pic_object"
+	    func_append non_pic_objects " $non_pic_object"
+	  else
+	    func_fatal_error "\`$arg' is not a valid libtool object"
+	  fi
+	fi
+	;;
+
+      *.$libext)
+	# An archive.
+	func_append deplibs " $arg"
+	func_append old_deplibs " $arg"
+	continue
+	;;
+
+      *.la)
+	# A libtool-controlled library.
+
+	func_resolve_sysroot "$arg"
+	if test "$prev" = dlfiles; then
+	  # This library was specified with -dlopen.
+	  func_append dlfiles " $func_resolve_sysroot_result"
+	  prev=
+	elif test "$prev" = dlprefiles; then
+	  # The library was specified with -dlpreopen.
+	  func_append dlprefiles " $func_resolve_sysroot_result"
+	  prev=
+	else
+	  func_append deplibs " $func_resolve_sysroot_result"
+	fi
+	continue
+	;;
+
+      # Some other compiler argument.
+      *)
+	# Unknown arguments in both finalize_command and compile_command need
+	# to be aesthetically quoted because they are evaled later.
+	func_quote_for_eval "$arg"
+	arg="$func_quote_for_eval_result"
+	;;
+      esac # arg
+
+      # Now actually substitute the argument into the commands.
+      if test -n "$arg"; then
+	func_append compile_command " $arg"
+	func_append finalize_command " $arg"
+      fi
+    done # argument parsing loop
+
+    test -n "$prev" && \
+      func_fatal_help "the \`$prevarg' option requires an argument"
+
+    if test "$export_dynamic" = yes && test -n "$export_dynamic_flag_spec"; then
+      eval arg=\"$export_dynamic_flag_spec\"
+      func_append compile_command " $arg"
+      func_append finalize_command " $arg"
+    fi
+
+    oldlibs=
+    # calculate the name of the file, without its directory
+    func_basename "$output"
+    outputname="$func_basename_result"
+    libobjs_save="$libobjs"
+
+    if test -n "$shlibpath_var"; then
+      # get the directories listed in $shlibpath_var
+      eval shlib_search_path=\`\$ECHO \"\${$shlibpath_var}\" \| \$SED \'s/:/ /g\'\`
+    else
+      shlib_search_path=
+    fi
+    eval sys_lib_search_path=\"$sys_lib_search_path_spec\"
+    eval sys_lib_dlsearch_path=\"$sys_lib_dlsearch_path_spec\"
+
+    func_dirname "$output" "/" ""
+    output_objdir="$func_dirname_result$objdir"
+    func_to_tool_file "$output_objdir/"
+    tool_output_objdir=$func_to_tool_file_result
+    # Create the object directory.
+    func_mkdir_p "$output_objdir"
+
+    # Determine the type of output
+    case $output in
+    "")
+      func_fatal_help "you must specify an output file"
+      ;;
+    *.$libext) linkmode=oldlib ;;
+    *.lo | *.$objext) linkmode=obj ;;
+    *.la) linkmode=lib ;;
+    *) linkmode=prog ;; # Anything else should be a program.
+    esac
+
+    specialdeplibs=
+
+    libs=
+    # Find all interdependent deplibs by searching for libraries
+    # that are linked more than once (e.g. -la -lb -la)
+    for deplib in $deplibs; do
+      if $opt_preserve_dup_deps ; then
+	case "$libs " in
+	*" $deplib "*) func_append specialdeplibs " $deplib" ;;
+	esac
+      fi
+      func_append libs " $deplib"
+    done
+
+    if test "$linkmode" = lib; then
+      libs="$predeps $libs $compiler_lib_search_path $postdeps"
+
+      # Compute libraries that are listed more than once in $predeps
+      # $postdeps and mark them as special (i.e., whose duplicates are
+      # not to be eliminated).
+      pre_post_deps=
+      if $opt_duplicate_compiler_generated_deps; then
+	for pre_post_dep in $predeps $postdeps; do
+	  case "$pre_post_deps " in
+	  *" $pre_post_dep "*) func_append specialdeplibs " $pre_post_deps" ;;
+	  esac
+	  func_append pre_post_deps " $pre_post_dep"
+	done
+      fi
+      pre_post_deps=
+    fi
+
+    deplibs=
+    newdependency_libs=
+    newlib_search_path=
+    need_relink=no # whether we're linking any uninstalled libtool libraries
+    notinst_deplibs= # not-installed libtool libraries
+    notinst_path= # paths that contain not-installed libtool libraries
+
+    case $linkmode in
+    lib)
+	passes="conv dlpreopen link"
+	for file in $dlfiles $dlprefiles; do
+	  case $file in
+	  *.la) ;;
+	  *)
+	    func_fatal_help "libraries can \`-dlopen' only libtool libraries: $file"
+	    ;;
+	  esac
+	done
+	;;
+    prog)
+	compile_deplibs=
+	finalize_deplibs=
+	alldeplibs=no
+	newdlfiles=
+	newdlprefiles=
+	passes="conv scan dlopen dlpreopen link"
+	;;
+    *)  passes="conv"
+	;;
+    esac
+
+    for pass in $passes; do
+      # The preopen pass in lib mode reverses $deplibs; put it back here
+      # so that -L comes before libs that need it for instance...
+      if test "$linkmode,$pass" = "lib,link"; then
+	## FIXME: Find the place where the list is rebuilt in the wrong
+	##        order, and fix it there properly
+        tmp_deplibs=
+	for deplib in $deplibs; do
+	  tmp_deplibs="$deplib $tmp_deplibs"
+	done
+	deplibs="$tmp_deplibs"
+      fi
+
+      if test "$linkmode,$pass" = "lib,link" ||
+	 test "$linkmode,$pass" = "prog,scan"; then
+	libs="$deplibs"
+	deplibs=
+      fi
+      if test "$linkmode" = prog; then
+	case $pass in
+	dlopen) libs="$dlfiles" ;;
+	dlpreopen) libs="$dlprefiles" ;;
+	link)
+	  libs="$deplibs %DEPLIBS%"
+	  test "X$link_all_deplibs" != Xno && libs="$libs $dependency_libs"
+	  ;;
+	esac
+      fi
+      if test "$linkmode,$pass" = "lib,dlpreopen"; then
+	# Collect and forward deplibs of preopened libtool libs
+	for lib in $dlprefiles; do
+	  # Ignore non-libtool-libs
+	  dependency_libs=
+	  func_resolve_sysroot "$lib"
+	  case $lib in
+	  *.la)	func_source "$func_resolve_sysroot_result" ;;
+	  esac
+
+	  # Collect preopened libtool deplibs, except any this library
+	  # has declared as weak libs
+	  for deplib in $dependency_libs; do
+	    func_basename "$deplib"
+            deplib_base=$func_basename_result
+	    case " $weak_libs " in
+	    *" $deplib_base "*) ;;
+	    *) func_append deplibs " $deplib" ;;
+	    esac
+	  done
+	done
+	libs="$dlprefiles"
+      fi
+      if test "$pass" = dlopen; then
+	# Collect dlpreopened libraries
+	save_deplibs="$deplibs"
+	deplibs=
+      fi
+
+      for deplib in $libs; do
+	lib=
+	found=no
+	case $deplib in
+	-mt|-mthreads|-kthread|-Kthread|-pthread|-pthreads|--thread-safe \
+        |-threads|-fopenmp|-openmp|-mp|-xopenmp|-omp|-qsmp=*)
+	  if test "$linkmode,$pass" = "prog,link"; then
+	    compile_deplibs="$deplib $compile_deplibs"
+	    finalize_deplibs="$deplib $finalize_deplibs"
+	  else
+	    func_append compiler_flags " $deplib"
+	    if test "$linkmode" = lib ; then
+		case "$new_inherited_linker_flags " in
+		    *" $deplib "*) ;;
+		    * ) func_append new_inherited_linker_flags " $deplib" ;;
+		esac
+	    fi
+	  fi
+	  continue
+	  ;;
+	-l*)
+	  if test "$linkmode" != lib && test "$linkmode" != prog; then
+	    func_warning "\`-l' is ignored for archives/objects"
+	    continue
+	  fi
+	  func_stripname '-l' '' "$deplib"
+	  name=$func_stripname_result
+	  if test "$linkmode" = lib; then
+	    searchdirs="$newlib_search_path $lib_search_path $compiler_lib_search_dirs $sys_lib_search_path $shlib_search_path"
+	  else
+	    searchdirs="$newlib_search_path $lib_search_path $sys_lib_search_path $shlib_search_path"
+	  fi
+	  for searchdir in $searchdirs; do
+	    for search_ext in .la $std_shrext .so .a; do
+	      # Search the libtool library
+	      lib="$searchdir/lib${name}${search_ext}"
+	      if test -f "$lib"; then
+		if test "$search_ext" = ".la"; then
+		  found=yes
+		else
+		  found=no
+		fi
+		break 2
+	      fi
+	    done
+	  done
+	  if test "$found" != yes; then
+	    # deplib doesn't seem to be a libtool library
+	    if test "$linkmode,$pass" = "prog,link"; then
+	      compile_deplibs="$deplib $compile_deplibs"
+	      finalize_deplibs="$deplib $finalize_deplibs"
+	    else
+	      deplibs="$deplib $deplibs"
+	      test "$linkmode" = lib && newdependency_libs="$deplib $newdependency_libs"
+	    fi
+	    continue
+	  else # deplib is a libtool library
+	    # If $allow_libtool_libs_with_static_runtimes && $deplib is a stdlib,
+	    # We need to do some special things here, and not later.
+	    if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then
+	      case " $predeps $postdeps " in
+	      *" $deplib "*)
+		if func_lalib_p "$lib"; then
+		  library_names=
+		  old_library=
+		  func_source "$lib"
+		  for l in $old_library $library_names; do
+		    ll="$l"
+		  done
+		  if test "X$ll" = "X$old_library" ; then # only static version available
+		    found=no
+		    func_dirname "$lib" "" "."
+		    ladir="$func_dirname_result"
+		    lib=$ladir/$old_library
+		    if test "$linkmode,$pass" = "prog,link"; then
+		      compile_deplibs="$deplib $compile_deplibs"
+		      finalize_deplibs="$deplib $finalize_deplibs"
+		    else
+		      deplibs="$deplib $deplibs"
+		      test "$linkmode" = lib && newdependency_libs="$deplib $newdependency_libs"
+		    fi
+		    continue
+		  fi
+		fi
+		;;
+	      *) ;;
+	      esac
+	    fi
+	  fi
+	  ;; # -l
+	*.ltframework)
+	  if test "$linkmode,$pass" = "prog,link"; then
+	    compile_deplibs="$deplib $compile_deplibs"
+	    finalize_deplibs="$deplib $finalize_deplibs"
+	  else
+	    deplibs="$deplib $deplibs"
+	    if test "$linkmode" = lib ; then
+		case "$new_inherited_linker_flags " in
+		    *" $deplib "*) ;;
+		    * ) func_append new_inherited_linker_flags " $deplib" ;;
+		esac
+	    fi
+	  fi
+	  continue
+	  ;;
+	-L*)
+	  case $linkmode in
+	  lib)
+	    deplibs="$deplib $deplibs"
+	    test "$pass" = conv && continue
+	    newdependency_libs="$deplib $newdependency_libs"
+	    func_stripname '-L' '' "$deplib"
+	    func_resolve_sysroot "$func_stripname_result"
+	    func_append newlib_search_path " $func_resolve_sysroot_result"
+	    ;;
+	  prog)
+	    if test "$pass" = conv; then
+	      deplibs="$deplib $deplibs"
+	      continue
+	    fi
+	    if test "$pass" = scan; then
+	      deplibs="$deplib $deplibs"
+	    else
+	      compile_deplibs="$deplib $compile_deplibs"
+	      finalize_deplibs="$deplib $finalize_deplibs"
+	    fi
+	    func_stripname '-L' '' "$deplib"
+	    func_resolve_sysroot "$func_stripname_result"
+	    func_append newlib_search_path " $func_resolve_sysroot_result"
+	    ;;
+	  *)
+	    func_warning "\`-L' is ignored for archives/objects"
+	    ;;
+	  esac # linkmode
+	  continue
+	  ;; # -L
+	-R*)
+	  if test "$pass" = link; then
+	    func_stripname '-R' '' "$deplib"
+	    func_resolve_sysroot "$func_stripname_result"
+	    dir=$func_resolve_sysroot_result
+	    # Make sure the xrpath contains only unique directories.
+	    case "$xrpath " in
+	    *" $dir "*) ;;
+	    *) func_append xrpath " $dir" ;;
+	    esac
+	  fi
+	  deplibs="$deplib $deplibs"
+	  continue
+	  ;;
+	*.la)
+	  func_resolve_sysroot "$deplib"
+	  lib=$func_resolve_sysroot_result
+	  ;;
+	*.$libext)
+	  if test "$pass" = conv; then
+	    deplibs="$deplib $deplibs"
+	    continue
+	  fi
+	  case $linkmode in
+	  lib)
+	    # Linking convenience modules into shared libraries is allowed,
+	    # but linking other static libraries is non-portable.
+	    case " $dlpreconveniencelibs " in
+	    *" $deplib "*) ;;
+	    *)
+	      valid_a_lib=no
+	      case $deplibs_check_method in
+		match_pattern*)
+		  set dummy $deplibs_check_method; shift
+		  match_pattern_regex=`expr "$deplibs_check_method" : "$1 \(.*\)"`
+		  if eval "\$ECHO \"$deplib\"" 2>/dev/null | $SED 10q \
+		    | $EGREP "$match_pattern_regex" > /dev/null; then
+		    valid_a_lib=yes
+		  fi
+		;;
+		pass_all)
+		  valid_a_lib=yes
+		;;
+	      esac
+	      if test "$valid_a_lib" != yes; then
+		echo
+		$ECHO "*** Warning: Trying to link with static lib archive $deplib."
+		echo "*** I have the capability to make that library automatically link in when"
+		echo "*** you link to this library.  But I can only do this if you have a"
+		echo "*** shared version of the library, which you do not appear to have"
+		echo "*** because the file extensions .$libext of this argument makes me believe"
+		echo "*** that it is just a static archive that I should not use here."
+	      else
+		echo
+		$ECHO "*** Warning: Linking the shared library $output against the"
+		$ECHO "*** static library $deplib is not portable!"
+		deplibs="$deplib $deplibs"
+	      fi
+	      ;;
+	    esac
+	    continue
+	    ;;
+	  prog)
+	    if test "$pass" != link; then
+	      deplibs="$deplib $deplibs"
+	    else
+	      compile_deplibs="$deplib $compile_deplibs"
+	      finalize_deplibs="$deplib $finalize_deplibs"
+	    fi
+	    continue
+	    ;;
+	  esac # linkmode
+	  ;; # *.$libext
+	*.lo | *.$objext)
+	  if test "$pass" = conv; then
+	    deplibs="$deplib $deplibs"
+	  elif test "$linkmode" = prog; then
+	    if test "$pass" = dlpreopen || test "$dlopen_support" != yes || test "$build_libtool_libs" = no; then
+	      # If there is no dlopen support or we're linking statically,
+	      # we need to preload.
+	      func_append newdlprefiles " $deplib"
+	      compile_deplibs="$deplib $compile_deplibs"
+	      finalize_deplibs="$deplib $finalize_deplibs"
+	    else
+	      func_append newdlfiles " $deplib"
+	    fi
+	  fi
+	  continue
+	  ;;
+	%DEPLIBS%)
+	  alldeplibs=yes
+	  continue
+	  ;;
+	esac # case $deplib
+
+	if test "$found" = yes || test -f "$lib"; then :
+	else
+	  func_fatal_error "cannot find the library \`$lib' or unhandled argument \`$deplib'"
+	fi
+
+	# Check to see that this really is a libtool archive.
+	func_lalib_unsafe_p "$lib" \
+	  || func_fatal_error "\`$lib' is not a valid libtool archive"
+
+	func_dirname "$lib" "" "."
+	ladir="$func_dirname_result"
+
+	dlname=
+	dlopen=
+	dlpreopen=
+	libdir=
+	library_names=
+	old_library=
+	inherited_linker_flags=
+	# If the library was installed with an old release of libtool,
+	# it will not redefine variables installed, or shouldnotlink
+	installed=yes
+	shouldnotlink=no
+	avoidtemprpath=
+
+
+	# Read the .la file
+	func_source "$lib"
+
+	# Convert "-framework foo" to "foo.ltframework"
+	if test -n "$inherited_linker_flags"; then
+	  tmp_inherited_linker_flags=`$ECHO "$inherited_linker_flags" | $SED 's/-framework \([^ $]*\)/\1.ltframework/g'`
+	  for tmp_inherited_linker_flag in $tmp_inherited_linker_flags; do
+	    case " $new_inherited_linker_flags " in
+	      *" $tmp_inherited_linker_flag "*) ;;
+	      *) func_append new_inherited_linker_flags " $tmp_inherited_linker_flag";;
+	    esac
+	  done
+	fi
+	dependency_libs=`$ECHO " $dependency_libs" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'`
+	if test "$linkmode,$pass" = "lib,link" ||
+	   test "$linkmode,$pass" = "prog,scan" ||
+	   { test "$linkmode" != prog && test "$linkmode" != lib; }; then
+	  test -n "$dlopen" && func_append dlfiles " $dlopen"
+	  test -n "$dlpreopen" && func_append dlprefiles " $dlpreopen"
+	fi
+
+	if test "$pass" = conv; then
+	  # Only check for convenience libraries
+	  deplibs="$lib $deplibs"
+	  if test -z "$libdir"; then
+	    if test -z "$old_library"; then
+	      func_fatal_error "cannot find name of link library for \`$lib'"
+	    fi
+	    # It is a libtool convenience library, so add in its objects.
+	    func_append convenience " $ladir/$objdir/$old_library"
+	    func_append old_convenience " $ladir/$objdir/$old_library"
+	    tmp_libs=
+	    for deplib in $dependency_libs; do
+	      deplibs="$deplib $deplibs"
+	      if $opt_preserve_dup_deps ; then
+		case "$tmp_libs " in
+		*" $deplib "*) func_append specialdeplibs " $deplib" ;;
+		esac
+	      fi
+	      func_append tmp_libs " $deplib"
+	    done
+	  elif test "$linkmode" != prog && test "$linkmode" != lib; then
+	    func_fatal_error "\`$lib' is not a convenience library"
+	  fi
+	  continue
+	fi # $pass = conv
+
+
+	# Get the name of the library we link against.
+	linklib=
+	if test -n "$old_library" &&
+	   { test "$prefer_static_libs" = yes ||
+	     test "$prefer_static_libs,$installed" = "built,no"; }; then
+	  linklib=$old_library
+	else
+	  for l in $old_library $library_names; do
+	    linklib="$l"
+	  done
+	fi
+	if test -z "$linklib"; then
+	  func_fatal_error "cannot find name of link library for \`$lib'"
+	fi
+
+	# This library was specified with -dlopen.
+	if test "$pass" = dlopen; then
+	  if test -z "$libdir"; then
+	    func_fatal_error "cannot -dlopen a convenience library: \`$lib'"
+	  fi
+	  if test -z "$dlname" ||
+	     test "$dlopen_support" != yes ||
+	     test "$build_libtool_libs" = no; then
+	    # If there is no dlname, no dlopen support or we're linking
+	    # statically, we need to preload.  We also need to preload any
+	    # dependent libraries so libltdl's deplib preloader doesn't
+	    # bomb out in the load deplibs phase.
+	    func_append dlprefiles " $lib $dependency_libs"
+	  else
+	    func_append newdlfiles " $lib"
+	  fi
+	  continue
+	fi # $pass = dlopen
+
+	# We need an absolute path.
+	case $ladir in
+	[\\/]* | [A-Za-z]:[\\/]*) abs_ladir="$ladir" ;;
+	*)
+	  abs_ladir=`cd "$ladir" && pwd`
+	  if test -z "$abs_ladir"; then
+	    func_warning "cannot determine absolute directory name of \`$ladir'"
+	    func_warning "passing it literally to the linker, although it might fail"
+	    abs_ladir="$ladir"
+	  fi
+	  ;;
+	esac
+	func_basename "$lib"
+	laname="$func_basename_result"
+
+	# Find the relevant object directory and library name.
+	if test "X$installed" = Xyes; then
+	  if test ! -f "$lt_sysroot$libdir/$linklib" && test -f "$abs_ladir/$linklib"; then
+	    func_warning "library \`$lib' was moved."
+	    dir="$ladir"
+	    absdir="$abs_ladir"
+	    libdir="$abs_ladir"
+	  else
+	    dir="$lt_sysroot$libdir"
+	    absdir="$lt_sysroot$libdir"
+	  fi
+	  test "X$hardcode_automatic" = Xyes && avoidtemprpath=yes
+	else
+	  if test ! -f "$ladir/$objdir/$linklib" && test -f "$abs_ladir/$linklib"; then
+	    dir="$ladir"
+	    absdir="$abs_ladir"
+	    # Remove this search path later
+	    func_append notinst_path " $abs_ladir"
+	  else
+	    dir="$ladir/$objdir"
+	    absdir="$abs_ladir/$objdir"
+	    # Remove this search path later
+	    func_append notinst_path " $abs_ladir"
+	  fi
+	fi # $installed = yes
+	func_stripname 'lib' '.la' "$laname"
+	name=$func_stripname_result
+
+	# This library was specified with -dlpreopen.
+	if test "$pass" = dlpreopen; then
+	  if test -z "$libdir" && test "$linkmode" = prog; then
+	    func_fatal_error "only libraries may -dlpreopen a convenience library: \`$lib'"
+	  fi
+	  case "$host" in
+	    # special handling for platforms with PE-DLLs.
+	    *cygwin* | *mingw* | *cegcc* )
+	      # Linker will automatically link against shared library if both
+	      # static and shared are present.  Therefore, ensure we extract
+	      # symbols from the import library if a shared library is present
+	      # (otherwise, the dlopen module name will be incorrect).  We do
+	      # this by putting the import library name into $newdlprefiles.
+	      # We recover the dlopen module name by 'saving' the la file
+	      # name in a special purpose variable, and (later) extracting the
+	      # dlname from the la file.
+	      if test -n "$dlname"; then
+	        func_tr_sh "$dir/$linklib"
+	        eval "libfile_$func_tr_sh_result=\$abs_ladir/\$laname"
+	        func_append newdlprefiles " $dir/$linklib"
+	      else
+	        func_append newdlprefiles " $dir/$old_library"
+	        # Keep a list of preopened convenience libraries to check
+	        # that they are being used correctly in the link pass.
+	        test -z "$libdir" && \
+	          func_append dlpreconveniencelibs " $dir/$old_library"
+	      fi
+	    ;;
+	    * )
+	      # Prefer using a static library (so that no silly _DYNAMIC symbols
+	      # are required to link).
+	      if test -n "$old_library"; then
+	        func_append newdlprefiles " $dir/$old_library"
+	        # Keep a list of preopened convenience libraries to check
+	        # that they are being used correctly in the link pass.
+	        test -z "$libdir" && \
+	          func_append dlpreconveniencelibs " $dir/$old_library"
+	      # Otherwise, use the dlname, so that lt_dlopen finds it.
+	      elif test -n "$dlname"; then
+	        func_append newdlprefiles " $dir/$dlname"
+	      else
+	        func_append newdlprefiles " $dir/$linklib"
+	      fi
+	    ;;
+	  esac
+	fi # $pass = dlpreopen
+
+	if test -z "$libdir"; then
+	  # Link the convenience library
+	  if test "$linkmode" = lib; then
+	    deplibs="$dir/$old_library $deplibs"
+	  elif test "$linkmode,$pass" = "prog,link"; then
+	    compile_deplibs="$dir/$old_library $compile_deplibs"
+	    finalize_deplibs="$dir/$old_library $finalize_deplibs"
+	  else
+	    deplibs="$lib $deplibs" # used for prog,scan pass
+	  fi
+	  continue
+	fi
+
+
+	if test "$linkmode" = prog && test "$pass" != link; then
+	  func_append newlib_search_path " $ladir"
+	  deplibs="$lib $deplibs"
+
+	  linkalldeplibs=no
+	  if test "$link_all_deplibs" != no || test -z "$library_names" ||
+	     test "$build_libtool_libs" = no; then
+	    linkalldeplibs=yes
+	  fi
+
+	  tmp_libs=
+	  for deplib in $dependency_libs; do
+	    case $deplib in
+	    -L*) func_stripname '-L' '' "$deplib"
+	         func_resolve_sysroot "$func_stripname_result"
+	         func_append newlib_search_path " $func_resolve_sysroot_result"
+		 ;;
+	    esac
+	    # Need to link against all dependency_libs?
+	    if test "$linkalldeplibs" = yes; then
+	      deplibs="$deplib $deplibs"
+	    else
+	      # Need to hardcode shared library paths
+	      # or/and link against static libraries
+	      newdependency_libs="$deplib $newdependency_libs"
+	    fi
+	    if $opt_preserve_dup_deps ; then
+	      case "$tmp_libs " in
+	      *" $deplib "*) func_append specialdeplibs " $deplib" ;;
+	      esac
+	    fi
+	    func_append tmp_libs " $deplib"
+	  done # for deplib
+	  continue
+	fi # $linkmode = prog...
+
+	if test "$linkmode,$pass" = "prog,link"; then
+	  if test -n "$library_names" &&
+	     { { test "$prefer_static_libs" = no ||
+	         test "$prefer_static_libs,$installed" = "built,yes"; } ||
+	       test -z "$old_library"; }; then
+	    # We need to hardcode the library path
+	    if test -n "$shlibpath_var" && test -z "$avoidtemprpath" ; then
+	      # Make sure the rpath contains only unique directories.
+	      case "$temp_rpath:" in
+	      *"$absdir:"*) ;;
+	      *) func_append temp_rpath "$absdir:" ;;
+	      esac
+	    fi
+
+	    # Hardcode the library path.
+	    # Skip directories that are in the system default run-time
+	    # search path.
+	    case " $sys_lib_dlsearch_path " in
+	    *" $absdir "*) ;;
+	    *)
+	      case "$compile_rpath " in
+	      *" $absdir "*) ;;
+	      *) func_append compile_rpath " $absdir" ;;
+	      esac
+	      ;;
+	    esac
+	    case " $sys_lib_dlsearch_path " in
+	    *" $libdir "*) ;;
+	    *)
+	      case "$finalize_rpath " in
+	      *" $libdir "*) ;;
+	      *) func_append finalize_rpath " $libdir" ;;
+	      esac
+	      ;;
+	    esac
+	  fi # $linkmode,$pass = prog,link...
+
+	  if test "$alldeplibs" = yes &&
+	     { test "$deplibs_check_method" = pass_all ||
+	       { test "$build_libtool_libs" = yes &&
+		 test -n "$library_names"; }; }; then
+	    # We only need to search for static libraries
+	    continue
+	  fi
+	fi
+
+	link_static=no # Whether the deplib will be linked statically
+	use_static_libs=$prefer_static_libs
+	if test "$use_static_libs" = built && test "$installed" = yes; then
+	  use_static_libs=no
+	fi
+	if test -n "$library_names" &&
+	   { test "$use_static_libs" = no || test -z "$old_library"; }; then
+	  case $host in
+	  *cygwin* | *mingw* | *cegcc*)
+	      # No point in relinking DLLs because paths are not encoded
+	      func_append notinst_deplibs " $lib"
+	      need_relink=no
+	    ;;
+	  *)
+	    if test "$installed" = no; then
+	      func_append notinst_deplibs " $lib"
+	      need_relink=yes
+	    fi
+	    ;;
+	  esac
+	  # This is a shared library
+
+	  # Warn about portability, can't link against -module's on some
+	  # systems (darwin).  Don't bleat about dlopened modules though!
+	  dlopenmodule=""
+	  for dlpremoduletest in $dlprefiles; do
+	    if test "X$dlpremoduletest" = "X$lib"; then
+	      dlopenmodule="$dlpremoduletest"
+	      break
+	    fi
+	  done
+	  if test -z "$dlopenmodule" && test "$shouldnotlink" = yes && test "$pass" = link; then
+	    echo
+	    if test "$linkmode" = prog; then
+	      $ECHO "*** Warning: Linking the executable $output against the loadable module"
+	    else
+	      $ECHO "*** Warning: Linking the shared library $output against the loadable module"
+	    fi
+	    $ECHO "*** $linklib is not portable!"
+	  fi
+	  if test "$linkmode" = lib &&
+	     test "$hardcode_into_libs" = yes; then
+	    # Hardcode the library path.
+	    # Skip directories that are in the system default run-time
+	    # search path.
+	    case " $sys_lib_dlsearch_path " in
+	    *" $absdir "*) ;;
+	    *)
+	      case "$compile_rpath " in
+	      *" $absdir "*) ;;
+	      *) func_append compile_rpath " $absdir" ;;
+	      esac
+	      ;;
+	    esac
+	    case " $sys_lib_dlsearch_path " in
+	    *" $libdir "*) ;;
+	    *)
+	      case "$finalize_rpath " in
+	      *" $libdir "*) ;;
+	      *) func_append finalize_rpath " $libdir" ;;
+	      esac
+	      ;;
+	    esac
+	  fi
+
+	  if test -n "$old_archive_from_expsyms_cmds"; then
+	    # figure out the soname
+	    set dummy $library_names
+	    shift
+	    realname="$1"
+	    shift
+	    libname=`eval "\\$ECHO \"$libname_spec\""`
+	    # use dlname if we got it. it's perfectly good, no?
+	    if test -n "$dlname"; then
+	      soname="$dlname"
+	    elif test -n "$soname_spec"; then
+	      # bleh windows
+	      case $host in
+	      *cygwin* | mingw* | *cegcc*)
+	        func_arith $current - $age
+		major=$func_arith_result
+		versuffix="-$major"
+		;;
+	      esac
+	      eval soname=\"$soname_spec\"
+	    else
+	      soname="$realname"
+	    fi
+
+	    # Make a new name for the extract_expsyms_cmds to use
+	    soroot="$soname"
+	    func_basename "$soroot"
+	    soname="$func_basename_result"
+	    func_stripname 'lib' '.dll' "$soname"
+	    newlib=libimp-$func_stripname_result.a
+
+	    # If the library has no export list, then create one now
+	    if test -f "$output_objdir/$soname-def"; then :
+	    else
+	      func_verbose "extracting exported symbol list from \`$soname'"
+	      func_execute_cmds "$extract_expsyms_cmds" 'exit $?'
+	    fi
+
+	    # Create $newlib
+	    if test -f "$output_objdir/$newlib"; then :; else
+	      func_verbose "generating import library for \`$soname'"
+	      func_execute_cmds "$old_archive_from_expsyms_cmds" 'exit $?'
+	    fi
+	    # make sure the library variables are pointing to the new library
+	    dir=$output_objdir
+	    linklib=$newlib
+	  fi # test -n "$old_archive_from_expsyms_cmds"
+
+	  if test "$linkmode" = prog || test "$opt_mode" != relink; then
+	    add_shlibpath=
+	    add_dir=
+	    add=
+	    lib_linked=yes
+	    case $hardcode_action in
+	    immediate | unsupported)
+	      if test "$hardcode_direct" = no; then
+		add="$dir/$linklib"
+		case $host in
+		  *-*-sco3.2v5.0.[024]*) add_dir="-L$dir" ;;
+		  *-*-sysv4*uw2*) add_dir="-L$dir" ;;
+		  *-*-sysv5OpenUNIX* | *-*-sysv5UnixWare7.[01].[10]* | \
+		    *-*-unixware7*) add_dir="-L$dir" ;;
+		  *-*-darwin* )
+		    # if the lib is a (non-dlopened) module then we can not
+		    # link against it, someone is ignoring the earlier warnings
+		    if /usr/bin/file -L $add 2> /dev/null |
+			 $GREP ": [^:]* bundle" >/dev/null ; then
+		      if test "X$dlopenmodule" != "X$lib"; then
+			$ECHO "*** Warning: lib $linklib is a module, not a shared library"
+			if test -z "$old_library" ; then
+			  echo
+			  echo "*** And there doesn't seem to be a static archive available"
+			  echo "*** The link will probably fail, sorry"
+			else
+			  add="$dir/$old_library"
+			fi
+		      elif test -n "$old_library"; then
+			add="$dir/$old_library"
+		      fi
+		    fi
+		esac
+	      elif test "$hardcode_minus_L" = no; then
+		case $host in
+		*-*-sunos*) add_shlibpath="$dir" ;;
+		esac
+		add_dir="-L$dir"
+		add="-l$name"
+	      elif test "$hardcode_shlibpath_var" = no; then
+		add_shlibpath="$dir"
+		add="-l$name"
+	      else
+		lib_linked=no
+	      fi
+	      ;;
+	    relink)
+	      if test "$hardcode_direct" = yes &&
+	         test "$hardcode_direct_absolute" = no; then
+		add="$dir/$linklib"
+	      elif test "$hardcode_minus_L" = yes; then
+		add_dir="-L$absdir"
+		# Try looking first in the location we're being installed to.
+		if test -n "$inst_prefix_dir"; then
+		  case $libdir in
+		    [\\/]*)
+		      func_append add_dir " -L$inst_prefix_dir$libdir"
+		      ;;
+		  esac
+		fi
+		add="-l$name"
+	      elif test "$hardcode_shlibpath_var" = yes; then
+		add_shlibpath="$dir"
+		add="-l$name"
+	      else
+		lib_linked=no
+	      fi
+	      ;;
+	    *) lib_linked=no ;;
+	    esac
+
+	    if test "$lib_linked" != yes; then
+	      func_fatal_configuration "unsupported hardcode properties"
+	    fi
+
+	    if test -n "$add_shlibpath"; then
+	      case :$compile_shlibpath: in
+	      *":$add_shlibpath:"*) ;;
+	      *) func_append compile_shlibpath "$add_shlibpath:" ;;
+	      esac
+	    fi
+	    if test "$linkmode" = prog; then
+	      test -n "$add_dir" && compile_deplibs="$add_dir $compile_deplibs"
+	      test -n "$add" && compile_deplibs="$add $compile_deplibs"
+	    else
+	      test -n "$add_dir" && deplibs="$add_dir $deplibs"
+	      test -n "$add" && deplibs="$add $deplibs"
+	      if test "$hardcode_direct" != yes &&
+		 test "$hardcode_minus_L" != yes &&
+		 test "$hardcode_shlibpath_var" = yes; then
+		case :$finalize_shlibpath: in
+		*":$libdir:"*) ;;
+		*) func_append finalize_shlibpath "$libdir:" ;;
+		esac
+	      fi
+	    fi
+	  fi
+
+	  if test "$linkmode" = prog || test "$opt_mode" = relink; then
+	    add_shlibpath=
+	    add_dir=
+	    add=
+	    # Finalize command for both is simple: just hardcode it.
+	    if test "$hardcode_direct" = yes &&
+	       test "$hardcode_direct_absolute" = no; then
+	      add="$libdir/$linklib"
+	    elif test "$hardcode_minus_L" = yes; then
+	      add_dir="-L$libdir"
+	      add="-l$name"
+	    elif test "$hardcode_shlibpath_var" = yes; then
+	      case :$finalize_shlibpath: in
+	      *":$libdir:"*) ;;
+	      *) func_append finalize_shlibpath "$libdir:" ;;
+	      esac
+	      add="-l$name"
+	    elif test "$hardcode_automatic" = yes; then
+	      if test -n "$inst_prefix_dir" &&
+		 test -f "$inst_prefix_dir$libdir/$linklib" ; then
+		add="$inst_prefix_dir$libdir/$linklib"
+	      else
+		add="$libdir/$linklib"
+	      fi
+	    else
+	      # We cannot seem to hardcode it, guess we'll fake it.
+	      add_dir="-L$libdir"
+	      # Try looking first in the location we're being installed to.
+	      if test -n "$inst_prefix_dir"; then
+		case $libdir in
+		  [\\/]*)
+		    func_append add_dir " -L$inst_prefix_dir$libdir"
+		    ;;
+		esac
+	      fi
+	      add="-l$name"
+	    fi
+
+	    if test "$linkmode" = prog; then
+	      test -n "$add_dir" && finalize_deplibs="$add_dir $finalize_deplibs"
+	      test -n "$add" && finalize_deplibs="$add $finalize_deplibs"
+	    else
+	      test -n "$add_dir" && deplibs="$add_dir $deplibs"
+	      test -n "$add" && deplibs="$add $deplibs"
+	    fi
+	  fi
+	elif test "$linkmode" = prog; then
+	  # Here we assume that one of hardcode_direct or hardcode_minus_L
+	  # is not unsupported.  This is valid on all known static and
+	  # shared platforms.
+	  if test "$hardcode_direct" != unsupported; then
+	    test -n "$old_library" && linklib="$old_library"
+	    compile_deplibs="$dir/$linklib $compile_deplibs"
+	    finalize_deplibs="$dir/$linklib $finalize_deplibs"
+	  else
+	    compile_deplibs="-l$name -L$dir $compile_deplibs"
+	    finalize_deplibs="-l$name -L$dir $finalize_deplibs"
+	  fi
+	elif test "$build_libtool_libs" = yes; then
+	  # Not a shared library
+	  if test "$deplibs_check_method" != pass_all; then
+	    # We're trying link a shared library against a static one
+	    # but the system doesn't support it.
+
+	    # Just print a warning and add the library to dependency_libs so
+	    # that the program can be linked against the static library.
+	    echo
+	    $ECHO "*** Warning: This system can not link to static lib archive $lib."
+	    echo "*** I have the capability to make that library automatically link in when"
+	    echo "*** you link to this library.  But I can only do this if you have a"
+	    echo "*** shared version of the library, which you do not appear to have."
+	    if test "$module" = yes; then
+	      echo "*** But as you try to build a module library, libtool will still create "
+	      echo "*** a static module, that should work as long as the dlopening application"
+	      echo "*** is linked with the -dlopen flag to resolve symbols at runtime."
+	      if test -z "$global_symbol_pipe"; then
+		echo
+		echo "*** However, this would only work if libtool was able to extract symbol"
+		echo "*** lists from a program, using \`nm' or equivalent, but libtool could"
+		echo "*** not find such a program.  So, this module is probably useless."
+		echo "*** \`nm' from GNU binutils and a full rebuild may help."
+	      fi
+	      if test "$build_old_libs" = no; then
+		build_libtool_libs=module
+		build_old_libs=yes
+	      else
+		build_libtool_libs=no
+	      fi
+	    fi
+	  else
+	    deplibs="$dir/$old_library $deplibs"
+	    link_static=yes
+	  fi
+	fi # link shared/static library?
+
+	if test "$linkmode" = lib; then
+	  if test -n "$dependency_libs" &&
+	     { test "$hardcode_into_libs" != yes ||
+	       test "$build_old_libs" = yes ||
+	       test "$link_static" = yes; }; then
+	    # Extract -R from dependency_libs
+	    temp_deplibs=
+	    for libdir in $dependency_libs; do
+	      case $libdir in
+	      -R*) func_stripname '-R' '' "$libdir"
+	           temp_xrpath=$func_stripname_result
+		   case " $xrpath " in
+		   *" $temp_xrpath "*) ;;
+		   *) func_append xrpath " $temp_xrpath";;
+		   esac;;
+	      *) func_append temp_deplibs " $libdir";;
+	      esac
+	    done
+	    dependency_libs="$temp_deplibs"
+	  fi
+
+	  func_append newlib_search_path " $absdir"
+	  # Link against this library
+	  test "$link_static" = no && newdependency_libs="$abs_ladir/$laname $newdependency_libs"
+	  # ... and its dependency_libs
+	  tmp_libs=
+	  for deplib in $dependency_libs; do
+	    newdependency_libs="$deplib $newdependency_libs"
+	    case $deplib in
+              -L*) func_stripname '-L' '' "$deplib"
+                   func_resolve_sysroot "$func_stripname_result";;
+              *) func_resolve_sysroot "$deplib" ;;
+            esac
+	    if $opt_preserve_dup_deps ; then
+	      case "$tmp_libs " in
+	      *" $func_resolve_sysroot_result "*)
+                func_append specialdeplibs " $func_resolve_sysroot_result" ;;
+	      esac
+	    fi
+	    func_append tmp_libs " $func_resolve_sysroot_result"
+	  done
+
+	  if test "$link_all_deplibs" != no; then
+	    # Add the search paths of all dependency libraries
+	    for deplib in $dependency_libs; do
+	      path=
+	      case $deplib in
+	      -L*) path="$deplib" ;;
+	      *.la)
+	        func_resolve_sysroot "$deplib"
+	        deplib=$func_resolve_sysroot_result
+	        func_dirname "$deplib" "" "."
+		dir=$func_dirname_result
+		# We need an absolute path.
+		case $dir in
+		[\\/]* | [A-Za-z]:[\\/]*) absdir="$dir" ;;
+		*)
+		  absdir=`cd "$dir" && pwd`
+		  if test -z "$absdir"; then
+		    func_warning "cannot determine absolute directory name of \`$dir'"
+		    absdir="$dir"
+		  fi
+		  ;;
+		esac
+		if $GREP "^installed=no" $deplib > /dev/null; then
+		case $host in
+		*-*-darwin*)
+		  depdepl=
+		  eval deplibrary_names=`${SED} -n -e 's/^library_names=\(.*\)$/\1/p' $deplib`
+		  if test -n "$deplibrary_names" ; then
+		    for tmp in $deplibrary_names ; do
+		      depdepl=$tmp
+		    done
+		    if test -f "$absdir/$objdir/$depdepl" ; then
+		      depdepl="$absdir/$objdir/$depdepl"
+		      darwin_install_name=`${OTOOL} -L $depdepl | awk '{if (NR == 2) {print $1;exit}}'`
+                      if test -z "$darwin_install_name"; then
+                          darwin_install_name=`${OTOOL64} -L $depdepl  | awk '{if (NR == 2) {print $1;exit}}'`
+                      fi
+		      func_append compiler_flags " ${wl}-dylib_file ${wl}${darwin_install_name}:${depdepl}"
+		      func_append linker_flags " -dylib_file ${darwin_install_name}:${depdepl}"
+		      path=
+		    fi
+		  fi
+		  ;;
+		*)
+		  path="-L$absdir/$objdir"
+		  ;;
+		esac
+		else
+		  eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $deplib`
+		  test -z "$libdir" && \
+		    func_fatal_error "\`$deplib' is not a valid libtool archive"
+		  test "$absdir" != "$libdir" && \
+		    func_warning "\`$deplib' seems to be moved"
+
+		  path="-L$absdir"
+		fi
+		;;
+	      esac
+	      case " $deplibs " in
+	      *" $path "*) ;;
+	      *) deplibs="$path $deplibs" ;;
+	      esac
+	    done
+	  fi # link_all_deplibs != no
+	fi # linkmode = lib
+      done # for deplib in $libs
+      if test "$pass" = link; then
+	if test "$linkmode" = "prog"; then
+	  compile_deplibs="$new_inherited_linker_flags $compile_deplibs"
+	  finalize_deplibs="$new_inherited_linker_flags $finalize_deplibs"
+	else
+	  compiler_flags="$compiler_flags "`$ECHO " $new_inherited_linker_flags" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'`
+	fi
+      fi
+      dependency_libs="$newdependency_libs"
+      if test "$pass" = dlpreopen; then
+	# Link the dlpreopened libraries before other libraries
+	for deplib in $save_deplibs; do
+	  deplibs="$deplib $deplibs"
+	done
+      fi
+      if test "$pass" != dlopen; then
+	if test "$pass" != conv; then
+	  # Make sure lib_search_path contains only unique directories.
+	  lib_search_path=
+	  for dir in $newlib_search_path; do
+	    case "$lib_search_path " in
+	    *" $dir "*) ;;
+	    *) func_append lib_search_path " $dir" ;;
+	    esac
+	  done
+	  newlib_search_path=
+	fi
+
+	if test "$linkmode,$pass" != "prog,link"; then
+	  vars="deplibs"
+	else
+	  vars="compile_deplibs finalize_deplibs"
+	fi
+	for var in $vars dependency_libs; do
+	  # Add libraries to $var in reverse order
+	  eval tmp_libs=\"\$$var\"
+	  new_libs=
+	  for deplib in $tmp_libs; do
+	    # FIXME: Pedantically, this is the right thing to do, so
+	    #        that some nasty dependency loop isn't accidentally
+	    #        broken:
+	    #new_libs="$deplib $new_libs"
+	    # Pragmatically, this seems to cause very few problems in
+	    # practice:
+	    case $deplib in
+	    -L*) new_libs="$deplib $new_libs" ;;
+	    -R*) ;;
+	    *)
+	      # And here is the reason: when a library appears more
+	      # than once as an explicit dependence of a library, or
+	      # is implicitly linked in more than once by the
+	      # compiler, it is considered special, and multiple
+	      # occurrences thereof are not removed.  Compare this
+	      # with having the same library being listed as a
+	      # dependency of multiple other libraries: in this case,
+	      # we know (pedantically, we assume) the library does not
+	      # need to be listed more than once, so we keep only the
+	      # last copy.  This is not always right, but it is rare
+	      # enough that we require users that really mean to play
+	      # such unportable linking tricks to link the library
+	      # using -Wl,-lname, so that libtool does not consider it
+	      # for duplicate removal.
+	      case " $specialdeplibs " in
+	      *" $deplib "*) new_libs="$deplib $new_libs" ;;
+	      *)
+		case " $new_libs " in
+		*" $deplib "*) ;;
+		*) new_libs="$deplib $new_libs" ;;
+		esac
+		;;
+	      esac
+	      ;;
+	    esac
+	  done
+	  tmp_libs=
+	  for deplib in $new_libs; do
+	    case $deplib in
+	    -L*)
+	      case " $tmp_libs " in
+	      *" $deplib "*) ;;
+	      *) func_append tmp_libs " $deplib" ;;
+	      esac
+	      ;;
+	    *) func_append tmp_libs " $deplib" ;;
+	    esac
+	  done
+	  eval $var=\"$tmp_libs\"
+	done # for var
+      fi
+      # Last step: remove runtime libs from dependency_libs
+      # (they stay in deplibs)
+      tmp_libs=
+      for i in $dependency_libs ; do
+	case " $predeps $postdeps $compiler_lib_search_path " in
+	*" $i "*)
+	  i=""
+	  ;;
+	esac
+	if test -n "$i" ; then
+	  func_append tmp_libs " $i"
+	fi
+      done
+      dependency_libs=$tmp_libs
+    done # for pass
+    if test "$linkmode" = prog; then
+      dlfiles="$newdlfiles"
+    fi
+    if test "$linkmode" = prog || test "$linkmode" = lib; then
+      dlprefiles="$newdlprefiles"
+    fi
+
+    case $linkmode in
+    oldlib)
+      if test -n "$dlfiles$dlprefiles" || test "$dlself" != no; then
+	func_warning "\`-dlopen' is ignored for archives"
+      fi
+
+      case " $deplibs" in
+      *\ -l* | *\ -L*)
+	func_warning "\`-l' and \`-L' are ignored for archives" ;;
+      esac
+
+      test -n "$rpath" && \
+	func_warning "\`-rpath' is ignored for archives"
+
+      test -n "$xrpath" && \
+	func_warning "\`-R' is ignored for archives"
+
+      test -n "$vinfo" && \
+	func_warning "\`-version-info/-version-number' is ignored for archives"
+
+      test -n "$release" && \
+	func_warning "\`-release' is ignored for archives"
+
+      test -n "$export_symbols$export_symbols_regex" && \
+	func_warning "\`-export-symbols' is ignored for archives"
+
+      # Now set the variables for building old libraries.
+      build_libtool_libs=no
+      oldlibs="$output"
+      func_append objs "$old_deplibs"
+      ;;
+
+    lib)
+      # Make sure we only generate libraries of the form `libNAME.la'.
+      case $outputname in
+      lib*)
+	func_stripname 'lib' '.la' "$outputname"
+	name=$func_stripname_result
+	eval shared_ext=\"$shrext_cmds\"
+	eval libname=\"$libname_spec\"
+	;;
+      *)
+	test "$module" = no && \
+	  func_fatal_help "libtool library \`$output' must begin with \`lib'"
+
+	if test "$need_lib_prefix" != no; then
+	  # Add the "lib" prefix for modules if required
+	  func_stripname '' '.la' "$outputname"
+	  name=$func_stripname_result
+	  eval shared_ext=\"$shrext_cmds\"
+	  eval libname=\"$libname_spec\"
+	else
+	  func_stripname '' '.la' "$outputname"
+	  libname=$func_stripname_result
+	fi
+	;;
+      esac
+
+      if test -n "$objs"; then
+	if test "$deplibs_check_method" != pass_all; then
+	  func_fatal_error "cannot build libtool library \`$output' from non-libtool objects on this host:$objs"
+	else
+	  echo
+	  $ECHO "*** Warning: Linking the shared library $output against the non-libtool"
+	  $ECHO "*** objects $objs is not portable!"
+	  func_append libobjs " $objs"
+	fi
+      fi
+
+      test "$dlself" != no && \
+	func_warning "\`-dlopen self' is ignored for libtool libraries"
+
+      set dummy $rpath
+      shift
+      test "$#" -gt 1 && \
+	func_warning "ignoring multiple \`-rpath's for a libtool library"
+
+      install_libdir="$1"
+
+      oldlibs=
+      if test -z "$rpath"; then
+	if test "$build_libtool_libs" = yes; then
+	  # Building a libtool convenience library.
+	  # Some compilers have problems with a `.al' extension so
+	  # convenience libraries should have the same extension an
+	  # archive normally would.
+	  oldlibs="$output_objdir/$libname.$libext $oldlibs"
+	  build_libtool_libs=convenience
+	  build_old_libs=yes
+	fi
+
+	test -n "$vinfo" && \
+	  func_warning "\`-version-info/-version-number' is ignored for convenience libraries"
+
+	test -n "$release" && \
+	  func_warning "\`-release' is ignored for convenience libraries"
+      else
+
+	# Parse the version information argument.
+	save_ifs="$IFS"; IFS=':'
+	set dummy $vinfo 0 0 0
+	shift
+	IFS="$save_ifs"
+
+	test -n "$7" && \
+	  func_fatal_help "too many parameters to \`-version-info'"
+
+	# convert absolute version numbers to libtool ages
+	# this retains compatibility with .la files and attempts
+	# to make the code below a bit more comprehensible
+
+	case $vinfo_number in
+	yes)
+	  number_major="$1"
+	  number_minor="$2"
+	  number_revision="$3"
+	  #
+	  # There are really only two kinds -- those that
+	  # use the current revision as the major version
+	  # and those that subtract age and use age as
+	  # a minor version.  But, then there is irix
+	  # which has an extra 1 added just for fun
+	  #
+	  case $version_type in
+	  # correct linux to gnu/linux during the next big refactor
+	  darwin|linux|osf|windows|none)
+	    func_arith $number_major + $number_minor
+	    current=$func_arith_result
+	    age="$number_minor"
+	    revision="$number_revision"
+	    ;;
+	  freebsd-aout|freebsd-elf|qnx|sunos)
+	    current="$number_major"
+	    revision="$number_minor"
+	    age="0"
+	    ;;
+	  irix|nonstopux)
+	    func_arith $number_major + $number_minor
+	    current=$func_arith_result
+	    age="$number_minor"
+	    revision="$number_minor"
+	    lt_irix_increment=no
+	    ;;
+	  *)
+	    func_fatal_configuration "$modename: unknown library version type \`$version_type'"
+	    ;;
+	  esac
+	  ;;
+	no)
+	  current="$1"
+	  revision="$2"
+	  age="$3"
+	  ;;
+	esac
+
+	# Check that each of the things are valid numbers.
+	case $current in
+	0|[1-9]|[1-9][0-9]|[1-9][0-9][0-9]|[1-9][0-9][0-9][0-9]|[1-9][0-9][0-9][0-9][0-9]) ;;
+	*)
+	  func_error "CURRENT \`$current' must be a nonnegative integer"
+	  func_fatal_error "\`$vinfo' is not valid version information"
+	  ;;
+	esac
+
+	case $revision in
+	0|[1-9]|[1-9][0-9]|[1-9][0-9][0-9]|[1-9][0-9][0-9][0-9]|[1-9][0-9][0-9][0-9][0-9]) ;;
+	*)
+	  func_error "REVISION \`$revision' must be a nonnegative integer"
+	  func_fatal_error "\`$vinfo' is not valid version information"
+	  ;;
+	esac
+
+	case $age in
+	0|[1-9]|[1-9][0-9]|[1-9][0-9][0-9]|[1-9][0-9][0-9][0-9]|[1-9][0-9][0-9][0-9][0-9]) ;;
+	*)
+	  func_error "AGE \`$age' must be a nonnegative integer"
+	  func_fatal_error "\`$vinfo' is not valid version information"
+	  ;;
+	esac
+
+	if test "$age" -gt "$current"; then
+	  func_error "AGE \`$age' is greater than the current interface number \`$current'"
+	  func_fatal_error "\`$vinfo' is not valid version information"
+	fi
+
+	# Calculate the version variables.
+	major=
+	versuffix=
+	verstring=
+	case $version_type in
+	none) ;;
+
+	darwin)
+	  # Like Linux, but with the current version available in
+	  # verstring for coding it into the library header
+	  func_arith $current - $age
+	  major=.$func_arith_result
+	  versuffix="$major.$age.$revision"
+	  # Darwin ld doesn't like 0 for these options...
+	  func_arith $current + 1
+	  minor_current=$func_arith_result
+	  xlcverstring="${wl}-compatibility_version ${wl}$minor_current ${wl}-current_version ${wl}$minor_current.$revision"
+	  verstring="-compatibility_version $minor_current -current_version $minor_current.$revision"
+	  ;;
+
+	freebsd-aout)
+	  major=".$current"
+	  versuffix=".$current.$revision";
+	  ;;
+
+	freebsd-elf)
+	  major=".$current"
+	  versuffix=".$current"
+	  ;;
+
+	irix | nonstopux)
+	  if test "X$lt_irix_increment" = "Xno"; then
+	    func_arith $current - $age
+	  else
+	    func_arith $current - $age + 1
+	  fi
+	  major=$func_arith_result
+
+	  case $version_type in
+	    nonstopux) verstring_prefix=nonstopux ;;
+	    *)         verstring_prefix=sgi ;;
+	  esac
+	  verstring="$verstring_prefix$major.$revision"
+
+	  # Add in all the interfaces that we are compatible with.
+	  loop=$revision
+	  while test "$loop" -ne 0; do
+	    func_arith $revision - $loop
+	    iface=$func_arith_result
+	    func_arith $loop - 1
+	    loop=$func_arith_result
+	    verstring="$verstring_prefix$major.$iface:$verstring"
+	  done
+
+	  # Before this point, $major must not contain `.'.
+	  major=.$major
+	  versuffix="$major.$revision"
+	  ;;
+
+	linux) # correct to gnu/linux during the next big refactor
+	  func_arith $current - $age
+	  major=.$func_arith_result
+	  versuffix="$major.$age.$revision"
+	  ;;
+
+	osf)
+	  func_arith $current - $age
+	  major=.$func_arith_result
+	  versuffix=".$current.$age.$revision"
+	  verstring="$current.$age.$revision"
+
+	  # Add in all the interfaces that we are compatible with.
+	  loop=$age
+	  while test "$loop" -ne 0; do
+	    func_arith $current - $loop
+	    iface=$func_arith_result
+	    func_arith $loop - 1
+	    loop=$func_arith_result
+	    verstring="$verstring:${iface}.0"
+	  done
+
+	  # Make executables depend on our current version.
+	  func_append verstring ":${current}.0"
+	  ;;
+
+	qnx)
+	  major=".$current"
+	  versuffix=".$current"
+	  ;;
+
+	sunos)
+	  major=".$current"
+	  versuffix=".$current.$revision"
+	  ;;
+
+	windows)
+	  # Use '-' rather than '.', since we only want one
+	  # extension on DOS 8.3 filesystems.
+	  func_arith $current - $age
+	  major=$func_arith_result
+	  versuffix="-$major"
+	  ;;
+
+	*)
+	  func_fatal_configuration "unknown library version type \`$version_type'"
+	  ;;
+	esac
+
+	# Clear the version info if we defaulted, and they specified a release.
+	if test -z "$vinfo" && test -n "$release"; then
+	  major=
+	  case $version_type in
+	  darwin)
+	    # we can't check for "0.0" in archive_cmds due to quoting
+	    # problems, so we reset it completely
+	    verstring=
+	    ;;
+	  *)
+	    verstring="0.0"
+	    ;;
+	  esac
+	  if test "$need_version" = no; then
+	    versuffix=
+	  else
+	    versuffix=".0.0"
+	  fi
+	fi
+
+	# Remove version info from name if versioning should be avoided
+	if test "$avoid_version" = yes && test "$need_version" = no; then
+	  major=
+	  versuffix=
+	  verstring=""
+	fi
+
+	# Check to see if the archive will have undefined symbols.
+	if test "$allow_undefined" = yes; then
+	  if test "$allow_undefined_flag" = unsupported; then
+	    func_warning "undefined symbols not allowed in $host shared libraries"
+	    build_libtool_libs=no
+	    build_old_libs=yes
+	  fi
+	else
+	  # Don't allow undefined symbols.
+	  allow_undefined_flag="$no_undefined_flag"
+	fi
+
+      fi
+
+      func_generate_dlsyms "$libname" "$libname" "yes"
+      func_append libobjs " $symfileobj"
+      test "X$libobjs" = "X " && libobjs=
+
+      if test "$opt_mode" != relink; then
+	# Remove our outputs, but don't remove object files since they
+	# may have been created when compiling PIC objects.
+	removelist=
+	tempremovelist=`$ECHO "$output_objdir/*"`
+	for p in $tempremovelist; do
+	  case $p in
+	    *.$objext | *.gcno)
+	       ;;
+	    $output_objdir/$outputname | $output_objdir/$libname.* | $output_objdir/${libname}${release}.*)
+	       if test "X$precious_files_regex" != "X"; then
+		 if $ECHO "$p" | $EGREP -e "$precious_files_regex" >/dev/null 2>&1
+		 then
+		   continue
+		 fi
+	       fi
+	       func_append removelist " $p"
+	       ;;
+	    *) ;;
+	  esac
+	done
+	test -n "$removelist" && \
+	  func_show_eval "${RM}r \$removelist"
+      fi
+
+      # Now set the variables for building old libraries.
+      if test "$build_old_libs" = yes && test "$build_libtool_libs" != convenience ; then
+	func_append oldlibs " $output_objdir/$libname.$libext"
+
+	# Transform .lo files to .o files.
+	oldobjs="$objs "`$ECHO "$libobjs" | $SP2NL | $SED "/\.${libext}$/d; $lo2o" | $NL2SP`
+      fi
+
+      # Eliminate all temporary directories.
+      #for path in $notinst_path; do
+      #	lib_search_path=`$ECHO "$lib_search_path " | $SED "s% $path % %g"`
+      #	deplibs=`$ECHO "$deplibs " | $SED "s% -L$path % %g"`
+      #	dependency_libs=`$ECHO "$dependency_libs " | $SED "s% -L$path % %g"`
+      #done
+
+      if test -n "$xrpath"; then
+	# If the user specified any rpath flags, then add them.
+	temp_xrpath=
+	for libdir in $xrpath; do
+	  func_replace_sysroot "$libdir"
+	  func_append temp_xrpath " -R$func_replace_sysroot_result"
+	  case "$finalize_rpath " in
+	  *" $libdir "*) ;;
+	  *) func_append finalize_rpath " $libdir" ;;
+	  esac
+	done
+	if test "$hardcode_into_libs" != yes || test "$build_old_libs" = yes; then
+	  dependency_libs="$temp_xrpath $dependency_libs"
+	fi
+      fi
+
+      # Make sure dlfiles contains only unique files that won't be dlpreopened
+      old_dlfiles="$dlfiles"
+      dlfiles=
+      for lib in $old_dlfiles; do
+	case " $dlprefiles $dlfiles " in
+	*" $lib "*) ;;
+	*) func_append dlfiles " $lib" ;;
+	esac
+      done
+
+      # Make sure dlprefiles contains only unique files
+      old_dlprefiles="$dlprefiles"
+      dlprefiles=
+      for lib in $old_dlprefiles; do
+	case "$dlprefiles " in
+	*" $lib "*) ;;
+	*) func_append dlprefiles " $lib" ;;
+	esac
+      done
+
+      if test "$build_libtool_libs" = yes; then
+	if test -n "$rpath"; then
+	  case $host in
+	  *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2* | *-*-beos* | *-cegcc* | *-*-haiku*)
+	    # these systems don't actually have a c library (as such)!
+	    ;;
+	  *-*-rhapsody* | *-*-darwin1.[012])
+	    # Rhapsody C library is in the System framework
+	    func_append deplibs " System.ltframework"
+	    ;;
+	  *-*-netbsd*)
+	    # Don't link with libc until the a.out ld.so is fixed.
+	    ;;
+	  *-*-openbsd* | *-*-freebsd* | *-*-dragonfly*)
+	    # Do not include libc due to us having libc/libc_r.
+	    ;;
+	  *-*-sco3.2v5* | *-*-sco5v6*)
+	    # Causes problems with __ctype
+	    ;;
+	  *-*-sysv4.2uw2* | *-*-sysv5* | *-*-unixware* | *-*-OpenUNIX*)
+	    # Compiler inserts libc in the correct place for threads to work
+	    ;;
+	  *)
+	    # Add libc to deplibs on all other systems if necessary.
+	    if test "$build_libtool_need_lc" = "yes"; then
+	      func_append deplibs " -lc"
+	    fi
+	    ;;
+	  esac
+	fi
+
+	# Transform deplibs into only deplibs that can be linked in shared.
+	name_save=$name
+	libname_save=$libname
+	release_save=$release
+	versuffix_save=$versuffix
+	major_save=$major
+	# I'm not sure if I'm treating the release correctly.  I think
+	# release should show up in the -l (ie -lgmp5) so we don't want to
+	# add it in twice.  Is that correct?
+	release=""
+	versuffix=""
+	major=""
+	newdeplibs=
+	droppeddeps=no
+	case $deplibs_check_method in
+	pass_all)
+	  # Don't check for shared/static.  Everything works.
+	  # This might be a little naive.  We might want to check
+	  # whether the library exists or not.  But this is on
+	  # osf3 & osf4 and I'm not really sure... Just
+	  # implementing what was already the behavior.
+	  newdeplibs=$deplibs
+	  ;;
+	test_compile)
+	  # This code stresses the "libraries are programs" paradigm to its
+	  # limits. Maybe even breaks it.  We compile a program, linking it
+	  # against the deplibs as a proxy for the library.  Then we can check
+	  # whether they linked in statically or dynamically with ldd.
+	  $opt_dry_run || $RM conftest.c
+	  cat > conftest.c <<EOF
+	  int main() { return 0; }
+EOF
+	  $opt_dry_run || $RM conftest
+	  if $LTCC $LTCFLAGS -o conftest conftest.c $deplibs; then
+	    ldd_output=`ldd conftest`
+	    for i in $deplibs; do
+	      case $i in
+	      -l*)
+		func_stripname -l '' "$i"
+		name=$func_stripname_result
+		if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then
+		  case " $predeps $postdeps " in
+		  *" $i "*)
+		    func_append newdeplibs " $i"
+		    i=""
+		    ;;
+		  esac
+		fi
+		if test -n "$i" ; then
+		  libname=`eval "\\$ECHO \"$libname_spec\""`
+		  deplib_matches=`eval "\\$ECHO \"$library_names_spec\""`
+		  set dummy $deplib_matches; shift
+		  deplib_match=$1
+		  if test `expr "$ldd_output" : ".*$deplib_match"` -ne 0 ; then
+		    func_append newdeplibs " $i"
+		  else
+		    droppeddeps=yes
+		    echo
+		    $ECHO "*** Warning: dynamic linker does not accept needed library $i."
+		    echo "*** I have the capability to make that library automatically link in when"
+		    echo "*** you link to this library.  But I can only do this if you have a"
+		    echo "*** shared version of the library, which I believe you do not have"
+		    echo "*** because a test_compile did reveal that the linker did not use it for"
+		    echo "*** its dynamic dependency list that programs get resolved with at runtime."
+		  fi
+		fi
+		;;
+	      *)
+		func_append newdeplibs " $i"
+		;;
+	      esac
+	    done
+	  else
+	    # Error occurred in the first compile.  Let's try to salvage
+	    # the situation: Compile a separate program for each library.
+	    for i in $deplibs; do
+	      case $i in
+	      -l*)
+		func_stripname -l '' "$i"
+		name=$func_stripname_result
+		$opt_dry_run || $RM conftest
+		if $LTCC $LTCFLAGS -o conftest conftest.c $i; then
+		  ldd_output=`ldd conftest`
+		  if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then
+		    case " $predeps $postdeps " in
+		    *" $i "*)
+		      func_append newdeplibs " $i"
+		      i=""
+		      ;;
+		    esac
+		  fi
+		  if test -n "$i" ; then
+		    libname=`eval "\\$ECHO \"$libname_spec\""`
+		    deplib_matches=`eval "\\$ECHO \"$library_names_spec\""`
+		    set dummy $deplib_matches; shift
+		    deplib_match=$1
+		    if test `expr "$ldd_output" : ".*$deplib_match"` -ne 0 ; then
+		      func_append newdeplibs " $i"
+		    else
+		      droppeddeps=yes
+		      echo
+		      $ECHO "*** Warning: dynamic linker does not accept needed library $i."
+		      echo "*** I have the capability to make that library automatically link in when"
+		      echo "*** you link to this library.  But I can only do this if you have a"
+		      echo "*** shared version of the library, which you do not appear to have"
+		      echo "*** because a test_compile did reveal that the linker did not use this one"
+		      echo "*** as a dynamic dependency that programs can get resolved with at runtime."
+		    fi
+		  fi
+		else
+		  droppeddeps=yes
+		  echo
+		  $ECHO "*** Warning!  Library $i is needed by this library but I was not able to"
+		  echo "*** make it link in!  You will probably need to install it or some"
+		  echo "*** library that it depends on before this library will be fully"
+		  echo "*** functional.  Installing it before continuing would be even better."
+		fi
+		;;
+	      *)
+		func_append newdeplibs " $i"
+		;;
+	      esac
+	    done
+	  fi
+	  ;;
+	file_magic*)
+	  set dummy $deplibs_check_method; shift
+	  file_magic_regex=`expr "$deplibs_check_method" : "$1 \(.*\)"`
+	  for a_deplib in $deplibs; do
+	    case $a_deplib in
+	    -l*)
+	      func_stripname -l '' "$a_deplib"
+	      name=$func_stripname_result
+	      if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then
+		case " $predeps $postdeps " in
+		*" $a_deplib "*)
+		  func_append newdeplibs " $a_deplib"
+		  a_deplib=""
+		  ;;
+		esac
+	      fi
+	      if test -n "$a_deplib" ; then
+		libname=`eval "\\$ECHO \"$libname_spec\""`
+		if test -n "$file_magic_glob"; then
+		  libnameglob=`func_echo_all "$libname" | $SED -e $file_magic_glob`
+		else
+		  libnameglob=$libname
+		fi
+		test "$want_nocaseglob" = yes && nocaseglob=`shopt -p nocaseglob`
+		for i in $lib_search_path $sys_lib_search_path $shlib_search_path; do
+		  if test "$want_nocaseglob" = yes; then
+		    shopt -s nocaseglob
+		    potential_libs=`ls $i/$libnameglob[.-]* 2>/dev/null`
+		    $nocaseglob
+		  else
+		    potential_libs=`ls $i/$libnameglob[.-]* 2>/dev/null`
+		  fi
+		  for potent_lib in $potential_libs; do
+		      # Follow soft links.
+		      if ls -lLd "$potent_lib" 2>/dev/null |
+			 $GREP " -> " >/dev/null; then
+			continue
+		      fi
+		      # The statement above tries to avoid entering an
+		      # endless loop below, in case of cyclic links.
+		      # We might still enter an endless loop, since a link
+		      # loop can be closed while we follow links,
+		      # but so what?
+		      potlib="$potent_lib"
+		      while test -h "$potlib" 2>/dev/null; do
+			potliblink=`ls -ld $potlib | ${SED} 's/.* -> //'`
+			case $potliblink in
+			[\\/]* | [A-Za-z]:[\\/]*) potlib="$potliblink";;
+			*) potlib=`$ECHO "$potlib" | $SED 's,[^/]*$,,'`"$potliblink";;
+			esac
+		      done
+		      if eval $file_magic_cmd \"\$potlib\" 2>/dev/null |
+			 $SED -e 10q |
+			 $EGREP "$file_magic_regex" > /dev/null; then
+			func_append newdeplibs " $a_deplib"
+			a_deplib=""
+			break 2
+		      fi
+		  done
+		done
+	      fi
+	      if test -n "$a_deplib" ; then
+		droppeddeps=yes
+		echo
+		$ECHO "*** Warning: linker path does not have real file for library $a_deplib."
+		echo "*** I have the capability to make that library automatically link in when"
+		echo "*** you link to this library.  But I can only do this if you have a"
+		echo "*** shared version of the library, which you do not appear to have"
+		echo "*** because I did check the linker path looking for a file starting"
+		if test -z "$potlib" ; then
+		  $ECHO "*** with $libname but no candidates were found. (...for file magic test)"
+		else
+		  $ECHO "*** with $libname and none of the candidates passed a file format test"
+		  $ECHO "*** using a file magic. Last file checked: $potlib"
+		fi
+	      fi
+	      ;;
+	    *)
+	      # Add a -L argument.
+	      func_append newdeplibs " $a_deplib"
+	      ;;
+	    esac
+	  done # Gone through all deplibs.
+	  ;;
+	match_pattern*)
+	  set dummy $deplibs_check_method; shift
+	  match_pattern_regex=`expr "$deplibs_check_method" : "$1 \(.*\)"`
+	  for a_deplib in $deplibs; do
+	    case $a_deplib in
+	    -l*)
+	      func_stripname -l '' "$a_deplib"
+	      name=$func_stripname_result
+	      if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then
+		case " $predeps $postdeps " in
+		*" $a_deplib "*)
+		  func_append newdeplibs " $a_deplib"
+		  a_deplib=""
+		  ;;
+		esac
+	      fi
+	      if test -n "$a_deplib" ; then
+		libname=`eval "\\$ECHO \"$libname_spec\""`
+		for i in $lib_search_path $sys_lib_search_path $shlib_search_path; do
+		  potential_libs=`ls $i/$libname[.-]* 2>/dev/null`
+		  for potent_lib in $potential_libs; do
+		    potlib="$potent_lib" # see symlink-check above in file_magic test
+		    if eval "\$ECHO \"$potent_lib\"" 2>/dev/null | $SED 10q | \
+		       $EGREP "$match_pattern_regex" > /dev/null; then
+		      func_append newdeplibs " $a_deplib"
+		      a_deplib=""
+		      break 2
+		    fi
+		  done
+		done
+	      fi
+	      if test -n "$a_deplib" ; then
+		droppeddeps=yes
+		echo
+		$ECHO "*** Warning: linker path does not have real file for library $a_deplib."
+		echo "*** I have the capability to make that library automatically link in when"
+		echo "*** you link to this library.  But I can only do this if you have a"
+		echo "*** shared version of the library, which you do not appear to have"
+		echo "*** because I did check the linker path looking for a file starting"
+		if test -z "$potlib" ; then
+		  $ECHO "*** with $libname but no candidates were found. (...for regex pattern test)"
+		else
+		  $ECHO "*** with $libname and none of the candidates passed a file format test"
+		  $ECHO "*** using a regex pattern. Last file checked: $potlib"
+		fi
+	      fi
+	      ;;
+	    *)
+	      # Add a -L argument.
+	      func_append newdeplibs " $a_deplib"
+	      ;;
+	    esac
+	  done # Gone through all deplibs.
+	  ;;
+	none | unknown | *)
+	  newdeplibs=""
+	  tmp_deplibs=`$ECHO " $deplibs" | $SED 's/ -lc$//; s/ -[LR][^ ]*//g'`
+	  if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then
+	    for i in $predeps $postdeps ; do
+	      # can't use Xsed below, because $i might contain '/'
+	      tmp_deplibs=`$ECHO " $tmp_deplibs" | $SED "s,$i,,"`
+	    done
+	  fi
+	  case $tmp_deplibs in
+	  *[!\	\ ]*)
+	    echo
+	    if test "X$deplibs_check_method" = "Xnone"; then
+	      echo "*** Warning: inter-library dependencies are not supported in this platform."
+	    else
+	      echo "*** Warning: inter-library dependencies are not known to be supported."
+	    fi
+	    echo "*** All declared inter-library dependencies are being dropped."
+	    droppeddeps=yes
+	    ;;
+	  esac
+	  ;;
+	esac
+	versuffix=$versuffix_save
+	major=$major_save
+	release=$release_save
+	libname=$libname_save
+	name=$name_save
+
+	case $host in
+	*-*-rhapsody* | *-*-darwin1.[012])
+	  # On Rhapsody replace the C library with the System framework
+	  newdeplibs=`$ECHO " $newdeplibs" | $SED 's/ -lc / System.ltframework /'`
+	  ;;
+	esac
+
+	if test "$droppeddeps" = yes; then
+	  if test "$module" = yes; then
+	    echo
+	    echo "*** Warning: libtool could not satisfy all declared inter-library"
+	    $ECHO "*** dependencies of module $libname.  Therefore, libtool will create"
+	    echo "*** a static module, that should work as long as the dlopening"
+	    echo "*** application is linked with the -dlopen flag."
+	    if test -z "$global_symbol_pipe"; then
+	      echo
+	      echo "*** However, this would only work if libtool was able to extract symbol"
+	      echo "*** lists from a program, using \`nm' or equivalent, but libtool could"
+	      echo "*** not find such a program.  So, this module is probably useless."
+	      echo "*** \`nm' from GNU binutils and a full rebuild may help."
+	    fi
+	    if test "$build_old_libs" = no; then
+	      oldlibs="$output_objdir/$libname.$libext"
+	      build_libtool_libs=module
+	      build_old_libs=yes
+	    else
+	      build_libtool_libs=no
+	    fi
+	  else
+	    echo "*** The inter-library dependencies that have been dropped here will be"
+	    echo "*** automatically added whenever a program is linked with this library"
+	    echo "*** or is declared to -dlopen it."
+
+	    if test "$allow_undefined" = no; then
+	      echo
+	      echo "*** Since this library must not contain undefined symbols,"
+	      echo "*** because either the platform does not support them or"
+	      echo "*** it was explicitly requested with -no-undefined,"
+	      echo "*** libtool will only create a static version of it."
+	      if test "$build_old_libs" = no; then
+		oldlibs="$output_objdir/$libname.$libext"
+		build_libtool_libs=module
+		build_old_libs=yes
+	      else
+		build_libtool_libs=no
+	      fi
+	    fi
+	  fi
+	fi
+	# Done checking deplibs!
+	deplibs=$newdeplibs
+      fi
+      # Time to change all our "foo.ltframework" stuff back to "-framework foo"
+      case $host in
+	*-*-darwin*)
+	  newdeplibs=`$ECHO " $newdeplibs" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'`
+	  new_inherited_linker_flags=`$ECHO " $new_inherited_linker_flags" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'`
+	  deplibs=`$ECHO " $deplibs" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'`
+	  ;;
+      esac
+
+      # move library search paths that coincide with paths to not yet
+      # installed libraries to the beginning of the library search list
+      new_libs=
+      for path in $notinst_path; do
+	case " $new_libs " in
+	*" -L$path/$objdir "*) ;;
+	*)
+	  case " $deplibs " in
+	  *" -L$path/$objdir "*)
+	    func_append new_libs " -L$path/$objdir" ;;
+	  esac
+	  ;;
+	esac
+      done
+      for deplib in $deplibs; do
+	case $deplib in
+	-L*)
+	  case " $new_libs " in
+	  *" $deplib "*) ;;
+	  *) func_append new_libs " $deplib" ;;
+	  esac
+	  ;;
+	*) func_append new_libs " $deplib" ;;
+	esac
+      done
+      deplibs="$new_libs"
+
+      # All the library-specific variables (install_libdir is set above).
+      library_names=
+      old_library=
+      dlname=
+
+      # Test again, we may have decided not to build it any more
+      if test "$build_libtool_libs" = yes; then
+	# Remove ${wl} instances when linking with ld.
+	# FIXME: should test the right _cmds variable.
+	case $archive_cmds in
+	  *\$LD\ *) wl= ;;
+        esac
+	if test "$hardcode_into_libs" = yes; then
+	  # Hardcode the library paths
+	  hardcode_libdirs=
+	  dep_rpath=
+	  rpath="$finalize_rpath"
+	  test "$opt_mode" != relink && rpath="$compile_rpath$rpath"
+	  for libdir in $rpath; do
+	    if test -n "$hardcode_libdir_flag_spec"; then
+	      if test -n "$hardcode_libdir_separator"; then
+		func_replace_sysroot "$libdir"
+		libdir=$func_replace_sysroot_result
+		if test -z "$hardcode_libdirs"; then
+		  hardcode_libdirs="$libdir"
+		else
+		  # Just accumulate the unique libdirs.
+		  case $hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator in
+		  *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*)
+		    ;;
+		  *)
+		    func_append hardcode_libdirs "$hardcode_libdir_separator$libdir"
+		    ;;
+		  esac
+		fi
+	      else
+		eval flag=\"$hardcode_libdir_flag_spec\"
+		func_append dep_rpath " $flag"
+	      fi
+	    elif test -n "$runpath_var"; then
+	      case "$perm_rpath " in
+	      *" $libdir "*) ;;
+	      *) func_append perm_rpath " $libdir" ;;
+	      esac
+	    fi
+	  done
+	  # Substitute the hardcoded libdirs into the rpath.
+	  if test -n "$hardcode_libdir_separator" &&
+	     test -n "$hardcode_libdirs"; then
+	    libdir="$hardcode_libdirs"
+	    eval "dep_rpath=\"$hardcode_libdir_flag_spec\""
+	  fi
+	  if test -n "$runpath_var" && test -n "$perm_rpath"; then
+	    # We should set the runpath_var.
+	    rpath=
+	    for dir in $perm_rpath; do
+	      func_append rpath "$dir:"
+	    done
+	    eval "$runpath_var='$rpath\$$runpath_var'; export $runpath_var"
+	  fi
+	  test -n "$dep_rpath" && deplibs="$dep_rpath $deplibs"
+	fi
+
+	shlibpath="$finalize_shlibpath"
+	test "$opt_mode" != relink && shlibpath="$compile_shlibpath$shlibpath"
+	if test -n "$shlibpath"; then
+	  eval "$shlibpath_var='$shlibpath\$$shlibpath_var'; export $shlibpath_var"
+	fi
+
+	# Get the real and link names of the library.
+	eval shared_ext=\"$shrext_cmds\"
+	eval library_names=\"$library_names_spec\"
+	set dummy $library_names
+	shift
+	realname="$1"
+	shift
+
+	if test -n "$soname_spec"; then
+	  eval soname=\"$soname_spec\"
+	else
+	  soname="$realname"
+	fi
+	if test -z "$dlname"; then
+	  dlname=$soname
+	fi
+
+	lib="$output_objdir/$realname"
+	linknames=
+	for link
+	do
+	  func_append linknames " $link"
+	done
+
+	# Use standard objects if they are pic
+	test -z "$pic_flag" && libobjs=`$ECHO "$libobjs" | $SP2NL | $SED "$lo2o" | $NL2SP`
+	test "X$libobjs" = "X " && libobjs=
+
+	delfiles=
+	if test -n "$export_symbols" && test -n "$include_expsyms"; then
+	  $opt_dry_run || cp "$export_symbols" "$output_objdir/$libname.uexp"
+	  export_symbols="$output_objdir/$libname.uexp"
+	  func_append delfiles " $export_symbols"
+	fi
+
+	orig_export_symbols=
+	case $host_os in
+	cygwin* | mingw* | cegcc*)
+	  if test -n "$export_symbols" && test -z "$export_symbols_regex"; then
+	    # exporting using user supplied symfile
+	    if test "x`$SED 1q $export_symbols`" != xEXPORTS; then
+	      # and it's NOT already a .def file. Must figure out
+	      # which of the given symbols are data symbols and tag
+	      # them as such. So, trigger use of export_symbols_cmds.
+	      # export_symbols gets reassigned inside the "prepare
+	      # the list of exported symbols" if statement, so the
+	      # include_expsyms logic still works.
+	      orig_export_symbols="$export_symbols"
+	      export_symbols=
+	      always_export_symbols=yes
+	    fi
+	  fi
+	  ;;
+	esac
+
+	# Prepare the list of exported symbols
+	if test -z "$export_symbols"; then
+	  if test "$always_export_symbols" = yes || test -n "$export_symbols_regex"; then
+	    func_verbose "generating symbol list for \`$libname.la'"
+	    export_symbols="$output_objdir/$libname.exp"
+	    $opt_dry_run || $RM $export_symbols
+	    cmds=$export_symbols_cmds
+	    save_ifs="$IFS"; IFS='~'
+	    for cmd1 in $cmds; do
+	      IFS="$save_ifs"
+	      # Take the normal branch if the nm_file_list_spec branch
+	      # doesn't work or if tool conversion is not needed.
+	      case $nm_file_list_spec~$to_tool_file_cmd in
+		*~func_convert_file_noop | *~func_convert_file_msys_to_w32 | ~*)
+		  try_normal_branch=yes
+		  eval cmd=\"$cmd1\"
+		  func_len " $cmd"
+		  len=$func_len_result
+		  ;;
+		*)
+		  try_normal_branch=no
+		  ;;
+	      esac
+	      if test "$try_normal_branch" = yes \
+		 && { test "$len" -lt "$max_cmd_len" \
+		      || test "$max_cmd_len" -le -1; }
+	      then
+		func_show_eval "$cmd" 'exit $?'
+		skipped_export=false
+	      elif test -n "$nm_file_list_spec"; then
+		func_basename "$output"
+		output_la=$func_basename_result
+		save_libobjs=$libobjs
+		save_output=$output
+		output=${output_objdir}/${output_la}.nm
+		func_to_tool_file "$output"
+		libobjs=$nm_file_list_spec$func_to_tool_file_result
+		func_append delfiles " $output"
+		func_verbose "creating $NM input file list: $output"
+		for obj in $save_libobjs; do
+		  func_to_tool_file "$obj"
+		  $ECHO "$func_to_tool_file_result"
+		done > "$output"
+		eval cmd=\"$cmd1\"
+		func_show_eval "$cmd" 'exit $?'
+		output=$save_output
+		libobjs=$save_libobjs
+		skipped_export=false
+	      else
+		# The command line is too long to execute in one step.
+		func_verbose "using reloadable object file for export list..."
+		skipped_export=:
+		# Break out early, otherwise skipped_export may be
+		# set to false by a later but shorter cmd.
+		break
+	      fi
+	    done
+	    IFS="$save_ifs"
+	    if test -n "$export_symbols_regex" && test "X$skipped_export" != "X:"; then
+	      func_show_eval '$EGREP -e "$export_symbols_regex" "$export_symbols" > "${export_symbols}T"'
+	      func_show_eval '$MV "${export_symbols}T" "$export_symbols"'
+	    fi
+	  fi
+	fi
+
+	if test -n "$export_symbols" && test -n "$include_expsyms"; then
+	  tmp_export_symbols="$export_symbols"
+	  test -n "$orig_export_symbols" && tmp_export_symbols="$orig_export_symbols"
+	  $opt_dry_run || eval '$ECHO "$include_expsyms" | $SP2NL >> "$tmp_export_symbols"'
+	fi
+
+	if test "X$skipped_export" != "X:" && test -n "$orig_export_symbols"; then
+	  # The given exports_symbols file has to be filtered, so filter it.
+	  func_verbose "filter symbol list for \`$libname.la' to tag DATA exports"
+	  # FIXME: $output_objdir/$libname.filter potentially contains lots of
+	  # 's' commands which not all seds can handle. GNU sed should be fine
+	  # though. Also, the filter scales superlinearly with the number of
+	  # global variables. join(1) would be nice here, but unfortunately
+	  # isn't a blessed tool.
+	  $opt_dry_run || $SED -e '/[ ,]DATA/!d;s,\(.*\)\([ \,].*\),s|^\1$|\1\2|,' < $export_symbols > $output_objdir/$libname.filter
+	  func_append delfiles " $export_symbols $output_objdir/$libname.filter"
+	  export_symbols=$output_objdir/$libname.def
+	  $opt_dry_run || $SED -f $output_objdir/$libname.filter < $orig_export_symbols > $export_symbols
+	fi
+
+	tmp_deplibs=
+	for test_deplib in $deplibs; do
+	  case " $convenience " in
+	  *" $test_deplib "*) ;;
+	  *)
+	    func_append tmp_deplibs " $test_deplib"
+	    ;;
+	  esac
+	done
+	deplibs="$tmp_deplibs"
+
+	if test -n "$convenience"; then
+	  if test -n "$whole_archive_flag_spec" &&
+	    test "$compiler_needs_object" = yes &&
+	    test -z "$libobjs"; then
+	    # extract the archives, so we have objects to list.
+	    # TODO: could optimize this to just extract one archive.
+	    whole_archive_flag_spec=
+	  fi
+	  if test -n "$whole_archive_flag_spec"; then
+	    save_libobjs=$libobjs
+	    eval libobjs=\"\$libobjs $whole_archive_flag_spec\"
+	    test "X$libobjs" = "X " && libobjs=
+	  else
+	    gentop="$output_objdir/${outputname}x"
+	    func_append generated " $gentop"
+
+	    func_extract_archives $gentop $convenience
+	    func_append libobjs " $func_extract_archives_result"
+	    test "X$libobjs" = "X " && libobjs=
+	  fi
+	fi
+
+	if test "$thread_safe" = yes && test -n "$thread_safe_flag_spec"; then
+	  eval flag=\"$thread_safe_flag_spec\"
+	  func_append linker_flags " $flag"
+	fi
+
+	# Make a backup of the uninstalled library when relinking
+	if test "$opt_mode" = relink; then
+	  $opt_dry_run || eval '(cd $output_objdir && $RM ${realname}U && $MV $realname ${realname}U)' || exit $?
+	fi
+
+	# Do each of the archive commands.
+	if test "$module" = yes && test -n "$module_cmds" ; then
+	  if test -n "$export_symbols" && test -n "$module_expsym_cmds"; then
+	    eval test_cmds=\"$module_expsym_cmds\"
+	    cmds=$module_expsym_cmds
+	  else
+	    eval test_cmds=\"$module_cmds\"
+	    cmds=$module_cmds
+	  fi
+	else
+	  if test -n "$export_symbols" && test -n "$archive_expsym_cmds"; then
+	    eval test_cmds=\"$archive_expsym_cmds\"
+	    cmds=$archive_expsym_cmds
+	  else
+	    eval test_cmds=\"$archive_cmds\"
+	    cmds=$archive_cmds
+	  fi
+	fi
+
+	if test "X$skipped_export" != "X:" &&
+	   func_len " $test_cmds" &&
+	   len=$func_len_result &&
+	   test "$len" -lt "$max_cmd_len" || test "$max_cmd_len" -le -1; then
+	  :
+	else
+	  # The command line is too long to link in one step, link piecewise
+	  # or, if using GNU ld and skipped_export is not :, use a linker
+	  # script.
+
+	  # Save the value of $output and $libobjs because we want to
+	  # use them later.  If we have whole_archive_flag_spec, we
+	  # want to use save_libobjs as it was before
+	  # whole_archive_flag_spec was expanded, because we can't
+	  # assume the linker understands whole_archive_flag_spec.
+	  # This may have to be revisited, in case too many
+	  # convenience libraries get linked in and end up exceeding
+	  # the spec.
+	  if test -z "$convenience" || test -z "$whole_archive_flag_spec"; then
+	    save_libobjs=$libobjs
+	  fi
+	  save_output=$output
+	  func_basename "$output"
+	  output_la=$func_basename_result
+
+	  # Clear the reloadable object creation command queue and
+	  # initialize k to one.
+	  test_cmds=
+	  concat_cmds=
+	  objlist=
+	  last_robj=
+	  k=1
+
+	  if test -n "$save_libobjs" && test "X$skipped_export" != "X:" && test "$with_gnu_ld" = yes; then
+	    output=${output_objdir}/${output_la}.lnkscript
+	    func_verbose "creating GNU ld script: $output"
+	    echo 'INPUT (' > $output
+	    for obj in $save_libobjs
+	    do
+	      func_to_tool_file "$obj"
+	      $ECHO "$func_to_tool_file_result" >> $output
+	    done
+	    echo ')' >> $output
+	    func_append delfiles " $output"
+	    func_to_tool_file "$output"
+	    output=$func_to_tool_file_result
+	  elif test -n "$save_libobjs" && test "X$skipped_export" != "X:" && test "X$file_list_spec" != X; then
+	    output=${output_objdir}/${output_la}.lnk
+	    func_verbose "creating linker input file list: $output"
+	    : > $output
+	    set x $save_libobjs
+	    shift
+	    firstobj=
+	    if test "$compiler_needs_object" = yes; then
+	      firstobj="$1 "
+	      shift
+	    fi
+	    for obj
+	    do
+	      func_to_tool_file "$obj"
+	      $ECHO "$func_to_tool_file_result" >> $output
+	    done
+	    func_append delfiles " $output"
+	    func_to_tool_file "$output"
+	    output=$firstobj\"$file_list_spec$func_to_tool_file_result\"
+	  else
+	    if test -n "$save_libobjs"; then
+	      func_verbose "creating reloadable object files..."
+	      output=$output_objdir/$output_la-${k}.$objext
+	      eval test_cmds=\"$reload_cmds\"
+	      func_len " $test_cmds"
+	      len0=$func_len_result
+	      len=$len0
+
+	      # Loop over the list of objects to be linked.
+	      for obj in $save_libobjs
+	      do
+		func_len " $obj"
+		func_arith $len + $func_len_result
+		len=$func_arith_result
+		if test "X$objlist" = X ||
+		   test "$len" -lt "$max_cmd_len"; then
+		  func_append objlist " $obj"
+		else
+		  # The command $test_cmds is almost too long, add a
+		  # command to the queue.
+		  if test "$k" -eq 1 ; then
+		    # The first file doesn't have a previous command to add.
+		    reload_objs=$objlist
+		    eval concat_cmds=\"$reload_cmds\"
+		  else
+		    # All subsequent reloadable object files will link in
+		    # the last one created.
+		    reload_objs="$objlist $last_robj"
+		    eval concat_cmds=\"\$concat_cmds~$reload_cmds~\$RM $last_robj\"
+		  fi
+		  last_robj=$output_objdir/$output_la-${k}.$objext
+		  func_arith $k + 1
+		  k=$func_arith_result
+		  output=$output_objdir/$output_la-${k}.$objext
+		  objlist=" $obj"
+		  func_len " $last_robj"
+		  func_arith $len0 + $func_len_result
+		  len=$func_arith_result
+		fi
+	      done
+	      # Handle the remaining objects by creating one last
+	      # reloadable object file.  All subsequent reloadable object
+	      # files will link in the last one created.
+	      test -z "$concat_cmds" || concat_cmds=$concat_cmds~
+	      reload_objs="$objlist $last_robj"
+	      eval concat_cmds=\"\${concat_cmds}$reload_cmds\"
+	      if test -n "$last_robj"; then
+	        eval concat_cmds=\"\${concat_cmds}~\$RM $last_robj\"
+	      fi
+	      func_append delfiles " $output"
+
+	    else
+	      output=
+	    fi
+
+	    if ${skipped_export-false}; then
+	      func_verbose "generating symbol list for \`$libname.la'"
+	      export_symbols="$output_objdir/$libname.exp"
+	      $opt_dry_run || $RM $export_symbols
+	      libobjs=$output
+	      # Append the command to create the export file.
+	      test -z "$concat_cmds" || concat_cmds=$concat_cmds~
+	      eval concat_cmds=\"\$concat_cmds$export_symbols_cmds\"
+	      if test -n "$last_robj"; then
+		eval concat_cmds=\"\$concat_cmds~\$RM $last_robj\"
+	      fi
+	    fi
+
+	    test -n "$save_libobjs" &&
+	      func_verbose "creating a temporary reloadable object file: $output"
+
+	    # Loop through the commands generated above and execute them.
+	    save_ifs="$IFS"; IFS='~'
+	    for cmd in $concat_cmds; do
+	      IFS="$save_ifs"
+	      $opt_silent || {
+		  func_quote_for_expand "$cmd"
+		  eval "func_echo $func_quote_for_expand_result"
+	      }
+	      $opt_dry_run || eval "$cmd" || {
+		lt_exit=$?
+
+		# Restore the uninstalled library and exit
+		if test "$opt_mode" = relink; then
+		  ( cd "$output_objdir" && \
+		    $RM "${realname}T" && \
+		    $MV "${realname}U" "$realname" )
+		fi
+
+		exit $lt_exit
+	      }
+	    done
+	    IFS="$save_ifs"
+
+	    if test -n "$export_symbols_regex" && ${skipped_export-false}; then
+	      func_show_eval '$EGREP -e "$export_symbols_regex" "$export_symbols" > "${export_symbols}T"'
+	      func_show_eval '$MV "${export_symbols}T" "$export_symbols"'
+	    fi
+	  fi
+
+          if ${skipped_export-false}; then
+	    if test -n "$export_symbols" && test -n "$include_expsyms"; then
+	      tmp_export_symbols="$export_symbols"
+	      test -n "$orig_export_symbols" && tmp_export_symbols="$orig_export_symbols"
+	      $opt_dry_run || eval '$ECHO "$include_expsyms" | $SP2NL >> "$tmp_export_symbols"'
+	    fi
+
+	    if test -n "$orig_export_symbols"; then
+	      # The given exports_symbols file has to be filtered, so filter it.
+	      func_verbose "filter symbol list for \`$libname.la' to tag DATA exports"
+	      # FIXME: $output_objdir/$libname.filter potentially contains lots of
+	      # 's' commands which not all seds can handle. GNU sed should be fine
+	      # though. Also, the filter scales superlinearly with the number of
+	      # global variables. join(1) would be nice here, but unfortunately
+	      # isn't a blessed tool.
+	      $opt_dry_run || $SED -e '/[ ,]DATA/!d;s,\(.*\)\([ \,].*\),s|^\1$|\1\2|,' < $export_symbols > $output_objdir/$libname.filter
+	      func_append delfiles " $export_symbols $output_objdir/$libname.filter"
+	      export_symbols=$output_objdir/$libname.def
+	      $opt_dry_run || $SED -f $output_objdir/$libname.filter < $orig_export_symbols > $export_symbols
+	    fi
+	  fi
+
+	  libobjs=$output
+	  # Restore the value of output.
+	  output=$save_output
+
+	  if test -n "$convenience" && test -n "$whole_archive_flag_spec"; then
+	    eval libobjs=\"\$libobjs $whole_archive_flag_spec\"
+	    test "X$libobjs" = "X " && libobjs=
+	  fi
+	  # Expand the library linking commands again to reset the
+	  # value of $libobjs for piecewise linking.
+
+	  # Do each of the archive commands.
+	  if test "$module" = yes && test -n "$module_cmds" ; then
+	    if test -n "$export_symbols" && test -n "$module_expsym_cmds"; then
+	      cmds=$module_expsym_cmds
+	    else
+	      cmds=$module_cmds
+	    fi
+	  else
+	    if test -n "$export_symbols" && test -n "$archive_expsym_cmds"; then
+	      cmds=$archive_expsym_cmds
+	    else
+	      cmds=$archive_cmds
+	    fi
+	  fi
+	fi
+
+	if test -n "$delfiles"; then
+	  # Append the command to remove temporary files to $cmds.
+	  eval cmds=\"\$cmds~\$RM $delfiles\"
+	fi
+
+	# Add any objects from preloaded convenience libraries
+	if test -n "$dlprefiles"; then
+	  gentop="$output_objdir/${outputname}x"
+	  func_append generated " $gentop"
+
+	  func_extract_archives $gentop $dlprefiles
+	  func_append libobjs " $func_extract_archives_result"
+	  test "X$libobjs" = "X " && libobjs=
+	fi
+
+	save_ifs="$IFS"; IFS='~'
+	for cmd in $cmds; do
+	  IFS="$save_ifs"
+	  eval cmd=\"$cmd\"
+	  $opt_silent || {
+	    func_quote_for_expand "$cmd"
+	    eval "func_echo $func_quote_for_expand_result"
+	  }
+	  $opt_dry_run || eval "$cmd" || {
+	    lt_exit=$?
+
+	    # Restore the uninstalled library and exit
+	    if test "$opt_mode" = relink; then
+	      ( cd "$output_objdir" && \
+	        $RM "${realname}T" && \
+		$MV "${realname}U" "$realname" )
+	    fi
+
+	    exit $lt_exit
+	  }
+	done
+	IFS="$save_ifs"
+
+	# Restore the uninstalled library and exit
+	if test "$opt_mode" = relink; then
+	  $opt_dry_run || eval '(cd $output_objdir && $RM ${realname}T && $MV $realname ${realname}T && $MV ${realname}U $realname)' || exit $?
+
+	  if test -n "$convenience"; then
+	    if test -z "$whole_archive_flag_spec"; then
+	      func_show_eval '${RM}r "$gentop"'
+	    fi
+	  fi
+
+	  exit $EXIT_SUCCESS
+	fi
+
+	# Create links to the real library.
+	for linkname in $linknames; do
+	  if test "$realname" != "$linkname"; then
+	    func_show_eval '(cd "$output_objdir" && $RM "$linkname" && $LN_S "$realname" "$linkname")' 'exit $?'
+	  fi
+	done
+
+	# If -module or -export-dynamic was specified, set the dlname.
+	if test "$module" = yes || test "$export_dynamic" = yes; then
+	  # On all known operating systems, these are identical.
+	  dlname="$soname"
+	fi
+      fi
+      ;;
+
+    obj)
+      if test -n "$dlfiles$dlprefiles" || test "$dlself" != no; then
+	func_warning "\`-dlopen' is ignored for objects"
+      fi
+
+      case " $deplibs" in
+      *\ -l* | *\ -L*)
+	func_warning "\`-l' and \`-L' are ignored for objects" ;;
+      esac
+
+      test -n "$rpath" && \
+	func_warning "\`-rpath' is ignored for objects"
+
+      test -n "$xrpath" && \
+	func_warning "\`-R' is ignored for objects"
+
+      test -n "$vinfo" && \
+	func_warning "\`-version-info' is ignored for objects"
+
+      test -n "$release" && \
+	func_warning "\`-release' is ignored for objects"
+
+      case $output in
+      *.lo)
+	test -n "$objs$old_deplibs" && \
+	  func_fatal_error "cannot build library object \`$output' from non-libtool objects"
+
+	libobj=$output
+	func_lo2o "$libobj"
+	obj=$func_lo2o_result
+	;;
+      *)
+	libobj=
+	obj="$output"
+	;;
+      esac
+
+      # Delete the old objects.
+      $opt_dry_run || $RM $obj $libobj
+
+      # Objects from convenience libraries.  This assumes
+      # single-version convenience libraries.  Whenever we create
+      # different ones for PIC/non-PIC, this we'll have to duplicate
+      # the extraction.
+      reload_conv_objs=
+      gentop=
+      # reload_cmds runs $LD directly, so let us get rid of
+      # -Wl from whole_archive_flag_spec and hope we can get by with
+      # turning comma into space..
+      wl=
+
+      if test -n "$convenience"; then
+	if test -n "$whole_archive_flag_spec"; then
+	  eval tmp_whole_archive_flags=\"$whole_archive_flag_spec\"
+	  reload_conv_objs=$reload_objs\ `$ECHO "$tmp_whole_archive_flags" | $SED 's|,| |g'`
+	else
+	  gentop="$output_objdir/${obj}x"
+	  func_append generated " $gentop"
+
+	  func_extract_archives $gentop $convenience
+	  reload_conv_objs="$reload_objs $func_extract_archives_result"
+	fi
+      fi
+
+      # If we're not building shared, we need to use non_pic_objs
+      test "$build_libtool_libs" != yes && libobjs="$non_pic_objects"
+
+      # Create the old-style object.
+      reload_objs="$objs$old_deplibs "`$ECHO "$libobjs" | $SP2NL | $SED "/\.${libext}$/d; /\.lib$/d; $lo2o" | $NL2SP`" $reload_conv_objs" ### testsuite: skip nested quoting test
+
+      output="$obj"
+      func_execute_cmds "$reload_cmds" 'exit $?'
+
+      # Exit if we aren't doing a library object file.
+      if test -z "$libobj"; then
+	if test -n "$gentop"; then
+	  func_show_eval '${RM}r "$gentop"'
+	fi
+
+	exit $EXIT_SUCCESS
+      fi
+
+      if test "$build_libtool_libs" != yes; then
+	if test -n "$gentop"; then
+	  func_show_eval '${RM}r "$gentop"'
+	fi
+
+	# Create an invalid libtool object if no PIC, so that we don't
+	# accidentally link it into a program.
+	# $show "echo timestamp > $libobj"
+	# $opt_dry_run || eval "echo timestamp > $libobj" || exit $?
+	exit $EXIT_SUCCESS
+      fi
+
+      if test -n "$pic_flag" || test "$pic_mode" != default; then
+	# Only do commands if we really have different PIC objects.
+	reload_objs="$libobjs $reload_conv_objs"
+	output="$libobj"
+	func_execute_cmds "$reload_cmds" 'exit $?'
+      fi
+
+      if test -n "$gentop"; then
+	func_show_eval '${RM}r "$gentop"'
+      fi
+
+      exit $EXIT_SUCCESS
+      ;;
+
+    prog)
+      case $host in
+	*cygwin*) func_stripname '' '.exe' "$output"
+	          output=$func_stripname_result.exe;;
+      esac
+      test -n "$vinfo" && \
+	func_warning "\`-version-info' is ignored for programs"
+
+      test -n "$release" && \
+	func_warning "\`-release' is ignored for programs"
+
+      test "$preload" = yes \
+        && test "$dlopen_support" = unknown \
+	&& test "$dlopen_self" = unknown \
+	&& test "$dlopen_self_static" = unknown && \
+	  func_warning "\`LT_INIT([dlopen])' not used. Assuming no dlopen support."
+
+      case $host in
+      *-*-rhapsody* | *-*-darwin1.[012])
+	# On Rhapsody replace the C library is the System framework
+	compile_deplibs=`$ECHO " $compile_deplibs" | $SED 's/ -lc / System.ltframework /'`
+	finalize_deplibs=`$ECHO " $finalize_deplibs" | $SED 's/ -lc / System.ltframework /'`
+	;;
+      esac
+
+      case $host in
+      *-*-darwin*)
+	# Don't allow lazy linking, it breaks C++ global constructors
+	# But is supposedly fixed on 10.4 or later (yay!).
+	if test "$tagname" = CXX ; then
+	  case ${MACOSX_DEPLOYMENT_TARGET-10.0} in
+	    10.[0123])
+	      func_append compile_command " ${wl}-bind_at_load"
+	      func_append finalize_command " ${wl}-bind_at_load"
+	    ;;
+	  esac
+	fi
+	# Time to change all our "foo.ltframework" stuff back to "-framework foo"
+	compile_deplibs=`$ECHO " $compile_deplibs" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'`
+	finalize_deplibs=`$ECHO " $finalize_deplibs" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'`
+	;;
+      esac
+
+
+      # move library search paths that coincide with paths to not yet
+      # installed libraries to the beginning of the library search list
+      new_libs=
+      for path in $notinst_path; do
+	case " $new_libs " in
+	*" -L$path/$objdir "*) ;;
+	*)
+	  case " $compile_deplibs " in
+	  *" -L$path/$objdir "*)
+	    func_append new_libs " -L$path/$objdir" ;;
+	  esac
+	  ;;
+	esac
+      done
+      for deplib in $compile_deplibs; do
+	case $deplib in
+	-L*)
+	  case " $new_libs " in
+	  *" $deplib "*) ;;
+	  *) func_append new_libs " $deplib" ;;
+	  esac
+	  ;;
+	*) func_append new_libs " $deplib" ;;
+	esac
+      done
+      compile_deplibs="$new_libs"
+
+
+      func_append compile_command " $compile_deplibs"
+      func_append finalize_command " $finalize_deplibs"
+
+      if test -n "$rpath$xrpath"; then
+	# If the user specified any rpath flags, then add them.
+	for libdir in $rpath $xrpath; do
+	  # This is the magic to use -rpath.
+	  case "$finalize_rpath " in
+	  *" $libdir "*) ;;
+	  *) func_append finalize_rpath " $libdir" ;;
+	  esac
+	done
+      fi
+
+      # Now hardcode the library paths
+      rpath=
+      hardcode_libdirs=
+      for libdir in $compile_rpath $finalize_rpath; do
+	if test -n "$hardcode_libdir_flag_spec"; then
+	  if test -n "$hardcode_libdir_separator"; then
+	    if test -z "$hardcode_libdirs"; then
+	      hardcode_libdirs="$libdir"
+	    else
+	      # Just accumulate the unique libdirs.
+	      case $hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator in
+	      *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*)
+		;;
+	      *)
+		func_append hardcode_libdirs "$hardcode_libdir_separator$libdir"
+		;;
+	      esac
+	    fi
+	  else
+	    eval flag=\"$hardcode_libdir_flag_spec\"
+	    func_append rpath " $flag"
+	  fi
+	elif test -n "$runpath_var"; then
+	  case "$perm_rpath " in
+	  *" $libdir "*) ;;
+	  *) func_append perm_rpath " $libdir" ;;
+	  esac
+	fi
+	case $host in
+	*-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2* | *-cegcc*)
+	  testbindir=`${ECHO} "$libdir" | ${SED} -e 's*/lib$*/bin*'`
+	  case :$dllsearchpath: in
+	  *":$libdir:"*) ;;
+	  ::) dllsearchpath=$libdir;;
+	  *) func_append dllsearchpath ":$libdir";;
+	  esac
+	  case :$dllsearchpath: in
+	  *":$testbindir:"*) ;;
+	  ::) dllsearchpath=$testbindir;;
+	  *) func_append dllsearchpath ":$testbindir";;
+	  esac
+	  ;;
+	esac
+      done
+      # Substitute the hardcoded libdirs into the rpath.
+      if test -n "$hardcode_libdir_separator" &&
+	 test -n "$hardcode_libdirs"; then
+	libdir="$hardcode_libdirs"
+	eval rpath=\" $hardcode_libdir_flag_spec\"
+      fi
+      compile_rpath="$rpath"
+
+      rpath=
+      hardcode_libdirs=
+      for libdir in $finalize_rpath; do
+	if test -n "$hardcode_libdir_flag_spec"; then
+	  if test -n "$hardcode_libdir_separator"; then
+	    if test -z "$hardcode_libdirs"; then
+	      hardcode_libdirs="$libdir"
+	    else
+	      # Just accumulate the unique libdirs.
+	      case $hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator in
+	      *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*)
+		;;
+	      *)
+		func_append hardcode_libdirs "$hardcode_libdir_separator$libdir"
+		;;
+	      esac
+	    fi
+	  else
+	    eval flag=\"$hardcode_libdir_flag_spec\"
+	    func_append rpath " $flag"
+	  fi
+	elif test -n "$runpath_var"; then
+	  case "$finalize_perm_rpath " in
+	  *" $libdir "*) ;;
+	  *) func_append finalize_perm_rpath " $libdir" ;;
+	  esac
+	fi
+      done
+      # Substitute the hardcoded libdirs into the rpath.
+      if test -n "$hardcode_libdir_separator" &&
+	 test -n "$hardcode_libdirs"; then
+	libdir="$hardcode_libdirs"
+	eval rpath=\" $hardcode_libdir_flag_spec\"
+      fi
+      finalize_rpath="$rpath"
+
+      if test -n "$libobjs" && test "$build_old_libs" = yes; then
+	# Transform all the library objects into standard objects.
+	compile_command=`$ECHO "$compile_command" | $SP2NL | $SED "$lo2o" | $NL2SP`
+	finalize_command=`$ECHO "$finalize_command" | $SP2NL | $SED "$lo2o" | $NL2SP`
+      fi
+
+      func_generate_dlsyms "$outputname" "@PROGRAM@" "no"
+
+      # template prelinking step
+      if test -n "$prelink_cmds"; then
+	func_execute_cmds "$prelink_cmds" 'exit $?'
+      fi
+
+      wrappers_required=yes
+      case $host in
+      *cegcc* | *mingw32ce*)
+        # Disable wrappers for cegcc and mingw32ce hosts, we are cross compiling anyway.
+        wrappers_required=no
+        ;;
+      *cygwin* | *mingw* )
+        if test "$build_libtool_libs" != yes; then
+          wrappers_required=no
+        fi
+        ;;
+      *)
+        if test "$need_relink" = no || test "$build_libtool_libs" != yes; then
+          wrappers_required=no
+        fi
+        ;;
+      esac
+      if test "$wrappers_required" = no; then
+	# Replace the output file specification.
+	compile_command=`$ECHO "$compile_command" | $SED 's%@OUTPUT@%'"$output"'%g'`
+	link_command="$compile_command$compile_rpath"
+
+	# We have no uninstalled library dependencies, so finalize right now.
+	exit_status=0
+	func_show_eval "$link_command" 'exit_status=$?'
+
+	if test -n "$postlink_cmds"; then
+	  func_to_tool_file "$output"
+	  postlink_cmds=`func_echo_all "$postlink_cmds" | $SED -e 's%@OUTPUT@%'"$output"'%g' -e 's%@TOOL_OUTPUT@%'"$func_to_tool_file_result"'%g'`
+	  func_execute_cmds "$postlink_cmds" 'exit $?'
+	fi
+
+	# Delete the generated files.
+	if test -f "$output_objdir/${outputname}S.${objext}"; then
+	  func_show_eval '$RM "$output_objdir/${outputname}S.${objext}"'
+	fi
+
+	exit $exit_status
+      fi
+
+      if test -n "$compile_shlibpath$finalize_shlibpath"; then
+	compile_command="$shlibpath_var=\"$compile_shlibpath$finalize_shlibpath\$$shlibpath_var\" $compile_command"
+      fi
+      if test -n "$finalize_shlibpath"; then
+	finalize_command="$shlibpath_var=\"$finalize_shlibpath\$$shlibpath_var\" $finalize_command"
+      fi
+
+      compile_var=
+      finalize_var=
+      if test -n "$runpath_var"; then
+	if test -n "$perm_rpath"; then
+	  # We should set the runpath_var.
+	  rpath=
+	  for dir in $perm_rpath; do
+	    func_append rpath "$dir:"
+	  done
+	  compile_var="$runpath_var=\"$rpath\$$runpath_var\" "
+	fi
+	if test -n "$finalize_perm_rpath"; then
+	  # We should set the runpath_var.
+	  rpath=
+	  for dir in $finalize_perm_rpath; do
+	    func_append rpath "$dir:"
+	  done
+	  finalize_var="$runpath_var=\"$rpath\$$runpath_var\" "
+	fi
+      fi
+
+      if test "$no_install" = yes; then
+	# We don't need to create a wrapper script.
+	link_command="$compile_var$compile_command$compile_rpath"
+	# Replace the output file specification.
+	link_command=`$ECHO "$link_command" | $SED 's%@OUTPUT@%'"$output"'%g'`
+	# Delete the old output file.
+	$opt_dry_run || $RM $output
+	# Link the executable and exit
+	func_show_eval "$link_command" 'exit $?'
+
+	if test -n "$postlink_cmds"; then
+	  func_to_tool_file "$output"
+	  postlink_cmds=`func_echo_all "$postlink_cmds" | $SED -e 's%@OUTPUT@%'"$output"'%g' -e 's%@TOOL_OUTPUT@%'"$func_to_tool_file_result"'%g'`
+	  func_execute_cmds "$postlink_cmds" 'exit $?'
+	fi
+
+	exit $EXIT_SUCCESS
+      fi
+
+      if test "$hardcode_action" = relink; then
+	# Fast installation is not supported
+	link_command="$compile_var$compile_command$compile_rpath"
+	relink_command="$finalize_var$finalize_command$finalize_rpath"
+
+	func_warning "this platform does not like uninstalled shared libraries"
+	func_warning "\`$output' will be relinked during installation"
+      else
+	if test "$fast_install" != no; then
+	  link_command="$finalize_var$compile_command$finalize_rpath"
+	  if test "$fast_install" = yes; then
+	    relink_command=`$ECHO "$compile_var$compile_command$compile_rpath" | $SED 's%@OUTPUT@%\$progdir/\$file%g'`
+	  else
+	    # fast_install is set to needless
+	    relink_command=
+	  fi
+	else
+	  link_command="$compile_var$compile_command$compile_rpath"
+	  relink_command="$finalize_var$finalize_command$finalize_rpath"
+	fi
+      fi
+
+      # Replace the output file specification.
+      link_command=`$ECHO "$link_command" | $SED 's%@OUTPUT@%'"$output_objdir/$outputname"'%g'`
+
+      # Delete the old output files.
+      $opt_dry_run || $RM $output $output_objdir/$outputname $output_objdir/lt-$outputname
+
+      func_show_eval "$link_command" 'exit $?'
+
+      if test -n "$postlink_cmds"; then
+	func_to_tool_file "$output_objdir/$outputname"
+	postlink_cmds=`func_echo_all "$postlink_cmds" | $SED -e 's%@OUTPUT@%'"$output_objdir/$outputname"'%g' -e 's%@TOOL_OUTPUT@%'"$func_to_tool_file_result"'%g'`
+	func_execute_cmds "$postlink_cmds" 'exit $?'
+      fi
+
+      # Now create the wrapper script.
+      func_verbose "creating $output"
+
+      # Quote the relink command for shipping.
+      if test -n "$relink_command"; then
+	# Preserve any variables that may affect compiler behavior
+	for var in $variables_saved_for_relink; do
+	  if eval test -z \"\${$var+set}\"; then
+	    relink_command="{ test -z \"\${$var+set}\" || $lt_unset $var || { $var=; export $var; }; }; $relink_command"
+	  elif eval var_value=\$$var; test -z "$var_value"; then
+	    relink_command="$var=; export $var; $relink_command"
+	  else
+	    func_quote_for_eval "$var_value"
+	    relink_command="$var=$func_quote_for_eval_result; export $var; $relink_command"
+	  fi
+	done
+	relink_command="(cd `pwd`; $relink_command)"
+	relink_command=`$ECHO "$relink_command" | $SED "$sed_quote_subst"`
+      fi
+
+      # Only actually do things if not in dry run mode.
+      $opt_dry_run || {
+	# win32 will think the script is a binary if it has
+	# a .exe suffix, so we strip it off here.
+	case $output in
+	  *.exe) func_stripname '' '.exe' "$output"
+	         output=$func_stripname_result ;;
+	esac
+	# test for cygwin because mv fails w/o .exe extensions
+	case $host in
+	  *cygwin*)
+	    exeext=.exe
+	    func_stripname '' '.exe' "$outputname"
+	    outputname=$func_stripname_result ;;
+	  *) exeext= ;;
+	esac
+	case $host in
+	  *cygwin* | *mingw* )
+	    func_dirname_and_basename "$output" "" "."
+	    output_name=$func_basename_result
+	    output_path=$func_dirname_result
+	    cwrappersource="$output_path/$objdir/lt-$output_name.c"
+	    cwrapper="$output_path/$output_name.exe"
+	    $RM $cwrappersource $cwrapper
+	    trap "$RM $cwrappersource $cwrapper; exit $EXIT_FAILURE" 1 2 15
+
+	    func_emit_cwrapperexe_src > $cwrappersource
+
+	    # The wrapper executable is built using the $host compiler,
+	    # because it contains $host paths and files. If cross-
+	    # compiling, it, like the target executable, must be
+	    # executed on the $host or under an emulation environment.
+	    $opt_dry_run || {
+	      $LTCC $LTCFLAGS -o $cwrapper $cwrappersource
+	      $STRIP $cwrapper
+	    }
+
+	    # Now, create the wrapper script for func_source use:
+	    func_ltwrapper_scriptname $cwrapper
+	    $RM $func_ltwrapper_scriptname_result
+	    trap "$RM $func_ltwrapper_scriptname_result; exit $EXIT_FAILURE" 1 2 15
+	    $opt_dry_run || {
+	      # note: this script will not be executed, so do not chmod.
+	      if test "x$build" = "x$host" ; then
+		$cwrapper --lt-dump-script > $func_ltwrapper_scriptname_result
+	      else
+		func_emit_wrapper no > $func_ltwrapper_scriptname_result
+	      fi
+	    }
+	  ;;
+	  * )
+	    $RM $output
+	    trap "$RM $output; exit $EXIT_FAILURE" 1 2 15
+
+	    func_emit_wrapper no > $output
+	    chmod +x $output
+	  ;;
+	esac
+      }
+      exit $EXIT_SUCCESS
+      ;;
+    esac
+
+    # See if we need to build an old-fashioned archive.
+    for oldlib in $oldlibs; do
+
+      if test "$build_libtool_libs" = convenience; then
+	oldobjs="$libobjs_save $symfileobj"
+	addlibs="$convenience"
+	build_libtool_libs=no
+      else
+	if test "$build_libtool_libs" = module; then
+	  oldobjs="$libobjs_save"
+	  build_libtool_libs=no
+	else
+	  oldobjs="$old_deplibs $non_pic_objects"
+	  if test "$preload" = yes && test -f "$symfileobj"; then
+	    func_append oldobjs " $symfileobj"
+	  fi
+	fi
+	addlibs="$old_convenience"
+      fi
+
+      if test -n "$addlibs"; then
+	gentop="$output_objdir/${outputname}x"
+	func_append generated " $gentop"
+
+	func_extract_archives $gentop $addlibs
+	func_append oldobjs " $func_extract_archives_result"
+      fi
+
+      # Do each command in the archive commands.
+      if test -n "$old_archive_from_new_cmds" && test "$build_libtool_libs" = yes; then
+	cmds=$old_archive_from_new_cmds
+      else
+
+	# Add any objects from preloaded convenience libraries
+	if test -n "$dlprefiles"; then
+	  gentop="$output_objdir/${outputname}x"
+	  func_append generated " $gentop"
+
+	  func_extract_archives $gentop $dlprefiles
+	  func_append oldobjs " $func_extract_archives_result"
+	fi
+
+	# POSIX demands no paths to be encoded in archives.  We have
+	# to avoid creating archives with duplicate basenames if we
+	# might have to extract them afterwards, e.g., when creating a
+	# static archive out of a convenience library, or when linking
+	# the entirety of a libtool archive into another (currently
+	# not supported by libtool).
+	if (for obj in $oldobjs
+	    do
+	      func_basename "$obj"
+	      $ECHO "$func_basename_result"
+	    done | sort | sort -uc >/dev/null 2>&1); then
+	  :
+	else
+	  echo "copying selected object files to avoid basename conflicts..."
+	  gentop="$output_objdir/${outputname}x"
+	  func_append generated " $gentop"
+	  func_mkdir_p "$gentop"
+	  save_oldobjs=$oldobjs
+	  oldobjs=
+	  counter=1
+	  for obj in $save_oldobjs
+	  do
+	    func_basename "$obj"
+	    objbase="$func_basename_result"
+	    case " $oldobjs " in
+	    " ") oldobjs=$obj ;;
+	    *[\ /]"$objbase "*)
+	      while :; do
+		# Make sure we don't pick an alternate name that also
+		# overlaps.
+		newobj=lt$counter-$objbase
+		func_arith $counter + 1
+		counter=$func_arith_result
+		case " $oldobjs " in
+		*[\ /]"$newobj "*) ;;
+		*) if test ! -f "$gentop/$newobj"; then break; fi ;;
+		esac
+	      done
+	      func_show_eval "ln $obj $gentop/$newobj || cp $obj $gentop/$newobj"
+	      func_append oldobjs " $gentop/$newobj"
+	      ;;
+	    *) func_append oldobjs " $obj" ;;
+	    esac
+	  done
+	fi
+	func_to_tool_file "$oldlib" func_convert_file_msys_to_w32
+	tool_oldlib=$func_to_tool_file_result
+	eval cmds=\"$old_archive_cmds\"
+
+	func_len " $cmds"
+	len=$func_len_result
+	if test "$len" -lt "$max_cmd_len" || test "$max_cmd_len" -le -1; then
+	  cmds=$old_archive_cmds
+	elif test -n "$archiver_list_spec"; then
+	  func_verbose "using command file archive linking..."
+	  for obj in $oldobjs
+	  do
+	    func_to_tool_file "$obj"
+	    $ECHO "$func_to_tool_file_result"
+	  done > $output_objdir/$libname.libcmd
+	  func_to_tool_file "$output_objdir/$libname.libcmd"
+	  oldobjs=" $archiver_list_spec$func_to_tool_file_result"
+	  cmds=$old_archive_cmds
+	else
+	  # the command line is too long to link in one step, link in parts
+	  func_verbose "using piecewise archive linking..."
+	  save_RANLIB=$RANLIB
+	  RANLIB=:
+	  objlist=
+	  concat_cmds=
+	  save_oldobjs=$oldobjs
+	  oldobjs=
+	  # Is there a better way of finding the last object in the list?
+	  for obj in $save_oldobjs
+	  do
+	    last_oldobj=$obj
+	  done
+	  eval test_cmds=\"$old_archive_cmds\"
+	  func_len " $test_cmds"
+	  len0=$func_len_result
+	  len=$len0
+	  for obj in $save_oldobjs
+	  do
+	    func_len " $obj"
+	    func_arith $len + $func_len_result
+	    len=$func_arith_result
+	    func_append objlist " $obj"
+	    if test "$len" -lt "$max_cmd_len"; then
+	      :
+	    else
+	      # the above command should be used before it gets too long
+	      oldobjs=$objlist
+	      if test "$obj" = "$last_oldobj" ; then
+		RANLIB=$save_RANLIB
+	      fi
+	      test -z "$concat_cmds" || concat_cmds=$concat_cmds~
+	      eval concat_cmds=\"\${concat_cmds}$old_archive_cmds\"
+	      objlist=
+	      len=$len0
+	    fi
+	  done
+	  RANLIB=$save_RANLIB
+	  oldobjs=$objlist
+	  if test "X$oldobjs" = "X" ; then
+	    eval cmds=\"\$concat_cmds\"
+	  else
+	    eval cmds=\"\$concat_cmds~\$old_archive_cmds\"
+	  fi
+	fi
+      fi
+      func_execute_cmds "$cmds" 'exit $?'
+    done
+
+    test -n "$generated" && \
+      func_show_eval "${RM}r$generated"
+
+    # Now create the libtool archive.
+    case $output in
+    *.la)
+      old_library=
+      test "$build_old_libs" = yes && old_library="$libname.$libext"
+      func_verbose "creating $output"
+
+      # Preserve any variables that may affect compiler behavior
+      for var in $variables_saved_for_relink; do
+	if eval test -z \"\${$var+set}\"; then
+	  relink_command="{ test -z \"\${$var+set}\" || $lt_unset $var || { $var=; export $var; }; }; $relink_command"
+	elif eval var_value=\$$var; test -z "$var_value"; then
+	  relink_command="$var=; export $var; $relink_command"
+	else
+	  func_quote_for_eval "$var_value"
+	  relink_command="$var=$func_quote_for_eval_result; export $var; $relink_command"
+	fi
+      done
+      # Quote the link command for shipping.
+      relink_command="(cd `pwd`; $SHELL $progpath $preserve_args --mode=relink $libtool_args @inst_prefix_dir@)"
+      relink_command=`$ECHO "$relink_command" | $SED "$sed_quote_subst"`
+      if test "$hardcode_automatic" = yes ; then
+	relink_command=
+      fi
+
+      # Only create the output if not a dry run.
+      $opt_dry_run || {
+	for installed in no yes; do
+	  if test "$installed" = yes; then
+	    if test -z "$install_libdir"; then
+	      break
+	    fi
+	    output="$output_objdir/$outputname"i
+	    # Replace all uninstalled libtool libraries with the installed ones
+	    newdependency_libs=
+	    for deplib in $dependency_libs; do
+	      case $deplib in
+	      *.la)
+		func_basename "$deplib"
+		name="$func_basename_result"
+		func_resolve_sysroot "$deplib"
+		eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $func_resolve_sysroot_result`
+		test -z "$libdir" && \
+		  func_fatal_error "\`$deplib' is not a valid libtool archive"
+		func_append newdependency_libs " ${lt_sysroot:+=}$libdir/$name"
+		;;
+	      -L*)
+		func_stripname -L '' "$deplib"
+		func_replace_sysroot "$func_stripname_result"
+		func_append newdependency_libs " -L$func_replace_sysroot_result"
+		;;
+	      -R*)
+		func_stripname -R '' "$deplib"
+		func_replace_sysroot "$func_stripname_result"
+		func_append newdependency_libs " -R$func_replace_sysroot_result"
+		;;
+	      *) func_append newdependency_libs " $deplib" ;;
+	      esac
+	    done
+	    dependency_libs="$newdependency_libs"
+	    newdlfiles=
+
+	    for lib in $dlfiles; do
+	      case $lib in
+	      *.la)
+	        func_basename "$lib"
+		name="$func_basename_result"
+		eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $lib`
+		test -z "$libdir" && \
+		  func_fatal_error "\`$lib' is not a valid libtool archive"
+		func_append newdlfiles " ${lt_sysroot:+=}$libdir/$name"
+		;;
+	      *) func_append newdlfiles " $lib" ;;
+	      esac
+	    done
+	    dlfiles="$newdlfiles"
+	    newdlprefiles=
+	    for lib in $dlprefiles; do
+	      case $lib in
+	      *.la)
+		# Only pass preopened files to the pseudo-archive (for
+		# eventual linking with the app. that links it) if we
+		# didn't already link the preopened objects directly into
+		# the library:
+		func_basename "$lib"
+		name="$func_basename_result"
+		eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $lib`
+		test -z "$libdir" && \
+		  func_fatal_error "\`$lib' is not a valid libtool archive"
+		func_append newdlprefiles " ${lt_sysroot:+=}$libdir/$name"
+		;;
+	      esac
+	    done
+	    dlprefiles="$newdlprefiles"
+	  else
+	    newdlfiles=
+	    for lib in $dlfiles; do
+	      case $lib in
+		[\\/]* | [A-Za-z]:[\\/]*) abs="$lib" ;;
+		*) abs=`pwd`"/$lib" ;;
+	      esac
+	      func_append newdlfiles " $abs"
+	    done
+	    dlfiles="$newdlfiles"
+	    newdlprefiles=
+	    for lib in $dlprefiles; do
+	      case $lib in
+		[\\/]* | [A-Za-z]:[\\/]*) abs="$lib" ;;
+		*) abs=`pwd`"/$lib" ;;
+	      esac
+	      func_append newdlprefiles " $abs"
+	    done
+	    dlprefiles="$newdlprefiles"
+	  fi
+	  $RM $output
+	  # place dlname in correct position for cygwin
+	  # In fact, it would be nice if we could use this code for all target
+	  # systems that can't hard-code library paths into their executables
+	  # and that have no shared library path variable independent of PATH,
+	  # but it turns out we can't easily determine that from inspecting
+	  # libtool variables, so we have to hard-code the OSs to which it
+	  # applies here; at the moment, that means platforms that use the PE
+	  # object format with DLL files.  See the long comment at the top of
+	  # tests/bindir.at for full details.
+	  tdlname=$dlname
+	  case $host,$output,$installed,$module,$dlname in
+	    *cygwin*,*lai,yes,no,*.dll | *mingw*,*lai,yes,no,*.dll | *cegcc*,*lai,yes,no,*.dll)
+	      # If a -bindir argument was supplied, place the dll there.
+	      if test "x$bindir" != x ;
+	      then
+		func_relative_path "$install_libdir" "$bindir"
+		tdlname=$func_relative_path_result$dlname
+	      else
+		# Otherwise fall back on heuristic.
+		tdlname=../bin/$dlname
+	      fi
+	      ;;
+	  esac
+	  $ECHO > $output "\
+# $outputname - a libtool library file
+# Generated by $PROGRAM (GNU $PACKAGE$TIMESTAMP) $VERSION
+#
+# Please DO NOT delete this file!
+# It is necessary for linking the library.
+
+# The name that we can dlopen(3).
+dlname='$tdlname'
+
+# Names of this library.
+library_names='$library_names'
+
+# The name of the static archive.
+old_library='$old_library'
+
+# Linker flags that can not go in dependency_libs.
+inherited_linker_flags='$new_inherited_linker_flags'
+
+# Libraries that this one depends upon.
+dependency_libs='$dependency_libs'
+
+# Names of additional weak libraries provided by this library
+weak_library_names='$weak_libs'
+
+# Version information for $libname.
+current=$current
+age=$age
+revision=$revision
+
+# Is this an already installed library?
+installed=$installed
+
+# Should we warn about portability when linking against -modules?
+shouldnotlink=$module
+
+# Files to dlopen/dlpreopen
+dlopen='$dlfiles'
+dlpreopen='$dlprefiles'
+
+# Directory that this library needs to be installed in:
+libdir='$install_libdir'"
+	  if test "$installed" = no && test "$need_relink" = yes; then
+	    $ECHO >> $output "\
+relink_command=\"$relink_command\""
+	  fi
+	done
+      }
+
+      # Do a symbolic link so that the libtool archive can be found in
+      # LD_LIBRARY_PATH before the program is installed.
+      func_show_eval '( cd "$output_objdir" && $RM "$outputname" && $LN_S "../$outputname" "$outputname" )' 'exit $?'
+      ;;
+    esac
+    exit $EXIT_SUCCESS
+}
+
+{ test "$opt_mode" = link || test "$opt_mode" = relink; } &&
+    func_mode_link ${1+"$@"}
+
+
+# func_mode_uninstall arg...
+func_mode_uninstall ()
+{
+    $opt_debug
+    RM="$nonopt"
+    files=
+    rmforce=
+    exit_status=0
+
+    # This variable tells wrapper scripts just to set variables rather
+    # than running their programs.
+    libtool_install_magic="$magic"
+
+    for arg
+    do
+      case $arg in
+      -f) func_append RM " $arg"; rmforce=yes ;;
+      -*) func_append RM " $arg" ;;
+      *) func_append files " $arg" ;;
+      esac
+    done
+
+    test -z "$RM" && \
+      func_fatal_help "you must specify an RM program"
+
+    rmdirs=
+
+    for file in $files; do
+      func_dirname "$file" "" "."
+      dir="$func_dirname_result"
+      if test "X$dir" = X.; then
+	odir="$objdir"
+      else
+	odir="$dir/$objdir"
+      fi
+      func_basename "$file"
+      name="$func_basename_result"
+      test "$opt_mode" = uninstall && odir="$dir"
+
+      # Remember odir for removal later, being careful to avoid duplicates
+      if test "$opt_mode" = clean; then
+	case " $rmdirs " in
+	  *" $odir "*) ;;
+	  *) func_append rmdirs " $odir" ;;
+	esac
+      fi
+
+      # Don't error if the file doesn't exist and rm -f was used.
+      if { test -L "$file"; } >/dev/null 2>&1 ||
+	 { test -h "$file"; } >/dev/null 2>&1 ||
+	 test -f "$file"; then
+	:
+      elif test -d "$file"; then
+	exit_status=1
+	continue
+      elif test "$rmforce" = yes; then
+	continue
+      fi
+
+      rmfiles="$file"
+
+      case $name in
+      *.la)
+	# Possibly a libtool archive, so verify it.
+	if func_lalib_p "$file"; then
+	  func_source $dir/$name
+
+	  # Delete the libtool libraries and symlinks.
+	  for n in $library_names; do
+	    func_append rmfiles " $odir/$n"
+	  done
+	  test -n "$old_library" && func_append rmfiles " $odir/$old_library"
+
+	  case "$opt_mode" in
+	  clean)
+	    case " $library_names " in
+	    *" $dlname "*) ;;
+	    *) test -n "$dlname" && func_append rmfiles " $odir/$dlname" ;;
+	    esac
+	    test -n "$libdir" && func_append rmfiles " $odir/$name $odir/${name}i"
+	    ;;
+	  uninstall)
+	    if test -n "$library_names"; then
+	      # Do each command in the postuninstall commands.
+	      func_execute_cmds "$postuninstall_cmds" 'test "$rmforce" = yes || exit_status=1'
+	    fi
+
+	    if test -n "$old_library"; then
+	      # Do each command in the old_postuninstall commands.
+	      func_execute_cmds "$old_postuninstall_cmds" 'test "$rmforce" = yes || exit_status=1'
+	    fi
+	    # FIXME: should reinstall the best remaining shared library.
+	    ;;
+	  esac
+	fi
+	;;
+
+      *.lo)
+	# Possibly a libtool object, so verify it.
+	if func_lalib_p "$file"; then
+
+	  # Read the .lo file
+	  func_source $dir/$name
+
+	  # Add PIC object to the list of files to remove.
+	  if test -n "$pic_object" &&
+	     test "$pic_object" != none; then
+	    func_append rmfiles " $dir/$pic_object"
+	  fi
+
+	  # Add non-PIC object to the list of files to remove.
+	  if test -n "$non_pic_object" &&
+	     test "$non_pic_object" != none; then
+	    func_append rmfiles " $dir/$non_pic_object"
+	  fi
+	fi
+	;;
+
+      *)
+	if test "$opt_mode" = clean ; then
+	  noexename=$name
+	  case $file in
+	  *.exe)
+	    func_stripname '' '.exe' "$file"
+	    file=$func_stripname_result
+	    func_stripname '' '.exe' "$name"
+	    noexename=$func_stripname_result
+	    # $file with .exe has already been added to rmfiles,
+	    # add $file without .exe
+	    func_append rmfiles " $file"
+	    ;;
+	  esac
+	  # Do a test to see if this is a libtool program.
+	  if func_ltwrapper_p "$file"; then
+	    if func_ltwrapper_executable_p "$file"; then
+	      func_ltwrapper_scriptname "$file"
+	      relink_command=
+	      func_source $func_ltwrapper_scriptname_result
+	      func_append rmfiles " $func_ltwrapper_scriptname_result"
+	    else
+	      relink_command=
+	      func_source $dir/$noexename
+	    fi
+
+	    # note $name still contains .exe if it was in $file originally
+	    # as does the version of $file that was added into $rmfiles
+	    func_append rmfiles " $odir/$name $odir/${name}S.${objext}"
+	    if test "$fast_install" = yes && test -n "$relink_command"; then
+	      func_append rmfiles " $odir/lt-$name"
+	    fi
+	    if test "X$noexename" != "X$name" ; then
+	      func_append rmfiles " $odir/lt-${noexename}.c"
+	    fi
+	  fi
+	fi
+	;;
+      esac
+      func_show_eval "$RM $rmfiles" 'exit_status=1'
+    done
+
+    # Try to remove the ${objdir}s in the directories where we deleted files
+    for dir in $rmdirs; do
+      if test -d "$dir"; then
+	func_show_eval "rmdir $dir >/dev/null 2>&1"
+      fi
+    done
+
+    exit $exit_status
+}
+
+{ test "$opt_mode" = uninstall || test "$opt_mode" = clean; } &&
+    func_mode_uninstall ${1+"$@"}
+
+test -z "$opt_mode" && {
+  help="$generic_help"
+  func_fatal_help "you must specify a MODE"
+}
+
+test -z "$exec_cmd" && \
+  func_fatal_help "invalid operation mode \`$opt_mode'"
+
+if test -n "$exec_cmd"; then
+  eval exec "$exec_cmd"
+  exit $EXIT_FAILURE
+fi
+
+exit $exit_status
+
+
+# The TAGs below are defined such that we never get into a situation
+# in which we disable both kinds of libraries.  Given conflicting
+# choices, we go for a static library, that is the most portable,
+# since we can't tell whether shared libraries were disabled because
+# the user asked for that or because the platform doesn't support
+# them.  This is particularly important on AIX, because we don't
+# support having both static and shared libraries enabled at the same
+# time on that platform, so we default to a shared-only configuration.
+# If a disable-shared tag is given, we'll fallback to a static-only
+# configuration.  But we'll never go from static-only to shared-only.
+
+# ### BEGIN LIBTOOL TAG CONFIG: disable-shared
+build_libtool_libs=no
+build_old_libs=yes
+# ### END LIBTOOL TAG CONFIG: disable-shared
+
+# ### BEGIN LIBTOOL TAG CONFIG: disable-static
+build_old_libs=`case $build_libtool_libs in yes) echo no;; *) echo yes;; esac`
+# ### END LIBTOOL TAG CONFIG: disable-static
+
+# Local Variables:
+# mode:shell-script
+# sh-indentation:2
+# End:
+# vi:sw=2
+

Added: vendor/jansson/dist/missing
===================================================================
--- vendor/jansson/dist/missing	                        (rev 0)
+++ vendor/jansson/dist/missing	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,215 @@
+#! /bin/sh
+# Common wrapper for a few potentially missing GNU programs.
+
+scriptversion=2013-10-28.13; # UTC
+
+# Copyright (C) 1996-2013 Free Software Foundation, Inc.
+# Originally written by Fran,cois Pinard <pinard at iro.umontreal.ca>, 1996.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2, or (at your option)
+# any later version.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+if test $# -eq 0; then
+  echo 1>&2 "Try '$0 --help' for more information"
+  exit 1
+fi
+
+case $1 in
+
+  --is-lightweight)
+    # Used by our autoconf macros to check whether the available missing
+    # script is modern enough.
+    exit 0
+    ;;
+
+  --run)
+    # Back-compat with the calling convention used by older automake.
+    shift
+    ;;
+
+  -h|--h|--he|--hel|--help)
+    echo "\
+$0 [OPTION]... PROGRAM [ARGUMENT]...
+
+Run 'PROGRAM [ARGUMENT]...', returning a proper advice when this fails due
+to PROGRAM being missing or too old.
+
+Options:
+  -h, --help      display this help and exit
+  -v, --version   output version information and exit
+
+Supported PROGRAM values:
+  aclocal   autoconf  autoheader   autom4te  automake  makeinfo
+  bison     yacc      flex         lex       help2man
+
+Version suffixes to PROGRAM as well as the prefixes 'gnu-', 'gnu', and
+'g' are ignored when checking the name.
+
+Send bug reports to <bug-automake at gnu.org>."
+    exit $?
+    ;;
+
+  -v|--v|--ve|--ver|--vers|--versi|--versio|--version)
+    echo "missing $scriptversion (GNU Automake)"
+    exit $?
+    ;;
+
+  -*)
+    echo 1>&2 "$0: unknown '$1' option"
+    echo 1>&2 "Try '$0 --help' for more information"
+    exit 1
+    ;;
+
+esac
+
+# Run the given program, remember its exit status.
+"$@"; st=$?
+
+# If it succeeded, we are done.
+test $st -eq 0 && exit 0
+
+# Also exit now if we it failed (or wasn't found), and '--version' was
+# passed; such an option is passed most likely to detect whether the
+# program is present and works.
+case $2 in --version|--help) exit $st;; esac
+
+# Exit code 63 means version mismatch.  This often happens when the user
+# tries to use an ancient version of a tool on a file that requires a
+# minimum version.
+if test $st -eq 63; then
+  msg="probably too old"
+elif test $st -eq 127; then
+  # Program was missing.
+  msg="missing on your system"
+else
+  # Program was found and executed, but failed.  Give up.
+  exit $st
+fi
+
+perl_URL=http://www.perl.org/
+flex_URL=http://flex.sourceforge.net/
+gnu_software_URL=http://www.gnu.org/software
+
+program_details ()
+{
+  case $1 in
+    aclocal|automake)
+      echo "The '$1' program is part of the GNU Automake package:"
+      echo "<$gnu_software_URL/automake>"
+      echo "It also requires GNU Autoconf, GNU m4 and Perl in order to run:"
+      echo "<$gnu_software_URL/autoconf>"
+      echo "<$gnu_software_URL/m4/>"
+      echo "<$perl_URL>"
+      ;;
+    autoconf|autom4te|autoheader)
+      echo "The '$1' program is part of the GNU Autoconf package:"
+      echo "<$gnu_software_URL/autoconf/>"
+      echo "It also requires GNU m4 and Perl in order to run:"
+      echo "<$gnu_software_URL/m4/>"
+      echo "<$perl_URL>"
+      ;;
+  esac
+}
+
+give_advice ()
+{
+  # Normalize program name to check for.
+  normalized_program=`echo "$1" | sed '
+    s/^gnu-//; t
+    s/^gnu//; t
+    s/^g//; t'`
+
+  printf '%s\n' "'$1' is $msg."
+
+  configure_deps="'configure.ac' or m4 files included by 'configure.ac'"
+  case $normalized_program in
+    autoconf*)
+      echo "You should only need it if you modified 'configure.ac',"
+      echo "or m4 files included by it."
+      program_details 'autoconf'
+      ;;
+    autoheader*)
+      echo "You should only need it if you modified 'acconfig.h' or"
+      echo "$configure_deps."
+      program_details 'autoheader'
+      ;;
+    automake*)
+      echo "You should only need it if you modified 'Makefile.am' or"
+      echo "$configure_deps."
+      program_details 'automake'
+      ;;
+    aclocal*)
+      echo "You should only need it if you modified 'acinclude.m4' or"
+      echo "$configure_deps."
+      program_details 'aclocal'
+      ;;
+   autom4te*)
+      echo "You might have modified some maintainer files that require"
+      echo "the 'autom4te' program to be rebuilt."
+      program_details 'autom4te'
+      ;;
+    bison*|yacc*)
+      echo "You should only need it if you modified a '.y' file."
+      echo "You may want to install the GNU Bison package:"
+      echo "<$gnu_software_URL/bison/>"
+      ;;
+    lex*|flex*)
+      echo "You should only need it if you modified a '.l' file."
+      echo "You may want to install the Fast Lexical Analyzer package:"
+      echo "<$flex_URL>"
+      ;;
+    help2man*)
+      echo "You should only need it if you modified a dependency" \
+           "of a man page."
+      echo "You may want to install the GNU Help2man package:"
+      echo "<$gnu_software_URL/help2man/>"
+    ;;
+    makeinfo*)
+      echo "You should only need it if you modified a '.texi' file, or"
+      echo "any other file indirectly affecting the aspect of the manual."
+      echo "You might want to install the Texinfo package:"
+      echo "<$gnu_software_URL/texinfo/>"
+      echo "The spurious makeinfo call might also be the consequence of"
+      echo "using a buggy 'make' (AIX, DU, IRIX), in which case you might"
+      echo "want to install GNU make:"
+      echo "<$gnu_software_URL/make/>"
+      ;;
+    *)
+      echo "You might have modified some files without having the proper"
+      echo "tools for further handling them.  Check the 'README' file, it"
+      echo "often tells you about the needed prerequisites for installing"
+      echo "this package.  You may also peek at any GNU archive site, in"
+      echo "case some other package contains this missing '$1' program."
+      ;;
+  esac
+}
+
+give_advice "$1" | sed -e '1s/^/WARNING: /' \
+                       -e '2,$s/^/         /' >&2
+
+# Propagate the correct exit status (expected to be 127 for a program
+# not found, 63 for a program that failed due to version mismatch).
+exit $st
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "scriptversion="
+# time-stamp-format: "%:y-%02m-%02d.%02H"
+# time-stamp-time-zone: "UTC"
+# time-stamp-end: "; # UTC"
+# End:

Added: vendor/jansson/dist/src/Makefile.am
===================================================================
--- vendor/jansson/dist/src/Makefile.am	                        (rev 0)
+++ vendor/jansson/dist/src/Makefile.am	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,26 @@
+EXTRA_DIST = jansson.def
+
+include_HEADERS = jansson.h jansson_config.h
+
+lib_LTLIBRARIES = libjansson.la
+libjansson_la_SOURCES = \
+	dump.c \
+	error.c \
+	hashtable.c \
+	hashtable.h \
+	hashtable_seed.c \
+	jansson_private.h \
+	load.c \
+	lookup3.h \
+	memory.c \
+	pack_unpack.c \
+	strbuffer.c \
+	strbuffer.h \
+	strconv.c \
+	utf.c \
+	utf.h \
+	value.c
+libjansson_la_LDFLAGS = \
+	-no-undefined \
+	-export-symbols-regex '^json_' \
+	-version-info 11:0:7

Added: vendor/jansson/dist/src/Makefile.in
===================================================================
--- vendor/jansson/dist/src/Makefile.in	                        (rev 0)
+++ vendor/jansson/dist/src/Makefile.in	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,693 @@
+# Makefile.in generated by automake 1.14.1 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994-2013 Free Software Foundation, Inc.
+
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+ at SET_MAKE@
+
+
+VPATH = @srcdir@
+am__is_gnu_make = test -n '$(MAKEFILE_LIST)' && test -n '$(MAKELEVEL)'
+am__make_running_with_option = \
+  case $${target_option-} in \
+      ?) ;; \
+      *) echo "am__make_running_with_option: internal error: invalid" \
+              "target option '$${target_option-}' specified" >&2; \
+         exit 1;; \
+  esac; \
+  has_opt=no; \
+  sane_makeflags=$$MAKEFLAGS; \
+  if $(am__is_gnu_make); then \
+    sane_makeflags=$$MFLAGS; \
+  else \
+    case $$MAKEFLAGS in \
+      *\\[\ \	]*) \
+        bs=\\; \
+        sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \
+          | sed "s/$$bs$$bs[$$bs $$bs	]*//g"`;; \
+    esac; \
+  fi; \
+  skip_next=no; \
+  strip_trailopt () \
+  { \
+    flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \
+  }; \
+  for flg in $$sane_makeflags; do \
+    test $$skip_next = yes && { skip_next=no; continue; }; \
+    case $$flg in \
+      *=*|--*) continue;; \
+        -*I) strip_trailopt 'I'; skip_next=yes;; \
+      -*I?*) strip_trailopt 'I';; \
+        -*O) strip_trailopt 'O'; skip_next=yes;; \
+      -*O?*) strip_trailopt 'O';; \
+        -*l) strip_trailopt 'l'; skip_next=yes;; \
+      -*l?*) strip_trailopt 'l';; \
+      -[dEDm]) skip_next=yes;; \
+      -[JT]) skip_next=yes;; \
+    esac; \
+    case $$flg in \
+      *$$target_option*) has_opt=yes; break;; \
+    esac; \
+  done; \
+  test $$has_opt = yes
+am__make_dryrun = (target_option=n; $(am__make_running_with_option))
+am__make_keepgoing = (target_option=k; $(am__make_running_with_option))
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+subdir = src
+DIST_COMMON = $(srcdir)/Makefile.in $(srcdir)/Makefile.am \
+	$(srcdir)/jansson_config.h.in $(top_srcdir)/depcomp \
+	$(include_HEADERS)
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+	$(ACLOCAL_M4)
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = $(top_builddir)/jansson_private_config.h
+CONFIG_CLEAN_FILES = jansson_config.h
+CONFIG_CLEAN_VPATH_FILES =
+am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`;
+am__vpath_adj = case $$p in \
+    $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \
+    *) f=$$p;; \
+  esac;
+am__strip_dir = f=`echo $$p | sed -e 's|^.*/||'`;
+am__install_max = 40
+am__nobase_strip_setup = \
+  srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*|]/\\\\&/g'`
+am__nobase_strip = \
+  for p in $$list; do echo "$$p"; done | sed -e "s|$$srcdirstrip/||"
+am__nobase_list = $(am__nobase_strip_setup); \
+  for p in $$list; do echo "$$p $$p"; done | \
+  sed "s| $$srcdirstrip/| |;"' / .*\//!s/ .*/ ./; s,\( .*\)/[^/]*$$,\1,' | \
+  $(AWK) 'BEGIN { files["."] = "" } { files[$$2] = files[$$2] " " $$1; \
+    if (++n[$$2] == $(am__install_max)) \
+      { print $$2, files[$$2]; n[$$2] = 0; files[$$2] = "" } } \
+    END { for (dir in files) print dir, files[dir] }'
+am__base_list = \
+  sed '$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;s/\n/ /g' | \
+  sed '$$!N;$$!N;$$!N;$$!N;s/\n/ /g'
+am__uninstall_files_from_dir = { \
+  test -z "$$files" \
+    || { test ! -d "$$dir" && test ! -f "$$dir" && test ! -r "$$dir"; } \
+    || { echo " ( cd '$$dir' && rm -f" $$files ")"; \
+         $(am__cd) "$$dir" && rm -f $$files; }; \
+  }
+am__installdirs = "$(DESTDIR)$(libdir)" "$(DESTDIR)$(includedir)"
+LTLIBRARIES = $(lib_LTLIBRARIES)
+libjansson_la_LIBADD =
+am_libjansson_la_OBJECTS = dump.lo error.lo hashtable.lo \
+	hashtable_seed.lo load.lo memory.lo pack_unpack.lo \
+	strbuffer.lo strconv.lo utf.lo value.lo
+libjansson_la_OBJECTS = $(am_libjansson_la_OBJECTS)
+AM_V_lt = $(am__v_lt_ at AM_V@)
+am__v_lt_ = $(am__v_lt_ at AM_DEFAULT_V@)
+am__v_lt_0 = --silent
+am__v_lt_1 = 
+libjansson_la_LINK = $(LIBTOOL) $(AM_V_lt) --tag=CC $(AM_LIBTOOLFLAGS) \
+	$(LIBTOOLFLAGS) --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) \
+	$(libjansson_la_LDFLAGS) $(LDFLAGS) -o $@
+AM_V_P = $(am__v_P_ at AM_V@)
+am__v_P_ = $(am__v_P_ at AM_DEFAULT_V@)
+am__v_P_0 = false
+am__v_P_1 = :
+AM_V_GEN = $(am__v_GEN_ at AM_V@)
+am__v_GEN_ = $(am__v_GEN_ at AM_DEFAULT_V@)
+am__v_GEN_0 = @echo "  GEN     " $@;
+am__v_GEN_1 = 
+AM_V_at = $(am__v_at_ at AM_V@)
+am__v_at_ = $(am__v_at_ at AM_DEFAULT_V@)
+am__v_at_0 = @
+am__v_at_1 = 
+DEFAULT_INCLUDES = -I. at am__isrc@ -I$(top_builddir)
+depcomp = $(SHELL) $(top_srcdir)/depcomp
+am__depfiles_maybe = depfiles
+am__mv = mv -f
+COMPILE = $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) \
+	$(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) $(AM_V_lt) --tag=CC $(AM_LIBTOOLFLAGS) \
+	$(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) \
+	$(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) \
+	$(AM_CFLAGS) $(CFLAGS)
+AM_V_CC = $(am__v_CC_ at AM_V@)
+am__v_CC_ = $(am__v_CC_ at AM_DEFAULT_V@)
+am__v_CC_0 = @echo "  CC      " $@;
+am__v_CC_1 = 
+CCLD = $(CC)
+LINK = $(LIBTOOL) $(AM_V_lt) --tag=CC $(AM_LIBTOOLFLAGS) \
+	$(LIBTOOLFLAGS) --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) \
+	$(AM_LDFLAGS) $(LDFLAGS) -o $@
+AM_V_CCLD = $(am__v_CCLD_ at AM_V@)
+am__v_CCLD_ = $(am__v_CCLD_ at AM_DEFAULT_V@)
+am__v_CCLD_0 = @echo "  CCLD    " $@;
+am__v_CCLD_1 = 
+SOURCES = $(libjansson_la_SOURCES)
+DIST_SOURCES = $(libjansson_la_SOURCES)
+am__can_run_installinfo = \
+  case $$AM_UPDATE_INFO_DIR in \
+    n|no|NO) false;; \
+    *) (install-info --version) >/dev/null 2>&1;; \
+  esac
+HEADERS = $(include_HEADERS)
+am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP)
+# Read a list of newline-separated strings from the standard input,
+# and print each of them once, without duplicates.  Input order is
+# *not* preserved.
+am__uniquify_input = $(AWK) '\
+  BEGIN { nonempty = 0; } \
+  { items[$$0] = 1; nonempty = 1; } \
+  END { if (nonempty) { for (i in items) print i; }; } \
+'
+# Make sure the list of sources is unique.  This is necessary because,
+# e.g., the same source file might be shared among _SOURCES variables
+# for different programs/libraries.
+am__define_uniq_tagged_files = \
+  list='$(am__tagged_files)'; \
+  unique=`for i in $$list; do \
+    if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+  done | $(am__uniquify_input)`
+ETAGS = etags
+CTAGS = ctags
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AM_CFLAGS = @AM_CFLAGS@
+AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DLLTOOL = @DLLTOOL@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+GREP = @GREP@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+LD = @LD@
+LDFLAGS = @LDFLAGS@
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+MAKEINFO = @MAKEINFO@
+MANIFEST_TOOL = @MANIFEST_TOOL@
+MKDIR_P = @MKDIR_P@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_URL = @PACKAGE_URL@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+VERSION = @VERSION@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+json_have_localeconv = @json_have_localeconv@
+json_have_long_long = @json_have_long_long@
+json_inline = @json_inline@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+EXTRA_DIST = jansson.def
+include_HEADERS = jansson.h jansson_config.h
+lib_LTLIBRARIES = libjansson.la
+libjansson_la_SOURCES = \
+	dump.c \
+	error.c \
+	hashtable.c \
+	hashtable.h \
+	hashtable_seed.c \
+	jansson_private.h \
+	load.c \
+	lookup3.h \
+	memory.c \
+	pack_unpack.c \
+	strbuffer.c \
+	strbuffer.h \
+	strconv.c \
+	utf.c \
+	utf.h \
+	value.c
+
+libjansson_la_LDFLAGS = \
+	-no-undefined \
+	-export-symbols-regex '^json_' \
+	-version-info 11:0:7
+
+all: all-am
+
+.SUFFIXES:
+.SUFFIXES: .c .lo .o .obj
+$(srcdir)/Makefile.in:  $(srcdir)/Makefile.am  $(am__configure_deps)
+	@for dep in $?; do \
+	  case '$(am__configure_deps)' in \
+	    *$$dep*) \
+	      ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \
+	        && { if test -f $@; then exit 0; else break; fi; }; \
+	      exit 1;; \
+	  esac; \
+	done; \
+	echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign src/Makefile'; \
+	$(am__cd) $(top_srcdir) && \
+	  $(AUTOMAKE) --foreign src/Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+	@case '$?' in \
+	  *config.status*) \
+	    cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
+	  *) \
+	    echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
+	    cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+	esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+
+$(top_srcdir)/configure:  $(am__configure_deps)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(ACLOCAL_M4):  $(am__aclocal_m4_deps)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(am__aclocal_m4_deps):
+jansson_config.h: $(top_builddir)/config.status $(srcdir)/jansson_config.h.in
+	cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@
+
+install-libLTLIBRARIES: $(lib_LTLIBRARIES)
+	@$(NORMAL_INSTALL)
+	@list='$(lib_LTLIBRARIES)'; test -n "$(libdir)" || list=; \
+	list2=; for p in $$list; do \
+	  if test -f $$p; then \
+	    list2="$$list2 $$p"; \
+	  else :; fi; \
+	done; \
+	test -z "$$list2" || { \
+	  echo " $(MKDIR_P) '$(DESTDIR)$(libdir)'"; \
+	  $(MKDIR_P) "$(DESTDIR)$(libdir)" || exit 1; \
+	  echo " $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=install $(INSTALL) $(INSTALL_STRIP_FLAG) $$list2 '$(DESTDIR)$(libdir)'"; \
+	  $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=install $(INSTALL) $(INSTALL_STRIP_FLAG) $$list2 "$(DESTDIR)$(libdir)"; \
+	}
+
+uninstall-libLTLIBRARIES:
+	@$(NORMAL_UNINSTALL)
+	@list='$(lib_LTLIBRARIES)'; test -n "$(libdir)" || list=; \
+	for p in $$list; do \
+	  $(am__strip_dir) \
+	  echo " $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=uninstall rm -f '$(DESTDIR)$(libdir)/$$f'"; \
+	  $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=uninstall rm -f "$(DESTDIR)$(libdir)/$$f"; \
+	done
+
+clean-libLTLIBRARIES:
+	-test -z "$(lib_LTLIBRARIES)" || rm -f $(lib_LTLIBRARIES)
+	@list='$(lib_LTLIBRARIES)'; \
+	locs=`for p in $$list; do echo $$p; done | \
+	      sed 's|^[^/]*$$|.|; s|/[^/]*$$||; s|$$|/so_locations|' | \
+	      sort -u`; \
+	test -z "$$locs" || { \
+	  echo rm -f $${locs}; \
+	  rm -f $${locs}; \
+	}
+
+libjansson.la: $(libjansson_la_OBJECTS) $(libjansson_la_DEPENDENCIES) $(EXTRA_libjansson_la_DEPENDENCIES) 
+	$(AM_V_CCLD)$(libjansson_la_LINK) -rpath $(libdir) $(libjansson_la_OBJECTS) $(libjansson_la_LIBADD) $(LIBS)
+
+mostlyclean-compile:
+	-rm -f *.$(OBJEXT)
+
+distclean-compile:
+	-rm -f *.tab.c
+
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/dump.Plo at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/error.Plo at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/hashtable.Plo at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/hashtable_seed.Plo at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/load.Plo at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/memory.Plo at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/pack_unpack.Plo at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/strbuffer.Plo at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/strconv.Plo at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/utf.Plo at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/value.Plo at am__quote@
+
+.c.o:
+ at am__fastdepCC_TRUE@	$(AM_V_CC)$(COMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $<
+ at am__fastdepCC_TRUE@	$(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	$(AM_V_CC)source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+ at am__fastdepCC_FALSE@	$(AM_V_CC at am__nodep@)$(COMPILE) -c -o $@ $<
+
+.c.obj:
+ at am__fastdepCC_TRUE@	$(AM_V_CC)$(COMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ `$(CYGPATH_W) '$<'`
+ at am__fastdepCC_TRUE@	$(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	$(AM_V_CC)source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+ at am__fastdepCC_FALSE@	$(AM_V_CC at am__nodep@)$(COMPILE) -c -o $@ `$(CYGPATH_W) '$<'`
+
+.c.lo:
+ at am__fastdepCC_TRUE@	$(AM_V_CC)$(LTCOMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $<
+ at am__fastdepCC_TRUE@	$(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Plo
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	$(AM_V_CC)source='$<' object='$@' libtool=yes @AMDEPBACKSLASH@
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+ at am__fastdepCC_FALSE@	$(AM_V_CC at am__nodep@)$(LTCOMPILE) -c -o $@ $<
+
+mostlyclean-libtool:
+	-rm -f *.lo
+
+clean-libtool:
+	-rm -rf .libs _libs
+install-includeHEADERS: $(include_HEADERS)
+	@$(NORMAL_INSTALL)
+	@list='$(include_HEADERS)'; test -n "$(includedir)" || list=; \
+	if test -n "$$list"; then \
+	  echo " $(MKDIR_P) '$(DESTDIR)$(includedir)'"; \
+	  $(MKDIR_P) "$(DESTDIR)$(includedir)" || exit 1; \
+	fi; \
+	for p in $$list; do \
+	  if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \
+	  echo "$$d$$p"; \
+	done | $(am__base_list) | \
+	while read files; do \
+	  echo " $(INSTALL_HEADER) $$files '$(DESTDIR)$(includedir)'"; \
+	  $(INSTALL_HEADER) $$files "$(DESTDIR)$(includedir)" || exit $$?; \
+	done
+
+uninstall-includeHEADERS:
+	@$(NORMAL_UNINSTALL)
+	@list='$(include_HEADERS)'; test -n "$(includedir)" || list=; \
+	files=`for p in $$list; do echo $$p; done | sed -e 's|^.*/||'`; \
+	dir='$(DESTDIR)$(includedir)'; $(am__uninstall_files_from_dir)
+
+ID: $(am__tagged_files)
+	$(am__define_uniq_tagged_files); mkid -fID $$unique
+tags: tags-am
+TAGS: tags
+
+tags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+	set x; \
+	here=`pwd`; \
+	$(am__define_uniq_tagged_files); \
+	shift; \
+	if test -z "$(ETAGS_ARGS)$$*$$unique"; then :; else \
+	  test -n "$$unique" || unique=$$empty_fix; \
+	  if test $$# -gt 0; then \
+	    $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+	      "$$@" $$unique; \
+	  else \
+	    $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+	      $$unique; \
+	  fi; \
+	fi
+ctags: ctags-am
+
+CTAGS: ctags
+ctags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+	$(am__define_uniq_tagged_files); \
+	test -z "$(CTAGS_ARGS)$$unique" \
+	  || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \
+	     $$unique
+
+GTAGS:
+	here=`$(am__cd) $(top_builddir) && pwd` \
+	  && $(am__cd) $(top_srcdir) \
+	  && gtags -i $(GTAGS_ARGS) "$$here"
+cscopelist: cscopelist-am
+
+cscopelist-am: $(am__tagged_files)
+	list='$(am__tagged_files)'; \
+	case "$(srcdir)" in \
+	  [\\/]* | ?:[\\/]*) sdir="$(srcdir)" ;; \
+	  *) sdir=$(subdir)/$(srcdir) ;; \
+	esac; \
+	for i in $$list; do \
+	  if test -f "$$i"; then \
+	    echo "$(subdir)/$$i"; \
+	  else \
+	    echo "$$sdir/$$i"; \
+	  fi; \
+	done >> $(top_builddir)/cscope.files
+
+distclean-tags:
+	-rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
+
+distdir: $(DISTFILES)
+	@srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	list='$(DISTFILES)'; \
+	  dist_files=`for file in $$list; do echo $$file; done | \
+	  sed -e "s|^$$srcdirstrip/||;t" \
+	      -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+	case $$dist_files in \
+	  */*) $(MKDIR_P) `echo "$$dist_files" | \
+			   sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+			   sort -u` ;; \
+	esac; \
+	for file in $$dist_files; do \
+	  if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+	  if test -d $$d/$$file; then \
+	    dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+	    if test -d "$(distdir)/$$file"; then \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+	      cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+	  else \
+	    test -f "$(distdir)/$$file" \
+	    || cp -p $$d/$$file "$(distdir)/$$file" \
+	    || exit 1; \
+	  fi; \
+	done
+check-am: all-am
+check: check-am
+all-am: Makefile $(LTLIBRARIES) $(HEADERS)
+installdirs:
+	for dir in "$(DESTDIR)$(libdir)" "$(DESTDIR)$(includedir)"; do \
+	  test -z "$$dir" || $(MKDIR_P) "$$dir"; \
+	done
+install: install-am
+install-exec: install-exec-am
+install-data: install-data-am
+uninstall: uninstall-am
+
+install-am: all-am
+	@$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-am
+install-strip:
+	if test -z '$(STRIP)'; then \
+	  $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+	    install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+	      install; \
+	else \
+	  $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+	    install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+	    "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \
+	fi
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+	-test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+	-test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+
+maintainer-clean-generic:
+	@echo "This command is intended for maintainers to use"
+	@echo "it deletes files that may require special tools to rebuild."
+clean: clean-am
+
+clean-am: clean-generic clean-libLTLIBRARIES clean-libtool \
+	mostlyclean-am
+
+distclean: distclean-am
+	-rm -rf ./$(DEPDIR)
+	-rm -f Makefile
+distclean-am: clean-am distclean-compile distclean-generic \
+	distclean-tags
+
+dvi: dvi-am
+
+dvi-am:
+
+html: html-am
+
+html-am:
+
+info: info-am
+
+info-am:
+
+install-data-am: install-includeHEADERS
+
+install-dvi: install-dvi-am
+
+install-dvi-am:
+
+install-exec-am: install-libLTLIBRARIES
+
+install-html: install-html-am
+
+install-html-am:
+
+install-info: install-info-am
+
+install-info-am:
+
+install-man:
+
+install-pdf: install-pdf-am
+
+install-pdf-am:
+
+install-ps: install-ps-am
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-am
+	-rm -rf ./$(DEPDIR)
+	-rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-am
+
+mostlyclean-am: mostlyclean-compile mostlyclean-generic \
+	mostlyclean-libtool
+
+pdf: pdf-am
+
+pdf-am:
+
+ps: ps-am
+
+ps-am:
+
+uninstall-am: uninstall-includeHEADERS uninstall-libLTLIBRARIES
+
+.MAKE: install-am install-strip
+
+.PHONY: CTAGS GTAGS TAGS all all-am check check-am clean clean-generic \
+	clean-libLTLIBRARIES clean-libtool cscopelist-am ctags \
+	ctags-am distclean distclean-compile distclean-generic \
+	distclean-libtool distclean-tags distdir dvi dvi-am html \
+	html-am info info-am install install-am install-data \
+	install-data-am install-dvi install-dvi-am install-exec \
+	install-exec-am install-html install-html-am \
+	install-includeHEADERS install-info install-info-am \
+	install-libLTLIBRARIES install-man install-pdf install-pdf-am \
+	install-ps install-ps-am install-strip installcheck \
+	installcheck-am installdirs maintainer-clean \
+	maintainer-clean-generic mostlyclean mostlyclean-compile \
+	mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
+	tags tags-am uninstall uninstall-am uninstall-includeHEADERS \
+	uninstall-libLTLIBRARIES
+
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:

Added: vendor/jansson/dist/src/dump.c
===================================================================
--- vendor/jansson/dist/src/dump.c	                        (rev 0)
+++ vendor/jansson/dist/src/dump.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,462 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef _GNU_SOURCE
+#define _GNU_SOURCE
+#endif
+
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <assert.h>
+
+#include "jansson.h"
+#include "jansson_private.h"
+#include "strbuffer.h"
+#include "utf.h"
+
+#define MAX_INTEGER_STR_LENGTH  100
+#define MAX_REAL_STR_LENGTH     100
+
+#define FLAGS_TO_INDENT(f)      ((f) & 0x1F)
+#define FLAGS_TO_PRECISION(f)   (((f) >> 11) & 0x1F)
+
+struct object_key {
+    size_t serial;
+    const char *key;
+};
+
+static int dump_to_strbuffer(const char *buffer, size_t size, void *data)
+{
+    return strbuffer_append_bytes((strbuffer_t *)data, buffer, size);
+}
+
+static int dump_to_file(const char *buffer, size_t size, void *data)
+{
+    FILE *dest = (FILE *)data;
+    if(fwrite(buffer, size, 1, dest) != 1)
+        return -1;
+    return 0;
+}
+
+/* 32 spaces (the maximum indentation size) */
+static const char whitespace[] = "                                ";
+
+static int dump_indent(size_t flags, int depth, int space, json_dump_callback_t dump, void *data)
+{
+    if(FLAGS_TO_INDENT(flags) > 0)
+    {
+        int i, ws_count = FLAGS_TO_INDENT(flags);
+
+        if(dump("\n", 1, data))
+            return -1;
+
+        for(i = 0; i < depth; i++)
+        {
+            if(dump(whitespace, ws_count, data))
+                return -1;
+        }
+    }
+    else if(space && !(flags & JSON_COMPACT))
+    {
+        return dump(" ", 1, data);
+    }
+    return 0;
+}
+
+static int dump_string(const char *str, size_t len, json_dump_callback_t dump, void *data, size_t flags)
+{
+    const char *pos, *end, *lim;
+    int32_t codepoint;
+
+    if(dump("\"", 1, data))
+        return -1;
+
+    end = pos = str;
+    lim = str + len;
+    while(1)
+    {
+        const char *text;
+        char seq[13];
+        int length;
+
+        while(end < lim)
+        {
+            end = utf8_iterate(pos, lim - pos, &codepoint);
+            if(!end)
+                return -1;
+
+            /* mandatory escape or control char */
+            if(codepoint == '\\' || codepoint == '"' || codepoint < 0x20)
+                break;
+
+            /* slash */
+            if((flags & JSON_ESCAPE_SLASH) && codepoint == '/')
+                break;
+
+            /* non-ASCII */
+            if((flags & JSON_ENSURE_ASCII) && codepoint > 0x7F)
+                break;
+
+            pos = end;
+        }
+
+        if(pos != str) {
+            if(dump(str, pos - str, data))
+                return -1;
+        }
+
+        if(end == pos)
+            break;
+
+        /* handle \, /, ", and control codes */
+        length = 2;
+        switch(codepoint)
+        {
+            case '\\': text = "\\\\"; break;
+            case '\"': text = "\\\""; break;
+            case '\b': text = "\\b"; break;
+            case '\f': text = "\\f"; break;
+            case '\n': text = "\\n"; break;
+            case '\r': text = "\\r"; break;
+            case '\t': text = "\\t"; break;
+            case '/':  text = "\\/"; break;
+            default:
+            {
+                /* codepoint is in BMP */
+                if(codepoint < 0x10000)
+                {
+                    sprintf(seq, "\\u%04X", codepoint);
+                    length = 6;
+                }
+
+                /* not in BMP -> construct a UTF-16 surrogate pair */
+                else
+                {
+                    int32_t first, last;
+
+                    codepoint -= 0x10000;
+                    first = 0xD800 | ((codepoint & 0xffc00) >> 10);
+                    last = 0xDC00 | (codepoint & 0x003ff);
+
+                    sprintf(seq, "\\u%04X\\u%04X", first, last);
+                    length = 12;
+                }
+
+                text = seq;
+                break;
+            }
+        }
+
+        if(dump(text, length, data))
+            return -1;
+
+        str = pos = end;
+    }
+
+    return dump("\"", 1, data);
+}
+
+static int object_key_compare_keys(const void *key1, const void *key2)
+{
+    return strcmp(((const struct object_key *)key1)->key,
+                  ((const struct object_key *)key2)->key);
+}
+
+static int object_key_compare_serials(const void *key1, const void *key2)
+{
+    size_t a = ((const struct object_key *)key1)->serial;
+    size_t b = ((const struct object_key *)key2)->serial;
+
+    return a < b ? -1 : a == b ? 0 : 1;
+}
+
+static int do_dump(const json_t *json, size_t flags, int depth,
+                   json_dump_callback_t dump, void *data)
+{
+    if(!json)
+        return -1;
+
+    switch(json_typeof(json)) {
+        case JSON_NULL:
+            return dump("null", 4, data);
+
+        case JSON_TRUE:
+            return dump("true", 4, data);
+
+        case JSON_FALSE:
+            return dump("false", 5, data);
+
+        case JSON_INTEGER:
+        {
+            char buffer[MAX_INTEGER_STR_LENGTH];
+            int size;
+
+            size = snprintf(buffer, MAX_INTEGER_STR_LENGTH,
+                            "%" JSON_INTEGER_FORMAT,
+                            json_integer_value(json));
+            if(size < 0 || size >= MAX_INTEGER_STR_LENGTH)
+                return -1;
+
+            return dump(buffer, size, data);
+        }
+
+        case JSON_REAL:
+        {
+            char buffer[MAX_REAL_STR_LENGTH];
+            int size;
+            double value = json_real_value(json);
+
+            size = jsonp_dtostr(buffer, MAX_REAL_STR_LENGTH, value,
+                                FLAGS_TO_PRECISION(flags));
+            if(size < 0)
+                return -1;
+
+            return dump(buffer, size, data);
+        }
+
+        case JSON_STRING:
+            return dump_string(json_string_value(json), json_string_length(json), dump, data, flags);
+
+        case JSON_ARRAY:
+        {
+            int i;
+            int n;
+            json_array_t *array;
+
+            /* detect circular references */
+            array = json_to_array(json);
+            if(array->visited)
+                goto array_error;
+            array->visited = 1;
+
+            n = json_array_size(json);
+
+            if(dump("[", 1, data))
+                goto array_error;
+            if(n == 0) {
+                array->visited = 0;
+                return dump("]", 1, data);
+            }
+            if(dump_indent(flags, depth + 1, 0, dump, data))
+                goto array_error;
+
+            for(i = 0; i < n; ++i) {
+                if(do_dump(json_array_get(json, i), flags, depth + 1,
+                           dump, data))
+                    goto array_error;
+
+                if(i < n - 1)
+                {
+                    if(dump(",", 1, data) ||
+                       dump_indent(flags, depth + 1, 1, dump, data))
+                        goto array_error;
+                }
+                else
+                {
+                    if(dump_indent(flags, depth, 0, dump, data))
+                        goto array_error;
+                }
+            }
+
+            array->visited = 0;
+            return dump("]", 1, data);
+
+        array_error:
+            array->visited = 0;
+            return -1;
+        }
+
+        case JSON_OBJECT:
+        {
+            json_object_t *object;
+            void *iter;
+            const char *separator;
+            int separator_length;
+
+            if(flags & JSON_COMPACT) {
+                separator = ":";
+                separator_length = 1;
+            }
+            else {
+                separator = ": ";
+                separator_length = 2;
+            }
+
+            /* detect circular references */
+            object = json_to_object(json);
+            if(object->visited)
+                goto object_error;
+            object->visited = 1;
+
+            iter = json_object_iter((json_t *)json);
+
+            if(dump("{", 1, data))
+                goto object_error;
+            if(!iter) {
+                object->visited = 0;
+                return dump("}", 1, data);
+            }
+            if(dump_indent(flags, depth + 1, 0, dump, data))
+                goto object_error;
+
+            if(flags & JSON_SORT_KEYS || flags & JSON_PRESERVE_ORDER)
+            {
+                struct object_key *keys;
+                size_t size, i;
+                int (*cmp_func)(const void *, const void *);
+
+                size = json_object_size(json);
+                keys = jsonp_malloc(size * sizeof(struct object_key));
+                if(!keys)
+                    goto object_error;
+
+                i = 0;
+                while(iter)
+                {
+                    keys[i].serial = hashtable_iter_serial(iter);
+                    keys[i].key = json_object_iter_key(iter);
+                    iter = json_object_iter_next((json_t *)json, iter);
+                    i++;
+                }
+                assert(i == size);
+
+                if(flags & JSON_SORT_KEYS)
+                    cmp_func = object_key_compare_keys;
+                else
+                    cmp_func = object_key_compare_serials;
+
+                qsort(keys, size, sizeof(struct object_key), cmp_func);
+
+                for(i = 0; i < size; i++)
+                {
+                    const char *key;
+                    json_t *value;
+
+                    key = keys[i].key;
+                    value = json_object_get(json, key);
+                    assert(value);
+
+                    dump_string(key, strlen(key), dump, data, flags);
+                    if(dump(separator, separator_length, data) ||
+                       do_dump(value, flags, depth + 1, dump, data))
+                    {
+                        jsonp_free(keys);
+                        goto object_error;
+                    }
+
+                    if(i < size - 1)
+                    {
+                        if(dump(",", 1, data) ||
+                           dump_indent(flags, depth + 1, 1, dump, data))
+                        {
+                            jsonp_free(keys);
+                            goto object_error;
+                        }
+                    }
+                    else
+                    {
+                        if(dump_indent(flags, depth, 0, dump, data))
+                        {
+                            jsonp_free(keys);
+                            goto object_error;
+                        }
+                    }
+                }
+
+                jsonp_free(keys);
+            }
+            else
+            {
+                /* Don't sort keys */
+
+                while(iter)
+                {
+                    void *next = json_object_iter_next((json_t *)json, iter);
+                    const char *key = json_object_iter_key(iter);
+
+                    dump_string(key, strlen(key), dump, data, flags);
+                    if(dump(separator, separator_length, data) ||
+                       do_dump(json_object_iter_value(iter), flags, depth + 1,
+                               dump, data))
+                        goto object_error;
+
+                    if(next)
+                    {
+                        if(dump(",", 1, data) ||
+                           dump_indent(flags, depth + 1, 1, dump, data))
+                            goto object_error;
+                    }
+                    else
+                    {
+                        if(dump_indent(flags, depth, 0, dump, data))
+                            goto object_error;
+                    }
+
+                    iter = next;
+                }
+            }
+
+            object->visited = 0;
+            return dump("}", 1, data);
+
+        object_error:
+            object->visited = 0;
+            return -1;
+        }
+
+        default:
+            /* not reached */
+            return -1;
+    }
+}
+
+char *json_dumps(const json_t *json, size_t flags)
+{
+    strbuffer_t strbuff;
+    char *result;
+
+    if(strbuffer_init(&strbuff))
+        return NULL;
+
+    if(json_dump_callback(json, dump_to_strbuffer, (void *)&strbuff, flags))
+        result = NULL;
+    else
+        result = jsonp_strdup(strbuffer_value(&strbuff));
+
+    strbuffer_close(&strbuff);
+    return result;
+}
+
+int json_dumpf(const json_t *json, FILE *output, size_t flags)
+{
+    return json_dump_callback(json, dump_to_file, (void *)output, flags);
+}
+
+int json_dump_file(const json_t *json, const char *path, size_t flags)
+{
+    int result;
+
+    FILE *output = fopen(path, "w");
+    if(!output)
+        return -1;
+
+    result = json_dumpf(json, output, flags);
+
+    fclose(output);
+    return result;
+}
+
+int json_dump_callback(const json_t *json, json_dump_callback_t callback, void *data, size_t flags)
+{
+    if(!(flags & JSON_ENCODE_ANY)) {
+        if(!json_is_array(json) && !json_is_object(json))
+           return -1;
+    }
+
+    return do_dump(json, flags, 0, callback, data);
+}

Added: vendor/jansson/dist/src/error.c
===================================================================
--- vendor/jansson/dist/src/error.c	                        (rev 0)
+++ vendor/jansson/dist/src/error.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,63 @@
+#include <string.h>
+#include "jansson_private.h"
+
+void jsonp_error_init(json_error_t *error, const char *source)
+{
+    if(error)
+    {
+        error->text[0] = '\0';
+        error->line = -1;
+        error->column = -1;
+        error->position = 0;
+        if(source)
+            jsonp_error_set_source(error, source);
+        else
+            error->source[0] = '\0';
+    }
+}
+
+void jsonp_error_set_source(json_error_t *error, const char *source)
+{
+    size_t length;
+
+    if(!error || !source)
+        return;
+
+    length = strlen(source);
+    if(length < JSON_ERROR_SOURCE_LENGTH)
+        strcpy(error->source, source);
+    else {
+        size_t extra = length - JSON_ERROR_SOURCE_LENGTH + 4;
+        strcpy(error->source, "...");
+        strcpy(error->source + 3, source + extra);
+    }
+}
+
+void jsonp_error_set(json_error_t *error, int line, int column,
+                     size_t position, const char *msg, ...)
+{
+    va_list ap;
+
+    va_start(ap, msg);
+    jsonp_error_vset(error, line, column, position, msg, ap);
+    va_end(ap);
+}
+
+void jsonp_error_vset(json_error_t *error, int line, int column,
+                      size_t position, const char *msg, va_list ap)
+{
+    if(!error)
+        return;
+
+    if(error->text[0] != '\0') {
+        /* error already set */
+        return;
+    }
+
+    error->line = line;
+    error->column = column;
+    error->position = position;
+
+    vsnprintf(error->text, JSON_ERROR_TEXT_LENGTH, msg, ap);
+    error->text[JSON_ERROR_TEXT_LENGTH - 1] = '\0';
+}

Added: vendor/jansson/dist/src/hashtable.c
===================================================================
--- vendor/jansson/dist/src/hashtable.c	                        (rev 0)
+++ vendor/jansson/dist/src/hashtable.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,352 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * This library is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#if HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#include <stdlib.h>
+#include <string.h>
+
+#if HAVE_STDINT_H
+#include <stdint.h>
+#endif
+
+#include <jansson_config.h>   /* for JSON_INLINE */
+#include "jansson_private.h"  /* for container_of() */
+#include "hashtable.h"
+
+typedef struct hashtable_list list_t;
+typedef struct hashtable_pair pair_t;
+typedef struct hashtable_bucket bucket_t;
+
+extern volatile uint32_t hashtable_seed;
+
+/* Implementation of the hash function */
+#include "lookup3.h"
+
+#define list_to_pair(list_)  container_of(list_, pair_t, list)
+#define hash_str(key)        ((size_t)hashlittle((key), strlen(key), hashtable_seed))
+
+static JSON_INLINE void list_init(list_t *list)
+{
+    list->next = list;
+    list->prev = list;
+}
+
+static JSON_INLINE void list_insert(list_t *list, list_t *node)
+{
+    node->next = list;
+    node->prev = list->prev;
+    list->prev->next = node;
+    list->prev = node;
+}
+
+static JSON_INLINE void list_remove(list_t *list)
+{
+    list->prev->next = list->next;
+    list->next->prev = list->prev;
+}
+
+static JSON_INLINE int bucket_is_empty(hashtable_t *hashtable, bucket_t *bucket)
+{
+    return bucket->first == &hashtable->list && bucket->first == bucket->last;
+}
+
+static void insert_to_bucket(hashtable_t *hashtable, bucket_t *bucket,
+                             list_t *list)
+{
+    if(bucket_is_empty(hashtable, bucket))
+    {
+        list_insert(&hashtable->list, list);
+        bucket->first = bucket->last = list;
+    }
+    else
+    {
+        list_insert(bucket->first, list);
+        bucket->first = list;
+    }
+}
+
+static pair_t *hashtable_find_pair(hashtable_t *hashtable, bucket_t *bucket,
+                                   const char *key, size_t hash)
+{
+    list_t *list;
+    pair_t *pair;
+
+    if(bucket_is_empty(hashtable, bucket))
+        return NULL;
+
+    list = bucket->first;
+    while(1)
+    {
+        pair = list_to_pair(list);
+        if(pair->hash == hash && strcmp(pair->key, key) == 0)
+            return pair;
+
+        if(list == bucket->last)
+            break;
+
+        list = list->next;
+    }
+
+    return NULL;
+}
+
+/* returns 0 on success, -1 if key was not found */
+static int hashtable_do_del(hashtable_t *hashtable,
+                            const char *key, size_t hash)
+{
+    pair_t *pair;
+    bucket_t *bucket;
+    size_t index;
+
+    index = hash & hashmask(hashtable->order);
+    bucket = &hashtable->buckets[index];
+
+    pair = hashtable_find_pair(hashtable, bucket, key, hash);
+    if(!pair)
+        return -1;
+
+    if(&pair->list == bucket->first && &pair->list == bucket->last)
+        bucket->first = bucket->last = &hashtable->list;
+
+    else if(&pair->list == bucket->first)
+        bucket->first = pair->list.next;
+
+    else if(&pair->list == bucket->last)
+        bucket->last = pair->list.prev;
+
+    list_remove(&pair->list);
+    json_decref(pair->value);
+
+    jsonp_free(pair);
+    hashtable->size--;
+
+    return 0;
+}
+
+static void hashtable_do_clear(hashtable_t *hashtable)
+{
+    list_t *list, *next;
+    pair_t *pair;
+
+    for(list = hashtable->list.next; list != &hashtable->list; list = next)
+    {
+        next = list->next;
+        pair = list_to_pair(list);
+        json_decref(pair->value);
+        jsonp_free(pair);
+    }
+}
+
+static int hashtable_do_rehash(hashtable_t *hashtable)
+{
+    list_t *list, *next;
+    pair_t *pair;
+    size_t i, index, new_size;
+
+    jsonp_free(hashtable->buckets);
+
+    hashtable->order++;
+    new_size = hashsize(hashtable->order);
+
+    hashtable->buckets = jsonp_malloc(new_size * sizeof(bucket_t));
+    if(!hashtable->buckets)
+        return -1;
+
+    for(i = 0; i < hashsize(hashtable->order); i++)
+    {
+        hashtable->buckets[i].first = hashtable->buckets[i].last =
+            &hashtable->list;
+    }
+
+    list = hashtable->list.next;
+    list_init(&hashtable->list);
+
+    for(; list != &hashtable->list; list = next) {
+        next = list->next;
+        pair = list_to_pair(list);
+        index = pair->hash % new_size;
+        insert_to_bucket(hashtable, &hashtable->buckets[index], &pair->list);
+    }
+
+    return 0;
+}
+
+
+int hashtable_init(hashtable_t *hashtable)
+{
+    size_t i;
+
+    hashtable->size = 0;
+    hashtable->order = 3;
+    hashtable->buckets = jsonp_malloc(hashsize(hashtable->order) * sizeof(bucket_t));
+    if(!hashtable->buckets)
+        return -1;
+
+    list_init(&hashtable->list);
+
+    for(i = 0; i < hashsize(hashtable->order); i++)
+    {
+        hashtable->buckets[i].first = hashtable->buckets[i].last =
+            &hashtable->list;
+    }
+
+    return 0;
+}
+
+void hashtable_close(hashtable_t *hashtable)
+{
+    hashtable_do_clear(hashtable);
+    jsonp_free(hashtable->buckets);
+}
+
+int hashtable_set(hashtable_t *hashtable,
+                  const char *key, size_t serial,
+                  json_t *value)
+{
+    pair_t *pair;
+    bucket_t *bucket;
+    size_t hash, index;
+
+    /* rehash if the load ratio exceeds 1 */
+    if(hashtable->size >= hashsize(hashtable->order))
+        if(hashtable_do_rehash(hashtable))
+            return -1;
+
+    hash = hash_str(key);
+    index = hash & hashmask(hashtable->order);
+    bucket = &hashtable->buckets[index];
+    pair = hashtable_find_pair(hashtable, bucket, key, hash);
+
+    if(pair)
+    {
+        json_decref(pair->value);
+        pair->value = value;
+    }
+    else
+    {
+        /* offsetof(...) returns the size of pair_t without the last,
+           flexible member. This way, the correct amount is
+           allocated. */
+
+        size_t len = strlen(key);
+        if(len >= (size_t)-1 - offsetof(pair_t, key)) {
+            /* Avoid an overflow if the key is very long */
+            return -1;
+        }
+
+        pair = jsonp_malloc(offsetof(pair_t, key) + len + 1);
+        if(!pair)
+            return -1;
+
+        pair->hash = hash;
+        pair->serial = serial;
+        strcpy(pair->key, key);
+        pair->value = value;
+        list_init(&pair->list);
+
+        insert_to_bucket(hashtable, bucket, &pair->list);
+
+        hashtable->size++;
+    }
+    return 0;
+}
+
+void *hashtable_get(hashtable_t *hashtable, const char *key)
+{
+    pair_t *pair;
+    size_t hash;
+    bucket_t *bucket;
+
+    hash = hash_str(key);
+    bucket = &hashtable->buckets[hash & hashmask(hashtable->order)];
+
+    pair = hashtable_find_pair(hashtable, bucket, key, hash);
+    if(!pair)
+        return NULL;
+
+    return pair->value;
+}
+
+int hashtable_del(hashtable_t *hashtable, const char *key)
+{
+    size_t hash = hash_str(key);
+    return hashtable_do_del(hashtable, key, hash);
+}
+
+void hashtable_clear(hashtable_t *hashtable)
+{
+    size_t i;
+
+    hashtable_do_clear(hashtable);
+
+    for(i = 0; i < hashsize(hashtable->order); i++)
+    {
+        hashtable->buckets[i].first = hashtable->buckets[i].last =
+            &hashtable->list;
+    }
+
+    list_init(&hashtable->list);
+    hashtable->size = 0;
+}
+
+void *hashtable_iter(hashtable_t *hashtable)
+{
+    return hashtable_iter_next(hashtable, &hashtable->list);
+}
+
+void *hashtable_iter_at(hashtable_t *hashtable, const char *key)
+{
+    pair_t *pair;
+    size_t hash;
+    bucket_t *bucket;
+
+    hash = hash_str(key);
+    bucket = &hashtable->buckets[hash & hashmask(hashtable->order)];
+
+    pair = hashtable_find_pair(hashtable, bucket, key, hash);
+    if(!pair)
+        return NULL;
+
+    return &pair->list;
+}
+
+void *hashtable_iter_next(hashtable_t *hashtable, void *iter)
+{
+    list_t *list = (list_t *)iter;
+    if(list->next == &hashtable->list)
+        return NULL;
+    return list->next;
+}
+
+void *hashtable_iter_key(void *iter)
+{
+    pair_t *pair = list_to_pair((list_t *)iter);
+    return pair->key;
+}
+
+size_t hashtable_iter_serial(void *iter)
+{
+    pair_t *pair = list_to_pair((list_t *)iter);
+    return pair->serial;
+}
+
+void *hashtable_iter_value(void *iter)
+{
+    pair_t *pair = list_to_pair((list_t *)iter);
+    return pair->value;
+}
+
+void hashtable_iter_set(void *iter, json_t *value)
+{
+    pair_t *pair = list_to_pair((list_t *)iter);
+
+    json_decref(pair->value);
+    pair->value = value;
+}

Added: vendor/jansson/dist/src/hashtable.h
===================================================================
--- vendor/jansson/dist/src/hashtable.h	                        (rev 0)
+++ vendor/jansson/dist/src/hashtable.h	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,181 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * This library is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef HASHTABLE_H
+#define HASHTABLE_H
+
+struct hashtable_list {
+    struct hashtable_list *prev;
+    struct hashtable_list *next;
+};
+
+/* "pair" may be a bit confusing a name, but think of it as a
+   key-value pair. In this case, it just encodes some extra data,
+   too */
+struct hashtable_pair {
+    size_t hash;
+    struct hashtable_list list;
+    json_t *value;
+    size_t serial;
+    char key[1];
+};
+
+struct hashtable_bucket {
+    struct hashtable_list *first;
+    struct hashtable_list *last;
+};
+
+typedef struct hashtable {
+    size_t size;
+    struct hashtable_bucket *buckets;
+    size_t order;  /* hashtable has pow(2, order) buckets */
+    struct hashtable_list list;
+} hashtable_t;
+
+
+#define hashtable_key_to_iter(key_) \
+    (&(container_of(key_, struct hashtable_pair, key)->list))
+
+
+/**
+ * hashtable_init - Initialize a hashtable object
+ *
+ * @hashtable: The (statically allocated) hashtable object
+ *
+ * Initializes a statically allocated hashtable object. The object
+ * should be cleared with hashtable_close when it's no longer used.
+ *
+ * Returns 0 on success, -1 on error (out of memory).
+ */
+int hashtable_init(hashtable_t *hashtable);
+
+/**
+ * hashtable_close - Release all resources used by a hashtable object
+ *
+ * @hashtable: The hashtable
+ *
+ * Destroys a statically allocated hashtable object.
+ */
+void hashtable_close(hashtable_t *hashtable);
+
+/**
+ * hashtable_set - Add/modify value in hashtable
+ *
+ * @hashtable: The hashtable object
+ * @key: The key
+ * @serial: For addition order of keys
+ * @value: The value
+ *
+ * If a value with the given key already exists, its value is replaced
+ * with the new value. Value is "stealed" in the sense that hashtable
+ * doesn't increment its refcount but decreases the refcount when the
+ * value is no longer needed.
+ *
+ * Returns 0 on success, -1 on failure (out of memory).
+ */
+int hashtable_set(hashtable_t *hashtable,
+                  const char *key, size_t serial,
+                  json_t *value);
+
+/**
+ * hashtable_get - Get a value associated with a key
+ *
+ * @hashtable: The hashtable object
+ * @key: The key
+ *
+ * Returns value if it is found, or NULL otherwise.
+ */
+void *hashtable_get(hashtable_t *hashtable, const char *key);
+
+/**
+ * hashtable_del - Remove a value from the hashtable
+ *
+ * @hashtable: The hashtable object
+ * @key: The key
+ *
+ * Returns 0 on success, or -1 if the key was not found.
+ */
+int hashtable_del(hashtable_t *hashtable, const char *key);
+
+/**
+ * hashtable_clear - Clear hashtable
+ *
+ * @hashtable: The hashtable object
+ *
+ * Removes all items from the hashtable.
+ */
+void hashtable_clear(hashtable_t *hashtable);
+
+/**
+ * hashtable_iter - Iterate over hashtable
+ *
+ * @hashtable: The hashtable object
+ *
+ * Returns an opaque iterator to the first element in the hashtable.
+ * The iterator should be passed to hashtable_iter_* functions.
+ * The hashtable items are not iterated over in any particular order.
+ *
+ * There's no need to free the iterator in any way. The iterator is
+ * valid as long as the item that is referenced by the iterator is not
+ * deleted. Other values may be added or deleted. In particular,
+ * hashtable_iter_next() may be called on an iterator, and after that
+ * the key/value pair pointed by the old iterator may be deleted.
+ */
+void *hashtable_iter(hashtable_t *hashtable);
+
+/**
+ * hashtable_iter_at - Return an iterator at a specific key
+ *
+ * @hashtable: The hashtable object
+ * @key: The key that the iterator should point to
+ *
+ * Like hashtable_iter() but returns an iterator pointing to a
+ * specific key.
+ */
+void *hashtable_iter_at(hashtable_t *hashtable, const char *key);
+
+/**
+ * hashtable_iter_next - Advance an iterator
+ *
+ * @hashtable: The hashtable object
+ * @iter: The iterator
+ *
+ * Returns a new iterator pointing to the next element in the
+ * hashtable or NULL if the whole hastable has been iterated over.
+ */
+void *hashtable_iter_next(hashtable_t *hashtable, void *iter);
+
+/**
+ * hashtable_iter_key - Retrieve the key pointed by an iterator
+ *
+ * @iter: The iterator
+ */
+void *hashtable_iter_key(void *iter);
+
+/**
+ * hashtable_iter_serial - Retrieve the serial number pointed to by an iterator
+ *
+ * @iter: The iterator
+ */
+size_t hashtable_iter_serial(void *iter);
+
+/**
+ * hashtable_iter_value - Retrieve the value pointed by an iterator
+ *
+ * @iter: The iterator
+ */
+void *hashtable_iter_value(void *iter);
+
+/**
+ * hashtable_iter_set - Set the value pointed by an iterator
+ *
+ * @iter: The iterator
+ * @value: The value to set
+ */
+void hashtable_iter_set(void *iter, json_t *value);
+
+#endif

Added: vendor/jansson/dist/src/hashtable_seed.c
===================================================================
--- vendor/jansson/dist/src/hashtable_seed.c	                        (rev 0)
+++ vendor/jansson/dist/src/hashtable_seed.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,277 @@
+/* Generate sizeof(uint32_t) bytes of as random data as possible to seed
+   the hash function.
+*/
+
+#ifdef HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#include <stdio.h>
+#include <time.h>
+
+#ifdef HAVE_STDINT_H
+#include <stdint.h>
+#endif
+
+#ifdef HAVE_FCNTL_H
+#include <fcntl.h>
+#endif
+
+#ifdef HAVE_SCHED_H
+#include <sched.h>
+#endif
+
+#ifdef HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+
+#ifdef HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+
+#ifdef HAVE_SYS_TIME_H
+#include <sys/time.h>
+#endif
+
+#ifdef HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#if defined(_WIN32)
+/* For GetModuleHandle(), GetProcAddress() and GetCurrentProcessId() */
+#include <windows.h>
+#endif
+
+#include "jansson.h"
+
+
+static uint32_t buf_to_uint32(char *data) {
+    size_t i;
+    uint32_t result = 0;
+
+    for (i = 0; i < sizeof(uint32_t); i++)
+        result = (result << 8) | (unsigned char)data[i];
+
+    return result;
+}
+
+
+
+/* /dev/urandom */
+#if !defined(_WIN32) && defined(USE_URANDOM)
+static int seed_from_urandom(uint32_t *seed) {
+    /* Use unbuffered I/O if we have open(), close() and read(). Otherwise
+       fall back to fopen() */
+
+    char data[sizeof(uint32_t)];
+    int ok;
+
+#if defined(HAVE_OPEN) && defined(HAVE_CLOSE) && defined(HAVE_READ)
+    int urandom;
+    urandom = open("/dev/urandom", O_RDONLY);
+    if (urandom == -1)
+        return 1;
+
+    ok = read(urandom, data, sizeof(uint32_t)) == sizeof(uint32_t);
+    close(urandom);
+#else
+    FILE *urandom;
+
+    urandom = fopen("/dev/urandom", "rb");
+    if (!urandom)
+        return 1;
+
+    ok = fread(data, 1, sizeof(uint32_t), urandom) == sizeof(uint32_t);
+    fclose(urandom);
+#endif
+
+    if (!ok)
+        return 1;
+
+    *seed = buf_to_uint32(data);
+    return 0;
+}
+#endif
+
+/* Windows Crypto API */
+#if defined(_WIN32) && defined(USE_WINDOWS_CRYPTOAPI)
+#include <wincrypt.h>
+
+typedef BOOL (WINAPI *CRYPTACQUIRECONTEXTA)(HCRYPTPROV *phProv, LPCSTR pszContainer, LPCSTR pszProvider, DWORD dwProvType, DWORD dwFlags);
+typedef BOOL (WINAPI *CRYPTGENRANDOM)(HCRYPTPROV hProv, DWORD dwLen, BYTE *pbBuffer);
+typedef BOOL (WINAPI *CRYPTRELEASECONTEXT)(HCRYPTPROV hProv, DWORD dwFlags);
+
+static int seed_from_windows_cryptoapi(uint32_t *seed)
+{
+    HINSTANCE hAdvAPI32 = NULL;
+    CRYPTACQUIRECONTEXTA pCryptAcquireContext = NULL;
+    CRYPTGENRANDOM pCryptGenRandom = NULL;
+    CRYPTRELEASECONTEXT pCryptReleaseContext = NULL;
+    HCRYPTPROV hCryptProv = 0;
+    BYTE data[sizeof(uint32_t)];
+    int ok;
+
+    hAdvAPI32 = GetModuleHandle(TEXT("advapi32.dll"));
+    if(hAdvAPI32 == NULL)
+        return 1;
+
+    pCryptAcquireContext = (CRYPTACQUIRECONTEXTA)GetProcAddress(hAdvAPI32, "CryptAcquireContextA");
+    if (!pCryptAcquireContext)
+        return 1;
+
+    pCryptGenRandom = (CRYPTGENRANDOM)GetProcAddress(hAdvAPI32, "CryptGenRandom");
+    if (!pCryptGenRandom)
+        return 1;
+
+    pCryptReleaseContext = (CRYPTRELEASECONTEXT)GetProcAddress(hAdvAPI32, "CryptReleaseContext");
+    if (!pCryptReleaseContext)
+        return 1;
+
+    if (!pCryptAcquireContext(&hCryptProv, NULL, NULL, PROV_RSA_FULL, CRYPT_VERIFYCONTEXT))
+        return 1;
+
+    ok = pCryptGenRandom(hCryptProv, sizeof(uint32_t), data);
+    pCryptReleaseContext(hCryptProv, 0);
+
+    if (!ok)
+        return 1;
+
+    *seed = buf_to_uint32((char *)data);
+    return 0;
+}
+#endif
+
+/* gettimeofday() and getpid() */
+static int seed_from_timestamp_and_pid(uint32_t *seed) {
+#ifdef HAVE_GETTIMEOFDAY
+    /* XOR of seconds and microseconds */
+    struct timeval tv;
+    gettimeofday(&tv, NULL);
+    *seed = (uint32_t)tv.tv_sec ^ (uint32_t)tv.tv_usec;
+#else
+    /* Seconds only */
+    *seed = (uint32_t)time(NULL);
+#endif
+
+    /* XOR with PID for more randomness */
+#if defined(_WIN32)
+    *seed ^= (uint32_t)GetCurrentProcessId();
+#elif defined(HAVE_GETPID)
+    *seed ^= (uint32_t)getpid();
+#endif
+
+    return 0;
+}
+
+static uint32_t generate_seed() {
+    uint32_t seed;
+    int done = 0;
+
+#if !defined(_WIN32) && defined(USE_URANDOM)
+    if (!done && seed_from_urandom(&seed) == 0)
+        done = 1;
+#endif
+
+#if defined(_WIN32) && defined(USE_WINDOWS_CRYPTOAPI)
+    if (!done && seed_from_windows_cryptoapi(&seed) == 0)
+        done = 1;
+#endif
+
+    if (!done) {
+        /* Fall back to timestamp and PID if no better randomness is
+           available */
+        seed_from_timestamp_and_pid(&seed);
+    }
+
+    /* Make sure the seed is never zero */
+    if (seed == 0)
+        seed = 1;
+
+    return seed;
+}
+
+
+volatile uint32_t hashtable_seed = 0;
+
+#if defined(HAVE_ATOMIC_BUILTINS) && (defined(HAVE_SCHED_YIELD) || !defined(_WIN32))
+static volatile char seed_initialized = 0;
+
+void json_object_seed(size_t seed) {
+    uint32_t new_seed = (uint32_t)seed;
+
+    if (hashtable_seed == 0) {
+        if (__atomic_test_and_set(&seed_initialized, __ATOMIC_RELAXED) == 0) {
+            /* Do the seeding ourselves */
+            if (new_seed == 0)
+                new_seed = generate_seed();
+
+            __atomic_store_n(&hashtable_seed, new_seed, __ATOMIC_RELEASE);
+        } else {
+            /* Wait for another thread to do the seeding */
+            do {
+#ifdef HAVE_SCHED_YIELD
+                sched_yield();
+#endif
+            } while(__atomic_load_n(&hashtable_seed, __ATOMIC_ACQUIRE) == 0);
+        }
+    }
+}
+#elif defined(HAVE_SYNC_BUILTINS) && (defined(HAVE_SCHED_YIELD) || !defined(_WIN32))
+void json_object_seed(size_t seed) {
+    uint32_t new_seed = (uint32_t)seed;
+
+    if (hashtable_seed == 0) {
+        if (new_seed == 0) {
+            /* Explicit synchronization fences are not supported by the
+               __sync builtins, so every thread getting here has to
+               generate the seed value.
+            */
+            new_seed = generate_seed();
+        }
+
+        do {
+            if (__sync_bool_compare_and_swap(&hashtable_seed, 0, new_seed)) {
+                /* We were the first to seed */
+                break;
+            } else {
+                /* Wait for another thread to do the seeding */
+#ifdef HAVE_SCHED_YIELD
+                sched_yield();
+#endif
+            }
+        } while(hashtable_seed == 0);
+    }
+}
+#elif defined(_WIN32)
+static long seed_initialized = 0;
+void json_object_seed(size_t seed) {
+    uint32_t new_seed = (uint32_t)seed;
+
+    if (hashtable_seed == 0) {
+        if (InterlockedIncrement(&seed_initialized) == 1) {
+            /* Do the seeding ourselves */
+            if (new_seed == 0)
+                new_seed = generate_seed();
+
+            hashtable_seed = new_seed;
+        } else {
+            /* Wait for another thread to do the seeding */
+            do {
+                SwitchToThread();
+            } while (hashtable_seed == 0);
+        }
+    }
+}
+#else
+/* Fall back to a thread-unsafe version */
+void json_object_seed(size_t seed) {
+    uint32_t new_seed = (uint32_t)seed;
+
+    if (hashtable_seed == 0) {
+        if (new_seed == 0)
+            new_seed = generate_seed();
+
+        hashtable_seed = new_seed;
+    }
+}
+#endif

Added: vendor/jansson/dist/src/jansson.def
===================================================================
--- vendor/jansson/dist/src/jansson.def	                        (rev 0)
+++ vendor/jansson/dist/src/jansson.def	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,69 @@
+EXPORTS
+    json_delete
+    json_true
+    json_false
+    json_null
+    json_string
+    json_stringn
+    json_string_nocheck
+    json_stringn_nocheck
+    json_string_value
+    json_string_length
+    json_string_set
+    json_string_setn
+    json_string_set_nocheck
+    json_string_setn_nocheck
+    json_integer
+    json_integer_value
+    json_integer_set
+    json_real
+    json_real_value
+    json_real_set
+    json_number_value
+    json_array
+    json_array_size
+    json_array_get
+    json_array_set_new
+    json_array_append_new
+    json_array_insert_new
+    json_array_remove
+    json_array_clear
+    json_array_extend
+    json_object
+    json_object_size
+    json_object_get
+    json_object_set_new
+    json_object_set_new_nocheck
+    json_object_del
+    json_object_clear
+    json_object_update
+    json_object_update_existing
+    json_object_update_missing
+    json_object_iter
+    json_object_iter_at
+    json_object_iter_next
+    json_object_iter_key
+    json_object_iter_value
+    json_object_iter_set_new
+    json_object_key_to_iter
+    json_object_seed
+    json_dumps
+    json_dumpf
+    json_dump_file
+    json_dump_callback
+    json_loads
+    json_loadb
+    json_loadf
+    json_load_file
+    json_load_callback
+    json_equal
+    json_copy
+    json_deep_copy
+    json_pack
+    json_pack_ex
+    json_vpack_ex
+    json_unpack
+    json_unpack_ex
+    json_vunpack_ex
+    json_set_alloc_funcs
+

Added: vendor/jansson/dist/src/jansson.h
===================================================================
--- vendor/jansson/dist/src/jansson.h	                        (rev 0)
+++ vendor/jansson/dist/src/jansson.h	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,290 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef JANSSON_H
+#define JANSSON_H
+
+#include <stdio.h>
+#include <stdlib.h>  /* for size_t */
+#include <stdarg.h>
+
+#include <jansson_config.h>
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+/* version */
+
+#define JANSSON_MAJOR_VERSION  2
+#define JANSSON_MINOR_VERSION  7
+#define JANSSON_MICRO_VERSION  0
+
+/* Micro version is omitted if it's 0 */
+#define JANSSON_VERSION  "2.7"
+
+/* Version as a 3-byte hex number, e.g. 0x010201 == 1.2.1. Use this
+   for numeric comparisons, e.g. #if JANSSON_VERSION_HEX >= ... */
+#define JANSSON_VERSION_HEX  ((JANSSON_MAJOR_VERSION << 16) |   \
+                              (JANSSON_MINOR_VERSION << 8)  |   \
+                              (JANSSON_MICRO_VERSION << 0))
+
+
+/* types */
+
+typedef enum {
+    JSON_OBJECT,
+    JSON_ARRAY,
+    JSON_STRING,
+    JSON_INTEGER,
+    JSON_REAL,
+    JSON_TRUE,
+    JSON_FALSE,
+    JSON_NULL
+} json_type;
+
+typedef struct json_t {
+    json_type type;
+    size_t refcount;
+} json_t;
+
+#ifndef JANSSON_USING_CMAKE /* disabled if using cmake */
+#if JSON_INTEGER_IS_LONG_LONG
+#ifdef _WIN32
+#define JSON_INTEGER_FORMAT "I64d"
+#else
+#define JSON_INTEGER_FORMAT "lld"
+#endif
+typedef long long json_int_t;
+#else
+#define JSON_INTEGER_FORMAT "ld"
+typedef long json_int_t;
+#endif /* JSON_INTEGER_IS_LONG_LONG */
+#endif
+
+#define json_typeof(json)      ((json)->type)
+#define json_is_object(json)   ((json) && json_typeof(json) == JSON_OBJECT)
+#define json_is_array(json)    ((json) && json_typeof(json) == JSON_ARRAY)
+#define json_is_string(json)   ((json) && json_typeof(json) == JSON_STRING)
+#define json_is_integer(json)  ((json) && json_typeof(json) == JSON_INTEGER)
+#define json_is_real(json)     ((json) && json_typeof(json) == JSON_REAL)
+#define json_is_number(json)   (json_is_integer(json) || json_is_real(json))
+#define json_is_true(json)     ((json) && json_typeof(json) == JSON_TRUE)
+#define json_is_false(json)    ((json) && json_typeof(json) == JSON_FALSE)
+#define json_boolean_value     json_is_true
+#define json_is_boolean(json)  (json_is_true(json) || json_is_false(json))
+#define json_is_null(json)     ((json) && json_typeof(json) == JSON_NULL)
+
+/* construction, destruction, reference counting */
+
+json_t *json_object(void);
+json_t *json_array(void);
+json_t *json_string(const char *value);
+json_t *json_stringn(const char *value, size_t len);
+json_t *json_string_nocheck(const char *value);
+json_t *json_stringn_nocheck(const char *value, size_t len);
+json_t *json_integer(json_int_t value);
+json_t *json_real(double value);
+json_t *json_true(void);
+json_t *json_false(void);
+#define json_boolean(val)      ((val) ? json_true() : json_false())
+json_t *json_null(void);
+
+static JSON_INLINE
+json_t *json_incref(json_t *json)
+{
+    if(json && json->refcount != (size_t)-1)
+        ++json->refcount;
+    return json;
+}
+
+/* do not call json_delete directly */
+void json_delete(json_t *json);
+
+static JSON_INLINE
+void json_decref(json_t *json)
+{
+    if(json && json->refcount != (size_t)-1 && --json->refcount == 0)
+        json_delete(json);
+}
+
+
+/* error reporting */
+
+#define JSON_ERROR_TEXT_LENGTH    160
+#define JSON_ERROR_SOURCE_LENGTH   80
+
+typedef struct {
+    int line;
+    int column;
+    int position;
+    char source[JSON_ERROR_SOURCE_LENGTH];
+    char text[JSON_ERROR_TEXT_LENGTH];
+} json_error_t;
+
+
+/* getters, setters, manipulation */
+
+void json_object_seed(size_t seed);
+size_t json_object_size(const json_t *object);
+json_t *json_object_get(const json_t *object, const char *key);
+int json_object_set_new(json_t *object, const char *key, json_t *value);
+int json_object_set_new_nocheck(json_t *object, const char *key, json_t *value);
+int json_object_del(json_t *object, const char *key);
+int json_object_clear(json_t *object);
+int json_object_update(json_t *object, json_t *other);
+int json_object_update_existing(json_t *object, json_t *other);
+int json_object_update_missing(json_t *object, json_t *other);
+void *json_object_iter(json_t *object);
+void *json_object_iter_at(json_t *object, const char *key);
+void *json_object_key_to_iter(const char *key);
+void *json_object_iter_next(json_t *object, void *iter);
+const char *json_object_iter_key(void *iter);
+json_t *json_object_iter_value(void *iter);
+int json_object_iter_set_new(json_t *object, void *iter, json_t *value);
+
+#define json_object_foreach(object, key, value) \
+    for(key = json_object_iter_key(json_object_iter(object)); \
+        key && (value = json_object_iter_value(json_object_key_to_iter(key))); \
+        key = json_object_iter_key(json_object_iter_next(object, json_object_key_to_iter(key))))
+
+#define json_array_foreach(array, index, value) \
+	for(index = 0; \
+		index < json_array_size(array) && (value = json_array_get(array, index)); \
+		index++)
+
+static JSON_INLINE
+int json_object_set(json_t *object, const char *key, json_t *value)
+{
+    return json_object_set_new(object, key, json_incref(value));
+}
+
+static JSON_INLINE
+int json_object_set_nocheck(json_t *object, const char *key, json_t *value)
+{
+    return json_object_set_new_nocheck(object, key, json_incref(value));
+}
+
+static JSON_INLINE
+int json_object_iter_set(json_t *object, void *iter, json_t *value)
+{
+    return json_object_iter_set_new(object, iter, json_incref(value));
+}
+
+size_t json_array_size(const json_t *array);
+json_t *json_array_get(const json_t *array, size_t index);
+int json_array_set_new(json_t *array, size_t index, json_t *value);
+int json_array_append_new(json_t *array, json_t *value);
+int json_array_insert_new(json_t *array, size_t index, json_t *value);
+int json_array_remove(json_t *array, size_t index);
+int json_array_clear(json_t *array);
+int json_array_extend(json_t *array, json_t *other);
+
+static JSON_INLINE
+int json_array_set(json_t *array, size_t ind, json_t *value)
+{
+    return json_array_set_new(array, ind, json_incref(value));
+}
+
+static JSON_INLINE
+int json_array_append(json_t *array, json_t *value)
+{
+    return json_array_append_new(array, json_incref(value));
+}
+
+static JSON_INLINE
+int json_array_insert(json_t *array, size_t ind, json_t *value)
+{
+    return json_array_insert_new(array, ind, json_incref(value));
+}
+
+const char *json_string_value(const json_t *string);
+size_t json_string_length(const json_t *string);
+json_int_t json_integer_value(const json_t *integer);
+double json_real_value(const json_t *real);
+double json_number_value(const json_t *json);
+
+int json_string_set(json_t *string, const char *value);
+int json_string_setn(json_t *string, const char *value, size_t len);
+int json_string_set_nocheck(json_t *string, const char *value);
+int json_string_setn_nocheck(json_t *string, const char *value, size_t len);
+int json_integer_set(json_t *integer, json_int_t value);
+int json_real_set(json_t *real, double value);
+
+/* pack, unpack */
+
+json_t *json_pack(const char *fmt, ...);
+json_t *json_pack_ex(json_error_t *error, size_t flags, const char *fmt, ...);
+json_t *json_vpack_ex(json_error_t *error, size_t flags, const char *fmt, va_list ap);
+
+#define JSON_VALIDATE_ONLY  0x1
+#define JSON_STRICT         0x2
+
+int json_unpack(json_t *root, const char *fmt, ...);
+int json_unpack_ex(json_t *root, json_error_t *error, size_t flags, const char *fmt, ...);
+int json_vunpack_ex(json_t *root, json_error_t *error, size_t flags, const char *fmt, va_list ap);
+
+
+/* equality */
+
+int json_equal(json_t *value1, json_t *value2);
+
+
+/* copying */
+
+json_t *json_copy(json_t *value);
+json_t *json_deep_copy(const json_t *value);
+
+
+/* decoding */
+
+#define JSON_REJECT_DUPLICATES  0x1
+#define JSON_DISABLE_EOF_CHECK  0x2
+#define JSON_DECODE_ANY         0x4
+#define JSON_DECODE_INT_AS_REAL 0x8
+#define JSON_ALLOW_NUL          0x10
+
+typedef size_t (*json_load_callback_t)(void *buffer, size_t buflen, void *data);
+
+json_t *json_loads(const char *input, size_t flags, json_error_t *error);
+json_t *json_loadb(const char *buffer, size_t buflen, size_t flags, json_error_t *error);
+json_t *json_loadf(FILE *input, size_t flags, json_error_t *error);
+json_t *json_load_file(const char *path, size_t flags, json_error_t *error);
+json_t *json_load_callback(json_load_callback_t callback, void *data, size_t flags, json_error_t *error);
+
+
+/* encoding */
+
+#define JSON_MAX_INDENT         0x1F
+#define JSON_INDENT(n)          ((n) & JSON_MAX_INDENT)
+#define JSON_COMPACT            0x20
+#define JSON_ENSURE_ASCII       0x40
+#define JSON_SORT_KEYS          0x80
+#define JSON_PRESERVE_ORDER     0x100
+#define JSON_ENCODE_ANY         0x200
+#define JSON_ESCAPE_SLASH       0x400
+#define JSON_REAL_PRECISION(n)  (((n) & 0x1F) << 11)
+
+typedef int (*json_dump_callback_t)(const char *buffer, size_t size, void *data);
+
+char *json_dumps(const json_t *json, size_t flags);
+int json_dumpf(const json_t *json, FILE *output, size_t flags);
+int json_dump_file(const json_t *json, const char *path, size_t flags);
+int json_dump_callback(const json_t *json, json_dump_callback_t callback, void *data, size_t flags);
+
+/* custom memory allocation */
+
+typedef void *(*json_malloc_t)(size_t);
+typedef void (*json_free_t)(void *);
+
+void json_set_alloc_funcs(json_malloc_t malloc_fn, json_free_t free_fn);
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif

Added: vendor/jansson/dist/src/jansson_config.h
===================================================================
--- vendor/jansson/dist/src/jansson_config.h	                        (rev 0)
+++ vendor/jansson/dist/src/jansson_config.h	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,39 @@
+/*
+ * Copyright (c) 2010-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ *
+ *
+ * This file specifies a part of the site-specific configuration for
+ * Jansson, namely those things that affect the public API in
+ * jansson.h.
+ *
+ * The configure script copies this file to jansson_config.h and
+ * replaces @var@ substitutions by values that fit your system. If you
+ * cannot run the configure script, you can do the value substitution
+ * by hand.
+ */
+
+#ifndef JANSSON_CONFIG_H
+#define JANSSON_CONFIG_H
+
+/* If your compiler supports the inline keyword in C, JSON_INLINE is
+   defined to `inline', otherwise empty. In C++, the inline is always
+   supported. */
+#ifdef __cplusplus
+#define JSON_INLINE inline
+#else
+#define JSON_INLINE inline
+#endif
+
+/* If your compiler supports the `long long` type and the strtoll()
+   library function, JSON_INTEGER_IS_LONG_LONG is defined to 1,
+   otherwise to 0. */
+#define JSON_INTEGER_IS_LONG_LONG 1
+
+/* If locale.h and localeconv() are available, define to 1,
+   otherwise to 0. */
+#define JSON_HAVE_LOCALECONV 1
+
+#endif

Added: vendor/jansson/dist/src/jansson_config.h.in
===================================================================
--- vendor/jansson/dist/src/jansson_config.h.in	                        (rev 0)
+++ vendor/jansson/dist/src/jansson_config.h.in	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,39 @@
+/*
+ * Copyright (c) 2010-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ *
+ *
+ * This file specifies a part of the site-specific configuration for
+ * Jansson, namely those things that affect the public API in
+ * jansson.h.
+ *
+ * The configure script copies this file to jansson_config.h and
+ * replaces @var@ substitutions by values that fit your system. If you
+ * cannot run the configure script, you can do the value substitution
+ * by hand.
+ */
+
+#ifndef JANSSON_CONFIG_H
+#define JANSSON_CONFIG_H
+
+/* If your compiler supports the inline keyword in C, JSON_INLINE is
+   defined to `inline', otherwise empty. In C++, the inline is always
+   supported. */
+#ifdef __cplusplus
+#define JSON_INLINE inline
+#else
+#define JSON_INLINE @json_inline@
+#endif
+
+/* If your compiler supports the `long long` type and the strtoll()
+   library function, JSON_INTEGER_IS_LONG_LONG is defined to 1,
+   otherwise to 0. */
+#define JSON_INTEGER_IS_LONG_LONG @json_have_long_long@
+
+/* If locale.h and localeconv() are available, define to 1,
+   otherwise to 0. */
+#define JSON_HAVE_LOCALECONV @json_have_localeconv@
+
+#endif

Added: vendor/jansson/dist/src/jansson_private.h
===================================================================
--- vendor/jansson/dist/src/jansson_private.h	                        (rev 0)
+++ vendor/jansson/dist/src/jansson_private.h	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,99 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef JANSSON_PRIVATE_H
+#define JANSSON_PRIVATE_H
+
+#include <stddef.h>
+#include "jansson.h"
+#include "hashtable.h"
+#include "strbuffer.h"
+
+#define container_of(ptr_, type_, member_)  \
+    ((type_ *)((char *)ptr_ - offsetof(type_, member_)))
+
+/* On some platforms, max() may already be defined */
+#ifndef max
+#define max(a, b)  ((a) > (b) ? (a) : (b))
+#endif
+
+/* va_copy is a C99 feature. In C89 implementations, it's sometimes
+   available as __va_copy. If not, memcpy() should do the trick. */
+#ifndef va_copy
+#ifdef __va_copy
+#define va_copy __va_copy
+#else
+#define va_copy(a, b)  memcpy(&(a), &(b), sizeof(va_list))
+#endif
+#endif
+
+typedef struct {
+    json_t json;
+    hashtable_t hashtable;
+    size_t serial;
+    int visited;
+} json_object_t;
+
+typedef struct {
+    json_t json;
+    size_t size;
+    size_t entries;
+    json_t **table;
+    int visited;
+} json_array_t;
+
+typedef struct {
+    json_t json;
+    char *value;
+    size_t length;
+} json_string_t;
+
+typedef struct {
+    json_t json;
+    double value;
+} json_real_t;
+
+typedef struct {
+    json_t json;
+    json_int_t value;
+} json_integer_t;
+
+#define json_to_object(json_)  container_of(json_, json_object_t, json)
+#define json_to_array(json_)   container_of(json_, json_array_t, json)
+#define json_to_string(json_)  container_of(json_, json_string_t, json)
+#define json_to_real(json_)    container_of(json_, json_real_t, json)
+#define json_to_integer(json_) container_of(json_, json_integer_t, json)
+
+/* Create a string by taking ownership of an existing buffer */
+json_t *jsonp_stringn_nocheck_own(const char *value, size_t len);
+
+/* Error message formatting */
+void jsonp_error_init(json_error_t *error, const char *source);
+void jsonp_error_set_source(json_error_t *error, const char *source);
+void jsonp_error_set(json_error_t *error, int line, int column,
+                     size_t position, const char *msg, ...);
+void jsonp_error_vset(json_error_t *error, int line, int column,
+                      size_t position, const char *msg, va_list ap);
+
+/* Locale independent string<->double conversions */
+int jsonp_strtod(strbuffer_t *strbuffer, double *out);
+int jsonp_dtostr(char *buffer, size_t size, double value, int prec);
+
+/* Wrappers for custom memory functions */
+void* jsonp_malloc(size_t size);
+void jsonp_free(void *ptr);
+char *jsonp_strndup(const char *str, size_t length);
+char *jsonp_strdup(const char *str);
+char *jsonp_strndup(const char *str, size_t len);
+
+/* Windows compatibility */
+#ifdef _WIN32
+#define snprintf _snprintf
+#define vsnprintf _vsnprintf
+#endif
+
+#endif

Added: vendor/jansson/dist/src/load.c
===================================================================
--- vendor/jansson/dist/src/load.c	                        (rev 0)
+++ vendor/jansson/dist/src/load.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,1105 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef _GNU_SOURCE
+#define _GNU_SOURCE
+#endif
+
+#include <errno.h>
+#include <limits.h>
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <assert.h>
+
+#include "jansson.h"
+#include "jansson_private.h"
+#include "strbuffer.h"
+#include "utf.h"
+
+#define STREAM_STATE_OK        0
+#define STREAM_STATE_EOF      -1
+#define STREAM_STATE_ERROR    -2
+
+#define TOKEN_INVALID         -1
+#define TOKEN_EOF              0
+#define TOKEN_STRING         256
+#define TOKEN_INTEGER        257
+#define TOKEN_REAL           258
+#define TOKEN_TRUE           259
+#define TOKEN_FALSE          260
+#define TOKEN_NULL           261
+
+/* Locale independent versions of isxxx() functions */
+#define l_isupper(c)  ('A' <= (c) && (c) <= 'Z')
+#define l_islower(c)  ('a' <= (c) && (c) <= 'z')
+#define l_isalpha(c)  (l_isupper(c) || l_islower(c))
+#define l_isdigit(c)  ('0' <= (c) && (c) <= '9')
+#define l_isxdigit(c) \
+    (l_isdigit(c) || ('A' <= (c) && (c) <= 'F') || ('a' <= (c) && (c) <= 'f'))
+
+/* Read one byte from stream, convert to unsigned char, then int, and
+   return. return EOF on end of file. This corresponds to the
+   behaviour of fgetc(). */
+typedef int (*get_func)(void *data);
+
+typedef struct {
+    get_func get;
+    void *data;
+    char buffer[5];
+    size_t buffer_pos;
+    int state;
+    int line;
+    int column, last_column;
+    size_t position;
+} stream_t;
+
+typedef struct {
+    stream_t stream;
+    strbuffer_t saved_text;
+    int token;
+    union {
+        struct {
+            char *val;
+            size_t len;
+        } string;
+        json_int_t integer;
+        double real;
+    } value;
+} lex_t;
+
+#define stream_to_lex(stream) container_of(stream, lex_t, stream)
+
+
+/*** error reporting ***/
+
+static void error_set(json_error_t *error, const lex_t *lex,
+                      const char *msg, ...)
+{
+    va_list ap;
+    char msg_text[JSON_ERROR_TEXT_LENGTH];
+    char msg_with_context[JSON_ERROR_TEXT_LENGTH];
+
+    int line = -1, col = -1;
+    size_t pos = 0;
+    const char *result = msg_text;
+
+    if(!error)
+        return;
+
+    va_start(ap, msg);
+    vsnprintf(msg_text, JSON_ERROR_TEXT_LENGTH, msg, ap);
+    msg_text[JSON_ERROR_TEXT_LENGTH - 1] = '\0';
+    va_end(ap);
+
+    if(lex)
+    {
+        const char *saved_text = strbuffer_value(&lex->saved_text);
+
+        line = lex->stream.line;
+        col = lex->stream.column;
+        pos = lex->stream.position;
+
+        if(saved_text && saved_text[0])
+        {
+            if(lex->saved_text.length <= 20) {
+                snprintf(msg_with_context, JSON_ERROR_TEXT_LENGTH,
+                         "%s near '%s'", msg_text, saved_text);
+                msg_with_context[JSON_ERROR_TEXT_LENGTH - 1] = '\0';
+                result = msg_with_context;
+            }
+        }
+        else
+        {
+            if(lex->stream.state == STREAM_STATE_ERROR) {
+                /* No context for UTF-8 decoding errors */
+                result = msg_text;
+            }
+            else {
+                snprintf(msg_with_context, JSON_ERROR_TEXT_LENGTH,
+                         "%s near end of file", msg_text);
+                msg_with_context[JSON_ERROR_TEXT_LENGTH - 1] = '\0';
+                result = msg_with_context;
+            }
+        }
+    }
+
+    jsonp_error_set(error, line, col, pos, "%s", result);
+}
+
+
+/*** lexical analyzer ***/
+
+static void
+stream_init(stream_t *stream, get_func get, void *data)
+{
+    stream->get = get;
+    stream->data = data;
+    stream->buffer[0] = '\0';
+    stream->buffer_pos = 0;
+
+    stream->state = STREAM_STATE_OK;
+    stream->line = 1;
+    stream->column = 0;
+    stream->position = 0;
+}
+
+static int stream_get(stream_t *stream, json_error_t *error)
+{
+    int c;
+
+    if(stream->state != STREAM_STATE_OK)
+        return stream->state;
+
+    if(!stream->buffer[stream->buffer_pos])
+    {
+        c = stream->get(stream->data);
+        if(c == EOF) {
+            stream->state = STREAM_STATE_EOF;
+            return STREAM_STATE_EOF;
+        }
+
+        stream->buffer[0] = c;
+        stream->buffer_pos = 0;
+
+        if(0x80 <= c && c <= 0xFF)
+        {
+            /* multi-byte UTF-8 sequence */
+            int i, count;
+
+            count = utf8_check_first(c);
+            if(!count)
+                goto out;
+
+            assert(count >= 2);
+
+            for(i = 1; i < count; i++)
+                stream->buffer[i] = stream->get(stream->data);
+
+            if(!utf8_check_full(stream->buffer, count, NULL))
+                goto out;
+
+            stream->buffer[count] = '\0';
+        }
+        else
+            stream->buffer[1] = '\0';
+    }
+
+    c = stream->buffer[stream->buffer_pos++];
+
+    stream->position++;
+    if(c == '\n') {
+        stream->line++;
+        stream->last_column = stream->column;
+        stream->column = 0;
+    }
+    else if(utf8_check_first(c)) {
+        /* track the Unicode character column, so increment only if
+           this is the first character of a UTF-8 sequence */
+        stream->column++;
+    }
+
+    return c;
+
+out:
+    stream->state = STREAM_STATE_ERROR;
+    error_set(error, stream_to_lex(stream), "unable to decode byte 0x%x", c);
+    return STREAM_STATE_ERROR;
+}
+
+static void stream_unget(stream_t *stream, int c)
+{
+    if(c == STREAM_STATE_EOF || c == STREAM_STATE_ERROR)
+        return;
+
+    stream->position--;
+    if(c == '\n') {
+        stream->line--;
+        stream->column = stream->last_column;
+    }
+    else if(utf8_check_first(c))
+        stream->column--;
+
+    assert(stream->buffer_pos > 0);
+    stream->buffer_pos--;
+    assert(stream->buffer[stream->buffer_pos] == c);
+}
+
+
+static int lex_get(lex_t *lex, json_error_t *error)
+{
+    return stream_get(&lex->stream, error);
+}
+
+static void lex_save(lex_t *lex, int c)
+{
+    strbuffer_append_byte(&lex->saved_text, c);
+}
+
+static int lex_get_save(lex_t *lex, json_error_t *error)
+{
+    int c = stream_get(&lex->stream, error);
+    if(c != STREAM_STATE_EOF && c != STREAM_STATE_ERROR)
+        lex_save(lex, c);
+    return c;
+}
+
+static void lex_unget(lex_t *lex, int c)
+{
+    stream_unget(&lex->stream, c);
+}
+
+static void lex_unget_unsave(lex_t *lex, int c)
+{
+    if(c != STREAM_STATE_EOF && c != STREAM_STATE_ERROR) {
+        /* Since we treat warnings as errors, when assertions are turned
+         * off the "d" variable would be set but never used. Which is
+         * treated as an error by GCC.
+         */
+        #ifndef NDEBUG
+        char d;
+        #endif
+        stream_unget(&lex->stream, c);
+        #ifndef NDEBUG
+        d = 
+        #endif
+            strbuffer_pop(&lex->saved_text);
+        assert(c == d);
+    }
+}
+
+static void lex_save_cached(lex_t *lex)
+{
+    while(lex->stream.buffer[lex->stream.buffer_pos] != '\0')
+    {
+        lex_save(lex, lex->stream.buffer[lex->stream.buffer_pos]);
+        lex->stream.buffer_pos++;
+        lex->stream.position++;
+    }
+}
+
+static void lex_free_string(lex_t *lex)
+{
+    jsonp_free(lex->value.string.val);
+    lex->value.string.val = NULL;
+    lex->value.string.len = 0;
+}
+
+/* assumes that str points to 'u' plus at least 4 valid hex digits */
+static int32_t decode_unicode_escape(const char *str)
+{
+    int i;
+    int32_t value = 0;
+
+    assert(str[0] == 'u');
+
+    for(i = 1; i <= 4; i++) {
+        char c = str[i];
+        value <<= 4;
+        if(l_isdigit(c))
+            value += c - '0';
+        else if(l_islower(c))
+            value += c - 'a' + 10;
+        else if(l_isupper(c))
+            value += c - 'A' + 10;
+        else
+            return -1;
+    }
+
+    return value;
+}
+
+static void lex_scan_string(lex_t *lex, json_error_t *error)
+{
+    int c;
+    const char *p;
+    char *t;
+    int i;
+
+    lex->value.string.val = NULL;
+    lex->token = TOKEN_INVALID;
+
+    c = lex_get_save(lex, error);
+
+    while(c != '"') {
+        if(c == STREAM_STATE_ERROR)
+            goto out;
+
+        else if(c == STREAM_STATE_EOF) {
+            error_set(error, lex, "premature end of input");
+            goto out;
+        }
+
+        else if(0 <= c && c <= 0x1F) {
+            /* control character */
+            lex_unget_unsave(lex, c);
+            if(c == '\n')
+                error_set(error, lex, "unexpected newline", c);
+            else
+                error_set(error, lex, "control character 0x%x", c);
+            goto out;
+        }
+
+        else if(c == '\\') {
+            c = lex_get_save(lex, error);
+            if(c == 'u') {
+                c = lex_get_save(lex, error);
+                for(i = 0; i < 4; i++) {
+                    if(!l_isxdigit(c)) {
+                        error_set(error, lex, "invalid escape");
+                        goto out;
+                    }
+                    c = lex_get_save(lex, error);
+                }
+            }
+            else if(c == '"' || c == '\\' || c == '/' || c == 'b' ||
+                    c == 'f' || c == 'n' || c == 'r' || c == 't')
+                c = lex_get_save(lex, error);
+            else {
+                error_set(error, lex, "invalid escape");
+                goto out;
+            }
+        }
+        else
+            c = lex_get_save(lex, error);
+    }
+
+    /* the actual value is at most of the same length as the source
+       string, because:
+         - shortcut escapes (e.g. "\t") (length 2) are converted to 1 byte
+         - a single \uXXXX escape (length 6) is converted to at most 3 bytes
+         - two \uXXXX escapes (length 12) forming an UTF-16 surrogate pair
+           are converted to 4 bytes
+    */
+    t = jsonp_malloc(lex->saved_text.length + 1);
+    if(!t) {
+        /* this is not very nice, since TOKEN_INVALID is returned */
+        goto out;
+    }
+    lex->value.string.val = t;
+
+    /* + 1 to skip the " */
+    p = strbuffer_value(&lex->saved_text) + 1;
+
+    while(*p != '"') {
+        if(*p == '\\') {
+            p++;
+            if(*p == 'u') {
+                size_t length;
+                int32_t value;
+
+                value = decode_unicode_escape(p);
+                if(value < 0) {
+                    error_set(error, lex, "invalid Unicode escape '%.6s'", p - 1);
+                    goto out;
+                }
+                p += 5;
+
+                if(0xD800 <= value && value <= 0xDBFF) {
+                    /* surrogate pair */
+                    if(*p == '\\' && *(p + 1) == 'u') {
+                        int32_t value2 = decode_unicode_escape(++p);
+                        if(value2 < 0) {
+                            error_set(error, lex, "invalid Unicode escape '%.6s'", p - 1);
+                            goto out;
+                        }
+                        p += 5;
+
+                        if(0xDC00 <= value2 && value2 <= 0xDFFF) {
+                            /* valid second surrogate */
+                            value =
+                                ((value - 0xD800) << 10) +
+                                (value2 - 0xDC00) +
+                                0x10000;
+                        }
+                        else {
+                            /* invalid second surrogate */
+                            error_set(error, lex,
+                                      "invalid Unicode '\\u%04X\\u%04X'",
+                                      value, value2);
+                            goto out;
+                        }
+                    }
+                    else {
+                        /* no second surrogate */
+                        error_set(error, lex, "invalid Unicode '\\u%04X'",
+                                  value);
+                        goto out;
+                    }
+                }
+                else if(0xDC00 <= value && value <= 0xDFFF) {
+                    error_set(error, lex, "invalid Unicode '\\u%04X'", value);
+                    goto out;
+                }
+
+                if(utf8_encode(value, t, &length))
+                    assert(0);
+                t += length;
+            }
+            else {
+                switch(*p) {
+                    case '"': case '\\': case '/':
+                        *t = *p; break;
+                    case 'b': *t = '\b'; break;
+                    case 'f': *t = '\f'; break;
+                    case 'n': *t = '\n'; break;
+                    case 'r': *t = '\r'; break;
+                    case 't': *t = '\t'; break;
+                    default: assert(0);
+                }
+                t++;
+                p++;
+            }
+        }
+        else
+            *(t++) = *(p++);
+    }
+    *t = '\0';
+    lex->value.string.len = t - lex->value.string.val;
+    lex->token = TOKEN_STRING;
+    return;
+
+out:
+    lex_free_string(lex);
+}
+
+#ifndef JANSSON_USING_CMAKE /* disabled if using cmake */
+#if JSON_INTEGER_IS_LONG_LONG
+#ifdef _MSC_VER  /* Microsoft Visual Studio */
+#define json_strtoint     _strtoi64
+#else
+#define json_strtoint     strtoll
+#endif
+#else
+#define json_strtoint     strtol
+#endif
+#endif
+
+static int lex_scan_number(lex_t *lex, int c, json_error_t *error)
+{
+    const char *saved_text;
+    char *end;
+    double doubleval;
+
+    lex->token = TOKEN_INVALID;
+
+    if(c == '-')
+        c = lex_get_save(lex, error);
+
+    if(c == '0') {
+        c = lex_get_save(lex, error);
+        if(l_isdigit(c)) {
+            lex_unget_unsave(lex, c);
+            goto out;
+        }
+    }
+    else if(l_isdigit(c)) {
+        c = lex_get_save(lex, error);
+        while(l_isdigit(c))
+            c = lex_get_save(lex, error);
+    }
+    else {
+        lex_unget_unsave(lex, c);
+        goto out;
+    }
+
+    if(c != '.' && c != 'E' && c != 'e') {
+        json_int_t intval;
+
+        lex_unget_unsave(lex, c);
+
+        saved_text = strbuffer_value(&lex->saved_text);
+
+        errno = 0;
+        intval = json_strtoint(saved_text, &end, 10);
+        if(errno == ERANGE) {
+            if(intval < 0)
+                error_set(error, lex, "too big negative integer");
+            else
+                error_set(error, lex, "too big integer");
+            goto out;
+        }
+
+        assert(end == saved_text + lex->saved_text.length);
+
+        lex->token = TOKEN_INTEGER;
+        lex->value.integer = intval;
+        return 0;
+    }
+
+    if(c == '.') {
+        c = lex_get(lex, error);
+        if(!l_isdigit(c)) {
+            lex_unget(lex, c);
+            goto out;
+        }
+        lex_save(lex, c);
+
+        c = lex_get_save(lex, error);
+        while(l_isdigit(c))
+            c = lex_get_save(lex, error);
+    }
+
+    if(c == 'E' || c == 'e') {
+        c = lex_get_save(lex, error);
+        if(c == '+' || c == '-')
+            c = lex_get_save(lex, error);
+
+        if(!l_isdigit(c)) {
+            lex_unget_unsave(lex, c);
+            goto out;
+        }
+
+        c = lex_get_save(lex, error);
+        while(l_isdigit(c))
+            c = lex_get_save(lex, error);
+    }
+
+    lex_unget_unsave(lex, c);
+
+    if(jsonp_strtod(&lex->saved_text, &doubleval)) {
+        error_set(error, lex, "real number overflow");
+        goto out;
+    }
+
+    lex->token = TOKEN_REAL;
+    lex->value.real = doubleval;
+    return 0;
+
+out:
+    return -1;
+}
+
+static int lex_scan(lex_t *lex, json_error_t *error)
+{
+    int c;
+
+    strbuffer_clear(&lex->saved_text);
+
+    if(lex->token == TOKEN_STRING)
+        lex_free_string(lex);
+
+    c = lex_get(lex, error);
+    while(c == ' ' || c == '\t' || c == '\n' || c == '\r')
+        c = lex_get(lex, error);
+
+    if(c == STREAM_STATE_EOF) {
+        lex->token = TOKEN_EOF;
+        goto out;
+    }
+
+    if(c == STREAM_STATE_ERROR) {
+        lex->token = TOKEN_INVALID;
+        goto out;
+    }
+
+    lex_save(lex, c);
+
+    if(c == '{' || c == '}' || c == '[' || c == ']' || c == ':' || c == ',')
+        lex->token = c;
+
+    else if(c == '"')
+        lex_scan_string(lex, error);
+
+    else if(l_isdigit(c) || c == '-') {
+        if(lex_scan_number(lex, c, error))
+            goto out;
+    }
+
+    else if(l_isalpha(c)) {
+        /* eat up the whole identifier for clearer error messages */
+        const char *saved_text;
+
+        c = lex_get_save(lex, error);
+        while(l_isalpha(c))
+            c = lex_get_save(lex, error);
+        lex_unget_unsave(lex, c);
+
+        saved_text = strbuffer_value(&lex->saved_text);
+
+        if(strcmp(saved_text, "true") == 0)
+            lex->token = TOKEN_TRUE;
+        else if(strcmp(saved_text, "false") == 0)
+            lex->token = TOKEN_FALSE;
+        else if(strcmp(saved_text, "null") == 0)
+            lex->token = TOKEN_NULL;
+        else
+            lex->token = TOKEN_INVALID;
+    }
+
+    else {
+        /* save the rest of the input UTF-8 sequence to get an error
+           message of valid UTF-8 */
+        lex_save_cached(lex);
+        lex->token = TOKEN_INVALID;
+    }
+
+out:
+    return lex->token;
+}
+
+static char *lex_steal_string(lex_t *lex, size_t *out_len)
+{
+    char *result = NULL;
+    if(lex->token == TOKEN_STRING) {
+        result = lex->value.string.val;
+        *out_len = lex->value.string.len;
+        lex->value.string.val = NULL;
+        lex->value.string.len = 0;
+    }
+    return result;
+}
+
+static int lex_init(lex_t *lex, get_func get, void *data)
+{
+    stream_init(&lex->stream, get, data);
+    if(strbuffer_init(&lex->saved_text))
+        return -1;
+
+    lex->token = TOKEN_INVALID;
+    return 0;
+}
+
+static void lex_close(lex_t *lex)
+{
+    if(lex->token == TOKEN_STRING)
+        lex_free_string(lex);
+    strbuffer_close(&lex->saved_text);
+}
+
+
+/*** parser ***/
+
+static json_t *parse_value(lex_t *lex, size_t flags, json_error_t *error);
+
+static json_t *parse_object(lex_t *lex, size_t flags, json_error_t *error)
+{
+    json_t *object = json_object();
+    if(!object)
+        return NULL;
+
+    lex_scan(lex, error);
+    if(lex->token == '}')
+        return object;
+
+    while(1) {
+        char *key;
+        size_t len;
+        json_t *value;
+
+        if(lex->token != TOKEN_STRING) {
+            error_set(error, lex, "string or '}' expected");
+            goto error;
+        }
+
+        key = lex_steal_string(lex, &len);
+        if(!key)
+            return NULL;
+        if (memchr(key, '\0', len)) {
+            jsonp_free(key);
+            error_set(error, lex, "NUL byte in object key not supported");
+            goto error;
+        }
+
+        if(flags & JSON_REJECT_DUPLICATES) {
+            if(json_object_get(object, key)) {
+                jsonp_free(key);
+                error_set(error, lex, "duplicate object key");
+                goto error;
+            }
+        }
+
+        lex_scan(lex, error);
+        if(lex->token != ':') {
+            jsonp_free(key);
+            error_set(error, lex, "':' expected");
+            goto error;
+        }
+
+        lex_scan(lex, error);
+        value = parse_value(lex, flags, error);
+        if(!value) {
+            jsonp_free(key);
+            goto error;
+        }
+
+        if(json_object_set_nocheck(object, key, value)) {
+            jsonp_free(key);
+            json_decref(value);
+            goto error;
+        }
+
+        json_decref(value);
+        jsonp_free(key);
+
+        lex_scan(lex, error);
+        if(lex->token != ',')
+            break;
+
+        lex_scan(lex, error);
+    }
+
+    if(lex->token != '}') {
+        error_set(error, lex, "'}' expected");
+        goto error;
+    }
+
+    return object;
+
+error:
+    json_decref(object);
+    return NULL;
+}
+
+static json_t *parse_array(lex_t *lex, size_t flags, json_error_t *error)
+{
+    json_t *array = json_array();
+    if(!array)
+        return NULL;
+
+    lex_scan(lex, error);
+    if(lex->token == ']')
+        return array;
+
+    while(lex->token) {
+        json_t *elem = parse_value(lex, flags, error);
+        if(!elem)
+            goto error;
+
+        if(json_array_append(array, elem)) {
+            json_decref(elem);
+            goto error;
+        }
+        json_decref(elem);
+
+        lex_scan(lex, error);
+        if(lex->token != ',')
+            break;
+
+        lex_scan(lex, error);
+    }
+
+    if(lex->token != ']') {
+        error_set(error, lex, "']' expected");
+        goto error;
+    }
+
+    return array;
+
+error:
+    json_decref(array);
+    return NULL;
+}
+
+static json_t *parse_value(lex_t *lex, size_t flags, json_error_t *error)
+{
+    json_t *json;
+    double value;
+
+    switch(lex->token) {
+        case TOKEN_STRING: {
+            const char *value = lex->value.string.val;
+            size_t len = lex->value.string.len;
+
+            if(!(flags & JSON_ALLOW_NUL)) {
+                if(memchr(value, '\0', len)) {
+                    error_set(error, lex, "\\u0000 is not allowed without JSON_ALLOW_NUL");
+                    return NULL;
+                }
+            }
+
+            json = jsonp_stringn_nocheck_own(value, len);
+            if(json) {
+                lex->value.string.val = NULL;
+                lex->value.string.len = 0;
+            }
+            break;
+        }
+
+        case TOKEN_INTEGER: {
+            if (flags & JSON_DECODE_INT_AS_REAL) {
+                if(jsonp_strtod(&lex->saved_text, &value)) {
+                    error_set(error, lex, "real number overflow");
+                    return NULL;
+                }
+                json = json_real(value);
+            } else {
+                json = json_integer(lex->value.integer);
+            }
+            break;
+        }
+
+        case TOKEN_REAL: {
+            json = json_real(lex->value.real);
+            break;
+        }
+
+        case TOKEN_TRUE:
+            json = json_true();
+            break;
+
+        case TOKEN_FALSE:
+            json = json_false();
+            break;
+
+        case TOKEN_NULL:
+            json = json_null();
+            break;
+
+        case '{':
+            json = parse_object(lex, flags, error);
+            break;
+
+        case '[':
+            json = parse_array(lex, flags, error);
+            break;
+
+        case TOKEN_INVALID:
+            error_set(error, lex, "invalid token");
+            return NULL;
+
+        default:
+            error_set(error, lex, "unexpected token");
+            return NULL;
+    }
+
+    if(!json)
+        return NULL;
+
+    return json;
+}
+
+static json_t *parse_json(lex_t *lex, size_t flags, json_error_t *error)
+{
+    json_t *result;
+
+    lex_scan(lex, error);
+    if(!(flags & JSON_DECODE_ANY)) {
+        if(lex->token != '[' && lex->token != '{') {
+            error_set(error, lex, "'[' or '{' expected");
+            return NULL;
+        }
+    }
+
+    result = parse_value(lex, flags, error);
+    if(!result)
+        return NULL;
+
+    if(!(flags & JSON_DISABLE_EOF_CHECK)) {
+        lex_scan(lex, error);
+        if(lex->token != TOKEN_EOF) {
+            error_set(error, lex, "end of file expected");
+            json_decref(result);
+            return NULL;
+        }
+    }
+
+    if(error) {
+        /* Save the position even though there was no error */
+        error->position = lex->stream.position;
+    }
+
+    return result;
+}
+
+typedef struct
+{
+    const char *data;
+    int pos;
+} string_data_t;
+
+static int string_get(void *data)
+{
+    char c;
+    string_data_t *stream = (string_data_t *)data;
+    c = stream->data[stream->pos];
+    if(c == '\0')
+        return EOF;
+    else
+    {
+        stream->pos++;
+        return (unsigned char)c;
+    }
+}
+
+json_t *json_loads(const char *string, size_t flags, json_error_t *error)
+{
+    lex_t lex;
+    json_t *result;
+    string_data_t stream_data;
+
+    jsonp_error_init(error, "<string>");
+
+    if (string == NULL) {
+        error_set(error, NULL, "wrong arguments");
+        return NULL;
+    }
+
+    stream_data.data = string;
+    stream_data.pos = 0;
+
+    if(lex_init(&lex, string_get, (void *)&stream_data))
+        return NULL;
+
+    result = parse_json(&lex, flags, error);
+
+    lex_close(&lex);
+    return result;
+}
+
+typedef struct
+{
+    const char *data;
+    size_t len;
+    size_t pos;
+} buffer_data_t;
+
+static int buffer_get(void *data)
+{
+    char c;
+    buffer_data_t *stream = data;
+    if(stream->pos >= stream->len)
+      return EOF;
+
+    c = stream->data[stream->pos];
+    stream->pos++;
+    return (unsigned char)c;
+}
+
+json_t *json_loadb(const char *buffer, size_t buflen, size_t flags, json_error_t *error)
+{
+    lex_t lex;
+    json_t *result;
+    buffer_data_t stream_data;
+
+    jsonp_error_init(error, "<buffer>");
+
+    if (buffer == NULL) {
+        error_set(error, NULL, "wrong arguments");
+        return NULL;
+    }
+
+    stream_data.data = buffer;
+    stream_data.pos = 0;
+    stream_data.len = buflen;
+
+    if(lex_init(&lex, buffer_get, (void *)&stream_data))
+        return NULL;
+
+    result = parse_json(&lex, flags, error);
+
+    lex_close(&lex);
+    return result;
+}
+
+json_t *json_loadf(FILE *input, size_t flags, json_error_t *error)
+{
+    lex_t lex;
+    const char *source;
+    json_t *result;
+
+    if(input == stdin)
+        source = "<stdin>";
+    else
+        source = "<stream>";
+
+    jsonp_error_init(error, source);
+
+    if (input == NULL) {
+        error_set(error, NULL, "wrong arguments");
+        return NULL;
+    }
+
+    if(lex_init(&lex, (get_func)fgetc, input))
+        return NULL;
+
+    result = parse_json(&lex, flags, error);
+
+    lex_close(&lex);
+    return result;
+}
+
+json_t *json_load_file(const char *path, size_t flags, json_error_t *error)
+{
+    json_t *result;
+    FILE *fp;
+
+    jsonp_error_init(error, path);
+
+    if (path == NULL) {
+        error_set(error, NULL, "wrong arguments");
+        return NULL;
+    }
+
+    fp = fopen(path, "rb");
+    if(!fp)
+    {
+        error_set(error, NULL, "unable to open %s: %s",
+                  path, strerror(errno));
+        return NULL;
+    }
+
+    result = json_loadf(fp, flags, error);
+
+    fclose(fp);
+    return result;
+}
+
+#define MAX_BUF_LEN 1024
+
+typedef struct
+{
+    char data[MAX_BUF_LEN];
+    size_t len;
+    size_t pos;
+    json_load_callback_t callback;
+    void *arg;
+} callback_data_t;
+
+static int callback_get(void *data)
+{
+    char c;
+    callback_data_t *stream = data;
+
+    if(stream->pos >= stream->len) {
+        stream->pos = 0;
+        stream->len = stream->callback(stream->data, MAX_BUF_LEN, stream->arg);
+        if(stream->len == 0 || stream->len == (size_t)-1)
+            return EOF;
+    }
+
+    c = stream->data[stream->pos];
+    stream->pos++;
+    return (unsigned char)c;
+}
+
+json_t *json_load_callback(json_load_callback_t callback, void *arg, size_t flags, json_error_t *error)
+{
+    lex_t lex;
+    json_t *result;
+
+    callback_data_t stream_data;
+
+    memset(&stream_data, 0, sizeof(stream_data));
+    stream_data.callback = callback;
+    stream_data.arg = arg;
+
+    jsonp_error_init(error, "<callback>");
+
+    if (callback == NULL) {
+        error_set(error, NULL, "wrong arguments");
+        return NULL;
+    }
+
+    if(lex_init(&lex, (get_func)callback_get, &stream_data))
+        return NULL;
+
+    result = parse_json(&lex, flags, error);
+
+    lex_close(&lex);
+    return result;
+}

Added: vendor/jansson/dist/src/lookup3.h
===================================================================
--- vendor/jansson/dist/src/lookup3.h	                        (rev 0)
+++ vendor/jansson/dist/src/lookup3.h	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,381 @@
+/*
+-------------------------------------------------------------------------------
+lookup3.c, by Bob Jenkins, May 2006, Public Domain.
+
+These are functions for producing 32-bit hashes for hash table lookup.
+hashword(), hashlittle(), hashlittle2(), hashbig(), mix(), and final() 
+are externally useful functions.  Routines to test the hash are included 
+if SELF_TEST is defined.  You can use this free for any purpose.  It's in
+the public domain.  It has no warranty.
+
+You probably want to use hashlittle().  hashlittle() and hashbig()
+hash byte arrays.  hashlittle() is is faster than hashbig() on
+little-endian machines.  Intel and AMD are little-endian machines.
+On second thought, you probably want hashlittle2(), which is identical to
+hashlittle() except it returns two 32-bit hashes for the price of one.  
+You could implement hashbig2() if you wanted but I haven't bothered here.
+
+If you want to find a hash of, say, exactly 7 integers, do
+  a = i1;  b = i2;  c = i3;
+  mix(a,b,c);
+  a += i4; b += i5; c += i6;
+  mix(a,b,c);
+  a += i7;
+  final(a,b,c);
+then use c as the hash value.  If you have a variable length array of
+4-byte integers to hash, use hashword().  If you have a byte array (like
+a character string), use hashlittle().  If you have several byte arrays, or
+a mix of things, see the comments above hashlittle().  
+
+Why is this so big?  I read 12 bytes at a time into 3 4-byte integers, 
+then mix those integers.  This is fast (you can do a lot more thorough
+mixing with 12*3 instructions on 3 integers than you can with 3 instructions
+on 1 byte), but shoehorning those bytes into integers efficiently is messy.
+-------------------------------------------------------------------------------
+*/
+
+#include <stdlib.h>
+
+#ifdef HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#ifdef HAVE_STDINT_H
+#include <stdint.h>     /* defines uint32_t etc */
+#endif
+
+#ifdef HAVE_SYS_PARAM_H
+#include <sys/param.h>  /* attempt to define endianness */
+#endif
+
+#ifdef HAVE_ENDIAN_H
+# include <endian.h>    /* attempt to define endianness */
+#endif
+
+/*
+ * My best guess at if you are big-endian or little-endian.  This may
+ * need adjustment.
+ */
+#if (defined(__BYTE_ORDER) && defined(__LITTLE_ENDIAN) && \
+     __BYTE_ORDER == __LITTLE_ENDIAN) || \
+    (defined(i386) || defined(__i386__) || defined(__i486__) || \
+     defined(__i586__) || defined(__i686__) || defined(vax) || defined(MIPSEL))
+# define HASH_LITTLE_ENDIAN 1
+# define HASH_BIG_ENDIAN 0
+#elif (defined(__BYTE_ORDER) && defined(__BIG_ENDIAN) && \
+       __BYTE_ORDER == __BIG_ENDIAN) || \
+      (defined(sparc) || defined(POWERPC) || defined(mc68000) || defined(sel))
+# define HASH_LITTLE_ENDIAN 0
+# define HASH_BIG_ENDIAN 1
+#else
+# define HASH_LITTLE_ENDIAN 0
+# define HASH_BIG_ENDIAN 0
+#endif
+
+#define hashsize(n) ((uint32_t)1<<(n))
+#define hashmask(n) (hashsize(n)-1)
+#define rot(x,k) (((x)<<(k)) | ((x)>>(32-(k))))
+
+/*
+-------------------------------------------------------------------------------
+mix -- mix 3 32-bit values reversibly.
+
+This is reversible, so any information in (a,b,c) before mix() is
+still in (a,b,c) after mix().
+
+If four pairs of (a,b,c) inputs are run through mix(), or through
+mix() in reverse, there are at least 32 bits of the output that
+are sometimes the same for one pair and different for another pair.
+This was tested for:
+* pairs that differed by one bit, by two bits, in any combination
+  of top bits of (a,b,c), or in any combination of bottom bits of
+  (a,b,c).
+* "differ" is defined as +, -, ^, or ~^.  For + and -, I transformed
+  the output delta to a Gray code (a^(a>>1)) so a string of 1's (as
+  is commonly produced by subtraction) look like a single 1-bit
+  difference.
+* the base values were pseudorandom, all zero but one bit set, or 
+  all zero plus a counter that starts at zero.
+
+Some k values for my "a-=c; a^=rot(c,k); c+=b;" arrangement that
+satisfy this are
+    4  6  8 16 19  4
+    9 15  3 18 27 15
+   14  9  3  7 17  3
+Well, "9 15 3 18 27 15" didn't quite get 32 bits diffing
+for "differ" defined as + with a one-bit base and a two-bit delta.  I
+used http://burtleburtle.net/bob/hash/avalanche.html to choose 
+the operations, constants, and arrangements of the variables.
+
+This does not achieve avalanche.  There are input bits of (a,b,c)
+that fail to affect some output bits of (a,b,c), especially of a.  The
+most thoroughly mixed value is c, but it doesn't really even achieve
+avalanche in c.
+
+This allows some parallelism.  Read-after-writes are good at doubling
+the number of bits affected, so the goal of mixing pulls in the opposite
+direction as the goal of parallelism.  I did what I could.  Rotates
+seem to cost as much as shifts on every machine I could lay my hands
+on, and rotates are much kinder to the top and bottom bits, so I used
+rotates.
+-------------------------------------------------------------------------------
+*/
+#define mix(a,b,c) \
+{ \
+  a -= c;  a ^= rot(c, 4);  c += b; \
+  b -= a;  b ^= rot(a, 6);  a += c; \
+  c -= b;  c ^= rot(b, 8);  b += a; \
+  a -= c;  a ^= rot(c,16);  c += b; \
+  b -= a;  b ^= rot(a,19);  a += c; \
+  c -= b;  c ^= rot(b, 4);  b += a; \
+}
+
+/*
+-------------------------------------------------------------------------------
+final -- final mixing of 3 32-bit values (a,b,c) into c
+
+Pairs of (a,b,c) values differing in only a few bits will usually
+produce values of c that look totally different.  This was tested for
+* pairs that differed by one bit, by two bits, in any combination
+  of top bits of (a,b,c), or in any combination of bottom bits of
+  (a,b,c).
+* "differ" is defined as +, -, ^, or ~^.  For + and -, I transformed
+  the output delta to a Gray code (a^(a>>1)) so a string of 1's (as
+  is commonly produced by subtraction) look like a single 1-bit
+  difference.
+* the base values were pseudorandom, all zero but one bit set, or 
+  all zero plus a counter that starts at zero.
+
+These constants passed:
+ 14 11 25 16 4 14 24
+ 12 14 25 16 4 14 24
+and these came close:
+  4  8 15 26 3 22 24
+ 10  8 15 26 3 22 24
+ 11  8 15 26 3 22 24
+-------------------------------------------------------------------------------
+*/
+#define final(a,b,c) \
+{ \
+  c ^= b; c -= rot(b,14); \
+  a ^= c; a -= rot(c,11); \
+  b ^= a; b -= rot(a,25); \
+  c ^= b; c -= rot(b,16); \
+  a ^= c; a -= rot(c,4);  \
+  b ^= a; b -= rot(a,14); \
+  c ^= b; c -= rot(b,24); \
+}
+
+/*
+-------------------------------------------------------------------------------
+hashlittle() -- hash a variable-length key into a 32-bit value
+  k       : the key (the unaligned variable-length array of bytes)
+  length  : the length of the key, counting by bytes
+  initval : can be any 4-byte value
+Returns a 32-bit value.  Every bit of the key affects every bit of
+the return value.  Two keys differing by one or two bits will have
+totally different hash values.
+
+The best hash table sizes are powers of 2.  There is no need to do
+mod a prime (mod is sooo slow!).  If you need less than 32 bits,
+use a bitmask.  For example, if you need only 10 bits, do
+  h = (h & hashmask(10));
+In which case, the hash table should have hashsize(10) elements.
+
+If you are hashing n strings (uint8_t **)k, do it like this:
+  for (i=0, h=0; i<n; ++i) h = hashlittle( k[i], len[i], h);
+
+By Bob Jenkins, 2006.  bob_jenkins at burtleburtle.net.  You may use this
+code any way you wish, private, educational, or commercial.  It's free.
+
+Use for hash table lookup, or anything where one collision in 2^^32 is
+acceptable.  Do NOT use for cryptographic purposes.
+-------------------------------------------------------------------------------
+*/
+
+static uint32_t hashlittle(const void *key, size_t length, uint32_t initval)
+{
+  uint32_t a,b,c;                                          /* internal state */
+  union { const void *ptr; size_t i; } u;     /* needed for Mac Powerbook G4 */
+
+  /* Set up the internal state */
+  a = b = c = 0xdeadbeef + ((uint32_t)length) + initval;
+
+  u.ptr = key;
+  if (HASH_LITTLE_ENDIAN && ((u.i & 0x3) == 0)) {
+    const uint32_t *k = (const uint32_t *)key;         /* read 32-bit chunks */
+
+/* Detect Valgrind or AddressSanitizer */
+#ifdef VALGRIND
+# define NO_MASKING_TRICK 1
+#else
+# if defined(__has_feature)  /* Clang */
+#  if __has_feature(address_sanitizer)  /* is ASAN enabled? */
+#   define NO_MASKING_TRICK 1
+#  endif
+# else
+#  if defined(__SANITIZE_ADDRESS__)  /* GCC 4.8.x, is ASAN enabled? */
+#   define NO_MASKING_TRICK 1
+#  endif
+# endif
+#endif
+
+#ifdef NO_MASKING_TRICK
+    const uint8_t  *k8;
+#endif
+
+    /*------ all but last block: aligned reads and affect 32 bits of (a,b,c) */
+    while (length > 12)
+    {
+      a += k[0];
+      b += k[1];
+      c += k[2];
+      mix(a,b,c);
+      length -= 12;
+      k += 3;
+    }
+
+    /*----------------------------- handle the last (probably partial) block */
+    /* 
+     * "k[2]&0xffffff" actually reads beyond the end of the string, but
+     * then masks off the part it's not allowed to read.  Because the
+     * string is aligned, the masked-off tail is in the same word as the
+     * rest of the string.  Every machine with memory protection I've seen
+     * does it on word boundaries, so is OK with this.  But VALGRIND will
+     * still catch it and complain.  The masking trick does make the hash
+     * noticably faster for short strings (like English words).
+     */
+#ifndef NO_MASKING_TRICK
+
+    switch(length)
+    {
+    case 12: c+=k[2]; b+=k[1]; a+=k[0]; break;
+    case 11: c+=k[2]&0xffffff; b+=k[1]; a+=k[0]; break;
+    case 10: c+=k[2]&0xffff; b+=k[1]; a+=k[0]; break;
+    case 9 : c+=k[2]&0xff; b+=k[1]; a+=k[0]; break;
+    case 8 : b+=k[1]; a+=k[0]; break;
+    case 7 : b+=k[1]&0xffffff; a+=k[0]; break;
+    case 6 : b+=k[1]&0xffff; a+=k[0]; break;
+    case 5 : b+=k[1]&0xff; a+=k[0]; break;
+    case 4 : a+=k[0]; break;
+    case 3 : a+=k[0]&0xffffff; break;
+    case 2 : a+=k[0]&0xffff; break;
+    case 1 : a+=k[0]&0xff; break;
+    case 0 : return c;              /* zero length strings require no mixing */
+    }
+
+#else /* make valgrind happy */
+
+    k8 = (const uint8_t *)k;
+    switch(length)
+    {
+    case 12: c+=k[2]; b+=k[1]; a+=k[0]; break;
+    case 11: c+=((uint32_t)k8[10])<<16;  /* fall through */
+    case 10: c+=((uint32_t)k8[9])<<8;    /* fall through */
+    case 9 : c+=k8[8];                   /* fall through */
+    case 8 : b+=k[1]; a+=k[0]; break;
+    case 7 : b+=((uint32_t)k8[6])<<16;   /* fall through */
+    case 6 : b+=((uint32_t)k8[5])<<8;    /* fall through */
+    case 5 : b+=k8[4];                   /* fall through */
+    case 4 : a+=k[0]; break;
+    case 3 : a+=((uint32_t)k8[2])<<16;   /* fall through */
+    case 2 : a+=((uint32_t)k8[1])<<8;    /* fall through */
+    case 1 : a+=k8[0]; break;
+    case 0 : return c;
+    }
+
+#endif /* !valgrind */
+
+  } else if (HASH_LITTLE_ENDIAN && ((u.i & 0x1) == 0)) {
+    const uint16_t *k = (const uint16_t *)key;         /* read 16-bit chunks */
+    const uint8_t  *k8;
+
+    /*--------------- all but last block: aligned reads and different mixing */
+    while (length > 12)
+    {
+      a += k[0] + (((uint32_t)k[1])<<16);
+      b += k[2] + (((uint32_t)k[3])<<16);
+      c += k[4] + (((uint32_t)k[5])<<16);
+      mix(a,b,c);
+      length -= 12;
+      k += 6;
+    }
+
+    /*----------------------------- handle the last (probably partial) block */
+    k8 = (const uint8_t *)k;
+    switch(length)
+    {
+    case 12: c+=k[4]+(((uint32_t)k[5])<<16);
+             b+=k[2]+(((uint32_t)k[3])<<16);
+             a+=k[0]+(((uint32_t)k[1])<<16);
+             break;
+    case 11: c+=((uint32_t)k8[10])<<16;     /* fall through */
+    case 10: c+=k[4];
+             b+=k[2]+(((uint32_t)k[3])<<16);
+             a+=k[0]+(((uint32_t)k[1])<<16);
+             break;
+    case 9 : c+=k8[8];                      /* fall through */
+    case 8 : b+=k[2]+(((uint32_t)k[3])<<16);
+             a+=k[0]+(((uint32_t)k[1])<<16);
+             break;
+    case 7 : b+=((uint32_t)k8[6])<<16;      /* fall through */
+    case 6 : b+=k[2];
+             a+=k[0]+(((uint32_t)k[1])<<16);
+             break;
+    case 5 : b+=k8[4];                      /* fall through */
+    case 4 : a+=k[0]+(((uint32_t)k[1])<<16);
+             break;
+    case 3 : a+=((uint32_t)k8[2])<<16;      /* fall through */
+    case 2 : a+=k[0];
+             break;
+    case 1 : a+=k8[0];
+             break;
+    case 0 : return c;                     /* zero length requires no mixing */
+    }
+
+  } else {                        /* need to read the key one byte at a time */
+    const uint8_t *k = (const uint8_t *)key;
+
+    /*--------------- all but the last block: affect some 32 bits of (a,b,c) */
+    while (length > 12)
+    {
+      a += k[0];
+      a += ((uint32_t)k[1])<<8;
+      a += ((uint32_t)k[2])<<16;
+      a += ((uint32_t)k[3])<<24;
+      b += k[4];
+      b += ((uint32_t)k[5])<<8;
+      b += ((uint32_t)k[6])<<16;
+      b += ((uint32_t)k[7])<<24;
+      c += k[8];
+      c += ((uint32_t)k[9])<<8;
+      c += ((uint32_t)k[10])<<16;
+      c += ((uint32_t)k[11])<<24;
+      mix(a,b,c);
+      length -= 12;
+      k += 12;
+    }
+
+    /*-------------------------------- last block: affect all 32 bits of (c) */
+    switch(length)                   /* all the case statements fall through */
+    {
+    case 12: c+=((uint32_t)k[11])<<24;
+    case 11: c+=((uint32_t)k[10])<<16;
+    case 10: c+=((uint32_t)k[9])<<8;
+    case 9 : c+=k[8];
+    case 8 : b+=((uint32_t)k[7])<<24;
+    case 7 : b+=((uint32_t)k[6])<<16;
+    case 6 : b+=((uint32_t)k[5])<<8;
+    case 5 : b+=k[4];
+    case 4 : a+=((uint32_t)k[3])<<24;
+    case 3 : a+=((uint32_t)k[2])<<16;
+    case 2 : a+=((uint32_t)k[1])<<8;
+    case 1 : a+=k[0];
+             break;
+    case 0 : return c;
+    }
+  }
+
+  final(a,b,c);
+  return c;
+}

Added: vendor/jansson/dist/src/memory.c
===================================================================
--- vendor/jansson/dist/src/memory.c	                        (rev 0)
+++ vendor/jansson/dist/src/memory.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,61 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ * Copyright (c) 2011-2012 Basile Starynkevitch <basile at starynkevitch.net>
+ *
+ * Jansson is free software; you can redistribute it and/or modify it
+ * under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <stdlib.h>
+#include <string.h>
+
+#include "jansson.h"
+#include "jansson_private.h"
+
+/* C89 allows these to be macros */
+#undef malloc
+#undef free
+
+/* memory function pointers */
+static json_malloc_t do_malloc = malloc;
+static json_free_t do_free = free;
+
+void *jsonp_malloc(size_t size)
+{
+    if(!size)
+        return NULL;
+
+    return (*do_malloc)(size);
+}
+
+void jsonp_free(void *ptr)
+{
+    if(!ptr)
+        return;
+
+    (*do_free)(ptr);
+}
+
+char *jsonp_strdup(const char *str)
+{
+    return jsonp_strndup(str, strlen(str));
+}
+
+char *jsonp_strndup(const char *str, size_t len)
+{
+    char *new_str;
+
+    new_str = jsonp_malloc(len + 1);
+    if(!new_str)
+        return NULL;
+
+    memcpy(new_str, str, len);
+    new_str[len] = '\0';
+    return new_str;
+}
+
+void json_set_alloc_funcs(json_malloc_t malloc_fn, json_free_t free_fn)
+{
+    do_malloc = malloc_fn;
+    do_free = free_fn;
+}

Added: vendor/jansson/dist/src/pack_unpack.c
===================================================================
--- vendor/jansson/dist/src/pack_unpack.c	                        (rev 0)
+++ vendor/jansson/dist/src/pack_unpack.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,805 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ * Copyright (c) 2011-2012 Graeme Smecher <graeme.smecher at mail.mcgill.ca>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <string.h>
+#include "jansson.h"
+#include "jansson_private.h"
+#include "utf.h"
+
+typedef struct {
+    int line;
+    int column;
+    size_t pos;
+    char token;
+} token_t;
+
+typedef struct {
+    const char *start;
+    const char *fmt;
+    token_t prev_token;
+    token_t token;
+    token_t next_token;
+    json_error_t *error;
+    size_t flags;
+    int line;
+    int column;
+    size_t pos;
+} scanner_t;
+
+#define token(scanner) ((scanner)->token.token)
+
+static const char * const type_names[] = {
+    "object",
+    "array",
+    "string",
+    "integer",
+    "real",
+    "true",
+    "false",
+    "null"
+};
+
+#define type_name(x) type_names[json_typeof(x)]
+
+static const char unpack_value_starters[] = "{[siIbfFOon";
+
+
+static void scanner_init(scanner_t *s, json_error_t *error,
+                         size_t flags, const char *fmt)
+{
+    s->error = error;
+    s->flags = flags;
+    s->fmt = s->start = fmt;
+    memset(&s->prev_token, 0, sizeof(token_t));
+    memset(&s->token, 0, sizeof(token_t));
+    memset(&s->next_token, 0, sizeof(token_t));
+    s->line = 1;
+    s->column = 0;
+    s->pos = 0;
+}
+
+static void next_token(scanner_t *s)
+{
+    const char *t;
+    s->prev_token = s->token;
+
+    if(s->next_token.line) {
+        s->token = s->next_token;
+        s->next_token.line = 0;
+        return;
+    }
+
+    t = s->fmt;
+    s->column++;
+    s->pos++;
+
+    /* skip space and ignored chars */
+    while(*t == ' ' || *t == '\t' || *t == '\n' || *t == ',' || *t == ':') {
+        if(*t == '\n') {
+            s->line++;
+            s->column = 1;
+        }
+        else
+            s->column++;
+
+        s->pos++;
+        t++;
+    }
+
+    s->token.token = *t;
+    s->token.line = s->line;
+    s->token.column = s->column;
+    s->token.pos = s->pos;
+
+    t++;
+    s->fmt = t;
+}
+
+static void prev_token(scanner_t *s)
+{
+    s->next_token = s->token;
+    s->token = s->prev_token;
+}
+
+static void set_error(scanner_t *s, const char *source, const char *fmt, ...)
+{
+    va_list ap;
+    va_start(ap, fmt);
+
+    jsonp_error_vset(s->error, s->token.line, s->token.column, s->token.pos,
+                     fmt, ap);
+
+    jsonp_error_set_source(s->error, source);
+
+    va_end(ap);
+}
+
+static json_t *pack(scanner_t *s, va_list *ap);
+
+
+/* ours will be set to 1 if jsonp_free() must be called for the result
+   afterwards */
+static char *read_string(scanner_t *s, va_list *ap,
+                         const char *purpose, size_t *out_len, int *ours)
+{
+    char t;
+    strbuffer_t strbuff;
+    const char *str;
+    size_t length;
+
+    next_token(s);
+    t = token(s);
+    prev_token(s);
+
+    if(t != '#' && t != '%' && t != '+') {
+        /* Optimize the simple case */
+        str = va_arg(*ap, const char *);
+
+        if(!str) {
+            set_error(s, "<args>", "NULL string argument");
+            return NULL;
+        }
+
+        length = strlen(str);
+
+        if(!utf8_check_string(str, length)) {
+            set_error(s, "<args>", "Invalid UTF-8 %s", purpose);
+            return NULL;
+        }
+
+        *out_len = length;
+        *ours = 0;
+        return (char *)str;
+    }
+
+    strbuffer_init(&strbuff);
+
+    while(1) {
+        str = va_arg(*ap, const char *);
+        if(!str) {
+            set_error(s, "<args>", "NULL string argument");
+            strbuffer_close(&strbuff);
+            return NULL;
+        }
+
+        next_token(s);
+
+        if(token(s) == '#') {
+            length = va_arg(*ap, int);
+        }
+        else if(token(s) == '%') {
+            length = va_arg(*ap, size_t);
+        }
+        else {
+            prev_token(s);
+            length = strlen(str);
+        }
+
+        if(strbuffer_append_bytes(&strbuff, str, length) == -1) {
+            set_error(s, "<internal>", "Out of memory");
+            strbuffer_close(&strbuff);
+            return NULL;
+        }
+
+        next_token(s);
+        if(token(s) != '+') {
+            prev_token(s);
+            break;
+        }
+    }
+
+    if(!utf8_check_string(strbuff.value, strbuff.length)) {
+        set_error(s, "<args>", "Invalid UTF-8 %s", purpose);
+        strbuffer_close(&strbuff);
+        return NULL;
+    }
+
+    *out_len = strbuff.length;
+    *ours = 1;
+    return strbuffer_steal_value(&strbuff);
+}
+
+static json_t *pack_object(scanner_t *s, va_list *ap)
+{
+    json_t *object = json_object();
+    next_token(s);
+
+    while(token(s) != '}') {
+        char *key;
+        size_t len;
+        int ours;
+        json_t *value;
+
+        if(!token(s)) {
+            set_error(s, "<format>", "Unexpected end of format string");
+            goto error;
+        }
+
+        if(token(s) != 's') {
+            set_error(s, "<format>", "Expected format 's', got '%c'", token(s));
+            goto error;
+        }
+
+        key = read_string(s, ap, "object key", &len, &ours);
+        if(!key)
+            goto error;
+
+        next_token(s);
+
+        value = pack(s, ap);
+        if(!value) {
+            if(ours)
+                jsonp_free(key);
+
+            goto error;
+        }
+
+        if(json_object_set_new_nocheck(object, key, value)) {
+            if(ours)
+                jsonp_free(key);
+
+            set_error(s, "<internal>", "Unable to add key \"%s\"", key);
+            goto error;
+        }
+
+        if(ours)
+            jsonp_free(key);
+
+        next_token(s);
+    }
+
+    return object;
+
+error:
+    json_decref(object);
+    return NULL;
+}
+
+static json_t *pack_array(scanner_t *s, va_list *ap)
+{
+    json_t *array = json_array();
+    next_token(s);
+
+    while(token(s) != ']') {
+        json_t *value;
+
+        if(!token(s)) {
+            set_error(s, "<format>", "Unexpected end of format string");
+            goto error;
+        }
+
+        value = pack(s, ap);
+        if(!value)
+            goto error;
+
+        if(json_array_append_new(array, value)) {
+            set_error(s, "<internal>", "Unable to append to array");
+            goto error;
+        }
+
+        next_token(s);
+    }
+    return array;
+
+error:
+    json_decref(array);
+    return NULL;
+}
+
+static json_t *pack(scanner_t *s, va_list *ap)
+{
+    switch(token(s)) {
+        case '{':
+            return pack_object(s, ap);
+
+        case '[':
+            return pack_array(s, ap);
+
+        case 's': /* string */
+        {
+            char *str;
+            size_t len;
+            int ours;
+
+            str = read_string(s, ap, "string", &len, &ours);
+            if(!str)
+                return NULL;
+
+            if (ours)
+                return jsonp_stringn_nocheck_own(str, len);
+            else
+                return json_stringn_nocheck(str, len);
+        }
+
+        case 'n': /* null */
+            return json_null();
+
+        case 'b': /* boolean */
+            return va_arg(*ap, int) ? json_true() : json_false();
+
+        case 'i': /* integer from int */
+            return json_integer(va_arg(*ap, int));
+
+        case 'I': /* integer from json_int_t */
+            return json_integer(va_arg(*ap, json_int_t));
+
+        case 'f': /* real */
+            return json_real(va_arg(*ap, double));
+
+        case 'O': /* a json_t object; increments refcount */
+            return json_incref(va_arg(*ap, json_t *));
+
+        case 'o': /* a json_t object; doesn't increment refcount */
+            return va_arg(*ap, json_t *);
+
+        default:
+            set_error(s, "<format>", "Unexpected format character '%c'",
+                      token(s));
+            return NULL;
+    }
+}
+
+static int unpack(scanner_t *s, json_t *root, va_list *ap);
+
+static int unpack_object(scanner_t *s, json_t *root, va_list *ap)
+{
+    int ret = -1;
+    int strict = 0;
+    int gotopt = 0;
+
+    /* Use a set (emulated by a hashtable) to check that all object
+       keys are accessed. Checking that the correct number of keys
+       were accessed is not enough, as the same key can be unpacked
+       multiple times.
+    */
+    hashtable_t key_set;
+
+    if(hashtable_init(&key_set)) {
+        set_error(s, "<internal>", "Out of memory");
+        return -1;
+    }
+
+    if(root && !json_is_object(root)) {
+        set_error(s, "<validation>", "Expected object, got %s",
+                  type_name(root));
+        goto out;
+    }
+    next_token(s);
+
+    while(token(s) != '}') {
+        const char *key;
+        json_t *value;
+        int opt = 0;
+
+        if(strict != 0) {
+            set_error(s, "<format>", "Expected '}' after '%c', got '%c'",
+                      (strict == 1 ? '!' : '*'), token(s));
+            goto out;
+        }
+
+        if(!token(s)) {
+            set_error(s, "<format>", "Unexpected end of format string");
+            goto out;
+        }
+
+        if(token(s) == '!' || token(s) == '*') {
+            strict = (token(s) == '!' ? 1 : -1);
+            next_token(s);
+            continue;
+        }
+
+        if(token(s) != 's') {
+            set_error(s, "<format>", "Expected format 's', got '%c'", token(s));
+            goto out;
+        }
+
+        key = va_arg(*ap, const char *);
+        if(!key) {
+            set_error(s, "<args>", "NULL object key");
+            goto out;
+        }
+
+        next_token(s);
+
+        if(token(s) == '?') {
+            opt = gotopt = 1;
+            next_token(s);
+        }
+
+        if(!root) {
+            /* skipping */
+            value = NULL;
+        }
+        else {
+            value = json_object_get(root, key);
+            if(!value && !opt) {
+                set_error(s, "<validation>", "Object item not found: %s", key);
+                goto out;
+            }
+        }
+
+        if(unpack(s, value, ap))
+            goto out;
+
+        hashtable_set(&key_set, key, 0, json_null());
+        next_token(s);
+    }
+
+    if(strict == 0 && (s->flags & JSON_STRICT))
+        strict = 1;
+
+    if(root && strict == 1) {
+        /* We need to check that all non optional items have been parsed */
+        const char *key;
+        json_t *value;
+        long unpacked = 0;
+        if (gotopt) {
+            /* We have optional keys, we need to iter on each key */
+            json_object_foreach(root, key, value) {
+                if(!hashtable_get(&key_set, key)) {
+                    unpacked++;
+                }
+            }
+        } else {
+            /* No optional keys, we can just compare the number of items */
+            unpacked = (long)json_object_size(root) - (long)key_set.size;
+        }
+        if (unpacked) {
+            set_error(s, "<validation>", "%li object item(s) left unpacked", unpacked);
+            goto out;
+        }
+    }
+
+    ret = 0;
+
+out:
+    hashtable_close(&key_set);
+    return ret;
+}
+
+static int unpack_array(scanner_t *s, json_t *root, va_list *ap)
+{
+    size_t i = 0;
+    int strict = 0;
+
+    if(root && !json_is_array(root)) {
+        set_error(s, "<validation>", "Expected array, got %s", type_name(root));
+        return -1;
+    }
+    next_token(s);
+
+    while(token(s) != ']') {
+        json_t *value;
+
+        if(strict != 0) {
+            set_error(s, "<format>", "Expected ']' after '%c', got '%c'",
+                      (strict == 1 ? '!' : '*'),
+                      token(s));
+            return -1;
+        }
+
+        if(!token(s)) {
+            set_error(s, "<format>", "Unexpected end of format string");
+            return -1;
+        }
+
+        if(token(s) == '!' || token(s) == '*') {
+            strict = (token(s) == '!' ? 1 : -1);
+            next_token(s);
+            continue;
+        }
+
+        if(!strchr(unpack_value_starters, token(s))) {
+            set_error(s, "<format>", "Unexpected format character '%c'",
+                      token(s));
+            return -1;
+        }
+
+        if(!root) {
+            /* skipping */
+            value = NULL;
+        }
+        else {
+            value = json_array_get(root, i);
+            if(!value) {
+                set_error(s, "<validation>", "Array index %lu out of range",
+                          (unsigned long)i);
+                return -1;
+            }
+        }
+
+        if(unpack(s, value, ap))
+            return -1;
+
+        next_token(s);
+        i++;
+    }
+
+    if(strict == 0 && (s->flags & JSON_STRICT))
+        strict = 1;
+
+    if(root && strict == 1 && i != json_array_size(root)) {
+        long diff = (long)json_array_size(root) - (long)i;
+        set_error(s, "<validation>", "%li array item(s) left unpacked", diff);
+        return -1;
+    }
+
+    return 0;
+}
+
+static int unpack(scanner_t *s, json_t *root, va_list *ap)
+{
+    switch(token(s))
+    {
+        case '{':
+            return unpack_object(s, root, ap);
+
+        case '[':
+            return unpack_array(s, root, ap);
+
+        case 's':
+            if(root && !json_is_string(root)) {
+                set_error(s, "<validation>", "Expected string, got %s",
+                          type_name(root));
+                return -1;
+            }
+
+            if(!(s->flags & JSON_VALIDATE_ONLY)) {
+                const char **str_target;
+                size_t *len_target = NULL;
+
+                str_target = va_arg(*ap, const char **);
+                if(!str_target) {
+                    set_error(s, "<args>", "NULL string argument");
+                    return -1;
+                }
+
+                next_token(s);
+
+                if(token(s) == '%') {
+                    len_target = va_arg(*ap, size_t *);
+                    if(!len_target) {
+                        set_error(s, "<args>", "NULL string length argument");
+                        return -1;
+                    }
+                }
+                else
+                    prev_token(s);
+
+                if(root) {
+                    *str_target = json_string_value(root);
+                    if(len_target)
+                        *len_target = json_string_length(root);
+                }
+            }
+            return 0;
+
+        case 'i':
+            if(root && !json_is_integer(root)) {
+                set_error(s, "<validation>", "Expected integer, got %s",
+                          type_name(root));
+                return -1;
+            }
+
+            if(!(s->flags & JSON_VALIDATE_ONLY)) {
+                int *target = va_arg(*ap, int*);
+                if(root)
+                    *target = (int)json_integer_value(root);
+            }
+
+            return 0;
+
+        case 'I':
+            if(root && !json_is_integer(root)) {
+                set_error(s, "<validation>", "Expected integer, got %s",
+                          type_name(root));
+                return -1;
+            }
+
+            if(!(s->flags & JSON_VALIDATE_ONLY)) {
+                json_int_t *target = va_arg(*ap, json_int_t*);
+                if(root)
+                    *target = json_integer_value(root);
+            }
+
+            return 0;
+
+        case 'b':
+            if(root && !json_is_boolean(root)) {
+                set_error(s, "<validation>", "Expected true or false, got %s",
+                          type_name(root));
+                return -1;
+            }
+
+            if(!(s->flags & JSON_VALIDATE_ONLY)) {
+                int *target = va_arg(*ap, int*);
+                if(root)
+                    *target = json_is_true(root);
+            }
+
+            return 0;
+
+        case 'f':
+            if(root && !json_is_real(root)) {
+                set_error(s, "<validation>", "Expected real, got %s",
+                          type_name(root));
+                return -1;
+            }
+
+            if(!(s->flags & JSON_VALIDATE_ONLY)) {
+                double *target = va_arg(*ap, double*);
+                if(root)
+                    *target = json_real_value(root);
+            }
+
+            return 0;
+
+        case 'F':
+            if(root && !json_is_number(root)) {
+                set_error(s, "<validation>", "Expected real or integer, got %s",
+                          type_name(root));
+                return -1;
+            }
+
+            if(!(s->flags & JSON_VALIDATE_ONLY)) {
+                double *target = va_arg(*ap, double*);
+                if(root)
+                    *target = json_number_value(root);
+            }
+
+            return 0;
+
+        case 'O':
+            if(root && !(s->flags & JSON_VALIDATE_ONLY))
+                json_incref(root);
+            /* Fall through */
+
+        case 'o':
+            if(!(s->flags & JSON_VALIDATE_ONLY)) {
+                json_t **target = va_arg(*ap, json_t**);
+                if(root)
+                    *target = root;
+            }
+
+            return 0;
+
+        case 'n':
+            /* Never assign, just validate */
+            if(root && !json_is_null(root)) {
+                set_error(s, "<validation>", "Expected null, got %s",
+                          type_name(root));
+                return -1;
+            }
+            return 0;
+
+        default:
+            set_error(s, "<format>", "Unexpected format character '%c'",
+                      token(s));
+            return -1;
+    }
+}
+
+json_t *json_vpack_ex(json_error_t *error, size_t flags,
+                      const char *fmt, va_list ap)
+{
+    scanner_t s;
+    va_list ap_copy;
+    json_t *value;
+
+    if(!fmt || !*fmt) {
+        jsonp_error_init(error, "<format>");
+        jsonp_error_set(error, -1, -1, 0, "NULL or empty format string");
+        return NULL;
+    }
+    jsonp_error_init(error, NULL);
+
+    scanner_init(&s, error, flags, fmt);
+    next_token(&s);
+
+    va_copy(ap_copy, ap);
+    value = pack(&s, &ap_copy);
+    va_end(ap_copy);
+
+    if(!value)
+        return NULL;
+
+    next_token(&s);
+    if(token(&s)) {
+        json_decref(value);
+        set_error(&s, "<format>", "Garbage after format string");
+        return NULL;
+    }
+
+    return value;
+}
+
+json_t *json_pack_ex(json_error_t *error, size_t flags, const char *fmt, ...)
+{
+    json_t *value;
+    va_list ap;
+
+    va_start(ap, fmt);
+    value = json_vpack_ex(error, flags, fmt, ap);
+    va_end(ap);
+
+    return value;
+}
+
+json_t *json_pack(const char *fmt, ...)
+{
+    json_t *value;
+    va_list ap;
+
+    va_start(ap, fmt);
+    value = json_vpack_ex(NULL, 0, fmt, ap);
+    va_end(ap);
+
+    return value;
+}
+
+int json_vunpack_ex(json_t *root, json_error_t *error, size_t flags,
+                    const char *fmt, va_list ap)
+{
+    scanner_t s;
+    va_list ap_copy;
+
+    if(!root) {
+        jsonp_error_init(error, "<root>");
+        jsonp_error_set(error, -1, -1, 0, "NULL root value");
+        return -1;
+    }
+
+    if(!fmt || !*fmt) {
+        jsonp_error_init(error, "<format>");
+        jsonp_error_set(error, -1, -1, 0, "NULL or empty format string");
+        return -1;
+    }
+    jsonp_error_init(error, NULL);
+
+    scanner_init(&s, error, flags, fmt);
+    next_token(&s);
+
+    va_copy(ap_copy, ap);
+    if(unpack(&s, root, &ap_copy)) {
+        va_end(ap_copy);
+        return -1;
+    }
+    va_end(ap_copy);
+
+    next_token(&s);
+    if(token(&s)) {
+        set_error(&s, "<format>", "Garbage after format string");
+        return -1;
+    }
+
+    return 0;
+}
+
+int json_unpack_ex(json_t *root, json_error_t *error, size_t flags, const char *fmt, ...)
+{
+    int ret;
+    va_list ap;
+
+    va_start(ap, fmt);
+    ret = json_vunpack_ex(root, error, flags, fmt, ap);
+    va_end(ap);
+
+    return ret;
+}
+
+int json_unpack(json_t *root, const char *fmt, ...)
+{
+    int ret;
+    va_list ap;
+
+    va_start(ap, fmt);
+    ret = json_vunpack_ex(root, NULL, 0, fmt, ap);
+    va_end(ap);
+
+    return ret;
+}

Added: vendor/jansson/dist/src/strbuffer.c
===================================================================
--- vendor/jansson/dist/src/strbuffer.c	                        (rev 0)
+++ vendor/jansson/dist/src/strbuffer.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,116 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef _GNU_SOURCE
+#define _GNU_SOURCE
+#endif
+
+#include <stdlib.h>
+#include <string.h>
+#include "jansson_private.h"
+#include "strbuffer.h"
+
+#define STRBUFFER_MIN_SIZE  16
+#define STRBUFFER_FACTOR    2
+#define STRBUFFER_SIZE_MAX  ((size_t)-1)
+
+int strbuffer_init(strbuffer_t *strbuff)
+{
+    strbuff->size = STRBUFFER_MIN_SIZE;
+    strbuff->length = 0;
+
+    strbuff->value = jsonp_malloc(strbuff->size);
+    if(!strbuff->value)
+        return -1;
+
+    /* initialize to empty */
+    strbuff->value[0] = '\0';
+    return 0;
+}
+
+void strbuffer_close(strbuffer_t *strbuff)
+{
+    if(strbuff->value)
+        jsonp_free(strbuff->value);
+
+    strbuff->size = 0;
+    strbuff->length = 0;
+    strbuff->value = NULL;
+}
+
+void strbuffer_clear(strbuffer_t *strbuff)
+{
+    strbuff->length = 0;
+    strbuff->value[0] = '\0';
+}
+
+const char *strbuffer_value(const strbuffer_t *strbuff)
+{
+    return strbuff->value;
+}
+
+char *strbuffer_steal_value(strbuffer_t *strbuff)
+{
+    char *result = strbuff->value;
+    strbuff->value = NULL;
+    return result;
+}
+
+int strbuffer_append(strbuffer_t *strbuff, const char *string)
+{
+    return strbuffer_append_bytes(strbuff, string, strlen(string));
+}
+
+int strbuffer_append_byte(strbuffer_t *strbuff, char byte)
+{
+    return strbuffer_append_bytes(strbuff, &byte, 1);
+}
+
+int strbuffer_append_bytes(strbuffer_t *strbuff, const char *data, size_t size)
+{
+    if(size >= strbuff->size - strbuff->length)
+    {
+        size_t new_size;
+        char *new_value;
+
+        /* avoid integer overflow */
+        if (strbuff->size > STRBUFFER_SIZE_MAX / STRBUFFER_FACTOR
+            || size > STRBUFFER_SIZE_MAX - 1
+            || strbuff->length > STRBUFFER_SIZE_MAX - 1 - size)
+            return -1;
+
+        new_size = max(strbuff->size * STRBUFFER_FACTOR,
+                       strbuff->length + size + 1);
+
+        new_value = jsonp_malloc(new_size);
+        if(!new_value)
+            return -1;
+
+        memcpy(new_value, strbuff->value, strbuff->length);
+
+        jsonp_free(strbuff->value);
+        strbuff->value = new_value;
+        strbuff->size = new_size;
+    }
+
+    memcpy(strbuff->value + strbuff->length, data, size);
+    strbuff->length += size;
+    strbuff->value[strbuff->length] = '\0';
+
+    return 0;
+}
+
+char strbuffer_pop(strbuffer_t *strbuff)
+{
+    if(strbuff->length > 0) {
+        char c = strbuff->value[--strbuff->length];
+        strbuff->value[strbuff->length] = '\0';
+        return c;
+    }
+    else
+        return '\0';
+}

Added: vendor/jansson/dist/src/strbuffer.h
===================================================================
--- vendor/jansson/dist/src/strbuffer.h	                        (rev 0)
+++ vendor/jansson/dist/src/strbuffer.h	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,33 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef STRBUFFER_H
+#define STRBUFFER_H
+
+typedef struct {
+    char *value;
+    size_t length;   /* bytes used */
+    size_t size;     /* bytes allocated */
+} strbuffer_t;
+
+int strbuffer_init(strbuffer_t *strbuff);
+void strbuffer_close(strbuffer_t *strbuff);
+
+void strbuffer_clear(strbuffer_t *strbuff);
+
+const char *strbuffer_value(const strbuffer_t *strbuff);
+
+/* Steal the value and close the strbuffer */
+char *strbuffer_steal_value(strbuffer_t *strbuff);
+
+int strbuffer_append(strbuffer_t *strbuff, const char *string);
+int strbuffer_append_byte(strbuffer_t *strbuff, char byte);
+int strbuffer_append_bytes(strbuffer_t *strbuff, const char *data, size_t size);
+
+char strbuffer_pop(strbuffer_t *strbuff);
+
+#endif

Added: vendor/jansson/dist/src/strconv.c
===================================================================
--- vendor/jansson/dist/src/strconv.c	                        (rev 0)
+++ vendor/jansson/dist/src/strconv.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,138 @@
+#include <assert.h>
+#include <errno.h>
+#include <stdio.h>
+#include <string.h>
+#include <math.h>
+#include "jansson_private.h"
+#include "strbuffer.h"
+
+/* need jansson_private_config.h to get the correct snprintf */
+#ifdef HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#if JSON_HAVE_LOCALECONV
+#include <locale.h>
+
+/*
+  - This code assumes that the decimal separator is exactly one
+    character.
+
+  - If setlocale() is called by another thread between the call to
+    localeconv() and the call to sprintf() or strtod(), the result may
+    be wrong. setlocale() is not thread-safe and should not be used
+    this way. Multi-threaded programs should use uselocale() instead.
+*/
+
+static void to_locale(strbuffer_t *strbuffer)
+{
+    const char *point;
+    char *pos;
+
+    point = localeconv()->decimal_point;
+    if(*point == '.') {
+        /* No conversion needed */
+        return;
+    }
+
+    pos = strchr(strbuffer->value, '.');
+    if(pos)
+        *pos = *point;
+}
+
+static void from_locale(char *buffer)
+{
+    const char *point;
+    char *pos;
+
+    point = localeconv()->decimal_point;
+    if(*point == '.') {
+        /* No conversion needed */
+        return;
+    }
+
+    pos = strchr(buffer, *point);
+    if(pos)
+        *pos = '.';
+}
+#endif
+
+int jsonp_strtod(strbuffer_t *strbuffer, double *out)
+{
+    double value;
+    char *end;
+
+#if JSON_HAVE_LOCALECONV
+    to_locale(strbuffer);
+#endif
+
+    errno = 0;
+    value = strtod(strbuffer->value, &end);
+    assert(end == strbuffer->value + strbuffer->length);
+
+    if((value == HUGE_VAL || value == -HUGE_VAL) && errno == ERANGE) {
+        /* Overflow */
+        return -1;
+    }
+
+    *out = value;
+    return 0;
+}
+
+int jsonp_dtostr(char *buffer, size_t size, double value, int precision)
+{
+    int ret;
+    char *start, *end;
+    size_t length;
+
+    if (precision == 0)
+        precision = 17;
+
+    ret = snprintf(buffer, size, "%.*g", precision, value);
+    if(ret < 0)
+        return -1;
+
+    length = (size_t)ret;
+    if(length >= size)
+        return -1;
+
+#if JSON_HAVE_LOCALECONV
+    from_locale(buffer);
+#endif
+
+    /* Make sure there's a dot or 'e' in the output. Otherwise
+       a real is converted to an integer when decoding */
+    if(strchr(buffer, '.') == NULL &&
+       strchr(buffer, 'e') == NULL)
+    {
+        if(length + 3 >= size) {
+            /* No space to append ".0" */
+            return -1;
+        }
+        buffer[length] = '.';
+        buffer[length + 1] = '0';
+        buffer[length + 2] = '\0';
+        length += 2;
+    }
+
+    /* Remove leading '+' from positive exponent. Also remove leading
+       zeros from exponents (added by some printf() implementations) */
+    start = strchr(buffer, 'e');
+    if(start) {
+        start++;
+        end = start + 1;
+
+        if(*start == '-')
+            start++;
+
+        while(*end == '0')
+            end++;
+
+        if(end != start) {
+            memmove(start, end, length - (size_t)(end - buffer));
+            length -= (size_t)(end - start);
+        }
+    }
+
+    return (int)length;
+}

Added: vendor/jansson/dist/src/utf.c
===================================================================
--- vendor/jansson/dist/src/utf.c	                        (rev 0)
+++ vendor/jansson/dist/src/utf.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,187 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <string.h>
+#include "utf.h"
+
+int utf8_encode(int32_t codepoint, char *buffer, size_t *size)
+{
+    if(codepoint < 0)
+        return -1;
+    else if(codepoint < 0x80)
+    {
+        buffer[0] = (char)codepoint;
+        *size = 1;
+    }
+    else if(codepoint < 0x800)
+    {
+        buffer[0] = 0xC0 + ((codepoint & 0x7C0) >> 6);
+        buffer[1] = 0x80 + ((codepoint & 0x03F));
+        *size = 2;
+    }
+    else if(codepoint < 0x10000)
+    {
+        buffer[0] = 0xE0 + ((codepoint & 0xF000) >> 12);
+        buffer[1] = 0x80 + ((codepoint & 0x0FC0) >> 6);
+        buffer[2] = 0x80 + ((codepoint & 0x003F));
+        *size = 3;
+    }
+    else if(codepoint <= 0x10FFFF)
+    {
+        buffer[0] = 0xF0 + ((codepoint & 0x1C0000) >> 18);
+        buffer[1] = 0x80 + ((codepoint & 0x03F000) >> 12);
+        buffer[2] = 0x80 + ((codepoint & 0x000FC0) >> 6);
+        buffer[3] = 0x80 + ((codepoint & 0x00003F));
+        *size = 4;
+    }
+    else
+        return -1;
+
+    return 0;
+}
+
+size_t utf8_check_first(char byte)
+{
+    unsigned char u = (unsigned char)byte;
+
+    if(u < 0x80)
+        return 1;
+
+    if(0x80 <= u && u <= 0xBF) {
+        /* second, third or fourth byte of a multi-byte
+           sequence, i.e. a "continuation byte" */
+        return 0;
+    }
+    else if(u == 0xC0 || u == 0xC1) {
+        /* overlong encoding of an ASCII byte */
+        return 0;
+    }
+    else if(0xC2 <= u && u <= 0xDF) {
+        /* 2-byte sequence */
+        return 2;
+    }
+
+    else if(0xE0 <= u && u <= 0xEF) {
+        /* 3-byte sequence */
+        return 3;
+    }
+    else if(0xF0 <= u && u <= 0xF4) {
+        /* 4-byte sequence */
+        return 4;
+    }
+    else { /* u >= 0xF5 */
+        /* Restricted (start of 4-, 5- or 6-byte sequence) or invalid
+           UTF-8 */
+        return 0;
+    }
+}
+
+size_t utf8_check_full(const char *buffer, size_t size, int32_t *codepoint)
+{
+    size_t i;
+    int32_t value = 0;
+    unsigned char u = (unsigned char)buffer[0];
+
+    if(size == 2)
+    {
+        value = u & 0x1F;
+    }
+    else if(size == 3)
+    {
+        value = u & 0xF;
+    }
+    else if(size == 4)
+    {
+        value = u & 0x7;
+    }
+    else
+        return 0;
+
+    for(i = 1; i < size; i++)
+    {
+        u = (unsigned char)buffer[i];
+
+        if(u < 0x80 || u > 0xBF) {
+            /* not a continuation byte */
+            return 0;
+        }
+
+        value = (value << 6) + (u & 0x3F);
+    }
+
+    if(value > 0x10FFFF) {
+        /* not in Unicode range */
+        return 0;
+    }
+
+    else if(0xD800 <= value && value <= 0xDFFF) {
+        /* invalid code point (UTF-16 surrogate halves) */
+        return 0;
+    }
+
+    else if((size == 2 && value < 0x80) ||
+            (size == 3 && value < 0x800) ||
+            (size == 4 && value < 0x10000)) {
+        /* overlong encoding */
+        return 0;
+    }
+
+    if(codepoint)
+        *codepoint = value;
+
+    return 1;
+}
+
+const char *utf8_iterate(const char *buffer, size_t bufsize, int32_t *codepoint)
+{
+    size_t count;
+    int32_t value;
+
+    if(!bufsize)
+        return buffer;
+
+    count = utf8_check_first(buffer[0]);
+    if(count <= 0)
+        return NULL;
+
+    if(count == 1)
+        value = (unsigned char)buffer[0];
+    else
+    {
+        if(count > bufsize || !utf8_check_full(buffer, count, &value))
+            return NULL;
+    }
+
+    if(codepoint)
+        *codepoint = value;
+
+    return buffer + count;
+}
+
+int utf8_check_string(const char *string, size_t length)
+{
+    size_t i;
+
+    for(i = 0; i < length; i++)
+    {
+        size_t count = utf8_check_first(string[i]);
+        if(count == 0)
+            return 0;
+        else if(count > 1)
+        {
+            if(count > length - i)
+                return 0;
+
+            if(!utf8_check_full(&string[i], count, NULL))
+                return 0;
+
+            i += count - 1;
+        }
+    }
+
+    return 1;
+}

Added: vendor/jansson/dist/src/utf.h
===================================================================
--- vendor/jansson/dist/src/utf.h	                        (rev 0)
+++ vendor/jansson/dist/src/utf.h	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,27 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef UTF_H
+#define UTF_H
+
+#ifdef HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#ifdef HAVE_STDINT_H
+#include <stdint.h>
+#endif
+
+int utf8_encode(int32_t codepoint, char *buffer, size_t *size);
+
+size_t utf8_check_first(char byte);
+size_t utf8_check_full(const char *buffer, size_t size, int32_t *codepoint);
+const char *utf8_iterate(const char *buffer, size_t size, int32_t *codepoint);
+
+int utf8_check_string(const char *string, size_t length);
+
+#endif

Added: vendor/jansson/dist/src/value.c
===================================================================
--- vendor/jansson/dist/src/value.c	                        (rev 0)
+++ vendor/jansson/dist/src/value.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,1041 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef _GNU_SOURCE
+#define _GNU_SOURCE
+#endif
+
+#ifdef HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#include <stddef.h>
+#include <stdlib.h>
+#include <string.h>
+#include <math.h>
+
+#ifdef HAVE_STDINT_H
+#include <stdint.h>
+#endif
+
+#include "jansson.h"
+#include "hashtable.h"
+#include "jansson_private.h"
+#include "utf.h"
+
+/* Work around nonstandard isnan() and isinf() implementations */
+#ifndef isnan
+#ifndef __sun
+static JSON_INLINE int isnan(double x) { return x != x; }
+#endif
+#endif
+#ifndef isinf
+static JSON_INLINE int isinf(double x) { return !isnan(x) && isnan(x - x); }
+#endif
+
+static JSON_INLINE void json_init(json_t *json, json_type type)
+{
+    json->type = type;
+    json->refcount = 1;
+}
+
+
+/*** object ***/
+
+extern volatile uint32_t hashtable_seed;
+
+json_t *json_object(void)
+{
+    json_object_t *object = jsonp_malloc(sizeof(json_object_t));
+    if(!object)
+        return NULL;
+
+    if (!hashtable_seed) {
+        /* Autoseed */
+        json_object_seed(0);
+    }
+
+    json_init(&object->json, JSON_OBJECT);
+
+    if(hashtable_init(&object->hashtable))
+    {
+        jsonp_free(object);
+        return NULL;
+    }
+
+    object->serial = 0;
+    object->visited = 0;
+
+    return &object->json;
+}
+
+static void json_delete_object(json_object_t *object)
+{
+    hashtable_close(&object->hashtable);
+    jsonp_free(object);
+}
+
+size_t json_object_size(const json_t *json)
+{
+    json_object_t *object;
+
+    if(!json_is_object(json))
+        return 0;
+
+    object = json_to_object(json);
+    return object->hashtable.size;
+}
+
+json_t *json_object_get(const json_t *json, const char *key)
+{
+    json_object_t *object;
+
+    if(!key || !json_is_object(json))
+        return NULL;
+
+    object = json_to_object(json);
+    return hashtable_get(&object->hashtable, key);
+}
+
+int json_object_set_new_nocheck(json_t *json, const char *key, json_t *value)
+{
+    json_object_t *object;
+
+    if(!value)
+        return -1;
+
+    if(!key || !json_is_object(json) || json == value)
+    {
+        json_decref(value);
+        return -1;
+    }
+    object = json_to_object(json);
+
+    if(hashtable_set(&object->hashtable, key, object->serial++, value))
+    {
+        json_decref(value);
+        return -1;
+    }
+
+    return 0;
+}
+
+int json_object_set_new(json_t *json, const char *key, json_t *value)
+{
+    if(!key || !utf8_check_string(key, strlen(key)))
+    {
+        json_decref(value);
+        return -1;
+    }
+
+    return json_object_set_new_nocheck(json, key, value);
+}
+
+int json_object_del(json_t *json, const char *key)
+{
+    json_object_t *object;
+
+    if(!key || !json_is_object(json))
+        return -1;
+
+    object = json_to_object(json);
+    return hashtable_del(&object->hashtable, key);
+}
+
+int json_object_clear(json_t *json)
+{
+    json_object_t *object;
+
+    if(!json_is_object(json))
+        return -1;
+
+    object = json_to_object(json);
+
+    hashtable_clear(&object->hashtable);
+    object->serial = 0;
+
+    return 0;
+}
+
+int json_object_update(json_t *object, json_t *other)
+{
+    const char *key;
+    json_t *value;
+
+    if(!json_is_object(object) || !json_is_object(other))
+        return -1;
+
+    json_object_foreach(other, key, value) {
+        if(json_object_set_nocheck(object, key, value))
+            return -1;
+    }
+
+    return 0;
+}
+
+int json_object_update_existing(json_t *object, json_t *other)
+{
+    const char *key;
+    json_t *value;
+
+    if(!json_is_object(object) || !json_is_object(other))
+        return -1;
+
+    json_object_foreach(other, key, value) {
+        if(json_object_get(object, key))
+            json_object_set_nocheck(object, key, value);
+    }
+
+    return 0;
+}
+
+int json_object_update_missing(json_t *object, json_t *other)
+{
+    const char *key;
+    json_t *value;
+
+    if(!json_is_object(object) || !json_is_object(other))
+        return -1;
+
+    json_object_foreach(other, key, value) {
+        if(!json_object_get(object, key))
+            json_object_set_nocheck(object, key, value);
+    }
+
+    return 0;
+}
+
+void *json_object_iter(json_t *json)
+{
+    json_object_t *object;
+
+    if(!json_is_object(json))
+        return NULL;
+
+    object = json_to_object(json);
+    return hashtable_iter(&object->hashtable);
+}
+
+void *json_object_iter_at(json_t *json, const char *key)
+{
+    json_object_t *object;
+
+    if(!key || !json_is_object(json))
+        return NULL;
+
+    object = json_to_object(json);
+    return hashtable_iter_at(&object->hashtable, key);
+}
+
+void *json_object_iter_next(json_t *json, void *iter)
+{
+    json_object_t *object;
+
+    if(!json_is_object(json) || iter == NULL)
+        return NULL;
+
+    object = json_to_object(json);
+    return hashtable_iter_next(&object->hashtable, iter);
+}
+
+const char *json_object_iter_key(void *iter)
+{
+    if(!iter)
+        return NULL;
+
+    return hashtable_iter_key(iter);
+}
+
+json_t *json_object_iter_value(void *iter)
+{
+    if(!iter)
+        return NULL;
+
+    return (json_t *)hashtable_iter_value(iter);
+}
+
+int json_object_iter_set_new(json_t *json, void *iter, json_t *value)
+{
+    if(!json_is_object(json) || !iter || !value)
+        return -1;
+
+    hashtable_iter_set(iter, value);
+    return 0;
+}
+
+void *json_object_key_to_iter(const char *key)
+{
+    if(!key)
+        return NULL;
+
+    return hashtable_key_to_iter(key);
+}
+
+static int json_object_equal(json_t *object1, json_t *object2)
+{
+    const char *key;
+    json_t *value1, *value2;
+
+    if(json_object_size(object1) != json_object_size(object2))
+        return 0;
+
+    json_object_foreach(object1, key, value1) {
+        value2 = json_object_get(object2, key);
+
+        if(!json_equal(value1, value2))
+            return 0;
+    }
+
+    return 1;
+}
+
+static json_t *json_object_copy(json_t *object)
+{
+    json_t *result;
+
+    const char *key;
+    json_t *value;
+
+    result = json_object();
+    if(!result)
+        return NULL;
+
+    json_object_foreach(object, key, value)
+        json_object_set_nocheck(result, key, value);
+
+    return result;
+}
+
+static json_t *json_object_deep_copy(const json_t *object)
+{
+    json_t *result;
+    void *iter;
+
+    result = json_object();
+    if(!result)
+        return NULL;
+
+    /* Cannot use json_object_foreach because object has to be cast
+       non-const */
+    iter = json_object_iter((json_t *)object);
+    while(iter) {
+        const char *key;
+        const json_t *value;
+        key = json_object_iter_key(iter);
+        value = json_object_iter_value(iter);
+
+        json_object_set_new_nocheck(result, key, json_deep_copy(value));
+        iter = json_object_iter_next((json_t *)object, iter);
+    }
+
+    return result;
+}
+
+
+/*** array ***/
+
+json_t *json_array(void)
+{
+    json_array_t *array = jsonp_malloc(sizeof(json_array_t));
+    if(!array)
+        return NULL;
+    json_init(&array->json, JSON_ARRAY);
+
+    array->entries = 0;
+    array->size = 8;
+
+    array->table = jsonp_malloc(array->size * sizeof(json_t *));
+    if(!array->table) {
+        jsonp_free(array);
+        return NULL;
+    }
+
+    array->visited = 0;
+
+    return &array->json;
+}
+
+static void json_delete_array(json_array_t *array)
+{
+    size_t i;
+
+    for(i = 0; i < array->entries; i++)
+        json_decref(array->table[i]);
+
+    jsonp_free(array->table);
+    jsonp_free(array);
+}
+
+size_t json_array_size(const json_t *json)
+{
+    if(!json_is_array(json))
+        return 0;
+
+    return json_to_array(json)->entries;
+}
+
+json_t *json_array_get(const json_t *json, size_t index)
+{
+    json_array_t *array;
+    if(!json_is_array(json))
+        return NULL;
+    array = json_to_array(json);
+
+    if(index >= array->entries)
+        return NULL;
+
+    return array->table[index];
+}
+
+int json_array_set_new(json_t *json, size_t index, json_t *value)
+{
+    json_array_t *array;
+
+    if(!value)
+        return -1;
+
+    if(!json_is_array(json) || json == value)
+    {
+        json_decref(value);
+        return -1;
+    }
+    array = json_to_array(json);
+
+    if(index >= array->entries)
+    {
+        json_decref(value);
+        return -1;
+    }
+
+    json_decref(array->table[index]);
+    array->table[index] = value;
+
+    return 0;
+}
+
+static void array_move(json_array_t *array, size_t dest,
+                       size_t src, size_t count)
+{
+    memmove(&array->table[dest], &array->table[src], count * sizeof(json_t *));
+}
+
+static void array_copy(json_t **dest, size_t dpos,
+                       json_t **src, size_t spos,
+                       size_t count)
+{
+    memcpy(&dest[dpos], &src[spos], count * sizeof(json_t *));
+}
+
+static json_t **json_array_grow(json_array_t *array,
+                                size_t amount,
+                                int copy)
+{
+    size_t new_size;
+    json_t **old_table, **new_table;
+
+    if(array->entries + amount <= array->size)
+        return array->table;
+
+    old_table = array->table;
+
+    new_size = max(array->size + amount, array->size * 2);
+    new_table = jsonp_malloc(new_size * sizeof(json_t *));
+    if(!new_table)
+        return NULL;
+
+    array->size = new_size;
+    array->table = new_table;
+
+    if(copy) {
+        array_copy(array->table, 0, old_table, 0, array->entries);
+        jsonp_free(old_table);
+        return array->table;
+    }
+
+    return old_table;
+}
+
+int json_array_append_new(json_t *json, json_t *value)
+{
+    json_array_t *array;
+
+    if(!value)
+        return -1;
+
+    if(!json_is_array(json) || json == value)
+    {
+        json_decref(value);
+        return -1;
+    }
+    array = json_to_array(json);
+
+    if(!json_array_grow(array, 1, 1)) {
+        json_decref(value);
+        return -1;
+    }
+
+    array->table[array->entries] = value;
+    array->entries++;
+
+    return 0;
+}
+
+int json_array_insert_new(json_t *json, size_t index, json_t *value)
+{
+    json_array_t *array;
+    json_t **old_table;
+
+    if(!value)
+        return -1;
+
+    if(!json_is_array(json) || json == value) {
+        json_decref(value);
+        return -1;
+    }
+    array = json_to_array(json);
+
+    if(index > array->entries) {
+        json_decref(value);
+        return -1;
+    }
+
+    old_table = json_array_grow(array, 1, 0);
+    if(!old_table) {
+        json_decref(value);
+        return -1;
+    }
+
+    if(old_table != array->table) {
+        array_copy(array->table, 0, old_table, 0, index);
+        array_copy(array->table, index + 1, old_table, index,
+                   array->entries - index);
+        jsonp_free(old_table);
+    }
+    else
+        array_move(array, index + 1, index, array->entries - index);
+
+    array->table[index] = value;
+    array->entries++;
+
+    return 0;
+}
+
+int json_array_remove(json_t *json, size_t index)
+{
+    json_array_t *array;
+
+    if(!json_is_array(json))
+        return -1;
+    array = json_to_array(json);
+
+    if(index >= array->entries)
+        return -1;
+
+    json_decref(array->table[index]);
+
+    /* If we're removing the last element, nothing has to be moved */
+    if(index < array->entries - 1)
+        array_move(array, index, index + 1, array->entries - index - 1);
+
+    array->entries--;
+
+    return 0;
+}
+
+int json_array_clear(json_t *json)
+{
+    json_array_t *array;
+    size_t i;
+
+    if(!json_is_array(json))
+        return -1;
+    array = json_to_array(json);
+
+    for(i = 0; i < array->entries; i++)
+        json_decref(array->table[i]);
+
+    array->entries = 0;
+    return 0;
+}
+
+int json_array_extend(json_t *json, json_t *other_json)
+{
+    json_array_t *array, *other;
+    size_t i;
+
+    if(!json_is_array(json) || !json_is_array(other_json))
+        return -1;
+    array = json_to_array(json);
+    other = json_to_array(other_json);
+
+    if(!json_array_grow(array, other->entries, 1))
+        return -1;
+
+    for(i = 0; i < other->entries; i++)
+        json_incref(other->table[i]);
+
+    array_copy(array->table, array->entries, other->table, 0, other->entries);
+
+    array->entries += other->entries;
+    return 0;
+}
+
+static int json_array_equal(json_t *array1, json_t *array2)
+{
+    size_t i, size;
+
+    size = json_array_size(array1);
+    if(size != json_array_size(array2))
+        return 0;
+
+    for(i = 0; i < size; i++)
+    {
+        json_t *value1, *value2;
+
+        value1 = json_array_get(array1, i);
+        value2 = json_array_get(array2, i);
+
+        if(!json_equal(value1, value2))
+            return 0;
+    }
+
+    return 1;
+}
+
+static json_t *json_array_copy(json_t *array)
+{
+    json_t *result;
+    size_t i;
+
+    result = json_array();
+    if(!result)
+        return NULL;
+
+    for(i = 0; i < json_array_size(array); i++)
+        json_array_append(result, json_array_get(array, i));
+
+    return result;
+}
+
+static json_t *json_array_deep_copy(const json_t *array)
+{
+    json_t *result;
+    size_t i;
+
+    result = json_array();
+    if(!result)
+        return NULL;
+
+    for(i = 0; i < json_array_size(array); i++)
+        json_array_append_new(result, json_deep_copy(json_array_get(array, i)));
+
+    return result;
+}
+
+/*** string ***/
+
+static json_t *string_create(const char *value, size_t len, int own)
+{
+    char *v;
+    json_string_t *string;
+
+    if(!value)
+        return NULL;
+
+    if(own)
+        v = (char *)value;
+    else {
+        v = jsonp_strndup(value, len);
+        if(!v)
+            return NULL;
+    }
+
+    string = jsonp_malloc(sizeof(json_string_t));
+    if(!string) {
+        if(!own)
+            jsonp_free(v);
+        return NULL;
+    }
+    json_init(&string->json, JSON_STRING);
+    string->value = v;
+    string->length = len;
+
+    return &string->json;
+}
+
+json_t *json_string_nocheck(const char *value)
+{
+    if(!value)
+        return NULL;
+
+    return string_create(value, strlen(value), 0);
+}
+
+json_t *json_stringn_nocheck(const char *value, size_t len)
+{
+    return string_create(value, len, 0);
+}
+
+/* this is private; "steal" is not a public API concept */
+json_t *jsonp_stringn_nocheck_own(const char *value, size_t len)
+{
+    return string_create(value, len, 1);
+}
+
+json_t *json_string(const char *value)
+{
+    if(!value)
+        return NULL;
+
+    return json_stringn(value, strlen(value));
+}
+
+json_t *json_stringn(const char *value, size_t len)
+{
+    if(!value || !utf8_check_string(value, len))
+        return NULL;
+
+    return json_stringn_nocheck(value, len);
+}
+
+const char *json_string_value(const json_t *json)
+{
+    if(!json_is_string(json))
+        return NULL;
+
+    return json_to_string(json)->value;
+}
+
+size_t json_string_length(const json_t *json)
+{
+    if(!json_is_string(json))
+        return 0;
+
+    return json_to_string(json)->length;
+}
+
+int json_string_set_nocheck(json_t *json, const char *value)
+{
+    if(!value)
+        return -1;
+
+    return json_string_setn_nocheck(json, value, strlen(value));
+}
+
+int json_string_setn_nocheck(json_t *json, const char *value, size_t len)
+{
+    char *dup;
+    json_string_t *string;
+
+    if(!json_is_string(json) || !value)
+        return -1;
+
+    dup = jsonp_strndup(value, len);
+    if(!dup)
+        return -1;
+
+    string = json_to_string(json);
+    jsonp_free(string->value);
+    string->value = dup;
+    string->length = len;
+
+    return 0;
+}
+
+int json_string_set(json_t *json, const char *value)
+{
+    if(!value)
+        return -1;
+
+    return json_string_setn(json, value, strlen(value));
+}
+
+int json_string_setn(json_t *json, const char *value, size_t len)
+{
+    if(!value || !utf8_check_string(value, len))
+        return -1;
+
+    return json_string_setn_nocheck(json, value, len);
+}
+
+static void json_delete_string(json_string_t *string)
+{
+    jsonp_free(string->value);
+    jsonp_free(string);
+}
+
+static int json_string_equal(json_t *string1, json_t *string2)
+{
+    json_string_t *s1, *s2;
+
+    if(!json_is_string(string1) || !json_is_string(string2))
+        return 0;
+
+    s1 = json_to_string(string1);
+    s2 = json_to_string(string2);
+    return s1->length == s2->length && !memcmp(s1->value, s2->value, s1->length);
+}
+
+static json_t *json_string_copy(const json_t *string)
+{
+    json_string_t *s;
+
+    if(!json_is_string(string))
+        return NULL;
+
+    s = json_to_string(string);
+    return json_stringn_nocheck(s->value, s->length);
+}
+
+
+/*** integer ***/
+
+json_t *json_integer(json_int_t value)
+{
+    json_integer_t *integer = jsonp_malloc(sizeof(json_integer_t));
+    if(!integer)
+        return NULL;
+    json_init(&integer->json, JSON_INTEGER);
+
+    integer->value = value;
+    return &integer->json;
+}
+
+json_int_t json_integer_value(const json_t *json)
+{
+    if(!json_is_integer(json))
+        return 0;
+
+    return json_to_integer(json)->value;
+}
+
+int json_integer_set(json_t *json, json_int_t value)
+{
+    if(!json_is_integer(json))
+        return -1;
+
+    json_to_integer(json)->value = value;
+
+    return 0;
+}
+
+static void json_delete_integer(json_integer_t *integer)
+{
+    jsonp_free(integer);
+}
+
+static int json_integer_equal(json_t *integer1, json_t *integer2)
+{
+    return json_integer_value(integer1) == json_integer_value(integer2);
+}
+
+static json_t *json_integer_copy(const json_t *integer)
+{
+    return json_integer(json_integer_value(integer));
+}
+
+
+/*** real ***/
+
+json_t *json_real(double value)
+{
+    json_real_t *real;
+
+    if(isnan(value) || isinf(value))
+        return NULL;
+
+    real = jsonp_malloc(sizeof(json_real_t));
+    if(!real)
+        return NULL;
+    json_init(&real->json, JSON_REAL);
+
+    real->value = value;
+    return &real->json;
+}
+
+double json_real_value(const json_t *json)
+{
+    if(!json_is_real(json))
+        return 0;
+
+    return json_to_real(json)->value;
+}
+
+int json_real_set(json_t *json, double value)
+{
+    if(!json_is_real(json) || isnan(value) || isinf(value))
+        return -1;
+
+    json_to_real(json)->value = value;
+
+    return 0;
+}
+
+static void json_delete_real(json_real_t *real)
+{
+    jsonp_free(real);
+}
+
+static int json_real_equal(json_t *real1, json_t *real2)
+{
+    return json_real_value(real1) == json_real_value(real2);
+}
+
+static json_t *json_real_copy(const json_t *real)
+{
+    return json_real(json_real_value(real));
+}
+
+
+/*** number ***/
+
+double json_number_value(const json_t *json)
+{
+    if(json_is_integer(json))
+        return (double)json_integer_value(json);
+    else if(json_is_real(json))
+        return json_real_value(json);
+    else
+        return 0.0;
+}
+
+
+/*** simple values ***/
+
+json_t *json_true(void)
+{
+    static json_t the_true = {JSON_TRUE, (size_t)-1};
+    return &the_true;
+}
+
+
+json_t *json_false(void)
+{
+    static json_t the_false = {JSON_FALSE, (size_t)-1};
+    return &the_false;
+}
+
+
+json_t *json_null(void)
+{
+    static json_t the_null = {JSON_NULL, (size_t)-1};
+    return &the_null;
+}
+
+
+/*** deletion ***/
+
+void json_delete(json_t *json)
+{
+    if(json_is_object(json))
+        json_delete_object(json_to_object(json));
+
+    else if(json_is_array(json))
+        json_delete_array(json_to_array(json));
+
+    else if(json_is_string(json))
+        json_delete_string(json_to_string(json));
+
+    else if(json_is_integer(json))
+        json_delete_integer(json_to_integer(json));
+
+    else if(json_is_real(json))
+        json_delete_real(json_to_real(json));
+
+    /* json_delete is not called for true, false or null */
+}
+
+
+/*** equality ***/
+
+int json_equal(json_t *json1, json_t *json2)
+{
+    if(!json1 || !json2)
+        return 0;
+
+    if(json_typeof(json1) != json_typeof(json2))
+        return 0;
+
+    /* this covers true, false and null as they are singletons */
+    if(json1 == json2)
+        return 1;
+
+    if(json_is_object(json1))
+        return json_object_equal(json1, json2);
+
+    if(json_is_array(json1))
+        return json_array_equal(json1, json2);
+
+    if(json_is_string(json1))
+        return json_string_equal(json1, json2);
+
+    if(json_is_integer(json1))
+        return json_integer_equal(json1, json2);
+
+    if(json_is_real(json1))
+        return json_real_equal(json1, json2);
+
+    return 0;
+}
+
+
+/*** copying ***/
+
+json_t *json_copy(json_t *json)
+{
+    if(!json)
+        return NULL;
+
+    if(json_is_object(json))
+        return json_object_copy(json);
+
+    if(json_is_array(json))
+        return json_array_copy(json);
+
+    if(json_is_string(json))
+        return json_string_copy(json);
+
+    if(json_is_integer(json))
+        return json_integer_copy(json);
+
+    if(json_is_real(json))
+        return json_real_copy(json);
+
+    if(json_is_true(json) || json_is_false(json) || json_is_null(json))
+        return json;
+
+    return NULL;
+}
+
+json_t *json_deep_copy(const json_t *json)
+{
+    if(!json)
+        return NULL;
+
+    if(json_is_object(json))
+        return json_object_deep_copy(json);
+
+    if(json_is_array(json))
+        return json_array_deep_copy(json);
+
+    /* for the rest of the types, deep copying doesn't differ from
+       shallow copying */
+
+    if(json_is_string(json))
+        return json_string_copy(json);
+
+    if(json_is_integer(json))
+        return json_integer_copy(json);
+
+    if(json_is_real(json))
+        return json_real_copy(json);
+
+    if(json_is_true(json) || json_is_false(json) || json_is_null(json))
+        return (json_t *)json;
+
+    return NULL;
+}

Added: vendor/jansson/dist/test/Makefile.am
===================================================================
--- vendor/jansson/dist/test/Makefile.am	                        (rev 0)
+++ vendor/jansson/dist/test/Makefile.am	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,10 @@
+SUBDIRS = bin suites
+EXTRA_DIST = scripts run-suites
+
+TESTS = run-suites
+TESTS_ENVIRONMENT = \
+	top_srcdir=$(top_srcdir) \
+	top_builddir=$(top_builddir)
+
+clean-local:
+	rm -rf logs

Added: vendor/jansson/dist/test/Makefile.in
===================================================================
--- vendor/jansson/dist/test/Makefile.in	                        (rev 0)
+++ vendor/jansson/dist/test/Makefile.in	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,985 @@
+# Makefile.in generated by automake 1.14.1 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994-2013 Free Software Foundation, Inc.
+
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+ at SET_MAKE@
+VPATH = @srcdir@
+am__is_gnu_make = test -n '$(MAKEFILE_LIST)' && test -n '$(MAKELEVEL)'
+am__make_running_with_option = \
+  case $${target_option-} in \
+      ?) ;; \
+      *) echo "am__make_running_with_option: internal error: invalid" \
+              "target option '$${target_option-}' specified" >&2; \
+         exit 1;; \
+  esac; \
+  has_opt=no; \
+  sane_makeflags=$$MAKEFLAGS; \
+  if $(am__is_gnu_make); then \
+    sane_makeflags=$$MFLAGS; \
+  else \
+    case $$MAKEFLAGS in \
+      *\\[\ \	]*) \
+        bs=\\; \
+        sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \
+          | sed "s/$$bs$$bs[$$bs $$bs	]*//g"`;; \
+    esac; \
+  fi; \
+  skip_next=no; \
+  strip_trailopt () \
+  { \
+    flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \
+  }; \
+  for flg in $$sane_makeflags; do \
+    test $$skip_next = yes && { skip_next=no; continue; }; \
+    case $$flg in \
+      *=*|--*) continue;; \
+        -*I) strip_trailopt 'I'; skip_next=yes;; \
+      -*I?*) strip_trailopt 'I';; \
+        -*O) strip_trailopt 'O'; skip_next=yes;; \
+      -*O?*) strip_trailopt 'O';; \
+        -*l) strip_trailopt 'l'; skip_next=yes;; \
+      -*l?*) strip_trailopt 'l';; \
+      -[dEDm]) skip_next=yes;; \
+      -[JT]) skip_next=yes;; \
+    esac; \
+    case $$flg in \
+      *$$target_option*) has_opt=yes; break;; \
+    esac; \
+  done; \
+  test $$has_opt = yes
+am__make_dryrun = (target_option=n; $(am__make_running_with_option))
+am__make_keepgoing = (target_option=k; $(am__make_running_with_option))
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+subdir = test
+DIST_COMMON = $(srcdir)/Makefile.in $(srcdir)/Makefile.am \
+	$(top_srcdir)/test-driver
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+	$(ACLOCAL_M4)
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = $(top_builddir)/jansson_private_config.h
+CONFIG_CLEAN_FILES =
+CONFIG_CLEAN_VPATH_FILES =
+AM_V_P = $(am__v_P_ at AM_V@)
+am__v_P_ = $(am__v_P_ at AM_DEFAULT_V@)
+am__v_P_0 = false
+am__v_P_1 = :
+AM_V_GEN = $(am__v_GEN_ at AM_V@)
+am__v_GEN_ = $(am__v_GEN_ at AM_DEFAULT_V@)
+am__v_GEN_0 = @echo "  GEN     " $@;
+am__v_GEN_1 = 
+AM_V_at = $(am__v_at_ at AM_V@)
+am__v_at_ = $(am__v_at_ at AM_DEFAULT_V@)
+am__v_at_0 = @
+am__v_at_1 = 
+SOURCES =
+DIST_SOURCES =
+RECURSIVE_TARGETS = all-recursive check-recursive cscopelist-recursive \
+	ctags-recursive dvi-recursive html-recursive info-recursive \
+	install-data-recursive install-dvi-recursive \
+	install-exec-recursive install-html-recursive \
+	install-info-recursive install-pdf-recursive \
+	install-ps-recursive install-recursive installcheck-recursive \
+	installdirs-recursive pdf-recursive ps-recursive \
+	tags-recursive uninstall-recursive
+am__can_run_installinfo = \
+  case $$AM_UPDATE_INFO_DIR in \
+    n|no|NO) false;; \
+    *) (install-info --version) >/dev/null 2>&1;; \
+  esac
+RECURSIVE_CLEAN_TARGETS = mostlyclean-recursive clean-recursive	\
+  distclean-recursive maintainer-clean-recursive
+am__recursive_targets = \
+  $(RECURSIVE_TARGETS) \
+  $(RECURSIVE_CLEAN_TARGETS) \
+  $(am__extra_recursive_targets)
+AM_RECURSIVE_TARGETS = $(am__recursive_targets:-recursive=) TAGS CTAGS \
+	check recheck distdir
+am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP)
+# Read a list of newline-separated strings from the standard input,
+# and print each of them once, without duplicates.  Input order is
+# *not* preserved.
+am__uniquify_input = $(AWK) '\
+  BEGIN { nonempty = 0; } \
+  { items[$$0] = 1; nonempty = 1; } \
+  END { if (nonempty) { for (i in items) print i; }; } \
+'
+# Make sure the list of sources is unique.  This is necessary because,
+# e.g., the same source file might be shared among _SOURCES variables
+# for different programs/libraries.
+am__define_uniq_tagged_files = \
+  list='$(am__tagged_files)'; \
+  unique=`for i in $$list; do \
+    if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+  done | $(am__uniquify_input)`
+ETAGS = etags
+CTAGS = ctags
+am__tty_colors_dummy = \
+  mgn= red= grn= lgn= blu= brg= std=; \
+  am__color_tests=no
+am__tty_colors = { \
+  $(am__tty_colors_dummy); \
+  if test "X$(AM_COLOR_TESTS)" = Xno; then \
+    am__color_tests=no; \
+  elif test "X$(AM_COLOR_TESTS)" = Xalways; then \
+    am__color_tests=yes; \
+  elif test "X$$TERM" != Xdumb && { test -t 1; } 2>/dev/null; then \
+    am__color_tests=yes; \
+  fi; \
+  if test $$am__color_tests = yes; then \
+    red=''; \
+    grn=''; \
+    lgn=''; \
+    blu=''; \
+    mgn=''; \
+    brg=''; \
+    std=''; \
+  fi; \
+}
+am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`;
+am__vpath_adj = case $$p in \
+    $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \
+    *) f=$$p;; \
+  esac;
+am__strip_dir = f=`echo $$p | sed -e 's|^.*/||'`;
+am__install_max = 40
+am__nobase_strip_setup = \
+  srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*|]/\\\\&/g'`
+am__nobase_strip = \
+  for p in $$list; do echo "$$p"; done | sed -e "s|$$srcdirstrip/||"
+am__nobase_list = $(am__nobase_strip_setup); \
+  for p in $$list; do echo "$$p $$p"; done | \
+  sed "s| $$srcdirstrip/| |;"' / .*\//!s/ .*/ ./; s,\( .*\)/[^/]*$$,\1,' | \
+  $(AWK) 'BEGIN { files["."] = "" } { files[$$2] = files[$$2] " " $$1; \
+    if (++n[$$2] == $(am__install_max)) \
+      { print $$2, files[$$2]; n[$$2] = 0; files[$$2] = "" } } \
+    END { for (dir in files) print dir, files[dir] }'
+am__base_list = \
+  sed '$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;s/\n/ /g' | \
+  sed '$$!N;$$!N;$$!N;$$!N;s/\n/ /g'
+am__uninstall_files_from_dir = { \
+  test -z "$$files" \
+    || { test ! -d "$$dir" && test ! -f "$$dir" && test ! -r "$$dir"; } \
+    || { echo " ( cd '$$dir' && rm -f" $$files ")"; \
+         $(am__cd) "$$dir" && rm -f $$files; }; \
+  }
+am__recheck_rx = ^[ 	]*:recheck:[ 	]*
+am__global_test_result_rx = ^[ 	]*:global-test-result:[ 	]*
+am__copy_in_global_log_rx = ^[ 	]*:copy-in-global-log:[ 	]*
+# A command that, given a newline-separated list of test names on the
+# standard input, print the name of the tests that are to be re-run
+# upon "make recheck".
+am__list_recheck_tests = $(AWK) '{ \
+  recheck = 1; \
+  while ((rc = (getline line < ($$0 ".trs"))) != 0) \
+    { \
+      if (rc < 0) \
+        { \
+          if ((getline line2 < ($$0 ".log")) < 0) \
+	    recheck = 0; \
+          break; \
+        } \
+      else if (line ~ /$(am__recheck_rx)[nN][Oo]/) \
+        { \
+          recheck = 0; \
+          break; \
+        } \
+      else if (line ~ /$(am__recheck_rx)[yY][eE][sS]/) \
+        { \
+          break; \
+        } \
+    }; \
+  if (recheck) \
+    print $$0; \
+  close ($$0 ".trs"); \
+  close ($$0 ".log"); \
+}'
+# A command that, given a newline-separated list of test names on the
+# standard input, create the global log from their .trs and .log files.
+am__create_global_log = $(AWK) ' \
+function fatal(msg) \
+{ \
+  print "fatal: making $@: " msg | "cat >&2"; \
+  exit 1; \
+} \
+function rst_section(header) \
+{ \
+  print header; \
+  len = length(header); \
+  for (i = 1; i <= len; i = i + 1) \
+    printf "="; \
+  printf "\n\n"; \
+} \
+{ \
+  copy_in_global_log = 1; \
+  global_test_result = "RUN"; \
+  while ((rc = (getline line < ($$0 ".trs"))) != 0) \
+    { \
+      if (rc < 0) \
+         fatal("failed to read from " $$0 ".trs"); \
+      if (line ~ /$(am__global_test_result_rx)/) \
+        { \
+          sub("$(am__global_test_result_rx)", "", line); \
+          sub("[ 	]*$$", "", line); \
+          global_test_result = line; \
+        } \
+      else if (line ~ /$(am__copy_in_global_log_rx)[nN][oO]/) \
+        copy_in_global_log = 0; \
+    }; \
+  if (copy_in_global_log) \
+    { \
+      rst_section(global_test_result ": " $$0); \
+      while ((rc = (getline line < ($$0 ".log"))) != 0) \
+      { \
+        if (rc < 0) \
+          fatal("failed to read from " $$0 ".log"); \
+        print line; \
+      }; \
+      printf "\n"; \
+    }; \
+  close ($$0 ".trs"); \
+  close ($$0 ".log"); \
+}'
+# Restructured Text title.
+am__rst_title = { sed 's/.*/   &   /;h;s/./=/g;p;x;s/ *$$//;p;g' && echo; }
+# Solaris 10 'make', and several other traditional 'make' implementations,
+# pass "-e" to $(SHELL), and POSIX 2008 even requires this.  Work around it
+# by disabling -e (using the XSI extension "set +e") if it's set.
+am__sh_e_setup = case $$- in *e*) set +e;; esac
+# Default flags passed to test drivers.
+am__common_driver_flags = \
+  --color-tests "$$am__color_tests" \
+  --enable-hard-errors "$$am__enable_hard_errors" \
+  --expect-failure "$$am__expect_failure"
+# To be inserted before the command running the test.  Creates the
+# directory for the log if needed.  Stores in $dir the directory
+# containing $f, in $tst the test, in $log the log.  Executes the
+# developer- defined test setup AM_TESTS_ENVIRONMENT (if any), and
+# passes TESTS_ENVIRONMENT.  Set up options for the wrapper that
+# will run the test scripts (or their associated LOG_COMPILER, if
+# thy have one).
+am__check_pre = \
+$(am__sh_e_setup);					\
+$(am__vpath_adj_setup) $(am__vpath_adj)			\
+$(am__tty_colors);					\
+srcdir=$(srcdir); export srcdir;			\
+case "$@" in						\
+  */*) am__odir=`echo "./$@" | sed 's|/[^/]*$$||'`;;	\
+    *) am__odir=.;; 					\
+esac;							\
+test "x$$am__odir" = x"." || test -d "$$am__odir" 	\
+  || $(MKDIR_P) "$$am__odir" || exit $$?;		\
+if test -f "./$$f"; then dir=./;			\
+elif test -f "$$f"; then dir=;				\
+else dir="$(srcdir)/"; fi;				\
+tst=$$dir$$f; log='$@'; 				\
+if test -n '$(DISABLE_HARD_ERRORS)'; then		\
+  am__enable_hard_errors=no; 				\
+else							\
+  am__enable_hard_errors=yes; 				\
+fi; 							\
+case " $(XFAIL_TESTS) " in				\
+  *[\ \	]$$f[\ \	]* | *[\ \	]$$dir$$f[\ \	]*) \
+    am__expect_failure=yes;;				\
+  *)							\
+    am__expect_failure=no;;				\
+esac; 							\
+$(AM_TESTS_ENVIRONMENT) $(TESTS_ENVIRONMENT)
+# A shell command to get the names of the tests scripts with any registered
+# extension removed (i.e., equivalently, the names of the test logs, with
+# the '.log' extension removed).  The result is saved in the shell variable
+# '$bases'.  This honors runtime overriding of TESTS and TEST_LOGS.  Sadly,
+# we cannot use something simpler, involving e.g., "$(TEST_LOGS:.log=)",
+# since that might cause problem with VPATH rewrites for suffix-less tests.
+# See also 'test-harness-vpath-rewrite.sh' and 'test-trs-basic.sh'.
+am__set_TESTS_bases = \
+  bases='$(TEST_LOGS)'; \
+  bases=`for i in $$bases; do echo $$i; done | sed 's/\.log$$//'`; \
+  bases=`echo $$bases`
+RECHECK_LOGS = $(TEST_LOGS)
+TEST_SUITE_LOG = test-suite.log
+TEST_EXTENSIONS = @EXEEXT@ .test
+LOG_DRIVER = $(SHELL) $(top_srcdir)/test-driver
+LOG_COMPILE = $(LOG_COMPILER) $(AM_LOG_FLAGS) $(LOG_FLAGS)
+am__set_b = \
+  case '$@' in \
+    */*) \
+      case '$*' in \
+        */*) b='$*';; \
+          *) b=`echo '$@' | sed 's/\.log$$//'`; \
+       esac;; \
+    *) \
+      b='$*';; \
+  esac
+am__test_logs1 = $(TESTS:=.log)
+am__test_logs2 = $(am__test_logs1:@EXEEXT at .log=.log)
+TEST_LOGS = $(am__test_logs2:.test.log=.log)
+TEST_LOG_DRIVER = $(SHELL) $(top_srcdir)/test-driver
+TEST_LOG_COMPILE = $(TEST_LOG_COMPILER) $(AM_TEST_LOG_FLAGS) \
+	$(TEST_LOG_FLAGS)
+DIST_SUBDIRS = $(SUBDIRS)
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+am__relativize = \
+  dir0=`pwd`; \
+  sed_first='s,^\([^/]*\)/.*$$,\1,'; \
+  sed_rest='s,^[^/]*/*,,'; \
+  sed_last='s,^.*/\([^/]*\)$$,\1,'; \
+  sed_butlast='s,/*[^/]*$$,,'; \
+  while test -n "$$dir1"; do \
+    first=`echo "$$dir1" | sed -e "$$sed_first"`; \
+    if test "$$first" != "."; then \
+      if test "$$first" = ".."; then \
+        dir2=`echo "$$dir0" | sed -e "$$sed_last"`/"$$dir2"; \
+        dir0=`echo "$$dir0" | sed -e "$$sed_butlast"`; \
+      else \
+        first2=`echo "$$dir2" | sed -e "$$sed_first"`; \
+        if test "$$first2" = "$$first"; then \
+          dir2=`echo "$$dir2" | sed -e "$$sed_rest"`; \
+        else \
+          dir2="../$$dir2"; \
+        fi; \
+        dir0="$$dir0"/"$$first"; \
+      fi; \
+    fi; \
+    dir1=`echo "$$dir1" | sed -e "$$sed_rest"`; \
+  done; \
+  reldir="$$dir2"
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AM_CFLAGS = @AM_CFLAGS@
+AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DLLTOOL = @DLLTOOL@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+GREP = @GREP@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+LD = @LD@
+LDFLAGS = @LDFLAGS@
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+MAKEINFO = @MAKEINFO@
+MANIFEST_TOOL = @MANIFEST_TOOL@
+MKDIR_P = @MKDIR_P@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_URL = @PACKAGE_URL@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+VERSION = @VERSION@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+json_have_localeconv = @json_have_localeconv@
+json_have_long_long = @json_have_long_long@
+json_inline = @json_inline@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+SUBDIRS = bin suites
+EXTRA_DIST = scripts run-suites
+TESTS = run-suites
+TESTS_ENVIRONMENT = \
+	top_srcdir=$(top_srcdir) \
+	top_builddir=$(top_builddir)
+
+all: all-recursive
+
+.SUFFIXES:
+.SUFFIXES: .log .test .test$(EXEEXT) .trs
+$(srcdir)/Makefile.in:  $(srcdir)/Makefile.am  $(am__configure_deps)
+	@for dep in $?; do \
+	  case '$(am__configure_deps)' in \
+	    *$$dep*) \
+	      ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \
+	        && { if test -f $@; then exit 0; else break; fi; }; \
+	      exit 1;; \
+	  esac; \
+	done; \
+	echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign test/Makefile'; \
+	$(am__cd) $(top_srcdir) && \
+	  $(AUTOMAKE) --foreign test/Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+	@case '$?' in \
+	  *config.status*) \
+	    cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
+	  *) \
+	    echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
+	    cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+	esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+
+$(top_srcdir)/configure:  $(am__configure_deps)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(ACLOCAL_M4):  $(am__aclocal_m4_deps)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(am__aclocal_m4_deps):
+
+mostlyclean-libtool:
+	-rm -f *.lo
+
+clean-libtool:
+	-rm -rf .libs _libs
+
+# This directory's subdirectories are mostly independent; you can cd
+# into them and run 'make' without going through this Makefile.
+# To change the values of 'make' variables: instead of editing Makefiles,
+# (1) if the variable is set in 'config.status', edit 'config.status'
+#     (which will cause the Makefiles to be regenerated when you run 'make');
+# (2) otherwise, pass the desired values on the 'make' command line.
+$(am__recursive_targets):
+	@fail=; \
+	if $(am__make_keepgoing); then \
+	  failcom='fail=yes'; \
+	else \
+	  failcom='exit 1'; \
+	fi; \
+	dot_seen=no; \
+	target=`echo $@ | sed s/-recursive//`; \
+	case "$@" in \
+	  distclean-* | maintainer-clean-*) list='$(DIST_SUBDIRS)' ;; \
+	  *) list='$(SUBDIRS)' ;; \
+	esac; \
+	for subdir in $$list; do \
+	  echo "Making $$target in $$subdir"; \
+	  if test "$$subdir" = "."; then \
+	    dot_seen=yes; \
+	    local_target="$$target-am"; \
+	  else \
+	    local_target="$$target"; \
+	  fi; \
+	  ($(am__cd) $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$local_target) \
+	  || eval $$failcom; \
+	done; \
+	if test "$$dot_seen" = "no"; then \
+	  $(MAKE) $(AM_MAKEFLAGS) "$$target-am" || exit 1; \
+	fi; test -z "$$fail"
+
+ID: $(am__tagged_files)
+	$(am__define_uniq_tagged_files); mkid -fID $$unique
+tags: tags-recursive
+TAGS: tags
+
+tags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+	set x; \
+	here=`pwd`; \
+	if ($(ETAGS) --etags-include --version) >/dev/null 2>&1; then \
+	  include_option=--etags-include; \
+	  empty_fix=.; \
+	else \
+	  include_option=--include; \
+	  empty_fix=; \
+	fi; \
+	list='$(SUBDIRS)'; for subdir in $$list; do \
+	  if test "$$subdir" = .; then :; else \
+	    test ! -f $$subdir/TAGS || \
+	      set "$$@" "$$include_option=$$here/$$subdir/TAGS"; \
+	  fi; \
+	done; \
+	$(am__define_uniq_tagged_files); \
+	shift; \
+	if test -z "$(ETAGS_ARGS)$$*$$unique"; then :; else \
+	  test -n "$$unique" || unique=$$empty_fix; \
+	  if test $$# -gt 0; then \
+	    $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+	      "$$@" $$unique; \
+	  else \
+	    $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+	      $$unique; \
+	  fi; \
+	fi
+ctags: ctags-recursive
+
+CTAGS: ctags
+ctags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+	$(am__define_uniq_tagged_files); \
+	test -z "$(CTAGS_ARGS)$$unique" \
+	  || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \
+	     $$unique
+
+GTAGS:
+	here=`$(am__cd) $(top_builddir) && pwd` \
+	  && $(am__cd) $(top_srcdir) \
+	  && gtags -i $(GTAGS_ARGS) "$$here"
+cscopelist: cscopelist-recursive
+
+cscopelist-am: $(am__tagged_files)
+	list='$(am__tagged_files)'; \
+	case "$(srcdir)" in \
+	  [\\/]* | ?:[\\/]*) sdir="$(srcdir)" ;; \
+	  *) sdir=$(subdir)/$(srcdir) ;; \
+	esac; \
+	for i in $$list; do \
+	  if test -f "$$i"; then \
+	    echo "$(subdir)/$$i"; \
+	  else \
+	    echo "$$sdir/$$i"; \
+	  fi; \
+	done >> $(top_builddir)/cscope.files
+
+distclean-tags:
+	-rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
+
+# Recover from deleted '.trs' file; this should ensure that
+# "rm -f foo.log; make foo.trs" re-run 'foo.test', and re-create
+# both 'foo.log' and 'foo.trs'.  Break the recipe in two subshells
+# to avoid problems with "make -n".
+.log.trs:
+	rm -f $< $@
+	$(MAKE) $(AM_MAKEFLAGS) $<
+
+# Leading 'am--fnord' is there to ensure the list of targets does not
+# expand to empty, as could happen e.g. with make check TESTS=''.
+am--fnord $(TEST_LOGS) $(TEST_LOGS:.log=.trs): $(am__force_recheck)
+am--force-recheck:
+	@:
+
+$(TEST_SUITE_LOG): $(TEST_LOGS)
+	@$(am__set_TESTS_bases); \
+	am__f_ok () { test -f "$$1" && test -r "$$1"; }; \
+	redo_bases=`for i in $$bases; do \
+	              am__f_ok $$i.trs && am__f_ok $$i.log || echo $$i; \
+	            done`; \
+	if test -n "$$redo_bases"; then \
+	  redo_logs=`for i in $$redo_bases; do echo $$i.log; done`; \
+	  redo_results=`for i in $$redo_bases; do echo $$i.trs; done`; \
+	  if $(am__make_dryrun); then :; else \
+	    rm -f $$redo_logs && rm -f $$redo_results || exit 1; \
+	  fi; \
+	fi; \
+	if test -n "$$am__remaking_logs"; then \
+	  echo "fatal: making $(TEST_SUITE_LOG): possible infinite" \
+	       "recursion detected" >&2; \
+	else \
+	  am__remaking_logs=yes $(MAKE) $(AM_MAKEFLAGS) $$redo_logs; \
+	fi; \
+	if $(am__make_dryrun); then :; else \
+	  st=0;  \
+	  errmsg="fatal: making $(TEST_SUITE_LOG): failed to create"; \
+	  for i in $$redo_bases; do \
+	    test -f $$i.trs && test -r $$i.trs \
+	      || { echo "$$errmsg $$i.trs" >&2; st=1; }; \
+	    test -f $$i.log && test -r $$i.log \
+	      || { echo "$$errmsg $$i.log" >&2; st=1; }; \
+	  done; \
+	  test $$st -eq 0 || exit 1; \
+	fi
+	@$(am__sh_e_setup); $(am__tty_colors); $(am__set_TESTS_bases); \
+	ws='[ 	]'; \
+	results=`for b in $$bases; do echo $$b.trs; done`; \
+	test -n "$$results" || results=/dev/null; \
+	all=`  grep "^$$ws*:test-result:"           $$results | wc -l`; \
+	pass=` grep "^$$ws*:test-result:$$ws*PASS"  $$results | wc -l`; \
+	fail=` grep "^$$ws*:test-result:$$ws*FAIL"  $$results | wc -l`; \
+	skip=` grep "^$$ws*:test-result:$$ws*SKIP"  $$results | wc -l`; \
+	xfail=`grep "^$$ws*:test-result:$$ws*XFAIL" $$results | wc -l`; \
+	xpass=`grep "^$$ws*:test-result:$$ws*XPASS" $$results | wc -l`; \
+	error=`grep "^$$ws*:test-result:$$ws*ERROR" $$results | wc -l`; \
+	if test `expr $$fail + $$xpass + $$error` -eq 0; then \
+	  success=true; \
+	else \
+	  success=false; \
+	fi; \
+	br='==================='; br=$$br$$br$$br$$br; \
+	result_count () \
+	{ \
+	    if test x"$$1" = x"--maybe-color"; then \
+	      maybe_colorize=yes; \
+	    elif test x"$$1" = x"--no-color"; then \
+	      maybe_colorize=no; \
+	    else \
+	      echo "$@: invalid 'result_count' usage" >&2; exit 4; \
+	    fi; \
+	    shift; \
+	    desc=$$1 count=$$2; \
+	    if test $$maybe_colorize = yes && test $$count -gt 0; then \
+	      color_start=$$3 color_end=$$std; \
+	    else \
+	      color_start= color_end=; \
+	    fi; \
+	    echo "$${color_start}# $$desc $$count$${color_end}"; \
+	}; \
+	create_testsuite_report () \
+	{ \
+	  result_count $$1 "TOTAL:" $$all   "$$brg"; \
+	  result_count $$1 "PASS: " $$pass  "$$grn"; \
+	  result_count $$1 "SKIP: " $$skip  "$$blu"; \
+	  result_count $$1 "XFAIL:" $$xfail "$$lgn"; \
+	  result_count $$1 "FAIL: " $$fail  "$$red"; \
+	  result_count $$1 "XPASS:" $$xpass "$$red"; \
+	  result_count $$1 "ERROR:" $$error "$$mgn"; \
+	}; \
+	{								\
+	  echo "$(PACKAGE_STRING): $(subdir)/$(TEST_SUITE_LOG)" |	\
+	    $(am__rst_title);						\
+	  create_testsuite_report --no-color;				\
+	  echo;								\
+	  echo ".. contents:: :depth: 2";				\
+	  echo;								\
+	  for b in $$bases; do echo $$b; done				\
+	    | $(am__create_global_log);					\
+	} >$(TEST_SUITE_LOG).tmp || exit 1;				\
+	mv $(TEST_SUITE_LOG).tmp $(TEST_SUITE_LOG);			\
+	if $$success; then						\
+	  col="$$grn";							\
+	 else								\
+	  col="$$red";							\
+	  test x"$$VERBOSE" = x || cat $(TEST_SUITE_LOG);		\
+	fi;								\
+	echo "$${col}$$br$${std}"; 					\
+	echo "$${col}Testsuite summary for $(PACKAGE_STRING)$${std}";	\
+	echo "$${col}$$br$${std}"; 					\
+	create_testsuite_report --maybe-color;				\
+	echo "$$col$$br$$std";						\
+	if $$success; then :; else					\
+	  echo "$${col}See $(subdir)/$(TEST_SUITE_LOG)$${std}";		\
+	  if test -n "$(PACKAGE_BUGREPORT)"; then			\
+	    echo "$${col}Please report to $(PACKAGE_BUGREPORT)$${std}";	\
+	  fi;								\
+	  echo "$$col$$br$$std";					\
+	fi;								\
+	$$success || exit 1
+
+check-TESTS:
+	@list='$(RECHECK_LOGS)';           test -z "$$list" || rm -f $$list
+	@list='$(RECHECK_LOGS:.log=.trs)'; test -z "$$list" || rm -f $$list
+	@test -z "$(TEST_SUITE_LOG)" || rm -f $(TEST_SUITE_LOG)
+	@set +e; $(am__set_TESTS_bases); \
+	log_list=`for i in $$bases; do echo $$i.log; done`; \
+	trs_list=`for i in $$bases; do echo $$i.trs; done`; \
+	log_list=`echo $$log_list`; trs_list=`echo $$trs_list`; \
+	$(MAKE) $(AM_MAKEFLAGS) $(TEST_SUITE_LOG) TEST_LOGS="$$log_list"; \
+	exit $$?;
+recheck: all 
+	@test -z "$(TEST_SUITE_LOG)" || rm -f $(TEST_SUITE_LOG)
+	@set +e; $(am__set_TESTS_bases); \
+	bases=`for i in $$bases; do echo $$i; done \
+	         | $(am__list_recheck_tests)` || exit 1; \
+	log_list=`for i in $$bases; do echo $$i.log; done`; \
+	log_list=`echo $$log_list`; \
+	$(MAKE) $(AM_MAKEFLAGS) $(TEST_SUITE_LOG) \
+	        am__force_recheck=am--force-recheck \
+	        TEST_LOGS="$$log_list"; \
+	exit $$?
+run-suites.log: run-suites
+	@p='run-suites'; \
+	b='run-suites'; \
+	$(am__check_pre) $(LOG_DRIVER) --test-name "$$f" \
+	--log-file $$b.log --trs-file $$b.trs \
+	$(am__common_driver_flags) $(AM_LOG_DRIVER_FLAGS) $(LOG_DRIVER_FLAGS) -- $(LOG_COMPILE) \
+	"$$tst" $(AM_TESTS_FD_REDIRECT)
+.test.log:
+	@p='$<'; \
+	$(am__set_b); \
+	$(am__check_pre) $(TEST_LOG_DRIVER) --test-name "$$f" \
+	--log-file $$b.log --trs-file $$b.trs \
+	$(am__common_driver_flags) $(AM_TEST_LOG_DRIVER_FLAGS) $(TEST_LOG_DRIVER_FLAGS) -- $(TEST_LOG_COMPILE) \
+	"$$tst" $(AM_TESTS_FD_REDIRECT)
+ at am__EXEEXT_TRUE@.test$(EXEEXT).log:
+ at am__EXEEXT_TRUE@	@p='$<'; \
+ at am__EXEEXT_TRUE@	$(am__set_b); \
+ at am__EXEEXT_TRUE@	$(am__check_pre) $(TEST_LOG_DRIVER) --test-name "$$f" \
+ at am__EXEEXT_TRUE@	--log-file $$b.log --trs-file $$b.trs \
+ at am__EXEEXT_TRUE@	$(am__common_driver_flags) $(AM_TEST_LOG_DRIVER_FLAGS) $(TEST_LOG_DRIVER_FLAGS) -- $(TEST_LOG_COMPILE) \
+ at am__EXEEXT_TRUE@	"$$tst" $(AM_TESTS_FD_REDIRECT)
+
+distdir: $(DISTFILES)
+	@srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	list='$(DISTFILES)'; \
+	  dist_files=`for file in $$list; do echo $$file; done | \
+	  sed -e "s|^$$srcdirstrip/||;t" \
+	      -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+	case $$dist_files in \
+	  */*) $(MKDIR_P) `echo "$$dist_files" | \
+			   sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+			   sort -u` ;; \
+	esac; \
+	for file in $$dist_files; do \
+	  if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+	  if test -d $$d/$$file; then \
+	    dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+	    if test -d "$(distdir)/$$file"; then \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+	      cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+	  else \
+	    test -f "$(distdir)/$$file" \
+	    || cp -p $$d/$$file "$(distdir)/$$file" \
+	    || exit 1; \
+	  fi; \
+	done
+	@list='$(DIST_SUBDIRS)'; for subdir in $$list; do \
+	  if test "$$subdir" = .; then :; else \
+	    $(am__make_dryrun) \
+	      || test -d "$(distdir)/$$subdir" \
+	      || $(MKDIR_P) "$(distdir)/$$subdir" \
+	      || exit 1; \
+	    dir1=$$subdir; dir2="$(distdir)/$$subdir"; \
+	    $(am__relativize); \
+	    new_distdir=$$reldir; \
+	    dir1=$$subdir; dir2="$(top_distdir)"; \
+	    $(am__relativize); \
+	    new_top_distdir=$$reldir; \
+	    echo " (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) top_distdir="$$new_top_distdir" distdir="$$new_distdir" \\"; \
+	    echo "     am__remove_distdir=: am__skip_length_check=: am__skip_mode_fix=: distdir)"; \
+	    ($(am__cd) $$subdir && \
+	      $(MAKE) $(AM_MAKEFLAGS) \
+	        top_distdir="$$new_top_distdir" \
+	        distdir="$$new_distdir" \
+		am__remove_distdir=: \
+		am__skip_length_check=: \
+		am__skip_mode_fix=: \
+	        distdir) \
+	      || exit 1; \
+	  fi; \
+	done
+check-am: all-am
+	$(MAKE) $(AM_MAKEFLAGS) check-TESTS
+check: check-recursive
+all-am: Makefile
+installdirs: installdirs-recursive
+installdirs-am:
+install: install-recursive
+install-exec: install-exec-recursive
+install-data: install-data-recursive
+uninstall: uninstall-recursive
+
+install-am: all-am
+	@$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-recursive
+install-strip:
+	if test -z '$(STRIP)'; then \
+	  $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+	    install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+	      install; \
+	else \
+	  $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+	    install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+	    "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \
+	fi
+mostlyclean-generic:
+	-test -z "$(TEST_LOGS)" || rm -f $(TEST_LOGS)
+	-test -z "$(TEST_LOGS:.log=.trs)" || rm -f $(TEST_LOGS:.log=.trs)
+	-test -z "$(TEST_SUITE_LOG)" || rm -f $(TEST_SUITE_LOG)
+
+clean-generic:
+
+distclean-generic:
+	-test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+	-test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+
+maintainer-clean-generic:
+	@echo "This command is intended for maintainers to use"
+	@echo "it deletes files that may require special tools to rebuild."
+clean: clean-recursive
+
+clean-am: clean-generic clean-libtool clean-local mostlyclean-am
+
+distclean: distclean-recursive
+	-rm -f Makefile
+distclean-am: clean-am distclean-generic distclean-tags
+
+dvi: dvi-recursive
+
+dvi-am:
+
+html: html-recursive
+
+html-am:
+
+info: info-recursive
+
+info-am:
+
+install-data-am:
+
+install-dvi: install-dvi-recursive
+
+install-dvi-am:
+
+install-exec-am:
+
+install-html: install-html-recursive
+
+install-html-am:
+
+install-info: install-info-recursive
+
+install-info-am:
+
+install-man:
+
+install-pdf: install-pdf-recursive
+
+install-pdf-am:
+
+install-ps: install-ps-recursive
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-recursive
+	-rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-recursive
+
+mostlyclean-am: mostlyclean-generic mostlyclean-libtool
+
+pdf: pdf-recursive
+
+pdf-am:
+
+ps: ps-recursive
+
+ps-am:
+
+uninstall-am:
+
+.MAKE: $(am__recursive_targets) check-am install-am install-strip
+
+.PHONY: $(am__recursive_targets) CTAGS GTAGS TAGS all all-am check \
+	check-TESTS check-am clean clean-generic clean-libtool \
+	clean-local cscopelist-am ctags ctags-am distclean \
+	distclean-generic distclean-libtool distclean-tags distdir dvi \
+	dvi-am html html-am info info-am install install-am \
+	install-data install-data-am install-dvi install-dvi-am \
+	install-exec install-exec-am install-html install-html-am \
+	install-info install-info-am install-man install-pdf \
+	install-pdf-am install-ps install-ps-am install-strip \
+	installcheck installcheck-am installdirs installdirs-am \
+	maintainer-clean maintainer-clean-generic mostlyclean \
+	mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
+	recheck tags tags-am uninstall uninstall-am
+
+
+clean-local:
+	rm -rf logs
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:

Added: vendor/jansson/dist/test/bin/Makefile.am
===================================================================
--- vendor/jansson/dist/test/bin/Makefile.am	                        (rev 0)
+++ vendor/jansson/dist/test/bin/Makefile.am	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,5 @@
+check_PROGRAMS = json_process
+
+AM_CPPFLAGS = -I$(top_builddir)/src -I$(top_srcdir)/src
+LDFLAGS = -static  # for speed and Valgrind
+LDADD = $(top_builddir)/src/libjansson.la

Added: vendor/jansson/dist/test/bin/Makefile.in
===================================================================
--- vendor/jansson/dist/test/bin/Makefile.in	                        (rev 0)
+++ vendor/jansson/dist/test/bin/Makefile.in	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,571 @@
+# Makefile.in generated by automake 1.14.1 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994-2013 Free Software Foundation, Inc.
+
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+ at SET_MAKE@
+VPATH = @srcdir@
+am__is_gnu_make = test -n '$(MAKEFILE_LIST)' && test -n '$(MAKELEVEL)'
+am__make_running_with_option = \
+  case $${target_option-} in \
+      ?) ;; \
+      *) echo "am__make_running_with_option: internal error: invalid" \
+              "target option '$${target_option-}' specified" >&2; \
+         exit 1;; \
+  esac; \
+  has_opt=no; \
+  sane_makeflags=$$MAKEFLAGS; \
+  if $(am__is_gnu_make); then \
+    sane_makeflags=$$MFLAGS; \
+  else \
+    case $$MAKEFLAGS in \
+      *\\[\ \	]*) \
+        bs=\\; \
+        sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \
+          | sed "s/$$bs$$bs[$$bs $$bs	]*//g"`;; \
+    esac; \
+  fi; \
+  skip_next=no; \
+  strip_trailopt () \
+  { \
+    flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \
+  }; \
+  for flg in $$sane_makeflags; do \
+    test $$skip_next = yes && { skip_next=no; continue; }; \
+    case $$flg in \
+      *=*|--*) continue;; \
+        -*I) strip_trailopt 'I'; skip_next=yes;; \
+      -*I?*) strip_trailopt 'I';; \
+        -*O) strip_trailopt 'O'; skip_next=yes;; \
+      -*O?*) strip_trailopt 'O';; \
+        -*l) strip_trailopt 'l'; skip_next=yes;; \
+      -*l?*) strip_trailopt 'l';; \
+      -[dEDm]) skip_next=yes;; \
+      -[JT]) skip_next=yes;; \
+    esac; \
+    case $$flg in \
+      *$$target_option*) has_opt=yes; break;; \
+    esac; \
+  done; \
+  test $$has_opt = yes
+am__make_dryrun = (target_option=n; $(am__make_running_with_option))
+am__make_keepgoing = (target_option=k; $(am__make_running_with_option))
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+check_PROGRAMS = json_process$(EXEEXT)
+subdir = test/bin
+DIST_COMMON = $(srcdir)/Makefile.in $(srcdir)/Makefile.am \
+	$(top_srcdir)/depcomp
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+	$(ACLOCAL_M4)
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = $(top_builddir)/jansson_private_config.h
+CONFIG_CLEAN_FILES =
+CONFIG_CLEAN_VPATH_FILES =
+json_process_SOURCES = json_process.c
+json_process_OBJECTS = json_process.$(OBJEXT)
+json_process_LDADD = $(LDADD)
+json_process_DEPENDENCIES = $(top_builddir)/src/libjansson.la
+AM_V_lt = $(am__v_lt_ at AM_V@)
+am__v_lt_ = $(am__v_lt_ at AM_DEFAULT_V@)
+am__v_lt_0 = --silent
+am__v_lt_1 = 
+AM_V_P = $(am__v_P_ at AM_V@)
+am__v_P_ = $(am__v_P_ at AM_DEFAULT_V@)
+am__v_P_0 = false
+am__v_P_1 = :
+AM_V_GEN = $(am__v_GEN_ at AM_V@)
+am__v_GEN_ = $(am__v_GEN_ at AM_DEFAULT_V@)
+am__v_GEN_0 = @echo "  GEN     " $@;
+am__v_GEN_1 = 
+AM_V_at = $(am__v_at_ at AM_V@)
+am__v_at_ = $(am__v_at_ at AM_DEFAULT_V@)
+am__v_at_0 = @
+am__v_at_1 = 
+DEFAULT_INCLUDES = -I. at am__isrc@ -I$(top_builddir)
+depcomp = $(SHELL) $(top_srcdir)/depcomp
+am__depfiles_maybe = depfiles
+am__mv = mv -f
+COMPILE = $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) \
+	$(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) $(AM_V_lt) --tag=CC $(AM_LIBTOOLFLAGS) \
+	$(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) \
+	$(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) \
+	$(AM_CFLAGS) $(CFLAGS)
+AM_V_CC = $(am__v_CC_ at AM_V@)
+am__v_CC_ = $(am__v_CC_ at AM_DEFAULT_V@)
+am__v_CC_0 = @echo "  CC      " $@;
+am__v_CC_1 = 
+CCLD = $(CC)
+LINK = $(LIBTOOL) $(AM_V_lt) --tag=CC $(AM_LIBTOOLFLAGS) \
+	$(LIBTOOLFLAGS) --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) \
+	$(AM_LDFLAGS) $(LDFLAGS) -o $@
+AM_V_CCLD = $(am__v_CCLD_ at AM_V@)
+am__v_CCLD_ = $(am__v_CCLD_ at AM_DEFAULT_V@)
+am__v_CCLD_0 = @echo "  CCLD    " $@;
+am__v_CCLD_1 = 
+SOURCES = json_process.c
+DIST_SOURCES = json_process.c
+am__can_run_installinfo = \
+  case $$AM_UPDATE_INFO_DIR in \
+    n|no|NO) false;; \
+    *) (install-info --version) >/dev/null 2>&1;; \
+  esac
+am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP)
+# Read a list of newline-separated strings from the standard input,
+# and print each of them once, without duplicates.  Input order is
+# *not* preserved.
+am__uniquify_input = $(AWK) '\
+  BEGIN { nonempty = 0; } \
+  { items[$$0] = 1; nonempty = 1; } \
+  END { if (nonempty) { for (i in items) print i; }; } \
+'
+# Make sure the list of sources is unique.  This is necessary because,
+# e.g., the same source file might be shared among _SOURCES variables
+# for different programs/libraries.
+am__define_uniq_tagged_files = \
+  list='$(am__tagged_files)'; \
+  unique=`for i in $$list; do \
+    if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+  done | $(am__uniquify_input)`
+ETAGS = etags
+CTAGS = ctags
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AM_CFLAGS = @AM_CFLAGS@
+AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DLLTOOL = @DLLTOOL@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+GREP = @GREP@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+LD = @LD@
+LDFLAGS = -static  # for speed and Valgrind
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+MAKEINFO = @MAKEINFO@
+MANIFEST_TOOL = @MANIFEST_TOOL@
+MKDIR_P = @MKDIR_P@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_URL = @PACKAGE_URL@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+VERSION = @VERSION@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+json_have_localeconv = @json_have_localeconv@
+json_have_long_long = @json_have_long_long@
+json_inline = @json_inline@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+AM_CPPFLAGS = -I$(top_builddir)/src -I$(top_srcdir)/src
+LDADD = $(top_builddir)/src/libjansson.la
+all: all-am
+
+.SUFFIXES:
+.SUFFIXES: .c .lo .o .obj
+$(srcdir)/Makefile.in:  $(srcdir)/Makefile.am  $(am__configure_deps)
+	@for dep in $?; do \
+	  case '$(am__configure_deps)' in \
+	    *$$dep*) \
+	      ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \
+	        && { if test -f $@; then exit 0; else break; fi; }; \
+	      exit 1;; \
+	  esac; \
+	done; \
+	echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign test/bin/Makefile'; \
+	$(am__cd) $(top_srcdir) && \
+	  $(AUTOMAKE) --foreign test/bin/Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+	@case '$?' in \
+	  *config.status*) \
+	    cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
+	  *) \
+	    echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
+	    cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+	esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+
+$(top_srcdir)/configure:  $(am__configure_deps)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(ACLOCAL_M4):  $(am__aclocal_m4_deps)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(am__aclocal_m4_deps):
+
+clean-checkPROGRAMS:
+	@list='$(check_PROGRAMS)'; test -n "$$list" || exit 0; \
+	echo " rm -f" $$list; \
+	rm -f $$list || exit $$?; \
+	test -n "$(EXEEXT)" || exit 0; \
+	list=`for p in $$list; do echo "$$p"; done | sed 's/$(EXEEXT)$$//'`; \
+	echo " rm -f" $$list; \
+	rm -f $$list
+
+json_process$(EXEEXT): $(json_process_OBJECTS) $(json_process_DEPENDENCIES) $(EXTRA_json_process_DEPENDENCIES) 
+	@rm -f json_process$(EXEEXT)
+	$(AM_V_CCLD)$(LINK) $(json_process_OBJECTS) $(json_process_LDADD) $(LIBS)
+
+mostlyclean-compile:
+	-rm -f *.$(OBJEXT)
+
+distclean-compile:
+	-rm -f *.tab.c
+
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/json_process.Po at am__quote@
+
+.c.o:
+ at am__fastdepCC_TRUE@	$(AM_V_CC)$(COMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $<
+ at am__fastdepCC_TRUE@	$(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	$(AM_V_CC)source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+ at am__fastdepCC_FALSE@	$(AM_V_CC at am__nodep@)$(COMPILE) -c -o $@ $<
+
+.c.obj:
+ at am__fastdepCC_TRUE@	$(AM_V_CC)$(COMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ `$(CYGPATH_W) '$<'`
+ at am__fastdepCC_TRUE@	$(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	$(AM_V_CC)source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+ at am__fastdepCC_FALSE@	$(AM_V_CC at am__nodep@)$(COMPILE) -c -o $@ `$(CYGPATH_W) '$<'`
+
+.c.lo:
+ at am__fastdepCC_TRUE@	$(AM_V_CC)$(LTCOMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $<
+ at am__fastdepCC_TRUE@	$(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Plo
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	$(AM_V_CC)source='$<' object='$@' libtool=yes @AMDEPBACKSLASH@
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+ at am__fastdepCC_FALSE@	$(AM_V_CC at am__nodep@)$(LTCOMPILE) -c -o $@ $<
+
+mostlyclean-libtool:
+	-rm -f *.lo
+
+clean-libtool:
+	-rm -rf .libs _libs
+
+ID: $(am__tagged_files)
+	$(am__define_uniq_tagged_files); mkid -fID $$unique
+tags: tags-am
+TAGS: tags
+
+tags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+	set x; \
+	here=`pwd`; \
+	$(am__define_uniq_tagged_files); \
+	shift; \
+	if test -z "$(ETAGS_ARGS)$$*$$unique"; then :; else \
+	  test -n "$$unique" || unique=$$empty_fix; \
+	  if test $$# -gt 0; then \
+	    $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+	      "$$@" $$unique; \
+	  else \
+	    $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+	      $$unique; \
+	  fi; \
+	fi
+ctags: ctags-am
+
+CTAGS: ctags
+ctags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+	$(am__define_uniq_tagged_files); \
+	test -z "$(CTAGS_ARGS)$$unique" \
+	  || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \
+	     $$unique
+
+GTAGS:
+	here=`$(am__cd) $(top_builddir) && pwd` \
+	  && $(am__cd) $(top_srcdir) \
+	  && gtags -i $(GTAGS_ARGS) "$$here"
+cscopelist: cscopelist-am
+
+cscopelist-am: $(am__tagged_files)
+	list='$(am__tagged_files)'; \
+	case "$(srcdir)" in \
+	  [\\/]* | ?:[\\/]*) sdir="$(srcdir)" ;; \
+	  *) sdir=$(subdir)/$(srcdir) ;; \
+	esac; \
+	for i in $$list; do \
+	  if test -f "$$i"; then \
+	    echo "$(subdir)/$$i"; \
+	  else \
+	    echo "$$sdir/$$i"; \
+	  fi; \
+	done >> $(top_builddir)/cscope.files
+
+distclean-tags:
+	-rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
+
+distdir: $(DISTFILES)
+	@srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	list='$(DISTFILES)'; \
+	  dist_files=`for file in $$list; do echo $$file; done | \
+	  sed -e "s|^$$srcdirstrip/||;t" \
+	      -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+	case $$dist_files in \
+	  */*) $(MKDIR_P) `echo "$$dist_files" | \
+			   sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+			   sort -u` ;; \
+	esac; \
+	for file in $$dist_files; do \
+	  if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+	  if test -d $$d/$$file; then \
+	    dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+	    if test -d "$(distdir)/$$file"; then \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+	      cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+	  else \
+	    test -f "$(distdir)/$$file" \
+	    || cp -p $$d/$$file "$(distdir)/$$file" \
+	    || exit 1; \
+	  fi; \
+	done
+check-am: all-am
+	$(MAKE) $(AM_MAKEFLAGS) $(check_PROGRAMS)
+check: check-am
+all-am: Makefile
+installdirs:
+install: install-am
+install-exec: install-exec-am
+install-data: install-data-am
+uninstall: uninstall-am
+
+install-am: all-am
+	@$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-am
+install-strip:
+	if test -z '$(STRIP)'; then \
+	  $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+	    install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+	      install; \
+	else \
+	  $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+	    install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+	    "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \
+	fi
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+	-test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+	-test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+
+maintainer-clean-generic:
+	@echo "This command is intended for maintainers to use"
+	@echo "it deletes files that may require special tools to rebuild."
+clean: clean-am
+
+clean-am: clean-checkPROGRAMS clean-generic clean-libtool \
+	mostlyclean-am
+
+distclean: distclean-am
+	-rm -rf ./$(DEPDIR)
+	-rm -f Makefile
+distclean-am: clean-am distclean-compile distclean-generic \
+	distclean-tags
+
+dvi: dvi-am
+
+dvi-am:
+
+html: html-am
+
+html-am:
+
+info: info-am
+
+info-am:
+
+install-data-am:
+
+install-dvi: install-dvi-am
+
+install-dvi-am:
+
+install-exec-am:
+
+install-html: install-html-am
+
+install-html-am:
+
+install-info: install-info-am
+
+install-info-am:
+
+install-man:
+
+install-pdf: install-pdf-am
+
+install-pdf-am:
+
+install-ps: install-ps-am
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-am
+	-rm -rf ./$(DEPDIR)
+	-rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-am
+
+mostlyclean-am: mostlyclean-compile mostlyclean-generic \
+	mostlyclean-libtool
+
+pdf: pdf-am
+
+pdf-am:
+
+ps: ps-am
+
+ps-am:
+
+uninstall-am:
+
+.MAKE: check-am install-am install-strip
+
+.PHONY: CTAGS GTAGS TAGS all all-am check check-am clean \
+	clean-checkPROGRAMS clean-generic clean-libtool cscopelist-am \
+	ctags ctags-am distclean distclean-compile distclean-generic \
+	distclean-libtool distclean-tags distdir dvi dvi-am html \
+	html-am info info-am install install-am install-data \
+	install-data-am install-dvi install-dvi-am install-exec \
+	install-exec-am install-html install-html-am install-info \
+	install-info-am install-man install-pdf install-pdf-am \
+	install-ps install-ps-am install-strip installcheck \
+	installcheck-am installdirs maintainer-clean \
+	maintainer-clean-generic mostlyclean mostlyclean-compile \
+	mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
+	tags tags-am uninstall uninstall-am
+
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:

Added: vendor/jansson/dist/test/bin/json_process.c
===================================================================
--- vendor/jansson/dist/test/bin/json_process.c	                        (rev 0)
+++ vendor/jansson/dist/test/bin/json_process.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,385 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifdef HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <ctype.h>
+#include <jansson.h>
+
+#ifdef HAVE_LOCALE_H
+#include <locale.h>
+ #endif
+
+#if _WIN32
+#include <io.h>  /* for _setmode() */
+#include <fcntl.h>  /* for _O_BINARY */
+
+static const char dir_sep = '\\';
+#else
+static const char dir_sep = '/';
+#endif
+
+
+struct config {
+    int indent;
+    int compact;
+    int preserve_order;
+    int ensure_ascii;
+    int sort_keys;
+    int strip;
+    int use_env;
+    int have_hashseed;
+    int hashseed;
+    int precision;
+} conf;
+
+#define l_isspace(c) ((c) == ' ' || (c) == '\n' || (c) == '\r' || (c) == '\t')
+
+/* Return a pointer to the first non-whitespace character of str.
+   Modifies str so that all trailing whitespace characters are
+   replaced by '\0'. */
+static const char *strip(char *str)
+{
+    size_t length;
+    char *result = str;
+    while (*result && l_isspace(*result))
+        result++;
+
+    length = strlen(result);
+    if (length == 0)
+        return result;
+
+    while (l_isspace(result[length - 1]))
+        result[--length] = '\0';
+
+    return result;
+}
+
+
+static char *loadfile(FILE *file)
+{
+    long fsize, ret;
+    char *buf;
+
+    fseek(file, 0, SEEK_END);
+    fsize = ftell(file);
+    fseek(file, 0, SEEK_SET);
+
+    buf = malloc(fsize+1);
+    ret = fread(buf, 1, fsize, file);
+    if (ret != fsize)
+        exit(1);
+    buf[fsize] = '\0';
+
+    return buf;
+}
+
+
+static void read_conf(FILE *conffile)
+{
+    char *buffer, *line, *val;
+
+    buffer = loadfile(conffile);
+    for (line = strtok(buffer, "\r\n"); line; line = strtok(NULL, "\r\n")) {
+        if (!strncmp(line, "export ", 7))
+            continue;
+        val = strchr(line, '=');
+        if (!val) {
+            printf("invalid configuration line\n");
+            break;
+        }
+        *val++ = '\0';
+
+        if (!strcmp(line, "JSON_INDENT"))
+            conf.indent = atoi(val);
+        if (!strcmp(line, "JSON_COMPACT"))
+            conf.compact = atoi(val);
+        if (!strcmp(line, "JSON_ENSURE_ASCII"))
+            conf.ensure_ascii = atoi(val);
+        if (!strcmp(line, "JSON_PRESERVE_ORDER"))
+            conf.preserve_order = atoi(val);
+        if (!strcmp(line, "JSON_SORT_KEYS"))
+            conf.sort_keys = atoi(val);
+        if (!strcmp(line, "JSON_REAL_PRECISION"))
+            conf.precision = atoi(val);
+        if (!strcmp(line, "STRIP"))
+            conf.strip = atoi(val);
+        if (!strcmp(line, "HASHSEED")) {
+            conf.have_hashseed = 1;
+            conf.hashseed = atoi(val);
+        } else {
+            conf.have_hashseed = 0;
+        }
+    }
+
+    free(buffer);
+}
+
+
+static int cmpfile(const char *str, const char *path, const char *fname)
+{
+    char filename[1024], *buffer;
+    int ret;
+    FILE *file;
+
+    sprintf(filename, "%s%c%s", path, dir_sep, fname);
+    file = fopen(filename, "rb");
+    if (!file) {
+        if (conf.strip)
+            strcat(filename, ".strip");
+        else
+            strcat(filename, ".normal");
+        file = fopen(filename, "rb");
+    }
+    if (!file) {
+        printf("Error: test result file could not be opened.\n");
+        exit(1);
+    }
+
+    buffer = loadfile(file);
+    if (strcmp(buffer, str) != 0)
+        ret = 1;
+    else
+        ret = 0;
+    free(buffer);
+    fclose(file);
+
+    return ret;
+}
+
+int use_conf(char *test_path)
+{
+    int ret;
+    size_t flags = 0;
+    char filename[1024], errstr[1024];
+    char *buffer;
+    FILE *infile, *conffile;
+    json_t *json;
+    json_error_t error;
+
+    sprintf(filename, "%s%cinput", test_path, dir_sep);
+    if (!(infile = fopen(filename, "rb"))) {
+        fprintf(stderr, "Could not open \"%s\"\n", filename);
+        return 2;
+    }
+
+    sprintf(filename, "%s%cenv", test_path, dir_sep);
+    conffile = fopen(filename, "rb");
+    if (conffile) {
+        read_conf(conffile);
+        fclose(conffile);
+    }
+
+    if (conf.indent < 0 || conf.indent > 31) {
+        fprintf(stderr, "invalid value for JSON_INDENT: %d\n", conf.indent);
+        fclose(infile);
+        return 2;
+    }
+    if (conf.indent)
+        flags |= JSON_INDENT(conf.indent);
+
+    if (conf.compact)
+        flags |= JSON_COMPACT;
+
+    if (conf.ensure_ascii)
+        flags |= JSON_ENSURE_ASCII;
+
+    if (conf.preserve_order)
+        flags |= JSON_PRESERVE_ORDER;
+
+    if (conf.sort_keys)
+        flags |= JSON_SORT_KEYS;
+
+    if (conf.precision < 0 || conf.precision > 31) {
+        fprintf(stderr, "invalid value for JSON_REAL_PRECISION: %d\n",
+                conf.precision);
+        fclose(infile);
+        return 2;
+    }
+    if (conf.precision)
+        flags |= JSON_REAL_PRECISION(conf.precision);
+
+    if (conf.have_hashseed)
+        json_object_seed(conf.hashseed);
+
+    if (conf.strip) {
+        /* Load to memory, strip leading and trailing whitespace */
+        buffer = loadfile(infile);
+        json = json_loads(strip(buffer), 0, &error);
+        free(buffer);
+    }
+    else
+        json = json_loadf(infile, 0, &error);
+
+    fclose(infile);
+
+    if (!json) {
+        sprintf(errstr, "%d %d %d\n%s\n",
+                error.line, error.column, error.position,
+                error.text);
+
+        ret = cmpfile(errstr, test_path, "error");
+        return ret;
+    }
+
+    buffer = json_dumps(json, flags);
+    ret = cmpfile(buffer, test_path, "output");
+    free(buffer);
+    json_decref(json);
+
+    return ret;
+}
+
+static int getenv_int(const char *name)
+{
+    char *value, *end;
+    long result;
+
+    value = getenv(name);
+    if(!value)
+        return 0;
+
+    result = strtol(value, &end, 10);
+    if(*end != '\0')
+        return 0;
+
+    return (int)result;
+}
+
+int use_env()
+{
+    int indent, precision;
+    size_t flags = 0;
+    json_t *json;
+    json_error_t error;
+
+    #ifdef _WIN32
+    /* On Windows, set stdout and stderr to binary mode to avoid
+       outputting DOS line terminators */
+    _setmode(_fileno(stdout), _O_BINARY);
+    _setmode(_fileno(stderr), _O_BINARY);
+    #endif
+
+    indent = getenv_int("JSON_INDENT");
+    if(indent < 0 || indent > 31) {
+        fprintf(stderr, "invalid value for JSON_INDENT: %d\n", indent);
+        return 2;
+    }
+    if(indent > 0)
+        flags |= JSON_INDENT(indent);
+
+    if(getenv_int("JSON_COMPACT") > 0)
+        flags |= JSON_COMPACT;
+
+    if(getenv_int("JSON_ENSURE_ASCII"))
+        flags |= JSON_ENSURE_ASCII;
+
+    if(getenv_int("JSON_PRESERVE_ORDER"))
+        flags |= JSON_PRESERVE_ORDER;
+
+    if(getenv_int("JSON_SORT_KEYS"))
+        flags |= JSON_SORT_KEYS;
+
+    precision = getenv_int("JSON_REAL_PRECISION");
+    if(precision < 0 || precision > 31) {
+        fprintf(stderr, "invalid value for JSON_REAL_PRECISION: %d\n",
+                precision);
+        return 2;
+    }
+
+    if(getenv("HASHSEED"))
+        json_object_seed(getenv_int("HASHSEED"));
+
+    if(precision > 0)
+        flags |= JSON_REAL_PRECISION(precision);
+
+    if(getenv_int("STRIP")) {
+        /* Load to memory, strip leading and trailing whitespace */
+        size_t size = 0, used = 0;
+        char *buffer = NULL, *buf_ck = NULL;
+
+        while(1) {
+            size_t count;
+
+            size = (size == 0 ? 128 : size * 2);
+            buf_ck = realloc(buffer, size);
+            if(!buf_ck) {
+                fprintf(stderr, "Unable to allocate %d bytes\n", (int)size);
+                free(buffer);
+                return 1;
+            }
+            buffer = buf_ck;
+
+            count = fread(buffer + used, 1, size - used, stdin);
+            if(count < size - used) {
+                buffer[used + count] = '\0';
+                break;
+            }
+            used += count;
+        }
+
+        json = json_loads(strip(buffer), 0, &error);
+        free(buffer);
+    }
+    else
+        json = json_loadf(stdin, 0, &error);
+
+    if(!json) {
+        fprintf(stderr, "%d %d %d\n%s\n",
+            error.line, error.column,
+            error.position, error.text);
+        return 1;
+    }
+
+    json_dumpf(json, stdout, flags);
+    json_decref(json);
+
+    return 0;
+}
+
+int main(int argc, char *argv[])
+{
+    int i;
+    char *test_path = NULL;
+
+    #ifdef HAVE_SETLOCALE
+    setlocale(LC_ALL, "");
+    #endif
+
+    if (argc < 2) {
+        goto usage;
+    }
+
+    for (i = 1; i < argc; i++) {
+        if (!strcmp(argv[i], "--strip"))
+            conf.strip = 1;
+        else if (!strcmp(argv[i], "--env"))
+            conf.use_env = 1;
+        else
+            test_path = argv[i];
+    }
+
+    if (conf.use_env)
+        return use_env();
+    else
+    {
+        if (!test_path)
+            goto usage;
+
+        return use_conf(test_path);
+    }
+
+usage:
+    fprintf(stderr, "argc =%d\n", argc);
+    fprintf(stderr, "usage: %s [--strip] [--env] test_dir\n", argv[0]);
+    return 2;
+}

Added: vendor/jansson/dist/test/run-suites
===================================================================
--- vendor/jansson/dist/test/run-suites	                        (rev 0)
+++ vendor/jansson/dist/test/run-suites	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,50 @@
+#!/bin/sh
+
+while [ -n "$1" ]; do
+    suite=$1
+    if [ -x $top_srcdir/test/suites/$suite/run ]; then
+        SUITES="$SUITES $suite"
+    else
+        echo "No such suite: $suite"
+        exit 1
+    fi
+    shift
+done
+
+if [ -z "$SUITES" ]; then
+    suitedirs=$top_srcdir/test/suites/*
+    for suitedir in $suitedirs; do
+        if [ -d $suitedir ]; then
+            SUITES="$SUITES `basename $suitedir`"
+        fi
+    done
+fi
+
+[ -z "$STOP" ] && STOP=0
+
+suites_srcdir=$top_srcdir/test/suites
+suites_builddir=suites
+scriptdir=$top_srcdir/test/scripts
+logdir=logs
+bindir=bin
+export suites_srcdir suites_builddir scriptdir logdir bindir
+
+passed=0
+failed=0
+for suite in $SUITES; do
+    echo "Suite: $suite"
+    if $suites_srcdir/$suite/run $suite; then
+        passed=$(($passed+1))
+    else
+        failed=$(($failed+1))
+        [ $STOP -eq 1 ] && break
+    fi
+done
+
+if [ $failed -gt 0 ]; then
+    echo "$failed of $((passed+failed)) test suites failed"
+    exit 1
+else
+    echo "$passed test suites passed"
+    rm -rf $logdir
+fi

Added: vendor/jansson/dist/test/scripts/run-tests.sh
===================================================================
--- vendor/jansson/dist/test/scripts/run-tests.sh	                        (rev 0)
+++ vendor/jansson/dist/test/scripts/run-tests.sh	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,100 @@
+# Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+#
+# Jansson is free software; you can redistribute it and/or modify
+# it under the terms of the MIT license. See LICENSE for details.
+
+die() {
+    echo "$1" >&2
+    exit 1
+}
+
+[ -n "$1" ] || die "Usage: $0 suite-name"
+[ -n "$bindir" ] || die "Set bindir"
+[ -n "$logdir" ] || die "Set logdir"
+[ -n "$scriptdir" ] || die "Set scriptdir"
+[ -n "$suites_srcdir" ] || die "Set suites_srcdir"
+[ -n "$suites_builddir" ] || die "Set suites_builddir"
+
+json_process=$bindir/json_process
+
+suite_name=$1
+suite_srcdir=$suites_srcdir/$suite_name
+suite_builddir=$suites_builddir/$suite_name
+suite_log=$logdir/$suite_name
+
+[ -z "$VERBOSE" ] && VERBOSE=0
+[ -z "$STOP" ] && STOP=0
+
+. $scriptdir/valgrind.sh
+
+rm -rf $suite_log
+mkdir -p $suite_log
+
+for test_path in $suite_srcdir/*; do
+    test_name=$(basename $test_path)
+    test_builddir=$suite_builddir/$test_name
+    test_log=$suite_log/$test_name
+
+    [ "$test_name" = "run" ] && continue
+    is_test || continue
+
+    rm -rf $test_log
+    mkdir -p $test_log
+    if [ $VERBOSE -eq 1 ]; then
+        printf '%s... ' "$test_name"
+    fi
+
+    run_test
+    case $? in
+        0)
+            # Success
+            if [ $VERBOSE -eq 1 ]; then
+                printf 'ok\n'
+            else
+                printf '.'
+            fi
+            rm -rf $test_log
+            ;;
+
+        77)
+            # Skip
+            if [ $VERBOSE -eq 1 ]; then
+                printf 'skipped\n'
+            else
+                printf 'S'
+            fi
+            rm -rf $test_log
+            ;;
+
+        *)
+            # Failure
+            if [ $VERBOSE -eq 1 ]; then
+                printf 'FAILED\n'
+            else
+                printf 'F'
+            fi
+
+            [ $STOP -eq 1 ] && break
+            ;;
+    esac
+done
+
+if [ $VERBOSE -eq 0 ]; then
+    printf '\n'
+fi
+
+if [ -n "$(ls -A $suite_log)" ]; then
+    for test_log in $suite_log/*; do
+        test_name=$(basename $test_log)
+        test_path=$suite_srcdir/$test_name
+        echo "================================================================="
+        echo "$suite_name/$test_name"
+        echo "================================================================="
+        show_error
+        echo
+    done
+    echo "================================================================="
+    exit 1
+else
+    rm -rf $suite_log
+fi

Added: vendor/jansson/dist/test/scripts/valgrind.sh
===================================================================
--- vendor/jansson/dist/test/scripts/valgrind.sh	                        (rev 0)
+++ vendor/jansson/dist/test/scripts/valgrind.sh	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,35 @@
+# Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+#
+# Jansson is free software; you can redistribute it and/or modify
+# it under the terms of the MIT license. See LICENSE for details.
+
+[ -z "$VALGRIND" ] && VALGRIND=0
+
+VALGRIND_CMDLINE="valgrind --leak-check=full --show-reachable=yes --track-origins=yes -q"
+
+if [ $VALGRIND -eq 1 ]; then
+    test_runner="$VALGRIND_CMDLINE"
+    json_process="$VALGRIND_CMDLINE $json_process"
+else
+    test_runner=""
+fi
+
+valgrind_check() {
+    if [ $VALGRIND -eq 1 ]; then
+        # Check for Valgrind error output. The valgrind option
+        # --error-exitcode is not enough because Valgrind doesn't
+        # think unfreed allocs are errors.
+        if grep -E -q '^==[0-9]+== ' $1; then
+            touch $test_log/valgrind_error
+            return 1
+        fi
+    fi
+}
+
+valgrind_show_error() {
+    if [ $VALGRIND -eq 1 -a -f $test_log/valgrind_error ]; then
+        echo "valgrind detected an error"
+        return 0
+    fi
+    return 1
+}

Added: vendor/jansson/dist/test/suites/Makefile.am
===================================================================
--- vendor/jansson/dist/test/suites/Makefile.am	                        (rev 0)
+++ vendor/jansson/dist/test/suites/Makefile.am	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+SUBDIRS = api
+EXTRA_DIST = invalid invalid-unicode valid

Added: vendor/jansson/dist/test/suites/Makefile.in
===================================================================
--- vendor/jansson/dist/test/suites/Makefile.in	                        (rev 0)
+++ vendor/jansson/dist/test/suites/Makefile.in	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,604 @@
+# Makefile.in generated by automake 1.14.1 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994-2013 Free Software Foundation, Inc.
+
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+ at SET_MAKE@
+VPATH = @srcdir@
+am__is_gnu_make = test -n '$(MAKEFILE_LIST)' && test -n '$(MAKELEVEL)'
+am__make_running_with_option = \
+  case $${target_option-} in \
+      ?) ;; \
+      *) echo "am__make_running_with_option: internal error: invalid" \
+              "target option '$${target_option-}' specified" >&2; \
+         exit 1;; \
+  esac; \
+  has_opt=no; \
+  sane_makeflags=$$MAKEFLAGS; \
+  if $(am__is_gnu_make); then \
+    sane_makeflags=$$MFLAGS; \
+  else \
+    case $$MAKEFLAGS in \
+      *\\[\ \	]*) \
+        bs=\\; \
+        sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \
+          | sed "s/$$bs$$bs[$$bs $$bs	]*//g"`;; \
+    esac; \
+  fi; \
+  skip_next=no; \
+  strip_trailopt () \
+  { \
+    flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \
+  }; \
+  for flg in $$sane_makeflags; do \
+    test $$skip_next = yes && { skip_next=no; continue; }; \
+    case $$flg in \
+      *=*|--*) continue;; \
+        -*I) strip_trailopt 'I'; skip_next=yes;; \
+      -*I?*) strip_trailopt 'I';; \
+        -*O) strip_trailopt 'O'; skip_next=yes;; \
+      -*O?*) strip_trailopt 'O';; \
+        -*l) strip_trailopt 'l'; skip_next=yes;; \
+      -*l?*) strip_trailopt 'l';; \
+      -[dEDm]) skip_next=yes;; \
+      -[JT]) skip_next=yes;; \
+    esac; \
+    case $$flg in \
+      *$$target_option*) has_opt=yes; break;; \
+    esac; \
+  done; \
+  test $$has_opt = yes
+am__make_dryrun = (target_option=n; $(am__make_running_with_option))
+am__make_keepgoing = (target_option=k; $(am__make_running_with_option))
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+subdir = test/suites
+DIST_COMMON = $(srcdir)/Makefile.in $(srcdir)/Makefile.am
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+	$(ACLOCAL_M4)
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = $(top_builddir)/jansson_private_config.h
+CONFIG_CLEAN_FILES =
+CONFIG_CLEAN_VPATH_FILES =
+AM_V_P = $(am__v_P_ at AM_V@)
+am__v_P_ = $(am__v_P_ at AM_DEFAULT_V@)
+am__v_P_0 = false
+am__v_P_1 = :
+AM_V_GEN = $(am__v_GEN_ at AM_V@)
+am__v_GEN_ = $(am__v_GEN_ at AM_DEFAULT_V@)
+am__v_GEN_0 = @echo "  GEN     " $@;
+am__v_GEN_1 = 
+AM_V_at = $(am__v_at_ at AM_V@)
+am__v_at_ = $(am__v_at_ at AM_DEFAULT_V@)
+am__v_at_0 = @
+am__v_at_1 = 
+SOURCES =
+DIST_SOURCES =
+RECURSIVE_TARGETS = all-recursive check-recursive cscopelist-recursive \
+	ctags-recursive dvi-recursive html-recursive info-recursive \
+	install-data-recursive install-dvi-recursive \
+	install-exec-recursive install-html-recursive \
+	install-info-recursive install-pdf-recursive \
+	install-ps-recursive install-recursive installcheck-recursive \
+	installdirs-recursive pdf-recursive ps-recursive \
+	tags-recursive uninstall-recursive
+am__can_run_installinfo = \
+  case $$AM_UPDATE_INFO_DIR in \
+    n|no|NO) false;; \
+    *) (install-info --version) >/dev/null 2>&1;; \
+  esac
+RECURSIVE_CLEAN_TARGETS = mostlyclean-recursive clean-recursive	\
+  distclean-recursive maintainer-clean-recursive
+am__recursive_targets = \
+  $(RECURSIVE_TARGETS) \
+  $(RECURSIVE_CLEAN_TARGETS) \
+  $(am__extra_recursive_targets)
+AM_RECURSIVE_TARGETS = $(am__recursive_targets:-recursive=) TAGS CTAGS \
+	distdir
+am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP)
+# Read a list of newline-separated strings from the standard input,
+# and print each of them once, without duplicates.  Input order is
+# *not* preserved.
+am__uniquify_input = $(AWK) '\
+  BEGIN { nonempty = 0; } \
+  { items[$$0] = 1; nonempty = 1; } \
+  END { if (nonempty) { for (i in items) print i; }; } \
+'
+# Make sure the list of sources is unique.  This is necessary because,
+# e.g., the same source file might be shared among _SOURCES variables
+# for different programs/libraries.
+am__define_uniq_tagged_files = \
+  list='$(am__tagged_files)'; \
+  unique=`for i in $$list; do \
+    if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+  done | $(am__uniquify_input)`
+ETAGS = etags
+CTAGS = ctags
+DIST_SUBDIRS = $(SUBDIRS)
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+am__relativize = \
+  dir0=`pwd`; \
+  sed_first='s,^\([^/]*\)/.*$$,\1,'; \
+  sed_rest='s,^[^/]*/*,,'; \
+  sed_last='s,^.*/\([^/]*\)$$,\1,'; \
+  sed_butlast='s,/*[^/]*$$,,'; \
+  while test -n "$$dir1"; do \
+    first=`echo "$$dir1" | sed -e "$$sed_first"`; \
+    if test "$$first" != "."; then \
+      if test "$$first" = ".."; then \
+        dir2=`echo "$$dir0" | sed -e "$$sed_last"`/"$$dir2"; \
+        dir0=`echo "$$dir0" | sed -e "$$sed_butlast"`; \
+      else \
+        first2=`echo "$$dir2" | sed -e "$$sed_first"`; \
+        if test "$$first2" = "$$first"; then \
+          dir2=`echo "$$dir2" | sed -e "$$sed_rest"`; \
+        else \
+          dir2="../$$dir2"; \
+        fi; \
+        dir0="$$dir0"/"$$first"; \
+      fi; \
+    fi; \
+    dir1=`echo "$$dir1" | sed -e "$$sed_rest"`; \
+  done; \
+  reldir="$$dir2"
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AM_CFLAGS = @AM_CFLAGS@
+AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DLLTOOL = @DLLTOOL@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+GREP = @GREP@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+LD = @LD@
+LDFLAGS = @LDFLAGS@
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+MAKEINFO = @MAKEINFO@
+MANIFEST_TOOL = @MANIFEST_TOOL@
+MKDIR_P = @MKDIR_P@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_URL = @PACKAGE_URL@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+VERSION = @VERSION@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+json_have_localeconv = @json_have_localeconv@
+json_have_long_long = @json_have_long_long@
+json_inline = @json_inline@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+SUBDIRS = api
+EXTRA_DIST = invalid invalid-unicode valid
+all: all-recursive
+
+.SUFFIXES:
+$(srcdir)/Makefile.in:  $(srcdir)/Makefile.am  $(am__configure_deps)
+	@for dep in $?; do \
+	  case '$(am__configure_deps)' in \
+	    *$$dep*) \
+	      ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \
+	        && { if test -f $@; then exit 0; else break; fi; }; \
+	      exit 1;; \
+	  esac; \
+	done; \
+	echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign test/suites/Makefile'; \
+	$(am__cd) $(top_srcdir) && \
+	  $(AUTOMAKE) --foreign test/suites/Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+	@case '$?' in \
+	  *config.status*) \
+	    cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
+	  *) \
+	    echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
+	    cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+	esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+
+$(top_srcdir)/configure:  $(am__configure_deps)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(ACLOCAL_M4):  $(am__aclocal_m4_deps)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(am__aclocal_m4_deps):
+
+mostlyclean-libtool:
+	-rm -f *.lo
+
+clean-libtool:
+	-rm -rf .libs _libs
+
+# This directory's subdirectories are mostly independent; you can cd
+# into them and run 'make' without going through this Makefile.
+# To change the values of 'make' variables: instead of editing Makefiles,
+# (1) if the variable is set in 'config.status', edit 'config.status'
+#     (which will cause the Makefiles to be regenerated when you run 'make');
+# (2) otherwise, pass the desired values on the 'make' command line.
+$(am__recursive_targets):
+	@fail=; \
+	if $(am__make_keepgoing); then \
+	  failcom='fail=yes'; \
+	else \
+	  failcom='exit 1'; \
+	fi; \
+	dot_seen=no; \
+	target=`echo $@ | sed s/-recursive//`; \
+	case "$@" in \
+	  distclean-* | maintainer-clean-*) list='$(DIST_SUBDIRS)' ;; \
+	  *) list='$(SUBDIRS)' ;; \
+	esac; \
+	for subdir in $$list; do \
+	  echo "Making $$target in $$subdir"; \
+	  if test "$$subdir" = "."; then \
+	    dot_seen=yes; \
+	    local_target="$$target-am"; \
+	  else \
+	    local_target="$$target"; \
+	  fi; \
+	  ($(am__cd) $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$local_target) \
+	  || eval $$failcom; \
+	done; \
+	if test "$$dot_seen" = "no"; then \
+	  $(MAKE) $(AM_MAKEFLAGS) "$$target-am" || exit 1; \
+	fi; test -z "$$fail"
+
+ID: $(am__tagged_files)
+	$(am__define_uniq_tagged_files); mkid -fID $$unique
+tags: tags-recursive
+TAGS: tags
+
+tags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+	set x; \
+	here=`pwd`; \
+	if ($(ETAGS) --etags-include --version) >/dev/null 2>&1; then \
+	  include_option=--etags-include; \
+	  empty_fix=.; \
+	else \
+	  include_option=--include; \
+	  empty_fix=; \
+	fi; \
+	list='$(SUBDIRS)'; for subdir in $$list; do \
+	  if test "$$subdir" = .; then :; else \
+	    test ! -f $$subdir/TAGS || \
+	      set "$$@" "$$include_option=$$here/$$subdir/TAGS"; \
+	  fi; \
+	done; \
+	$(am__define_uniq_tagged_files); \
+	shift; \
+	if test -z "$(ETAGS_ARGS)$$*$$unique"; then :; else \
+	  test -n "$$unique" || unique=$$empty_fix; \
+	  if test $$# -gt 0; then \
+	    $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+	      "$$@" $$unique; \
+	  else \
+	    $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+	      $$unique; \
+	  fi; \
+	fi
+ctags: ctags-recursive
+
+CTAGS: ctags
+ctags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+	$(am__define_uniq_tagged_files); \
+	test -z "$(CTAGS_ARGS)$$unique" \
+	  || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \
+	     $$unique
+
+GTAGS:
+	here=`$(am__cd) $(top_builddir) && pwd` \
+	  && $(am__cd) $(top_srcdir) \
+	  && gtags -i $(GTAGS_ARGS) "$$here"
+cscopelist: cscopelist-recursive
+
+cscopelist-am: $(am__tagged_files)
+	list='$(am__tagged_files)'; \
+	case "$(srcdir)" in \
+	  [\\/]* | ?:[\\/]*) sdir="$(srcdir)" ;; \
+	  *) sdir=$(subdir)/$(srcdir) ;; \
+	esac; \
+	for i in $$list; do \
+	  if test -f "$$i"; then \
+	    echo "$(subdir)/$$i"; \
+	  else \
+	    echo "$$sdir/$$i"; \
+	  fi; \
+	done >> $(top_builddir)/cscope.files
+
+distclean-tags:
+	-rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
+
+distdir: $(DISTFILES)
+	@srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	list='$(DISTFILES)'; \
+	  dist_files=`for file in $$list; do echo $$file; done | \
+	  sed -e "s|^$$srcdirstrip/||;t" \
+	      -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+	case $$dist_files in \
+	  */*) $(MKDIR_P) `echo "$$dist_files" | \
+			   sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+			   sort -u` ;; \
+	esac; \
+	for file in $$dist_files; do \
+	  if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+	  if test -d $$d/$$file; then \
+	    dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+	    if test -d "$(distdir)/$$file"; then \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+	      cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+	  else \
+	    test -f "$(distdir)/$$file" \
+	    || cp -p $$d/$$file "$(distdir)/$$file" \
+	    || exit 1; \
+	  fi; \
+	done
+	@list='$(DIST_SUBDIRS)'; for subdir in $$list; do \
+	  if test "$$subdir" = .; then :; else \
+	    $(am__make_dryrun) \
+	      || test -d "$(distdir)/$$subdir" \
+	      || $(MKDIR_P) "$(distdir)/$$subdir" \
+	      || exit 1; \
+	    dir1=$$subdir; dir2="$(distdir)/$$subdir"; \
+	    $(am__relativize); \
+	    new_distdir=$$reldir; \
+	    dir1=$$subdir; dir2="$(top_distdir)"; \
+	    $(am__relativize); \
+	    new_top_distdir=$$reldir; \
+	    echo " (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) top_distdir="$$new_top_distdir" distdir="$$new_distdir" \\"; \
+	    echo "     am__remove_distdir=: am__skip_length_check=: am__skip_mode_fix=: distdir)"; \
+	    ($(am__cd) $$subdir && \
+	      $(MAKE) $(AM_MAKEFLAGS) \
+	        top_distdir="$$new_top_distdir" \
+	        distdir="$$new_distdir" \
+		am__remove_distdir=: \
+		am__skip_length_check=: \
+		am__skip_mode_fix=: \
+	        distdir) \
+	      || exit 1; \
+	  fi; \
+	done
+check-am: all-am
+check: check-recursive
+all-am: Makefile
+installdirs: installdirs-recursive
+installdirs-am:
+install: install-recursive
+install-exec: install-exec-recursive
+install-data: install-data-recursive
+uninstall: uninstall-recursive
+
+install-am: all-am
+	@$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-recursive
+install-strip:
+	if test -z '$(STRIP)'; then \
+	  $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+	    install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+	      install; \
+	else \
+	  $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+	    install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+	    "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \
+	fi
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+	-test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+	-test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+
+maintainer-clean-generic:
+	@echo "This command is intended for maintainers to use"
+	@echo "it deletes files that may require special tools to rebuild."
+clean: clean-recursive
+
+clean-am: clean-generic clean-libtool mostlyclean-am
+
+distclean: distclean-recursive
+	-rm -f Makefile
+distclean-am: clean-am distclean-generic distclean-tags
+
+dvi: dvi-recursive
+
+dvi-am:
+
+html: html-recursive
+
+html-am:
+
+info: info-recursive
+
+info-am:
+
+install-data-am:
+
+install-dvi: install-dvi-recursive
+
+install-dvi-am:
+
+install-exec-am:
+
+install-html: install-html-recursive
+
+install-html-am:
+
+install-info: install-info-recursive
+
+install-info-am:
+
+install-man:
+
+install-pdf: install-pdf-recursive
+
+install-pdf-am:
+
+install-ps: install-ps-recursive
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-recursive
+	-rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-recursive
+
+mostlyclean-am: mostlyclean-generic mostlyclean-libtool
+
+pdf: pdf-recursive
+
+pdf-am:
+
+ps: ps-recursive
+
+ps-am:
+
+uninstall-am:
+
+.MAKE: $(am__recursive_targets) install-am install-strip
+
+.PHONY: $(am__recursive_targets) CTAGS GTAGS TAGS all all-am check \
+	check-am clean clean-generic clean-libtool cscopelist-am ctags \
+	ctags-am distclean distclean-generic distclean-libtool \
+	distclean-tags distdir dvi dvi-am html html-am info info-am \
+	install install-am install-data install-data-am install-dvi \
+	install-dvi-am install-exec install-exec-am install-html \
+	install-html-am install-info install-info-am install-man \
+	install-pdf install-pdf-am install-ps install-ps-am \
+	install-strip installcheck installcheck-am installdirs \
+	installdirs-am maintainer-clean maintainer-clean-generic \
+	mostlyclean mostlyclean-generic mostlyclean-libtool pdf pdf-am \
+	ps ps-am tags tags-am uninstall uninstall-am
+
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:

Added: vendor/jansson/dist/test/suites/api/Makefile.am
===================================================================
--- vendor/jansson/dist/test/suites/api/Makefile.am	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/Makefile.am	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,34 @@
+EXTRA_DIST = run check-exports
+
+check_PROGRAMS = \
+	test_array \
+	test_copy \
+	test_dump \
+	test_dump_callback \
+	test_equal \
+	test_load \
+	test_loadb \
+	test_load_callback \
+	test_memory_funcs \
+	test_number \
+	test_object \
+	test_pack \
+	test_simple \
+	test_unpack
+
+test_array_SOURCES = test_array.c util.h
+test_copy_SOURCES = test_copy.c util.h
+test_dump_SOURCES = test_dump.c util.h
+test_dump_callback_SOURCES = test_dump_callback.c util.h
+test_load_SOURCES = test_load.c util.h
+test_loadb_SOURCES = test_loadb.c util.h
+test_memory_funcs_SOURCES = test_memory_funcs.c util.h
+test_number_SOURCES = test_number.c util.h
+test_object_SOURCES = test_object.c util.h
+test_pack_SOURCES = test_pack.c util.h
+test_simple_SOURCES = test_simple.c util.h
+test_unpack_SOURCES = test_unpack.c util.h
+
+AM_CPPFLAGS = -I$(top_builddir)/src -I$(top_srcdir)/src
+LDFLAGS = -static  # for speed and Valgrind
+LDADD = $(top_builddir)/src/libjansson.la

Added: vendor/jansson/dist/test/suites/api/Makefile.in
===================================================================
--- vendor/jansson/dist/test/suites/api/Makefile.in	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/Makefile.in	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,718 @@
+# Makefile.in generated by automake 1.14.1 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994-2013 Free Software Foundation, Inc.
+
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+ at SET_MAKE@
+VPATH = @srcdir@
+am__is_gnu_make = test -n '$(MAKEFILE_LIST)' && test -n '$(MAKELEVEL)'
+am__make_running_with_option = \
+  case $${target_option-} in \
+      ?) ;; \
+      *) echo "am__make_running_with_option: internal error: invalid" \
+              "target option '$${target_option-}' specified" >&2; \
+         exit 1;; \
+  esac; \
+  has_opt=no; \
+  sane_makeflags=$$MAKEFLAGS; \
+  if $(am__is_gnu_make); then \
+    sane_makeflags=$$MFLAGS; \
+  else \
+    case $$MAKEFLAGS in \
+      *\\[\ \	]*) \
+        bs=\\; \
+        sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \
+          | sed "s/$$bs$$bs[$$bs $$bs	]*//g"`;; \
+    esac; \
+  fi; \
+  skip_next=no; \
+  strip_trailopt () \
+  { \
+    flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \
+  }; \
+  for flg in $$sane_makeflags; do \
+    test $$skip_next = yes && { skip_next=no; continue; }; \
+    case $$flg in \
+      *=*|--*) continue;; \
+        -*I) strip_trailopt 'I'; skip_next=yes;; \
+      -*I?*) strip_trailopt 'I';; \
+        -*O) strip_trailopt 'O'; skip_next=yes;; \
+      -*O?*) strip_trailopt 'O';; \
+        -*l) strip_trailopt 'l'; skip_next=yes;; \
+      -*l?*) strip_trailopt 'l';; \
+      -[dEDm]) skip_next=yes;; \
+      -[JT]) skip_next=yes;; \
+    esac; \
+    case $$flg in \
+      *$$target_option*) has_opt=yes; break;; \
+    esac; \
+  done; \
+  test $$has_opt = yes
+am__make_dryrun = (target_option=n; $(am__make_running_with_option))
+am__make_keepgoing = (target_option=k; $(am__make_running_with_option))
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+check_PROGRAMS = test_array$(EXEEXT) test_copy$(EXEEXT) \
+	test_dump$(EXEEXT) test_dump_callback$(EXEEXT) \
+	test_equal$(EXEEXT) test_load$(EXEEXT) test_loadb$(EXEEXT) \
+	test_load_callback$(EXEEXT) test_memory_funcs$(EXEEXT) \
+	test_number$(EXEEXT) test_object$(EXEEXT) test_pack$(EXEEXT) \
+	test_simple$(EXEEXT) test_unpack$(EXEEXT)
+subdir = test/suites/api
+DIST_COMMON = $(srcdir)/Makefile.in $(srcdir)/Makefile.am \
+	$(top_srcdir)/depcomp
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+	$(ACLOCAL_M4)
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = $(top_builddir)/jansson_private_config.h
+CONFIG_CLEAN_FILES =
+CONFIG_CLEAN_VPATH_FILES =
+am_test_array_OBJECTS = test_array.$(OBJEXT)
+test_array_OBJECTS = $(am_test_array_OBJECTS)
+test_array_LDADD = $(LDADD)
+test_array_DEPENDENCIES = $(top_builddir)/src/libjansson.la
+AM_V_lt = $(am__v_lt_ at AM_V@)
+am__v_lt_ = $(am__v_lt_ at AM_DEFAULT_V@)
+am__v_lt_0 = --silent
+am__v_lt_1 = 
+am_test_copy_OBJECTS = test_copy.$(OBJEXT)
+test_copy_OBJECTS = $(am_test_copy_OBJECTS)
+test_copy_LDADD = $(LDADD)
+test_copy_DEPENDENCIES = $(top_builddir)/src/libjansson.la
+am_test_dump_OBJECTS = test_dump.$(OBJEXT)
+test_dump_OBJECTS = $(am_test_dump_OBJECTS)
+test_dump_LDADD = $(LDADD)
+test_dump_DEPENDENCIES = $(top_builddir)/src/libjansson.la
+am_test_dump_callback_OBJECTS = test_dump_callback.$(OBJEXT)
+test_dump_callback_OBJECTS = $(am_test_dump_callback_OBJECTS)
+test_dump_callback_LDADD = $(LDADD)
+test_dump_callback_DEPENDENCIES = $(top_builddir)/src/libjansson.la
+test_equal_SOURCES = test_equal.c
+test_equal_OBJECTS = test_equal.$(OBJEXT)
+test_equal_LDADD = $(LDADD)
+test_equal_DEPENDENCIES = $(top_builddir)/src/libjansson.la
+am_test_load_OBJECTS = test_load.$(OBJEXT)
+test_load_OBJECTS = $(am_test_load_OBJECTS)
+test_load_LDADD = $(LDADD)
+test_load_DEPENDENCIES = $(top_builddir)/src/libjansson.la
+test_load_callback_SOURCES = test_load_callback.c
+test_load_callback_OBJECTS = test_load_callback.$(OBJEXT)
+test_load_callback_LDADD = $(LDADD)
+test_load_callback_DEPENDENCIES = $(top_builddir)/src/libjansson.la
+am_test_loadb_OBJECTS = test_loadb.$(OBJEXT)
+test_loadb_OBJECTS = $(am_test_loadb_OBJECTS)
+test_loadb_LDADD = $(LDADD)
+test_loadb_DEPENDENCIES = $(top_builddir)/src/libjansson.la
+am_test_memory_funcs_OBJECTS = test_memory_funcs.$(OBJEXT)
+test_memory_funcs_OBJECTS = $(am_test_memory_funcs_OBJECTS)
+test_memory_funcs_LDADD = $(LDADD)
+test_memory_funcs_DEPENDENCIES = $(top_builddir)/src/libjansson.la
+am_test_number_OBJECTS = test_number.$(OBJEXT)
+test_number_OBJECTS = $(am_test_number_OBJECTS)
+test_number_LDADD = $(LDADD)
+test_number_DEPENDENCIES = $(top_builddir)/src/libjansson.la
+am_test_object_OBJECTS = test_object.$(OBJEXT)
+test_object_OBJECTS = $(am_test_object_OBJECTS)
+test_object_LDADD = $(LDADD)
+test_object_DEPENDENCIES = $(top_builddir)/src/libjansson.la
+am_test_pack_OBJECTS = test_pack.$(OBJEXT)
+test_pack_OBJECTS = $(am_test_pack_OBJECTS)
+test_pack_LDADD = $(LDADD)
+test_pack_DEPENDENCIES = $(top_builddir)/src/libjansson.la
+am_test_simple_OBJECTS = test_simple.$(OBJEXT)
+test_simple_OBJECTS = $(am_test_simple_OBJECTS)
+test_simple_LDADD = $(LDADD)
+test_simple_DEPENDENCIES = $(top_builddir)/src/libjansson.la
+am_test_unpack_OBJECTS = test_unpack.$(OBJEXT)
+test_unpack_OBJECTS = $(am_test_unpack_OBJECTS)
+test_unpack_LDADD = $(LDADD)
+test_unpack_DEPENDENCIES = $(top_builddir)/src/libjansson.la
+AM_V_P = $(am__v_P_ at AM_V@)
+am__v_P_ = $(am__v_P_ at AM_DEFAULT_V@)
+am__v_P_0 = false
+am__v_P_1 = :
+AM_V_GEN = $(am__v_GEN_ at AM_V@)
+am__v_GEN_ = $(am__v_GEN_ at AM_DEFAULT_V@)
+am__v_GEN_0 = @echo "  GEN     " $@;
+am__v_GEN_1 = 
+AM_V_at = $(am__v_at_ at AM_V@)
+am__v_at_ = $(am__v_at_ at AM_DEFAULT_V@)
+am__v_at_0 = @
+am__v_at_1 = 
+DEFAULT_INCLUDES = -I. at am__isrc@ -I$(top_builddir)
+depcomp = $(SHELL) $(top_srcdir)/depcomp
+am__depfiles_maybe = depfiles
+am__mv = mv -f
+COMPILE = $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) \
+	$(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) $(AM_V_lt) --tag=CC $(AM_LIBTOOLFLAGS) \
+	$(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) \
+	$(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) \
+	$(AM_CFLAGS) $(CFLAGS)
+AM_V_CC = $(am__v_CC_ at AM_V@)
+am__v_CC_ = $(am__v_CC_ at AM_DEFAULT_V@)
+am__v_CC_0 = @echo "  CC      " $@;
+am__v_CC_1 = 
+CCLD = $(CC)
+LINK = $(LIBTOOL) $(AM_V_lt) --tag=CC $(AM_LIBTOOLFLAGS) \
+	$(LIBTOOLFLAGS) --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) \
+	$(AM_LDFLAGS) $(LDFLAGS) -o $@
+AM_V_CCLD = $(am__v_CCLD_ at AM_V@)
+am__v_CCLD_ = $(am__v_CCLD_ at AM_DEFAULT_V@)
+am__v_CCLD_0 = @echo "  CCLD    " $@;
+am__v_CCLD_1 = 
+SOURCES = $(test_array_SOURCES) $(test_copy_SOURCES) \
+	$(test_dump_SOURCES) $(test_dump_callback_SOURCES) \
+	test_equal.c $(test_load_SOURCES) test_load_callback.c \
+	$(test_loadb_SOURCES) $(test_memory_funcs_SOURCES) \
+	$(test_number_SOURCES) $(test_object_SOURCES) \
+	$(test_pack_SOURCES) $(test_simple_SOURCES) \
+	$(test_unpack_SOURCES)
+DIST_SOURCES = $(test_array_SOURCES) $(test_copy_SOURCES) \
+	$(test_dump_SOURCES) $(test_dump_callback_SOURCES) \
+	test_equal.c $(test_load_SOURCES) test_load_callback.c \
+	$(test_loadb_SOURCES) $(test_memory_funcs_SOURCES) \
+	$(test_number_SOURCES) $(test_object_SOURCES) \
+	$(test_pack_SOURCES) $(test_simple_SOURCES) \
+	$(test_unpack_SOURCES)
+am__can_run_installinfo = \
+  case $$AM_UPDATE_INFO_DIR in \
+    n|no|NO) false;; \
+    *) (install-info --version) >/dev/null 2>&1;; \
+  esac
+am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP)
+# Read a list of newline-separated strings from the standard input,
+# and print each of them once, without duplicates.  Input order is
+# *not* preserved.
+am__uniquify_input = $(AWK) '\
+  BEGIN { nonempty = 0; } \
+  { items[$$0] = 1; nonempty = 1; } \
+  END { if (nonempty) { for (i in items) print i; }; } \
+'
+# Make sure the list of sources is unique.  This is necessary because,
+# e.g., the same source file might be shared among _SOURCES variables
+# for different programs/libraries.
+am__define_uniq_tagged_files = \
+  list='$(am__tagged_files)'; \
+  unique=`for i in $$list; do \
+    if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+  done | $(am__uniquify_input)`
+ETAGS = etags
+CTAGS = ctags
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AM_CFLAGS = @AM_CFLAGS@
+AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DLLTOOL = @DLLTOOL@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+GREP = @GREP@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+LD = @LD@
+LDFLAGS = -static  # for speed and Valgrind
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+MAKEINFO = @MAKEINFO@
+MANIFEST_TOOL = @MANIFEST_TOOL@
+MKDIR_P = @MKDIR_P@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_URL = @PACKAGE_URL@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+VERSION = @VERSION@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+json_have_localeconv = @json_have_localeconv@
+json_have_long_long = @json_have_long_long@
+json_inline = @json_inline@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+EXTRA_DIST = run check-exports
+test_array_SOURCES = test_array.c util.h
+test_copy_SOURCES = test_copy.c util.h
+test_dump_SOURCES = test_dump.c util.h
+test_dump_callback_SOURCES = test_dump_callback.c util.h
+test_load_SOURCES = test_load.c util.h
+test_loadb_SOURCES = test_loadb.c util.h
+test_memory_funcs_SOURCES = test_memory_funcs.c util.h
+test_number_SOURCES = test_number.c util.h
+test_object_SOURCES = test_object.c util.h
+test_pack_SOURCES = test_pack.c util.h
+test_simple_SOURCES = test_simple.c util.h
+test_unpack_SOURCES = test_unpack.c util.h
+AM_CPPFLAGS = -I$(top_builddir)/src -I$(top_srcdir)/src
+LDADD = $(top_builddir)/src/libjansson.la
+all: all-am
+
+.SUFFIXES:
+.SUFFIXES: .c .lo .o .obj
+$(srcdir)/Makefile.in:  $(srcdir)/Makefile.am  $(am__configure_deps)
+	@for dep in $?; do \
+	  case '$(am__configure_deps)' in \
+	    *$$dep*) \
+	      ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \
+	        && { if test -f $@; then exit 0; else break; fi; }; \
+	      exit 1;; \
+	  esac; \
+	done; \
+	echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign test/suites/api/Makefile'; \
+	$(am__cd) $(top_srcdir) && \
+	  $(AUTOMAKE) --foreign test/suites/api/Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+	@case '$?' in \
+	  *config.status*) \
+	    cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
+	  *) \
+	    echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
+	    cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+	esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+
+$(top_srcdir)/configure:  $(am__configure_deps)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(ACLOCAL_M4):  $(am__aclocal_m4_deps)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(am__aclocal_m4_deps):
+
+clean-checkPROGRAMS:
+	@list='$(check_PROGRAMS)'; test -n "$$list" || exit 0; \
+	echo " rm -f" $$list; \
+	rm -f $$list || exit $$?; \
+	test -n "$(EXEEXT)" || exit 0; \
+	list=`for p in $$list; do echo "$$p"; done | sed 's/$(EXEEXT)$$//'`; \
+	echo " rm -f" $$list; \
+	rm -f $$list
+
+test_array$(EXEEXT): $(test_array_OBJECTS) $(test_array_DEPENDENCIES) $(EXTRA_test_array_DEPENDENCIES) 
+	@rm -f test_array$(EXEEXT)
+	$(AM_V_CCLD)$(LINK) $(test_array_OBJECTS) $(test_array_LDADD) $(LIBS)
+
+test_copy$(EXEEXT): $(test_copy_OBJECTS) $(test_copy_DEPENDENCIES) $(EXTRA_test_copy_DEPENDENCIES) 
+	@rm -f test_copy$(EXEEXT)
+	$(AM_V_CCLD)$(LINK) $(test_copy_OBJECTS) $(test_copy_LDADD) $(LIBS)
+
+test_dump$(EXEEXT): $(test_dump_OBJECTS) $(test_dump_DEPENDENCIES) $(EXTRA_test_dump_DEPENDENCIES) 
+	@rm -f test_dump$(EXEEXT)
+	$(AM_V_CCLD)$(LINK) $(test_dump_OBJECTS) $(test_dump_LDADD) $(LIBS)
+
+test_dump_callback$(EXEEXT): $(test_dump_callback_OBJECTS) $(test_dump_callback_DEPENDENCIES) $(EXTRA_test_dump_callback_DEPENDENCIES) 
+	@rm -f test_dump_callback$(EXEEXT)
+	$(AM_V_CCLD)$(LINK) $(test_dump_callback_OBJECTS) $(test_dump_callback_LDADD) $(LIBS)
+
+test_equal$(EXEEXT): $(test_equal_OBJECTS) $(test_equal_DEPENDENCIES) $(EXTRA_test_equal_DEPENDENCIES) 
+	@rm -f test_equal$(EXEEXT)
+	$(AM_V_CCLD)$(LINK) $(test_equal_OBJECTS) $(test_equal_LDADD) $(LIBS)
+
+test_load$(EXEEXT): $(test_load_OBJECTS) $(test_load_DEPENDENCIES) $(EXTRA_test_load_DEPENDENCIES) 
+	@rm -f test_load$(EXEEXT)
+	$(AM_V_CCLD)$(LINK) $(test_load_OBJECTS) $(test_load_LDADD) $(LIBS)
+
+test_load_callback$(EXEEXT): $(test_load_callback_OBJECTS) $(test_load_callback_DEPENDENCIES) $(EXTRA_test_load_callback_DEPENDENCIES) 
+	@rm -f test_load_callback$(EXEEXT)
+	$(AM_V_CCLD)$(LINK) $(test_load_callback_OBJECTS) $(test_load_callback_LDADD) $(LIBS)
+
+test_loadb$(EXEEXT): $(test_loadb_OBJECTS) $(test_loadb_DEPENDENCIES) $(EXTRA_test_loadb_DEPENDENCIES) 
+	@rm -f test_loadb$(EXEEXT)
+	$(AM_V_CCLD)$(LINK) $(test_loadb_OBJECTS) $(test_loadb_LDADD) $(LIBS)
+
+test_memory_funcs$(EXEEXT): $(test_memory_funcs_OBJECTS) $(test_memory_funcs_DEPENDENCIES) $(EXTRA_test_memory_funcs_DEPENDENCIES) 
+	@rm -f test_memory_funcs$(EXEEXT)
+	$(AM_V_CCLD)$(LINK) $(test_memory_funcs_OBJECTS) $(test_memory_funcs_LDADD) $(LIBS)
+
+test_number$(EXEEXT): $(test_number_OBJECTS) $(test_number_DEPENDENCIES) $(EXTRA_test_number_DEPENDENCIES) 
+	@rm -f test_number$(EXEEXT)
+	$(AM_V_CCLD)$(LINK) $(test_number_OBJECTS) $(test_number_LDADD) $(LIBS)
+
+test_object$(EXEEXT): $(test_object_OBJECTS) $(test_object_DEPENDENCIES) $(EXTRA_test_object_DEPENDENCIES) 
+	@rm -f test_object$(EXEEXT)
+	$(AM_V_CCLD)$(LINK) $(test_object_OBJECTS) $(test_object_LDADD) $(LIBS)
+
+test_pack$(EXEEXT): $(test_pack_OBJECTS) $(test_pack_DEPENDENCIES) $(EXTRA_test_pack_DEPENDENCIES) 
+	@rm -f test_pack$(EXEEXT)
+	$(AM_V_CCLD)$(LINK) $(test_pack_OBJECTS) $(test_pack_LDADD) $(LIBS)
+
+test_simple$(EXEEXT): $(test_simple_OBJECTS) $(test_simple_DEPENDENCIES) $(EXTRA_test_simple_DEPENDENCIES) 
+	@rm -f test_simple$(EXEEXT)
+	$(AM_V_CCLD)$(LINK) $(test_simple_OBJECTS) $(test_simple_LDADD) $(LIBS)
+
+test_unpack$(EXEEXT): $(test_unpack_OBJECTS) $(test_unpack_DEPENDENCIES) $(EXTRA_test_unpack_DEPENDENCIES) 
+	@rm -f test_unpack$(EXEEXT)
+	$(AM_V_CCLD)$(LINK) $(test_unpack_OBJECTS) $(test_unpack_LDADD) $(LIBS)
+
+mostlyclean-compile:
+	-rm -f *.$(OBJEXT)
+
+distclean-compile:
+	-rm -f *.tab.c
+
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/test_array.Po at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/test_copy.Po at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/test_dump.Po at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/test_dump_callback.Po at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/test_equal.Po at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/test_load.Po at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/test_load_callback.Po at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/test_loadb.Po at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/test_memory_funcs.Po at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/test_number.Po at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/test_object.Po at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/test_pack.Po at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/test_simple.Po at am__quote@
+ at AMDEP_TRUE@@am__include@ @am__quote at ./$(DEPDIR)/test_unpack.Po at am__quote@
+
+.c.o:
+ at am__fastdepCC_TRUE@	$(AM_V_CC)$(COMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $<
+ at am__fastdepCC_TRUE@	$(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	$(AM_V_CC)source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+ at am__fastdepCC_FALSE@	$(AM_V_CC at am__nodep@)$(COMPILE) -c -o $@ $<
+
+.c.obj:
+ at am__fastdepCC_TRUE@	$(AM_V_CC)$(COMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ `$(CYGPATH_W) '$<'`
+ at am__fastdepCC_TRUE@	$(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	$(AM_V_CC)source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+ at am__fastdepCC_FALSE@	$(AM_V_CC at am__nodep@)$(COMPILE) -c -o $@ `$(CYGPATH_W) '$<'`
+
+.c.lo:
+ at am__fastdepCC_TRUE@	$(AM_V_CC)$(LTCOMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $<
+ at am__fastdepCC_TRUE@	$(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Plo
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	$(AM_V_CC)source='$<' object='$@' libtool=yes @AMDEPBACKSLASH@
+ at AMDEP_TRUE@@am__fastdepCC_FALSE@	DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+ at am__fastdepCC_FALSE@	$(AM_V_CC at am__nodep@)$(LTCOMPILE) -c -o $@ $<
+
+mostlyclean-libtool:
+	-rm -f *.lo
+
+clean-libtool:
+	-rm -rf .libs _libs
+
+ID: $(am__tagged_files)
+	$(am__define_uniq_tagged_files); mkid -fID $$unique
+tags: tags-am
+TAGS: tags
+
+tags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+	set x; \
+	here=`pwd`; \
+	$(am__define_uniq_tagged_files); \
+	shift; \
+	if test -z "$(ETAGS_ARGS)$$*$$unique"; then :; else \
+	  test -n "$$unique" || unique=$$empty_fix; \
+	  if test $$# -gt 0; then \
+	    $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+	      "$$@" $$unique; \
+	  else \
+	    $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+	      $$unique; \
+	  fi; \
+	fi
+ctags: ctags-am
+
+CTAGS: ctags
+ctags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+	$(am__define_uniq_tagged_files); \
+	test -z "$(CTAGS_ARGS)$$unique" \
+	  || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \
+	     $$unique
+
+GTAGS:
+	here=`$(am__cd) $(top_builddir) && pwd` \
+	  && $(am__cd) $(top_srcdir) \
+	  && gtags -i $(GTAGS_ARGS) "$$here"
+cscopelist: cscopelist-am
+
+cscopelist-am: $(am__tagged_files)
+	list='$(am__tagged_files)'; \
+	case "$(srcdir)" in \
+	  [\\/]* | ?:[\\/]*) sdir="$(srcdir)" ;; \
+	  *) sdir=$(subdir)/$(srcdir) ;; \
+	esac; \
+	for i in $$list; do \
+	  if test -f "$$i"; then \
+	    echo "$(subdir)/$$i"; \
+	  else \
+	    echo "$$sdir/$$i"; \
+	  fi; \
+	done >> $(top_builddir)/cscope.files
+
+distclean-tags:
+	-rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
+
+distdir: $(DISTFILES)
+	@srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	list='$(DISTFILES)'; \
+	  dist_files=`for file in $$list; do echo $$file; done | \
+	  sed -e "s|^$$srcdirstrip/||;t" \
+	      -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+	case $$dist_files in \
+	  */*) $(MKDIR_P) `echo "$$dist_files" | \
+			   sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+			   sort -u` ;; \
+	esac; \
+	for file in $$dist_files; do \
+	  if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+	  if test -d $$d/$$file; then \
+	    dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+	    if test -d "$(distdir)/$$file"; then \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+	      cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+	  else \
+	    test -f "$(distdir)/$$file" \
+	    || cp -p $$d/$$file "$(distdir)/$$file" \
+	    || exit 1; \
+	  fi; \
+	done
+check-am: all-am
+	$(MAKE) $(AM_MAKEFLAGS) $(check_PROGRAMS)
+check: check-am
+all-am: Makefile
+installdirs:
+install: install-am
+install-exec: install-exec-am
+install-data: install-data-am
+uninstall: uninstall-am
+
+install-am: all-am
+	@$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-am
+install-strip:
+	if test -z '$(STRIP)'; then \
+	  $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+	    install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+	      install; \
+	else \
+	  $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+	    install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+	    "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \
+	fi
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+	-test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+	-test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+
+maintainer-clean-generic:
+	@echo "This command is intended for maintainers to use"
+	@echo "it deletes files that may require special tools to rebuild."
+clean: clean-am
+
+clean-am: clean-checkPROGRAMS clean-generic clean-libtool \
+	mostlyclean-am
+
+distclean: distclean-am
+	-rm -rf ./$(DEPDIR)
+	-rm -f Makefile
+distclean-am: clean-am distclean-compile distclean-generic \
+	distclean-tags
+
+dvi: dvi-am
+
+dvi-am:
+
+html: html-am
+
+html-am:
+
+info: info-am
+
+info-am:
+
+install-data-am:
+
+install-dvi: install-dvi-am
+
+install-dvi-am:
+
+install-exec-am:
+
+install-html: install-html-am
+
+install-html-am:
+
+install-info: install-info-am
+
+install-info-am:
+
+install-man:
+
+install-pdf: install-pdf-am
+
+install-pdf-am:
+
+install-ps: install-ps-am
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-am
+	-rm -rf ./$(DEPDIR)
+	-rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-am
+
+mostlyclean-am: mostlyclean-compile mostlyclean-generic \
+	mostlyclean-libtool
+
+pdf: pdf-am
+
+pdf-am:
+
+ps: ps-am
+
+ps-am:
+
+uninstall-am:
+
+.MAKE: check-am install-am install-strip
+
+.PHONY: CTAGS GTAGS TAGS all all-am check check-am clean \
+	clean-checkPROGRAMS clean-generic clean-libtool cscopelist-am \
+	ctags ctags-am distclean distclean-compile distclean-generic \
+	distclean-libtool distclean-tags distdir dvi dvi-am html \
+	html-am info info-am install install-am install-data \
+	install-data-am install-dvi install-dvi-am install-exec \
+	install-exec-am install-html install-html-am install-info \
+	install-info-am install-man install-pdf install-pdf-am \
+	install-ps install-ps-am install-strip installcheck \
+	installcheck-am installdirs maintainer-clean \
+	maintainer-clean-generic mostlyclean mostlyclean-compile \
+	mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
+	tags tags-am uninstall uninstall-am
+
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:

Added: vendor/jansson/dist/test/suites/api/check-exports
===================================================================
--- vendor/jansson/dist/test/suites/api/check-exports	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/check-exports	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,23 @@
+#!/bin/sh
+#
+# This test checks that libjansson.so exports the correct symbols.
+#
+
+SOFILE="../src/.libs/libjansson.so"
+
+# The list of symbols, which the shared object should export, is read
+# from the def file, which is used in Windows builds
+grep 'json_' $top_srcdir/src/jansson.def \
+    | sed -e 's/ //g' \
+    | sort \
+    >$test_log/exports
+
+nm -D $SOFILE >/dev/null >$test_log/symbols 2>/dev/null \
+    || exit 77  # Skip if "nm -D" doesn't seem to work
+
+grep ' [DT] ' $test_log/symbols | cut -d' ' -f3 | grep -v '^_' | sort >$test_log/output
+
+if ! cmp -s $test_log/exports $test_log/output; then
+    diff -u $test_log/exports $test_log/output >&2
+    exit 1
+fi

Added: vendor/jansson/dist/test/suites/api/run
===================================================================
--- vendor/jansson/dist/test/suites/api/run	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/run	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,36 @@
+#!/bin/sh
+#
+# Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+#
+# Jansson is free software; you can redistribute it and/or modify
+# it under the terms of the MIT license. See LICENSE for details.
+
+is_test() {
+    case "$test_name" in
+        *.c|check-exports)
+            return 0
+            ;;
+        *)
+            return 1
+            ;;
+    esac
+}
+
+run_test() {
+    if [ "$test_name" = "check-exports" ]; then
+        test_log=$test_log $test_path >$test_log/stdout 2>$test_log/stderr
+    else
+        $test_runner $suite_builddir/${test_name%.c} \
+            >$test_log/stdout \
+            2>$test_log/stderr \
+            || return 1
+        valgrind_check $test_log/stderr || return 1
+    fi
+}
+
+show_error() {
+    valgrind_show_error && return
+    cat $test_log/stderr
+}
+
+. $top_srcdir/test/scripts/run-tests.sh

Added: vendor/jansson/dist/test/suites/api/test_array.c
===================================================================
--- vendor/jansson/dist/test/suites/api/test_array.c	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/test_array.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,432 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <jansson.h>
+#include "util.h"
+
+static void test_misc(void)
+{
+    json_t *array, *five, *seven, *value;
+    size_t i;
+
+    array = json_array();
+    five = json_integer(5);
+    seven = json_integer(7);
+
+    if(!array)
+        fail("unable to create array");
+    if(!five || !seven)
+        fail("unable to create integer");
+
+    if(json_array_size(array) != 0)
+        fail("empty array has nonzero size");
+
+    if(!json_array_append(array, NULL))
+        fail("able to append NULL");
+
+    if(json_array_append(array, five))
+        fail("unable to append");
+
+    if(json_array_size(array) != 1)
+        fail("wrong array size");
+
+    value = json_array_get(array, 0);
+    if(!value)
+        fail("unable to get item");
+    if(value != five)
+        fail("got wrong value");
+
+    if(json_array_append(array, seven))
+        fail("unable to append value");
+
+    if(json_array_size(array) != 2)
+        fail("wrong array size");
+
+    value = json_array_get(array, 1);
+    if(!value)
+        fail("unable to get item");
+    if(value != seven)
+        fail("got wrong value");
+
+    if(json_array_set(array, 0, seven))
+        fail("unable to set value");
+
+    if(!json_array_set(array, 0, NULL))
+        fail("able to set NULL");
+
+    if(json_array_size(array) != 2)
+        fail("wrong array size");
+
+    value = json_array_get(array, 0);
+    if(!value)
+        fail("unable to get item");
+    if(value != seven)
+        fail("got wrong value");
+
+    if(json_array_get(array, 2) != NULL)
+        fail("able to get value out of bounds");
+
+    if(!json_array_set(array, 2, seven))
+        fail("able to set value out of bounds");
+
+    for(i = 2; i < 30; i++) {
+        if(json_array_append(array, seven))
+            fail("unable to append value");
+
+        if(json_array_size(array) != i + 1)
+            fail("wrong array size");
+    }
+
+    for(i = 0; i < 30; i++) {
+        value = json_array_get(array, i);
+        if(!value)
+            fail("unable to get item");
+        if(value != seven)
+            fail("got wrong value");
+    }
+
+    if(json_array_set_new(array, 15, json_integer(123)))
+        fail("unable to set new value");
+
+    value = json_array_get(array, 15);
+    if(!json_is_integer(value) || json_integer_value(value) != 123)
+        fail("json_array_set_new works incorrectly");
+
+    if(!json_array_set_new(array, 15, NULL))
+        fail("able to set_new NULL value");
+
+    if(json_array_append_new(array, json_integer(321)))
+        fail("unable to append new value");
+
+    value = json_array_get(array, json_array_size(array) - 1);
+    if(!json_is_integer(value) || json_integer_value(value) != 321)
+        fail("json_array_append_new works incorrectly");
+
+    if(!json_array_append_new(array, NULL))
+        fail("able to append_new NULL value");
+
+    json_decref(five);
+    json_decref(seven);
+    json_decref(array);
+}
+
+static void test_insert(void)
+{
+    json_t *array, *five, *seven, *eleven, *value;
+    int i;
+
+    array = json_array();
+    five = json_integer(5);
+    seven = json_integer(7);
+    eleven = json_integer(11);
+
+    if(!array)
+        fail("unable to create array");
+    if(!five || !seven || !eleven)
+        fail("unable to create integer");
+
+
+    if(!json_array_insert(array, 1, five))
+        fail("able to insert value out of bounds");
+
+
+    if(json_array_insert(array, 0, five))
+        fail("unable to insert value in an empty array");
+
+    if(json_array_get(array, 0) != five)
+        fail("json_array_insert works incorrectly");
+
+    if(json_array_size(array) != 1)
+        fail("array size is invalid after insertion");
+
+
+    if(json_array_insert(array, 1, seven))
+        fail("unable to insert value at the end of an array");
+
+    if(json_array_get(array, 0) != five)
+        fail("json_array_insert works incorrectly");
+
+    if(json_array_get(array, 1) != seven)
+        fail("json_array_insert works incorrectly");
+
+    if(json_array_size(array) != 2)
+        fail("array size is invalid after insertion");
+
+
+    if(json_array_insert(array, 1, eleven))
+        fail("unable to insert value in the middle of an array");
+
+    if(json_array_get(array, 0) != five)
+        fail("json_array_insert works incorrectly");
+
+    if(json_array_get(array, 1) != eleven)
+        fail("json_array_insert works incorrectly");
+
+    if(json_array_get(array, 2) != seven)
+        fail("json_array_insert works incorrectly");
+
+    if(json_array_size(array) != 3)
+        fail("array size is invalid after insertion");
+
+
+    if(json_array_insert_new(array, 2, json_integer(123)))
+        fail("unable to insert value in the middle of an array");
+
+    value = json_array_get(array, 2);
+    if(!json_is_integer(value) || json_integer_value(value) != 123)
+        fail("json_array_insert_new works incorrectly");
+
+    if(json_array_size(array) != 4)
+        fail("array size is invalid after insertion");
+
+
+    for(i = 0; i < 20; i++) {
+        if(json_array_insert(array, 0, seven))
+            fail("unable to insert value at the begining of an array");
+    }
+
+    for(i = 0; i < 20; i++) {
+        if(json_array_get(array, i) != seven)
+            fail("json_aray_insert works incorrectly");
+    }
+
+    if(json_array_size(array) != 24)
+        fail("array size is invalid after loop insertion");
+
+    json_decref(five);
+    json_decref(seven);
+    json_decref(eleven);
+    json_decref(array);
+}
+
+static void test_remove(void)
+{
+    json_t *array, *five, *seven;
+    int i;
+
+    array = json_array();
+    five = json_integer(5);
+    seven = json_integer(7);
+
+    if(!array)
+        fail("unable to create array");
+    if(!five)
+        fail("unable to create integer");
+    if(!seven)
+        fail("unable to create integer");
+
+
+    if(!json_array_remove(array, 0))
+        fail("able to remove an unexisting index");
+
+
+    if(json_array_append(array, five))
+        fail("unable to append");
+
+    if(!json_array_remove(array, 1))
+        fail("able to remove an unexisting index");
+
+    if(json_array_remove(array, 0))
+        fail("unable to remove");
+
+    if(json_array_size(array) != 0)
+        fail("array size is invalid after removing");
+
+
+    if(json_array_append(array, five) ||
+       json_array_append(array, seven) ||
+       json_array_append(array, five) ||
+       json_array_append(array, seven))
+        fail("unable to append");
+
+    if(json_array_remove(array, 2))
+        fail("unable to remove");
+
+    if(json_array_size(array) != 3)
+        fail("array size is invalid after removing");
+
+    if(json_array_get(array, 0) != five ||
+       json_array_get(array, 1) != seven ||
+       json_array_get(array, 2) != seven)
+        fail("remove works incorrectly");
+
+    json_decref(array);
+
+    array = json_array();
+    for(i = 0; i < 4; i++) {
+        json_array_append(array, five);
+        json_array_append(array, seven);
+    }
+    if(json_array_size(array) != 8)
+        fail("unable to append 8 items to array");
+
+    /* Remove an element from a "full" array. */
+    json_array_remove(array, 5);
+
+    json_decref(five);
+    json_decref(seven);
+    json_decref(array);
+}
+
+static void test_clear(void)
+{
+    json_t *array, *five, *seven;
+    int i;
+
+    array = json_array();
+    five = json_integer(5);
+    seven = json_integer(7);
+
+    if(!array)
+        fail("unable to create array");
+    if(!five || !seven)
+        fail("unable to create integer");
+
+    for(i = 0; i < 10; i++) {
+        if(json_array_append(array, five))
+            fail("unable to append");
+    }
+    for(i = 0; i < 10; i++) {
+        if(json_array_append(array, seven))
+            fail("unable to append");
+    }
+
+    if(json_array_size(array) != 20)
+        fail("array size is invalid after appending");
+
+    if(json_array_clear(array))
+        fail("unable to clear");
+
+    if(json_array_size(array) != 0)
+        fail("array size is invalid after clearing");
+
+    json_decref(five);
+    json_decref(seven);
+    json_decref(array);
+}
+
+static void test_extend(void)
+{
+    json_t *array1, *array2, *five, *seven;
+    int i;
+
+    array1 = json_array();
+    array2 = json_array();
+    five = json_integer(5);
+    seven = json_integer(7);
+
+    if(!array1 || !array2)
+        fail("unable to create array");
+    if(!five || !seven)
+        fail("unable to create integer");
+
+    for(i = 0; i < 10; i++) {
+        if(json_array_append(array1, five))
+            fail("unable to append");
+    }
+    for(i = 0; i < 10; i++) {
+        if(json_array_append(array2, seven))
+            fail("unable to append");
+    }
+
+    if(json_array_size(array1) != 10 || json_array_size(array2) != 10)
+        fail("array size is invalid after appending");
+
+    if(json_array_extend(array1, array2))
+        fail("unable to extend");
+
+    for(i = 0; i < 10; i++) {
+        if(json_array_get(array1, i) != five)
+            fail("invalid array contents after extending");
+    }
+    for(i = 10; i < 20; i++) {
+        if(json_array_get(array1, i) != seven)
+            fail("invalid array contents after extending");
+    }
+
+    json_decref(five);
+    json_decref(seven);
+    json_decref(array1);
+    json_decref(array2);
+}
+
+static void test_circular()
+{
+    json_t *array1, *array2;
+
+    /* the simple cases are checked */
+
+    array1 = json_array();
+    if(!array1)
+        fail("unable to create array");
+
+    if(json_array_append(array1, array1) == 0)
+        fail("able to append self");
+
+    if(json_array_insert(array1, 0, array1) == 0)
+        fail("able to insert self");
+
+    if(json_array_append_new(array1, json_true()))
+        fail("failed to append true");
+
+    if(json_array_set(array1, 0, array1) == 0)
+        fail("able to set self");
+
+    json_decref(array1);
+
+
+    /* create circular references */
+
+    array1 = json_array();
+    array2 = json_array();
+    if(!array1 || !array2)
+        fail("unable to create array");
+
+    if(json_array_append(array1, array2) ||
+       json_array_append(array2, array1))
+        fail("unable to append");
+
+    /* circularity is detected when dumping */
+    if(json_dumps(array1, 0) != NULL)
+        fail("able to dump circulars");
+
+    /* decref twice to deal with the circular references */
+    json_decref(array1);
+    json_decref(array2);
+    json_decref(array1);
+}
+
+static void test_array_foreach()
+{
+    size_t index;
+    json_t *array1, *array2, *value;
+
+    array1 = json_pack("[sisisi]", "foo", 1, "bar", 2, "baz", 3);
+    array2 = json_array();
+
+    json_array_foreach(array1, index, value) {
+        json_array_append(array2, value);
+    }
+    
+    if(!json_equal(array1, array2))
+        fail("json_array_foreach failed to iterate all elements");
+
+    json_decref(array1);
+    json_decref(array2);
+}
+
+
+static void run_tests()
+{
+    test_misc();
+    test_insert();
+    test_remove();
+    test_clear();
+    test_extend();
+    test_circular();
+    test_array_foreach();
+}

Added: vendor/jansson/dist/test/suites/api/test_copy.c
===================================================================
--- vendor/jansson/dist/test/suites/api/test_copy.c	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/test_copy.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,318 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <string.h>
+#include <jansson.h>
+#include "util.h"
+
+static void test_copy_simple(void)
+{
+    json_t *value, *copy;
+
+    if(json_copy(NULL))
+        fail("copying NULL doesn't return NULL");
+
+    /* true */
+    value = json_true();
+    copy = json_copy(value);
+    if(value != copy)
+        fail("copying true failed");
+    json_decref(value);
+    json_decref(copy);
+
+    /* false */
+    value = json_false();
+    copy = json_copy(value);
+    if(value != copy)
+        fail("copying false failed");
+    json_decref(value);
+    json_decref(copy);
+
+    /* null */
+    value = json_null();
+    copy = json_copy(value);
+    if(value != copy)
+        fail("copying null failed");
+    json_decref(value);
+    json_decref(copy);
+
+    /* string */
+    value = json_string("foo");
+    if(!value)
+        fail("unable to create a string");
+    copy = json_copy(value);
+    if(!copy)
+        fail("unable to copy a string");
+    if(copy == value)
+        fail("copying a string doesn't copy");
+    if(!json_equal(copy, value))
+        fail("copying a string produces an inequal copy");
+    if(value->refcount != 1 || copy->refcount != 1)
+        fail("invalid refcounts");
+    json_decref(value);
+    json_decref(copy);
+
+    /* integer */
+    value = json_integer(543);
+    if(!value)
+        fail("unable to create an integer");
+    copy = json_copy(value);
+    if(!copy)
+        fail("unable to copy an integer");
+    if(copy == value)
+        fail("copying an integer doesn't copy");
+    if(!json_equal(copy, value))
+        fail("copying an integer produces an inequal copy");
+    if(value->refcount != 1 || copy->refcount != 1)
+        fail("invalid refcounts");
+    json_decref(value);
+    json_decref(copy);
+
+    /* real */
+    value = json_real(123e9);
+    if(!value)
+        fail("unable to create a real");
+    copy = json_copy(value);
+    if(!copy)
+        fail("unable to copy a real");
+    if(copy == value)
+        fail("copying a real doesn't copy");
+    if(!json_equal(copy, value))
+        fail("copying a real produces an inequal copy");
+    if(value->refcount != 1 || copy->refcount != 1)
+        fail("invalid refcounts");
+    json_decref(value);
+    json_decref(copy);
+}
+
+static void test_deep_copy_simple(void)
+{
+    json_t *value, *copy;
+
+    if(json_deep_copy(NULL))
+        fail("deep copying NULL doesn't return NULL");
+
+    /* true */
+    value = json_true();
+    copy = json_deep_copy(value);
+    if(value != copy)
+        fail("deep copying true failed");
+    json_decref(value);
+    json_decref(copy);
+
+    /* false */
+    value = json_false();
+    copy = json_deep_copy(value);
+    if(value != copy)
+        fail("deep copying false failed");
+    json_decref(value);
+    json_decref(copy);
+
+    /* null */
+    value = json_null();
+    copy = json_deep_copy(value);
+    if(value != copy)
+        fail("deep copying null failed");
+    json_decref(value);
+    json_decref(copy);
+
+    /* string */
+    value = json_string("foo");
+    if(!value)
+        fail("unable to create a string");
+    copy = json_deep_copy(value);
+    if(!copy)
+        fail("unable to deep copy a string");
+    if(copy == value)
+        fail("deep copying a string doesn't copy");
+    if(!json_equal(copy, value))
+        fail("deep copying a string produces an inequal copy");
+    if(value->refcount != 1 || copy->refcount != 1)
+        fail("invalid refcounts");
+    json_decref(value);
+    json_decref(copy);
+
+    /* integer */
+    value = json_integer(543);
+    if(!value)
+        fail("unable to create an integer");
+    copy = json_deep_copy(value);
+    if(!copy)
+        fail("unable to deep copy an integer");
+    if(copy == value)
+        fail("deep copying an integer doesn't copy");
+    if(!json_equal(copy, value))
+        fail("deep copying an integer produces an inequal copy");
+    if(value->refcount != 1 || copy->refcount != 1)
+        fail("invalid refcounts");
+    json_decref(value);
+    json_decref(copy);
+
+    /* real */
+    value = json_real(123e9);
+    if(!value)
+        fail("unable to create a real");
+    copy = json_deep_copy(value);
+    if(!copy)
+        fail("unable to deep copy a real");
+    if(copy == value)
+        fail("deep copying a real doesn't copy");
+    if(!json_equal(copy, value))
+        fail("deep copying a real produces an inequal copy");
+    if(value->refcount != 1 || copy->refcount != 1)
+        fail("invalid refcounts");
+    json_decref(value);
+    json_decref(copy);
+}
+
+static void test_copy_array(void)
+{
+    const char *json_array_text = "[1, \"foo\", 3.141592, {\"foo\": \"bar\"}]";
+
+    json_t *array, *copy;
+    size_t i;
+
+    array = json_loads(json_array_text, 0, NULL);
+    if(!array)
+        fail("unable to parse an array");
+
+    copy = json_copy(array);
+    if(!copy)
+        fail("unable to copy an array");
+    if(copy == array)
+        fail("copying an array doesn't copy");
+    if(!json_equal(copy, array))
+        fail("copying an array produces an inequal copy");
+
+    for(i = 0; i < json_array_size(copy); i++)
+    {
+        if(json_array_get(array, i) != json_array_get(copy, i))
+            fail("copying an array modifies its elements");
+    }
+
+    json_decref(array);
+    json_decref(copy);
+}
+
+static void test_deep_copy_array(void)
+{
+    const char *json_array_text = "[1, \"foo\", 3.141592, {\"foo\": \"bar\"}]";
+
+    json_t *array, *copy;
+    size_t i;
+
+    array = json_loads(json_array_text, 0, NULL);
+    if(!array)
+        fail("unable to parse an array");
+
+    copy = json_deep_copy(array);
+    if(!copy)
+        fail("unable to deep copy an array");
+    if(copy == array)
+        fail("deep copying an array doesn't copy");
+    if(!json_equal(copy, array))
+        fail("deep copying an array produces an inequal copy");
+
+    for(i = 0; i < json_array_size(copy); i++)
+    {
+        if(json_array_get(array, i) == json_array_get(copy, i))
+            fail("deep copying an array doesn't copy its elements");
+    }
+
+    json_decref(array);
+    json_decref(copy);
+}
+
+static void test_copy_object(void)
+{
+    const char *json_object_text =
+        "{\"foo\": \"bar\", \"a\": 1, \"b\": 3.141592, \"c\": [1,2,3,4]}";
+
+    json_t *object, *copy;
+    void *iter;
+
+    object = json_loads(json_object_text, 0, NULL);
+    if(!object)
+        fail("unable to parse an object");
+
+    copy = json_copy(object);
+    if(!copy)
+        fail("unable to copy an object");
+    if(copy == object)
+        fail("copying an object doesn't copy");
+    if(!json_equal(copy, object))
+        fail("copying an object produces an inequal copy");
+
+    iter = json_object_iter(object);
+    while(iter)
+    {
+        const char *key;
+        json_t *value1, *value2;
+
+        key = json_object_iter_key(iter);
+        value1 = json_object_iter_value(iter);
+        value2 = json_object_get(copy, key);
+
+        if(value1 != value2)
+            fail("deep copying an object modifies its items");
+
+        iter = json_object_iter_next(object, iter);
+    }
+
+    json_decref(object);
+    json_decref(copy);
+}
+
+static void test_deep_copy_object(void)
+{
+    const char *json_object_text =
+        "{\"foo\": \"bar\", \"a\": 1, \"b\": 3.141592, \"c\": [1,2,3,4]}";
+
+    json_t *object, *copy;
+    void *iter;
+
+    object = json_loads(json_object_text, 0, NULL);
+    if(!object)
+        fail("unable to parse an object");
+
+    copy = json_deep_copy(object);
+    if(!copy)
+        fail("unable to deep copy an object");
+    if(copy == object)
+        fail("deep copying an object doesn't copy");
+    if(!json_equal(copy, object))
+        fail("deep copying an object produces an inequal copy");
+
+    iter = json_object_iter(object);
+    while(iter)
+    {
+        const char *key;
+        json_t *value1, *value2;
+
+        key = json_object_iter_key(iter);
+        value1 = json_object_iter_value(iter);
+        value2 = json_object_get(copy, key);
+
+        if(value1 == value2)
+            fail("deep copying an object doesn't copy its items");
+
+        iter = json_object_iter_next(object, iter);
+    }
+
+    json_decref(object);
+    json_decref(copy);
+}
+
+static void run_tests()
+{
+    test_copy_simple();
+    test_deep_copy_simple();
+    test_copy_array();
+    test_deep_copy_array();
+    test_copy_object();
+    test_deep_copy_object();
+}

Added: vendor/jansson/dist/test/suites/api/test_dump.c
===================================================================
--- vendor/jansson/dist/test/suites/api/test_dump.c	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/test_dump.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,205 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <jansson.h>
+#include <string.h>
+#include "util.h"
+
+static int encode_null_callback(const char *buffer, size_t size, void *data)
+{
+    (void)buffer;
+    (void)size;
+    (void)data;
+    return 0;
+}
+
+static void encode_null()
+{
+    if(json_dumps(NULL, JSON_ENCODE_ANY) != NULL)
+        fail("json_dumps didn't fail for NULL");
+
+    if(json_dumpf(NULL, stderr, JSON_ENCODE_ANY) != -1)
+        fail("json_dumpf didn't fail for NULL");
+
+    /* Don't test json_dump_file to avoid creating a file */
+
+    if(json_dump_callback(NULL, encode_null_callback, NULL, JSON_ENCODE_ANY) != -1)
+        fail("json_dump_callback didn't fail for NULL");
+}
+
+
+static void encode_twice()
+{
+    /* Encode an empty object/array, add an item, encode again */
+
+    json_t *json;
+    char *result;
+
+    json = json_object();
+    result = json_dumps(json, 0);
+    if(!result || strcmp(result, "{}"))
+      fail("json_dumps failed");
+    free(result);
+
+    json_object_set_new(json, "foo", json_integer(5));
+    result = json_dumps(json, 0);
+    if(!result || strcmp(result, "{\"foo\": 5}"))
+      fail("json_dumps failed");
+    free(result);
+
+    json_decref(json);
+
+    json = json_array();
+    result = json_dumps(json, 0);
+    if(!result || strcmp(result, "[]"))
+      fail("json_dumps failed");
+    free(result);
+
+    json_array_append_new(json, json_integer(5));
+    result = json_dumps(json, 0);
+    if(!result || strcmp(result, "[5]"))
+      fail("json_dumps failed");
+    free(result);
+
+    json_decref(json);
+}
+
+static void circular_references()
+{
+    /* Construct a JSON object/array with a circular reference:
+
+       object: {"a": {"b": {"c": <circular reference to $.a>}}}
+       array: [[[<circular reference to the $[0] array>]]]
+
+       Encode it, remove the circular reference and encode again.
+    */
+
+    json_t *json;
+    char *result;
+
+    json = json_object();
+    json_object_set_new(json, "a", json_object());
+    json_object_set_new(json_object_get(json, "a"), "b", json_object());
+    json_object_set(json_object_get(json_object_get(json, "a"), "b"), "c",
+                    json_object_get(json, "a"));
+
+    if(json_dumps(json, 0))
+        fail("json_dumps encoded a circular reference!");
+
+    json_object_del(json_object_get(json_object_get(json, "a"), "b"), "c");
+
+    result = json_dumps(json, 0);
+    if(!result || strcmp(result, "{\"a\": {\"b\": {}}}"))
+        fail("json_dumps failed!");
+    free(result);
+
+    json_decref(json);
+
+    json = json_array();
+    json_array_append_new(json, json_array());
+    json_array_append_new(json_array_get(json, 0), json_array());
+    json_array_append(json_array_get(json_array_get(json, 0), 0),
+                      json_array_get(json, 0));
+
+    if(json_dumps(json, 0))
+        fail("json_dumps encoded a circular reference!");
+
+    json_array_remove(json_array_get(json_array_get(json, 0), 0), 0);
+
+    result = json_dumps(json, 0);
+    if(!result || strcmp(result, "[[[]]]"))
+        fail("json_dumps failed!");
+    free(result);
+
+    json_decref(json);
+}
+
+static void encode_other_than_array_or_object()
+{
+    /* Encoding anything other than array or object should only
+     * succeed if the JSON_ENCODE_ANY flag is used */
+
+    json_t *json;
+    FILE *fp = NULL;
+    char *result;
+
+    json = json_string("foo");
+    if(json_dumps(json, 0) != NULL)
+        fail("json_dumps encoded a string!");
+    if(json_dumpf(json, fp, 0) == 0)
+        fail("json_dumpf encoded a string!");
+
+    result = json_dumps(json, JSON_ENCODE_ANY);
+    if(!result || strcmp(result, "\"foo\"") != 0)
+        fail("json_dumps failed to encode a string with JSON_ENCODE_ANY");
+
+    free(result);
+    json_decref(json);
+
+    json = json_integer(42);
+    if(json_dumps(json, 0) != NULL)
+        fail("json_dumps encoded an integer!");
+    if(json_dumpf(json, fp, 0) == 0)
+        fail("json_dumpf encoded an integer!");
+
+    result = json_dumps(json, JSON_ENCODE_ANY);
+    if(!result || strcmp(result, "42") != 0)
+        fail("json_dumps failed to encode an integer with JSON_ENCODE_ANY");
+
+    free(result);
+    json_decref(json);
+
+
+}
+
+static void escape_slashes()
+{
+    /* Test dump escaping slashes */
+
+    json_t *json;
+    char *result;
+
+    json = json_object();
+    json_object_set_new(json, "url", json_string("https://github.com/akheron/jansson"));
+
+    result = json_dumps(json, 0);
+    if(!result || strcmp(result, "{\"url\": \"https://github.com/akheron/jansson\"}"))
+        fail("json_dumps failed to not escape slashes");
+
+    free(result);
+
+    result = json_dumps(json, JSON_ESCAPE_SLASH);
+    if(!result || strcmp(result, "{\"url\": \"https:\\/\\/github.com\\/akheron\\/jansson\"}"))
+        fail("json_dumps failed to escape slashes");
+
+    free(result);
+    json_decref(json);
+}
+
+static void encode_nul_byte()
+{
+    json_t *json;
+    char *result;
+
+    json = json_stringn("nul byte \0 in string", 20);
+    result = json_dumps(json, JSON_ENCODE_ANY);
+    if(!result || memcmp(result, "\"nul byte \\u0000 in string\"", 27))
+        fail("json_dumps failed to dump an embedded NUL byte");
+
+    free(result);
+    json_decref(json);
+}
+
+static void run_tests()
+{
+    encode_null();
+    encode_twice();
+    circular_references();
+    encode_other_than_array_or_object();
+    escape_slashes();
+    encode_nul_byte();
+}

Added: vendor/jansson/dist/test/suites/api/test_dump_callback.c
===================================================================
--- vendor/jansson/dist/test/suites/api/test_dump_callback.c	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/test_dump_callback.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,81 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <jansson.h>
+#include <string.h>
+#include <stdlib.h>
+#include "util.h"
+
+struct my_sink {
+    char *buf;
+    size_t off;
+    size_t cap;
+};
+
+static int my_writer(const char *buffer, size_t len, void *data) {
+    struct my_sink *s = data;
+    if (len > s->cap - s->off) {
+        return -1;
+    }
+    memcpy(s->buf + s->off, buffer, len);
+    s->off += len;
+    return 0;
+}
+
+static void run_tests()
+{
+    struct my_sink s;
+    json_t *json;
+    const char str[] = "[\"A\", {\"B\": \"C\", \"e\": false}, 1, null, \"foo\"]";
+    char *dumped_to_string;
+
+    json = json_loads(str, 0, NULL);
+    if(!json) {
+        fail("json_loads failed");
+    }
+
+    dumped_to_string = json_dumps(json, 0);
+    if (!dumped_to_string) {
+        json_decref(json);
+        fail("json_dumps failed");
+    }
+
+    s.off = 0;
+    s.cap = strlen(dumped_to_string);
+    s.buf = malloc(s.cap);
+    if (!s.buf) {
+        json_decref(json);
+        free(dumped_to_string);
+        fail("malloc failed");
+    }
+
+    if (json_dump_callback(json, my_writer, &s, 0) == -1) {
+        json_decref(json);
+        free(dumped_to_string);
+        free(s.buf);
+        fail("json_dump_callback failed on an exact-length sink buffer");
+    }
+
+    if (strncmp(dumped_to_string, s.buf, s.off) != 0) {
+        json_decref(json);
+        free(dumped_to_string);
+        free(s.buf);
+        fail("json_dump_callback and json_dumps did not produce identical output");
+    }
+
+    s.off = 1;
+    if (json_dump_callback(json, my_writer, &s, 0) != -1) {
+        json_decref(json);
+        free(dumped_to_string);
+        free(s.buf);
+        fail("json_dump_callback succeeded on a short buffer when it should have failed");
+    }
+
+    json_decref(json);
+    free(dumped_to_string);
+    free(s.buf);
+}

Added: vendor/jansson/dist/test/suites/api/test_equal.c
===================================================================
--- vendor/jansson/dist/test/suites/api/test_equal.c	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/test_equal.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,189 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <jansson.h>
+#include "util.h"
+
+static void test_equal_simple()
+{
+    json_t *value1, *value2;
+
+    if(json_equal(NULL, NULL))
+        fail("json_equal fails for two NULLs");
+
+    value1 = json_true();
+    if(json_equal(value1, NULL) || json_equal(NULL, value1))
+        fail("json_equal fails for NULL");
+
+    /* this covers true, false and null as they are singletons */
+    if(!json_equal(value1, value1))
+        fail("identical objects are not equal");
+    json_decref(value1);
+
+    /* integer */
+    value1 = json_integer(1);
+    value2 = json_integer(1);
+    if(!value1 || !value2)
+        fail("unable to create integers");
+    if(!json_equal(value1, value2))
+        fail("json_equal fails for two equal integers");
+    json_decref(value2);
+
+    value2 = json_integer(2);
+    if(!value2)
+        fail("unable to create an integer");
+    if(json_equal(value1, value2))
+        fail("json_equal fails for two inequal integers");
+
+    json_decref(value1);
+    json_decref(value2);
+
+    /* real */
+    value1 = json_real(1.2);
+    value2 = json_real(1.2);
+    if(!value1 || !value2)
+        fail("unable to create reals");
+    if(!json_equal(value1, value2))
+        fail("json_equal fails for two equal reals");
+    json_decref(value2);
+
+    value2 = json_real(3.141592);
+    if(!value2)
+        fail("unable to create an real");
+    if(json_equal(value1, value2))
+        fail("json_equal fails for two inequal reals");
+
+    json_decref(value1);
+    json_decref(value2);
+
+    /* string */
+    value1 = json_string("foo");
+    value2 = json_string("foo");
+    if(!value1 || !value2)
+        fail("unable to create strings");
+    if(!json_equal(value1, value2))
+        fail("json_equal fails for two equal strings");
+    json_decref(value2);
+
+    value2 = json_string("bar");
+    if(!value2)
+        fail("unable to create an string");
+    if(json_equal(value1, value2))
+        fail("json_equal fails for two inequal strings");
+
+    json_decref(value1);
+    json_decref(value2);
+}
+
+static void test_equal_array()
+{
+    json_t *array1, *array2;
+
+    array1 = json_array();
+    array2 = json_array();
+    if(!array1 || !array2)
+        fail("unable to create arrays");
+
+    if(!json_equal(array1, array2))
+        fail("json_equal fails for two empty arrays");
+
+    json_array_append_new(array1, json_integer(1));
+    json_array_append_new(array2, json_integer(1));
+    json_array_append_new(array1, json_string("foo"));
+    json_array_append_new(array2, json_string("foo"));
+    json_array_append_new(array1, json_integer(2));
+    json_array_append_new(array2, json_integer(2));
+    if(!json_equal(array1, array2))
+        fail("json_equal fails for two equal arrays");
+
+    json_array_remove(array2, 2);
+    if(json_equal(array1, array2))
+        fail("json_equal fails for two inequal arrays");
+
+    json_array_append_new(array2, json_integer(3));
+    if(json_equal(array1, array2))
+        fail("json_equal fails for two inequal arrays");
+
+    json_decref(array1);
+    json_decref(array2);
+}
+
+static void test_equal_object()
+{
+    json_t *object1, *object2;
+
+    object1 = json_object();
+    object2 = json_object();
+    if(!object1 || !object2)
+        fail("unable to create objects");
+
+    if(!json_equal(object1, object2))
+        fail("json_equal fails for two empty objects");
+
+    json_object_set_new(object1, "a", json_integer(1));
+    json_object_set_new(object2, "a", json_integer(1));
+    json_object_set_new(object1, "b", json_string("foo"));
+    json_object_set_new(object2, "b", json_string("foo"));
+    json_object_set_new(object1, "c", json_integer(2));
+    json_object_set_new(object2, "c", json_integer(2));
+    if(!json_equal(object1, object2))
+        fail("json_equal fails for two equal objects");
+
+    json_object_del(object2, "c");
+    if(json_equal(object1, object2))
+        fail("json_equal fails for two inequal objects");
+
+    json_object_set_new(object2, "c", json_integer(3));
+    if(json_equal(object1, object2))
+        fail("json_equal fails for two inequal objects");
+
+    json_object_del(object2, "c");
+    json_object_set_new(object2, "d", json_integer(2));
+    if(json_equal(object1, object2))
+        fail("json_equal fails for two inequal objects");
+
+    json_decref(object1);
+    json_decref(object2);
+}
+
+static void test_equal_complex()
+{
+    json_t *value1, *value2;
+
+    const char *complex_json =
+"{"
+"    \"integer\": 1, "
+"    \"real\": 3.141592, "
+"    \"string\": \"foobar\", "
+"    \"true\": true, "
+"    \"object\": {"
+"        \"array-in-object\": [1,true,\"foo\",{}],"
+"        \"object-in-object\": {\"foo\": \"bar\"}"
+"    },"
+"    \"array\": [\"foo\", false, null, 1.234]"
+"}";
+
+    value1 = json_loads(complex_json, 0, NULL);
+    value2 = json_loads(complex_json, 0, NULL);
+    if(!value1 || !value2)
+        fail("unable to parse JSON");
+    if(!json_equal(value1, value2))
+        fail("json_equal fails for two inequal strings");
+
+    json_decref(value1);
+    json_decref(value2);
+
+    /* TODO: There's no negative test case here */
+}
+
+static void run_tests()
+{
+    test_equal_simple();
+    test_equal_array();
+    test_equal_object();
+    test_equal_complex();
+}

Added: vendor/jansson/dist/test/suites/api/test_load.c
===================================================================
--- vendor/jansson/dist/test/suites/api/test_load.c	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/test_load.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,187 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <jansson.h>
+#include <string.h>
+#include "util.h"
+
+static void file_not_found()
+{
+    json_t *json;
+    json_error_t error;
+    char *pos;
+
+    json = json_load_file("/path/to/nonexistent/file.json", 0, &error);
+    if(json)
+        fail("json_load_file returned non-NULL for a nonexistent file");
+    if(error.line != -1)
+        fail("json_load_file returned an invalid line number");
+
+    /* The error message is locale specific, only check the beginning
+       of the error message. */
+
+    pos = strchr(error.text, ':');
+    if(!pos)
+        fail("json_load_file returne an invalid error message");
+
+    *pos = '\0';
+
+    if(strcmp(error.text, "unable to open /path/to/nonexistent/file.json") != 0)
+        fail("json_load_file returned an invalid error message");
+}
+
+static void reject_duplicates()
+{
+    json_error_t error;
+
+    if(json_loads("{\"foo\": 1, \"foo\": 2}", JSON_REJECT_DUPLICATES, &error))
+        fail("json_loads did not detect a duplicate key");
+    check_error("duplicate object key near '\"foo\"'", "<string>", 1, 16, 16);
+}
+
+static void disable_eof_check()
+{
+    json_error_t error;
+    json_t *json;
+
+    const char *text = "{\"foo\": 1} garbage";
+
+    if(json_loads(text, 0, &error))
+        fail("json_loads did not detect garbage after JSON text");
+    check_error("end of file expected near 'garbage'", "<string>", 1, 18, 18);
+
+    json = json_loads(text, JSON_DISABLE_EOF_CHECK, &error);
+    if(!json)
+        fail("json_loads failed with JSON_DISABLE_EOF_CHECK");
+
+    json_decref(json);
+}
+
+static void decode_any()
+{
+    json_t *json;
+    json_error_t error;
+
+    json = json_loads("\"foo\"", JSON_DECODE_ANY, &error);
+    if (!json || !json_is_string(json))
+        fail("json_load decoded any failed - string");
+    json_decref(json);
+
+    json = json_loads("42", JSON_DECODE_ANY, &error);
+    if (!json || !json_is_integer(json))
+        fail("json_load decoded any failed - integer");
+    json_decref(json);
+
+    json = json_loads("true", JSON_DECODE_ANY, &error);
+    if (!json || !json_is_true(json))
+        fail("json_load decoded any failed - boolean");
+    json_decref(json);
+
+    json = json_loads("null", JSON_DECODE_ANY, &error);
+    if (!json || !json_is_null(json))
+        fail("json_load decoded any failed - null");
+    json_decref(json);
+}
+
+static void decode_int_as_real()
+{
+    json_t *json;
+    json_error_t error;
+
+#if JSON_INTEGER_IS_LONG_LONG
+    const char *imprecise;
+    json_int_t expected;
+#endif
+
+    json = json_loads("42", JSON_DECODE_INT_AS_REAL | JSON_DECODE_ANY, &error);
+    if (!json || !json_is_real(json) || json_real_value(json) != 42.0)
+        fail("json_load decode int as real failed - int");
+    json_decref(json);
+
+#if JSON_INTEGER_IS_LONG_LONG
+    /* This number cannot be represented exactly by a double */
+    imprecise = "9007199254740993";
+    expected = 9007199254740992ll;
+
+    json = json_loads(imprecise, JSON_DECODE_INT_AS_REAL | JSON_DECODE_ANY,
+                      &error);
+    if (!json || !json_is_real(json) || expected != (json_int_t)json_real_value(json))
+        fail("json_load decode int as real failed - expected imprecision");
+    json_decref(json);
+#endif
+}
+
+static void allow_nul()
+{
+    const char *text = "\"nul byte \\u0000 in string\"";
+    const char *expected = "nul byte \0 in string";
+    size_t len = 20;
+    json_t *json;
+
+    json = json_loads(text, JSON_ALLOW_NUL | JSON_DECODE_ANY, NULL);
+    if(!json || !json_is_string(json))
+        fail("unable to decode embedded NUL byte");
+
+    if(json_string_length(json) != len)
+        fail("decoder returned wrong string length");
+
+    if(memcmp(json_string_value(json), expected, len + 1))
+        fail("decoder returned wrong string content");
+
+    json_decref(json);
+}
+
+static void load_wrong_args()
+{
+    json_t *json;
+    json_error_t error;
+
+    json = json_loads(NULL, 0, &error);
+    if (json)
+        fail("json_loads should return NULL if the first argument is NULL");
+
+    json = json_loadb(NULL, 0, 0, &error);
+    if (json)
+        fail("json_loadb should return NULL if the first argument is NULL");
+
+    json = json_loadf(NULL, 0, &error);
+    if (json)
+        fail("json_loadf should return NULL if the first argument is NULL");
+
+    json = json_load_file(NULL, 0, &error);
+    if (json)
+        fail("json_loadf should return NULL if the first argument is NULL");
+}
+
+static void position()
+{
+    json_t *json;
+    size_t flags = JSON_DISABLE_EOF_CHECK;
+    json_error_t error;
+
+    json = json_loads("{\"foo\": \"bar\"}", 0, &error);
+    if(error.position != 14)
+        fail("json_loads returned a wrong position");
+    json_decref(json);
+
+    json = json_loads("{\"foo\": \"bar\"} baz quux", flags, &error);
+    if(error.position != 14)
+        fail("json_loads returned a wrong position");
+    json_decref(json);
+}
+
+static void run_tests()
+{
+    file_not_found();
+    reject_duplicates();
+    disable_eof_check();
+    decode_any();
+    decode_int_as_real();
+    allow_nul();
+    load_wrong_args();
+    position();
+}

Added: vendor/jansson/dist/test/suites/api/test_load_callback.c
===================================================================
--- vendor/jansson/dist/test/suites/api/test_load_callback.c	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/test_load_callback.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,75 @@
+/*
+ * Copyright (c) 2009-2011 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <jansson.h>
+#include <string.h>
+#include <stdlib.h>
+#include "util.h"
+
+struct my_source {
+    const char *buf;
+    size_t off;
+    size_t cap;
+};
+
+static const char my_str[] = "[\"A\", {\"B\": \"C\", \"e\": false}, 1, null, \"foo\"]";
+
+static size_t greedy_reader(void *buf, size_t buflen, void *arg)
+{
+    struct my_source *s = arg;
+    if (buflen > s->cap - s->off)
+        buflen = s->cap - s->off;
+    if (buflen > 0) {
+        memcpy(buf, s->buf + s->off, buflen);
+        s->off += buflen;
+        return buflen;
+    } else {
+        return 0;
+    }
+}
+
+static void run_tests()
+{
+    struct my_source s;
+    json_t *json;
+    json_error_t error;
+
+    s.off = 0;
+    s.cap = strlen(my_str);
+    s.buf = my_str;
+
+    json = json_load_callback(greedy_reader, &s, 0, &error);
+
+    if (!json)
+        fail("json_load_callback failed on a valid callback");
+    json_decref(json);
+
+    s.off = 0;
+    s.cap = strlen(my_str) - 1;
+    s.buf = my_str;
+
+    json = json_load_callback(greedy_reader, &s, 0, &error);
+    if (json) {
+        json_decref(json);
+        fail("json_load_callback should have failed on an incomplete stream, but it didn't");
+    }
+    if (strcmp(error.source, "<callback>") != 0) {
+        fail("json_load_callback returned an invalid error source");
+    }
+    if (strcmp(error.text, "']' expected near end of file") != 0) {
+        fail("json_load_callback returned an invalid error message for an unclosed top-level array");
+    }
+
+    json = json_load_callback(NULL, NULL, 0, &error);
+    if (json) {
+        json_decref(json);
+        fail("json_load_callback should have failed on NULL load callback, but it didn't");
+    }
+    if (strcmp(error.text, "wrong arguments") != 0) {
+        fail("json_load_callback returned an invalid error message for a NULL load callback");
+    }
+}

Added: vendor/jansson/dist/test/suites/api/test_loadb.c
===================================================================
--- vendor/jansson/dist/test/suites/api/test_loadb.c	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/test_loadb.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,36 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <jansson.h>
+#include <string.h>
+#include "util.h"
+
+static void run_tests()
+{
+    json_t *json;
+    json_error_t error;
+    const char str[] = "[\"A\", {\"B\": \"C\"}, 1, 2, 3]garbage";
+    size_t len = strlen(str) - strlen("garbage");
+
+    json = json_loadb(str, len, 0, &error);
+    if(!json) {
+        fail("json_loadb failed on a valid JSON buffer");
+    }
+    json_decref(json);
+
+    json = json_loadb(str, len - 1, 0, &error);
+    if (json) {
+        json_decref(json);
+        fail("json_loadb should have failed on an incomplete buffer, but it didn't");
+    }
+    if(error.line != 1) {
+        fail("json_loadb returned an invalid line number on fail");
+    }
+    if(strcmp(error.text, "']' expected near end of file") != 0) {
+        fail("json_loadb returned an invalid error message for an unclosed top-level array");
+    }
+}

Added: vendor/jansson/dist/test/suites/api/test_memory_funcs.c
===================================================================
--- vendor/jansson/dist/test/suites/api/test_memory_funcs.c	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/test_memory_funcs.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,82 @@
+#include <string.h>
+#include <jansson.h>
+
+#include "util.h"
+
+static int malloc_called = 0;
+static int free_called = 0;
+
+/* helper */
+static void create_and_free_complex_object()
+{
+    json_t *obj;
+
+    obj = json_pack("{s:i,s:n,s:b,s:b,s:{s:s},s:[i,i,i]",
+                    "foo", 42,
+                    "bar",
+                    "baz", 1,
+                    "qux", 0,
+                    "alice", "bar", "baz",
+                    "bob", 9, 8, 7);
+
+    json_decref(obj);
+}
+
+static void *my_malloc(size_t size)
+{
+    malloc_called = 1;
+    return malloc(size);
+}
+
+static void my_free(void *ptr)
+{
+    free_called = 1;
+    free(ptr);
+}
+
+static void test_simple()
+{
+    json_set_alloc_funcs(my_malloc, my_free);
+    create_and_free_complex_object();
+
+    if(malloc_called != 1 || free_called != 1)
+        fail("Custom allocation failed");
+}
+
+
+/*
+  Test the secure memory functions code given in the API reference
+  documentation, but by using plain memset instead of
+  guaranteed_memset().
+*/
+
+static void *secure_malloc(size_t size)
+{
+    /* Store the memory area size in the beginning of the block */
+    void *ptr = malloc(size + 8);
+    *((size_t *)ptr) = size;
+    return (char *)ptr + 8;
+}
+
+static void secure_free(void *ptr)
+{
+    size_t size;
+
+    ptr = (char *)ptr - 8;
+    size = *((size_t *)ptr);
+
+    /*guaranteed_*/memset(ptr, 0, size + 8);
+    free(ptr);
+}
+
+static void test_secure_funcs(void)
+{
+    json_set_alloc_funcs(secure_malloc, secure_free);
+    create_and_free_complex_object();
+}
+
+static void run_tests()
+{
+    test_simple();
+    test_secure_funcs();
+}

Added: vendor/jansson/dist/test/suites/api/test_number.c
===================================================================
--- vendor/jansson/dist/test/suites/api/test_number.c	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/test_number.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,73 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <math.h>
+#include <jansson.h>
+#include "util.h"
+
+static void run_tests()
+{
+    json_t *integer, *real;
+    json_int_t i;
+    double d;
+
+    integer = json_integer(5);
+    real = json_real(100.1);
+
+    if(!integer)
+        fail("unable to create integer");
+    if(!real)
+        fail("unable to create real");
+
+    i = json_integer_value(integer);
+    if(i != 5)
+        fail("wrong integer value");
+
+    d = json_real_value(real);
+    if(d != 100.1)
+        fail("wrong real value");
+
+    d = json_number_value(integer);
+    if(d != 5.0)
+        fail("wrong number value");
+    d = json_number_value(real);
+    if(d != 100.1)
+        fail("wrong number value");
+
+    json_decref(integer);
+    json_decref(real);
+
+#ifdef NAN
+    real = json_real(NAN);
+    if(real != NULL)
+        fail("could construct a real from NaN");
+
+    real = json_real(1.0);
+    if(json_real_set(real, NAN) != -1)
+        fail("could set a real to NaN");
+
+    if(json_real_value(real) != 1.0)
+        fail("real value changed unexpectedly");
+
+    json_decref(real);
+#endif
+
+#ifdef INFINITY
+    real = json_real(INFINITY);
+    if(real != NULL)
+        fail("could construct a real from Inf");
+
+    real = json_real(1.0);
+    if(json_real_set(real, INFINITY) != -1)
+        fail("could set a real to Inf");
+
+    if(json_real_value(real) != 1.0)
+        fail("real value changed unexpectedly");
+
+    json_decref(real);
+#endif
+}

Added: vendor/jansson/dist/test/suites/api/test_object.c
===================================================================
--- vendor/jansson/dist/test/suites/api/test_object.c	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/test_object.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,527 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <jansson.h>
+#include <string.h>
+#include "util.h"
+
+static void test_clear()
+{
+    json_t *object, *ten;
+
+    object = json_object();
+    ten = json_integer(10);
+
+    if(!object)
+        fail("unable to create object");
+    if(!ten)
+        fail("unable to create integer");
+
+    if(json_object_set(object, "a", ten) ||
+       json_object_set(object, "b", ten) ||
+       json_object_set(object, "c", ten) ||
+       json_object_set(object, "d", ten) ||
+       json_object_set(object, "e", ten))
+        fail("unable to set value");
+
+    if(json_object_size(object) != 5)
+        fail("invalid size");
+
+    json_object_clear(object);
+
+    if(json_object_size(object) != 0)
+        fail("invalid size after clear");
+
+    json_decref(ten);
+    json_decref(object);
+}
+
+static void test_update()
+{
+    json_t *object, *other, *nine, *ten;
+
+    object = json_object();
+    other = json_object();
+
+    nine = json_integer(9);
+    ten = json_integer(10);
+
+    if(!object || !other)
+        fail("unable to create object");
+    if(!nine || !ten)
+        fail("unable to create integer");
+
+
+    /* update an empty object with an empty object */
+
+    if(json_object_update(object, other))
+        fail("unable to update an emtpy object with an empty object");
+
+    if(json_object_size(object) != 0)
+        fail("invalid size after update");
+
+    if(json_object_size(other) != 0)
+        fail("invalid size for updater after update");
+
+
+    /* update an empty object with a nonempty object */
+
+    if(json_object_set(other, "a", ten) ||
+       json_object_set(other, "b", ten) ||
+       json_object_set(other, "c", ten) ||
+       json_object_set(other, "d", ten) ||
+       json_object_set(other, "e", ten))
+        fail("unable to set value");
+
+    if(json_object_update(object, other))
+        fail("unable to update an empty object");
+
+    if(json_object_size(object) != 5)
+        fail("invalid size after update");
+
+    if(json_object_get(object, "a") != ten ||
+       json_object_get(object, "b") != ten ||
+       json_object_get(object, "c") != ten ||
+       json_object_get(object, "d") != ten ||
+       json_object_get(object, "e") != ten)
+        fail("update works incorrectly");
+
+
+    /* perform the same update again */
+
+    if(json_object_update(object, other))
+        fail("unable to update a non-empty object");
+
+    if(json_object_size(object) != 5)
+        fail("invalid size after update");
+
+    if(json_object_get(object, "a") != ten ||
+       json_object_get(object, "b") != ten ||
+       json_object_get(object, "c") != ten ||
+       json_object_get(object, "d") != ten ||
+       json_object_get(object, "e") != ten)
+        fail("update works incorrectly");
+
+
+    /* update a nonempty object with a nonempty object with both old
+       and new keys */
+
+    if(json_object_clear(other))
+        fail("clear failed");
+
+    if(json_object_set(other, "a", nine) ||
+       json_object_set(other, "b", nine) ||
+       json_object_set(other, "f", nine) ||
+       json_object_set(other, "g", nine) ||
+       json_object_set(other, "h", nine))
+        fail("unable to set value");
+
+    if(json_object_update(object, other))
+        fail("unable to update a nonempty object");
+
+    if(json_object_size(object) != 8)
+        fail("invalid size after update");
+
+    if(json_object_get(object, "a") != nine ||
+       json_object_get(object, "b") != nine ||
+       json_object_get(object, "f") != nine ||
+       json_object_get(object, "g") != nine ||
+       json_object_get(object, "h") != nine)
+        fail("update works incorrectly");
+
+    json_decref(nine);
+    json_decref(ten);
+    json_decref(other);
+    json_decref(object);
+}
+
+static void test_conditional_updates()
+{
+    json_t *object, *other;
+
+    object = json_pack("{sisi}", "foo", 1, "bar", 2);
+    other = json_pack("{sisi}", "foo", 3, "baz", 4);
+
+    if(json_object_update_existing(object, other))
+        fail("json_object_update_existing failed");
+
+    if(json_object_size(object) != 2)
+        fail("json_object_update_existing added new items");
+
+    if(json_integer_value(json_object_get(object, "foo")) != 3)
+        fail("json_object_update_existing failed to update existing key");
+
+    if(json_integer_value(json_object_get(object, "bar")) != 2)
+        fail("json_object_update_existing updated wrong key");
+
+    json_decref(object);
+
+    object = json_pack("{sisi}", "foo", 1, "bar", 2);
+
+    if(json_object_update_missing(object, other))
+        fail("json_object_update_missing failed");
+
+    if(json_object_size(object) != 3)
+        fail("json_object_update_missing didn't add new items");
+
+    if(json_integer_value(json_object_get(object, "foo")) != 1)
+        fail("json_object_update_missing updated existing key");
+
+    if(json_integer_value(json_object_get(object, "bar")) != 2)
+        fail("json_object_update_missing updated wrong key");
+
+    if(json_integer_value(json_object_get(object, "baz")) != 4)
+        fail("json_object_update_missing didn't add new items");
+
+    json_decref(object);
+    json_decref(other);
+}
+
+static void test_circular()
+{
+    json_t *object1, *object2;
+
+    object1 = json_object();
+    object2 = json_object();
+    if(!object1 || !object2)
+        fail("unable to create object");
+
+    /* the simple case is checked */
+    if(json_object_set(object1, "a", object1) == 0)
+        fail("able to set self");
+
+    /* create circular references */
+    if(json_object_set(object1, "a", object2) ||
+       json_object_set(object2, "a", object1))
+        fail("unable to set value");
+
+    /* circularity is detected when dumping */
+    if(json_dumps(object1, 0) != NULL)
+        fail("able to dump circulars");
+
+    /* decref twice to deal with the circular references */
+    json_decref(object1);
+    json_decref(object2);
+    json_decref(object1);
+}
+
+static void test_set_nocheck()
+{
+    json_t *object, *string;
+
+    object = json_object();
+    string = json_string("bar");
+
+    if(!object)
+        fail("unable to create object");
+    if(!string)
+        fail("unable to create string");
+
+    if(json_object_set_nocheck(object, "foo", string))
+        fail("json_object_set_nocheck failed");
+    if(json_object_get(object, "foo") != string)
+        fail("json_object_get after json_object_set_nocheck failed");
+
+    /* invalid UTF-8 in key */
+    if(json_object_set_nocheck(object, "a\xefz", string))
+        fail("json_object_set_nocheck failed for invalid UTF-8");
+    if(json_object_get(object, "a\xefz") != string)
+        fail("json_object_get after json_object_set_nocheck failed");
+
+    if(json_object_set_new_nocheck(object, "bax", json_integer(123)))
+        fail("json_object_set_new_nocheck failed");
+    if(json_integer_value(json_object_get(object, "bax")) != 123)
+        fail("json_object_get after json_object_set_new_nocheck failed");
+
+    /* invalid UTF-8 in key */
+    if(json_object_set_new_nocheck(object, "asdf\xfe", json_integer(321)))
+        fail("json_object_set_new_nocheck failed for invalid UTF-8");
+    if(json_integer_value(json_object_get(object, "asdf\xfe")) != 321)
+        fail("json_object_get after json_object_set_new_nocheck failed");
+
+    json_decref(string);
+    json_decref(object);
+}
+
+static void test_iterators()
+{
+    int i;
+    json_t *object, *foo, *bar, *baz;
+    const char *iter_keys[3];
+    int have_key[3] = { 0, 0, 0 };
+    json_t *iter_values[3];
+    void *iter;
+
+    if(json_object_iter(NULL))
+        fail("able to iterate over NULL");
+
+    if(json_object_iter_next(NULL, NULL))
+        fail("able to increment an iterator on a NULL object");
+
+    object = json_object();
+    foo = json_string("foo");
+    bar = json_string("bar");
+    baz = json_string("baz");
+    if(!object || !foo || !bar || !bar)
+        fail("unable to create values");
+
+    if(json_object_iter_next(object, NULL))
+        fail("able to increment a NULL iterator");
+
+    if(json_object_set(object, "a", foo) ||
+       json_object_set(object, "b", bar) ||
+       json_object_set(object, "c", baz))
+        fail("unable to populate object");
+
+    iter = json_object_iter(object);
+    if(!iter)
+        fail("unable to get iterator");
+    iter_keys[0] = json_object_iter_key(iter);
+    iter_values[0] = json_object_iter_value(iter);
+
+    iter = json_object_iter_next(object, iter);
+    if(!iter)
+        fail("unable to increment iterator");
+    iter_keys[1] = json_object_iter_key(iter);
+    iter_values[1] = json_object_iter_value(iter);
+
+    iter = json_object_iter_next(object, iter);
+    if(!iter)
+        fail("unable to increment iterator");
+    iter_keys[2] = json_object_iter_key(iter);
+    iter_values[2] = json_object_iter_value(iter);
+
+    if(json_object_iter_next(object, iter) != NULL)
+        fail("able to iterate over the end");
+
+    /* Check that keys have correct values */
+    for (i = 0; i < 3; i++) {
+        if (strcmp(iter_keys[i], "a") == 0) {
+            if (iter_values[i] != foo)
+                fail("wrong value for iter key a");
+            else
+                have_key[0] = 1;
+        } else if (strcmp(iter_keys[i], "b") == 0) {
+            if (iter_values[i] != bar)
+                fail("wrong value for iter key b");
+            else
+                have_key[1] = 1;
+        } else if (strcmp(iter_keys[i], "c") == 0) {
+            if (iter_values[i] != baz)
+                fail("wrong value for iter key c");
+            else
+                have_key[2] = 1;
+        }
+    }
+
+    /* Check that we got all keys */
+    for(i = 0; i < 3; i++) {
+        if(!have_key[i])
+            fail("a key wasn't iterated over");
+    }
+
+    if(json_object_iter_at(object, "foo"))
+        fail("json_object_iter_at() succeeds for non-existent key");
+
+    iter = json_object_iter_at(object, "b");
+    if(!iter)
+        fail("json_object_iter_at() fails for an existing key");
+
+    if(strcmp(json_object_iter_key(iter), "b"))
+        fail("iterating failed: wrong key");
+    if(json_object_iter_value(iter) != bar)
+        fail("iterating failed: wrong value");
+
+    if(json_object_iter_set(object, iter, baz))
+        fail("unable to set value at iterator");
+
+    if(strcmp(json_object_iter_key(iter), "b"))
+        fail("json_object_iter_key() fails after json_object_iter_set()");
+    if(json_object_iter_value(iter) != baz)
+        fail("json_object_iter_value() fails after json_object_iter_set()");
+    if(json_object_get(object, "b") != baz)
+        fail("json_object_get() fails after json_object_iter_set()");
+
+    json_decref(object);
+    json_decref(foo);
+    json_decref(bar);
+    json_decref(baz);
+}
+
+static void test_misc()
+{
+    json_t *object, *string, *other_string, *value;
+
+    object = json_object();
+    string = json_string("test");
+    other_string = json_string("other");
+
+    if(!object)
+        fail("unable to create object");
+    if(!string || !other_string)
+        fail("unable to create string");
+
+    if(json_object_get(object, "a"))
+        fail("value for nonexisting key");
+
+    if(json_object_set(object, "a", string))
+        fail("unable to set value");
+
+    if(!json_object_set(object, NULL, string))
+        fail("able to set NULL key");
+
+    if(!json_object_set(object, "a", NULL))
+        fail("able to set NULL value");
+
+    /* invalid UTF-8 in key */
+    if(!json_object_set(object, "a\xefz", string))
+        fail("able to set invalid unicode key");
+
+    value = json_object_get(object, "a");
+    if(!value)
+        fail("no value for existing key");
+    if(value != string)
+        fail("got different value than what was added");
+
+    /* "a", "lp" and "px" collide in a five-bucket hashtable */
+    if(json_object_set(object, "b", string) ||
+       json_object_set(object, "lp", string) ||
+       json_object_set(object, "px", string))
+        fail("unable to set value");
+
+    value = json_object_get(object, "a");
+    if(!value)
+        fail("no value for existing key");
+    if(value != string)
+        fail("got different value than what was added");
+
+    if(json_object_set(object, "a", other_string))
+        fail("unable to replace an existing key");
+
+    value = json_object_get(object, "a");
+    if(!value)
+        fail("no value for existing key");
+    if(value != other_string)
+        fail("got different value than what was set");
+
+    if(!json_object_del(object, "nonexisting"))
+        fail("able to delete a nonexisting key");
+
+    if(json_object_del(object, "px"))
+        fail("unable to delete an existing key");
+
+    if(json_object_del(object, "a"))
+        fail("unable to delete an existing key");
+
+    if(json_object_del(object, "lp"))
+        fail("unable to delete an existing key");
+
+
+    /* add many keys to initiate rehashing */
+
+    if(json_object_set(object, "a", string))
+        fail("unable to set value");
+
+    if(json_object_set(object, "lp", string))
+        fail("unable to set value");
+
+    if(json_object_set(object, "px", string))
+        fail("unable to set value");
+
+    if(json_object_set(object, "c", string))
+        fail("unable to set value");
+
+    if(json_object_set(object, "d", string))
+        fail("unable to set value");
+
+    if(json_object_set(object, "e", string))
+        fail("unable to set value");
+
+
+    if(json_object_set_new(object, "foo", json_integer(123)))
+        fail("unable to set new value");
+
+    value = json_object_get(object, "foo");
+    if(!json_is_integer(value) || json_integer_value(value) != 123)
+        fail("json_object_set_new works incorrectly");
+
+    if(!json_object_set_new(object, NULL, json_integer(432)))
+        fail("able to set_new NULL key");
+
+    if(!json_object_set_new(object, "foo", NULL))
+        fail("able to set_new NULL value");
+
+    json_decref(string);
+    json_decref(other_string);
+    json_decref(object);
+}
+
+static void test_preserve_order()
+{
+    json_t *object;
+    char *result;
+
+    const char *expected = "{\"foobar\": 1, \"bazquux\": 6, \"lorem ipsum\": 3, \"sit amet\": 5, \"helicopter\": 7}";
+
+    object = json_object();
+
+    json_object_set_new(object, "foobar", json_integer(1));
+    json_object_set_new(object, "bazquux", json_integer(2));
+    json_object_set_new(object, "lorem ipsum", json_integer(3));
+    json_object_set_new(object, "dolor", json_integer(4));
+    json_object_set_new(object, "sit amet", json_integer(5));
+
+    /* changing a value should preserve the order */
+    json_object_set_new(object, "bazquux", json_integer(6));
+
+    /* deletion shouldn't change the order of others */
+    json_object_del(object, "dolor");
+
+    /* add a new item just to make sure */
+    json_object_set_new(object, "helicopter", json_integer(7));
+
+    result = json_dumps(object, JSON_PRESERVE_ORDER);
+
+    if(strcmp(expected, result) != 0) {
+        fprintf(stderr, "%s != %s", expected, result);
+        fail("JSON_PRESERVE_ORDER doesn't work");
+    }
+
+    free(result);
+    json_decref(object);
+}
+
+static void test_object_foreach()
+{
+    const char *key;
+    json_t *object1, *object2, *value;
+
+    object1 = json_pack("{sisisi}", "foo", 1, "bar", 2, "baz", 3);
+    object2 = json_object();
+
+    json_object_foreach(object1, key, value)
+        json_object_set(object2, key, value);
+
+    if(!json_equal(object1, object2))
+        fail("json_object_foreach failed to iterate all key-value pairs");
+
+    json_decref(object1);
+    json_decref(object2);
+}
+
+static void run_tests()
+{
+    test_misc();
+    test_clear();
+    test_update();
+    test_conditional_updates();
+    test_circular();
+    test_set_nocheck();
+    test_iterators();
+    test_preserve_order();
+    test_object_foreach();
+}

Added: vendor/jansson/dist/test/suites/api/test_pack.c
===================================================================
--- vendor/jansson/dist/test/suites/api/test_pack.c	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/test_pack.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,307 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ * Copyright (c) 2010-2012 Graeme Smecher <graeme.smecher at mail.mcgill.ca>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifdef HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#include <jansson_config.h>
+
+#include <string.h>
+#include <jansson.h>
+#include <stdio.h>
+#include "util.h"
+
+static void run_tests()
+{
+    json_t *value;
+    int i;
+    char buffer[4] = {'t', 'e', 's', 't'};
+    json_error_t error;
+
+    /*
+     * Simple, valid json_pack cases
+     */
+    /* true */
+    value = json_pack("b", 1);
+    if(!json_is_true(value))
+        fail("json_pack boolean failed");
+    if(value->refcount != (size_t)-1)
+        fail("json_pack boolean refcount failed");
+    json_decref(value);
+
+    /* false */
+    value = json_pack("b", 0);
+    if(!json_is_false(value))
+        fail("json_pack boolean failed");
+    if(value->refcount != (size_t)-1)
+        fail("json_pack boolean refcount failed");
+    json_decref(value);
+
+    /* null */
+    value = json_pack("n");
+    if(!json_is_null(value))
+        fail("json_pack null failed");
+    if(value->refcount != (size_t)-1)
+        fail("json_pack null refcount failed");
+    json_decref(value);
+
+    /* integer */
+    value = json_pack("i", 1);
+    if(!json_is_integer(value) || json_integer_value(value) != 1)
+        fail("json_pack integer failed");
+    if(value->refcount != (size_t)1)
+        fail("json_pack integer refcount failed");
+    json_decref(value);
+
+    /* integer from json_int_t */
+    value = json_pack("I", (json_int_t)555555);
+    if(!json_is_integer(value) || json_integer_value(value) != 555555)
+        fail("json_pack json_int_t failed");
+    if(value->refcount != (size_t)1)
+        fail("json_pack integer refcount failed");
+    json_decref(value);
+
+    /* real */
+    value = json_pack("f", 1.0);
+    if(!json_is_real(value) || json_real_value(value) != 1.0)
+        fail("json_pack real failed");
+    if(value->refcount != (size_t)1)
+        fail("json_pack real refcount failed");
+    json_decref(value);
+
+    /* string */
+    value = json_pack("s", "test");
+    if(!json_is_string(value) || strcmp("test", json_string_value(value)))
+        fail("json_pack string failed");
+    if(value->refcount != (size_t)1)
+        fail("json_pack string refcount failed");
+    json_decref(value);
+
+    /* string and length (int) */
+    value = json_pack("s#", "test asdf", 4);
+    if(!json_is_string(value) || strcmp("test", json_string_value(value)))
+        fail("json_pack string and length failed");
+    if(value->refcount != (size_t)1)
+        fail("json_pack string and length refcount failed");
+    json_decref(value);
+
+    /* string and length (size_t) */
+    value = json_pack("s%", "test asdf", (size_t)4);
+    if(!json_is_string(value) || strcmp("test", json_string_value(value)))
+        fail("json_pack string and length failed");
+    if(value->refcount != (size_t)1)
+        fail("json_pack string and length refcount failed");
+    json_decref(value);
+
+    /* string and length (int), non-NUL terminated string */
+    value = json_pack("s#", buffer, 4);
+    if(!json_is_string(value) || strcmp("test", json_string_value(value)))
+        fail("json_pack string and length (int) failed");
+    if(value->refcount != (size_t)1)
+        fail("json_pack string and length (int) refcount failed");
+    json_decref(value);
+
+    /* string and length (size_t), non-NUL terminated string */
+    value = json_pack("s%", buffer, (size_t)4);
+    if(!json_is_string(value) || strcmp("test", json_string_value(value)))
+        fail("json_pack string and length (size_t) failed");
+    if(value->refcount != (size_t)1)
+        fail("json_pack string and length (size_t) refcount failed");
+    json_decref(value);
+
+    /* string concatenation */
+    value = json_pack("s++", "te", "st", "ing");
+    if(!json_is_string(value) || strcmp("testing", json_string_value(value)))
+        fail("json_pack string concatenation failed");
+    if(value->refcount != (size_t)1)
+        fail("json_pack string concatenation refcount failed");
+    json_decref(value);
+
+    /* string concatenation and length (int) */
+    value = json_pack("s#+#+", "test", 1, "test", 2, "test");
+    if(!json_is_string(value) || strcmp("ttetest", json_string_value(value)))
+        fail("json_pack string concatenation and length (int) failed");
+    if(value->refcount != (size_t)1)
+        fail("json_pack string concatenation and length (int) refcount failed");
+    json_decref(value);
+
+    /* string concatenation and length (size_t) */
+    value = json_pack("s%+%+", "test", (size_t)1, "test", (size_t)2, "test");
+    if(!json_is_string(value) || strcmp("ttetest", json_string_value(value)))
+        fail("json_pack string concatenation and length (size_t) failed");
+    if(value->refcount != (size_t)1)
+        fail("json_pack string concatenation and length (size_t) refcount failed");
+    json_decref(value);
+
+    /* empty object */
+    value = json_pack("{}", 1.0);
+    if(!json_is_object(value) || json_object_size(value) != 0)
+        fail("json_pack empty object failed");
+    if(value->refcount != (size_t)1)
+        fail("json_pack empty object refcount failed");
+    json_decref(value);
+
+    /* empty list */
+    value = json_pack("[]", 1.0);
+    if(!json_is_array(value) || json_array_size(value) != 0)
+        fail("json_pack empty list failed");
+    if(value->refcount != (size_t)1)
+        fail("json_pack empty list failed");
+    json_decref(value);
+
+    /* non-incref'd object */
+    value = json_pack("o", json_integer(1));
+    if(!json_is_integer(value) || json_integer_value(value) != 1)
+        fail("json_pack object failed");
+    if(value->refcount != (size_t)1)
+        fail("json_pack integer refcount failed");
+    json_decref(value);
+
+    /* incref'd object */
+    value = json_pack("O", json_integer(1));
+    if(!json_is_integer(value) || json_integer_value(value) != 1)
+        fail("json_pack object failed");
+    if(value->refcount != (size_t)2)
+        fail("json_pack integer refcount failed");
+    json_decref(value);
+    json_decref(value);
+
+    /* simple object */
+    value = json_pack("{s:[]}", "foo");
+    if(!json_is_object(value) || json_object_size(value) != 1)
+        fail("json_pack array failed");
+    if(!json_is_array(json_object_get(value, "foo")))
+        fail("json_pack array failed");
+    if(json_object_get(value, "foo")->refcount != (size_t)1)
+        fail("json_pack object refcount failed");
+    json_decref(value);
+
+    /* object with complex key */
+    value = json_pack("{s+#+: []}", "foo", "barbar", 3, "baz");
+    if(!json_is_object(value) || json_object_size(value) != 1)
+        fail("json_pack array failed");
+    if(!json_is_array(json_object_get(value, "foobarbaz")))
+        fail("json_pack array failed");
+    if(json_object_get(value, "foobarbaz")->refcount != (size_t)1)
+        fail("json_pack object refcount failed");
+    json_decref(value);
+
+    /* simple array */
+    value = json_pack("[i,i,i]", 0, 1, 2);
+    if(!json_is_array(value) || json_array_size(value) != 3)
+        fail("json_pack object failed");
+    for(i=0; i<3; i++)
+    {
+        if(!json_is_integer(json_array_get(value, i)) ||
+           json_integer_value(json_array_get(value, i)) != i)
+
+            fail("json_pack integer array failed");
+    }
+    json_decref(value);
+
+    /* Whitespace; regular string */
+    value = json_pack(" s ", "test");
+    if(!json_is_string(value) || strcmp("test", json_string_value(value)))
+        fail("json_pack string (with whitespace) failed");
+    json_decref(value);
+
+    /* Whitespace; empty array */
+    value = json_pack("[ ]");
+    if(!json_is_array(value) || json_array_size(value) != 0)
+        fail("json_pack empty array (with whitespace) failed");
+    json_decref(value);
+
+    /* Whitespace; array */
+    value = json_pack("[ i , i,  i ] ", 1, 2, 3);
+    if(!json_is_array(value) || json_array_size(value) != 3)
+        fail("json_pack array (with whitespace) failed");
+    json_decref(value);
+
+    /*
+     * Invalid cases
+     */
+
+    /* newline in format string */
+    if(json_pack_ex(&error, 0, "{\n\n1"))
+        fail("json_pack failed to catch invalid format '1'");
+    check_error("Expected format 's', got '1'", "<format>", 3, 1, 4);
+
+    /* mismatched open/close array/object */
+    if(json_pack_ex(&error, 0, "[}"))
+        fail("json_pack failed to catch mismatched '}'");
+    check_error("Unexpected format character '}'", "<format>", 1, 2, 2);
+
+    if(json_pack_ex(&error, 0, "{]"))
+        fail("json_pack failed to catch mismatched ']'");
+    check_error("Expected format 's', got ']'", "<format>", 1, 2, 2);
+
+    /* missing close array */
+    if(json_pack_ex(&error, 0, "["))
+        fail("json_pack failed to catch missing ']'");
+    check_error("Unexpected end of format string", "<format>", 1, 2, 2);
+
+    /* missing close object */
+    if(json_pack_ex(&error, 0, "{"))
+        fail("json_pack failed to catch missing '}'");
+    check_error("Unexpected end of format string", "<format>", 1, 2, 2);
+
+    /* garbage after format string */
+    if(json_pack_ex(&error, 0, "[i]a", 42))
+        fail("json_pack failed to catch garbage after format string");
+    check_error("Garbage after format string", "<format>", 1, 4, 4);
+
+    if(json_pack_ex(&error, 0, "ia", 42))
+        fail("json_pack failed to catch garbage after format string");
+    check_error("Garbage after format string", "<format>", 1, 2, 2);
+
+    /* NULL string */
+    if(json_pack_ex(&error, 0, "s", NULL))
+        fail("json_pack failed to catch null argument string");
+    check_error("NULL string argument", "<args>", 1, 1, 1);
+
+    /* + on its own */
+    if(json_pack_ex(&error, 0, "+", NULL))
+        fail("json_pack failed to a lone +");
+    check_error("Unexpected format character '+'", "<format>", 1, 1, 1);
+
+    /* NULL format */
+    if(json_pack_ex(&error, 0, NULL))
+        fail("json_pack failed to catch NULL format string");
+    check_error("NULL or empty format string", "<format>", -1, -1, 0);
+
+    /* NULL key */
+    if(json_pack_ex(&error, 0, "{s:i}", NULL, 1))
+        fail("json_pack failed to catch NULL key");
+    check_error("NULL string argument", "<args>", 1, 2, 2);
+
+    /* More complicated checks for row/columns */
+    if(json_pack_ex(&error, 0, "{ {}: s }", "foo"))
+        fail("json_pack failed to catch object as key");
+    check_error("Expected format 's', got '{'", "<format>", 1, 3, 3);
+
+    /* Complex object */
+    if(json_pack_ex(&error, 0, "{ s: {},  s:[ii{} }", "foo", "bar", 12, 13))
+        fail("json_pack failed to catch missing ]");
+    check_error("Unexpected format character '}'", "<format>", 1, 19, 19);
+
+    /* Complex array */
+    if(json_pack_ex(&error, 0, "[[[[[   [[[[[  [[[[ }]]]] ]]]] ]]]]]"))
+        fail("json_pack failed to catch extra }");
+    check_error("Unexpected format character '}'", "<format>", 1, 21, 21);
+
+    /* Invalid UTF-8 in object key */
+    if(json_pack_ex(&error, 0, "{s:i}", "\xff\xff", 42))
+        fail("json_pack failed to catch invalid UTF-8 in an object key");
+    check_error("Invalid UTF-8 object key", "<args>", 1, 2, 2);
+
+    /* Invalid UTF-8 in a string */
+    if(json_pack_ex(&error, 0, "{s:s}", "foo", "\xff\xff"))
+        fail("json_pack failed to catch invalid UTF-8 in a string");
+    check_error("Invalid UTF-8 string", "<args>", 1, 4, 4);
+}

Added: vendor/jansson/dist/test/suites/api/test_simple.c
===================================================================
--- vendor/jansson/dist/test/suites/api/test_simple.c	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/test_simple.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,227 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <string.h>
+#include <jansson.h>
+#include "util.h"
+
+/* Call the simple functions not covered by other tests of the public API */
+static void run_tests()
+{
+    json_t *value;
+
+    value = json_boolean(1);
+    if(!json_is_true(value))
+        fail("json_boolean(1) failed");
+    json_decref(value);
+
+    value = json_boolean(-123);
+    if(!json_is_true(value))
+        fail("json_boolean(-123) failed");
+    json_decref(value);
+
+    value = json_boolean(0);
+    if(!json_is_false(value))
+        fail("json_boolean(0) failed");
+    if(json_boolean_value(value) != 0)
+        fail("json_boolean_value failed");
+    json_decref(value);
+
+
+    value = json_integer(1);
+    if(json_typeof(value) != JSON_INTEGER)
+        fail("json_typeof failed");
+
+    if(json_is_object(value))
+        fail("json_is_object failed");
+
+    if(json_is_array(value))
+        fail("json_is_array failed");
+
+    if(json_is_string(value))
+        fail("json_is_string failed");
+
+    if(!json_is_integer(value))
+        fail("json_is_integer failed");
+
+    if(json_is_real(value))
+        fail("json_is_real failed");
+
+    if(!json_is_number(value))
+        fail("json_is_number failed");
+
+    if(json_is_true(value))
+        fail("json_is_true failed");
+
+    if(json_is_false(value))
+        fail("json_is_false failed");
+
+    if(json_is_boolean(value))
+        fail("json_is_boolean failed");
+
+    if(json_is_null(value))
+        fail("json_is_null failed");
+
+    json_decref(value);
+
+
+    value = json_string("foo");
+    if(!value)
+        fail("json_string failed");
+    if(strcmp(json_string_value(value), "foo"))
+        fail("invalid string value");
+    if (json_string_length(value) != 3)
+        fail("invalid string length");
+
+    if(json_string_set(value, "barr"))
+        fail("json_string_set failed");
+    if(strcmp(json_string_value(value), "barr"))
+        fail("invalid string value");
+    if (json_string_length(value) != 4)
+        fail("invalid string length");
+
+    if(json_string_setn(value, "hi\0ho", 5))
+        fail("json_string_set failed");
+    if(memcmp(json_string_value(value), "hi\0ho\0", 6))
+        fail("invalid string value");
+    if (json_string_length(value) != 5)
+        fail("invalid string length");
+
+    json_decref(value);
+
+    value = json_string(NULL);
+    if(value)
+        fail("json_string(NULL) failed");
+
+    /* invalid UTF-8  */
+    value = json_string("a\xefz");
+    if(value)
+        fail("json_string(<invalid utf-8>) failed");
+
+    value = json_string_nocheck("foo");
+    if(!value)
+        fail("json_string_nocheck failed");
+    if(strcmp(json_string_value(value), "foo"))
+        fail("invalid string value");
+    if (json_string_length(value) != 3)
+        fail("invalid string length");
+
+    if(json_string_set_nocheck(value, "barr"))
+        fail("json_string_set_nocheck failed");
+    if(strcmp(json_string_value(value), "barr"))
+        fail("invalid string value");
+    if (json_string_length(value) != 4)
+        fail("invalid string length");
+
+    if(json_string_setn_nocheck(value, "hi\0ho", 5))
+        fail("json_string_set failed");
+    if(memcmp(json_string_value(value), "hi\0ho\0", 6))
+        fail("invalid string value");
+    if (json_string_length(value) != 5)
+        fail("invalid string length");
+
+    json_decref(value);
+
+    /* invalid UTF-8 */
+    value = json_string_nocheck("qu\xff");
+    if(!value)
+        fail("json_string_nocheck failed");
+    if(strcmp(json_string_value(value), "qu\xff"))
+        fail("invalid string value");
+    if (json_string_length(value) != 3)
+        fail("invalid string length");
+
+    if(json_string_set_nocheck(value, "\xfd\xfe\xff"))
+        fail("json_string_set_nocheck failed");
+    if(strcmp(json_string_value(value), "\xfd\xfe\xff"))
+        fail("invalid string value");
+    if (json_string_length(value) != 3)
+        fail("invalid string length");
+
+    json_decref(value);
+
+
+    value = json_integer(123);
+    if(!value)
+        fail("json_integer failed");
+    if(json_integer_value(value) != 123)
+        fail("invalid integer value");
+    if(json_number_value(value) != 123.0)
+        fail("invalid number value");
+
+    if(json_integer_set(value, 321))
+        fail("json_integer_set failed");
+    if(json_integer_value(value) != 321)
+        fail("invalid integer value");
+    if(json_number_value(value) != 321.0)
+        fail("invalid number value");
+
+    json_decref(value);
+
+    value = json_real(123.123);
+    if(!value)
+        fail("json_real failed");
+    if(json_real_value(value) != 123.123)
+        fail("invalid integer value");
+    if(json_number_value(value) != 123.123)
+        fail("invalid number value");
+
+    if(json_real_set(value, 321.321))
+        fail("json_real_set failed");
+    if(json_real_value(value) != 321.321)
+        fail("invalid real value");
+    if(json_number_value(value) != 321.321)
+        fail("invalid number value");
+
+    json_decref(value);
+
+    value = json_true();
+    if(!value)
+        fail("json_true failed");
+    json_decref(value);
+
+    value = json_false();
+    if(!value)
+        fail("json_false failed");
+    json_decref(value);
+
+    value = json_null();
+    if(!value)
+        fail("json_null failed");
+    json_decref(value);
+
+    /* Test reference counting on singletons (true, false, null) */
+    value = json_true();
+    if(value->refcount != (size_t)-1)
+      fail("refcounting true works incorrectly");
+    json_decref(value);
+    if(value->refcount != (size_t)-1)
+      fail("refcounting true works incorrectly");
+    json_incref(value);
+    if(value->refcount != (size_t)-1)
+      fail("refcounting true works incorrectly");
+
+    value = json_false();
+    if(value->refcount != (size_t)-1)
+      fail("refcounting false works incorrectly");
+    json_decref(value);
+    if(value->refcount != (size_t)-1)
+      fail("refcounting false works incorrectly");
+    json_incref(value);
+    if(value->refcount != (size_t)-1)
+      fail("refcounting false works incorrectly");
+
+    value = json_null();
+    if(value->refcount != (size_t)-1)
+      fail("refcounting null works incorrectly");
+    json_decref(value);
+    if(value->refcount != (size_t)-1)
+      fail("refcounting null works incorrectly");
+    json_incref(value);
+    if(value->refcount != (size_t)-1)
+      fail("refcounting null works incorrectly");
+}

Added: vendor/jansson/dist/test/suites/api/test_unpack.c
===================================================================
--- vendor/jansson/dist/test/suites/api/test_unpack.c	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/test_unpack.c	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,400 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ * Copyright (c) 2010-2012 Graeme Smecher <graeme.smecher at mail.mcgill.ca>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <string.h>
+#include <jansson.h>
+#include <stdio.h>
+#include "util.h"
+
+static void run_tests()
+{
+    json_t *j, *j2;
+    int i1, i2, i3;
+    json_int_t I1;
+    int rv;
+    size_t z;
+    double f;
+    char *s;
+
+    json_error_t error;
+
+    /*
+     * Simple, valid json_pack cases
+     */
+
+    /* true */
+    rv = json_unpack(json_true(), "b", &i1);
+    if(rv || !i1)
+        fail("json_unpack boolean failed");
+
+    /* false */
+    rv = json_unpack(json_false(), "b", &i1);
+    if(rv || i1)
+        fail("json_unpack boolean failed");
+
+    /* null */
+    if(json_unpack(json_null(), "n"))
+        fail("json_unpack null failed");
+
+    /* integer */
+    j = json_integer(42);
+    rv = json_unpack(j, "i", &i1);
+    if(rv || i1 != 42)
+        fail("json_unpack integer failed");
+    json_decref(j);
+
+    /* json_int_t */
+    j = json_integer(5555555);
+    rv = json_unpack(j, "I", &I1);
+    if(rv || I1 != 5555555)
+        fail("json_unpack json_int_t failed");
+    json_decref(j);
+
+    /* real */
+    j = json_real(1.7);
+    rv = json_unpack(j, "f", &f);
+    if(rv || f != 1.7)
+        fail("json_unpack real failed");
+    json_decref(j);
+
+    /* number */
+    j = json_integer(12345);
+    rv = json_unpack(j, "F", &f);
+    if(rv || f != 12345.0)
+        fail("json_unpack (real or) integer failed");
+    json_decref(j);
+
+    j = json_real(1.7);
+    rv = json_unpack(j, "F", &f);
+    if(rv || f != 1.7)
+        fail("json_unpack real (or integer) failed");
+    json_decref(j);
+
+    /* string */
+    j = json_string("foo");
+    rv = json_unpack(j, "s", &s);
+    if(rv || strcmp(s, "foo"))
+        fail("json_unpack string failed");
+    json_decref(j);
+
+    /* string with length (size_t) */
+    j = json_string("foo");
+    rv = json_unpack(j, "s%", &s, &z);
+    if(rv || strcmp(s, "foo") || z != 3)
+        fail("json_unpack string with length (size_t) failed");
+    json_decref(j);
+
+    /* empty object */
+    j = json_object();
+    if(json_unpack(j, "{}"))
+        fail("json_unpack empty object failed");
+    json_decref(j);
+
+    /* empty list */
+    j = json_array();
+    if(json_unpack(j, "[]"))
+        fail("json_unpack empty list failed");
+    json_decref(j);
+
+    /* non-incref'd object */
+    j = json_object();
+    rv = json_unpack(j, "o", &j2);
+    if(rv || j2 != j || j->refcount != 1)
+        fail("json_unpack object failed");
+    json_decref(j);
+
+    /* incref'd object */
+    j = json_object();
+    rv = json_unpack(j, "O", &j2);
+    if(rv || j2 != j || j->refcount != 2)
+        fail("json_unpack object failed");
+    json_decref(j);
+    json_decref(j);
+
+    /* simple object */
+    j = json_pack("{s:i}", "foo", 42);
+    rv = json_unpack(j, "{s:i}", "foo", &i1);
+    if(rv || i1 != 42)
+        fail("json_unpack simple object failed");
+    json_decref(j);
+
+    /* simple array */
+    j = json_pack("[iii]", 1, 2, 3);
+    rv = json_unpack(j, "[i,i,i]", &i1, &i2, &i3);
+    if(rv || i1 != 1 || i2 != 2 || i3 != 3)
+        fail("json_unpack simple array failed");
+    json_decref(j);
+
+    /* object with many items & strict checking */
+    j = json_pack("{s:i, s:i, s:i}", "a", 1, "b", 2, "c", 3);
+    rv = json_unpack(j, "{s:i, s:i, s:i}", "a", &i1, "b", &i2, "c", &i3);
+    if(rv || i1 != 1 || i2 != 2 || i3 != 3)
+        fail("json_unpack object with many items failed");
+    json_decref(j);
+
+    /*
+     * Invalid cases
+     */
+
+    j = json_integer(42);
+    if(!json_unpack_ex(j, &error, 0, "z"))
+        fail("json_unpack succeeded with invalid format character");
+    check_error("Unexpected format character 'z'", "<format>", 1, 1, 1);
+
+    if(!json_unpack_ex(NULL, &error, 0, "[i]"))
+        fail("json_unpack succeeded with NULL root");
+    check_error("NULL root value", "<root>", -1, -1, 0);
+    json_decref(j);
+
+    /* mismatched open/close array/object */
+    j = json_pack("[]");
+    if(!json_unpack_ex(j, &error, 0, "[}"))
+        fail("json_unpack failed to catch mismatched ']'");
+    check_error("Unexpected format character '}'", "<format>", 1, 2, 2);
+    json_decref(j);
+
+    j = json_pack("{}");
+    if(!json_unpack_ex(j, &error, 0, "{]"))
+        fail("json_unpack failed to catch mismatched '}'");
+    check_error("Expected format 's', got ']'", "<format>", 1, 2, 2);
+    json_decref(j);
+
+    /* missing close array */
+    j = json_pack("[]");
+    if(!json_unpack_ex(j, &error, 0, "["))
+        fail("json_unpack failed to catch missing ']'");
+    check_error("Unexpected end of format string", "<format>", 1, 2, 2);
+    json_decref(j);
+
+    /* missing close object */
+    j = json_pack("{}");
+    if(!json_unpack_ex(j, &error, 0, "{"))
+        fail("json_unpack failed to catch missing '}'");
+    check_error("Unexpected end of format string", "<format>", 1, 2, 2);
+    json_decref(j);
+
+    /* garbage after format string */
+    j = json_pack("[i]", 42);
+    if(!json_unpack_ex(j, &error, 0, "[i]a", &i1))
+        fail("json_unpack failed to catch garbage after format string");
+    check_error("Garbage after format string", "<format>", 1, 4, 4);
+    json_decref(j);
+
+    j = json_integer(12345);
+    if(!json_unpack_ex(j, &error, 0, "ia", &i1))
+        fail("json_unpack failed to catch garbage after format string");
+    check_error("Garbage after format string", "<format>", 1, 2, 2);
+    json_decref(j);
+
+    /* NULL format string */
+    j = json_pack("[]");
+    if(!json_unpack_ex(j, &error, 0, NULL))
+        fail("json_unpack failed to catch null format string");
+    check_error("NULL or empty format string", "<format>", -1, -1, 0);
+    json_decref(j);
+
+    /* NULL string pointer */
+    j = json_string("foobie");
+    if(!json_unpack_ex(j, &error, 0, "s", NULL))
+        fail("json_unpack failed to catch null string pointer");
+    check_error("NULL string argument", "<args>", 1, 1, 1);
+    json_decref(j);
+
+    /* invalid types */
+    j = json_integer(42);
+    j2 = json_string("foo");
+    if(!json_unpack_ex(j, &error, 0, "s"))
+        fail("json_unpack failed to catch invalid type");
+    check_error("Expected string, got integer", "<validation>", 1, 1, 1);
+
+    if(!json_unpack_ex(j, &error, 0, "n"))
+        fail("json_unpack failed to catch invalid type");
+    check_error("Expected null, got integer", "<validation>", 1, 1, 1);
+
+    if(!json_unpack_ex(j, &error, 0, "b"))
+        fail("json_unpack failed to catch invalid type");
+    check_error("Expected true or false, got integer", "<validation>", 1, 1, 1);
+
+    if(!json_unpack_ex(j2, &error, 0, "i"))
+        fail("json_unpack failed to catch invalid type");
+    check_error("Expected integer, got string", "<validation>", 1, 1, 1);
+
+    if(!json_unpack_ex(j2, &error, 0, "I"))
+        fail("json_unpack failed to catch invalid type");
+    check_error("Expected integer, got string", "<validation>", 1, 1, 1);
+
+    if(!json_unpack_ex(j, &error, 0, "f"))
+        fail("json_unpack failed to catch invalid type");
+    check_error("Expected real, got integer", "<validation>", 1, 1, 1);
+
+    if(!json_unpack_ex(j2, &error, 0, "F"))
+        fail("json_unpack failed to catch invalid type");
+    check_error("Expected real or integer, got string", "<validation>", 1, 1, 1);
+
+    if(!json_unpack_ex(j, &error, 0, "[i]"))
+        fail("json_unpack failed to catch invalid type");
+    check_error("Expected array, got integer", "<validation>", 1, 1, 1);
+
+    if(!json_unpack_ex(j, &error, 0, "{si}", "foo"))
+        fail("json_unpack failed to catch invalid type");
+    check_error("Expected object, got integer", "<validation>", 1, 1, 1);
+
+    json_decref(j);
+    json_decref(j2);
+
+    /* Array index out of range */
+    j = json_pack("[i]", 1);
+    if(!json_unpack_ex(j, &error, 0, "[ii]", &i1, &i2))
+        fail("json_unpack failed to catch index out of array bounds");
+    check_error("Array index 1 out of range", "<validation>", 1, 3, 3);
+    json_decref(j);
+
+    /* NULL object key */
+    j = json_pack("{si}", "foo", 42);
+    if(!json_unpack_ex(j, &error, 0, "{si}", NULL, &i1))
+        fail("json_unpack failed to catch null string pointer");
+    check_error("NULL object key", "<args>", 1, 2, 2);
+    json_decref(j);
+
+    /* Object key not found */
+    j = json_pack("{si}", "foo", 42);
+    if(!json_unpack_ex(j, &error, 0, "{si}", "baz", &i1))
+        fail("json_unpack failed to catch null string pointer");
+    check_error("Object item not found: baz", "<validation>", 1, 3, 3);
+    json_decref(j);
+
+    /*
+     * Strict validation
+     */
+
+    j = json_pack("[iii]", 1, 2, 3);
+    rv = json_unpack(j, "[iii!]", &i1, &i2, &i3);
+    if(rv || i1 != 1 || i2 != 2 || i3 != 3)
+        fail("json_unpack array with strict validation failed");
+    json_decref(j);
+
+    j = json_pack("[iii]", 1, 2, 3);
+    if(!json_unpack_ex(j, &error, 0, "[ii!]", &i1, &i2))
+        fail("json_unpack array with strict validation failed");
+    check_error("1 array item(s) left unpacked", "<validation>", 1, 5, 5);
+    json_decref(j);
+
+    /* Like above, but with JSON_STRICT instead of '!' format */
+    j = json_pack("[iii]", 1, 2, 3);
+    if(!json_unpack_ex(j, &error, JSON_STRICT, "[ii]", &i1, &i2))
+        fail("json_unpack array with strict validation failed");
+    check_error("1 array item(s) left unpacked", "<validation>", 1, 4, 4);
+    json_decref(j);
+
+    j = json_pack("{s:s, s:i}", "foo", "bar", "baz", 42);
+    rv = json_unpack(j, "{sssi!}", "foo", &s, "baz", &i1);
+    if(rv || strcmp(s, "bar") != 0 || i1 != 42)
+        fail("json_unpack object with strict validation failed");
+    json_decref(j);
+
+    /* Unpack the same item twice */
+    j = json_pack("{s:s, s:i}", "foo", "bar", "baz", 42);
+    if(!json_unpack_ex(j, &error, 0, "{s:s,s:s!}", "foo", &s, "foo", &s))
+        fail("json_unpack object with strict validation failed");
+    check_error("1 object item(s) left unpacked", "<validation>", 1, 10, 10);
+    json_decref(j);
+
+    j = json_pack("[i,{s:i,s:n},[i,i]]", 1, "foo", 2, "bar", 3, 4);
+    if(json_unpack_ex(j, NULL, JSON_STRICT | JSON_VALIDATE_ONLY,
+                      "[i{sisn}[ii]]", "foo", "bar"))
+        fail("json_unpack complex value with strict validation failed");
+    json_decref(j);
+
+    /* ! and * must be last */
+    j = json_pack("[ii]", 1, 2);
+    if(!json_unpack_ex(j, &error, 0, "[i!i]", &i1, &i2))
+        fail("json_unpack failed to catch ! in the middle of an array");
+    check_error("Expected ']' after '!', got 'i'", "<format>", 1, 4, 4);
+
+    if(!json_unpack_ex(j, &error, 0, "[i*i]", &i1, &i2))
+        fail("json_unpack failed to catch * in the middle of an array");
+    check_error("Expected ']' after '*', got 'i'", "<format>", 1, 4, 4);
+    json_decref(j);
+
+    j = json_pack("{sssi}", "foo", "bar", "baz", 42);
+    if(!json_unpack_ex(j, &error, 0, "{ss!si}", "foo", &s, "baz", &i1))
+        fail("json_unpack failed to catch ! in the middle of an object");
+    check_error("Expected '}' after '!', got 's'", "<format>", 1, 5, 5);
+
+    if(!json_unpack_ex(j, &error, 0, "{ss*si}", "foo", &s, "baz", &i1))
+        fail("json_unpack failed to catch ! in the middle of an object");
+    check_error("Expected '}' after '*', got 's'", "<format>", 1, 5, 5);
+    json_decref(j);
+
+    /* Error in nested object */
+    j = json_pack("{s{snsn}}", "foo", "bar", "baz");
+    if(!json_unpack_ex(j, &error, 0, "{s{sn!}}", "foo", "bar"))
+        fail("json_unpack nested object with strict validation failed");
+    check_error("1 object item(s) left unpacked", "<validation>", 1, 7, 7);
+    json_decref(j);
+
+    /* Error in nested array */
+    j = json_pack("[[ii]]", 1, 2);
+    if(!json_unpack_ex(j, &error, 0, "[[i!]]", &i1))
+        fail("json_unpack nested array with strict validation failed");
+    check_error("1 array item(s) left unpacked", "<validation>", 1, 5, 5);
+    json_decref(j);
+
+    /* Optional values */
+    j = json_object();
+    i1 = 0;
+    if(json_unpack(j, "{s?i}", "foo", &i1))
+        fail("json_unpack failed for optional key");
+    if(i1 != 0)
+        fail("json_unpack unpacked an optional key");
+    json_decref(j);
+
+    i1 = 0;
+    j = json_pack("{si}", "foo", 42);
+    if(json_unpack(j, "{s?i}", "foo", &i1))
+        fail("json_unpack failed for an optional value");
+    if(i1 != 42)
+        fail("json_unpack failed to unpack an optional value");
+    json_decref(j);
+
+    j = json_object();
+    i1 = i2 = i3 = 0;
+    if(json_unpack(j, "{s?[ii]s?{s{si}}}",
+                   "foo", &i1, &i2,
+                   "bar", "baz", "quux", &i3))
+        fail("json_unpack failed for complex optional values");
+    if(i1 != 0 || i2 != 0 || i3 != 0)
+        fail("json_unpack unexpectedly unpacked something");
+    json_decref(j);
+
+    j = json_pack("{s{si}}", "foo", "bar", 42);
+    if(json_unpack(j, "{s?{s?i}}", "foo", "bar", &i1))
+        fail("json_unpack failed for complex optional values");
+    if(i1 != 42)
+        fail("json_unpack failed to unpack");
+    json_decref(j);
+
+    /* Combine ? and ! */
+    j = json_pack("{si}", "foo", 42);
+    i1 = i2 = 0;
+    if(json_unpack(j, "{sis?i!}", "foo", &i1, "bar", &i2))
+        fail("json_unpack failed for optional values with strict mode");
+    if(i1 != 42)
+        fail("json_unpack failed to unpack");
+    if(i2 != 0)
+        fail("json_unpack failed to unpack");
+    json_decref(j);
+
+    /* But don't compensate a missing key with an optional one. */
+    j = json_pack("{sisi}", "foo", 42, "baz", 43);
+    i1 = i2 = i3 = 0;
+    if(!json_unpack_ex(j, &error, 0, "{sis?i!}", "foo", &i1, "bar", &i2))
+        fail("json_unpack failed for optional values with strict mode and compensation");
+    check_error("1 object item(s) left unpacked", "<validation>", 1, 8, 8);
+    json_decref(j);
+}

Added: vendor/jansson/dist/test/suites/api/util.h
===================================================================
--- vendor/jansson/dist/test/suites/api/util.h	                        (rev 0)
+++ vendor/jansson/dist/test/suites/api/util.h	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,74 @@
+/*
+ * Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef UTIL_H
+#define UTIL_H
+
+#ifdef HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#include <stdio.h>
+#include <stdlib.h>
+#if HAVE_LOCALE_H
+#include <locale.h>
+#endif
+
+#include <jansson.h>
+
+#define failhdr fprintf(stderr, "%s:%s:%d: ", __FILE__, __FUNCTION__, __LINE__)
+
+#define fail(msg)                                                \
+    do {                                                         \
+        failhdr;                                                 \
+        fprintf(stderr, "%s\n", msg);                            \
+        exit(1);                                                 \
+    } while(0)
+
+/* Assumes json_error_t error */
+#define check_error(text_, source_, line_, column_, position_)          \
+    do {                                                                \
+        if(strcmp(error.text, text_) != 0) {                            \
+            failhdr;                                                    \
+            fprintf(stderr, "text: \"%s\" != \"%s\"\n", error.text, text_); \
+            exit(1);                                                    \
+        }                                                               \
+        if(strcmp(error.source, source_) != 0) {                        \
+            failhdr;                                                    \
+                                                                        \
+            fprintf(stderr, "source: \"%s\" != \"%s\"\n", error.source, source_); \
+            exit(1);                                                    \
+        }                                                               \
+        if(error.line != line_) {                                       \
+            failhdr;                                                    \
+            fprintf(stderr, "line: %d != %d\n", error.line, line_);     \
+            exit(1);                                                    \
+        }                                                               \
+        if(error.column != column_) {                                   \
+            failhdr;                                                    \
+            fprintf(stderr, "column: %d != %d\n", error.column, column_); \
+            exit(1);                                                    \
+        }                                                               \
+        if(error.position != position_) {                               \
+            failhdr;                                                    \
+            fprintf(stderr, "position: %d != %d\n", error.position, position_); \
+            exit(1);                                                    \
+        }                                                               \
+    } while(0)
+
+
+static void run_tests();
+
+int main() {
+#ifdef HAVE_SETLOCALE
+    setlocale(LC_ALL, "");
+#endif
+    run_tests();
+    return 0;
+}
+
+#endif

Added: vendor/jansson/dist/test/suites/invalid/apostrophe/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/apostrophe/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/apostrophe/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+invalid token near '''

Added: vendor/jansson/dist/test/suites/invalid/apostrophe/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/apostrophe/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/apostrophe/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+['

Added: vendor/jansson/dist/test/suites/invalid/ascii-unicode-identifier/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/ascii-unicode-identifier/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/ascii-unicode-identifier/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 1 1
+'[' or '{' expected near 'a'

Added: vendor/jansson/dist/test/suites/invalid/ascii-unicode-identifier/input
===================================================================
(Binary files differ)

Index: vendor/jansson/dist/test/suites/invalid/ascii-unicode-identifier/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/ascii-unicode-identifier/input	2015-07-29 00:47:57 UTC (rev 7200)
+++ vendor/jansson/dist/test/suites/invalid/ascii-unicode-identifier/input	2015-08-02 14:24:45 UTC (rev 7201)

Property changes on: vendor/jansson/dist/test/suites/invalid/ascii-unicode-identifier/input
___________________________________________________________________
Added: svn:mime-type
## -0,0 +1 ##
+application/octet-stream
\ No newline at end of property
Added: vendor/jansson/dist/test/suites/invalid/brace-comma/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/brace-comma/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/brace-comma/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+string or '}' expected near ','

Added: vendor/jansson/dist/test/suites/invalid/brace-comma/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/brace-comma/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/brace-comma/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+{,

Added: vendor/jansson/dist/test/suites/invalid/bracket-comma/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/bracket-comma/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/bracket-comma/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+unexpected token near ','

Added: vendor/jansson/dist/test/suites/invalid/bracket-comma/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/bracket-comma/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/bracket-comma/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[,

Added: vendor/jansson/dist/test/suites/invalid/bracket-one-comma/error.normal
===================================================================
--- vendor/jansson/dist/test/suites/invalid/bracket-one-comma/error.normal	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/bracket-one-comma/error.normal	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+2 0 4
+']' expected near end of file

Added: vendor/jansson/dist/test/suites/invalid/bracket-one-comma/error.strip
===================================================================
--- vendor/jansson/dist/test/suites/invalid/bracket-one-comma/error.strip	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/bracket-one-comma/error.strip	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 3 3
+']' expected near end of file

Added: vendor/jansson/dist/test/suites/invalid/bracket-one-comma/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/bracket-one-comma/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/bracket-one-comma/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1,

Added: vendor/jansson/dist/test/suites/invalid/empty/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/empty/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/empty/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 0 0
+'[' or '{' expected near end of file

Added: vendor/jansson/dist/test/suites/invalid/empty/input
===================================================================
Added: vendor/jansson/dist/test/suites/invalid/extra-comma-in-array/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/extra-comma-in-array/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/extra-comma-in-array/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 4 4
+unexpected token near ']'

Added: vendor/jansson/dist/test/suites/invalid/extra-comma-in-array/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/extra-comma-in-array/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/extra-comma-in-array/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1,]

Added: vendor/jansson/dist/test/suites/invalid/extra-comma-in-multiline-array/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/extra-comma-in-multiline-array/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/extra-comma-in-multiline-array/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+6 1 17
+unexpected token near ']'

Added: vendor/jansson/dist/test/suites/invalid/extra-comma-in-multiline-array/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/extra-comma-in-multiline-array/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/extra-comma-in-multiline-array/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,6 @@
+[1,
+2,
+3,
+4,
+5,
+]

Added: vendor/jansson/dist/test/suites/invalid/garbage-after-newline/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/garbage-after-newline/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/garbage-after-newline/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+2 3 11
+end of file expected near 'foo'

Added: vendor/jansson/dist/test/suites/invalid/garbage-after-newline/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/garbage-after-newline/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/garbage-after-newline/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+[1,2,3]
+foo

Added: vendor/jansson/dist/test/suites/invalid/garbage-at-the-end/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/garbage-at-the-end/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/garbage-at-the-end/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 10 10
+end of file expected near 'foo'

Added: vendor/jansson/dist/test/suites/invalid/garbage-at-the-end/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/garbage-at-the-end/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/garbage-at-the-end/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1,2,3]foo

Added: vendor/jansson/dist/test/suites/invalid/integer-starting-with-zero/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/integer-starting-with-zero/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/integer-starting-with-zero/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+invalid token near '0'

Added: vendor/jansson/dist/test/suites/invalid/integer-starting-with-zero/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/integer-starting-with-zero/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/integer-starting-with-zero/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[012]

Added: vendor/jansson/dist/test/suites/invalid/invalid-escape/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/invalid-escape/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/invalid-escape/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 4 4
+invalid escape near '"\a'

Added: vendor/jansson/dist/test/suites/invalid/invalid-escape/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/invalid-escape/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/invalid-escape/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\a <-- invalid escape"]

Added: vendor/jansson/dist/test/suites/invalid/invalid-identifier/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/invalid-identifier/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/invalid-identifier/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 5 5
+invalid token near 'troo'

Added: vendor/jansson/dist/test/suites/invalid/invalid-identifier/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/invalid-identifier/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/invalid-identifier/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[troo

Added: vendor/jansson/dist/test/suites/invalid/invalid-negative-integer/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/invalid-negative-integer/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/invalid-negative-integer/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 8 8
+']' expected near 'foo'

Added: vendor/jansson/dist/test/suites/invalid/invalid-negative-integer/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/invalid-negative-integer/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/invalid-negative-integer/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[-123foo]

Added: vendor/jansson/dist/test/suites/invalid/invalid-negative-real/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/invalid-negative-real/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/invalid-negative-real/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 12 12
+']' expected near 'foo'

Added: vendor/jansson/dist/test/suites/invalid/invalid-negative-real/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/invalid-negative-real/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/invalid-negative-real/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[-123.123foo]

Added: vendor/jansson/dist/test/suites/invalid/invalid-second-surrogate/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/invalid-second-surrogate/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/invalid-second-surrogate/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 62 62
+invalid Unicode '\uD888\u3210'

Added: vendor/jansson/dist/test/suites/invalid/invalid-second-surrogate/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/invalid-second-surrogate/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/invalid-second-surrogate/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\uD888\u3210 (first surrogate and invalid second surrogate)"]

Added: vendor/jansson/dist/test/suites/invalid/lone-open-brace/error.normal
===================================================================
--- vendor/jansson/dist/test/suites/invalid/lone-open-brace/error.normal	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/lone-open-brace/error.normal	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+2 0 2
+string or '}' expected near end of file

Added: vendor/jansson/dist/test/suites/invalid/lone-open-brace/error.strip
===================================================================
--- vendor/jansson/dist/test/suites/invalid/lone-open-brace/error.strip	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/lone-open-brace/error.strip	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 1 1
+string or '}' expected near end of file

Added: vendor/jansson/dist/test/suites/invalid/lone-open-brace/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/lone-open-brace/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/lone-open-brace/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+{

Added: vendor/jansson/dist/test/suites/invalid/lone-open-bracket/error.normal
===================================================================
--- vendor/jansson/dist/test/suites/invalid/lone-open-bracket/error.normal	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/lone-open-bracket/error.normal	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+2 0 2
+']' expected near end of file

Added: vendor/jansson/dist/test/suites/invalid/lone-open-bracket/error.strip
===================================================================
--- vendor/jansson/dist/test/suites/invalid/lone-open-bracket/error.strip	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/lone-open-bracket/error.strip	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 1 1
+']' expected near end of file

Added: vendor/jansson/dist/test/suites/invalid/lone-open-bracket/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/lone-open-bracket/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/lone-open-bracket/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[

Added: vendor/jansson/dist/test/suites/invalid/lone-second-surrogate/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/lone-second-surrogate/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/lone-second-surrogate/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 40 40
+invalid Unicode '\uDFAA'

Added: vendor/jansson/dist/test/suites/invalid/lone-second-surrogate/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/lone-second-surrogate/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/lone-second-surrogate/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\uDFAA (second surrogate on it's own)"]

Added: vendor/jansson/dist/test/suites/invalid/minus-sign-without-number/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/minus-sign-without-number/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/minus-sign-without-number/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+invalid token near '-'

Added: vendor/jansson/dist/test/suites/invalid/minus-sign-without-number/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/minus-sign-without-number/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/minus-sign-without-number/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[-foo]

Added: vendor/jansson/dist/test/suites/invalid/negative-integer-starting-with-zero/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/negative-integer-starting-with-zero/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/negative-integer-starting-with-zero/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 3 3
+invalid token near '-0'

Added: vendor/jansson/dist/test/suites/invalid/negative-integer-starting-with-zero/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/negative-integer-starting-with-zero/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/negative-integer-starting-with-zero/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[-012]

Added: vendor/jansson/dist/test/suites/invalid/null/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/null/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/null/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 4 4
+'[' or '{' expected near 'null'

Added: vendor/jansson/dist/test/suites/invalid/null/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/null/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/null/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+null

Added: vendor/jansson/dist/test/suites/invalid/null-byte-in-object-key/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/null-byte-in-object-key/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/null-byte-in-object-key/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 15 15
+NUL byte in object key not supported near '"foo\u0000bar"'

Added: vendor/jansson/dist/test/suites/invalid/null-byte-in-object-key/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/null-byte-in-object-key/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/null-byte-in-object-key/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+{"foo\u0000bar": 42}
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/invalid/null-byte-in-string/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/null-byte-in-string/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/null-byte-in-string/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 12 12
+control character 0x0 near '"null byte '

Added: vendor/jansson/dist/test/suites/invalid/null-byte-in-string/input
===================================================================
(Binary files differ)

Index: vendor/jansson/dist/test/suites/invalid/null-byte-in-string/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/null-byte-in-string/input	2015-07-29 00:47:57 UTC (rev 7200)
+++ vendor/jansson/dist/test/suites/invalid/null-byte-in-string/input	2015-08-02 14:24:45 UTC (rev 7201)

Property changes on: vendor/jansson/dist/test/suites/invalid/null-byte-in-string/input
___________________________________________________________________
Added: svn:mime-type
## -0,0 +1 ##
+application/octet-stream
\ No newline at end of property
Added: vendor/jansson/dist/test/suites/invalid/null-byte-in-string/nostrip
===================================================================
--- vendor/jansson/dist/test/suites/invalid/null-byte-in-string/nostrip	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/null-byte-in-string/nostrip	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+The embedded NULL byte breaks json_loads(), which is used instead of
+json_loadf() in the stripped tests.

Added: vendor/jansson/dist/test/suites/invalid/null-byte-outside-string/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/null-byte-outside-string/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/null-byte-outside-string/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+invalid token near end of file

Added: vendor/jansson/dist/test/suites/invalid/null-byte-outside-string/input
===================================================================
(Binary files differ)

Index: vendor/jansson/dist/test/suites/invalid/null-byte-outside-string/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/null-byte-outside-string/input	2015-07-29 00:47:57 UTC (rev 7200)
+++ vendor/jansson/dist/test/suites/invalid/null-byte-outside-string/input	2015-08-02 14:24:45 UTC (rev 7201)

Property changes on: vendor/jansson/dist/test/suites/invalid/null-byte-outside-string/input
___________________________________________________________________
Added: svn:mime-type
## -0,0 +1 ##
+application/octet-stream
\ No newline at end of property
Added: vendor/jansson/dist/test/suites/invalid/null-byte-outside-string/nostrip
===================================================================
--- vendor/jansson/dist/test/suites/invalid/null-byte-outside-string/nostrip	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/null-byte-outside-string/nostrip	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+The embedded NULL byte breaks json_loads(), which is used instead of
+json_loadf() in the stripped tests.

Added: vendor/jansson/dist/test/suites/invalid/object-apostrophes/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/object-apostrophes/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/object-apostrophes/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+string or '}' expected near '''

Added: vendor/jansson/dist/test/suites/invalid/object-apostrophes/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/object-apostrophes/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/object-apostrophes/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+{'a'

Added: vendor/jansson/dist/test/suites/invalid/object-garbage-at-end/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/object-garbage-at-end/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/object-garbage-at-end/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 12 12
+'}' expected near '123'

Added: vendor/jansson/dist/test/suites/invalid/object-garbage-at-end/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/object-garbage-at-end/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/object-garbage-at-end/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+{"a":"a" 123}

Added: vendor/jansson/dist/test/suites/invalid/object-in-unterminated-array/error.normal
===================================================================
--- vendor/jansson/dist/test/suites/invalid/object-in-unterminated-array/error.normal	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/object-in-unterminated-array/error.normal	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+2 0 4
+']' expected near end of file

Added: vendor/jansson/dist/test/suites/invalid/object-in-unterminated-array/error.strip
===================================================================
--- vendor/jansson/dist/test/suites/invalid/object-in-unterminated-array/error.strip	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/object-in-unterminated-array/error.strip	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 3 3
+']' expected near end of file

Added: vendor/jansson/dist/test/suites/invalid/object-in-unterminated-array/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/object-in-unterminated-array/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/object-in-unterminated-array/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[{}

Added: vendor/jansson/dist/test/suites/invalid/object-no-colon/error.normal
===================================================================
--- vendor/jansson/dist/test/suites/invalid/object-no-colon/error.normal	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/object-no-colon/error.normal	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+2 0 5
+':' expected near end of file

Added: vendor/jansson/dist/test/suites/invalid/object-no-colon/error.strip
===================================================================
--- vendor/jansson/dist/test/suites/invalid/object-no-colon/error.strip	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/object-no-colon/error.strip	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 4 4
+':' expected near end of file

Added: vendor/jansson/dist/test/suites/invalid/object-no-colon/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/object-no-colon/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/object-no-colon/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+{"a"

Added: vendor/jansson/dist/test/suites/invalid/object-no-value/error.normal
===================================================================
--- vendor/jansson/dist/test/suites/invalid/object-no-value/error.normal	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/object-no-value/error.normal	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+2 0 6
+unexpected token near end of file

Added: vendor/jansson/dist/test/suites/invalid/object-no-value/error.strip
===================================================================
--- vendor/jansson/dist/test/suites/invalid/object-no-value/error.strip	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/object-no-value/error.strip	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 5 5
+unexpected token near end of file

Added: vendor/jansson/dist/test/suites/invalid/object-no-value/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/object-no-value/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/object-no-value/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+{"a":

Added: vendor/jansson/dist/test/suites/invalid/object-unterminated-value/error.normal
===================================================================
--- vendor/jansson/dist/test/suites/invalid/object-unterminated-value/error.normal	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/object-unterminated-value/error.normal	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 7 7
+unexpected newline near '"a'

Added: vendor/jansson/dist/test/suites/invalid/object-unterminated-value/error.strip
===================================================================
--- vendor/jansson/dist/test/suites/invalid/object-unterminated-value/error.strip	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/object-unterminated-value/error.strip	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 7 7
+premature end of input near '"a'

Added: vendor/jansson/dist/test/suites/invalid/object-unterminated-value/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/object-unterminated-value/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/object-unterminated-value/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+{"a":"a

Added: vendor/jansson/dist/test/suites/invalid/real-garbage-after-e/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/real-garbage-after-e/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/real-garbage-after-e/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 3 3
+invalid token near '1e'

Added: vendor/jansson/dist/test/suites/invalid/real-garbage-after-e/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/real-garbage-after-e/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/real-garbage-after-e/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1ea]

Added: vendor/jansson/dist/test/suites/invalid/real-negative-overflow/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/real-negative-overflow/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/real-negative-overflow/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 15 15
+real number overflow near '-123123e100000'

Added: vendor/jansson/dist/test/suites/invalid/real-negative-overflow/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/real-negative-overflow/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/real-negative-overflow/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[-123123e100000]

Added: vendor/jansson/dist/test/suites/invalid/real-positive-overflow/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/real-positive-overflow/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/real-positive-overflow/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 14 14
+real number overflow near '123123e100000'

Added: vendor/jansson/dist/test/suites/invalid/real-positive-overflow/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/real-positive-overflow/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/real-positive-overflow/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[123123e100000]

Added: vendor/jansson/dist/test/suites/invalid/real-truncated-at-e/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/real-truncated-at-e/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/real-truncated-at-e/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 3 3
+invalid token near '1e'

Added: vendor/jansson/dist/test/suites/invalid/real-truncated-at-e/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/real-truncated-at-e/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/real-truncated-at-e/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1e]

Added: vendor/jansson/dist/test/suites/invalid/real-truncated-at-point/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/real-truncated-at-point/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/real-truncated-at-point/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 3 3
+invalid token near '1.'

Added: vendor/jansson/dist/test/suites/invalid/real-truncated-at-point/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/real-truncated-at-point/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/real-truncated-at-point/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1.]

Added: vendor/jansson/dist/test/suites/invalid/run
===================================================================
--- vendor/jansson/dist/test/suites/invalid/run	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/run	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,57 @@
+#!/bin/sh
+#
+# Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+#
+# Jansson is free software; you can redistribute it and/or modify
+# it under the terms of the MIT license. See LICENSE for details.
+
+is_test() {
+    test -d $test_path
+}
+
+do_run() {
+    variant=$1
+    s=".$1"
+
+    strip=0
+    if [ "$variant" = "strip" ]; then
+        # This test should not be stripped
+        [ -f $test_path/nostrip ] && return
+        strip=1
+    fi
+
+    STRIP=$strip $json_process --env \
+        <$test_path/input >$test_log/stdout$s 2>$test_log/stderr$s
+    valgrind_check $test_log/stderr$s || return 1
+
+    ref=error
+    [ -f $test_path/error$s ] && ref=error$s
+
+    if ! cmp -s $test_path/$ref $test_log/stderr$s; then
+        echo $variant > $test_log/variant
+        return 1
+    fi
+}
+
+run_test() {
+    do_run normal && do_run strip
+}
+
+show_error() {
+    valgrind_show_error && return
+
+    read variant < $test_log/variant
+    s=".$variant"
+
+    echo "VARIANT: $variant"
+
+    echo "EXPECTED ERROR:"
+    ref=error
+    [ -f $test_path/error$s ] && ref=error$s
+    nl -bn $test_path/$ref
+
+    echo "ACTUAL ERROR:"
+    nl -bn $test_log/stderr$s
+}
+
+. $top_srcdir/test/scripts/run-tests.sh

Added: vendor/jansson/dist/test/suites/invalid/tab-character-in-string/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/tab-character-in-string/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/tab-character-in-string/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+control character 0x9 near '"'

Added: vendor/jansson/dist/test/suites/invalid/tab-character-in-string/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/tab-character-in-string/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/tab-character-in-string/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["	 <-- tab character"]

Added: vendor/jansson/dist/test/suites/invalid/too-big-negative-integer/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/too-big-negative-integer/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/too-big-negative-integer/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 32 32
+too big negative integer

Added: vendor/jansson/dist/test/suites/invalid/too-big-negative-integer/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/too-big-negative-integer/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/too-big-negative-integer/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[-123123123123123123123123123123]

Added: vendor/jansson/dist/test/suites/invalid/too-big-positive-integer/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/too-big-positive-integer/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/too-big-positive-integer/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 31 31
+too big integer

Added: vendor/jansson/dist/test/suites/invalid/too-big-positive-integer/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/too-big-positive-integer/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/too-big-positive-integer/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[123123123123123123123123123123]

Added: vendor/jansson/dist/test/suites/invalid/truncated-unicode-surrogate/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/truncated-unicode-surrogate/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/truncated-unicode-surrogate/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 46 46
+invalid Unicode '\uDADA'

Added: vendor/jansson/dist/test/suites/invalid/truncated-unicode-surrogate/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/truncated-unicode-surrogate/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/truncated-unicode-surrogate/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\uDADA (first surrogate without the second)"]

Added: vendor/jansson/dist/test/suites/invalid/unicode-identifier/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unicode-identifier/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unicode-identifier/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 1 2
+'[' or '{' expected near 'å'

Added: vendor/jansson/dist/test/suites/invalid/unicode-identifier/input
===================================================================
(Binary files differ)

Index: vendor/jansson/dist/test/suites/invalid/unicode-identifier/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unicode-identifier/input	2015-07-29 00:47:57 UTC (rev 7200)
+++ vendor/jansson/dist/test/suites/invalid/unicode-identifier/input	2015-08-02 14:24:45 UTC (rev 7201)

Property changes on: vendor/jansson/dist/test/suites/invalid/unicode-identifier/input
___________________________________________________________________
Added: svn:mime-type
## -0,0 +1 ##
+application/octet-stream
\ No newline at end of property
Added: vendor/jansson/dist/test/suites/invalid/unterminated-array/error.normal
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unterminated-array/error.normal	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unterminated-array/error.normal	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+2 0 5
+']' expected near end of file

Added: vendor/jansson/dist/test/suites/invalid/unterminated-array/error.strip
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unterminated-array/error.strip	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unterminated-array/error.strip	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 4 4
+']' expected near end of file

Added: vendor/jansson/dist/test/suites/invalid/unterminated-array/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unterminated-array/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unterminated-array/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["a"

Added: vendor/jansson/dist/test/suites/invalid/unterminated-array-and-object/error.normal
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unterminated-array-and-object/error.normal	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unterminated-array-and-object/error.normal	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+2 0 3
+string or '}' expected near end of file

Added: vendor/jansson/dist/test/suites/invalid/unterminated-array-and-object/error.strip
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unterminated-array-and-object/error.strip	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unterminated-array-and-object/error.strip	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+string or '}' expected near end of file

Added: vendor/jansson/dist/test/suites/invalid/unterminated-array-and-object/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unterminated-array-and-object/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unterminated-array-and-object/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[{

Added: vendor/jansson/dist/test/suites/invalid/unterminated-empty-key/error.normal
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unterminated-empty-key/error.normal	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unterminated-empty-key/error.normal	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+unexpected newline near '"'

Added: vendor/jansson/dist/test/suites/invalid/unterminated-empty-key/error.strip
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unterminated-empty-key/error.strip	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unterminated-empty-key/error.strip	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+premature end of input near '"'

Added: vendor/jansson/dist/test/suites/invalid/unterminated-empty-key/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unterminated-empty-key/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unterminated-empty-key/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+{"

Added: vendor/jansson/dist/test/suites/invalid/unterminated-key/error.normal
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unterminated-key/error.normal	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unterminated-key/error.normal	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 3 3
+unexpected newline near '"a'

Added: vendor/jansson/dist/test/suites/invalid/unterminated-key/error.strip
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unterminated-key/error.strip	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unterminated-key/error.strip	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 3 3
+premature end of input near '"a'

Added: vendor/jansson/dist/test/suites/invalid/unterminated-key/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unterminated-key/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unterminated-key/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+{"a

Added: vendor/jansson/dist/test/suites/invalid/unterminated-object-and-array/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unterminated-object-and-array/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unterminated-object-and-array/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+string or '}' expected near '['

Added: vendor/jansson/dist/test/suites/invalid/unterminated-object-and-array/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unterminated-object-and-array/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unterminated-object-and-array/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+{[

Added: vendor/jansson/dist/test/suites/invalid/unterminated-string/error.normal
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unterminated-string/error.normal	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unterminated-string/error.normal	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 3 3
+unexpected newline near '"a'

Added: vendor/jansson/dist/test/suites/invalid/unterminated-string/error.strip
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unterminated-string/error.strip	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unterminated-string/error.strip	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 3 3
+premature end of input near '"a'

Added: vendor/jansson/dist/test/suites/invalid/unterminated-string/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid/unterminated-string/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid/unterminated-string/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["a

Added: vendor/jansson/dist/test/suites/invalid-unicode/encoded-surrogate-half/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/encoded-surrogate-half/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/encoded-surrogate-half/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xed near '"'

Added: vendor/jansson/dist/test/suites/invalid-unicode/encoded-surrogate-half/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/encoded-surrogate-half/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/encoded-surrogate-half/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\x{D8AB} <-- encoded surrogate half"]

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-after-backslash/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-after-backslash/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-after-backslash/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 3 3
+unable to decode byte 0xe5 near '"\'

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-after-backslash/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-after-backslash/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-after-backslash/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\\xE5"]

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-array/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-array/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-array/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 1 1
+unable to decode byte 0xe5

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-array/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-array/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-array/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[\xE5]

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-bigger-int/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-bigger-int/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-bigger-int/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 4 4
+unable to decode byte 0xe5 near '123'

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-bigger-int/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-bigger-int/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-bigger-int/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[123\xE5]

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-escape/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-escape/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-escape/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 4 4
+unable to decode byte 0xe5 near '"\u'

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-escape/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-escape/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-escape/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\u\xE5"]

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-exponent/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-exponent/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-exponent/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 4 4
+unable to decode byte 0xe5 near '1e1'

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-exponent/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-exponent/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-exponent/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1e1\xE5]

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-identifier/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-identifier/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-identifier/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xe5 near 'a'

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-identifier/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-identifier/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-identifier/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[a\xE5]

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-int/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-int/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-int/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xe5 near '0'

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-int/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-int/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-int/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[0\xE5]

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-real-after-e/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-real-after-e/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-real-after-e/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 3 3
+unable to decode byte 0xe5 near '1e'

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-real-after-e/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-real-after-e/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-real-after-e/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1e\xE5]

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-string/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-string/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-string/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xe5 near '"'

Added: vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-string/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-string/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/invalid-utf-8-in-string/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\xE5 <-- invalid UTF-8"]

Added: vendor/jansson/dist/test/suites/invalid-unicode/lone-invalid-utf-8/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/lone-invalid-utf-8/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/lone-invalid-utf-8/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 0 0
+unable to decode byte 0xe5

Added: vendor/jansson/dist/test/suites/invalid-unicode/lone-invalid-utf-8/input
===================================================================
(Binary files differ)

Index: vendor/jansson/dist/test/suites/invalid-unicode/lone-invalid-utf-8/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/lone-invalid-utf-8/input	2015-07-29 00:47:57 UTC (rev 7200)
+++ vendor/jansson/dist/test/suites/invalid-unicode/lone-invalid-utf-8/input	2015-08-02 14:24:45 UTC (rev 7201)

Property changes on: vendor/jansson/dist/test/suites/invalid-unicode/lone-invalid-utf-8/input
___________________________________________________________________
Added: svn:mime-type
## -0,0 +1 ##
+application/octet-stream
\ No newline at end of property
Added: vendor/jansson/dist/test/suites/invalid-unicode/lone-utf-8-continuation-byte/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/lone-utf-8-continuation-byte/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/lone-utf-8-continuation-byte/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0x81 near '"'

Added: vendor/jansson/dist/test/suites/invalid-unicode/lone-utf-8-continuation-byte/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/lone-utf-8-continuation-byte/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/lone-utf-8-continuation-byte/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\x81"]

Added: vendor/jansson/dist/test/suites/invalid-unicode/not-in-unicode-range/error
===================================================================
(Binary files differ)

Index: vendor/jansson/dist/test/suites/invalid-unicode/not-in-unicode-range/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/not-in-unicode-range/error	2015-07-29 00:47:57 UTC (rev 7200)
+++ vendor/jansson/dist/test/suites/invalid-unicode/not-in-unicode-range/error	2015-08-02 14:24:45 UTC (rev 7201)

Property changes on: vendor/jansson/dist/test/suites/invalid-unicode/not-in-unicode-range/error
___________________________________________________________________
Added: svn:mime-type
## -0,0 +1 ##
+application/octet-stream
\ No newline at end of property
Added: vendor/jansson/dist/test/suites/invalid-unicode/not-in-unicode-range/input
===================================================================
(Binary files differ)

Index: vendor/jansson/dist/test/suites/invalid-unicode/not-in-unicode-range/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/not-in-unicode-range/input	2015-07-29 00:47:57 UTC (rev 7200)
+++ vendor/jansson/dist/test/suites/invalid-unicode/not-in-unicode-range/input	2015-08-02 14:24:45 UTC (rev 7201)

Property changes on: vendor/jansson/dist/test/suites/invalid-unicode/not-in-unicode-range/input
___________________________________________________________________
Added: svn:mime-type
## -0,0 +1 ##
+application/octet-stream
\ No newline at end of property
Added: vendor/jansson/dist/test/suites/invalid-unicode/overlong-3-byte-encoding/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/overlong-3-byte-encoding/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/overlong-3-byte-encoding/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xe0 near '"'

Added: vendor/jansson/dist/test/suites/invalid-unicode/overlong-3-byte-encoding/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/overlong-3-byte-encoding/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/overlong-3-byte-encoding/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\xE0\x80\xA2 <-- overlong encoding"]

Added: vendor/jansson/dist/test/suites/invalid-unicode/overlong-4-byte-encoding/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/overlong-4-byte-encoding/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/overlong-4-byte-encoding/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xf0 near '"'

Added: vendor/jansson/dist/test/suites/invalid-unicode/overlong-4-byte-encoding/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/overlong-4-byte-encoding/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/overlong-4-byte-encoding/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\xF0\x80\x80\xA2 <-- overlong encoding"]

Added: vendor/jansson/dist/test/suites/invalid-unicode/overlong-ascii-encoding/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/overlong-ascii-encoding/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/overlong-ascii-encoding/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xc1 near '"'

Added: vendor/jansson/dist/test/suites/invalid-unicode/overlong-ascii-encoding/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/overlong-ascii-encoding/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/overlong-ascii-encoding/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\xC1"]

Added: vendor/jansson/dist/test/suites/invalid-unicode/restricted-utf-8/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/restricted-utf-8/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/restricted-utf-8/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xfd near '"'

Added: vendor/jansson/dist/test/suites/invalid-unicode/restricted-utf-8/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/restricted-utf-8/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/restricted-utf-8/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\xFD"]

Added: vendor/jansson/dist/test/suites/invalid-unicode/run
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/run	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/run	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,27 @@
+#!/bin/sh
+#
+# Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+#
+# Jansson is free software; you can redistribute it and/or modify
+# it under the terms of the MIT license. See LICENSE for details.
+
+is_test() {
+    test -d $test_path
+}
+
+run_test() {
+    $json_process --env <$test_path/input >$test_log/stdout 2>$test_log/stderr
+    valgrind_check $test_log/stderr || return 1
+    cmp -s $test_path/error $test_log/stderr
+}
+
+show_error() {
+    valgrind_show_error && return
+
+    echo "EXPECTED ERROR:"
+    nl -bn $test_path/error
+    echo "ACTUAL ERROR:"
+    nl -bn $test_log/stderr
+}
+
+. $top_srcdir/test/scripts/run-tests.sh

Added: vendor/jansson/dist/test/suites/invalid-unicode/truncated-utf-8/error
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/truncated-utf-8/error	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/truncated-utf-8/error	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xe0 near '"'

Added: vendor/jansson/dist/test/suites/invalid-unicode/truncated-utf-8/input
===================================================================
--- vendor/jansson/dist/test/suites/invalid-unicode/truncated-utf-8/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/invalid-unicode/truncated-utf-8/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\xE0\xFF <-- truncated UTF-8"]

Added: vendor/jansson/dist/test/suites/valid/complex-array/env
===================================================================
--- vendor/jansson/dist/test/suites/valid/complex-array/env	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/complex-array/env	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+JSON_SORT_KEYS=1
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/complex-array/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/complex-array/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/complex-array/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,5 @@
+[1,2,3,4,
+"a", "b", "c",
+{"foo": "bar", "core": "dump"},
+true, false, true, true, null, false
+]

Added: vendor/jansson/dist/test/suites/valid/complex-array/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/complex-array/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/complex-array/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1, 2, 3, 4, "a", "b", "c", {"core": "dump", "foo": "bar"}, true, false, true, true, null, false]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/empty-array/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/empty-array/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/empty-array/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[]

Added: vendor/jansson/dist/test/suites/valid/empty-array/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/empty-array/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/empty-array/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/empty-object/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/empty-object/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/empty-object/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+{}

Added: vendor/jansson/dist/test/suites/valid/empty-object/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/empty-object/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/empty-object/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+{}
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/empty-object-in-array/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/empty-object-in-array/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/empty-object-in-array/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[{}]

Added: vendor/jansson/dist/test/suites/valid/empty-object-in-array/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/empty-object-in-array/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/empty-object-in-array/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[{}]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/empty-string/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/empty-string/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/empty-string/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[""]

Added: vendor/jansson/dist/test/suites/valid/empty-string/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/empty-string/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/empty-string/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[""]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/escaped-utf-control-char/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/escaped-utf-control-char/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/escaped-utf-control-char/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\u0012 escaped control character"]

Added: vendor/jansson/dist/test/suites/valid/escaped-utf-control-char/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/escaped-utf-control-char/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/escaped-utf-control-char/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\u0012 escaped control character"]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/false/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/false/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/false/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[false]

Added: vendor/jansson/dist/test/suites/valid/false/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/false/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/false/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[false]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/negative-int/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/negative-int/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/negative-int/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[-123]

Added: vendor/jansson/dist/test/suites/valid/negative-int/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/negative-int/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/negative-int/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[-123]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/negative-one/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/negative-one/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/negative-one/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[-1]

Added: vendor/jansson/dist/test/suites/valid/negative-one/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/negative-one/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/negative-one/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[-1]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/negative-zero/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/negative-zero/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/negative-zero/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[-0]

Added: vendor/jansson/dist/test/suites/valid/negative-zero/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/negative-zero/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/negative-zero/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[0]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/null/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/null/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/null/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[null]

Added: vendor/jansson/dist/test/suites/valid/null/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/null/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/null/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[null]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/one-byte-utf-8/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/one-byte-utf-8/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/one-byte-utf-8/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\u002c one-byte UTF-8"]

Added: vendor/jansson/dist/test/suites/valid/one-byte-utf-8/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/one-byte-utf-8/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/one-byte-utf-8/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[", one-byte UTF-8"]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/real-capital-e/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-capital-e/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-capital-e/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1E22]

Added: vendor/jansson/dist/test/suites/valid/real-capital-e/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-capital-e/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-capital-e/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1e22]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/real-capital-e-negative-exponent/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-capital-e-negative-exponent/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-capital-e-negative-exponent/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1E-2]

Added: vendor/jansson/dist/test/suites/valid/real-capital-e-negative-exponent/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-capital-e-negative-exponent/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-capital-e-negative-exponent/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[0.01]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/real-capital-e-positive-exponent/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-capital-e-positive-exponent/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-capital-e-positive-exponent/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1E+2]

Added: vendor/jansson/dist/test/suites/valid/real-capital-e-positive-exponent/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-capital-e-positive-exponent/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-capital-e-positive-exponent/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[100.0]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/real-exponent/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-exponent/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-exponent/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[123e45]

Added: vendor/jansson/dist/test/suites/valid/real-exponent/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-exponent/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-exponent/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1.2299999999999999e47]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/real-fraction-exponent/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-fraction-exponent/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-fraction-exponent/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[123.456e78]

Added: vendor/jansson/dist/test/suites/valid/real-fraction-exponent/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-fraction-exponent/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-fraction-exponent/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1.23456e80]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/real-negative-exponent/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-negative-exponent/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-negative-exponent/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1e-2]

Added: vendor/jansson/dist/test/suites/valid/real-negative-exponent/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-negative-exponent/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-negative-exponent/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[0.01]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/real-positive-exponent/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-positive-exponent/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-positive-exponent/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1e+2]

Added: vendor/jansson/dist/test/suites/valid/real-positive-exponent/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-positive-exponent/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-positive-exponent/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[100.0]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/real-subnormal-number/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-subnormal-number/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-subnormal-number/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1.8011670033376514e-308]

Added: vendor/jansson/dist/test/suites/valid/real-subnormal-number/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-subnormal-number/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-subnormal-number/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1.8011670033376514e-308]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/real-underflow/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-underflow/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-underflow/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[123e-10000000]

Added: vendor/jansson/dist/test/suites/valid/real-underflow/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/real-underflow/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/real-underflow/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[0.0]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/run
===================================================================
--- vendor/jansson/dist/test/suites/valid/run	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/run	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,56 @@
+#!/bin/sh
+#
+# Copyright (c) 2009-2014 Petri Lehtinen <petri at digip.org>
+#
+# Jansson is free software; you can redistribute it and/or modify
+# it under the terms of the MIT license. See LICENSE for details.
+
+JSON_SORT_KEYS=1
+export JSON_SORT_KEYS
+
+is_test() {
+    test -d $test_path
+}
+
+do_run() {
+    variant=$1
+    s=".$1"
+
+    strip=0
+    [ "$variant" = "strip" ] && strip=1
+
+    STRIP=$strip $json_process --env \
+        <$test_path/input >$test_log/stdout$s 2>$test_log/stderr$s
+    valgrind_check $test_log/stderr$s || return 1
+
+    ref=output
+    [ -f $test_path/output$s ] && ref=output$s
+
+    if ! cmp -s $test_path/$ref $test_log/stdout$s; then
+        echo $variant > $test_log/variant
+        return 1
+    fi
+}
+
+run_test() {
+    do_run normal && do_run strip
+}
+
+show_error() {
+    valgrind_show_error && return
+
+    read variant < $test_log/variant
+    s=".$variant"
+
+    echo "VARIANT: $variant"
+
+    echo "EXPECTED OUTPUT:"
+    ref=output
+    [ -f $test_path/output$s ] && ref=output$s
+    nl -bn $test_path/$ref
+
+    echo "ACTUAL OUTPUT:"
+    nl -bn $test_log/stdout$s
+}
+
+. $top_srcdir/test/scripts/run-tests.sh

Added: vendor/jansson/dist/test/suites/valid/short-string/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/short-string/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/short-string/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["a"]

Added: vendor/jansson/dist/test/suites/valid/short-string/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/short-string/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/short-string/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["a"]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/simple-ascii-string/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/simple-ascii-string/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/simple-ascii-string/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["abcdefghijklmnopqrstuvwxyz1234567890 "]

Added: vendor/jansson/dist/test/suites/valid/simple-ascii-string/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/simple-ascii-string/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/simple-ascii-string/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["abcdefghijklmnopqrstuvwxyz1234567890 "]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/simple-int-0/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/simple-int-0/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/simple-int-0/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[0]

Added: vendor/jansson/dist/test/suites/valid/simple-int-0/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/simple-int-0/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/simple-int-0/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[0]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/simple-int-1/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/simple-int-1/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/simple-int-1/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1]

Added: vendor/jansson/dist/test/suites/valid/simple-int-1/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/simple-int-1/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/simple-int-1/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[1]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/simple-int-123/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/simple-int-123/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/simple-int-123/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[123]

Added: vendor/jansson/dist/test/suites/valid/simple-int-123/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/simple-int-123/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/simple-int-123/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[123]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/simple-object/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/simple-object/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/simple-object/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+{"a":[]}

Added: vendor/jansson/dist/test/suites/valid/simple-object/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/simple-object/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/simple-object/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+{"a": []}
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/simple-real/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/simple-real/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/simple-real/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[123.456789]

Added: vendor/jansson/dist/test/suites/valid/simple-real/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/simple-real/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/simple-real/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[123.456789]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/string-escapes/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/string-escapes/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/string-escapes/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\"\\\/\b\f\n\r\t"]

Added: vendor/jansson/dist/test/suites/valid/string-escapes/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/string-escapes/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/string-escapes/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\"\\/\b\f\n\r\t"]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/three-byte-utf-8/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/three-byte-utf-8/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/three-byte-utf-8/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\u0821 three-byte UTF-8"]

Added: vendor/jansson/dist/test/suites/valid/three-byte-utf-8/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/three-byte-utf-8/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/three-byte-utf-8/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["ࠡ three-byte UTF-8"]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/true/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/true/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/true/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[true]

Added: vendor/jansson/dist/test/suites/valid/true/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/true/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/true/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+[true]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/two-byte-utf-8/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/two-byte-utf-8/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/two-byte-utf-8/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\u0123 two-byte UTF-8"]

Added: vendor/jansson/dist/test/suites/valid/two-byte-utf-8/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/two-byte-utf-8/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/two-byte-utf-8/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["ģ two-byte UTF-8"]
\ No newline at end of file

Added: vendor/jansson/dist/test/suites/valid/utf-8-string/input
===================================================================
(Binary files differ)

Index: vendor/jansson/dist/test/suites/valid/utf-8-string/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/utf-8-string/input	2015-07-29 00:47:57 UTC (rev 7200)
+++ vendor/jansson/dist/test/suites/valid/utf-8-string/input	2015-08-02 14:24:45 UTC (rev 7201)

Property changes on: vendor/jansson/dist/test/suites/valid/utf-8-string/input
___________________________________________________________________
Added: svn:mime-type
## -0,0 +1 ##
+application/octet-stream
\ No newline at end of property
Added: vendor/jansson/dist/test/suites/valid/utf-8-string/output
===================================================================
(Binary files differ)

Index: vendor/jansson/dist/test/suites/valid/utf-8-string/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/utf-8-string/output	2015-07-29 00:47:57 UTC (rev 7200)
+++ vendor/jansson/dist/test/suites/valid/utf-8-string/output	2015-08-02 14:24:45 UTC (rev 7201)

Property changes on: vendor/jansson/dist/test/suites/valid/utf-8-string/output
___________________________________________________________________
Added: svn:mime-type
## -0,0 +1 ##
+application/octet-stream
\ No newline at end of property
Added: vendor/jansson/dist/test/suites/valid/utf-surrogate-four-byte-encoding/input
===================================================================
--- vendor/jansson/dist/test/suites/valid/utf-surrogate-four-byte-encoding/input	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/utf-surrogate-four-byte-encoding/input	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["\uD834\uDD1E surrogate, four-byte UTF-8"]

Added: vendor/jansson/dist/test/suites/valid/utf-surrogate-four-byte-encoding/output
===================================================================
--- vendor/jansson/dist/test/suites/valid/utf-surrogate-four-byte-encoding/output	                        (rev 0)
+++ vendor/jansson/dist/test/suites/valid/utf-surrogate-four-byte-encoding/output	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1 @@
+["𝄞 surrogate, four-byte UTF-8"]
\ No newline at end of file

Added: vendor/jansson/dist/test-driver
===================================================================
--- vendor/jansson/dist/test-driver	                        (rev 0)
+++ vendor/jansson/dist/test-driver	2015-08-02 14:24:45 UTC (rev 7201)
@@ -0,0 +1,139 @@
+#! /bin/sh
+# test-driver - basic testsuite driver script.
+
+scriptversion=2013-07-13.22; # UTC
+
+# Copyright (C) 2011-2013 Free Software Foundation, Inc.
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2, or (at your option)
+# any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# This file is maintained in Automake, please report
+# bugs to <bug-automake at gnu.org> or send patches to
+# <automake-patches at gnu.org>.
+
+# Make unconditional expansion of undefined variables an error.  This
+# helps a lot in preventing typo-related bugs.
+set -u
+
+usage_error ()
+{
+  echo "$0: $*" >&2
+  print_usage >&2
+  exit 2
+}
+
+print_usage ()
+{
+  cat <<END
+Usage:
+  test-driver --test-name=NAME --log-file=PATH --trs-file=PATH
+              [--expect-failure={yes|no}] [--color-tests={yes|no}]
+              [--enable-hard-errors={yes|no}] [--]
+              TEST-SCRIPT [TEST-SCRIPT-ARGUMENTS]
+The '--test-name', '--log-file' and '--trs-file' options are mandatory.
+END
+}
+
+test_name= # Used for reporting.
+log_file=  # Where to save the output of the test script.
+trs_file=  # Where to save the metadata of the test run.
+expect_failure=no
+color_tests=no
+enable_hard_errors=yes
+while test $# -gt 0; do
+  case $1 in
+  --help) print_usage; exit $?;;
+  --version) echo "test-driver $scriptversion"; exit $?;;
+  --test-name) test_name=$2; shift;;
+  --log-file) log_file=$2; shift;;
+  --trs-file) trs_file=$2; shift;;
+  --color-tests) color_tests=$2; shift;;
+  --expect-failure) expect_failure=$2; shift;;
+  --enable-hard-errors) enable_hard_errors=$2; shift;;
+  --) shift; break;;
+  -*) usage_error "invalid option: '$1'";;
+   *) break;;
+  esac
+  shift
+done
+
+missing_opts=
+test x"$test_name" = x && missing_opts="$missing_opts --test-name"
+test x"$log_file"  = x && missing_opts="$missing_opts --log-file"
+test x"$trs_file"  = x && missing_opts="$missing_opts --trs-file"
+if test x"$missing_opts" != x; then
+  usage_error "the following mandatory options are missing:$missing_opts"
+fi
+
+if test $# -eq 0; then
+  usage_error "missing argument"
+fi
+
+if test $color_tests = yes; then
+  # Keep this in sync with 'lib/am/check.am:$(am__tty_colors)'.
+  red='' # Red.
+  grn='' # Green.
+  lgn='' # Light green.
+  blu='' # Blue.
+  mgn='' # Magenta.
+  std=''     # No color.
+else
+  red= grn= lgn= blu= mgn= std=
+fi
+
+do_exit='rm -f $log_file $trs_file; (exit $st); exit $st'
+trap "st=129; $do_exit" 1
+trap "st=130; $do_exit" 2
+trap "st=141; $do_exit" 13
+trap "st=143; $do_exit" 15
+
+# Test script is run here.
+"$@" >$log_file 2>&1
+estatus=$?
+if test $enable_hard_errors = no && test $estatus -eq 99; then
+  estatus=1
+fi
+
+case $estatus:$expect_failure in
+  0:yes) col=$red res=XPASS recheck=yes gcopy=yes;;
+  0:*)   col=$grn res=PASS  recheck=no  gcopy=no;;
+  77:*)  col=$blu res=SKIP  recheck=no  gcopy=yes;;
+  99:*)  col=$mgn res=ERROR recheck=yes gcopy=yes;;
+  *:yes) col=$lgn res=XFAIL recheck=no  gcopy=yes;;
+  *:*)   col=$red res=FAIL  recheck=yes gcopy=yes;;
+esac
+
+# Report outcome to console.
+echo "${col}${res}${std}: $test_name"
+
+# Register the test result, and other relevant metadata.
+echo ":test-result: $res" > $trs_file
+echo ":global-test-result: $res" >> $trs_file
+echo ":recheck: $recheck" >> $trs_file
+echo ":copy-in-global-log: $gcopy" >> $trs_file
+
+# Local Variables:
+# mode: shell-script
+# sh-indentation: 2
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "scriptversion="
+# time-stamp-format: "%:y-%02m-%02d.%02H"
+# time-stamp-time-zone: "UTC"
+# time-stamp-end: "; # UTC"
+# End:



More information about the Midnightbsd-cvs mailing list